aboutsummaryrefslogtreecommitdiff
path: root/src/client/views
diff options
context:
space:
mode:
Diffstat (limited to 'src/client/views')
-rw-r--r--src/client/views/.DS_Storebin10244 -> 10244 bytes
-rw-r--r--src/client/views/AntimodeMenu.scss8
-rw-r--r--src/client/views/ContextMenu.scss20
-rw-r--r--src/client/views/ContextMenu.tsx2
-rw-r--r--src/client/views/DocComponent.tsx23
-rw-r--r--src/client/views/DocumentButtonBar.scss51
-rw-r--r--src/client/views/DocumentButtonBar.tsx35
-rw-r--r--src/client/views/DocumentDecorations.scss34
-rw-r--r--src/client/views/DocumentDecorations.tsx6
-rw-r--r--src/client/views/EditableView.scss8
-rw-r--r--src/client/views/GestureOverlay.tsx2
-rw-r--r--src/client/views/GlobalKeyHandler.ts4
-rw-r--r--src/client/views/InkControls.tsx142
-rw-r--r--src/client/views/InkHandles.tsx124
-rw-r--r--src/client/views/InkStroke.scss11
-rw-r--r--src/client/views/InkStrokeProperties.ts375
-rw-r--r--src/client/views/InkingStroke.scss11
-rw-r--r--src/client/views/InkingStroke.tsx216
-rw-r--r--src/client/views/LightboxView.scss30
-rw-r--r--src/client/views/LightboxView.tsx22
-rw-r--r--src/client/views/Main.scss6
-rw-r--r--src/client/views/Main.tsx1
-rw-r--r--src/client/views/MainView.scss115
-rw-r--r--src/client/views/MainView.tsx63
-rw-r--r--src/client/views/MarqueeAnnotator.tsx37
-rw-r--r--src/client/views/PropertiesButtons.scss16
-rw-r--r--src/client/views/PropertiesView.scss37
-rw-r--r--src/client/views/PropertiesView.tsx6
-rw-r--r--src/client/views/SidebarAnnos.tsx39
-rw-r--r--src/client/views/StyleProvider.tsx43
-rw-r--r--src/client/views/TemplateMenu.scss6
-rw-r--r--src/client/views/_nodeModuleOverrides.scss53
-rw-r--r--src/client/views/animationtimeline/Keyframe.scss10
-rw-r--r--src/client/views/animationtimeline/Keyframe.tsx2
-rw-r--r--src/client/views/animationtimeline/Timeline.scss6
-rw-r--r--src/client/views/animationtimeline/TimelineMenu.scss10
-rw-r--r--src/client/views/animationtimeline/TimelineOverview.scss2
-rw-r--r--src/client/views/animationtimeline/Track.scss6
-rw-r--r--src/client/views/collections/CollectionDockingView.scss114
-rw-r--r--src/client/views/collections/CollectionDockingView.tsx56
-rw-r--r--src/client/views/collections/CollectionLinearView.scss38
-rw-r--r--src/client/views/collections/CollectionLinearView.tsx10
-rw-r--r--src/client/views/collections/CollectionMenu.scss147
-rw-r--r--src/client/views/collections/CollectionMenu.tsx9
-rw-r--r--src/client/views/collections/CollectionPileView.tsx15
-rw-r--r--src/client/views/collections/CollectionSchemaView.tsx34
-rw-r--r--src/client/views/collections/CollectionStackingView.scss14
-rw-r--r--src/client/views/collections/CollectionStackingView.tsx6
-rw-r--r--src/client/views/collections/CollectionSubView.tsx51
-rw-r--r--src/client/views/collections/CollectionTimeView.tsx14
-rw-r--r--src/client/views/collections/CollectionTreeView.scss8
-rw-r--r--src/client/views/collections/CollectionTreeView.tsx2
-rw-r--r--src/client/views/collections/CollectionView.scss4
-rw-r--r--src/client/views/collections/CollectionView.tsx16
-rw-r--r--src/client/views/collections/TabDocView.scss59
-rw-r--r--src/client/views/collections/TabDocView.tsx123
-rw-r--r--src/client/views/collections/TreeView.scss6
-rw-r--r--src/client/views/collections/TreeView.tsx39
-rw-r--r--src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx5
-rw-r--r--src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss2
-rw-r--r--src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss4
-rw-r--r--src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx29
-rw-r--r--src/client/views/collections/collectionFreeForm/MarqueeView.tsx7
-rw-r--r--src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx4
-rw-r--r--src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx4
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx (renamed from src/client/views/collections/CollectionSchemaCells.tsx)113
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx (renamed from src/client/views/collections/CollectionSchemaHeaders.tsx)16
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaMovableColumn.tsx128
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx (renamed from src/client/views/collections/CollectionSchemaMovableTableHOC.tsx)141
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaView.scss (renamed from src/client/views/collections/CollectionSchemaView.scss)117
-rw-r--r--src/client/views/collections/collectionSchema/CollectionSchemaView.tsx575
-rw-r--r--src/client/views/collections/collectionSchema/SchemaTable.tsx (renamed from src/client/views/collections/SchemaTable.tsx)50
-rw-r--r--src/client/views/global/globalCssVariables.scss (renamed from src/client/views/globalCssVariables.scss)58
-rw-r--r--src/client/views/global/globalCssVariables.scss.d.ts (renamed from src/client/views/globalCssVariables.scss.d.ts)0
-rw-r--r--src/client/views/global/globalEnums.tsx38
-rw-r--r--src/client/views/linking/LinkEditor.scss22
-rw-r--r--src/client/views/linking/LinkMenu.scss28
-rw-r--r--src/client/views/linking/LinkMenu.tsx8
-rw-r--r--src/client/views/linking/LinkMenuGroup.tsx2
-rw-r--r--src/client/views/linking/LinkMenuItem.scss20
-rw-r--r--src/client/views/linking/LinkPopup.scss45
-rw-r--r--src/client/views/linking/LinkPopup.tsx114
-rw-r--r--src/client/views/nodes/AudioBox.tsx2
-rw-r--r--src/client/views/nodes/DocumentContentsView.tsx19
-rw-r--r--src/client/views/nodes/DocumentLinksButton.scss57
-rw-r--r--src/client/views/nodes/DocumentLinksButton.tsx160
-rw-r--r--src/client/views/nodes/DocumentView.scss8
-rw-r--r--src/client/views/nodes/DocumentView.tsx30
-rw-r--r--src/client/views/nodes/FieldView.tsx6
-rw-r--r--src/client/views/nodes/FontIconBox.scss13
-rw-r--r--src/client/views/nodes/FontIconBox.tsx3
-rw-r--r--src/client/views/nodes/ImageBox.tsx32
-rw-r--r--src/client/views/nodes/KeyValueBox.scss20
-rw-r--r--src/client/views/nodes/KeyValuePair.scss2
-rw-r--r--src/client/views/nodes/LinkDescriptionPopup.scss65
-rw-r--r--src/client/views/nodes/LinkDocPreview.tsx4
-rw-r--r--src/client/views/nodes/PDFBox.scss5
-rw-r--r--src/client/views/nodes/PDFBox.tsx63
-rw-r--r--src/client/views/nodes/RadialMenu.scss4
-rw-r--r--src/client/views/nodes/ScreenshotBox.tsx8
-rw-r--r--src/client/views/nodes/VideoBox.tsx10
-rw-r--r--src/client/views/nodes/WebBox.scss3
-rw-r--r--src/client/views/nodes/WebBox.tsx56
-rw-r--r--src/client/views/nodes/formattedText/DashFieldView.scss11
-rw-r--r--src/client/views/nodes/formattedText/FormattedTextBox.scss8
-rw-r--r--src/client/views/nodes/formattedText/FormattedTextBox.tsx86
-rw-r--r--src/client/views/nodes/formattedText/RichTextMenu.scss4
-rw-r--r--src/client/views/nodes/formattedText/RichTextMenu.tsx21
-rw-r--r--src/client/views/nodes/formattedText/TooltipTextMenu.scss10
-rw-r--r--src/client/views/nodes/trails/PresBox.scss (renamed from src/client/views/nodes/PresBox.scss)144
-rw-r--r--src/client/views/nodes/trails/PresBox.tsx (renamed from src/client/views/nodes/PresBox.tsx)184
-rw-r--r--src/client/views/nodes/trails/PresElementBox.scss (renamed from src/client/views/presentationview/PresElementBox.scss)0
-rw-r--r--src/client/views/nodes/trails/PresElementBox.tsx (renamed from src/client/views/presentationview/PresElementBox.tsx)50
-rw-r--r--src/client/views/nodes/trails/PresEnums.ts28
-rw-r--r--src/client/views/nodes/trails/index.ts3
-rw-r--r--src/client/views/pdf/AnchorMenu.tsx20
-rw-r--r--src/client/views/pdf/PDFViewer.tsx13
-rw-r--r--src/client/views/search/CheckBox.scss6
-rw-r--r--src/client/views/search/CollectionFilters.scss2
-rw-r--r--src/client/views/search/IconBar.scss2
-rw-r--r--src/client/views/search/IconButton.scss6
-rw-r--r--src/client/views/search/IconButton.tsx4
-rw-r--r--src/client/views/search/NaviconButton.scss4
-rw-r--r--src/client/views/search/SearchBox.scss2
-rw-r--r--src/client/views/search/SelectorContextMenu.scss6
-rw-r--r--src/client/views/search/ToggleBar.scss8
-rw-r--r--src/client/views/topbar/TopBar.scss217
-rw-r--r--src/client/views/topbar/TopBar.tsx66
-rw-r--r--src/client/views/webcam/DashWebRTCVideo.scss2
129 files changed, 3550 insertions, 1804 deletions
diff --git a/src/client/views/.DS_Store b/src/client/views/.DS_Store
index 33e624ef4..e4ac87aad 100644
--- a/src/client/views/.DS_Store
+++ b/src/client/views/.DS_Store
Binary files differ
diff --git a/src/client/views/AntimodeMenu.scss b/src/client/views/AntimodeMenu.scss
index a275901be..8a0e5480e 100644
--- a/src/client/views/AntimodeMenu.scss
+++ b/src/client/views/AntimodeMenu.scss
@@ -1,14 +1,14 @@
-@import "./globalCssVariables";
+@import "./global/globalCssVariables";
.antimodeMenu-cont {
position: absolute;
z-index: 10001;
height: $antimodemenu-height;
- background: #323232;
- box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25);
+ background: $dark-gray;
+ border-bottom: $standard-border;
+ // box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25);
// border-radius: 0px 6px 6px 6px;
- z-index: 1001;
display: flex;
&.with-rows {
diff --git a/src/client/views/ContextMenu.scss b/src/client/views/ContextMenu.scss
index b514de5f2..795529780 100644
--- a/src/client/views/ContextMenu.scss
+++ b/src/client/views/ContextMenu.scss
@@ -1,10 +1,10 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
.contextMenu-cont {
position: absolute;
display: flex;
z-index: $contextMenu-zindex;
- box-shadow: $intermediate-color 0.2vw 0.2vw 0.4vw;
+ box-shadow: $medium-gray 0.2vw 0.2vw 0.4vw;
flex-direction: column;
background: whitesmoke;
padding-top: 10px;
@@ -14,17 +14,17 @@
}
// .contextMenu-item:first-child {
-// background: $intermediate-color;
-// color: $light-color;
+// background: $medium-gray;
+// color: $white;
// }
// .contextMenu-item:first-child::placeholder {
-// color: $light-color;
+// color: $white;
// }
// .contextMenu-item:first-child:hover {
-// background: $intermediate-color;
-// color: $light-color;
+// background: $medium-gray;
+// color: $white;
// }
.contextMenu-subMenu-cont {
@@ -94,7 +94,7 @@
.contextMenu-item:hover {
border-width: .11px;
border-style: none;
- border-color: $intermediate-color; // rgb(187, 186, 186);
+ border-color: $medium-gray; // rgb(187, 186, 186);
border-bottom-style: solid;
border-top-style: solid;
@@ -122,7 +122,7 @@
transition: all .1s;
border-width: .11px;
border-style: none;
- border-color: $intermediate-color; // rgb(187, 186, 186);
+ border-color: $medium-gray; // rgb(187, 186, 186);
// padding: 10px 0px 10px 0px;
white-space: nowrap;
font-size: 13px;
@@ -137,7 +137,7 @@
.contextMenu-item:hover {
transition: all 0.1s ease;
- background: $lighter-alt-accent;
+ background: $light-blue;
}
.contextMenu-description {
diff --git a/src/client/views/ContextMenu.tsx b/src/client/views/ContextMenu.tsx
index d96de72e3..c4fabbf99 100644
--- a/src/client/views/ContextMenu.tsx
+++ b/src/client/views/ContextMenu.tsx
@@ -218,7 +218,7 @@ export class ContextMenu extends React.Component {
@computed get menuItems() {
if (!this._searchString) {
- return this._items.map(item => <ContextMenuItem {...item} noexpand={this.itemsNeedSearch ? true : (item as any).noexpand} key={item.description} closeMenu={this.closeMenu} />);
+ return this._items.map((item, ind) => <ContextMenuItem {...item} noexpand={this.itemsNeedSearch ? true : (item as any).noexpand} key={ind + item.description} closeMenu={this.closeMenu} />);
}
return this.filteredViews;
}
diff --git a/src/client/views/DocComponent.tsx b/src/client/views/DocComponent.tsx
index a878a7afb..fc36c7e43 100644
--- a/src/client/views/DocComponent.tsx
+++ b/src/client/views/DocComponent.tsx
@@ -7,7 +7,7 @@ import { InteractionUtils } from '../util/InteractionUtils';
import { List } from '../../fields/List';
import { DateField } from '../../fields/DateField';
import { ScriptField } from '../../fields/ScriptField';
-import { GetEffectiveAcl, SharingPermissions, distributeAcls, denormalizeEmail } from '../../fields/util';
+import { GetEffectiveAcl, SharingPermissions, distributeAcls, denormalizeEmail, inheritParentAcls } from '../../fields/util';
import { CurrentUserUtils } from '../util/CurrentUserUtils';
import { DocUtils } from '../documents/Documents';
import { returnFalse } from '../../Utils';
@@ -107,19 +107,12 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
// key where data is stored
@computed get fieldKey() { return this.props.fieldKey; }
- private AclMap = new Map<symbol, string>([
- [AclPrivate, SharingPermissions.None],
- [AclReadonly, SharingPermissions.View],
- [AclAddonly, SharingPermissions.Add],
- [AclEdit, SharingPermissions.Edit],
- [AclAdmin, SharingPermissions.Admin]
- ]);
lookupField = (field: string) => ScriptCast((this.layoutDoc as any).lookupField)?.script.run({ self: this.layoutDoc, data: this.rootDoc, field: field }).result;
styleFromLayoutString = (scale: number) => {
const style: { [key: string]: any } = {};
- const divKeys = ["width", "height", "fontSize", "left", "background", "top", "pointerEvents", "position"];
+ const divKeys = ["width", "height", "fontSize", "transform", "left", "background", "left", "right", "top", "bottom", "pointerEvents", "position"];
const replacer = (match: any, expr: string, offset: any, string: any) => { // bcz: this executes a script to convert a property expression string: { script } into a value
return ScriptField.MakeFunction(expr, { self: Doc.name, this: Doc.name, scale: "number" })?.script.run({ self: this.rootDoc, this: this.layoutDoc, scale }).result as string || "";
};
@@ -154,7 +147,10 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
leavePushpin && DocUtils.LeavePushpin(doc, annotationKey ?? this.annotationKey);
Doc.RemoveDocFromList(targetDataDoc, annotationKey ?? this.annotationKey, doc);
doc.context = undefined;
- recent && Doc.AddDocToList(recent, "data", doc, undefined, true, true);
+ if (recent) {
+ Doc.RemoveDocFromList(recent, "data", doc);
+ Doc.AddDocToList(recent, "data", doc, undefined, true, true);
+ }
});
this.props.select(false);
return true;
@@ -198,15 +194,14 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
if (this.props.Document[AclSym] && Object.keys(this.props.Document[AclSym]).length) {
added.forEach(d => {
for (const [key, value] of Object.entries(this.props.Document[AclSym])) {
- if (d.author === denormalizeEmail(key.substring(4)) && !d.aliasOf) distributeAcls(key, SharingPermissions.Admin, d, true);
- //else if (this.props.Document[key] === SharingPermissions.Admin) distributeAcls(key, SharingPermissions.Add, d, true);
- // else distributeAcls(key, this.AclMap.get(value) as SharingPermissions, d, true);
+ if (d.author === denormalizeEmail(key.substring(4)) && !d.aliasOf) distributeAcls(key, SharingPermissions.Admin, d);
}
});
}
if (effectiveAcl === AclAddonly) {
added.map(doc => {
+ if ([AclAdmin, AclEdit].includes(GetEffectiveAcl(doc))) inheritParentAcls(CurrentUserUtils.ActiveDashboard, doc);
doc.context = this.props.Document;
if (annotationKey ?? this._annotationKey) Doc.GetProto(doc).annotationOn = this.props.Document;
this.props.layerProvider?.(doc, true);
@@ -220,6 +215,8 @@ export function ViewBoxAnnotatableComponent<P extends ViewBoxAnnotatableProps, T
doc._stayInCollection = undefined;
doc.context = this.props.Document;
if (annotationKey ?? this._annotationKey) Doc.GetProto(doc).annotationOn = this.props.Document;
+
+ inheritParentAcls(CurrentUserUtils.ActiveDashboard, doc);
});
const annoDocs = targetDataDoc[annotationKey ?? this.annotationKey] as List<Doc>;
if (annoDocs) annoDocs.push(...added);
diff --git a/src/client/views/DocumentButtonBar.scss b/src/client/views/DocumentButtonBar.scss
index 09ae14016..a112f4745 100644
--- a/src/client/views/DocumentButtonBar.scss
+++ b/src/client/views/DocumentButtonBar.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
$linkGap : 3px;
@@ -7,13 +7,13 @@ $linkGap : 3px;
}
.documentButtonBar-linkButton-empty:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
.documentButtonBar-linkButton-nonempty:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
@@ -25,8 +25,8 @@ $linkGap : 3px;
border-radius: 50%;
opacity: 0.9;
pointer-events: auto;
- background-color: $dark-color;
- color: $light-color;
+ background-color: $dark-gray;
+ color: $white;
text-transform: uppercase;
letter-spacing: 2px;
font-size: 75%;
@@ -37,39 +37,60 @@ $linkGap : 3px;
align-items: center;
&:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
}
.documentButtonBar {
- margin-top: $linkGap;
- grid-column: 1/4;
- width: max-content;
- height: auto;
display: flex;
flex-direction: row;
}
.documentButtonBar-button {
- pointer-events: auto;
- padding-right: 5px;
- width: 25px;
+ cursor: pointer;
+ display: flex;
+ width: 30px;
+ height: 30px;
+ align-content: center;
+ justify-content: center;
+ align-items: center;
}
+// depracated (now use .documentButtonBar-icon) for standard buttons
.documentButtonBar-linker {
height: 20px;
width: 20px;
text-align: center;
border-radius: 50%;
pointer-events: auto;
- background-color: $dark-color;
+ background-color: $dark-gray;
+ border: none;
+ transition: 0.2s ease all;
+
+ &:hover {
+ background-color: $medium-gray;
+ }
+}
+
+.documentButtonBar-icon {
+ height: 80%;
+ width: 80%;
+ font-size: 100%;
+ text-align: center;
+ border-radius: 50%;
+ pointer-events: auto;
+ background-color: $dark-gray;
border: none;
transition: 0.2s ease all;
+ display: flex;
+ align-content: center;
+ justify-content: center;
+ align-items: center;
&:hover {
- background-color: $main-accent;
+ background-color: $black;
}
}
diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx
index a5d80cd22..df1e6899d 100644
--- a/src/client/views/DocumentButtonBar.tsx
+++ b/src/client/views/DocumentButtonBar.tsx
@@ -3,7 +3,7 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { Tooltip } from '@material-ui/core';
import { action, computed, observable, runInAction } from "mobx";
import { observer } from "mobx-react";
-import { Doc } from "../../fields/Doc";
+import { Doc, DocCastAsync } from "../../fields/Doc";
import { RichTextField } from '../../fields/RichTextField';
import { Cast, NumCast, StrCast } from "../../fields/Types";
import { emptyFunction, setupMoveUpEvents, simulateMouseClick } from "../../Utils";
@@ -24,7 +24,7 @@ import { DocumentView } from './nodes/DocumentView';
import { GoogleRef } from "./nodes/formattedText/FormattedTextBox";
import { TemplateMenu } from "./TemplateMenu";
import React = require("react");
-import { PresBox } from './nodes/PresBox';
+import { PresBox } from './nodes/trails/PresBox';
import { undoBatch } from '../util/UndoManager';
import { CollectionViewType } from './collections/CollectionView';
const higflyout = require("@hig/flyout");
@@ -110,7 +110,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
const animation = this.isAnimatingPulse ? "shadow-pulse 1s linear infinite" : "none";
return !targetDoc ? (null) : <Tooltip title={<><div className="dash-tooltip">{`${published ? "Push" : "Publish"} to Google Docs`}</div></>}>
<div
- className="documentButtonBar-linker"
+ className="documentButtonBar-button"
style={{ animation }}
onClick={async () => {
await GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken();
@@ -139,7 +139,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
return !targetDoc || !dataDoc || !dataDoc[GoogleRef] ? (null) : <Tooltip
title={<><div className="dash-tooltip">{title}</div></>}>
- <div className="documentButtonBar-linker"
+ <div className="documentButtonBar-button"
style={{ backgroundColor: this.pullColor }}
onPointerEnter={action(e => {
if (e.altKey) {
@@ -188,8 +188,8 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
const targetDoc = this.view0?.props.Document;
return !targetDoc ? (null) : <Tooltip title={
<div className="dash-tooltip">{"follow primary link on click"}</div>}>
- <div className="documentButtonBar-linker"
- style={{ color: targetDoc.isLinkButton ? "black" : "white", backgroundColor: targetDoc.isLinkButton ? "white" : "black" }}
+ <div className="documentButtonBar-icon"
+ style={{ color: targetDoc.isLinkButton ? "black" : "white" }}
onClick={undoBatch(e => this.props.views().map(view => view?.docView?.toggleFollowLink(undefined, false, false)))}>
<FontAwesomeIcon className="documentdecorations-icon" size="sm" icon="hand-point-right" />
</div>
@@ -200,7 +200,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
const targetDoc = this.view0?.props.Document;
return !targetDoc ? (null) : <Tooltip title={
<div className="dash-tooltip">{SelectionManager.Views().length > 1 ? "Pin multiple documents to presentation" : "Pin to presentation"}</div>}>
- <div className="documentButtonBar-linker"
+ <div className="documentButtonBar-icon"
style={{ color: "white" }}
onClick={undoBatch(e => this.props.views().map(view => view && TabDocView.PinDoc(view.props.Document, { setPosition: e.shiftKey ? true : undefined })))}>
<FontAwesomeIcon className="documentdecorations-icon" size="sm" icon="map-pin" />
@@ -243,7 +243,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
const presPinWithViewIcon = <img src="/assets/pinWithView.png" style={{ margin: "auto", width: 17, transform: 'translate(0, 1px)' }} />;
const targetDoc = this.view0?.props.Document;
return !targetDoc ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Pin with current view"}</div></>}>
- <div className="documentButtonBar-linker" onClick={() => this.pinWithView(targetDoc)}>
+ <div className="documentButtonBar-icon" onClick={() => this.pinWithView(targetDoc)}>
{presPinWithViewIcon}
</div>
</Tooltip>;
@@ -253,8 +253,8 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
get shareButton() {
const targetDoc = this.view0?.props.Document;
return !targetDoc ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Open Sharing Manager"}</div></>}>
- <div className="documentButtonBar-linker" style={{ color: "white" }} onClick={e => SharingManager.Instance.open(this.view0, targetDoc)}>
- <FontAwesomeIcon className="documentdecorations-icon" size="sm" icon="users" />
+ <div className="documentButtonBar-icon" style={{ color: "white" }} onClick={e => SharingManager.Instance.open(this.view0, targetDoc)}>
+ <FontAwesomeIcon className="documentdecorations-icon" icon="users" />
</div></Tooltip >;
}
@@ -262,8 +262,8 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
get menuButton() {
const targetDoc = this.view0?.props.Document;
return !targetDoc ? (null) : <Tooltip title={<><div className="dash-tooltip">{`Open Context Menu`}</div></>}>
- <div className="documentButtonBar-linker" style={{ color: "white", cursor: "pointer" }} onClick={e => this.openContextMenu(e)}>
- <FontAwesomeIcon className="documentdecorations-icon" size="sm" icon="bars" />
+ <div className="documentButtonBar-icon" style={{ color: "white", cursor: "pointer" }} onClick={e => this.openContextMenu(e)}>
+ <FontAwesomeIcon className="documentdecorations-icon" icon="bars" />
</div></Tooltip >;
}
@@ -271,9 +271,9 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
get moreButton() {
const targetDoc = this.view0?.props.Document;
return !targetDoc ? (null) : <Tooltip title={<><div className="dash-tooltip">{`${CurrentUserUtils.propertiesWidth > 0 ? "Close" : "Open"} Properties Panel`}</div></>}>
- <div className="documentButtonBar-linker" style={{ color: "white", cursor: "e-resize" }} onClick={action(e =>
+ <div className="documentButtonBar-icon" style={{ color: "white", cursor: "e-resize" }} onClick={action(e =>
CurrentUserUtils.propertiesWidth = CurrentUserUtils.propertiesWidth > 0 ? 0 : 250)}>
- <FontAwesomeIcon className="documentdecorations-icon" size="sm" icon="ellipsis-h"
+ <FontAwesomeIcon className="documentdecorations-icon" icon="ellipsis-h"
/>
</div></Tooltip >;
}
@@ -286,7 +286,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
<Flyout anchorPoint={anchorPoints.LEFT_TOP}
content={<MetadataEntryMenu docs={this.props.views().filter(dv => dv).map(dv => dv!.props.Document)} suggestWithFunction /> /* tfs: @bcz This might need to be the data document? */}>
<div className={"documentButtonBar-linkButton-" + "empty"} onPointerDown={e => e.stopPropagation()} >
- {<FontAwesomeIcon className="documentdecorations-icon" icon="tag" size="sm" />}
+ {<FontAwesomeIcon className="documentdecorations-icon" icon="tag" />}
</div>
</Flyout>
</div></Tooltip>;
@@ -348,16 +348,17 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV
if (!this.view0) return (null);
const isText = this.view0.props.Document[this.view0.LayoutFieldKey] instanceof RichTextField;
+ const doc = this.view0?.props.Document;
const considerPull = isText && this.considerGoogleDocsPull;
const considerPush = isText && this.considerGoogleDocsPush;
return <div className="documentButtonBar">
<div className="documentButtonBar-button">
<DocumentLinksButton View={this.view0} AlwaysOn={true} InMenu={true} StartLink={true} />
</div>
- {DocumentLinksButton.StartLink || !Doc.UserDoc()["documentLinksButton-fullMenu"] ? <div className="documentButtonBar-button">
+ {(DocumentLinksButton.StartLink || Doc.UserDoc()["documentLinksButton-fullMenu"]) && DocumentLinksButton.StartLink != doc ? <div className="documentButtonBar-button">
<DocumentLinksButton View={this.view0} AlwaysOn={true} InMenu={true} StartLink={false} />
</div> : (null)}
- {!Doc.UserDoc()["documentLinksButton-fullMenu"] ? (null) : <div className="documentButtonBar-button">
+ {/*!Doc.UserDoc()["documentLinksButton-fullMenu"] ? (null) : <div className="documentButtonBar-button">
{this.templateButton}
</div>
/*<div className="documentButtonBar-button">
diff --git a/src/client/views/DocumentDecorations.scss b/src/client/views/DocumentDecorations.scss
index db2d56aa8..316f63240 100644
--- a/src/client/views/DocumentDecorations.scss
+++ b/src/client/views/DocumentDecorations.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
$linkGap : 3px;
@@ -49,7 +49,7 @@ $linkGap : 3px;
.documentDecorations-bottomResizer,
.documentDecorations-rightResizer {
pointer-events: auto;
- background: $alt-accent;
+ background: $medium-gray;
opacity: 0.1;
&:hover {
opacity: 1;
@@ -251,19 +251,18 @@ $linkGap : 3px;
}
.linkButton-empty:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
.linkButton-nonempty:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
.link-button-container {
- padding: $linkGap;
border-radius: 10px;
width: max-content;
height: auto;
@@ -271,7 +270,10 @@ $linkGap : 3px;
flex-direction: row;
z-index: 998;
position: absolute;
- background: $alt-accent;
+ justify-content: center;
+ align-items: center;
+ gap: 5px;
+ background: $medium-gray;
}
.linkButtonWrapper {
@@ -286,8 +288,8 @@ $linkGap : 3px;
text-align: center;
border-radius: 50%;
pointer-events: auto;
- color: $dark-color;
- border: $dark-color 1px solid;
+ color: $dark-gray;
+ border: $dark-gray 1px solid;
}
.linkButton-linker:hover {
@@ -302,8 +304,8 @@ $linkGap : 3px;
border-radius: 50%;
opacity: 0.9;
pointer-events: auto;
- background-color: $dark-color;
- color: $light-color;
+ background-color: $dark-gray;
+ color: $white;
text-transform: uppercase;
letter-spacing: 2px;
font-size: 75%;
@@ -314,7 +316,7 @@ $linkGap : 3px;
align-items: center;
&:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
@@ -334,7 +336,7 @@ $linkGap : 3px;
}
.documentdecorations-icon {
- margin-top: 3px;
+ margin: 0px;
}
.templating-button,
.docDecs-tagButton {
@@ -343,13 +345,13 @@ $linkGap : 3px;
border-radius: 50%;
opacity: 0.9;
font-size: 14;
- background-color: $dark-color;
- color: $light-color;
+ background-color: $dark-gray;
+ color: $white;
text-align: center;
cursor: pointer;
&:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
}
}
@@ -365,7 +367,7 @@ $linkGap : 3px;
width: max-content;
font-family: $sans-serif;
font-size: 12px;
- background-color: $light-color-secondary;
+ background-color: $light-gray;
padding: 2px 12px;
list-style: none;
diff --git a/src/client/views/DocumentDecorations.tsx b/src/client/views/DocumentDecorations.tsx
index bf939d57c..d24ab974c 100644
--- a/src/client/views/DocumentDecorations.tsx
+++ b/src/client/views/DocumentDecorations.tsx
@@ -201,7 +201,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
(e: PointerEvent, down: number[], delta: number[]) => {
const movement = { X: delta[0], Y: e.clientY - down[1] };
const angle = Math.max(1, Math.abs(movement.Y / 10));
- InkStrokeProperties.Instance?.rotate(2 * movement.X / angle * (Math.PI / 180));
+ InkStrokeProperties.Instance?.rotateInk(2 * movement.X / angle * (Math.PI / 180));
return false;
},
() => this._rotateUndo?.end(),
@@ -235,7 +235,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
this._resizeUndo = UndoManager.StartBatch("DocDecs resize");
this._snapX = e.pageX;
this._snapY = e.pageY;
- DragManager.docsBeingDragged.forEach(doc => this._dragHeights.set(doc, { start: NumCast(doc._height), lowest: NumCast(doc._height) }));
+ SelectionManager.Views().forEach(docView => this._dragHeights.set(docView.layoutDoc, { start: NumCast(docView.rootDoc._height), lowest: NumCast(docView.rootDoc._height) }));
}
onPointerMove = (e: PointerEvent, down: number[], move: number[]): boolean => {
@@ -382,7 +382,7 @@ export class DocumentDecorations extends React.Component<{ boundsLeft: number, b
SnappingManager.clearSnapLines();
// detect autoHeight gesture and apply
- DragManager.docsBeingDragged.map(doc => ({ doc, hgts: this._dragHeights.get(doc) }))
+ SelectionManager.Views().map(docView => ({ doc: docView.layoutDoc, hgts: this._dragHeights.get(docView.layoutDoc) }))
.filter(pair => pair.hgts && pair.hgts.lowest < pair.hgts.start && pair.hgts.lowest <= 20)
.forEach(pair => pair.doc._autoHeight = true);
//need to change points for resize, or else rotation/control points will fail.
diff --git a/src/client/views/EditableView.scss b/src/client/views/EditableView.scss
index 5dc0c1962..1aebedf2e 100644
--- a/src/client/views/EditableView.scss
+++ b/src/client/views/EditableView.scss
@@ -26,4 +26,10 @@
width: 100%;
background: inherit;
pointer-events: all;
-} \ No newline at end of file
+}
+
+.editableView-input:focus {
+ border: none;
+ outline: none;
+}
+ \ No newline at end of file
diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx
index 491bf18b2..6a4f55bef 100644
--- a/src/client/views/GestureOverlay.tsx
+++ b/src/client/views/GestureOverlay.tsx
@@ -634,7 +634,7 @@ export class GestureOverlay extends Touchable {
} else {
this._points = [];
}
- CollectionFreeFormViewChrome.Instance.primCreated();
+ CollectionFreeFormViewChrome.Instance?.primCreated();
}
makePolygon = (shape: string, gesture: boolean) => {
diff --git a/src/client/views/GlobalKeyHandler.ts b/src/client/views/GlobalKeyHandler.ts
index 2a3cb36c7..0127d3080 100644
--- a/src/client/views/GlobalKeyHandler.ts
+++ b/src/client/views/GlobalKeyHandler.ts
@@ -88,8 +88,6 @@ export class KeyManager {
private unmodified = action((keyname: string, e: KeyboardEvent) => {
switch (keyname) {
- case "a": SnappingManager.GetIsDragging() && (DragManager.CanEmbed = true);
- break;
case "u":
if (document.activeElement?.tagName === "INPUT" || document.activeElement?.tagName === "TEXTAREA") {
return { stopPropagation: false, preventDefault: false };
@@ -115,7 +113,7 @@ export class KeyManager {
case "escape":
DocumentLinksButton.StartLink = undefined;
DocumentLinksButton.StartLinkView = undefined;
- InkStrokeProperties.Instance && (InkStrokeProperties.Instance._controlBtn = false);
+ InkStrokeProperties.Instance && (InkStrokeProperties.Instance._controlButton = false);
CurrentUserUtils.SelectedTool = InkTool.None;
var doDeselect = true;
if (SnappingManager.GetIsDragging()) {
diff --git a/src/client/views/InkControls.tsx b/src/client/views/InkControls.tsx
new file mode 100644
index 000000000..6213a4075
--- /dev/null
+++ b/src/client/views/InkControls.tsx
@@ -0,0 +1,142 @@
+import React = require("react");
+import { observable, action } from "mobx";
+import { observer } from "mobx-react";
+import { InkStrokeProperties } from "./InkStrokeProperties";
+import { setupMoveUpEvents, emptyFunction } from "../../Utils";
+import { UndoManager } from "../util/UndoManager";
+import { ControlPoint, InkData, PointData } from "../../fields/InkField";
+import { Transform } from "../util/Transform";
+import { Colors } from "./global/globalEnums";
+import { Doc } from "../../fields/Doc";
+import { listSpec } from "../../fields/Schema";
+import { Cast } from "../../fields/Types";
+
+export interface InkControlProps {
+ inkDoc: Doc;
+ data: InkData;
+ addedPoints: PointData[];
+ format: number[];
+ ScreenToLocalTransform: () => Transform;
+}
+
+@observer
+export class InkControls extends React.Component<InkControlProps> {
+ @observable private _overControl = -1;
+ @observable private _overAddPoint = -1;
+
+ /**
+ * Handles the movement of a selected control point when the user clicks and drags.
+ * @param controlIndex The index of the currently selected control point.
+ */
+ @action
+ onControlDown = (e: React.PointerEvent, controlIndex: number): void => {
+ if (InkStrokeProperties.Instance) {
+ InkStrokeProperties.Instance.moveControl(0, 0, 1);
+ const controlUndo = UndoManager.StartBatch("DocDecs set radius");
+ const screenScale = this.props.ScreenToLocalTransform().Scale;
+ const order = controlIndex % 4;
+ const handleIndexA = order === 2 ? controlIndex - 1 : controlIndex - 2;
+ const handleIndexB = order === 2 ? controlIndex + 2 : controlIndex + 1;
+ const brokenIndices = Cast(this.props.inkDoc.brokenInkIndices, listSpec("number"));
+ setupMoveUpEvents(this, e,
+ (e: PointerEvent, down: number[], delta: number[]) => {
+ InkStrokeProperties.Instance?.moveControl(-delta[0] * screenScale, -delta[1] * screenScale, controlIndex);
+ return false;
+ },
+ () => controlUndo?.end(),
+ action((e: PointerEvent, doubleTap: boolean | undefined) => {
+ if (doubleTap && brokenIndices && brokenIndices.includes(controlIndex)) {
+ InkStrokeProperties.Instance?.snapHandleTangent(controlIndex, handleIndexA, handleIndexB);
+ }
+ }));
+ }
+ }
+
+ /**
+ * Deletes the currently selected point.
+ */
+ @action
+ onDelete = (e: KeyboardEvent) => {
+ if (["-", "Backspace", "Delete"].includes(e.key)) {
+ if (InkStrokeProperties.Instance?.deletePoints()) e.stopPropagation();
+ }
+ }
+
+ /**
+ * Changes the current selected control point.
+ */
+ @action
+ changeCurrPoint = (i: number) => {
+ if (InkStrokeProperties.Instance) {
+ InkStrokeProperties.Instance._currentPoint = i;
+ document.addEventListener("keydown", this.onDelete, true);
+ }
+ }
+
+ /**
+ * Updates whether a user has hovered over a particular control point or point that could be added
+ * on click.
+ */
+ @action onEnterControl = (i: number) => { this._overControl = i; };
+ @action onLeaveControl = () => { this._overControl = -1; };
+ @action onEnterAddPoint = (i: number) => { this._overAddPoint = i; };
+ @action onLeaveAddPoint = () => { this._overAddPoint = -1; };
+
+ render() {
+ const formatInstance = InkStrokeProperties.Instance;
+ if (!formatInstance) return (null);
+
+ // Accessing the current ink's data and extracting all control points.
+ const data = this.props.data;
+ const controlPoints: ControlPoint[] = [];
+ if (data.length >= 4) {
+ for (let i = 0; i <= data.length - 4; i += 4) {
+ controlPoints.push({ X: data[i].X, Y: data[i].Y, I: i });
+ controlPoints.push({ X: data[i + 3].X, Y: data[i + 3].Y, I: i + 3 });
+ }
+ }
+ const addedPoints = this.props.addedPoints;
+ const [left, top, scaleX, scaleY, strokeWidth] = this.props.format;
+
+ return (
+ <>
+ {addedPoints.map((pts, i) =>
+ <svg height="10" width="10" key={`add${i}`}>
+ <circle
+ cx={(pts.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
+ cy={(pts.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
+ r={strokeWidth / 1.5}
+ stroke={this._overAddPoint === i ? Colors.MEDIUM_BLUE : "transparent"}
+ strokeWidth={0} fill={this._overAddPoint === i ? Colors.MEDIUM_BLUE : "transparent"}
+ onPointerDown={() => { formatInstance?.addPoints(pts.X, pts.Y, addedPoints, i, controlPoints); }}
+ onMouseEnter={() => this.onEnterAddPoint(i)}
+ onMouseLeave={this.onLeaveAddPoint}
+ pointerEvents="all"
+ cursor="all-scroll"
+ />
+ </svg>
+ )}
+ {controlPoints.map((control, i) =>
+ <svg height="10" width="10" key={`ctrl${i}`}>
+ <rect
+ x={(control.X - left - strokeWidth / 2) * scaleX}
+ y={(control.Y - top - strokeWidth / 2) * scaleY}
+ height={this._overControl === i ? strokeWidth * 1.5 : strokeWidth}
+ width={this._overControl === i ? strokeWidth * 1.5 : strokeWidth}
+ strokeWidth={strokeWidth / 6} stroke={Colors.MEDIUM_BLUE}
+ fill={formatInstance?._currentPoint === control.I ? Colors.MEDIUM_BLUE : Colors.WHITE}
+ onPointerDown={(e) => {
+ this.changeCurrPoint(control.I);
+ this.onControlDown(e, control.I);
+ }}
+ onMouseEnter={() => this.onEnterControl(i)}
+ onMouseLeave={this.onLeaveControl}
+ pointerEvents="all"
+ cursor="default"
+ />
+ </svg>
+ )}
+ </>
+ );
+ }
+} \ No newline at end of file
diff --git a/src/client/views/InkHandles.tsx b/src/client/views/InkHandles.tsx
new file mode 100644
index 000000000..f1eb4b9db
--- /dev/null
+++ b/src/client/views/InkHandles.tsx
@@ -0,0 +1,124 @@
+import React = require("react");
+import { observable, action } from "mobx";
+import { observer } from "mobx-react";
+import { InkStrokeProperties } from "./InkStrokeProperties";
+import { setupMoveUpEvents, emptyFunction } from "../../Utils";
+import { UndoManager } from "../util/UndoManager";
+import { InkData, HandlePoint, HandleLine } from "../../fields/InkField";
+import { Transform } from "../util/Transform";
+import { Doc } from "../../fields/Doc";
+import { listSpec } from "../../fields/Schema";
+import { List } from "../../fields/List";
+import { Cast } from "../../fields/Types";
+import { Colors } from "./global/globalEnums";
+
+export interface InkHandlesProps {
+ inkDoc: Doc;
+ data: InkData;
+ format: number[];
+ ScreenToLocalTransform: () => Transform;
+}
+
+@observer
+export class InkHandles extends React.Component<InkHandlesProps> {
+ /**
+ * Handles the movement of a selected handle point when the user clicks and drags.
+ * @param handleNum The index of the currently selected handle point.
+ */
+ onHandleDown = (e: React.PointerEvent, handleIndex: number): void => {
+ if (InkStrokeProperties.Instance) {
+ InkStrokeProperties.Instance.moveControl(0, 0, 1);
+ const controlUndo = UndoManager.StartBatch("DocDecs set radius");
+ const screenScale = this.props.ScreenToLocalTransform().Scale;
+ const order = handleIndex % 4;
+ const oppositeHandleIndex = order === 1 ? handleIndex - 3 : handleIndex + 3;
+ const controlIndex = order === 1 ? handleIndex - 1 : handleIndex + 2;
+ document.addEventListener("keydown", (e: KeyboardEvent) => this.onBreakTangent(e, controlIndex), true);
+ setupMoveUpEvents(this, e, (e: PointerEvent, down: number[], delta: number[]) => {
+ InkStrokeProperties.Instance?.moveHandle(-delta[0] * screenScale, -delta[1] * screenScale, handleIndex, oppositeHandleIndex, controlIndex);
+ return false;
+ }, () => controlUndo?.end(), emptyFunction
+ );
+ }
+ }
+
+ /**
+ * Breaks tangent handle movement when ‘Alt’ key is held down. Adds the current handle index and
+ * its matching (opposite) handle to a list of broken handle indices.
+ * @param handleNum The index of the currently selected handle point.
+ */
+ @action
+ onBreakTangent = (e: KeyboardEvent, controlIndex: number) => {
+ const doc: Doc = this.props.inkDoc;
+ if (["Alt"].includes(e.key)) {
+ e.stopPropagation();
+ if (doc) {
+ const brokenIndices = Cast(doc.brokenInkIndices, listSpec("number")) || new List;
+ if (brokenIndices && !brokenIndices.includes(controlIndex)) {
+ brokenIndices.push(controlIndex);
+ }
+ doc.brokenInkIndices = brokenIndices;
+ }
+ }
+ }
+
+ render() {
+ const formatInstance = InkStrokeProperties.Instance;
+ if (!formatInstance) return (null);
+
+ // Accessing the current ink's data and extracting all handle points and handle lines.
+ const data = this.props.data;
+ const handlePoints: HandlePoint[] = [];
+ const handleLines: HandleLine[] = [];
+ if (data.length >= 4) {
+ for (let i = 0; i <= data.length - 4; i += 4) {
+ handlePoints.push({ X: data[i + 1].X, Y: data[i + 1].Y, I: i + 1, dot1: i, dot2: i === 0 ? i : i - 1 });
+ handlePoints.push({ X: data[i + 2].X, Y: data[i + 2].Y, I: i + 2, dot1: i + 3, dot2: i === data.length ? i + 3 : i + 4 });
+ }
+ // Adding first and last (single) handle lines.
+ handleLines.push({ X1: data[0].X, Y1: data[0].Y, X2: data[0].X, Y2: data[0].Y, X3: data[1].X, Y3: data[1].Y, dot1: 0, dot2: 0 });
+ handleLines.push({ X1: data[data.length - 2].X, Y1: data[data.length - 2].Y, X2: data[data.length - 1].X, Y2: data[data.length - 1].Y, X3: data[data.length - 1].X, Y3: data[data.length - 1].Y, dot1: data.length - 1, dot2: data.length - 1 });
+ for (let i = 2; i < data.length - 4; i += 4) {
+ handleLines.push({ X1: data[i].X, Y1: data[i].Y, X2: data[i + 1].X, Y2: data[i + 1].Y, X3: data[i + 3].X, Y3: data[i + 3].Y, dot1: i + 1, dot2: i + 2 });
+ }
+ }
+ const [left, top, scaleX, scaleY, strokeWidth] = this.props.format;
+
+ return (
+ <>
+ {handlePoints.map((pts, i) =>
+ <svg height="10" width="10" key={`hdl${i}`}>
+ <circle
+ cx={(pts.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
+ cy={(pts.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
+ r={strokeWidth / 2}
+ strokeWidth={0}
+ fill={Colors.MEDIUM_BLUE}
+ onPointerDown={(e) => this.onHandleDown(e, pts.I)}
+ pointerEvents="all"
+ cursor="default"
+ display={(pts.dot1 === formatInstance._currentPoint || pts.dot2 === formatInstance._currentPoint) ? "inherit" : "none"} />
+ </svg>)}
+ {handleLines.map((pts, i) =>
+ <svg height="100" width="100" key={`line${i}`}>
+ <line
+ x1={(pts.X1 - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
+ y1={(pts.Y1 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
+ x2={(pts.X2 - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
+ y2={(pts.Y2 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
+ stroke={Colors.MEDIUM_BLUE}
+ strokeWidth={strokeWidth / 4}
+ display={(pts.dot1 === formatInstance._currentPoint || pts.dot2 === formatInstance._currentPoint) ? "inherit" : "none"} />
+ <line
+ x1={(pts.X2 - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
+ y1={(pts.Y2 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
+ x2={(pts.X3 - left - strokeWidth / 2) * scaleX + strokeWidth / 2}
+ y2={(pts.Y3 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
+ stroke={Colors.MEDIUM_BLUE}
+ strokeWidth={strokeWidth / 4}
+ display={(pts.dot1 === formatInstance._currentPoint || pts.dot2 === formatInstance._currentPoint) ? "inherit" : "none"} />
+ </svg>)}
+ </>
+ );
+ }
+} \ No newline at end of file
diff --git a/src/client/views/InkStroke.scss b/src/client/views/InkStroke.scss
new file mode 100644
index 000000000..812a79bd5
--- /dev/null
+++ b/src/client/views/InkStroke.scss
@@ -0,0 +1,11 @@
+.inkStroke {
+ mix-blend-mode: multiply;
+ stroke-linejoin: round;
+ stroke-linecap: round;
+ overflow: visible !important;
+ transform-origin: top left;
+
+ svg:not(:root) {
+ overflow: visible !important;
+ }
+}
diff --git a/src/client/views/InkStrokeProperties.ts b/src/client/views/InkStrokeProperties.ts
index b13b04f68..76ca5b5ec 100644
--- a/src/client/views/InkStrokeProperties.ts
+++ b/src/client/views/InkStrokeProperties.ts
@@ -1,124 +1,44 @@
import { action, computed, observable } from "mobx";
-import { ColorState } from 'react-color';
-import { Doc, Field, Opt } from "../../fields/Doc";
+import { Doc, DocListCast, Field, Opt } from "../../fields/Doc";
import { Document } from "../../fields/documentSchemas";
-import { InkField, InkData } from "../../fields/InkField";
+import { InkField, InkData, PointData, ControlPoint } from "../../fields/InkField";
+import { List } from "../../fields/List";
+import { listSpec } from "../../fields/Schema";
import { Cast, NumCast } from "../../fields/Types";
import { DocumentType } from "../documents/DocumentTypes";
import { SelectionManager } from "../util/SelectionManager";
import { undoBatch } from "../util/UndoManager";
-import { bool } from "sharp";
export class InkStrokeProperties {
static Instance: InkStrokeProperties | undefined;
- private _lastFill = "#D0021B";
- private _lastLine = "#D0021B";
- private _lastDash = "2";
- private _inkDocs: { x: number, y: number, width: number, height: number }[] = [];
-
@observable _lock = false;
- @observable _controlBtn = false;
- @observable _currPoint = -1;
+ @observable _controlButton = false;
+ @observable _currentPoint = -1;
- getField(key: string) {
- return this.selectedInk?.reduce((p, i) =>
- (p === undefined || (p && p === i.rootDoc[key])) && i.rootDoc[key] !== "0" ? Field.toString(i.rootDoc[key] as Field) : "", undefined as Opt<string>);
+ constructor() {
+ InkStrokeProperties.Instance = this;
}
@computed get selectedInk() {
const inks = SelectionManager.Views().filter(i => Document(i.rootDoc).type === DocumentType.INK);
return inks.length ? inks : undefined;
}
- @computed get unFilled() { return this.selectedInk?.reduce((p, i) => p && !i.rootDoc.fillColor ? true : false, true) || false; }
- @computed get unStrokd() { return this.selectedInk?.reduce((p, i) => p && !i.rootDoc.color ? true : false, true) || false; }
- @computed get solidFil() { return this.selectedInk?.reduce((p, i) => p && i.rootDoc.fillColor ? true : false, true) || false; }
- @computed get solidStk() { return this.selectedInk?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.strokeDash || i.rootDoc.strokeDash === "0") ? true : false, true) || false; }
- @computed get dashdStk() { return !this.unStrokd && this.getField("strokeDash") || ""; }
- @computed get colorFil() { const ccol = this.getField("fillColor") || ""; ccol && (this._lastFill = ccol); return ccol; }
- @computed get colorStk() { const ccol = this.getField("color") || ""; ccol && (this._lastLine = ccol); return ccol; }
- @computed get widthStk() { return this.getField("strokeWidth") || "1"; }
- @computed get markHead() { return this.getField("strokeStartMarker") || ""; }
- @computed get markTail() { return this.getField("strokeEndMarker") || ""; }
- @computed get shapeHgt() { return this.getField("_height"); }
- @computed get shapeWid() { return this.getField("_width"); }
- @computed get shapeXps() { return this.getField("x"); }
- @computed get shapeYps() { return this.getField("y"); }
- @computed get shapeRot() { return this.getField("rotation"); }
- set unFilled(value) { this.colorFil = value ? "" : this._lastFill; }
- set solidFil(value) { this.unFilled = !value; }
- set colorFil(value) { value && (this._lastFill = value); this.selectedInk?.forEach(i => i.rootDoc.fillColor = value ? value : undefined); }
- set colorStk(value) { value && (this._lastLine = value); this.selectedInk?.forEach(i => i.rootDoc.color = value ? value : undefined); }
- set markHead(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeStartMarker = value); }
- set markTail(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeEndMarker = value); }
- set unStrokd(value) { this.colorStk = value ? "" : this._lastLine; }
- set solidStk(value) { this.dashdStk = ""; this.unStrokd = !value; }
- set dashdStk(value) {
- value && (this._lastDash = value) && (this.unStrokd = false);
- this.selectedInk?.forEach(i => i.rootDoc.strokeDash = value ? this._lastDash : undefined);
- }
- set shapeXps(value) { this.selectedInk?.forEach(i => i.rootDoc.x = Number(value)); }
- set shapeYps(value) { this.selectedInk?.forEach(i => i.rootDoc.y = Number(value)); }
- set shapeRot(value) { this.selectedInk?.forEach(i => i.rootDoc.rotation = Number(value)); }
- set widthStk(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeWidth = Number(value)); }
- set shapeWid(value) {
- this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => {
- const oldWidth = NumCast(i.rootDoc._width);
- i.rootDoc._width = Number(value);
- this._lock && (i.rootDoc._height = (i.rootDoc._width * NumCast(i.rootDoc._height)) / oldWidth);
- });
- }
- set shapeHgt(value) {
- this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => {
- const oldHeight = NumCast(i.rootDoc._height);
- i.rootDoc._height = Number(value);
- this._lock && (i.rootDoc._width = (i.rootDoc._height * NumCast(i.rootDoc._width)) / oldHeight);
- });
- }
-
- constructor() {
- InkStrokeProperties.Instance = this;
- }
- @undoBatch
- @action
- addPoints = (x: number, y: number, pts: { X: number, Y: number }[], index: number, control: { X: number, Y: number }[]) => {
- this.selectedInk?.forEach(action(inkView => {
- if (this.selectedInk?.length === 1) {
- const doc = Document(inkView.rootDoc);
- if (doc.type === DocumentType.INK) {
- const ink = Cast(doc.data, InkField)?.inkData;
- if (ink) {
- const newPoints: { X: number, Y: number }[] = [];
- var counter = 0;
- for (var k = 0; k < index; k++) {
- control.forEach(pt => (pts[k].X === pt.X && pts[k].Y === pt.Y) && counter++);
- }
- //decide where to put the new coordinate
- const spNum = Math.floor(counter / 2) * 4 + 2;
-
- for (var i = 0; i < spNum; i++) {
- ink[i] && newPoints.push({ X: ink[i].X, Y: ink[i].Y });
- }
- for (var j = 0; j < 4; j++) {
- newPoints.push({ X: x, Y: y });
-
- }
- for (var i = spNum; i < ink.length; i++) {
- newPoints.push({ X: ink[i].X, Y: ink[i].Y });
- }
- this._currPoint = -1;
- Doc.GetProto(doc).data = new InkField(newPoints);
- }
- }
- }
- }));
+ getField(key: string) {
+ return this.selectedInk?.reduce((p, i) =>
+ (p === undefined || (p && p === i.rootDoc[key])) && i.rootDoc[key] !== "0" ? Field.toString(i.rootDoc[key] as Field) : "", undefined as Opt<string>);
}
+ /**
+ * Helper function that enables other functions to be applied to a particular ink instance.
+ * @param func The inputted function.
+ * @param requireCurrPoint Indicates whether the current selected point is needed.
+ */
applyFunction = (func: (doc: Doc, ink: InkData, ptsXscale: number, ptsYscale: number) => { X: number, Y: number }[] | undefined, requireCurrPoint: boolean = false) => {
var appliedFunc = false;
this.selectedInk?.forEach(action(inkView => {
- if (this.selectedInk?.length === 1 && (!requireCurrPoint || this._currPoint !== -1)) {
+ if (this.selectedInk?.length === 1 && (!requireCurrPoint || this._currentPoint !== -1)) {
const doc = Document(inkView.rootDoc);
if (doc.type === DocumentType.INK && doc.width && doc.height) {
const ink = Cast(doc.data, InkField)?.inkData;
@@ -145,17 +65,136 @@ export class InkStrokeProperties {
return appliedFunc;
}
+ /**
+ * Adds a new control point to the ink instance when editing its format.
+ * @param index The index of the new point.
+ * @param control The list of all control points of the ink.
+ */
+ @undoBatch
+ @action
+ addPoints = (x: number, y: number, points: InkData, index: number, controls: { X: number, Y: number }[]) => {
+ this.applyFunction((doc: Doc, ink: InkData) => {
+ const newControl = { X: x, Y: y };
+ const newPoints: InkData = [];
+ let [counter, start, end] = [0, 0, 0];
+ for (let k = 0; k < points.length; k++) {
+ if (end === 0) {
+ controls.forEach((control) => {
+ if (control.X === points[k].X && control.Y === points[k].Y) {
+ if (k < index) {
+ counter++;
+ start = k;
+ } else if (k > index) {
+ end = k;
+ }
+ }
+ });
+ }
+ }
+ if (end === 0) end = points.length - 1;
+ // Index of new control point with regards to the ink data.
+ const newIndex = Math.floor(counter / 2) * 4 + 2;
+ // Creating new ink data with the new control point and handle points inputted.
+ for (let i = 0; i < ink.length; i++) {
+ if (i === newIndex) {
+ const [handleA, handleB] = this.getNewHandlePoints(points.slice(start, index + 1), points.slice(index, end), newControl);
+ newPoints.push(handleA, newControl, newControl, handleB);
+ // Adjusting the magnitude of the left handle line of the right neighboring control point.
+ const [rightControl, rightHandle] = [points[end], ink[i]];
+ const scaledVector = this.getScaledHandlePoint(false, start, end, index, rightControl, rightHandle);
+ rightHandle && newPoints.push({ X: rightControl.X - scaledVector.X, Y: rightControl.Y - scaledVector.Y });
+ } else if (i === newIndex - 1) {
+ // Adjusting the magnitude of the right handle line of the left neighboring control point.
+ const [leftControl, leftHandle] = [points[start], ink[i]];
+ const scaledVector = this.getScaledHandlePoint(true, start, end, index, leftControl, leftHandle);
+ leftHandle && newPoints.push({ X: leftControl.X - scaledVector.X, Y: leftControl.Y - scaledVector.Y });
+ } else {
+ ink[i] && newPoints.push({ X: ink[i].X, Y: ink[i].Y });
+ }
+
+ }
+ let brokenIndices = Cast(doc.brokenInkIndices, listSpec("number"));
+ // Updating the indices of the control points whose handle tangency has been broken.
+ if (brokenIndices) {
+ brokenIndices = new List(brokenIndices.map((control) => {
+ if (control >= newIndex) {
+ return control + 4;
+ } else {
+ return control;
+ }
+ }));
+ }
+ doc.brokenInkIndices = brokenIndices;
+ this._currentPoint = -1;
+ return newPoints;
+ });
+ }
+
+ /**
+ * Scales a handle point of a control point that is adjacent to a newly added one.
+ * @param isLeft Determines if the current control point is on the left or right side of the newly added one.
+ * @param start Beginning index of curve from the left control point to the newly added one.
+ * @param end Final index of curve from the newly added control point to its right neighbor.
+ */
+ getScaledHandlePoint(isLeft: boolean, start: number, end: number, index: number, control: PointData, handle: PointData) {
+ const prevSize = end - start;
+ const newSize = isLeft ? index - start : end - index;
+ const handleVector = { X: control.X - handle.X, Y: control.Y - handle.Y };
+ const scaledVector = { X: handleVector.X * (newSize / prevSize), Y: handleVector.Y * (newSize / prevSize) };
+ return scaledVector;
+ }
+
+ /**
+ * Determines the position of the handle points of a newly added control point by finding the
+ * tangent vectors to the split curve at the new control. Given the properties of Bézier curves,
+ * the tangent vector to a control point is equivalent to the first/last (depending on the direction
+ * of the curve) leg of the Bézier curve's derivative.
+ * (Source: https://pages.mtu.edu/~shene/COURSES/cs3621/NOTES/spline/Bezier/bezier-der.html)
+ *
+ * @param C The curve represented by all points from the previous control until the newly added point.
+ * @param D The curve represented by all points from the newly added point to the next control.
+ * @param newControl The newly added control point.
+ */
+ getNewHandlePoints = (C: PointData[], D: PointData[], newControl: PointData) => {
+ const [m, n] = [C.length, D.length];
+ let handleSizeA = Math.sqrt((Math.pow(newControl.X - C[0].X, 2)) + (Math.pow(newControl.Y - C[0].Y, 2)));
+ let handleSizeB = Math.sqrt((Math.pow(D[n - 1].X - newControl.X, 2)) + (Math.pow(D[n - 1].Y - newControl.Y, 2)));
+ // Scaling adjustments to improve the ratio between the magnitudes of the two handle lines.
+ // (Ensures that the new point added doesn't augment the inital shape of the curve much).
+ if (handleSizeA < 75 && handleSizeB < 75) {
+ handleSizeA *= 3;
+ handleSizeB *= 3;
+ }
+ if (Math.abs(handleSizeA - handleSizeB) < 50) {
+ handleSizeA *= 5;
+ handleSizeB *= 5;
+ } else if (Math.abs(handleSizeA - handleSizeB) < 150) {
+ handleSizeA *= 2;
+ handleSizeB *= 2;
+ }
+ // Finding the last leg of the derivative curve of C.
+ const dC = { X: (handleSizeA / n) * (C[m - 1].X - C[m - 2].X), Y: (handleSizeA / n) * (C[m - 1].Y - C[m - 2].Y) };
+ // Finding the first leg of the derivative curve of D.
+ const dD = { X: (handleSizeB / m) * (D[1].X - D[0].X), Y: (handleSizeB / m) * (D[1].Y - D[0].Y) };
+ const handleA = { X: newControl.X - dC.X, Y: newControl.Y - dC.Y };
+ const handleB = { X: newControl.X + dD.X, Y: newControl.Y + dD.Y };
+ return [handleA, handleB];
+ }
+
+ /**
+ * Deletes the current control point of the selected ink instance.
+ */
@undoBatch
@action
deletePoints = () => this.applyFunction((doc: Doc, ink: InkData) => {
- var newPoints: { X: number, Y: number }[] = [];
- const toRemove = Math.floor(((this._currPoint + 2) / 4));
- for (var i = 0; i < ink.length; i++) {
+ const newPoints: { X: number, Y: number }[] = [];
+ const toRemove = Math.floor(((this._currentPoint + 2) / 4));
+ for (let i = 0; i < ink.length; i++) {
if (Math.floor((i + 2) / 4) !== toRemove && (toRemove !== 0 || i > 3)) {
newPoints.push({ X: ink[i].X, Y: ink[i].Y });
}
}
- this._currPoint = -1;
+ this._currentPoint = -1;
if (newPoints.length < 4) return undefined;
if (newPoints.length === 4) {
const newerPoints: { X: number, Y: number }[] = [];
@@ -166,12 +205,16 @@ export class InkStrokeProperties {
return newerPoints;
}
return newPoints;
- }, true);
+ }, true)
+ /**
+ * Rotates the entire selected ink instance.
+ * @param angle The angle at which to rotate the ink in radians.
+ */
@undoBatch
@action
- rotate = (angle: number) => {
- this.applyFunction((doc: Doc, ink: InkData, ptsXscale: number, ptsYscale: number) => {
+ rotateInk = (angle: number) => {
+ this.applyFunction((doc: Doc, ink: InkData, xScale: number, yScale: number) => {
const oldXrange = (xs => ({ coord: NumCast(doc.x), min: Math.min(...xs), max: Math.max(...xs) }))(ink.map(p => p.X));
const oldYrange = (ys => ({ coord: NumCast(doc.y), min: Math.min(...ys), max: Math.max(...ys) }))(ink.map(p => p.Y));
const centerPoint = { X: (oldXrange.min + oldXrange.max) / 2, Y: (oldYrange.min + oldYrange.max) / 2 };
@@ -186,42 +229,116 @@ export class InkStrokeProperties {
});
}
+ /**
+ * Handles the movement/scaling of a control point.
+ */
@undoBatch
@action
- control = (xDiff: number, yDiff: number, controlNum: number) =>
- this.applyFunction((doc: Doc, ink: InkData, ptsXscale: number, ptsYscale: number) => {
+ moveControl = (deltaX: number, deltaY: number, controlIndex: number) =>
+ this.applyFunction((doc: Doc, ink: InkData, xScale: number, yScale: number) => {
const newPoints: { X: number, Y: number }[] = [];
- const order = controlNum % 4;
+ const order = controlIndex % 4;
for (var i = 0; i < ink.length; i++) {
- newPoints.push(
- (controlNum === i ||
- (order === 0 && i === controlNum + 1) ||
- (order === 0 && controlNum !== 0 && i === controlNum - 2) ||
- (order === 0 && controlNum !== 0 && i === controlNum - 1) ||
- (order === 3 && i === controlNum - 1) ||
- (order === 3 && controlNum !== ink.length - 1 && i === controlNum + 1) ||
- (order === 3 && controlNum !== ink.length - 1 && i === controlNum + 2) ||
- ((ink[0].X === ink[ink.length - 1].X) && (ink[0].Y === ink[ink.length - 1].Y) && (i === 0 || i === ink.length - 1) && (controlNum === 0 || controlNum === ink.length - 1))
- ) ?
- { X: ink[i].X - xDiff / ptsXscale, Y: ink[i].Y - yDiff / ptsYscale } :
- { X: ink[i].X, Y: ink[i].Y });
+ const leftHandlePoint = order === 0 && i === controlIndex + 1;
+ const rightHandlePoint = order === 0 && controlIndex !== 0 && i === controlIndex - 2;
+ if (controlIndex === i ||
+ leftHandlePoint ||
+ rightHandlePoint ||
+ (order === 0 && controlIndex !== 0 && i === controlIndex - 1) ||
+ (order === 3 && i === controlIndex - 1) ||
+ (order === 3 && controlIndex !== ink.length - 1 && i === controlIndex + 1) ||
+ (order === 3 && controlIndex !== ink.length - 1 && i === controlIndex + 2) ||
+ ((ink[0].X === ink[ink.length - 1].X) && (ink[0].Y === ink[ink.length - 1].Y) && (i === 0 || i === ink.length - 1) && (controlIndex === 0 || controlIndex === ink.length - 1))) {
+ newPoints.push({ X: ink[i].X - deltaX / xScale, Y: ink[i].Y - deltaY / yScale });
+ } else {
+ newPoints.push({ X: ink[i].X, Y: ink[i].Y });
+ }
}
return newPoints;
+ })
+
+ /**
+ * Snaps a control point with broken tangency back to synced rotation.
+ * @param handleIndexA The handle point that retains its current position.
+ * @param handleIndexB The handle point that is rotated to be 180 degrees from its opposite.
+ */
+ snapHandleTangent = (controlIndex: number, handleIndexA: number, handleIndexB: number) => {
+ this.applyFunction((doc: Doc, ink: InkData) => {
+ const brokenIndices = Cast(doc.brokenInkIndices, listSpec("number"));
+ if (brokenIndices) {
+ brokenIndices.splice(brokenIndices.indexOf(controlIndex), 1);
+ doc.brokenInkIndices = brokenIndices;
+ const [controlPoint, handleA, handleB] = [ink[controlIndex], ink[handleIndexA], ink[handleIndexB]];
+ const oppositeHandleA = this.rotatePoint(handleA, controlPoint, Math.PI);
+ const angleDifference = this.angleChange(handleB, oppositeHandleA, controlPoint);
+ const newHandleB = this.rotatePoint(handleB, controlPoint, angleDifference);
+ ink[handleIndexB] = newHandleB;
+ return ink;
+ }
});
+ }
- @undoBatch
+ /**
+ * Rotates the target point about the origin point for a given angle (radians).
+ */
@action
- switchStk = (color: ColorState) => {
- const val = String(color.hex);
- this.colorStk = val;
- return true;
+ rotatePoint = (target: PointData, origin: PointData, angle: number) => {
+ let rotatedTarget = { X: target.X - origin.X, Y: target.Y - origin.Y };
+ const newX = Math.cos(angle) * rotatedTarget.X - Math.sin(angle) * rotatedTarget.Y;
+ const newY = Math.sin(angle) * rotatedTarget.X + Math.cos(angle) * rotatedTarget.Y;
+ rotatedTarget.X = newX + origin.X;
+ rotatedTarget.Y = newY + origin.Y;
+ return rotatedTarget;
+ }
+
+ /**
+ * Finds the angle (in radians) between two inputted vectors.
+ *
+ * α = arccos(a·b / |a|·|b|), where a and b are both vectors.
+ */
+ angleBetweenTwoVectors = (vectorA: PointData, vectorB: PointData) => {
+ const magnitudeA = Math.sqrt(vectorA.X * vectorA.X + vectorA.Y * vectorA.Y);
+ const magnitudeB = Math.sqrt(vectorB.X * vectorB.X + vectorB.Y * vectorB.Y);
+ // Normalizing the vectors.
+ vectorA = { X: vectorA.X / magnitudeA, Y: vectorA.Y / magnitudeA };
+ vectorB = { X: vectorB.X / magnitudeB, Y: vectorB.Y / magnitudeB };
+ const dotProduct = vectorB.X * vectorA.X + vectorB.Y * vectorA.Y;
+ return Math.acos(dotProduct);
}
+ /**
+ * Finds the angle difference (in radians) between two vectors relative to an arbitrary origin.
+ */
+ angleChange = (a: PointData, b: PointData, origin: PointData) => {
+ // Finding vector representation of inputted points relative to new origin.
+ const vectorA = { X: a.X - origin.X, Y: a.Y - origin.Y };
+ const vectorB = { X: b.X - origin.X, Y: b.Y - origin.Y };
+ const crossProduct = vectorB.X * vectorA.Y - vectorB.Y * vectorA.X;
+ // Determining whether rotation is clockwise or counterclockwise.
+ const sign = crossProduct < 0 ? 1 : -1;
+ const theta = this.angleBetweenTwoVectors(vectorA, vectorB);
+ return sign * theta;
+ }
+
+ /**
+ * Handles the movement/scaling of a handle point.
+ */
@undoBatch
@action
- switchFil = (color: ColorState) => {
- const val = String(color.hex);
- this.colorFil = val;
- return true;
- }
+ moveHandle = (deltaX: number, deltaY: number, handleIndex: number, oppositeHandleIndex: number, controlIndex: number) =>
+ this.applyFunction((doc: Doc, ink: InkData, xScale: number, yScale: number) => {
+ const oldHandlePoint = ink[handleIndex];
+ let oppositeHandlePoint = ink[oppositeHandleIndex];
+ const controlPoint = ink[controlIndex];
+ const newHandlePoint = { X: ink[handleIndex].X - deltaX / xScale, Y: ink[handleIndex].Y - deltaY / yScale };
+ ink[handleIndex] = newHandlePoint;
+ const brokenIndices = Cast(doc.brokenInkIndices, listSpec("number"));
+ // Rotate opposite handle if user hasn't held 'Alt' key or not first/final control (which have only 1 handle).
+ if ((!brokenIndices || !brokenIndices?.includes(controlIndex)) && handleIndex !== 1 && handleIndex !== ink.length - 2) {
+ const angle = this.angleChange(oldHandlePoint, newHandlePoint, controlPoint);
+ oppositeHandlePoint = this.rotatePoint(oppositeHandlePoint, controlPoint, angle);
+ ink[oppositeHandleIndex] = oppositeHandlePoint;
+ }
+ return ink;
+ })
} \ No newline at end of file
diff --git a/src/client/views/InkingStroke.scss b/src/client/views/InkingStroke.scss
deleted file mode 100644
index 30ab1967e..000000000
--- a/src/client/views/InkingStroke.scss
+++ /dev/null
@@ -1,11 +0,0 @@
-.inkingStroke {
- mix-blend-mode: multiply;
- stroke-linejoin: round;
- stroke-linecap: round;
- overflow: visible !important;
- transform-origin: top left;
-
- svg:not(:root) {
- overflow: visible !important;
- }
-} \ No newline at end of file
diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx
index 449019ca8..63cefbf67 100644
--- a/src/client/views/InkingStroke.tsx
+++ b/src/client/views/InkingStroke.tsx
@@ -1,4 +1,5 @@
-import { action } from "mobx";
+import React = require("react");
+import { action, observable } from "mobx";
import { observer } from "mobx-react";
import { Doc } from "../../fields/Doc";
import { documentSchema } from "../../fields/documentSchemas";
@@ -10,25 +11,35 @@ import { setupMoveUpEvents, emptyFunction, returnFalse } from "../../Utils";
import { CognitiveServices } from "../cognitive_services/CognitiveServices";
import { InteractionUtils } from "../util/InteractionUtils";
import { Scripting } from "../util/Scripting";
-import { UndoManager } from "../util/UndoManager";
import { ContextMenu } from "./ContextMenu";
import { ViewBoxBaseComponent } from "./DocComponent";
-import "./InkingStroke.scss";
+import "./InkStroke.scss";
import { FieldView, FieldViewProps } from "./nodes/FieldView";
-import React = require("react");
import { InkStrokeProperties } from "./InkStrokeProperties";
import { CurrentUserUtils } from "../util/CurrentUserUtils";
+import { InkControls } from "./InkControls";
+import { InkHandles } from "./InkHandles";
+import { Colors } from "./global/globalEnums";
type InkDocument = makeInterface<[typeof documentSchema]>;
const InkDocument = makeInterface(documentSchema);
@observer
export class InkingStroke extends ViewBoxBaseComponent<FieldViewProps, InkDocument>(InkDocument) {
- private _controlUndo?: UndoManager.Batch;
+ static readonly MaskDim = 50000;
+ @observable private _properties?: InkStrokeProperties;
+
+ constructor(props: FieldViewProps & InkDocument) {
+ super(props);
+
+ this._properties = InkStrokeProperties.Instance;
+ }
- public static LayoutString(fieldStr: string) { return FieldView.LayoutString(InkingStroke, fieldStr); }
+ public static LayoutString(fieldStr: string) {
+ return FieldView.LayoutString(InkingStroke, fieldStr);
+ }
- private analyzeStrokes = () => {
+ analyzeStrokes() {
const data: InkData = Cast(this.dataDoc[this.fieldKey], InkField)?.inkData ?? [];
CognitiveServices.Inking.Appliers.ConcatenateHandwriting(this.dataDoc, ["inkAnalysis", "handwriting"], [data]);
}
@@ -41,149 +52,65 @@ export class InkingStroke extends ViewBoxBaseComponent<FieldViewProps, InkDocume
inkDoc._stayInCollection = inkDoc.isInkMask ? true : undefined;
});
- @action
- onControlDown = (e: React.PointerEvent, controlNum: number): void => {
- if (InkStrokeProperties.Instance) {
- InkStrokeProperties.Instance.control(0, 0, 1);
- const controlUndo = UndoManager.StartBatch("DocDecs set radius");
- const screenScale = this.props.ScreenToLocalTransform().Scale;
- setupMoveUpEvents(this, e,
- (e: PointerEvent, down: number[], delta: number[]) => {
- InkStrokeProperties.Instance?.control(-delta[0] * screenScale, -delta[1] * screenScale, controlNum);
- return false;
- },
- () => controlUndo?.end(), emptyFunction);
- }
- }
-
- @action
- changeCurrPoint = (i: number) => {
- if (InkStrokeProperties.Instance) {
- InkStrokeProperties.Instance._currPoint = i;
- document.addEventListener("keydown", this.delPts, true);
+ /**
+ * Handles the movement of the entire ink object when the user clicks and drags.
+ */
+ onPointerDown = (e: React.PointerEvent) => {
+ if (this.props.isSelected(true)) {
+ setupMoveUpEvents(this, e, returnFalse, emptyFunction,
+ action((e: PointerEvent, doubleTap: boolean | undefined) =>
+ doubleTap && this._properties && (this._properties._controlButton = true))
+ );
}
}
+ /**
+ * Ensures the ink controls and handles aren't rendered when the current ink stroke is reselected.
+ */
@action
- delPts = (e: KeyboardEvent) => {
- if (["-", "Backspace", "Delete"].includes(e.key)) {
- if (InkStrokeProperties.Instance?.deletePoints()) e.stopPropagation();
+ toggleControlButton = () => {
+ if (!this.props.isSelected() && this._properties) {
+ this._properties._controlButton = false;
}
}
- onPointerDown = (e: React.PointerEvent) => {
- if (this.props.isSelected(true)) {
- setupMoveUpEvents(this, e, returnFalse, emptyFunction, action((e: PointerEvent, doubleTap: boolean | undefined) =>
- doubleTap && InkStrokeProperties.Instance && (InkStrokeProperties.Instance._controlBtn = true)));
- }
- }
-
- public static MaskDim = 50000;
render() {
TraceMobx();
- const formatInstance = InkStrokeProperties.Instance;
- if (!formatInstance) return (null);
+ this.toggleControlButton();
+ // Extracting the ink data and formatting information of the current ink stroke.
const data: InkData = Cast(this.dataDoc[this.fieldKey], InkField)?.inkData ?? [];
- // const strokeWidth = Number(StrCast(this.layoutDoc.strokeWidth, ActiveInkWidth()));
+ const inkDoc: Doc = this.layoutDoc;
const strokeWidth = Number(this.layoutDoc.strokeWidth);
- const xs = data.map(p => p.X);
- const ys = data.map(p => p.Y);
- const lineTop = Math.min(...ys);
- const lineBot = Math.max(...ys);
- const lineLft = Math.min(...xs);
- const lineRgt = Math.max(...xs);
- const left = lineLft - strokeWidth / 2;
+ const lineTop = Math.min(...data.map(p => p.Y));
+ const lineBottom = Math.max(...data.map(p => p.Y));
+ const lineLeft = Math.min(...data.map(p => p.X));
+ const lineRight = Math.max(...data.map(p => p.X));
+ const left = lineLeft - strokeWidth / 2;
const top = lineTop - strokeWidth / 2;
- const right = lineRgt + strokeWidth / 2;
- const bottom = lineBot + strokeWidth / 2;
+ const right = lineRight + strokeWidth / 2;
+ const bottom = lineBottom + strokeWidth / 2;
const width = Math.max(1, right - left);
const height = Math.max(1, bottom - top);
const scaleX = width === strokeWidth ? 1 : (this.props.PanelWidth() - strokeWidth) / (width - strokeWidth);
const scaleY = height === strokeWidth ? 1 : (this.props.PanelHeight() - strokeWidth) / (height - strokeWidth);
const strokeColor = StrCast(this.layoutDoc.color, "");
-
- const points = InteractionUtils.CreatePolyline(data, left, top, strokeColor, strokeWidth, strokeWidth,
- StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"),
- StrCast(this.layoutDoc.strokeStartMarker), StrCast(this.layoutDoc.strokeEndMarker),
- StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", this.props.isSelected() && strokeWidth <= 5 && lineBot - lineTop > 1 && lineRgt - lineLft > 1, false);
-
- const hpoints = InteractionUtils.CreatePolyline(data, left, top,
- this.props.isSelected() && strokeWidth > 5 ? strokeColor : "transparent", strokeWidth, (strokeWidth + 15),
- StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"),
- "none", "none", undefined, scaleX, scaleY, "", this.props.layerProvider?.(this.props.Document) === false ? "none" : "visiblepainted", false, true);
-
- //points for adding
- const apoints = InteractionUtils.CreatePoints(data, left, top, strokeColor, strokeWidth, strokeWidth,
- StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"),
- StrCast(this.layoutDoc.strokeStartMarker), StrCast(this.layoutDoc.strokeEndMarker),
- StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", this.props.isSelected() && strokeWidth <= 5, false);
-
- const controlPoints: { X: number, Y: number, I: number }[] = [];
- const handlePoints: { X: number, Y: number, I: number, dot1: number, dot2: number }[] = [];
- const handleLine: { X1: number, Y1: number, X2: number, Y2: number, X3: number, Y3: number, dot1: number, dot2: number }[] = [];
- if (data.length >= 4) {
- for (var i = 0; i <= data.length - 4; i += 4) {
- controlPoints.push({ X: data[i].X, Y: data[i].Y, I: i });
- controlPoints.push({ X: data[i + 3].X, Y: data[i + 3].Y, I: i + 3 });
- handlePoints.push({ X: data[i + 1].X, Y: data[i + 1].Y, I: i + 1, dot1: i, dot2: i === 0 ? i : i - 1 });
- handlePoints.push({ X: data[i + 2].X, Y: data[i + 2].Y, I: i + 2, dot1: i + 3, dot2: i === data.length ? i + 3 : i + 4 });
- }
-
- handleLine.push({ X1: data[0].X, Y1: data[0].Y, X2: data[0].X, Y2: data[0].Y, X3: data[1].X, Y3: data[1].Y, dot1: 0, dot2: 0 });
- for (var i = 2; i < data.length - 4; i += 4) {
-
- handleLine.push({ X1: data[i].X, Y1: data[i].Y, X2: data[i + 1].X, Y2: data[i + 1].Y, X3: data[i + 3].X, Y3: data[i + 3].Y, dot1: i + 1, dot2: i + 2 });
-
- }
- handleLine.push({ X1: data[data.length - 2].X, Y1: data[data.length - 2].Y, X2: data[data.length - 1].X, Y2: data[data.length - 1].Y, X3: data[data.length - 1].X, Y3: data[data.length - 1].Y, dot1: data.length - 1, dot2: data.length - 1 });
-
- for (var i = 0; i <= data.length - 4; i += 4) {
- handlePoints.push({ X: data[i + 1].X, Y: data[i + 1].Y, I: i + 1, dot1: i, dot2: i === 0 ? i : i - 1 });
- handlePoints.push({ X: data[i + 2].X, Y: data[i + 2].Y, I: i + 2, dot1: i + 3, dot2: i === data.length ? i + 3 : i + 4 });
- }
- }
- // if (data.length <= 4) {
- // handlePoints = [];
- // handleLine = [];
- // controlPoints = [];
- // for (var i = 0; i < data.length; i++) {
- // controlPoints.push({ X: data[i].X, Y: data[i].Y, I: i });
- // }
-
- // }
const dotsize = Math.max(width * scaleX, height * scaleY) / 40;
- const addpoints = apoints.map((pts, i) =>
- <svg height="10" width="10" key={`add${i}`}>
- <circle cx={(pts.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2} cy={(pts.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2} r={strokeWidth / 2} stroke="invisible" strokeWidth={dotsize / 2} fill="invisible"
- onPointerDown={(e) => { formatInstance.addPoints(pts.X, pts.Y, apoints, i, controlPoints); }} pointerEvents="all" cursor="all-scroll"
- />
- </svg>);
- const handles = handlePoints.map((pts, i) =>
- <svg height="10" width="10" key={`hdl${i}`}>
- <circle cx={(pts.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2} cy={(pts.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2} r={strokeWidth} strokeWidth={0} fill="green"
- onPointerDown={(e) => this.onControlDown(e, pts.I)} pointerEvents="all" cursor="default" display={(pts.dot1 === formatInstance._currPoint || pts.dot2 === formatInstance._currPoint) ? "inherit" : "none"} />
- </svg>);
-
- const controls = controlPoints.map((pts, i) =>
- <svg height="10" width="10" key={`ctrl${i}`}>
- <circle cx={(pts.X - left - strokeWidth / 2) * scaleX + strokeWidth / 2} cy={(pts.Y - top - strokeWidth / 2) * scaleY + strokeWidth / 2} r={strokeWidth / 2} strokeWidth={0} fill="red"
- onPointerDown={(e) => { this.changeCurrPoint(pts.I); this.onControlDown(e, pts.I); }} pointerEvents="all" cursor="default"
- />
- </svg>);
- const handleLines = handleLine.map((pts, i) =>
- <svg height="100" width="100" key={`line${i}`} >
- <line x1={(pts.X1 - left - strokeWidth / 2) * scaleX + strokeWidth / 2} y1={(pts.Y1 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
- x2={(pts.X2 - left - strokeWidth / 2) * scaleX + strokeWidth / 2} y2={(pts.Y2 - top - strokeWidth / 2) * scaleY + strokeWidth / 2} stroke="green" strokeWidth={dotsize / 6}
- display={(pts.dot1 === formatInstance._currPoint || pts.dot2 === formatInstance._currPoint) ? "inherit" : "none"} />
- <line x1={(pts.X2 - left - strokeWidth / 2) * scaleX + strokeWidth / 2} y1={(pts.Y2 - top - strokeWidth / 2) * scaleY + strokeWidth / 2}
- x2={(pts.X3 - left - strokeWidth / 2) * scaleX + strokeWidth / 2} y2={(pts.Y3 - top - strokeWidth / 2) * scaleY + strokeWidth / 2} stroke="green" strokeWidth={dotsize / 6}
- display={(pts.dot1 === formatInstance._currPoint || pts.dot2 === formatInstance._currPoint) ? "inherit" : "none"} />
- </svg>);
-
+ // Visually renders the polygonal line made by the user.
+ const inkLine = InteractionUtils.CreatePolyline(data, left, top, strokeColor, strokeWidth, strokeWidth, StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"), StrCast(this.layoutDoc.strokeStartMarker),
+ StrCast(this.layoutDoc.strokeEndMarker), StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", this.props.isSelected() && strokeWidth <= 5 && lineBottom - lineTop > 1 && lineRight - lineLeft > 1, false);
+ // Thin blue line indicating that the current ink stroke is selected.
+ const selectedLine = InteractionUtils.CreatePolyline(data, left - strokeWidth / 3, top - strokeWidth / 3, Colors.MEDIUM_BLUE, strokeWidth / 6, strokeWidth / 6, StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"),
+ StrCast(this.layoutDoc.strokeStartMarker), StrCast(this.layoutDoc.strokeEndMarker), StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", this.props.isSelected() && strokeWidth <= 5 && lineBottom - lineTop > 1 && lineRight - lineLeft > 1, false);
+ // Invisible polygonal line that enables the ink to be selected by the user.
+ const clickableLine = InteractionUtils.CreatePolyline(data, left, top, this.props.isSelected() && strokeWidth > 5 ? strokeColor : "transparent", strokeWidth, strokeWidth + 15, StrCast(this.layoutDoc.strokeBezier),
+ StrCast(this.layoutDoc.fillColor, "none"), "none", "none", undefined, scaleX, scaleY, "", this.props.layerProvider?.(this.props.Document) === false ? "none" : "visiblepainted", false, true);
+ // Set of points rendered upon the ink that can be added if a user clicks on one.
+ const addedPoints = InteractionUtils.CreatePoints(data, left, top, strokeColor, strokeWidth, strokeWidth, StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "none"), StrCast(this.layoutDoc.strokeStartMarker),
+ StrCast(this.layoutDoc.strokeEndMarker), StrCast(this.layoutDoc.strokeDash), scaleX, scaleY, "", "none", this.props.isSelected() && strokeWidth <= 5, false);
return (
- <svg className="inkingStroke"
+ <svg className="inkStroke"
style={{
pointerEvents: this.props.Document.isInkMask && this.props.layerProvider?.(this.props.Document) !== false ? "all" : "none",
transform: this.props.Document.isInkMask ? `translate(${InkingStroke.MaskDim / 2}px, ${InkingStroke.MaskDim / 2}px)` : undefined,
@@ -196,19 +123,28 @@ export class InkingStroke extends ViewBoxBaseComponent<FieldViewProps, InkDocume
if (cm) {
!Doc.UserDoc().noviceMode && cm.addItem({ description: "Recognize Writing", event: this.analyzeStrokes, icon: "paint-brush" });
cm.addItem({ description: "Toggle Mask", event: () => InkingStroke.toggleMask(this.rootDoc), icon: "paint-brush" });
- cm.addItem({ description: "Edit Points", event: action(() => formatInstance._controlBtn = !formatInstance._controlBtn), icon: "paint-brush" });
- //cm.addItem({ description: "Format Shape...", event: this.formatShape, icon: "paint-brush" });
+ cm.addItem({ description: "Edit Points", event: action(() => { if (this._properties) { this._properties._controlButton = !this._properties._controlButton; } }), icon: "paint-brush" });
}
}}
- ><defs>
- </defs>
- {hpoints}
- {points}
- {formatInstance._controlBtn && this.props.isSelected() ? addpoints : ""}
- {formatInstance._controlBtn && this.props.isSelected() ? handleLines : ""}
- {formatInstance._controlBtn && this.props.isSelected() ? handles : ""}
- {formatInstance._controlBtn && this.props.isSelected() ? controls : ""}
-
+ >
+
+ {clickableLine}
+ {inkLine}
+ {this.props.isSelected() ? selectedLine : ""}
+ {this.props.isSelected() && this._properties?._controlButton ?
+ <>
+ <InkControls
+ inkDoc={inkDoc}
+ data={data}
+ addedPoints={addedPoints}
+ format={[left, top, scaleX, scaleY, strokeWidth]}
+ ScreenToLocalTransform={this.props.ScreenToLocalTransform} />
+ <InkHandles
+ inkDoc={inkDoc}
+ data={data}
+ format={[left, top, scaleX, scaleY, strokeWidth]}
+ ScreenToLocalTransform={this.props.ScreenToLocalTransform} />
+ </> : ""}
</svg>
);
}
diff --git a/src/client/views/LightboxView.scss b/src/client/views/LightboxView.scss
index 4ea2dc2d6..5d42cd97f 100644
--- a/src/client/views/LightboxView.scss
+++ b/src/client/views/LightboxView.scss
@@ -1,3 +1,32 @@
+
+ .lightboxView-navBtn {
+ margin: auto;
+ position: absolute;
+ right: 10;
+ top: 10;
+ background: transparent;
+ border-radius: 8;
+ color:white;
+ opacity: 0.7;
+ width: 35;
+ &:hover {
+ opacity: 1;
+ }
+ }
+ .lightboxView-tabBtn {
+ margin: auto;
+ position: absolute;
+ right: 35;
+ top: 10;
+ background: transparent;
+ border-radius: 8;
+ color:white;
+ opacity: 0.7;
+ width: 35;
+ &:hover {
+ opacity: 1;
+ }
+ }
.lightboxView-frame {
position: absolute;
top: 0; left: 0;
@@ -15,7 +44,6 @@
position: relative;
background: transparent;
border-radius: 8;
- color:white;
opacity: 0.7;
width: 35;
&:hover {
diff --git a/src/client/views/LightboxView.tsx b/src/client/views/LightboxView.tsx
index ce36d9182..88739fe91 100644
--- a/src/client/views/LightboxView.tsx
+++ b/src/client/views/LightboxView.tsx
@@ -1,19 +1,20 @@
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
-import { action, computed, observable, trace } from 'mobx';
+import { action, computed, observable } from 'mobx';
import { observer } from 'mobx-react';
import "normalize.css";
import * as React from 'react';
import { Doc, DocListCast, Opt } from '../../fields/Doc';
import { Cast, NumCast, StrCast } from '../../fields/Types';
-import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnTrue, returnFalse } from '../../Utils';
+import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from '../../Utils';
import { DocUtils } from '../documents/Documents';
import { DocumentManager } from '../util/DocumentManager';
import { LinkManager } from '../util/LinkManager';
import { SelectionManager } from '../util/SelectionManager';
import { Transform } from '../util/Transform';
+import { CollectionDockingView } from './collections/CollectionDockingView';
import { TabDocView } from './collections/TabDocView';
import "./LightboxView.scss";
-import { DocumentView, ViewAdjustment } from './nodes/DocumentView';
+import { DocumentView } from './nodes/DocumentView';
import { DefaultStyleProvider, wavyBorderPath } from './StyleProvider';
interface LightboxViewProps {
@@ -160,7 +161,7 @@ export class LightboxView extends React.Component<LightboxViewProps> {
const { doc, target } = LightboxView._history?.lastElement();
const docView = DocumentManager.Instance.getLightboxDocumentView(target || doc);
if (docView) {
- LightboxView._docTarget = undefined;
+ LightboxView._docTarget = target;
const focusSpeed = 1000;
doc._viewTransition = `transform ${focusSpeed}ms`;
if (!target) docView.ComponentView?.shrinkWrap?.();
@@ -197,7 +198,6 @@ export class LightboxView extends React.Component<LightboxViewProps> {
TabDocView.PinDoc(coll, { hidePresBox: true });
}
}
- setTimeout(LightboxView.Next);
}
future = () => LightboxView._future;
@@ -228,7 +228,6 @@ export class LightboxView extends React.Component<LightboxViewProps> {
const targetView = target && DocumentManager.Instance.getLightboxDocumentView(target);
if (doc === r.props.Document && (!target || target === doc)) r.ComponentView?.shrinkWrap?.();
else target && targetView?.focus(target, { willZoom: true, scale: 0.9, instant: true });
- LightboxView._docTarget = undefined;
}));
})}
Document={LightboxView.LightboxDoc}
@@ -270,7 +269,16 @@ export class LightboxView extends React.Component<LightboxViewProps> {
LightboxView.Next();
})}
<LightboxTourBtn navBtn={this.navBtn} future={this.future} stepInto={this.stepInto} tourMap={this.tourMap} />
- <div className="lightboxView-navBtn" title={"toggle fit width"} style={{ position: "absolute", right: 10, top: 10, color: "white" }}
+ <div className="lightboxView-tabBtn" title={"open in tab"}
+ onClick={e => {
+ e.stopPropagation();
+ CollectionDockingView.AddSplit(LightboxView._docTarget || LightboxView._doc!, "onRight");
+ SelectionManager.DeselectAll();
+ LightboxView.SetLightboxDoc(undefined);
+ }}>
+ <FontAwesomeIcon icon={"file-download"} size="2x" />
+ </div>
+ <div className="lightboxView-navBtn" title={"toggle fit width"}
onClick={e => { e.stopPropagation(); LightboxView.LightboxDoc!._fitWidth = !LightboxView.LightboxDoc!._fitWidth; }}>
<FontAwesomeIcon icon={"arrows-alt-h"} size="2x" />
</div>
diff --git a/src/client/views/Main.scss b/src/client/views/Main.scss
index b1ad4868c..c8e64b5c4 100644
--- a/src/client/views/Main.scss
+++ b/src/client/views/Main.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
@import "nodeModuleOverrides";
:root {
@@ -54,7 +54,7 @@ button {
background: black;
outline: none;
border: 0px;
- color: $light-color;
+ color: $white;
text-transform: uppercase;
letter-spacing: 2px;
font-size: 75%;
@@ -63,7 +63,7 @@ button {
}
button:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
diff --git a/src/client/views/Main.tsx b/src/client/views/Main.tsx
index 60327f1bf..7553c8118 100644
--- a/src/client/views/Main.tsx
+++ b/src/client/views/Main.tsx
@@ -12,6 +12,7 @@ import { LinkManager } from "../util/LinkManager";
AssignAllExtensions();
(async () => {
+ MainView.Live = window.location.search.includes("live");
window.location.search.includes("safe") && CollectionView.SetSafeMode(true);
const info = await CurrentUserUtils.loadCurrentUser();
if (info.id !== "__guest__") {
diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss
index 3f04a0f3a..d913f2069 100644
--- a/src/client/views/MainView.scss
+++ b/src/client/views/MainView.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
@import "nodeModuleOverrides";
@@ -22,10 +22,6 @@
height: 100%;
}
-.mainContent-div-flyout {
- left: calc(-1 * var(--flyoutHandleWidth));
-}
-
// add nodes menu. Note that the + button is actually an input label, not an actual button.
.mainView-docButtons {
position: absolute;
@@ -56,50 +52,50 @@
touch-action: none;
.searchBox-container {
- background: lightgray;
+ background: $light-gray;
}
}
.mainView-container {
- color: black;
+ color: $dark-gray;
.lm_title {
- background: #cacaca;
- color: black;
+ background: $light-gray;
+ color: $dark-gray;
}
}
.mainView-container-dark {
- color: lightgray;
+ color: $light-gray;
.lm_goldenlayout {
- background: dimgray;
+ background: $medium-gray;
}
.lm_title {
- background: black;
+ background: $dark-gray;
color: unset;
}
.marquee {
- border-color: white;
+ border-color: $white;
}
#search-input {
- background: lightgray;
+ background: $light-gray;
}
.searchBox-container {
- background: rgb(45, 45, 45);
+ background: $dark-gray;
}
.contextMenu-cont,
.contextMenu-item {
- background: dimGray;
+ background: $medium-gray;
}
.contextMenu-item:hover {
- background: gray;
+ background: $medium-gray;
}
}
@@ -111,14 +107,21 @@
user-select: none;
}
+.properties-container {
+ height: 100%;
+ position: relative;
+ left: 100%;
+ top: calc(-100% - 36px);
+ z-index: 3000;
+}
+
.mainView-propertiesDragger {
//background-color: rgb(140, 139, 139);
- background-color: lightgrey;
+ background-color: $light-gray;
height: 55px;
width: 17px;
position: absolute;
top: 50%;
- border: 1px black solid;
border-radius: 0;
border-top-left-radius: 10px;
border-bottom-left-radius: 10px;
@@ -141,18 +144,6 @@
}
}
-.mainiView-propertiesView {
- display: flex;
- flex-direction: column;
- height: 100%;
- position: absolute;
- right: 0;
- top: 0;
- border-left: solid 1px;
- z-index: 100000;
- cursor: auto;
-}
-
.mainView-innerContent, .mainView-innerContent-dark {
display: contents;
flex-direction: row;
@@ -163,43 +154,43 @@
flex-direction: column;
position: relative;
height: 100%;
- background: dimgray;
+ background: $medium-gray;
.documentView-node-topmost {
- background: lightgrey;
+ background: $light-gray;
}
}
.propertiesView {
- right: 0;
+ left: 0;
position: absolute;
z-index: 2;
- background-color: rgb(159, 159, 159);
+ background-color: $light-gray;
.editable-title {
- background-color: lightgrey;
+ background-color: $light-gray;
}
}
}
.mainView-libraryHandle {
- background-color: lightgrey;
+ background-color: $light-gray;
}
.mainView-innerContent-dark
{
.propertiesView {
background-color: #252525;
input {
- background-color: dimgrey;
+ background-color: $medium-gray;
}
.propertiesView-sharingTable
{
- background-color: dimgrey;
+ background-color: $medium-gray;
}
.editable-title {
- background-color: dimgrey;
+ background-color: $medium-gray;
}
.propertiesView-field {
- background-color: dimgrey;
+ background-color: $medium-gray;
}
}
.mainView-propertiesDragger,
@@ -209,17 +200,18 @@
}
.mainView-container-dark {
.contextMenu-cont {
- background: dimgrey;
- color: white;
+ background: $medium-gray;
+ color: $white;
input::placeholder {
- color:white;
+ color:$white;
}
}
}
.mainView-menuPanel {
min-width: var(--menuPanelWidth);
- background-color: #121721;
+ background-color: $dark-gray;
+ border-right: $standard-border;
.collectionStackingView {
scrollbar-width: none;
@@ -233,13 +225,13 @@
padding: 7px;
padding-left: 7px;
width: 100%;
- background: black;
+ background: $dark-gray;
.mainView-menuPanel-button-wrap {
width: 45px;
/* padding: 5px; */
touch-action: none;
- background: black;
+ background: $dark-gray;
transform-origin: top left;
/* margin-bottom: 5px; */
margin-top: 5px;
@@ -247,7 +239,7 @@
border-radius: 8px;
&:hover {
- background: rgb(61, 61, 61);
+ background: $black;
cursor: pointer;
}
}
@@ -419,31 +411,4 @@
display: block;
width: 500px;
height: 1000px;
-}
-
-.lm_drag_tab {
- padding: 0;
- width: 15px !important;
- height: 15px !important;
- position: relative !important;
- display: inline-flex !important;
- align-items: center;
- top: 0 !important;
- right: unset !important;
- left: 0 !important;
-}
-.lm_close_tab {
- padding: 0;
- width: 15px !important;
- height: 15px !important;
- position: relative !important;
- display: inline-flex !important;
- align-items: center;
- top: 0 !important;
- right: unset !important;
- left: 0 !important;
-}
-.lm_tab, .lm_tab_active {
- display: flex !important;
- padding-right: 0 !important;
} \ No newline at end of file
diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx
index 97c88930e..a07f4037a 100644
--- a/src/client/views/MainView.tsx
+++ b/src/client/views/MainView.tsx
@@ -13,7 +13,7 @@ import { List } from '../../fields/List';
import { PrefetchProxy } from '../../fields/Proxy';
import { BoolCast, PromiseValue, StrCast } from '../../fields/Types';
import { TraceMobx } from '../../fields/util';
-import { emptyFunction, emptyPath, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue, setupMoveUpEvents, simulateMouseClick, Utils } from '../../Utils';
+import { emptyFunction, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue, setupMoveUpEvents, simulateMouseClick, Utils } from '../../Utils';
import { GoogleAuthenticationManager } from '../apis/GoogleAuthenticationManager';
import { DocServer } from '../DocServer';
import { Docs, DocUtils } from '../documents/Documents';
@@ -29,28 +29,27 @@ import { SettingsManager } from '../util/SettingsManager';
import { SharingManager } from '../util/SharingManager';
import { SnappingManager } from '../util/SnappingManager';
import { Transform } from '../util/Transform';
-import { undoBatch, UndoManager } from '../util/UndoManager';
import { TimelineMenu } from './animationtimeline/TimelineMenu';
import { CollectionDockingView } from './collections/CollectionDockingView';
import { MarqueeOptionsMenu } from './collections/collectionFreeForm/MarqueeOptionsMenu';
import { CollectionLinearView } from './collections/CollectionLinearView';
import { CollectionMenu } from './collections/CollectionMenu';
import { CollectionViewType } from './collections/CollectionView';
+import "./collections/TreeView.scss";
import { ContextMenu } from './ContextMenu';
import { DictationOverlay } from './DictationOverlay';
import { DocumentDecorations } from './DocumentDecorations';
import { GestureOverlay } from './GestureOverlay';
-import { MENU_PANEL_WIDTH, SEARCH_PANEL_HEIGHT } from './globalCssVariables.scss';
+import { MENU_PANEL_WIDTH, SEARCH_PANEL_HEIGHT } from './global/globalCssVariables.scss';
+import { Colors } from './global/globalEnums';
import { KeyManager } from './GlobalKeyHandler';
import { InkStrokeProperties } from './InkStrokeProperties';
import { LightboxView } from './LightboxView';
import { LinkMenu } from './linking/LinkMenu';
import "./MainView.scss";
-import "./collections/TreeView.scss";
import { AudioBox } from './nodes/AudioBox';
import { DocumentLinksButton } from './nodes/DocumentLinksButton';
-import { DocumentView, DocumentViewProps, DocAfterFocusFunc } from './nodes/DocumentView';
-import { FieldViewProps } from './nodes/FieldView';
+import { DocumentView } from './nodes/DocumentView';
import { FormattedTextBox } from './nodes/formattedText/FormattedTextBox';
import { LinkDescriptionPopup } from './nodes/LinkDescriptionPopup';
import { LinkDocPreview } from './nodes/LinkDocPreview';
@@ -61,13 +60,14 @@ import { OverlayView } from './OverlayView';
import { AnchorMenu } from './pdf/AnchorMenu';
import { PreviewCursor } from './PreviewCursor';
import { PropertiesView } from './PropertiesView';
-import { SearchBox } from './search/SearchBox';
-import { DefaultStyleProvider, DashboardStyleProvider, StyleProp } from './StyleProvider';
+import { DashboardStyleProvider, DefaultStyleProvider } from './StyleProvider';
+import { TopBar } from './topbar/TopBar';
const _global = (window /* browser */ || global /* node */) as any;
@observer
export class MainView extends React.Component {
public static Instance: MainView;
+ public static Live: boolean = false;
private _docBtnRef = React.createRef<HTMLDivElement>();
@observable public LastButton: Opt<Doc>;
@observable private _windowWidth: number = 0;
@@ -78,7 +78,7 @@ export class MainView extends React.Component {
@observable private _sidebarContent: any = this.userDoc?.sidebar;
@observable private _flyoutWidth: number = 0;
- @computed private get topOffset() { return (CollectionMenu.Instance?.Pinned ? 35 : 0) + Number(SEARCH_PANEL_HEIGHT.replace("px", "")); }
+ @computed private get topOffset() { return Number(SEARCH_PANEL_HEIGHT.replace("px", "")); } //TODO remove
@computed private get leftOffset() { return this.menuPanelWidth() - 2; }
@computed private get userDoc() { return Doc.UserDoc(); }
@computed private get darkScheme() { return BoolCast(CurrentUserUtils.ActiveDashboard?.darkScheme); }
@@ -103,8 +103,9 @@ export class MainView extends React.Component {
}
new InkStrokeProperties();
this._sidebarContent.proto = undefined;
- DocServer.setPlaygroundFields(["x", "y", "dataTransition", "_autoHeight", "_showSidebar", "_sidebarWidthPercent", "_width", "_height", "_viewTransition", "_panX", "_panY", "_viewScale", "_scrollTop", "hidden", "_curPage", "_viewType", "_chromeHidden"]); // can play with these fields on someone else's
-
+ if (!MainView.Live) {
+ DocServer.setPlaygroundFields(["x", "y", "dataTransition", "_autoHeight", "_showSidebar", "showSidebar", "_sidebarWidthPercent", "_width", "_height", "width", "height", "_viewTransition", "_panX", "_panY", "_viewScale", "_scrollTop", "hidden", "_curPage", "_viewType", "_chromeHidden", "nativeWidth", "_nativeWidth"]); // can play with these fields on someone else's
+ }
DocServer.GetRefField("rtfProto").then(proto => (proto instanceof Doc) && reaction(() => StrCast(proto.BROADCAST_MESSAGE), msg => msg && alert(msg)));
const tag = document.createElement('script');
@@ -186,7 +187,7 @@ export class MainView extends React.Component {
initEventListeners = () => {
window.addEventListener("drop", e => e.preventDefault(), false); // prevent default behavior of navigating to a new web page
window.addEventListener("dragover", e => e.preventDefault(), false);
- //document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined));
+ // document.addEventListener("pointermove", action(e => SearchBox.Instance._undoBackground = UndoManager.batchCounter ? "#000000a8" : undefined));
document.addEventListener("pointerdown", this.globalPointerDown);
document.addEventListener("click", (e: MouseEvent) => {
if (!e.cancelBubble) {
@@ -236,8 +237,9 @@ export class MainView extends React.Component {
}
getPWidth = () => this._panelWidth - this.propertiesWidth();
- getPHeight = () => this._panelHeight;
+ getPHeight = () => this._panelHeight - (CollectionMenu.Instance?.Pinned ? 35 : 0);
getContentsHeight = () => this._panelHeight;
+ getMenuPanelHeight = () => this._panelHeight + (CollectionMenu.Instance?.Pinned ? 35 : 0);
@computed get mainDocView() {
return <DocumentView key="main"
@@ -269,10 +271,12 @@ export class MainView extends React.Component {
@computed get dockingContent() {
return <div key="docking" className={`mainContent-div${this._flyoutWidth ? "-flyout" : ""}`} onDrop={e => { e.stopPropagation(); e.preventDefault(); }}
+ // style={{ minWidth: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`, width: `calc(100% - ${this._flyoutWidth + this.propertiesWidth()}px)` }}>
+ // FIXME update with property panel width
style={{
minWidth: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`,
transform: LightboxView.LightboxDoc ? "scale(0.0001)" : undefined,
- width: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`
+ //TODO:glr width: `calc(100% - ${this._flyoutWidth + this.menuPanelWidth() + this.propertiesWidth()}px)`
}}>
{!this.mainContainer ? (null) : this.mainDocView}
</div>;
@@ -352,7 +356,7 @@ export class MainView extends React.Component {
removeDocument={returnFalse}
ScreenToLocalTransform={this.sidebarScreenToLocal}
PanelWidth={this.menuPanelWidth}
- PanelHeight={this.getContentsHeight}
+ PanelHeight={this.getMenuPanelHeight}
renderDepth={0}
docViewPath={returnEmptyDoclist}
focus={DocUtils.DefaultFocus}
@@ -391,20 +395,27 @@ export class MainView extends React.Component {
}
@computed get mainInnerContent() {
+ const width = this.propertiesWidth() + this._flyoutWidth + this.menuPanelWidth();
+ const transform = this._flyoutWidth ? 'translate(-28px, 0px)' : undefined;
return <>
{this.menuPanel}
<div key="inner" className={`mainView-innerContent${this.darkScheme ? "-dark" : ""}`}>
{this.flyout}
- <div className="mainView-libraryHandle" style={{ display: !this._flyoutWidth ? "none" : undefined, }} onPointerDown={this.onFlyoutPointerDown} >
+ <div className="mainView-libraryHandle" style={{ display: !this._flyoutWidth ? "none" : undefined }} onPointerDown={this.onFlyoutPointerDown} >
<FontAwesomeIcon icon="chevron-left" color={this.darkScheme ? "white" : "black"} style={{ opacity: "50%" }} size="sm" />
</div>
+ <div className="mainView-innerContainer" style={{ width: `calc(100% - ${width}px)`, transform: transform }}>
+ <CollectionMenu />
- {this.dockingContent}
+ {this.dockingContent}
- <div className="mainView-propertiesDragger" key="props" onPointerDown={this.onPropertiesPointerDown} style={{ right: this.propertiesWidth() - 1 }}>
- <FontAwesomeIcon icon={this.propertiesWidth() < 10 ? "chevron-left" : "chevron-right"} color={this.darkScheme ? "white" : "black"} size="sm" />
+ <div className="mainView-propertiesDragger" key="props" onPointerDown={this.onPropertiesPointerDown} style={{ right: this._flyoutWidth ? 0 : this.propertiesWidth() - 1 }}>
+ <FontAwesomeIcon icon={this.propertiesWidth() < 10 ? "chevron-left" : "chevron-right"} color={this.darkScheme ? Colors.WHITE : Colors.BLACK} size="sm" />
+ </div>
+ <div className="properties-container">
+ {this.propertiesWidth() < 10 ? (null) : <PropertiesView styleProvider={DefaultStyleProvider} width={this.propertiesWidth()} height={this.getContentsHeight()} />}
+ </div>
</div>
- {this.propertiesWidth() < 10 ? (null) : <PropertiesView styleProvider={DefaultStyleProvider} width={this.propertiesWidth()} height={this.getContentsHeight()} />}
</div>
</>;
}
@@ -513,6 +524,13 @@ export class MainView extends React.Component {
</svg>;
}
+ @computed get topbar() {
+ TraceMobx();
+ return <div className="mainView-topbar">
+ <TopBar />
+ </div>;
+ }
+
@computed get invisibleWebBox() { // see note under the makeLink method in HypothesisUtils.ts
return !DocumentLinksButton.invisibleWebDoc ? null :
<div className="mainView-invisibleWebRef" ref={DocumentLinksButton.invisibleWebRef}>
@@ -560,8 +578,7 @@ export class MainView extends React.Component {
<GroupManager />
<GoogleAuthenticationManager />
<DocumentDecorations boundsLeft={this.leftOffset} boundsTop={this.topOffset} />
- {/*this.search*/}
- <CollectionMenu />
+ {this.topbar}
{LinkDescriptionPopup.descriptionPopup ? <LinkDescriptionPopup /> : null}
{DocumentLinksButton.LinkEditorDocView ? <LinkMenu docView={DocumentLinksButton.LinkEditorDocView} changeFlyout={emptyFunction} /> : (null)}
{LinkDocPreview.LinkInfo ? <LinkDocPreview {...LinkDocPreview.LinkInfo} /> : (null)}
@@ -579,7 +596,7 @@ export class MainView extends React.Component {
{this.snapLines}
<div className="mainView-webRef" ref={this.makeWebRef} />
<LightboxView PanelWidth={this._windowWidth} PanelHeight={this._windowHeight} maxBorder={[200, 50]} />
- </div>);
+ </div >);
}
makeWebRef = (ele: HTMLDivElement) => {
diff --git a/src/client/views/MarqueeAnnotator.tsx b/src/client/views/MarqueeAnnotator.tsx
index d2074d653..805cda95c 100644
--- a/src/client/views/MarqueeAnnotator.tsx
+++ b/src/client/views/MarqueeAnnotator.tsx
@@ -65,10 +65,9 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
doc.addEventListener("pointermove", this.onSelectMove);
doc.addEventListener("pointerup", this.onSelectEnd);
- AnchorMenu.Instance.OnClick = (e: PointerEvent) => {
- this.props.anchorMenuClick?.()?.(this.highlight("rgba(173, 216, 230, 0.75)", true));
- };
+ AnchorMenu.Instance.OnClick = (e: PointerEvent) => this.props.anchorMenuClick?.()?.(this.highlight("rgba(173, 216, 230, 0.75)", true));
AnchorMenu.Instance.Highlight = this.highlight;
+ AnchorMenu.Instance.GetAnchor = (savedAnnotations?: ObservableMap<number, HTMLDivElement[]>) => this.highlight("rgba(173, 216, 230, 0.75)", true, savedAnnotations);
/**
* This function is used by the AnchorMenu to create an anchor highlight and a new linked text annotation.
* It also initiates a Drag/Drop interaction to place the text annotation.
@@ -103,11 +102,13 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
@undoBatch
@action
- makeAnnotationDocument = (color: string, isLinkButton?: boolean): Opt<Doc> => {
- if (this.props.savedAnnotations.size === 0) return undefined;
- if ((Array.from(this.props.savedAnnotations.values())[0][0] as any).marqueeing) {
+ makeAnnotationDocument = (color: string, isLinkButton?: boolean, savedAnnotations?: ObservableMap<number, HTMLDivElement[]>): Opt<Doc> => {
+ const savedAnnoMap = savedAnnotations ?? this.props.savedAnnotations;
+ if (savedAnnoMap.size === 0) return undefined;
+ const savedAnnos = Array.from(savedAnnoMap.values())[0];
+ if (savedAnnos.length && (savedAnnos[0] as any).marqueeing) {
const scale = this.props.scaling?.() || 1;
- const anno = Array.from(this.props.savedAnnotations.values())[0][0];
+ const anno = savedAnnos[0];
const containerOffset = this.props.containerOffset?.() || [0, 0];
const marqueeAnno = Docs.Create.FreeformDocument([], { _isLinkButton: isLinkButton, backgroundColor: color, annotationOn: this.props.rootDoc, title: "Annotation on " + this.props.rootDoc.title });
marqueeAnno.x = (parseInt(anno.style.left || "0") - containerOffset[0]) / scale;
@@ -115,15 +116,17 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
marqueeAnno._height = parseInt(anno.style.height || "0") / scale;
marqueeAnno._width = parseInt(anno.style.width || "0") / scale;
anno.remove();
- this.props.savedAnnotations.clear();
+ savedAnnoMap.clear();
return marqueeAnno;
}
- const textRegionAnno = Docs.Create.HTMLAnchorDocument([], { annotationOn: this.props.rootDoc, title: "Selection on " + this.props.rootDoc.title, _width: 1, _height: 1 });
+ const textRegionAnno = Docs.Create.HTMLAnchorDocument([], { annotationOn: this.props.rootDoc, backgroundColor: "transparent", title: "Selection on " + this.props.rootDoc.title });
+ let minX = Number.MAX_VALUE;
let maxX = -Number.MAX_VALUE;
let minY = Number.MAX_VALUE;
+ let maxY = -Number.MIN_VALUE;
const annoDocs: Doc[] = [];
- this.props.savedAnnotations.forEach((value: HTMLDivElement[], key: number) => value.map(anno => {
+ savedAnnoMap.forEach((value: HTMLDivElement[], key: number) => value.map(anno => {
const textRegion = new Doc();
textRegion.x = parseInt(anno.style.left ?? "0");
textRegion.y = parseInt(anno.style.top ?? "0");
@@ -134,23 +137,27 @@ export class MarqueeAnnotator extends React.Component<MarqueeAnnotatorProps> {
annoDocs.push(textRegion);
anno.remove();
minY = Math.min(NumCast(textRegion.y), minY);
+ minX = Math.min(NumCast(textRegion.x), minX);
+ maxY = Math.max(NumCast(textRegion.y) + NumCast(textRegion._height), maxY);
maxX = Math.max(NumCast(textRegion.x) + NumCast(textRegion._width), maxX);
}));
const textRegionAnnoProto = Doc.GetProto(textRegionAnno);
textRegionAnnoProto.y = Math.max(minY, 0);
- textRegionAnnoProto.x = Math.max(maxX, 0);
+ textRegionAnnoProto.x = Math.max(minX, 0);
+ textRegionAnnoProto.height = Math.max(maxY, 0) - Math.max(minY, 0);
+ textRegionAnnoProto.width = Math.max(maxX, 0) - Math.max(minX, 0);
// mainAnnoDocProto.text = this._selectionText;
textRegionAnnoProto.textInlineAnnotations = new List<Doc>(annoDocs);
- this.props.savedAnnotations.clear();
+ savedAnnoMap.clear();
return textRegionAnno;
}
@action
- highlight = (color: string, isLinkButton: boolean) => {
+ highlight = (color: string, isLinkButton: boolean, savedAnnotations?: ObservableMap<number, HTMLDivElement[]>) => {
// creates annotation documents for current highlights
const effectiveAcl = GetEffectiveAcl(this.props.rootDoc[DataSym]);
- const annotationDoc = [AclAddonly, AclEdit, AclAdmin].includes(effectiveAcl) && this.makeAnnotationDocument(color, isLinkButton);
- annotationDoc && this.props.addDocument(annotationDoc);
+ const annotationDoc = [AclAddonly, AclEdit, AclAdmin].includes(effectiveAcl) && this.makeAnnotationDocument(color, isLinkButton, savedAnnotations);
+ !savedAnnotations && annotationDoc && this.props.addDocument(annotationDoc);
return annotationDoc as Doc ?? undefined;
}
diff --git a/src/client/views/PropertiesButtons.scss b/src/client/views/PropertiesButtons.scss
index 29d2bfcb7..484522bc7 100644
--- a/src/client/views/PropertiesButtons.scss
+++ b/src/client/views/PropertiesButtons.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
$linkGap : 3px;
@@ -7,13 +7,13 @@ $linkGap : 3px;
}
.propertiesButtons-linkButton-empty:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
.propertiesButtons-linkButton-nonempty:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
@@ -24,7 +24,7 @@ $linkGap : 3px;
width: 29px;
border-radius: 6px;
pointer-events: auto;
- background-color: #121721;
+ background-color: $dark-gray;
color: #fcfbf7;
text-transform: uppercase;
letter-spacing: 2px;
@@ -38,18 +38,18 @@ $linkGap : 3px;
margin-left: 4px;
&:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
}
.propertiesButtons-linkButton-empty.toggle-on {
background-color: white;
- color: black;
+ color: $dark-gray;
}
.propertiesButtons-linkButton-empty.toggle-hover {
background-color: gray;
- color: black;
+ color: $dark-gray;
}
.propertiesButtons-linkButton-empty.toggle-off {
color: white;
@@ -111,7 +111,7 @@ $linkGap : 3px;
margin-left: 4px;
&:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
cursor: pointer;
}
diff --git a/src/client/views/PropertiesView.scss b/src/client/views/PropertiesView.scss
index fa45a065d..321b83f52 100644
--- a/src/client/views/PropertiesView.scss
+++ b/src/client/views/PropertiesView.scss
@@ -1,6 +1,8 @@
+@import "./global/globalCssVariables.scss";
+
.propertiesView {
height: 100%;
- font-family: "Noto Sans";
+ font-family: "Roboto";
cursor: auto;
overflow-x: hidden;
@@ -28,9 +30,7 @@
color: grey;
cursor: pointer;
}
-
}
-
}
.propertiesView-name {
@@ -80,7 +80,6 @@
padding-bottom: 10px;
padding-top: 8px;
}
-
}
.propertiesView-sharing {
@@ -140,8 +139,6 @@
}
}
-
-
.change-buttons {
display: flex;
@@ -216,7 +213,6 @@
}
}
-
.propertiesView-appearance {
//border-bottom: 1px solid black;
//padding: 8.5px;
@@ -305,7 +301,7 @@
.notify-button-icon {
width: 6px;
height: 6.5px;
- margin-left: .5px;
+ margin-left: 0.5px;
}
&:hover {
@@ -331,7 +327,6 @@
}
.propertiesView-sharingTable {
-
// whatever's commented out - add it back in when adding the buttons
// border: 1.5px solid black;
@@ -347,7 +342,6 @@
width: 92%;
.propertiesView-sharingTable-item {
-
display: flex;
// padding: 5px;
padding: 3px;
@@ -421,7 +415,6 @@
cursor: pointer;
}
}
-
}
.propertiesView-fields-checkbox {
@@ -468,7 +461,6 @@
}
.propertiesView-contexts {
-
.propertiesView-contexts-title {
font-weight: bold;
font-size: 12.5px;
@@ -499,11 +491,9 @@
overflow: hidden;
padding: 10px;
}
-
}
.propertiesView-layout {
-
.propertiesView-layout-title {
font-weight: bold;
font-size: 12.5px;
@@ -534,7 +524,6 @@
overflow: hidden;
padding: 10px;
}
-
}
.propertiesView-presTrails {
@@ -576,7 +565,6 @@
}
.inking-button {
-
display: flex;
.inking-button-points {
@@ -635,7 +623,6 @@
}
.inputBox {
-
margin-top: 10px;
display: flex;
height: 19px;
@@ -658,7 +645,6 @@
}
.inputBox-button {
-
.inputBox-button-up {
background-color: #333333;
height: 9px;
@@ -690,7 +676,6 @@
cursor: pointer;
}
}
-
}
}
@@ -767,7 +752,6 @@
}
.widthAndDash {
-
.width {
.width-top {
display: flex;
@@ -792,13 +776,11 @@
}
.arrows {
-
display: flex;
margin-bottom: 3px;
margin-left: 4px;
.arrows-head {
-
display: flex;
margin-right: 35px;
@@ -827,7 +809,6 @@
}
.dashed {
-
display: flex;
margin-left: 64px;
margin-bottom: 6px;
@@ -844,19 +825,15 @@
}
.editable-title {
- border: none;
padding: 6px;
padding-bottom: 2px;
- background: #eeeeee;
- border-top: 1px solid;
- border-left: 1px solid;
+ border: solid 1px $dark-gray;
&:hover {
- border: 0.75px solid rgb(122, 28, 28);
+ border: 0.75px solid $medium-blue;
}
}
-
.properties-flyout {
grid-column: 2/4;
-} \ No newline at end of file
+}
diff --git a/src/client/views/PropertiesView.tsx b/src/client/views/PropertiesView.tsx
index d09d949ff..8136edf04 100644
--- a/src/client/views/PropertiesView.tsx
+++ b/src/client/views/PropertiesView.tsx
@@ -24,7 +24,7 @@ import { EditableView } from "./EditableView";
import { InkStrokeProperties } from "./InkStrokeProperties";
import { DocumentView, StyleProviderFunc } from "./nodes/DocumentView";
import { KeyValueBox } from "./nodes/KeyValueBox";
-import { PresBox } from "./nodes/PresBox";
+import { PresBox } from "./nodes/trails/PresBox";
import { PropertiesButtons } from "./PropertiesButtons";
import { PropertiesDocContextSelector } from "./PropertiesDocContextSelector";
import "./PropertiesView.scss";
@@ -86,7 +86,7 @@ export class PropertiesView extends React.Component<PropertiesViewProps> {
@observable openSlideOptions: boolean = false;
@observable inOptions: boolean = false;
- @observable _controlBtn: boolean = false;
+ @observable _controlButton: boolean = false;
@observable _lock: boolean = false;
componentDidMount() {
@@ -540,7 +540,7 @@ export class PropertiesView extends React.Component<PropertiesViewProps> {
const formatInstance = InkStrokeProperties.Instance;
return !formatInstance ? (null) : <div className="inking-button">
<Tooltip title={<div className="dash-tooltip">{"Edit points"}</div>}>
- <div className="inking-button-points" onPointerDown={action(() => formatInstance._controlBtn = !formatInstance._controlBtn)} style={{ backgroundColor: formatInstance._controlBtn ? "black" : "" }}>
+ <div className="inking-button-points" onPointerDown={action(() => formatInstance._controlButton = !formatInstance._controlButton)} style={{ backgroundColor: formatInstance._controlButton ? "black" : "" }}>
<FontAwesomeIcon icon="bezier-curve" color="white" size="lg" />
</div>
</Tooltip>
diff --git a/src/client/views/SidebarAnnos.tsx b/src/client/views/SidebarAnnos.tsx
index 59ff1c340..f1d168a22 100644
--- a/src/client/views/SidebarAnnos.tsx
+++ b/src/client/views/SidebarAnnos.tsx
@@ -23,6 +23,7 @@ interface ExtraProps {
layoutDoc: Doc;
rootDoc: Doc;
dataDoc: Doc;
+ showSidebar: boolean;
whenChildContentsActiveChanged: (isActive: boolean) => void;
ScreenToLocalTransform: () => Transform;
sidebarAddDocument: (doc: (Doc | Doc[]), suffix: string) => boolean;
@@ -31,18 +32,22 @@ interface ExtraProps {
}
@observer
export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
+ constructor(props: Readonly<FieldViewProps & ExtraProps>) {
+ super(props);
+ // this.props.dataDoc[this.sidebarKey] = new List<Doc>(); // bcz: can't do this here. it blows away existing things and isn't a robust solution for making sure the field exists -- instead this should happen when the document is created and/or shared
+ }
_stackRef = React.createRef<CollectionStackingView>();
@computed get allHashtags() {
const keys = new Set<string>();
- DocListCast(this.props.rootDoc[this.sidebarKey()]).forEach(doc => SearchBox.documentKeys(doc).forEach(key => keys.add(key)));
+ DocListCast(this.props.rootDoc[this.sidebarKey]).forEach(doc => SearchBox.documentKeys(doc).forEach(key => keys.add(key)));
return Array.from(keys.keys()).filter(key => key[0]).filter(key => !key.startsWith("_") && (key[0] === "#" || key[0] === key[0].toUpperCase())).sort();
}
@computed get allUsers() {
const keys = new Set<string>();
- DocListCast(this.props.rootDoc[this.sidebarKey()]).forEach(doc => keys.add(StrCast(doc.author)));
+ DocListCast(this.props.rootDoc[this.sidebarKey]).forEach(doc => keys.add(StrCast(doc.author)));
return Array.from(keys.keys()).sort();
}
- get filtersKey() { return "_" + this.sidebarKey() + "-docFilters"; }
+ get filtersKey() { return "_" + this.sidebarKey + "-docFilters"; }
anchorMenuClick = (anchor: Doc) => {
const startup = StrListCast(this.props.rootDoc.docFilters).map(filter => filter.split(":")[0]).join(" ");
@@ -59,7 +64,7 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
this._stackRef.current?.focusDocument(target);
}
makeDocUnfiltered = (doc: Doc) => {
- if (DocListCast(this.props.rootDoc[this.sidebarKey()]).includes(doc)) {
+ if (DocListCast(this.props.rootDoc[this.sidebarKey]).includes(doc)) {
if (this.props.layoutDoc[this.filtersKey]) {
this.props.layoutDoc[this.filtersKey] = new List<string>();
return true;
@@ -67,36 +72,39 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
}
return false;
}
- sidebarKey = () => this.props.fieldKey + "-sidebar";
+
+ get sidebarKey() { return this.props.fieldKey + "-sidebar"; }
filtersHeight = () => 38;
screenToLocalTransform = () => this.props.ScreenToLocalTransform().translate(Doc.NativeWidth(this.props.dataDoc), 0).scale(this.props.scaling?.() || 1);
- panelWidth = () => !this.props.layoutDoc._showSidebar ? 0 : this.props.layoutDoc.type === DocumentType.RTF ? this.props.PanelWidth() : (NumCast(this.props.layoutDoc.nativeWidth) - Doc.NativeWidth(this.props.dataDoc)) * this.props.PanelWidth() / NumCast(this.props.layoutDoc.nativeWidth);
+ panelWidth = () => !this.props.showSidebar ? 0 : this.props.layoutDoc.type === DocumentType.RTF ? this.props.PanelWidth() : (NumCast(this.props.layoutDoc.nativeWidth) - Doc.NativeWidth(this.props.dataDoc)) * this.props.PanelWidth() / NumCast(this.props.layoutDoc.nativeWidth);
panelHeight = () => this.props.PanelHeight() - this.filtersHeight();
- addDocument = (doc: Doc | Doc[]) => this.props.sidebarAddDocument(doc, this.sidebarKey());
- moveDocument = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDocument: (doc: Doc | Doc[]) => boolean) => this.props.moveDocument(doc, targetCollection, addDocument, this.sidebarKey());
- removeDocument = (doc: Doc | Doc[]) => this.props.removeDocument(doc, this.sidebarKey());
+ addDocument = (doc: Doc | Doc[]) => this.props.sidebarAddDocument(doc, this.sidebarKey);
+ moveDocument = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDocument: (doc: Doc | Doc[]) => boolean) => this.props.moveDocument(doc, targetCollection, addDocument, this.sidebarKey);
+ removeDocument = (doc: Doc | Doc[]) => this.props.removeDocument(doc, this.sidebarKey);
docFilters = () => [...StrListCast(this.props.layoutDoc._docFilters), ...StrListCast(this.props.layoutDoc[this.filtersKey])];
sidebarStyleProvider = (doc: Opt<Doc>, props: Opt<FieldViewProps | DocumentViewProps>, property: string) => {
- if (property === StyleProp.ShowTitle) return StrCast(this.props.layoutDoc["sidebar-childShowTitle"], "title");
+ if (property === StyleProp.ShowTitle) {
+ return doc === this.props.rootDoc ? undefined : StrCast(this.props.layoutDoc["sidebar-childShowTitle"], "title");
+ }
return this.props.styleProvider?.(doc, props, property);
}
render() {
const renderTag = (tag: string) => {
const active = StrListCast(this.props.rootDoc[this.filtersKey]).includes(`${tag}:${tag}:check`);
return <div key={tag} className={`sidebarAnnos-filterTag${active ? "-active" : ""}`}
- onClick={e => Doc.setDocFilter(this.props.rootDoc, tag, tag, "check", true, this.sidebarKey(), e.shiftKey)}>
+ onClick={e => Doc.setDocFilter(this.props.rootDoc, tag, tag, "check", true, this.sidebarKey, e.shiftKey)}>
{tag}
</div>;
};
const renderUsers = (user: string) => {
const active = StrListCast(this.props.rootDoc[this.filtersKey]).includes(`author:${user}:check`);
return <div key={user} className={`sidebarAnnos-filterUser${active ? "-active" : ""}`}
- onClick={e => Doc.setDocFilter(this.props.rootDoc, "author", user, "check", true, this.sidebarKey(), e.shiftKey)}>
+ onClick={e => Doc.setDocFilter(this.props.rootDoc, "author", user, "check", true, this.sidebarKey, e.shiftKey)}>
{user}
</div>;
};
- return !this.props.layoutDoc._showSidebar ? (null) :
+ return !this.props.showSidebar ? (null) :
<div style={{
position: "absolute", pointerEvents: this.props.isContentActive() ? "all" : undefined, top: 0, right: 0,
background: this.props.styleProvider?.(this.props.rootDoc, this.props, StyleProp.WidgetColor),
@@ -116,7 +124,8 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
PanelWidth={this.panelWidth}
styleProvider={this.sidebarStyleProvider}
docFilters={this.docFilters}
- scaleField={this.sidebarKey() + "-scale"}
+ scaleField={this.sidebarKey + "-scale"}
+ setHeight={(height) => this.props.setHeight(height + this.filtersHeight())}
isAnnotationOverlay={false}
select={emptyFunction}
scaling={returnOne}
@@ -129,7 +138,7 @@ export class SidebarAnnos extends React.Component<FieldViewProps & ExtraProps> {
ScreenToLocalTransform={this.screenToLocalTransform}
renderDepth={this.props.renderDepth + 1}
viewType={CollectionViewType.Stacking}
- fieldKey={this.sidebarKey()}
+ fieldKey={this.sidebarKey}
pointerEvents={"all"}
/>
</div>
diff --git a/src/client/views/StyleProvider.tsx b/src/client/views/StyleProvider.tsx
index e670420d1..c9e532745 100644
--- a/src/client/views/StyleProvider.tsx
+++ b/src/client/views/StyleProvider.tsx
@@ -1,4 +1,5 @@
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
+import { Colors } from './global/globalEnums';
import { IconProp } from '@fortawesome/fontawesome-svg-core';
import 'golden-layout/src/css/goldenlayout-base.css';
import 'golden-layout/src/css/goldenlayout-dark-theme.css';
@@ -97,16 +98,16 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps
case StyleProp.Color:
const docColor: Opt<string> = StrCast(doc?.[fieldKey + "color"], StrCast(doc?._color));
if (docColor) return docColor;
- const backColor = backgroundCol();// || (darkScheme() ? "black" : "white");
+ const backColor = backgroundCol();
if (!backColor) return undefined;
const nonAlphaColor = backColor.startsWith("#") ? (backColor as string).substring(0, 7) :
backColor.startsWith("rgba") ? backColor.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : backColor;
const col = Color(nonAlphaColor).rgb();
const colsum = (col.red() + col.green() + col.blue());
- if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return "black";
- return "white";
+ if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return Colors.DARK_GRAY;
+ return Colors.WHITE;
case StyleProp.Hidden: return BoolCast(doc?._hidden);
- case StyleProp.BorderRounding: return StrCast(doc?.[fieldKey + "borderRounding"]);
+ case StyleProp.BorderRounding: return StrCast(doc?.[fieldKey + "borderRounding"], doc?._viewType === CollectionViewType.Pile ? "50%" : "");
case StyleProp.TitleHeight: return 15;
case StyleProp.BorderPath: return comicStyle() && props?.renderDepth ? { path: wavyBorderPath(props?.PanelWidth?.() || 0, props?.PanelHeight?.() || 0), fill: wavyBorderPath(props?.PanelWidth?.() || 0, props?.PanelHeight?.() || 0, .08), width: 3 } : { path: undefined, width: 0 };
case StyleProp.JitterRotation: return comicStyle() ? random(-1, 1, NumCast(doc?.x), NumCast(doc?.y)) * ((props?.PanelWidth() || 0) > (props?.PanelHeight() || 0) ? 5 : 10) : 0;
@@ -114,38 +115,38 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps
doc?.type === DocumentType.RTF) && showTitle() && !StrCast(doc?.showTitle).includes(":hover") ? 15 : 0;
case StyleProp.BackgroundColor: {
let docColor: Opt<string> = StrCast(doc?.[fieldKey + "backgroundColor"], StrCast(doc?._backgroundColor, isCaption ? "rgba(0,0,0,0.4)" : ""));
- if (MainView.Instance.LastButton === doc) return darkScheme() ? "dimgrey" : "lightgrey";
+ if (MainView.Instance.LastButton === doc) return darkScheme() ? Colors.MEDIUM_GRAY : Colors.LIGHT_GRAY;
switch (doc?.type) {
case DocumentType.PRESELEMENT: docColor = docColor || (darkScheme() ? "" : ""); break;
- case DocumentType.PRES: docColor = docColor || (darkScheme() ? "#3e3e3e" : "white"); break;
- case DocumentType.FONTICON: docColor = docColor || "black"; break;
- case DocumentType.RTF: docColor = docColor || (darkScheme() ? "#2d2d2d" : "#f1efeb"); break;
- case DocumentType.FILTER: docColor = docColor || (darkScheme() ? "#2d2d2d" : "rgba(105, 105, 105, 0.432)"); break;
+ case DocumentType.PRES: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.WHITE); break;
+ case DocumentType.FONTICON: docColor = docColor || Colors.DARK_GRAY; break;
+ case DocumentType.RTF: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY); break;
+ case DocumentType.FILTER: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : "rgba(105, 105, 105, 0.432)"); break;
case DocumentType.INK: docColor = doc?.isInkMask ? "rgba(0,0,0,0.7)" : undefined; break;
case DocumentType.SLIDER: break;
case DocumentType.EQUATION: docColor = docColor || "transparent"; break;
case DocumentType.LABEL: docColor = docColor || (doc.annotationOn !== undefined ? "rgba(128, 128, 128, 0.18)" : undefined); break;
- case DocumentType.BUTTON: docColor = docColor || (darkScheme() ? "#2d2d2d" : "lightgray"); break;
- case DocumentType.LINKANCHOR: docColor = isAnchor ? "lightblue" : "transparent"; break;
- case DocumentType.LINK: docColor = docColor || "transparent"; break;
+ case DocumentType.BUTTON: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY); break;
+ case DocumentType.LINKANCHOR: docColor = isAnchor ? Colors.LIGHT_BLUE : "transparent"; break;
+ case DocumentType.LINK: docColor = (isAnchor ? docColor : "") || "transparent"; break;
case DocumentType.IMG:
case DocumentType.WEB:
case DocumentType.PDF:
case DocumentType.SCREENSHOT:
- case DocumentType.VID: docColor = docColor || (darkScheme() ? "#2d2d2d" : "lightgray"); break;
+ case DocumentType.VID: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY); break;
case DocumentType.COL:
if (StrCast(Doc.LayoutField(doc)).includes("SliderBox")) break;
- docColor = docColor ? docColor :
- doc?._isGroup ? "#00000004" : // very faint highlight to show bounds of group
- (Doc.IsSystem(doc) ? (darkScheme() ? "rgb(62,62,62)" : "lightgrey") : // system docs (seen in treeView) get a grayish background
+ docColor = docColor ||
+ (doc?._isGroup ? "#00000004" : // very faint highlight to show bounds of group
+ (doc?._viewType === CollectionViewType.Pile || Doc.IsSystem(doc) ? (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY) : // system docs (seen in treeView) get a grayish background
isBackground() ? "cyan" : // ?? is there a good default for a background collection
doc.annotationOn ? "#00000015" : // faint interior for collections on PDFs, images, etc
StrCast((props?.renderDepth || 0) > 0 ?
Doc.UserDoc().activeCollectionNestedBackground :
- Doc.UserDoc().activeCollectionBackground));
+ Doc.UserDoc().activeCollectionBackground)));
break;
//if (doc._viewType !== CollectionViewType.Freeform && doc._viewType !== CollectionViewType.Time) return "rgb(62,62,62)";
- default: docColor = docColor || (darkScheme() ? "black" : "white"); break;
+ default: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.WHITE); break;
}
if (docColor && (!doc || props?.layerProvider?.(doc) === false)) docColor = Color(docColor.toLowerCase()).fade(0.5).toString();
return docColor;
@@ -158,8 +159,9 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps
switch (doc?.type) {
case DocumentType.COL:
return StrCast(doc?.boxShadow,
- isBackground() || doc?._isGroup || docProps?.LayoutTemplateString ? undefined : // groups have no drop shadow -- they're supposed to be "invisible". LayoutString's imply collection is being rendered as something else (e.g., title of a Slide)
- `${darkScheme() ? "rgb(30, 32, 31) " : "#9c9396 "} ${StrCast(doc.boxShadow, "0.2vw 0.2vw 0.8vw")}`);
+ doc?._viewType === CollectionViewType.Pile ? "4px 4px 10px 2px" :
+ isBackground() || doc?._isGroup || docProps?.LayoutTemplateString ? undefined : // groups have no drop shadow -- they're supposed to be "invisible". LayoutString's imply collection is being rendered as something else (e.g., title of a Slide)
+ `${darkScheme() ? Colors.DARK_GRAY : Colors.MEDIUM_GRAY} ${StrCast(doc.boxShadow, "0.2vw 0.2vw 0.8vw")}`);
case DocumentType.LABEL:
if (doc?.annotationOn !== undefined) return "black 2px 2px 1px";
@@ -172,6 +174,7 @@ export function DefaultStyleProvider(doc: Opt<Doc>, props: Opt<DocumentViewProps
}
}
case StyleProp.PointerEvents:
+ if (doc?.type === DocumentType.MARKER) return "none";
if (props?.pointerEvents === "none") return "none";
const layer = doc && props?.layerProvider?.(doc);
if (opacity() === 0 || (doc?.type === DocumentType.INK && !docProps?.treeViewDoc) || doc?.isInkMask) return "none";
diff --git a/src/client/views/TemplateMenu.scss b/src/client/views/TemplateMenu.scss
index bbed8cd96..f81cbdaab 100644
--- a/src/client/views/TemplateMenu.scss
+++ b/src/client/views/TemplateMenu.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
.templating-menu {
position: absolute;
pointer-events: auto;
@@ -24,7 +24,7 @@
cursor: pointer;
&:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.05);
}
}
@@ -32,7 +32,7 @@
.template-list {
font-family: $sans-serif;
font-size: 12px;
- background-color: $light-color-secondary;
+ background-color: $light-gray;
padding: 2px 12px;
list-style: none;
position: relative;
diff --git a/src/client/views/_nodeModuleOverrides.scss b/src/client/views/_nodeModuleOverrides.scss
index b8a7db034..fd0ac9d5c 100644
--- a/src/client/views/_nodeModuleOverrides.scss
+++ b/src/client/views/_nodeModuleOverrides.scss
@@ -1,8 +1,50 @@
+@import "./global/globalCssVariables";
// this file is for overriding all the css from installed node modules
// goldenlayout stuff
div .lm_header {
- background: $dark-color;
+ background: $dark-gray;
+ overflow: hidden;
+ height: 27px !important;
+}
+
+/* Width */
+.lm_header::-webkit-scrollbar {
+ -webkit-appearance: none;
+ display: none;
+}
+
+/* Width */
+.lm_header:hover::-webkit-scrollbar {
+ -webkit-appearance: none;
+ display: block;
+ height: 0px;
+}
+
+/* Track */
+.lm_header:hover::-webkit-scrollbar-track {
+ -webkit-appearance: none;
+ display: none;
+}
+
+/* Handle */
+.lm_header:hover::-webkit-scrollbar-thumb {
+ -webkit-appearance: none;
+ background: $dark-gray;
+}
+
+/* Handle on hover */
+.lm_header:hover::-webkit-scrollbar-thumb:hover {
+ -webkit-appearance: none;
+ background: $dark-gray;
+}
+
+.lm_tabs {
+ display: flex;
+ position: absolute;
+ width: calc(100% - 60px);
+ overflow: scroll;
+ background: $dark-gray;
}
.lm_tab {
@@ -15,7 +57,14 @@ div .lm_header {
}
.lm_header .lm_controls {
- right: 1em !important;
+ align-items: center;
+ position: absolute;
+ background-color: $dark-gray;
+ border-radius: 5px;
+ display: flex;
+ justify-content: space-evenly;
+ height: 23px;
+ width: 65px;
}
// @TODO the ril__navgiation buttons in the img gallery are a lil messed up but I can't figure out
diff --git a/src/client/views/animationtimeline/Keyframe.scss b/src/client/views/animationtimeline/Keyframe.scss
index 84c8de287..38eb103c6 100644
--- a/src/client/views/animationtimeline/Keyframe.scss
+++ b/src/client/views/animationtimeline/Keyframe.scss
@@ -1,4 +1,4 @@
-@import "./../globalCssVariables.scss";
+@import "./../global/globalCssVariables.scss";
$timelineColor: #9acedf;
@@ -15,11 +15,11 @@ $timelineDark: #77a1aa;
height: 200px;
top: 50%;
position: relative;
- background-color: $light-color;
+ background-color: $white;
.menutable {
tr:nth-child(odd) {
- background-color: $light-color-secondary;
+ background-color: $light-gray;
}
}
}
@@ -67,7 +67,7 @@ $timelineDark: #77a1aa;
height: 100%;
position: absolute;
pointer-events: none;
- background: linear-gradient(to left, $timelineColor 10%, $light-color);
+ background: linear-gradient(to left, $timelineColor 10%, $white);
}
.fadeRight {
@@ -75,7 +75,7 @@ $timelineDark: #77a1aa;
height: 100%;
position: absolute;
pointer-events: none;
- background: linear-gradient(to right, $timelineColor 10%, $light-color);
+ background: linear-gradient(to right, $timelineColor 10%, $white);
}
.divider {
diff --git a/src/client/views/animationtimeline/Keyframe.tsx b/src/client/views/animationtimeline/Keyframe.tsx
index e84022366..82b0218bf 100644
--- a/src/client/views/animationtimeline/Keyframe.tsx
+++ b/src/client/views/animationtimeline/Keyframe.tsx
@@ -1,7 +1,7 @@
import * as React from "react";
import "./Keyframe.scss";
import "./Timeline.scss";
-import "../globalCssVariables.scss";
+import "../global/globalCssVariables.scss";
import { observer } from "mobx-react";
import { observable, reaction, action, IReactionDisposer, observe, computed, runInAction, trace } from "mobx";
import { Doc, DocListCast, DocListCastAsync, Opt } from "../../../fields/Doc";
diff --git a/src/client/views/animationtimeline/Timeline.scss b/src/client/views/animationtimeline/Timeline.scss
index f90249771..48422b789 100644
--- a/src/client/views/animationtimeline/Timeline.scss
+++ b/src/client/views/animationtimeline/Timeline.scss
@@ -1,4 +1,4 @@
-@import "./../globalCssVariables.scss";
+@import "./../global/globalCssVariables.scss";
$timelineColor: #9acedf;
$timelineDark: #77a1aa;
@@ -161,7 +161,7 @@ $timelineDark: #77a1aa;
width: 100%;
height: 300px;
position: absolute;
- background-color: $light-color-secondary;
+ background-color: $light-gray;
border-bottom: 2px solid $timelineDark;
transition: transform 500ms ease;
@@ -251,7 +251,7 @@ $timelineDark: #77a1aa;
top: 0px;
width: 100px;
height: 30%;
- border: 1px solid $dark-color;
+ border: 1px solid $dark-gray;
font-size: 12px;
line-height: 11px;
background-color: $timelineDark;
diff --git a/src/client/views/animationtimeline/TimelineMenu.scss b/src/client/views/animationtimeline/TimelineMenu.scss
index 7ee0a43d5..43a89419e 100644
--- a/src/client/views/animationtimeline/TimelineMenu.scss
+++ b/src/client/views/animationtimeline/TimelineMenu.scss
@@ -1,10 +1,10 @@
-@import "./../globalCssVariables.scss";
+@import "./../global/globalCssVariables.scss";
.timeline-menu-container{
position: absolute;
display: flex;
- box-shadow: $intermediate-color 0.2vw 0.2vw 0.4vw;
+ box-shadow: $medium-gray 0.2vw 0.2vw 0.4vw;
flex-direction: column;
background: whitesmoke;
z-index: 10000;
@@ -39,7 +39,7 @@
border-top-left-radius: 15px;
border-top-right-radius: 15px;
text-transform: uppercase;
- background: $dark-color;
+ background: $dark-gray;
letter-spacing: 2px;
.timeline-menu-header-desc{
@@ -79,10 +79,10 @@
.timeline-menu-item:hover {
border-width: .11px;
border-style: none;
- border-color: $intermediate-color;
+ border-color: $medium-gray;
border-bottom-style: solid;
border-top-style: solid;
- background: $darker-alt-accent;
+ background: $medium-blue;
}
.timeline-menu-desc {
diff --git a/src/client/views/animationtimeline/TimelineOverview.scss b/src/client/views/animationtimeline/TimelineOverview.scss
index 283163ea7..c8d96c399 100644
--- a/src/client/views/animationtimeline/TimelineOverview.scss
+++ b/src/client/views/animationtimeline/TimelineOverview.scss
@@ -1,4 +1,4 @@
-@import "./../globalCssVariables.scss";
+@import "./../global/globalCssVariables.scss";
$timelineColor: #9acedf;
$timelineDark: #77a1aa;
diff --git a/src/client/views/animationtimeline/Track.scss b/src/client/views/animationtimeline/Track.scss
index aec587a79..f45e0556d 100644
--- a/src/client/views/animationtimeline/Track.scss
+++ b/src/client/views/animationtimeline/Track.scss
@@ -1,4 +1,4 @@
-@import "./../globalCssVariables.scss";
+@import "./../global/globalCssVariables.scss";
.track-container {
@@ -6,8 +6,8 @@
.inner {
top: 0px;
width: calc(100%);
- background-color: $light-color;
- border: 1px solid $dark-color;
+ background-color: $white;
+ border: 1px solid $dark-gray;
position: relative;
z-index: 100;
}
diff --git a/src/client/views/collections/CollectionDockingView.scss b/src/client/views/collections/CollectionDockingView.scss
index f4736eb29..77e7b86ea 100644
--- a/src/client/views/collections/CollectionDockingView.scss
+++ b/src/client/views/collections/CollectionDockingView.scss
@@ -1,40 +1,46 @@
-@import "../../views/globalCssVariables.scss";
+@import "../global/globalCssVariables.scss";
.lm_title {
- margin-top: 3px;
- border-radius: 5px;
- border: solid 0px dimgray;
- border-width: 2px 2px 0px;
- height: 20px;
- transform: translate(0px, -3px);
+ -webkit-appearance: none;
+ display: inline-block;
+ align-self: center;
+ align-items: center;
+ height: 100%;
+ overflow: hidden;
+ text-overflow: ellipsis;
+ background: transparent;
+ border: solid 0px transparent;
cursor: grab;
+ color: $black;
}
.lm_title.focus-visible {
+ -webkit-appearance: none;
cursor: text;
}
.lm_title_wrap {
overflow: hidden;
- height: 19px;
- margin-top: -2px;
- display: inline-block;
+ align-items: center;
+ align-self: center;
+ background: transparent;
+ width: max-content;
+ height: 100%;
+ display: flex;
}
.lm_active .lm_title {
- border: solid 1px lightgray;
-}
-
-.lm_header .lm_tab .lm_close_tab {
- position: absolute;
- text-align: center;
+ -webkit-appearance: none;
+ // font-weight: 700;
}
.lm_header .lm_tab {
- padding-right: 20px;
- margin-top: -1px;
- border-bottom: 1px black;
+ padding: 0px;
+ opacity: 0.7;
+ box-shadow: none;
+ height: 24px;
+ // border-bottom: 1px black;
.collectionDockingView-gear {
display: none;
@@ -42,9 +48,13 @@
}
.lm_header .lm_tab.lm_active {
- padding-right: 20px;
- margin-top: 1px;
- border-bottom: unset;
+ padding: 0;
+ opacity: 1;
+ margin: 0;
+ box-shadow: none;
+ height: 27px;
+ margin-right: 2px;
+ // border-bottom: unset;
.collectionDockingView-gear {
display: inline-block;
@@ -55,6 +65,41 @@
display: inline;
}
+.lm_drag_tab {
+ padding: 0;
+ width: 15px !important;
+ height: 15px !important;
+ position: relative !important;
+ display: inline-flex !important;
+ align-items: center;
+ top: 0 !important;
+ right: unset !important;
+ left: 0 !important;
+}
+
+.lm_close_tab {
+ padding: 0;
+ align-self: center;
+ margin-right: 5px;
+ background-color: black;
+ border-radius: 3px;
+ opacity: 1 !important;
+ width: 15px !important;
+ height: 15px !important;
+ position: relative !important;
+ display: inline-flex !important;
+ align-items: center;
+ top: 0 !important;
+ right: unset !important;
+ left: 0 !important;
+}
+
+.lm_tab,
+.lm_tab_active {
+ display: flex !important;
+ padding-right: 0 !important;
+}
+
.collectiondockingview-container {
width: 100%;
height: 100%;
@@ -82,16 +127,17 @@
}
.lm_content {
- background: white;
+ background: $white;
}
.lm_controls>li {
- opacity: 0.6;
- transform: scale(1.2);
+ opacity: 1;
+ transform: scale(1);
}
.lm_controls .lm_popout {
- background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABUAAAAUCAAAAABHICnvAAAABGdBTUEAALGPC/xhBQAAACBjSFJNAAB6JgAAgIQAAPoAAACA6AAAdTAAAOpgAAA6mAAAF3CculE8AAAAAmJLR0QAAKqNIzIAAAAHdElNRQfkCBsXMgbrEyzaAAAAT0lEQVQY02NgIAcIu8tgEW3/u4IDQ5B14/8LQlhFhckVFfCJjIyIOfP/QWpEZGSQJFS05s9fIPj3/z+YmseCTxS7CZS7DI+PsYcOjpAkDAA6H0KZxzDzlgAAACV0RVh0ZGF0ZTpjcmVhdGUAMjAyMC0wOC0yN1QyMzo1MDowNi0wNDowMDvgVpQAAAAldEVYdGRhdGU6bW9kaWZ5ADIwMjAtMDgtMjdUMjM6NTA6MDYtMDQ6MDBKve4oAAAAAElFTkSuQmCC)
+ transform: rotate(45deg);
+ background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAkAAAAJCAYAAADgkQYQAAAAQUlEQVR4nHXOQQ4AMAgCQeT/f6aXpsGK3jSTuCVJAAr7iBdoAwCKd0nwfaAdHbYERw5b44+E8JoBjEYGMBq5gAYP3usUDu2IvoUAAAAASUVORK5CYII=);
}
.lm_maximised .lm_controls .lm_maximise {
@@ -110,7 +156,7 @@
}
.flexlayout__splitter {
- background-color: black;
+ background-color: $dark-gray;
}
.flexlayout__splitter:hover {
@@ -179,7 +225,7 @@
position: absolute;
box-sizing: border-box;
background-color: #222;
- color: black;
+ color: $dark-gray;
}
.flexlayout__tab_button {
@@ -268,7 +314,7 @@
}
.flexlayout__tab_header_outer {
- background-color: black;
+ background-color: $dark-gray;
position: absolute;
left: 0;
right: 0;
@@ -311,8 +357,6 @@
background: transparent url("../../../../node_modules/flexlayout-react/images/restore.png") no-repeat center;
}
- .flexlayout__popup_menu {}
-
.flexlayout__popup_menu_item {
padding: 2px 10px 2px 10px;
color: #ddd;
@@ -332,28 +376,28 @@
}
.flexlayout__border_top {
- background-color: black;
+ background-color: $dark-gray;
border-bottom: 1px solid #ddd;
box-sizing: border-box;
overflow: hidden;
}
.flexlayout__border_bottom {
- background-color: black;
+ background-color: $dark-gray;
border-top: 1px solid #333;
box-sizing: border-box;
overflow: hidden;
}
.flexlayout__border_left {
- background-color: black;
+ background-color: $dark-gray;
border-right: 1px solid #333;
box-sizing: border-box;
overflow: hidden;
}
.flexlayout__border_right {
- background-color: black;
+ background-color: $dark-gray;
border-left: 1px solid #333;
box-sizing: border-box;
overflow: hidden;
diff --git a/src/client/views/collections/CollectionDockingView.tsx b/src/client/views/collections/CollectionDockingView.tsx
index 388f9a909..c0d39b2a2 100644
--- a/src/client/views/collections/CollectionDockingView.tsx
+++ b/src/client/views/collections/CollectionDockingView.tsx
@@ -4,7 +4,7 @@ import { action, IReactionDisposer, observable, reaction, runInAction } from "mo
import { observer } from "mobx-react";
import * as ReactDOM from 'react-dom';
import * as GoldenLayout from "../../../client/goldenLayout";
-import { Doc, DocListCast, Opt, DocListCastAsync } from "../../../fields/Doc";
+import { Doc, DocListCast, Opt, DocListCastAsync, DataSym } from "../../../fields/Doc";
import { Id } from '../../../fields/FieldSymbols';
import { InkTool } from '../../../fields/InkField';
import { List } from '../../../fields/List';
@@ -24,6 +24,7 @@ import React = require("react");
import { DocumentType } from '../../documents/DocumentTypes';
import { listSpec } from '../../../fields/Schema';
import { LightboxView } from '../LightboxView';
+import { inheritParentAcls } from '../../../fields/util';
const _global = (window /* browser */ || global /* node */) as any;
@observer
@@ -160,6 +161,18 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
}
const instance = CollectionDockingView.Instance;
if (!instance) return false;
+ else {
+ const docList = DocListCast(instance.props.Document[DataSym]["data-all"]);
+ // adds the doc of the newly created tab to the data-all field if it doesn't already include that doc or one of its aliases
+ !docList.includes(document) && !docList.includes(document.aliasOf as Doc) && Doc.AddDocToList(instance.props.Document[DataSym], "data-all", document);
+ // adds an alias of the doc to the data-all field of the layoutdocs of the aliases
+ DocListCast(instance.props.Document[DataSym].aliases).forEach(alias => {
+ const aliasDocList = DocListCast(alias["data-all"]);
+ // if aliasDocList contains the alias, don't do anything
+ // otherwise add the original or an alias depending on whether the doc you're looking at is the current doc or a different alias
+ !DocListCast(document.aliases).some(a => aliasDocList.includes(a)) && Doc.AddDocToList(alias, "data-all", alias !== instance.props.Document ? Doc.MakeAlias(document) : document);
+ });
+ }
const docContentConfig = CollectionDockingView.makeDocumentConfig(document, panelName);
if (!pullSide && stack) {
@@ -381,15 +394,22 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
setTimeout(async () => {
const sublists = await DocListCastAsync(this.props.Document[this.props.fieldKey]);
const tabs = sublists && Cast(sublists[0], Doc, null);
- const other = sublists && Cast(sublists[1], Doc, null);
+ // const other = sublists && Cast(sublists[1], Doc, null);
const tabdocs = await DocListCastAsync(tabs?.data);
- const otherdocs = await DocListCastAsync(other?.data);
- tabs && (Doc.GetProto(tabs).data = new List<Doc>(docs));
- const otherSet = new Set<Doc>();
- otherdocs?.filter(doc => !docs.includes(doc)).forEach(doc => otherSet.add(doc));
- tabdocs?.filter(doc => !docs.includes(doc) && doc.type !== DocumentType.KVP).forEach(doc => otherSet.add(doc));
- const vals = Array.from(otherSet.values()).filter(val => val instanceof Doc).map(d => d).filter(d => d.type !== DocumentType.KVP);
- other && (Doc.GetProto(other).data = new List<Doc>(vals));
+ // const otherdocs = await DocListCastAsync(other?.data);
+ if (tabs) {
+ tabs.data = new List<Doc>(docs);
+ // DocListCast(tabs.aliases).forEach(tab => tab !== tabs && (tab.data = new List<Doc>(docs)));
+ }
+ // const otherSet = new Set<Doc>();
+ // otherdocs?.filter(doc => !docs.includes(doc)).forEach(doc => otherSet.add(doc));
+ // tabdocs?.filter(doc => !docs.includes(doc) && doc.type !== DocumentType.KVP).forEach(doc => otherSet.add(doc));
+ // const vals = Array.from(otherSet.values()).filter(val => val instanceof Doc).map(d => d).filter(d => d.type !== DocumentType.KVP);
+ // this.props.Document[DataSym][this.props.fieldKey + "-all"] = new List<Doc>([...docs, ...vals]);
+ // if (other) {
+ // other.data = new List<Doc>(vals);
+ // // DocListCast(other.aliases).forEach(tab => tab !== other && (tab.data = new List<Doc>(vals)));
+ // }
}, 0);
}
@@ -399,7 +419,7 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
tab.reactComponents?.forEach((ele: any) => ReactDOM.unmountComponentAtNode(ele));
}
tabCreated = (tab: any) => {
- tab.contentItem.element[0]?.firstChild?.firstChild?.InitTab?.(tab); // have to explicitly initialize tabs that reuse contents from previous abs (ie, when dragging a tab around a new tab is created for the old content)
+ tab.contentItem.element[0]?.firstChild?.firstChild?.InitTab?.(tab); // have to explicitly initialize tabs that reuse contents from previous tabs (ie, when dragging a tab around a new tab is created for the old content)
}
stackCreated = (stack: any) => {
@@ -407,9 +427,11 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
if (e.target === stack.header?.element[0] && e.button === 2) {
const emptyPane = CurrentUserUtils.EmptyPane;
emptyPane["dragFactory-count"] = NumCast(emptyPane["dragFactory-count"]) + 1;
- CollectionDockingView.AddSplit(Docs.Create.FreeformDocument([], {
- _width: this.props.PanelWidth(), _height: this.props.PanelHeight(), _fitWidth: true, title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`
- }), "", stack);
+ const docToAdd = Docs.Create.FreeformDocument([], {
+ _width: this.props.PanelWidth(), _height: this.props.PanelHeight(), _fitWidth: true, title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`,
+ });
+ this.props.Document.isShared && inheritParentAcls(this.props.Document, docToAdd);
+ CollectionDockingView.AddSplit(docToAdd, "", stack);
}
});
@@ -430,9 +452,11 @@ export class CollectionDockingView extends CollectionSubView(doc => doc) {
// stack.config.fixed = !stack.config.fixed; // force the stack to have a fixed size
const emptyPane = CurrentUserUtils.EmptyPane;
emptyPane["dragFactory-count"] = NumCast(emptyPane["dragFactory-count"]) + 1;
- CollectionDockingView.AddSplit(Docs.Create.FreeformDocument([], {
+ const docToAdd = Docs.Create.FreeformDocument([], {
_width: this.props.PanelWidth(), _height: this.props.PanelHeight(), _fitWidth: true, title: `Untitled Tab ${NumCast(emptyPane["dragFactory-count"])}`
- }), "", stack);
+ });
+ this.props.Document.isShared && inheritParentAcls(this.props.Document, docToAdd);
+ CollectionDockingView.AddSplit(docToAdd, "", stack);
}));
}
@@ -445,4 +469,4 @@ Scripting.addGlobal(function openInLightbox(doc: any) { LightboxView.AddDocTab(d
"opens up document in a lightbox", "(doc: any)");
Scripting.addGlobal(function openOnRight(doc: any) { return CollectionDockingView.AddSplit(doc, "right"); },
"opens up document in tab on right side of the screen", "(doc: any)");
-Scripting.addGlobal(function useRightSplit(doc: any, shiftKey?: boolean) { CollectionDockingView.ReplaceTab(doc, "right", undefined, shiftKey); });
+Scripting.addGlobal(function useRightSplit(doc: any, shiftKey?: boolean) { CollectionDockingView.ReplaceTab(doc, "right", undefined, shiftKey); }); \ No newline at end of file
diff --git a/src/client/views/collections/CollectionLinearView.scss b/src/client/views/collections/CollectionLinearView.scss
index ca72b98a5..46e40489b 100644
--- a/src/client/views/collections/CollectionLinearView.scss
+++ b/src/client/views/collections/CollectionLinearView.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
@import "../_nodeModuleOverrides";
.collectionLinearView-outer {
@@ -12,59 +12,65 @@
align-items: center;
>span {
- background: $dark-color;
- color: $light-color;
+ background: $dark-gray;
+ color: $white;
border-radius: 18px;
margin-right: 6px;
cursor: pointer;
}
.bottomPopup-background {
- padding-right: 14px;
+ background: $medium-blue;
+ display: flex;
+ border-radius: 10px;
height: 35;
- transform: translate3d(6px, 5px, 0px);
- padding-top: 6.5px;
- padding-bottom: 7px;
- padding-left: 5px;
+ transform: translate3d(6px, 0px, 0px);
+ align-content: center;
+ justify-content: center;
+ align-items: center;
}
.bottomPopup-text {
+ color: $white;
display: inline;
white-space: nowrap;
padding-left: 8px;
- padding-right: 4px;
+ padding-right: 20px;
vertical-align: middle;
font-size: 12.5px;
}
.bottomPopup-descriptions {
+ cursor:pointer;
display: inline;
white-space: nowrap;
padding-left: 8px;
padding-right: 8px;
vertical-align: middle;
- background-color: lightgrey;
- border-radius: 5.5px;
+ background-color: $light-gray;
+ border-radius: 3px;
color: black;
margin-right: 5px;
}
.bottomPopup-exit {
+ cursor:pointer;
display: inline;
white-space: nowrap;
+ margin-right: 10px;
padding-left: 8px;
padding-right: 8px;
vertical-align: middle;
- background-color: lightgrey;
- border-radius: 5.5px;
+ background-color: $close-red;
+ border-radius: 3px;
color: black;
}
>label {
margin-top: "auto";
margin-bottom: "auto";
- background: $dark-color;
- color: $light-color;
+ background: $dark-gray;
+ color: $white;
display: inline-block;
border-radius: 18px;
font-size: 12.5px;
@@ -82,7 +88,7 @@
}
label:hover {
- background: $main-accent;
+ background: $medium-gray;
transform: scale(1.15);
}
diff --git a/src/client/views/collections/CollectionLinearView.tsx b/src/client/views/collections/CollectionLinearView.tsx
index e0b90304b..52c836556 100644
--- a/src/client/views/collections/CollectionLinearView.tsx
+++ b/src/client/views/collections/CollectionLinearView.tsx
@@ -167,24 +167,22 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) {
})}
</div>
{DocumentLinksButton.StartLink ? <span className="bottomPopup-background" style={{
- background: backgroundColor === color ? "black" : backgroundColor,
pointerEvents: "all"
}}
onPointerDown={e => e.stopPropagation()} >
<span className="bottomPopup-text" >
- Creating link from: {DocumentLinksButton.AnnotationId ? "Annotation in " : " "} {StrCast(DocumentLinksButton.StartLink.title).length < 51 ? DocumentLinksButton.StartLink.title : StrCast(DocumentLinksButton.StartLink.title).slice(0, 50) + '...'}
+ Creating link from: <b>{DocumentLinksButton.AnnotationId ? "Annotation in " : " "} {StrCast(DocumentLinksButton.StartLink.title).length < 51 ? DocumentLinksButton.StartLink.title : StrCast(DocumentLinksButton.StartLink.title).slice(0, 50) + '...'}</b>
</span>
- <Tooltip title={<><div className="dash-tooltip">{LinkDescriptionPopup.showDescriptions ? "Turn off description pop-up" :
- "Turn on description pop-up"} </div></>} placement="top">
+ <Tooltip title={<><div className="dash-tooltip">{"Toggle description pop-up"} </div></>} placement="top">
<span className="bottomPopup-descriptions" onClick={this.changeDescriptionSetting}>
Labels: {LinkDescriptionPopup.showDescriptions ? LinkDescriptionPopup.showDescriptions : "ON"}
</span>
</Tooltip>
- <Tooltip title={<><div className="dash-tooltip">Exit link clicking mode </div></>} placement="top">
+ <Tooltip title={<><div className="dash-tooltip">Exit linking mode</div></>} placement="top">
<span className="bottomPopup-exit" onClick={this.exitLongLinks}>
- Clear
+ Stop
</span>
</Tooltip>
diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss
index dc5231a3a..f04b19ef7 100644
--- a/src/client/views/collections/CollectionMenu.scss
+++ b/src/client/views/collections/CollectionMenu.scss
@@ -1,5 +1,4 @@
-@import "../globalCssVariables";
-
+@import "../global/globalCssVariables";
.collectionMenu-cont {
position: relative;
@@ -8,8 +7,8 @@
opacity: 0.9;
z-index: 901;
transition: top .5s;
- background: #323232;
- color: white;
+ background: $dark-gray;
+ color: $white;
transform-origin: top left;
top: 0;
width: 100%;
@@ -18,7 +17,7 @@
border-radius: 100%;
width: 18px;
height: 18px;
- border: solid 1px #f5f5f5;
+ border: solid 1px $white;
display: flex;
align-items: center;
justify-content: center;
@@ -28,7 +27,7 @@
border-radius: 100%;
width: 70%;
height: 70%;
- background: white;
+ background: $white;
}
.collectionMenu {
@@ -39,11 +38,11 @@
border: unset;
.collectionMenu-divider {
- height: 85%;
+ height: 100%;
margin-left: 3px;
margin-right: 3px;
- width: 1.5px;
- background-color: #656060;
+ width: 2px;
+ background-color: $medium-gray;
}
.collectionViewBaseChrome {
@@ -51,11 +50,11 @@
align-items: center;
.collectionViewBaseChrome-viewPicker {
- font-size: 75%;
- outline-color: black;
- color: white;
+ font-size: $small-text;
+ outline-color: $black;
+ color: $white;
border: none;
- background: #323232;
+ background: $dark-gray;
}
.collectionViewBaseChrome-viewPicker:focus {
@@ -64,16 +63,16 @@
}
.collectionViewBaseChrome-viewPicker:active {
- outline-color: black;
+ outline-color: $black;
}
.collectionViewBaseChrome-button {
- font-size: 75%;
+ font-size: $small-text;
text-transform: uppercase;
letter-spacing: 2px;
- background: rgb(238, 238, 238);
- color: purple;
- outline-color: black;
+ background: $white;
+ color: $pink;
+ outline-color: $black;
border: none;
padding: 12px 10px 11px 10px;
margin-left: 10px;
@@ -82,11 +81,11 @@
.collectionViewBaseChrome-cmdPicker {
margin-left: 3px;
margin-right: 0px;
- font-size: 75%;
+ font-size: $small-text;
text-transform: capitalize;
- color: white;
+ color: $white;
border: none;
- background: #323232;
+ background: $dark-gray;
}
.collectionViewBaseChrome-cmdPicker:focus {
@@ -105,7 +104,7 @@
overflow: hidden;
.commandEntry-drop {
- color: white;
+ color: $white;
width: 30px;
margin-top: auto;
margin-bottom: auto;
@@ -113,11 +112,11 @@
}
.commandEntry-outerDiv:hover{
- background-color: rgba(0,0,0,0.2);
+ background-color: $drop-shadow;
.collectionViewBaseChrome-viewPicker,
.collectionViewBaseChrome-cmdPicker{
- background: rgb(41,41,41);
+ background: $dark-gray;
}
}
@@ -142,7 +141,7 @@
height: 100%;
display: flex;
background: transparent;
- color: grey;
+ color: $medium-gray;
justify-content: center;
}
@@ -150,31 +149,31 @@
margin-left: 5px;
display: grid;
border: none;
- border-right: solid gray 1px;
+ border-right: solid $medium-gray 1px;
.collectionViewBaseChrome-filterIcon {
position: relative;
display: flex;
margin: auto;
- background: #323232;
- color: white;
+ background: $dark-gray;
+ color: $white;
width: 30px;
height: 30px;
align-items: center;
justify-content: center;
border: none;
- border-right: solid gray 1px;
+ border-right: solid $medium-gray 1px;
}
.collectionViewBaseChrome-viewSpecsInput {
padding: 12px 10px 11px 10px;
border: 0px;
- color: grey;
+ color: $medium-gray;
text-align: center;
letter-spacing: 2px;
- outline-color: black;
- font-size: 75%;
- background: rgb(238, 238, 238);
+ outline-color: $black;
+ font-size: $small-text;
+ background: $white;
height: 100%;
width: 75px;
}
@@ -187,8 +186,8 @@
z-index: 100;
display: flex;
flex-direction: column;
- background: rgb(238, 238, 238);
- box-shadow: grey 2px 2px 4px;
+ background: $white;
+ box-shadow: $medium-gray 2px 2px 4px;
.qs-datepicker {
left: unset;
@@ -204,13 +203,13 @@
.collectionViewBaseChrome-viewSpecsMenu-rowLeft,
.collectionViewBaseChrome-viewSpecsMenu-rowMiddle,
.collectionViewBaseChrome-viewSpecsMenu-rowRight {
- font-size: 75%;
+ font-size: $small-text;
letter-spacing: 2px;
- color: grey;
+ color: $medium-gray;
margin-left: 10px;
padding: 5px;
border: none;
- outline-color: black;
+ outline-color: $black;
}
}
@@ -236,19 +235,19 @@
margin-left: 10;
.collectionGridViewChrome-viewPicker {
- font-size: 75%;
+ font-size: $small-text;
//text-transform: uppercase;
//letter-spacing: 2px;
- background: #121721;
- color: white;
- outline-color: black;
- color: white;
+ background: $dark-gray;
+ color: $white;
+ outline-color: $black;
+ color: $white;
border: none;
- border-right: solid gray 1px;
+ border-right: solid $medium-gray 1px;
}
.collectionGridViewChrome-viewPicker:active {
- outline-color: black;
+ outline-color: $black;
}
.grid-control {
@@ -268,11 +267,11 @@
.collectionGridViewChrome-entryBox {
width: 50%;
- color: black;
+ color: $black;
}
.collectionGridViewChrome-columnButton {
- color: black;
+ color: $black;
}
}
}
@@ -302,7 +301,7 @@
align-items: center;
display: flex;
grid-auto-columns: auto;
- font-size: 75%;
+ font-size: $small-text;
letter-spacing: 2px;
.collectionStackingViewChrome-pivotField-label,
@@ -311,7 +310,7 @@
grid-column: 1;
margin-right: 7px;
user-select: none;
- font-family: 'Roboto';
+ font-family: $sans-serif;
letter-spacing: normal;
}
@@ -329,13 +328,13 @@
}
.collectionStackingViewChrome-sortIcon:hover {
- background-color: rgba(0,0,0,0.2);
+ background-color: $drop-shadow;
}
.collectionStackingViewChrome-pivotField,
.collectionTreeViewChrome-pivotField,
.collection3DCarouselViewChrome-scrollSpeed {
- color: white;
+ color: $white;
grid-column: 2;
grid-row: 1;
width: 90%;
@@ -344,7 +343,7 @@
height: 80%;
border-radius: 7px;
align-items: center;
- background: #eeeeee;
+ background: $white;
.editable-view-input,
input,
@@ -352,16 +351,16 @@
.editableView-container-editing {
margin: auto;
border: 0px;
- color: grey !important;
+ color: $light-gray !important;
text-align: center;
letter-spacing: 2px;
- outline-color: black;
+ outline-color: $black;
height: 100%;
}
.react-autosuggest__container {
margin: 0;
- color: grey;
+ color: $medium-gray;
padding: 0px;
}
}
@@ -407,11 +406,11 @@
}
.switchToText {
- color: $main-accent;
+ color: $medium-gray;
}
.switchToText:hover {
- color: $dark-color;
+ color: $dark-gray;
}
}
@@ -424,11 +423,11 @@
.collectionMenu-urlInput {
padding: 12px 10px 11px 10px;
border: 0px;
- color: black;
- font-size: 10px;
+ color: $black;
+ font-size: $small-text;
letter-spacing: 2px;
- outline-color: black;
- background: rgb(238, 238, 238);
+ outline-color: $black;
+ background: $white;
width: 100%;
min-width: 350px;
margin-right: 10px;
@@ -477,10 +476,10 @@
width: 20;
height: 30;
bottom: 0;
- background: #323232;
+ background: $dark-gray;
display: inline-flex;
align-items: center;
- color: white;
+ color: $white;
}
.backKeyframe {
@@ -502,13 +501,13 @@
margin: auto;
}
- border-right: solid gray 1px;
+ border-right: solid $medium-gray 1px;
}
}
.collectionSchemaViewChrome-cont {
display: flex;
- font-size: 10.5px;
+ font-size: $small-text;
.collectionSchemaViewChrome-toggle {
display: flex;
@@ -527,19 +526,19 @@
.collectionSchemaViewChrome-toggler {
width: 100px;
height: 35px;
- background-color: black;
+ background-color: $black;
position: relative;
}
.collectionSchemaViewChrome-togglerButton {
width: 47px;
height: 30px;
- background-color: $light-color-secondary;
+ background-color: $light-gray;
// position: absolute;
transition: all 0.5s ease;
// top: 3px;
margin-top: 3px;
- color: gray;
+ color: $medium-gray;
letter-spacing: 2px;
text-transform: uppercase;
display: flex;
@@ -579,7 +578,7 @@
}
.react-autosuggest__input {
- border: 1px solid #aaa;
+ border: 1px solid $light-gray;
border-radius: 4px;
width: 100%;
}
@@ -603,11 +602,11 @@
overflow-y: auto;
max-height: 400px;
width: 180px;
- border: 1px solid #aaa;
- background-color: #fff;
- font-family: Helvetica, sans-serif;
+ border: 1px solid $light-gray;
+ background-color: $white;
+ font-family: $sans-serif;
font-weight: 300;
- font-size: 16px;
+ font-size: $large-header;
border-bottom-left-radius: 4px;
border-bottom-right-radius: 4px;
z-index: 2;
@@ -625,5 +624,5 @@
}
.react-autosuggest__suggestion--highlighted {
- background-color: #ddd;
+ background-color: $light-gray;
} \ No newline at end of file
diff --git a/src/client/views/collections/CollectionMenu.tsx b/src/client/views/collections/CollectionMenu.tsx
index 6e6fabd0d..8f4df4a92 100644
--- a/src/client/views/collections/CollectionMenu.tsx
+++ b/src/client/views/collections/CollectionMenu.tsx
@@ -29,7 +29,7 @@ import { ActiveFillColor, ActiveInkColor, SetActiveArrowEnd, SetActiveArrowStart
import { CollectionFreeFormDocumentView } from "../nodes/CollectionFreeFormDocumentView";
import { DocumentView } from "../nodes/DocumentView";
import { RichTextMenu } from "../nodes/formattedText/RichTextMenu";
-import { PresBox } from "../nodes/PresBox";
+import { PresBox } from "../nodes/trails/PresBox";
import "./CollectionMenu.scss";
import { CollectionViewType, COLLECTION_BORDER_WIDTH } from "./CollectionView";
import { TabDocView } from "./TabDocView";
@@ -665,7 +665,7 @@ export class CollectionFreeFormViewChrome extends React.Component<CollectionMenu
}
@computed get drawButtons() {
- const func = action((i: number, keep: boolean) => {
+ const func = action((e: React.MouseEvent | React.PointerEvent, i: number, keep: boolean) => {
this._keepPrimitiveMode = keep;
if (this._selectedPrimitive !== i) {
this._selectedPrimitive = i;
@@ -683,13 +683,14 @@ export class CollectionFreeFormViewChrome extends React.Component<CollectionMenu
GestureOverlay.Instance.InkShape = "";
SetActiveBezierApprox("0");
}
+ e.stopPropagation();
});
return <div className="btn-draw" key="draw">
{this._draw.map((icon, i) =>
<Tooltip key={icon} title={<div className="dash-tooltip">{this._title[i]}</div>} placement="bottom">
<button className="antimodeMenu-button"
- onPointerDown={() => func(i, false)}
- onDoubleClick={() => func(i, true)}
+ onPointerDown={e => func(e, i, false)}
+ onDoubleClick={e => func(e, i, true)}
style={{ backgroundColor: i === this._selectedPrimitive ? "525252" : "", fontSize: "20" }}>
<FontAwesomeIcon icon={this._faName[i] as IconProp} size="sm" />
</button>
diff --git a/src/client/views/collections/CollectionPileView.tsx b/src/client/views/collections/CollectionPileView.tsx
index 6baf633dd..bc1407c53 100644
--- a/src/client/views/collections/CollectionPileView.tsx
+++ b/src/client/views/collections/CollectionPileView.tsx
@@ -1,12 +1,12 @@
-import { action, computed } from "mobx";
+import { action, computed, IReactionDisposer, reaction } from "mobx";
import { observer } from "mobx-react";
import { Doc, HeightSym, WidthSym } from "../../../fields/Doc";
import { NumCast, StrCast } from "../../../fields/Types";
-import { emptyFunction, setupMoveUpEvents, returnTrue } from "../../../Utils";
+import { emptyFunction, returnTrue, setupMoveUpEvents } from "../../../Utils";
import { DocUtils } from "../../documents/Documents";
import { SelectionManager } from "../../util/SelectionManager";
import { SnappingManager } from "../../util/SnappingManager";
-import { UndoManager, undoBatch } from "../../util/UndoManager";
+import { undoBatch, UndoManager } from "../../util/UndoManager";
import { CollectionFreeFormView } from "./collectionFreeForm/CollectionFreeFormView";
import "./CollectionPileView.scss";
import { CollectionSubView } from "./CollectionSubView";
@@ -15,6 +15,7 @@ import React = require("react");
@observer
export class CollectionPileView extends CollectionSubView(doc => doc) {
_originalChrome: any = "";
+ _disposers: { [name: string]: IReactionDisposer } = {};
componentDidMount() {
if (this.layoutEngine() !== "pass" && this.layoutEngine() !== "starburst") {
@@ -22,9 +23,14 @@ export class CollectionPileView extends CollectionSubView(doc => doc) {
}
this._originalChrome = this.layoutDoc._chromeHidden;
this.layoutDoc._chromeHidden = true;
+
+ // pileups are designed to go away when they are empty.
+ this._disposers.selected = reaction(() => this.childDocs.length,
+ (num) => !num && this.props.ContainingCollectionView?.removeDocument(this.props.Document));
}
componentWillUnmount() {
this.layoutDoc._chromeHidden = this._originalChrome;
+ Object.values(this._disposers).forEach(disposer => disposer?.());
}
layoutEngine = () => StrCast(this.Document._pileLayoutEngine);
@@ -107,9 +113,6 @@ export class CollectionPileView extends CollectionSubView(doc => doc) {
this._undoBatch?.end();
this._undoBatch = undefined;
SnappingManager.SetIsDragging(false);
- if (!this.childDocs.length) {
- this.props.ContainingCollectionView?.removeDocument(this.props.Document);
- }
}, emptyFunction, e.shiftKey && this.layoutEngine() === "pass", this.layoutEngine() === "pass" && e.shiftKey); // this sets _doubleTap
}
diff --git a/src/client/views/collections/CollectionSchemaView.tsx b/src/client/views/collections/CollectionSchemaView.tsx
index 971dd5cbf..1efea96be 100644
--- a/src/client/views/collections/CollectionSchemaView.tsx
+++ b/src/client/views/collections/CollectionSchemaView.tsx
@@ -11,12 +11,13 @@ import { listSpec } from "../../../fields/Schema";
import { PastelSchemaPalette, SchemaHeaderField } from "../../../fields/SchemaHeaderField";
import { Cast, NumCast } from "../../../fields/Types";
import { TraceMobx } from "../../../fields/util";
-import { emptyFunction, emptyPath, returnFalse, setupMoveUpEvents, returnEmptyDoclist, returnTrue } from "../../../Utils";
+import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents } from "../../../Utils";
+import { DocUtils } from "../../documents/Documents";
import { SelectionManager } from "../../util/SelectionManager";
import { SnappingManager } from "../../util/SnappingManager";
import { Transform } from "../../util/Transform";
import { undoBatch } from "../../util/UndoManager";
-import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/globalCssVariables.scss';
+import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/global/globalCssVariables.scss';
import { ContextMenu } from "../ContextMenu";
import { ContextMenuProps } from "../ContextMenuItem";
import '../DocumentDecorations.scss';
@@ -24,8 +25,7 @@ import { DocumentView } from "../nodes/DocumentView";
import { DefaultStyleProvider } from "../StyleProvider";
import "./CollectionSchemaView.scss";
import { CollectionSubView } from "./CollectionSubView";
-import { SchemaTable } from "./SchemaTable";
-import { DocUtils } from "../../documents/Documents";
+import { SchemaTable } from "../collections/collectionSchema/SchemaTable";
// bcz: need to add drag and drop of rows and columns. This seems like it might work for rows: https://codesandbox.io/s/l94mn1q657
export enum ColumnType {
@@ -147,43 +147,43 @@ export class CollectionSchemaView extends CollectionSubView(doc => doc) {
const anyType = <div className={"columnMenu-option" + (type === ColumnType.Any ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Any)}>
<FontAwesomeIcon icon={"align-justify"} size="sm" />
- Any
- </div>;
+ Any
+ </div>;
const numType = <div className={"columnMenu-option" + (type === ColumnType.Number ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Number)}>
<FontAwesomeIcon icon={"hashtag"} size="sm" />
- Number
- </div>;
+ Number
+ </div>;
const textType = <div className={"columnMenu-option" + (type === ColumnType.String ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.String)}>
<FontAwesomeIcon icon={"font"} size="sm" />
Text
- </div>;
+ </div>;
const boolType = <div className={"columnMenu-option" + (type === ColumnType.Boolean ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Boolean)}>
<FontAwesomeIcon icon={"check-square"} size="sm" />
Checkbox
- </div>;
+ </div>;
const listType = <div className={"columnMenu-option" + (type === ColumnType.List ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.List)}>
<FontAwesomeIcon icon={"list-ul"} size="sm" />
List
- </div>;
+ </div>;
const docType = <div className={"columnMenu-option" + (type === ColumnType.Doc ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Doc)}>
<FontAwesomeIcon icon={"file"} size="sm" />
Document
- </div>;
+ </div>;
const imageType = <div className={"columnMenu-option" + (type === ColumnType.Image ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Image)}>
<FontAwesomeIcon icon={"image"} size="sm" />
Image
- </div>;
+ </div>;
const dateType = <div className={"columnMenu-option" + (type === ColumnType.Date ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Date)}>
<FontAwesomeIcon icon={"calendar"} size="sm" />
- Date
- </div>;
+ Date
+ </div>;
const allColumnTypes = <div className="columnMenu-types">
@@ -413,8 +413,8 @@ export class CollectionSchemaView extends CollectionSubView(doc => doc) {
isContentActive={returnTrue}
isDocumentActive={returnFalse}
ScreenToLocalTransform={this.getPreviewTransform}
- docFilters={this.docFilters}
- docRangeFilters={this.docRangeFilters}
+ docFilters={this.childDocFilters}
+ docRangeFilters={this.childDocRangeFilters}
searchFilterDocs={this.searchFilterDocs}
styleProvider={DefaultStyleProvider}
layerProvider={undefined}
diff --git a/src/client/views/collections/CollectionStackingView.scss b/src/client/views/collections/CollectionStackingView.scss
index 9f56a0c0e..4b123c8b6 100644
--- a/src/client/views/collections/CollectionStackingView.scss
+++ b/src/client/views/collections/CollectionStackingView.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.collectionMasonryView {
display: inline;
@@ -96,8 +96,8 @@
height: 2vw;
width: 100%;
font-family: $sans-serif;
- background: $dark-color;
- color: $light-color;
+ background: $dark-gray;
+ color: $white;
}
.collectionStackingView-columnDragger {
@@ -128,7 +128,7 @@
margin-left: 2px;
margin-right: 2px;
margin-top: 2px;
- background: $main-accent;
+ background: $medium-gray;
height: 5px;
&.active {
@@ -180,11 +180,11 @@
.collectionStackingView-sectionHeader {
text-align: center;
margin: auto;
- background: $main-accent;
+ background: $medium-gray;
// overflow: hidden; overflow is visible so the color menu isn't hidden -ftong
.editableView-input {
- color: black;
+ color: $dark-gray;
}
.editableView-input:hover,
@@ -205,7 +205,7 @@
display: flex;
align-items: center;
justify-content: center;
- color: black;
+ color: $dark-gray;
.editableView-container-editing-oneLine,
.editableView-container-editing {
diff --git a/src/client/views/collections/CollectionStackingView.tsx b/src/client/views/collections/CollectionStackingView.tsx
index 30f8e0112..b9bc83d49 100644
--- a/src/client/views/collections/CollectionStackingView.tsx
+++ b/src/client/views/collections/CollectionStackingView.tsx
@@ -239,10 +239,10 @@ export class CollectionStackingView extends CollectionSubView<StackingDocument,
onDoubleClick={this.onChildDoubleClickHandler}
ScreenToLocalTransform={stackedDocTransform}
focus={this.focusDocument}
- docFilters={this.docFilters}
+ docFilters={this.childDocFilters}
hideDecorationTitle={this.props.childHideDecorationTitle?.()}
hideTitle={this.props.childHideTitle?.()}
- docRangeFilters={this.docRangeFilters}
+ docRangeFilters={this.childDocRangeFilters}
searchFilterDocs={this.searchFilterDocs}
ContainingCollectionDoc={this.props.CollectionView?.props.Document}
ContainingCollectionView={this.props.CollectionView}
@@ -480,7 +480,7 @@ export class CollectionStackingView extends CollectionSubView<StackingDocument,
if (value && this.columnHeaders) {
const schemaHdrField = new SchemaHeaderField(value);
this.columnHeaders.push(schemaHdrField);
- DocUtils.addFieldEnumerations(undefined, this.pivotField, [{ title: value, _backgroundColor: schemaHdrField.color }]);
+ DocUtils.addFieldEnumerations(undefined, this.pivotField, [{ title: value, _backgroundColor: "schemaHdrField.color" }]);
return true;
}
return false;
diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx
index 8d549bd56..a9b5ce465 100644
--- a/src/client/views/collections/CollectionSubView.tsx
+++ b/src/client/views/collections/CollectionSubView.tsx
@@ -8,7 +8,7 @@ import { ScriptField } from "../../../fields/ScriptField";
import { WebField } from "../../../fields/URLField";
import { Cast, ScriptCast, NumCast, StrCast } from "../../../fields/Types";
import { GestureUtils } from "../../../pen-gestures/GestureUtils";
-import { Utils, returnFalse } from "../../../Utils";
+import { Utils, returnFalse, returnEmptyFilter } from "../../../Utils";
import { DocServer } from "../../DocServer";
import { Networking } from "../../Network";
import { ImageUtils } from "../../util/Import & Export/ImageUtils";
@@ -22,6 +22,7 @@ import ReactLoading from 'react-loading';
export interface SubCollectionViewProps extends CollectionViewProps {
CollectionView: Opt<CollectionView>;
+ SetSubView?: (subView: any) => void;
}
export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?: X) {
@@ -30,6 +31,8 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
private gestureDisposer?: GestureUtils.GestureEventDisposer;
protected _multiTouchDisposer?: InteractionUtils.MultiTouchEventDisposer;
protected _mainCont?: HTMLDivElement;
+ @observable _focusFilters: Opt<string[]>; // docFilters that are overridden when previewing a link to an anchor which has docFilters set on it
+ @observable _focusRangeFilters: Opt<string[]>; // docRangeFilters that are overridden when previewing a link to an anchor which has docRangeFilters set on it
protected createDashEventsTarget = (ele: HTMLDivElement) => { //used for stacking and masonry view
this.dropDisposer?.();
this.gestureDisposer?.();
@@ -45,6 +48,10 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
this.createDashEventsTarget(ele);
}
+ componentDidMount() {
+ this.props.SetSubView?.(this);
+ }
+
componentWillUnmount() {
this.gestureDisposer?.();
this._multiTouchDisposer?.();
@@ -81,15 +88,13 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
get childDocList() {
return Cast(this.dataField, listSpec(Doc));
}
- docFilters = () => {
- return [...this.props.docFilters(), ...Cast(this.props.Document._docFilters, listSpec("string"), [])];
- }
- docRangeFilters = () => {
- return [...this.props.docRangeFilters(), ...Cast(this.props.Document._docRangeFilters, listSpec("string"), [])];
- }
- searchFilterDocs = () => {
- return [...this.props.searchFilterDocs(), ...DocListCast(this.props.Document._searchFilterDocs)];
- }
+ collectionFilters = () => this._focusFilters ?? Cast(this.props.Document._docFilters, listSpec("string"), []);
+ collectionRangeDocFilters = () => this._focusRangeFilters ?? Cast(this.props.Document._docRangeFilters, listSpec("string"), []);
+ childDocFilters = () => [...this.props.docFilters(), ...this.collectionFilters()];
+ childDocRangeFilters = () => [...(this.props.docRangeFilters?.() || []), ...this.collectionRangeDocFilters()];
+ IsFiltered = () => this.collectionFilters().length || this.collectionRangeDocFilters().length ? "hasFilter" :
+ this.props.docFilters().length || this.props.docRangeFilters().length ? "inheritsFilter" : undefined;
+ searchFilterDocs = () => this.props.searchFilterDocs?.() ?? DocListCast(this.props.Document._searchFilterDocs);
@computed.struct get childDocs() {
TraceMobx();
let rawdocs: (Doc | Promise<Doc>)[] = [];
@@ -108,8 +113,8 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
const viewSpecScript = Cast(this.props.Document.viewSpecScript, ScriptField);
const childDocs = viewSpecScript ? docs.filter(d => viewSpecScript.script.run({ doc: d }, console.log).result) : docs;
- const docFilters = this.docFilters();
- const docRangeFilters = this.docRangeFilters();
+ const docFilters = this.childDocFilters();
+ const docRangeFilters = this.childDocRangeFilters();
const searchDocs = this.searchFilterDocs();
if (this.props.Document.dontRegisterView || (!docFilters.length && !docRangeFilters.length && !searchDocs.length)) {
return childDocs.filter(cd => !cd.cookies); // remove any documents that require a cookie if there are no filters to provide one
@@ -241,7 +246,7 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
@undoBatch
@action
- protected async onExternalDrop(e: React.DragEvent, options: DocumentOptions, completed?: () => void) {
+ protected async onExternalDrop(e: React.DragEvent, options: DocumentOptions, completed?: (docs: Doc[]) => void) {
if (e.ctrlKey) {
e.stopPropagation(); // bcz: this is a hack to stop propagation when dropping an image on a text document with shift+ctrl
return;
@@ -303,7 +308,7 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
} else {
const path = window.location.origin + "/doc/";
if (text.startsWith(path)) {
- const docid = text.replace(Utils.prepend("/doc/"), "").split("?")[0];
+ const docid = text.replace(Doc.globalServerPath(), "").split("?")[0];
DocServer.GetRefField(docid).then(f => {
if (f instanceof Doc) {
if (options.x || options.y) { f.x = options.x; f.y = options.y; } // should be in CollectionFreeFormView
@@ -439,7 +444,7 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
}
this.slowLoadDocuments(files, options, generatedDocuments, text, completed, e.clientX, e.clientY, addDocument).then(batch.end);
}
- slowLoadDocuments = async (files: (File[] | string), options: DocumentOptions, generatedDocuments: Doc[], text: string, completed: (() => void) | undefined, clientX: number, clientY: number, addDocument: (doc: Doc | Doc[]) => boolean) => {
+ slowLoadDocuments = async (files: (File[] | string), options: DocumentOptions, generatedDocuments: Doc[], text: string, completed: ((doc: Doc[]) => void) | undefined, clientX: number, clientY: number, addDocument: (doc: Doc | Doc[]) => boolean) => {
const disposer = OverlayView.Instance.addElement(
<ReactLoading type={"spinningBubbles"} color={"green"} height={250} width={250} />, { x: clientX - 125, y: clientY - 125 });
if (typeof files === "string") {
@@ -448,13 +453,17 @@ export function CollectionSubView<T, X>(schemaCtor: (doc: Doc) => T, moreProps?:
generatedDocuments.push(...await DocUtils.uploadFilesToDocs(files, options));
}
if (generatedDocuments.length) {
- const set = generatedDocuments.length > 1 && generatedDocuments.map(d => DocUtils.iconify(d));
- if (set) {
- addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!)!);
- } else {
- generatedDocuments.forEach(addDocument);
+ const isFreeformView = this.props.Document._viewType === CollectionViewType.Freeform;
+ const set = !isFreeformView ? generatedDocuments :
+ generatedDocuments.length > 1 ? generatedDocuments.map(d => { DocUtils.iconify(d); return d; }) : [];
+ if (completed) completed(set);
+ else {
+ if (isFreeformView && generatedDocuments.length > 1) {
+ addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!));
+ } else {
+ generatedDocuments.forEach(addDocument);
+ }
}
- completed?.();
} else {
if (text && !text.includes("https://")) {
addDocument(Docs.Create.TextDocument(text, { ...options, title: text.substring(0, 20), _width: 400, _height: 315 }));
diff --git a/src/client/views/collections/CollectionTimeView.tsx b/src/client/views/collections/CollectionTimeView.tsx
index f41043179..292dfd77c 100644
--- a/src/client/views/collections/CollectionTimeView.tsx
+++ b/src/client/views/collections/CollectionTimeView.tsx
@@ -32,12 +32,10 @@ export class CollectionTimeView extends CollectionSubView(doc => doc) {
@observable _collapsed: boolean = false;
@observable _childClickedScript: Opt<ScriptField>;
@observable _viewDefDivClick: Opt<ScriptField>;
- @observable _focusDocFilters: Opt<string[]>; // fields that get overridden by a focus anchor
@observable _focusPivotField: Opt<string>;
- @observable _focusRangeFilters: Opt<string[]>;
getAnchor = () => {
- const anchor = Docs.Create.TextanchorDocument({
+ const anchor = Docs.Create.HTMLAnchorDocument([], {
title: ComputedField.MakeFunction(`"${this.pivotField}"])`) as any,
annotationOn: this.rootDoc
});
@@ -72,9 +70,9 @@ export class CollectionTimeView extends CollectionSubView(doc => doc) {
@action
setViewSpec = (anchor: Doc, preview: boolean) => {
if (preview) { // if in preview, then override document's fields with view spec
+ this._focusFilters = StrListCast(Doc.GetProto(anchor).docFilters);
+ this._focusRangeFilters = StrListCast(Doc.GetProto(anchor).docRangeFilters);
this._focusPivotField = StrCast(anchor.pivotField);
- this._focusDocFilters = StrListCast(anchor.docFilters);
- this._focusRangeFilters = StrListCast(anchor.docRangeFilters);
} else if (anchor.pivotField !== undefined) { // otherwise set document's fields based on anchor view spec
this.layoutDoc._prevFilterIndex = 1;
this.layoutDoc._pivotField = StrCast(anchor.pivotField);
@@ -84,8 +82,6 @@ export class CollectionTimeView extends CollectionSubView(doc => doc) {
return 0;
}
- pivotDocFilters = () => this._focusDocFilters || this.props.docFilters();
- pivotDocRangeFilters = () => this._focusRangeFilters || this.props.docRangeFilters();
layoutEngine = () => this._layoutEngine;
toggleVisibility = action(() => this._collapsed = !this._collapsed);
@@ -139,10 +135,8 @@ export class CollectionTimeView extends CollectionSubView(doc => doc) {
return <div className="collectionTimeView-innards" key="timeline" style={{ pointerEvents: this.props.isContentActive() ? undefined : "none" }}
onClick={this.contentsDown}>
<CollectionFreeFormView {...this.props}
- engineProps={{ pivotField: this.pivotField, docFilters: this.docFilters, docRangeFilters: this.docRangeFilters }}
+ engineProps={{ pivotField: this.pivotField, docFilters: this.childDocFilters, docRangeFilters: this.childDocRangeFilters }}
fitContentsToDoc={returnTrue}
- docFilters={this.pivotDocFilters}
- docRangeFilters={this.pivotDocRangeFilters}
childClickScript={this._childClickedScript}
viewDefDivClick={this._viewDefDivClick}
childFreezeDimensions={true}
diff --git a/src/client/views/collections/CollectionTreeView.scss b/src/client/views/collections/CollectionTreeView.scss
index 72ab51784..ec461ab94 100644
--- a/src/client/views/collections/CollectionTreeView.scss
+++ b/src/client/views/collections/CollectionTreeView.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.collectionTreeView-dropTarget {
border-width: $COLLECTION_BORDER_WIDTH;
@@ -12,7 +12,7 @@
top: 0;
padding-left: 10px;
padding-right: 10px;
- background: $light-color-secondary;
+ background: $light-gray;
font-size: 13px;
overflow: auto;
user-select: none;
@@ -40,7 +40,7 @@
}
.delete-button {
- color: $intermediate-color;
+ color: $medium-gray;
// float: right;
margin-left: 15px;
// margin-top: 3px;
@@ -71,7 +71,7 @@
.collectionTreeView-subtitle {
font-style: italic;
font-size: 8pt;
- color: $intermediate-color;
+ color: $medium-gray;
}
.docContainer {
diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx
index 82c8a9114..3eece0086 100644
--- a/src/client/views/collections/CollectionTreeView.tsx
+++ b/src/client/views/collections/CollectionTreeView.tsx
@@ -154,7 +154,7 @@ export class CollectionTreeView extends CollectionSubView<Document, Partial<coll
!existingOnClick && ContextMenu.Instance.addItem({ description: "OnClick...", noexpand: true, subitems: onClicks, icon: "mouse-pointer" });
}
}
- onTreeDrop = (e: React.DragEvent) => this.onExternalDrop(e, {});
+ onTreeDrop = (e: React.DragEvent, addDocs?: (docs: Doc[]) => void) => this.onExternalDrop(e, {}, addDocs);
@undoBatch
makeTextCollection = (childDocs: Doc[]) => {
diff --git a/src/client/views/collections/CollectionView.scss b/src/client/views/collections/CollectionView.scss
index a5aef86de..5db489c0a 100644
--- a/src/client/views/collections/CollectionView.scss
+++ b/src/client/views/collections/CollectionView.scss
@@ -1,8 +1,8 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.collectionView {
border-width: 0;
- border-color: $light-color-secondary;
+ border-color: $light-gray;
border-style: solid;
border-radius: 0 0 $border-radius $border-radius;
box-sizing: border-box;
diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx
index fb60265e3..2718cbbbf 100644
--- a/src/client/views/collections/CollectionView.tsx
+++ b/src/client/views/collections/CollectionView.tsx
@@ -1,4 +1,4 @@
-import { computed, observable, runInAction } from 'mobx';
+import { computed, observable, runInAction, action } from 'mobx';
import { observer } from "mobx-react";
import * as React from 'react';
import 'react-image-lightbox-with-rotate/style.css'; // This only needs to be imported once in your app
@@ -29,7 +29,7 @@ import CollectionMapView from './CollectionMapView';
import { CollectionMulticolumnView } from './collectionMulticolumn/CollectionMulticolumnView';
import { CollectionMultirowView } from './collectionMulticolumn/CollectionMultirowView';
import { CollectionPileView } from './CollectionPileView';
-import { CollectionSchemaView } from "./CollectionSchemaView";
+import { CollectionSchemaView } from "./collectionSchema/CollectionSchemaView";
import { CollectionStackingView } from './CollectionStackingView';
import { SubCollectionViewProps } from './CollectionSubView';
import { CollectionTimeView } from './CollectionTimeView';
@@ -236,13 +236,19 @@ export class CollectionView extends ViewBoxAnnotatableComponent<ViewBoxAnnotatab
* Shows the filter icon if it's a user-created collection which isn't a dashboard and has some docFilters applied on it or on the current dashboard.
*/
@computed get showFilterIcon() {
- return this.props.Document.viewType !== CollectionViewType.Docking && !Doc.IsSystem(this.props.Document) && ((StrListCast(this.props.Document._docFilters).length || StrListCast(this.props.Document._docRangeFilters).length || StrListCast(CurrentUserUtils.ActiveDashboard._docFilters).length || StrListCast(CurrentUserUtils.ActiveDashboard._docRangeFilters).length));
+ return this.props.Document.viewType !== CollectionViewType.Docking && !Doc.IsSystem(this.props.Document) && this._subView?.IsFiltered()
}
+ @observable _subView: any = undefined;
+
render() {
TraceMobx();
const props: SubCollectionViewProps = {
...this.props,
+ SetSubView: action((subView: any) => {
+ console.log("Setting sub", subView);
+ return this._subView = subView
+ }),
addDocument: this.addDocument,
moveDocument: this.moveDocument,
removeDocument: this.removeDocument,
@@ -260,8 +266,8 @@ export class CollectionView extends ViewBoxAnnotatableComponent<ViewBoxAnnotatab
{this.collectionViewType !== undefined ? this.SubView(this.collectionViewType, props) : (null)}
{this.showFilterIcon ?
<FontAwesomeIcon icon={"filter"} size="lg"
- style={{ position: 'absolute', top: '1%', right: '1%', cursor: "pointer", padding: 1, color: '#18c718bd', zIndex: 1 }}
- onPointerDown={e => { runInAction(() => CurrentUserUtils.propertiesWidth = 250); e.stopPropagation(); }}
+ style={{ position: 'absolute', top: '1%', right: '1%', cursor: "pointer", padding: 1, color: this.showFilterIcon === "hasFilter" ? '#18c718bd' : "orange", zIndex: 1 }}
+ onPointerDown={action(e => { this.props.select(false); CurrentUserUtils.propertiesWidth = 250; e.stopPropagation(); })}
/>
: (null)}
</div>);
diff --git a/src/client/views/collections/TabDocView.scss b/src/client/views/collections/TabDocView.scss
index 9acbc4f85..a963f1cb9 100644
--- a/src/client/views/collections/TabDocView.scss
+++ b/src/client/views/collections/TabDocView.scss
@@ -1,19 +1,62 @@
input.lm_title:focus,
-input.lm_title
-{
+input.lm_title {
max-width: unset !important;
+ outline: none;
transition-delay: unset;
- width: 100%;
+ width: max-content;
cursor: text;
}
+
input.lm_title {
transition-delay: 0.35s;
- width: 100px;
+ width: max-content;
cursor: pointer;
}
-.tabDocView-drag {
- margin: auto;
+
+.lm_iconWrap {
+ display: flex;
+ color: black;
+ width: 15px;
+ height: 15px;
+ align-items: center;
+ align-self: center;
+ justify-content: center;
+ margin: 3px;
+ border-radius: 20%;
+
+ .moreInfoDot {
+ background-color: white;
+ border-radius: 100%;
+ width: 3px;
+ height: 3px;
+ margin: 0.5px;
+ }
+}
+
+.ffMenu {
+ display: grid;
+ grid-auto-rows: 35px;
+ grid-auto-columns: auto auto auto auto auto;
+ right: 10px;
+ bottom: 50px;
+ position: absolute;
+ min-height: 35px;
+ height: max-content;
+ border: solid 2px black;
+ border-radius: 5px;
+ background-color: #bddbe6;
+ width: max-content;
+ min-width: 35px;
+
+ .ffMenuButton {
+ display: flex;
+ width: 35px;
+ height: 35px;
+ align-items: center;
+ justify-content: center;
+ }
}
+
.miniMap-hidden,
.miniMap {
position: absolute;
@@ -37,6 +80,7 @@ input.lm_title {
}
}
}
+
.miniMap-hidden {
position: absolute;
bottom: 0;
@@ -46,7 +90,8 @@ input.lm_title {
transform: translate(20px, 20px) rotate(45deg);
border-radius: 30px;
padding: 2px;
- > svg {
+
+ >svg {
margin-top: 3px;
transform: translate(0px, 7px);
}
diff --git a/src/client/views/collections/TabDocView.tsx b/src/client/views/collections/TabDocView.tsx
index 7e2f7811e..623e0f58d 100644
--- a/src/client/views/collections/TabDocView.tsx
+++ b/src/client/views/collections/TabDocView.tsx
@@ -1,3 +1,4 @@
+import { IconProp } from '@fortawesome/fontawesome-svg-core';
import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
import { Tooltip } from '@material-ui/core';
import 'golden-layout/src/css/goldenlayout-base.css';
@@ -9,9 +10,9 @@ import * as ReactDOM from 'react-dom';
import { DataSym, Doc, DocListCast, DocListCastAsync, HeightSym, Opt, WidthSym } from "../../../fields/Doc";
import { Id } from '../../../fields/FieldSymbols';
import { FieldId } from "../../../fields/RefField";
-import { Cast, NumCast, StrCast, BoolCast } from "../../../fields/Types";
+import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types";
import { TraceMobx } from '../../../fields/util';
-import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents, Utils } from "../../../Utils";
+import { emptyFunction, lightOrDark, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents, Utils } from "../../../Utils";
import { DocServer } from "../../DocServer";
import { DocUtils } from '../../documents/Documents';
import { DocumentType } from '../../documents/DocumentTypes';
@@ -24,15 +25,15 @@ import { Transform } from '../../util/Transform';
import { undoBatch, UndoManager } from "../../util/UndoManager";
import { LightboxView } from '../LightboxView';
import { DocFocusOptions, DocumentView, DocumentViewProps } from "../nodes/DocumentView";
-import { FieldViewProps } from '../nodes/FieldView';
-import { PinProps, PresBox, PresMovement } from '../nodes/PresBox';
+import { PinProps, PresBox, PresMovement } from '../nodes/trails';
import { DefaultLayerProvider, DefaultStyleProvider, StyleLayers, StyleProp } from '../StyleProvider';
import { CollectionDockingView } from './CollectionDockingView';
import { CollectionDockingViewMenu } from './CollectionDockingViewMenu';
import { CollectionFreeFormView } from './collectionFreeForm/CollectionFreeFormView';
-import { CollectionViewType, CollectionView } from './CollectionView';
+import { CollectionView, CollectionViewType } from './CollectionView';
import "./TabDocView.scss";
import React = require("react");
+import Color = require('color');
const _global = (window /* browser */ || global /* node */) as any;
interface TabDocViewProps {
@@ -52,6 +53,14 @@ export class TabDocView extends React.Component<TabDocViewProps> {
@computed get layoutDoc() { return this._document && Doc.Layout(this._document); }
@computed get tabColor() { return StrCast(this._document?._backgroundColor, StrCast(this._document?.backgroundColor, DefaultStyleProvider(this._document, undefined, StyleProp.BackgroundColor))); }
+ @computed get tabTextColor() { return this._document?.type === DocumentType.PRES ? "black" : StrCast(this._document?._color, StrCast(this._document?.color, DefaultStyleProvider(this._document, undefined, StyleProp.Color))); }
+ // @computed get renderBounds() {
+ // const bounds = this._document ? Cast(this._document._renderContentBounds, listSpec("number"), [0, 0, this.returnMiniSize(), this.returnMiniSize()]) : [0, 0, 0, 0];
+ // const xbounds = bounds[2] - bounds[0];
+ // const ybounds = bounds[3] - bounds[1];
+ // const dim = Math.max(xbounds, ybounds);
+ // return { l: bounds[0] + xbounds / 2 - dim / 2, t: bounds[1] + ybounds / 2 - dim / 2, cx: bounds[0] + xbounds / 2, cy: bounds[1] + ybounds / 2, dim };
+ // }
get stack() { return (this.props as any).glContainer.parent.parent; }
get tab() { return (this.props as any).glContainer.tab; }
@@ -65,15 +74,25 @@ export class TabDocView extends React.Component<TabDocViewProps> {
tab.contentItem.config.fixed && (tab.contentItem.parent.config.fixed = true);
tab.DashDoc = doc;
CollectionDockingView.Instance.tabMap.add(tab);
-
+ const iconType: IconProp = Doc.toIcon(doc);
// setup the title element and set its size according to the # of chars in the title. Show the full title when clicked.
const titleEle = tab.titleElement[0];
+ const iconWrap = document.createElement("div");
+ const closeWrap = document.createElement("div");
+
+
titleEle.size = StrCast(doc.title).length + 3;
titleEle.value = doc.title;
titleEle.onchange = undoBatch(action((e: any) => {
titleEle.size = e.currentTarget.value.length + 3;
Doc.GetProto(doc).title = e.currentTarget.value;
}));
+
+ const dragBtnDown = (e: React.PointerEvent) => {
+ setupMoveUpEvents(this, e, e => !e.defaultPrevented && DragManager.StartDocumentDrag([iconWrap], new DragManager.DocumentDragData([doc], doc.dropAction as dropActionType), e.clientX, e.clientY), returnFalse, emptyFunction);
+ };
+
+
if (tab.element[0].children[1].children.length === 1) {
const toggle = document.createElement("div");
toggle.style.width = "10px";
@@ -83,18 +102,42 @@ export class TabDocView extends React.Component<TabDocViewProps> {
toggle.style.borderTopRightRadius = "7px";
toggle.style.position = "relative";
toggle.style.display = "inline-block";
- toggle.style.background = "gray";
- toggle.style.borderLeft = "solid 1px black";
+ toggle.style.background = "transparent";
toggle.onclick = (e: MouseEvent) => {
if (tab.contentItem === tab.header.parent.getActiveContentItem()) {
tab.DashDoc.activeLayer = tab.DashDoc.activeLayer ? undefined : StyleLayers.Background;
}
};
- tab.element[0].style.borderTopRightRadius = "8px";
- tab.element[0].children[1].appendChild(toggle);
- tab._disposers.layerDisposer = reaction(() =>
- ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }),
- ({ layer, color }) => toggle.style.background = !layer ? color : "dimgrey", { fireImmediately: true });
+ iconWrap.className = "lm_iconWrap";
+ iconWrap.id = "lm_iconWrap";
+ closeWrap.className = "lm_iconWrap";
+ closeWrap.id = "lm_closeWrap";
+ closeWrap.onclick = (e: MouseEvent) => {
+ tab.header.parent.contentItem.remove();
+ Doc.AddDocToList(CurrentUserUtils.MyRecentlyClosed, "data", tab.DashDoc, undefined, true, true);
+ };
+ const docIcon = <FontAwesomeIcon onPointerDown={dragBtnDown} icon={iconType} />;
+ const closeIcon = <FontAwesomeIcon icon={"times"} />;
+ ReactDOM.render(docIcon, iconWrap);
+ ReactDOM.render(closeIcon, closeWrap);
+ // tab.element[0].append(closeWrap);
+ tab.element[0].prepend(iconWrap);
+ tab._disposers.layerDisposer = reaction(() => ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }),
+ ({ layer, color }) => {
+ const textColor = lightOrDark(this.tabColor); //not working with StyleProp.Color
+ titleEle.style.color = textColor;
+ titleEle.style.backgroundColor = "transparent";
+ iconWrap.style.color = textColor;
+ closeWrap.style.color = textColor;
+ moreInfoDrag.style.backgroundColor = textColor;
+ tab.element[0].style.background = !layer ? color : "dimgrey";
+ }, { fireImmediately: true });
+ // TODO:glr fix
+ // tab.element[0].style.borderTopRightRadius = "8px";
+ // tab.element[0].children[1].appendChild(toggle);
+ // tab._disposers.layerDisposer = reaction(() =>
+ // ({ layer: tab.DashDoc.activeLayer, color: this.tabColor }),
+ // ({ layer, color }) => toggle.style.background = !layer ? color : "dimgrey", { fireImmediately: true });
}
// shifts the focus to this tab when another tab is dragged over it
tab.element[0].onmouseenter = (e: MouseEvent) => {
@@ -103,13 +146,11 @@ export class TabDocView extends React.Component<TabDocViewProps> {
tab.setActive(true);
}
};
- const dragBtnDown = (e: React.PointerEvent) => {
- setupMoveUpEvents(this, e, e => !e.defaultPrevented && DragManager.StartDocumentDrag([dragHdl], new DragManager.DocumentDragData([doc], doc.dropAction as dropActionType), e.clientX, e.clientY), returnFalse, emptyFunction);
- };
+
// select the tab document when the tab is directly clicked and activate the tab whenver the tab document is selected
titleEle.onpointerdown = action((e: any) => {
- if (e.target.className !== "lm_close_tab") {
+ if (e.target.className !== "lm_iconWrap") {
if (this.view) SelectionManager.SelectView(this.view, false);
else this._activated = true;
if (Date.now() - titleEle.lastClick < 1000) titleEle.select();
@@ -123,25 +164,30 @@ export class TabDocView extends React.Component<TabDocViewProps> {
const toggle = tab.element[0].children[1].children[0] as HTMLInputElement;
selected && tab.contentItem !== tab.header.parent.getActiveContentItem() &&
UndoManager.RunInBatch(() => tab.header.parent.setActiveContentItem(tab.contentItem), "tab switch");
- toggle.style.fontWeight = selected ? "bold" : "";
- toggle.style.textTransform = selected ? "uppercase" : "";
+ // toggle.style.fontWeight = selected ? "bold" : "";
+ // toggle.style.textTransform = selected ? "uppercase" : "";
}));
//attach the selection doc buttons menu to the drag handle
- const stack = tab.contentItem.parent;
- const dragHdl = document.createElement("div");
- dragHdl.className = "lm_drag_tab";
+ const stack: HTMLDivElement = tab.contentItem.parent;
+ const header: HTMLDivElement = tab;
+ console.log("Stack: " + stack.id, stack.className)
+ stack.onscroll = action((e: any) => {
+ console.log('scrolling...')
+ })
+ const moreInfoDrag = document.createElement("div");
+ moreInfoDrag.className = "lm_iconWrap";
tab._disposers.buttonDisposer = reaction(() => this.view, view =>
- view && [ReactDOM.render(<span className="tabDocView-drag" onPointerDown={dragBtnDown}><CollectionDockingViewMenu views={() => [view]} Stack={stack} /></span>, dragHdl), tab._disposers.buttonDisposer?.()],
+ view && [ReactDOM.render(<span><CollectionDockingViewMenu views={() => [view]} Stack={stack} /></span>, moreInfoDrag), tab._disposers.buttonDisposer?.()],
{ fireImmediately: true });
- tab.reactComponents = [dragHdl];
- tab.closeElement.before(dragHdl);
+ // tab.reactComponents = [moreInfoDrag];
+ // tab.element[0].children[3].before(moreInfoDrag);
// highlight the tab when the tab document is brushed in any part of the UI
tab._disposers.reactionDisposer = reaction(() => ({ title: doc.title, degree: Doc.IsBrushedDegree(doc) }), ({ title, degree }) => {
titleEle.value = title;
- titleEle.style.padding = degree ? 0 : 2;
- titleEle.style.border = `${["gray", "gray", "gray"][degree]} ${["none", "dashed", "solid"][degree]} 2px`;
+ // titleEle.style.padding = degree ? 0 : 2;
+ // titleEle.style.border = `${["gray", "gray", "gray"][degree]} ${["none", "dashed", "solid"][degree]} 2px`;
}, { fireImmediately: true });
// clean up the tab when it is closed
@@ -221,9 +267,9 @@ export class TabDocView extends React.Component<TabDocViewProps> {
})).observe(this.props.glContainer._element[0]);
this.props.glContainer.layoutManager.on("activeContentItemChanged", this.onActiveContentItemChanged);
this.props.glContainer.tab?.isActive && this.onActiveContentItemChanged(undefined);
- this._tabReaction = reaction(() => ({ selected: this.active(), title: this.tab?.titleElement[0] }),
- ({ selected, title }) => title && (title.style.backgroundColor = selected ? "white" : ""),
- { fireImmediately: true });
+ // this._tabReaction = reaction(() => ({ selected: this.active(), title: this.tab?.titleElement[0] }),
+ // ({ selected, title }) => title && (title.style.backgroundColor = selected ? "white" : ""),
+ // { fireImmediately: true });
}
componentWillUnmount() {
@@ -243,10 +289,10 @@ export class TabDocView extends React.Component<TabDocViewProps> {
}
// adds a tab to the layout based on the locaiton parameter which can be:
- // close[:{left,right,top,bottom}] - e.g., "close" will close the tab, "close:left" will close the left tab,
+ // close[:{left,right,top,bottom}] - e.g., "close" will close the tab, "close:left" will close the left tab,
// add[:{left,right,top,bottom}] - e.g., "add" will add a tab to the current stack, "add:right" will add a tab on the right
- // replace[:{left,right,top,bottom,<any string>}] - e.g., "replace" will replace the current stack contents,
- // "replace:right" - will replace the stack on the right named "right" if it exists, or create a stack on the right with that name,
+ // replace[:{left,right,top,bottom,<any string>}] - e.g., "replace" will replace the current stack contents,
+ // "replace:right" - will replace the stack on the right named "right" if it exists, or create a stack on the right with that name,
// "replace:monkeys" - will replace any tab that has the label 'monkeys', or a tab with that label will be created by default on the right
// inPlace - will add the document to any collection along the path from the document to the docking view that has a field isInPlaceContainer. if none is found, inPlace adds a tab to current stack
addDocTab = (doc: Doc, location: string) => {
@@ -317,8 +363,8 @@ export class TabDocView extends React.Component<TabDocViewProps> {
PanelHeight={this.PanelHeight}
layerProvider={this.layerProvider}
styleProvider={DefaultStyleProvider}
- docFilters={CollectionDockingView.Instance.docFilters}
- docRangeFilters={CollectionDockingView.Instance.docRangeFilters}
+ docFilters={CollectionDockingView.Instance.childDocFilters}
+ docRangeFilters={CollectionDockingView.Instance.childDocRangeFilters}
searchFilterDocs={CollectionDockingView.Instance.searchFilterDocs}
addDocument={undefined}
removeDocument={undefined}
@@ -422,6 +468,7 @@ export class TabMinimapView extends React.Component<TabMinimapViewProps> {
<div className="miniMap" style={{ width: miniSize, height: miniSize, background: this.props.background() }}>
<CollectionFreeFormView
Document={this.props.document}
+ SetSubView={() => this}
CollectionView={undefined}
ContainingCollectionView={undefined}
ContainingCollectionDoc={undefined}
@@ -450,8 +497,8 @@ export class TabMinimapView extends React.Component<TabMinimapViewProps> {
layerProvider={undefined}
addDocTab={this.props.addDocTab}
pinToPres={TabDocView.PinDoc}
- docFilters={CollectionDockingView.Instance.docFilters}
- docRangeFilters={CollectionDockingView.Instance.docRangeFilters}
+ docFilters={CollectionDockingView.Instance.childDocFilters}
+ docRangeFilters={CollectionDockingView.Instance.childDocRangeFilters}
searchFilterDocs={CollectionDockingView.Instance.searchFilterDocs}
fitContentsToDoc={returnTrue}
/>
@@ -460,4 +507,4 @@ export class TabMinimapView extends React.Component<TabMinimapViewProps> {
</div>
</div>;
}
-} \ No newline at end of file
+}
diff --git a/src/client/views/collections/TreeView.scss b/src/client/views/collections/TreeView.scss
index 3f6fc8b0c..1ebc5873e 100644
--- a/src/client/views/collections/TreeView.scss
+++ b/src/client/views/collections/TreeView.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.treeView-label {
max-height: 1.5em;
@@ -14,7 +14,7 @@
.bullet-outline {
position: relative;
width: $TREE_BULLET_WIDTH;
- color: $intermediate-color;
+ color: $medium-gray;
transform: scale(0.5);
display: inline-flex;
align-items: center;
@@ -45,7 +45,7 @@
.bullet {
position: relative;
width: $TREE_BULLET_WIDTH;
- color: $intermediate-color;
+ color: $medium-gray;
margin-top: 3px;
transform: scale(1.3, 1.3);
border: #80808030 1px solid;
diff --git a/src/client/views/collections/TreeView.tsx b/src/client/views/collections/TreeView.tsx
index 2e98fb508..e33c39d20 100644
--- a/src/client/views/collections/TreeView.tsx
+++ b/src/client/views/collections/TreeView.tsx
@@ -20,7 +20,7 @@ import { SnappingManager } from '../../util/SnappingManager';
import { Transform } from '../../util/Transform';
import { undoBatch, UndoManager } from '../../util/UndoManager';
import { EditableView } from "../EditableView";
-import { TREE_BULLET_WIDTH } from '../globalCssVariables.scss';
+import { TREE_BULLET_WIDTH } from '../global/globalCssVariables.scss';
import { DocumentView, DocumentViewProps, StyleProviderFunc, DocumentViewInternal } from '../nodes/DocumentView';
import { FormattedTextBox } from '../nodes/formattedText/FormattedTextBox';
import { RichTextMenu } from '../nodes/formattedText/RichTextMenu';
@@ -151,7 +151,10 @@ export class TreeView extends React.Component<TreeViewProps> {
this.treeViewOpen = !this.treeViewOpen;
} else {
// choose an appropriate alias or make one. --- choose the first alias that (1) user owns, (2) has no context field ... otherwise make a new alias
+ // this.props.addDocTab(CurrentUserUtils.ActiveDashboard.isShared ? Doc.MakeAlias(this.props.document) : this.props.document, "add:right");
+ // choose an appropriate alias or make one -- -- choose the first alias that (1) the user owns, (2) has no context field - if I own it and someone else does not have it open,, otherwise create an alias
this.props.addDocTab(this.props.document, "add:right");
+
}
}
constructor(props: any) {
@@ -261,15 +264,19 @@ export class TreeView extends React.Component<TreeViewProps> {
if (docDragData) {
e.stopPropagation();
if (docDragData.draggedDocuments[0] === this.doc) return true;
- const parentAddDoc = (doc: Doc | Doc[]) => this.props.addDocument(doc, undefined, before);
- const canAdd = !StrCast((inside ? this.props.document : this.props.containerCollection)?.freezeChildren).includes("add") || docDragData.treeViewDoc === this.props.treeView.props.Document;
- const localAdd = (doc: Doc) => Doc.AddDocToList(this.dataDoc, this.fieldKey, doc) && ((doc.context = this.doc.context) || true) ? true : false;
- const addDoc = !inside ? parentAddDoc :
- (doc: Doc | Doc[]) => (doc instanceof Doc ? [doc] : doc).reduce((flg, doc) => flg && localAdd(doc), true as boolean);
- const move = (!docDragData.dropAction || docDragData.dropAction === "proto" || docDragData.dropAction === "move" || docDragData.dropAction === "same") && docDragData.moveDocument;
- if (canAdd) {
- UndoManager.RunInTempBatch(() => docDragData.droppedDocuments.reduce((added, d) => (move ? move(d, undefined, addDoc) || (docDragData.dropAction === "proto" ? addDoc(d) : false) : addDoc(d)) || added, false));
- }
+ this.dropDocuments(docDragData.droppedDocuments, before, inside, docDragData.dropAction, docDragData.moveDocument, docDragData.treeViewDoc === this.props.treeView.props.Document);
+ }
+ }
+
+ dropDocuments(droppedDocuments: Doc[], before: boolean, inside: number | boolean, dropAction: dropActionType, moveDocument: DragManager.MoveFunction | undefined, forceAdd: boolean) {
+ const parentAddDoc = (doc: Doc | Doc[]) => this.props.addDocument(doc, undefined, before);
+ const canAdd = !StrCast((inside ? this.props.document : this.props.containerCollection)?.freezeChildren).includes("add") || forceAdd;
+ const localAdd = (doc: Doc) => Doc.AddDocToList(this.dataDoc, this.fieldKey, doc) && ((doc.context = this.doc.context) || true) ? true : false;
+ const addDoc = !inside ? parentAddDoc :
+ (doc: Doc | Doc[]) => (doc instanceof Doc ? [doc] : doc).reduce((flg, doc) => flg && localAdd(doc), true as boolean);
+ const move = (!dropAction || dropAction === "proto" || dropAction === "move" || dropAction === "same") && moveDocument;
+ if (canAdd) {
+ UndoManager.RunInTempBatch(() => droppedDocuments.reduce((added, d) => (move ? move(d, undefined, addDoc) || (dropAction === "proto" ? addDoc(d) : false) : addDoc(d)) || added, false));
}
}
@@ -507,6 +514,7 @@ export class TreeView extends React.Component<TreeViewProps> {
[{ script: ScriptField.MakeFunction(`DocFocusOrOpen(self)`)!, label: "Focus or Open" }];
}
onChildClick = () => this.props.onChildClick?.() ?? (this._editTitleScript?.() || ScriptCast(this.doc.treeChildClick));
+
onChildDoubleClick = () => (!this.props.treeView.outlineMode && this._openScript?.()) || ScriptCast(this.doc.treeChildDoubleClick);
refocus = () => this.props.treeView.props.focus(this.props.treeView.props.Document);
@@ -727,12 +735,23 @@ export class TreeView extends React.Component<TreeViewProps> {
</div>;
}
+ onTreeDrop = (de: React.DragEvent) => {
+ const pt = [de.clientX, de.clientY];
+ const rect = this._header.current!.getBoundingClientRect();
+ const before = pt[1] < rect.top + rect.height / 2;
+ const inside = this.props.treeView.fileSysMode && !this.doc.isFolder ? false : pt[0] > Math.min(rect.left + 75, rect.left + rect.width * .75) || (!before && this.treeViewOpen && this.childDocList.length);
+
+ const docs = this.props.treeView.onTreeDrop(de, (docs: Doc[]) => this.dropDocuments(docs, before, inside, "copy", undefined, false));
+ }
+
render() {
TraceMobx();
const hideTitle = this.doc.treeViewHideHeader || this.props.treeView.outlineMode;
return this.props.renderedIds.indexOf(this.doc[Id]) !== -1 ? "<" + this.doc.title + ">" : // just print the title of documents we've previously rendered in this hierarchical path to avoid cycles
<div className={`treeView-container${this.props.isContentActive() ? "-active" : ""}`}
ref={this.createTreeDropTarget}
+
+ onDrop={this.onTreeDrop}
//onPointerDown={e => this.props.isContentActive(true) && SelectionManager.DeselectAll()} // bcz: this breaks entering a text filter in a filterBox since it deselects the filter's target document
onKeyDown={this.onKeyDown}>
<li className="collection-child">
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx
index afc1babeb..37444a9dc 100644
--- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx
+++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx
@@ -126,7 +126,8 @@ export function computerStarburstLayout(
replica: ""
});
});
- return normalizeResults(scaleDim, 12, docMap, poolData, viewDefsToJSX, [], 0, []);
+ const divider = { type: "div", color: "transparent", x: -burstRadius[0] / 3, y: 0, width: 15, height: 15, payload: undefined };
+ return normalizeResults(scaleDim, 12, docMap, poolData, viewDefsToJSX, [], 0, [divider]);
}
@@ -399,7 +400,7 @@ function normalizeResults(
): ViewDefResult[] {
const grpEles = groupNames.map(gn => ({ x: gn.x, y: gn.y, width: gn.width, height: gn.height }) as ViewDefBounds);
const docEles = Array.from(docMap.entries()).map(ele => ele[1]);
- const aggBounds = aggregateBounds(grpEles.concat(docEles.map(de => ({ ...de, type: "doc", payload: "" }))).filter(e => e.zIndex !== -99), 0, 0);
+ const aggBounds = aggregateBounds(extras.concat(grpEles.concat(docEles.map(de => ({ ...de, type: "doc", payload: "" })))).filter(e => e.zIndex !== -99), 0, 0);
aggBounds.r = Math.max(minWidth, aggBounds.r - aggBounds.x);
const wscale = panelDim[0] / (aggBounds.r - aggBounds.x);
let scale = wscale * (aggBounds.b - aggBounds.y) > panelDim[1] ? (panelDim[1]) / (aggBounds.b - aggBounds.y) : wscale;
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss b/src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss
index c5b8fc5e8..5fa01b102 100644
--- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss
+++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss
@@ -1,4 +1,4 @@
-@import "globalCssVariables";
+@import "global/globalCssVariables";
.collectionFreeFormRemoteCursors-cont {
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss
index eb0538c41..79e063f7f 100644
--- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss
+++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss
@@ -1,4 +1,4 @@
-@import "../../globalCssVariables";
+@import "../../global/globalCssVariables";
.collectionfreeformview-none {
position: inherit;
@@ -226,7 +226,7 @@
// linear-gradient(to bottom, $light-color-secondary 1px, transparent 1px);
// background-size: 30px 30px;
// }
- border: 0px solid $light-color-secondary;
+ border: 0px solid $light-gray;
border-radius: inherit;
box-sizing: border-box;
position: absolute;
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
index accb80c5a..ba6222605 100644
--- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
+++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx
@@ -28,7 +28,7 @@ import { SelectionManager } from "../../../util/SelectionManager";
import { SnappingManager } from "../../../util/SnappingManager";
import { Transform } from "../../../util/Transform";
import { undoBatch } from "../../../util/UndoManager";
-import { COLLECTION_BORDER_WIDTH } from "../../../views/globalCssVariables.scss";
+import { COLLECTION_BORDER_WIDTH } from "../../../views/global/globalCssVariables.scss";
import { Timeline } from "../../animationtimeline/Timeline";
import { ContextMenu } from "../../ContextMenu";
import { DocumentDecorations } from "../../DocumentDecorations";
@@ -38,7 +38,7 @@ import { CollectionFreeFormDocumentView } from "../../nodes/CollectionFreeFormDo
import { DocFocusOptions, DocumentView, DocumentViewProps, ViewAdjustment, ViewSpecPrefix } from "../../nodes/DocumentView";
import { FormattedTextBox } from "../../nodes/formattedText/FormattedTextBox";
import { pageSchema } from "../../nodes/ImageBox";
-import { PresBox } from "../../nodes/PresBox";
+import { PresBox } from "../../nodes/trails/PresBox";
import { StyleLayers, StyleProp } from "../../StyleProvider";
import { CollectionDockingView } from "../CollectionDockingView";
import { CollectionSubView } from "../CollectionSubView";
@@ -48,6 +48,7 @@ import { CollectionFreeFormRemoteCursors } from "./CollectionFreeFormRemoteCurso
import "./CollectionFreeFormView.scss";
import { MarqueeView } from "./MarqueeView";
import React = require("react");
+import { DocumentType } from "../../../documents/DocumentTypes";
export const panZoomSchema = createSchema({
_panX: "number",
@@ -109,8 +110,6 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
@observable _timelineRef = React.createRef<Timeline>();
@observable _marqueeRef = React.createRef<HTMLDivElement>();
@observable _keyframeEditing = false;
- @observable _focusFilters: Opt<string[]>; // docFilters that are overridden when previewing a link to an anchor which has docFilters set on it
- @observable _focusRangeFilters: Opt<string[]>; // docRangeFilters that are overridden when previewing a link to an anchor which has docRangeFilters set on it
@observable ChildDrag: DocumentView | undefined; // child document view being dragged. needed to update drop areas of groups when a group item is dragged.
@computed get views() { return this._layoutElements.filter(ele => ele.bounds && !ele.bounds.z).map(ele => ele.ele); }
@@ -158,8 +157,6 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
this.layoutDoc._viewScale = vals.scale;
}
freeformData = (force?: boolean) => this.fitToContent || force ? this.fitToContentVals : undefined;
- freeformDocFilters = () => this._focusFilters || this.docFilters();
- freeformRangeDocFilters = () => this._focusRangeFilters || this.docRangeFilters();
reverseNativeScaling = () => this.fitToContent ? true : false;
panX = () => this.freeformData()?.bounds.cx ?? NumCast(this.Document._panX);
panY = () => this.freeformData()?.bounds.cy ?? NumCast(this.Document._panY);
@@ -1029,8 +1026,8 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
ScreenToLocalTransform={childLayout.z ? this.getTransformOverlay : this.getTransform}
PanelWidth={childLayout[WidthSym]}
PanelHeight={childLayout[HeightSym]}
- docFilters={this.freeformDocFilters}
- docRangeFilters={this.freeformRangeDocFilters}
+ docFilters={this.childDocFilters}
+ docRangeFilters={this.childDocRangeFilters}
searchFilterDocs={this.searchFilterDocs}
isContentActive={this.isAnnotationOverlay ? this.props.isContentActive : returnFalse}
isDocumentActive={this.props.childDocumentsActive ? this.props.isDocumentActive : this.isContentActive}
@@ -1196,14 +1193,21 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
if (preview) {
this._focusFilters = StrListCast(Doc.GetProto(anchor).docFilters);
this._focusRangeFilters = StrListCast(Doc.GetProto(anchor).docRangeFilters);
- } else if (anchor.pivotField !== undefined) {
- this.layoutDoc._docFilters = new List<string>(StrListCast(anchor.docFilters));
- this.layoutDoc._docRangeFilters = new List<string>(StrListCast(anchor.docRangeFilters));
+ } else {
+ if (anchor.docFilters) {
+ this.layoutDoc._docFilters = new List<string>(StrListCast(anchor.docFilters));
+ }
+ if (anchor.docRangeFilters) {
+ this.layoutDoc._docRangeFilters = new List<string>(StrListCast(anchor.docRangeFilters));
+ }
}
return 0;
}
getAnchor = () => {
+ if (this.props.Document.annotationOn) {
+ return this.rootDoc;
+ }
const anchor = Docs.Create.TextanchorDocument({ title: StrCast(this.layoutDoc._viewType), annotationOn: this.rootDoc });
const proto = Doc.GetProto(anchor);
proto[ViewSpecPrefix + "_viewType"] = this.layoutDoc._viewType;
@@ -1486,7 +1490,8 @@ export class CollectionFreeFormView extends CollectionSubView<PanZoomDocument, P
onDragOver={e => e.preventDefault()}
onContextMenu={this.onContextMenu}
style={{
- pointerEvents: this.backgroundEvents ? "all" : this.props.pointerEvents as any,
+ pointerEvents: this.props.Document.type === DocumentType.MARKER ? "none" : // bcz: ugh.. this is here to prevent markers, which render as freeform views, from grabbing events -- need a better approach.
+ this.backgroundEvents ? "all" : this.props.pointerEvents as any,
transform: `scale(${this.contentScaling || 1})`,
width: `${100 / (this.contentScaling || 1)}%`,
height: this.isAnnotationOverlay && this.Document.scrollHeight ? this.Document.scrollHeight : `${100 / (this.contentScaling || 1)}%`// : this.isAnnotationOverlay ? (this.Document.scrollHeight ? this.Document.scrollHeight : "100%") : this.props.PanelHeight()
diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
index b1f2750c3..846d28214 100644
--- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
+++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx
@@ -19,7 +19,8 @@ import { Transform } from "../../../util/Transform";
import { undoBatch, UndoManager } from "../../../util/UndoManager";
import { ContextMenu } from "../../ContextMenu";
import { FormattedTextBox } from "../../nodes/formattedText/FormattedTextBox";
-import { PresBox, PresMovement } from "../../nodes/PresBox";
+import { PresBox } from "../../nodes/trails/PresBox";
+import { PresMovement } from "../../nodes/trails/PresEnums";
import { PreviewCursor } from "../../PreviewCursor";
import { CollectionDockingView } from "../CollectionDockingView";
import { SubCollectionViewProps } from "../CollectionSubView";
@@ -368,8 +369,8 @@ export class MarqueeView extends React.Component<SubCollectionViewProps & Marque
SelectionManager.DeselectAll();
selected.forEach(d => this.props.removeDocument?.(d));
const newCollection = DocUtils.pileup(selected, this.Bounds.left + this.Bounds.width / 2, this.Bounds.top + this.Bounds.height / 2);
- this.props.addDocument?.(newCollection!);
- this.props.selectDocuments([newCollection!]);
+ this.props.addDocument?.(newCollection);
+ this.props.selectDocuments([newCollection]);
MarqueeOptionsMenu.Instance.fadeOut(true);
this.hideMarquee();
}
diff --git a/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx b/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx
index f3a39a262..65c345547 100644
--- a/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx
+++ b/src/client/views/collections/collectionMulticolumn/CollectionMulticolumnView.tsx
@@ -237,8 +237,8 @@ export class CollectionMulticolumnView extends CollectionSubView(MulticolumnDocu
onDoubleClick={this.onChildDoubleClickHandler}
ScreenToLocalTransform={dxf}
focus={this.props.focus}
- docFilters={this.docFilters}
- docRangeFilters={this.docRangeFilters}
+ docFilters={this.childDocFilters}
+ docRangeFilters={this.childDocRangeFilters}
searchFilterDocs={this.searchFilterDocs}
ContainingCollectionDoc={this.props.CollectionView?.props.Document}
ContainingCollectionView={this.props.CollectionView}
diff --git a/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx b/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx
index 29cb3511a..30836854a 100644
--- a/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx
+++ b/src/client/views/collections/collectionMulticolumn/CollectionMultirowView.tsx
@@ -236,9 +236,9 @@ export class CollectionMultirowView extends CollectionSubView(MultirowDocument)
onDoubleClick={this.onChildDoubleClickHandler}
ScreenToLocalTransform={dxf}
focus={this.props.focus}
- docFilters={this.docFilters}
+ docFilters={this.childDocFilters}
isContentActive={returnFalse}
- docRangeFilters={this.docRangeFilters}
+ docRangeFilters={this.childDocRangeFilters}
searchFilterDocs={this.searchFilterDocs}
ContainingCollectionDoc={this.props.CollectionView?.props.Document}
ContainingCollectionView={this.props.CollectionView}
diff --git a/src/client/views/collections/CollectionSchemaCells.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx
index 2e6186680..fd99abce5 100644
--- a/src/client/views/collections/CollectionSchemaCells.tsx
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx
@@ -6,33 +6,34 @@ import DatePicker from "react-datepicker";
import "react-datepicker/dist/react-datepicker.css";
import { CellInfo } from "react-table";
import "react-table/react-table.css";
-import { DateField } from "../../../fields/DateField";
-import { Doc, DocListCast, Field, Opt } from "../../../fields/Doc";
-import { Id } from "../../../fields/FieldSymbols";
-import { List } from "../../../fields/List";
-import { SchemaHeaderField } from "../../../fields/SchemaHeaderField";
-import { ComputedField } from "../../../fields/ScriptField";
-import { BoolCast, Cast, DateCast, FieldValue, NumCast, StrCast } from "../../../fields/Types";
-import { ImageField } from "../../../fields/URLField";
-import { Utils, emptyFunction } from "../../../Utils";
-import { Docs } from "../../documents/Documents";
-import { DocumentType } from "../../documents/DocumentTypes";
-import { DocumentManager } from "../../util/DocumentManager";
-import { DragManager } from "../../util/DragManager";
-import { KeyCodes } from "../../util/KeyCodes";
-import { CompileScript } from "../../util/Scripting";
-import { SearchUtil } from "../../util/SearchUtil";
-import { SnappingManager } from "../../util/SnappingManager";
-import { undoBatch } from "../../util/UndoManager";
-import '../DocumentDecorations.scss';
-import { EditableView } from "../EditableView";
-import { MAX_ROW_HEIGHT } from '../globalCssVariables.scss';
-import { DocumentIconContainer } from "../nodes/DocumentIcon";
-import { OverlayView } from "../OverlayView";
+import { DateField } from "../../../../fields/DateField";
+import { Doc, DocListCast, Field, Opt } from "../../../../fields/Doc";
+import { Id } from "../../../../fields/FieldSymbols";
+import { List } from "../../../../fields/List";
+import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField";
+import { ComputedField } from "../../../../fields/ScriptField";
+import { BoolCast, Cast, DateCast, FieldValue, NumCast, StrCast } from "../../../../fields/Types";
+import { ImageField } from "../../../../fields/URLField";
+import { Utils, emptyFunction } from "../../../../Utils";
+import { Docs } from "../../../documents/Documents";
+import { DocumentType } from "../../../documents/DocumentTypes";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { DragManager } from "../../../util/DragManager";
+import { KeyCodes } from "../../../util/KeyCodes";
+import { CompileScript } from "../../../util/Scripting";
+import { SearchUtil } from "../../../util/SearchUtil";
+import { SnappingManager } from "../../../util/SnappingManager";
+import { undoBatch } from "../../../util/UndoManager";
+import '../../../views/DocumentDecorations.scss';
+import { EditableView } from "../../EditableView";
+import { MAX_ROW_HEIGHT } from '../../global/globalCssVariables.scss';
+import { DocumentIconContainer } from "../../nodes/DocumentIcon";
+import { OverlayView } from "../../OverlayView";
import "./CollectionSchemaView.scss";
-import { CollectionView } from "./CollectionView";
+import { CollectionView } from "../CollectionView";
const path = require('path');
+// intialize cell properties
export interface CellProps {
row: number;
col: number;
@@ -102,6 +103,7 @@ export class CollectionSchemaCell extends React.Component<CellProps> {
this.props.changeFocusedCellByIndex(this.props.row, this.props.col);
this.props.setPreviewDoc(this.props.rowProps.original);
+ console.log("click cell");
let url: string;
if (url = StrCast(this.props.rowProps.row.href)) {
try {
@@ -236,14 +238,69 @@ export class CollectionSchemaCell extends React.Component<CellProps> {
Field.IsField(cfield) ? Field.toScriptString(cfield) : "";
}}
SetValue={action((value: string) => {
+ // sets what is displayed after the user makes an input
let retVal = false;
if (value.startsWith(":=") || value.startsWith("=:=")) {
+ // decides how to compute a value when given either of the above strings
const script = value.substring(value.startsWith("=:=") ? 3 : 2);
retVal = this.props.setComputed(script, value.startsWith(":=") ? this._rowDataDoc : this._rowDoc, this.renderFieldKey, this.props.row, this.props.col);
} else {
- const inputscript = value.substring(value.startsWith("=") ? 1 : 0);
- const script = CompileScript(inputscript, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } });
- script.compiled && (retVal = this.applyToDoc(inputscript.length !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run));
+ // check if the input is a number
+ let inputIsNum = true;
+ for (const s of value) {
+ if (isNaN(parseInt(s)) && !(s === ".") && !(s === ",")) {
+ inputIsNum = false;
+ }
+ }
+ // check if the input is a boolean
+ const inputIsBool: boolean = value === "false" || value === "true";
+ // what to do in the case
+ if (!inputIsNum && !inputIsBool && !value.startsWith("=")) {
+ // if it's not a number, it's a string, and should be processed as such
+ // strips the string of quotes when it is edited to prevent quotes form being added to the text automatically
+ // after each edit
+ let valueSansQuotes = value;
+ if (this._isEditing) {
+ const vsqLength = valueSansQuotes.length;
+ // get rid of outer quotes
+ valueSansQuotes = valueSansQuotes.substring(value.startsWith("\"") ? 1 : 0,
+ valueSansQuotes.charAt(vsqLength - 1) === "\"" ? vsqLength - 1 : vsqLength);
+ }
+ let inputAsString = '"';
+ // escape any quotes in the string
+ for (const i of valueSansQuotes) {
+ if (i === '"') {
+ inputAsString += '\\"';
+ } else {
+ inputAsString += i;
+ }
+ }
+ // add a closing quote
+ inputAsString += '"';
+ //two options here: we can strip off outer quotes or we can figure out what's going on with the script
+ const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } });
+ const changeMade = inputAsString.length !== value.length || inputAsString.length - 2 !== value.length;
+ script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run));
+ // handle numbers and expressions
+ } else if (inputIsNum || value.startsWith("=")) {
+ //TODO: make accept numbers
+ const inputscript = value.substring(value.startsWith("=") ? 1 : 0);
+ // if commas are not stripped, the parser only considers the numbers after the last comma
+ let inputSansCommas = "";
+ for (const s of inputscript) {
+ if (!(s === ",")) {
+ inputSansCommas += s;
+ }
+ }
+ const script = CompileScript(inputSansCommas, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } });
+ const changeMade = value.length !== value.length || value.length - 2 !== value.length;
+ script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run));
+ // handle booleans
+ } else if (inputIsBool) {
+ const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } });
+ const changeMade = value.length !== value.length || value.length - 2 !== value.length;
+ script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run));
+ }
}
if (retVal) {
this._isEditing = false; // need to set this here. otherwise, the assignment of the field will invalidate & cause render() to be called with the wrong value for 'editing'
@@ -318,7 +375,7 @@ export class CollectionSchemaDocCell extends CollectionSchemaCell {
const script = CompileScript(value, {
addReturn: true,
- typecheck: false,
+ typecheck: true,
transformer: DocumentIconContainer.getTransformer()
});
diff --git a/src/client/views/collections/CollectionSchemaHeaders.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx
index c98dcd1d0..aaa50ba67 100644
--- a/src/client/views/collections/CollectionSchemaHeaders.tsx
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx
@@ -3,16 +3,16 @@ import { IconProp, library } from "@fortawesome/fontawesome-svg-core";
import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { action, computed, observable, runInAction } from "mobx";
import { observer } from "mobx-react";
-import { Doc, DocListCast, Opt } from "../../../fields/Doc";
-import { listSpec } from "../../../fields/Schema";
-import { PastelSchemaPalette, SchemaHeaderField } from "../../../fields/SchemaHeaderField";
-import { ScriptField } from "../../../fields/ScriptField";
-import { Cast, StrCast } from "../../../fields/Types";
-import { undoBatch } from "../../util/UndoManager";
-import { SearchBox } from "../search/SearchBox";
+import { Doc, DocListCast, Opt } from "../../../../fields/Doc";
+import { listSpec } from "../../../../fields/Schema";
+import { PastelSchemaPalette, SchemaHeaderField } from "../../../../fields/SchemaHeaderField";
+import { ScriptField } from "../../../../fields/ScriptField";
+import { Cast, StrCast } from "../../../../fields/Types";
+import { undoBatch } from "../../../util/UndoManager";
+import { SearchBox } from "../../search/SearchBox";
import { ColumnType } from "./CollectionSchemaView";
import "./CollectionSchemaView.scss";
-import { CollectionView } from "./CollectionView";
+import { CollectionView } from "../CollectionView";
const higflyout = require("@hig/flyout");
export const { anchorPoints } = higflyout;
diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaMovableColumn.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaMovableColumn.tsx
new file mode 100644
index 000000000..456c38c68
--- /dev/null
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaMovableColumn.tsx
@@ -0,0 +1,128 @@
+import React = require("react");
+import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
+import { action } from "mobx";
+import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table";
+import { Doc } from "../../../../fields/Doc";
+import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField";
+import { Cast, FieldValue, StrCast } from "../../../../fields/Types";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { DragManager, dropActionType, SetupDrag } from "../../../util/DragManager";
+import { SnappingManager } from "../../../util/SnappingManager";
+import { Transform } from "../../../util/Transform";
+import { undoBatch } from "../../../util/UndoManager";
+import { ContextMenu } from "../../ContextMenu";
+import "./CollectionSchemaView.scss";
+
+export interface MovableColumnProps {
+ columnRenderer: TableCellRenderer;
+ columnValue: SchemaHeaderField;
+ allColumns: SchemaHeaderField[];
+ reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columns: SchemaHeaderField[]) => void;
+ ScreenToLocalTransform: () => Transform;
+}
+export class MovableColumn extends React.Component<MovableColumnProps> {
+ private _header?: React.RefObject<HTMLDivElement> = React.createRef();
+ private _colDropDisposer?: DragManager.DragDropDisposer;
+ private _startDragPosition: { x: number, y: number } = { x: 0, y: 0 };
+ private _sensitivity: number = 16;
+ private _dragRef: React.RefObject<HTMLDivElement> = React.createRef();
+
+ onPointerEnter = (e: React.PointerEvent): void => {
+ if (e.buttons === 1 && SnappingManager.GetIsDragging()) {
+ this._header!.current!.className = "collectionSchema-col-wrapper";
+ document.addEventListener("pointermove", this.onDragMove, true);
+ }
+ }
+ onPointerLeave = (e: React.PointerEvent): void => {
+ this._header!.current!.className = "collectionSchema-col-wrapper";
+ document.removeEventListener("pointermove", this.onDragMove, true);
+ !e.buttons && document.removeEventListener("pointermove", this.onPointerMove);
+ }
+ onDragMove = (e: PointerEvent): void => {
+ const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY);
+ const rect = this._header!.current!.getBoundingClientRect();
+ const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top);
+ const before = x[0] < bounds[0];
+ this._header!.current!.className = "collectionSchema-col-wrapper";
+ if (before) this._header!.current!.className += " col-before";
+ if (!before) this._header!.current!.className += " col-after";
+ e.stopPropagation();
+ }
+
+ createColDropTarget = (ele: HTMLDivElement) => {
+ this._colDropDisposer?.();
+ if (ele) {
+ this._colDropDisposer = DragManager.MakeDropTarget(ele, this.colDrop.bind(this));
+ }
+ }
+
+ colDrop = (e: Event, de: DragManager.DropEvent) => {
+ document.removeEventListener("pointermove", this.onDragMove, true);
+ const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y);
+ const rect = this._header!.current!.getBoundingClientRect();
+ const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top);
+ const before = x[0] < bounds[0];
+ const colDragData = de.complete.columnDragData;
+ if (colDragData) {
+ e.stopPropagation();
+ this.props.reorderColumns(colDragData.colKey, this.props.columnValue, before, this.props.allColumns);
+ return true;
+ }
+ return false;
+ }
+
+ onPointerMove = (e: PointerEvent) => {
+ const onRowMove = (e: PointerEvent) => {
+ e.stopPropagation();
+ e.preventDefault();
+
+ document.removeEventListener("pointermove", onRowMove);
+ document.removeEventListener('pointerup', onRowUp);
+ const dragData = new DragManager.ColumnDragData(this.props.columnValue);
+ DragManager.StartColumnDrag(this._dragRef.current!, dragData, e.x, e.y);
+ };
+ const onRowUp = (): void => {
+ document.removeEventListener("pointermove", onRowMove);
+ document.removeEventListener('pointerup', onRowUp);
+ };
+ if (e.buttons === 1) {
+ const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX - this._startDragPosition.x, e.clientY - this._startDragPosition.y);
+ if (Math.abs(dx) + Math.abs(dy) > this._sensitivity) {
+ document.removeEventListener("pointermove", this.onPointerMove);
+ e.stopPropagation();
+
+ document.addEventListener("pointermove", onRowMove);
+ document.addEventListener("pointerup", onRowUp);
+ }
+ }
+ }
+
+ onPointerUp = (e: React.PointerEvent) => {
+ document.removeEventListener("pointermove", this.onPointerMove);
+ }
+
+ @action
+ onPointerDown = (e: React.PointerEvent, ref: React.RefObject<HTMLDivElement>) => {
+ this._dragRef = ref;
+ const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX, e.clientY);
+ if (!(e.target as any)?.tagName.includes("INPUT")) {
+ this._startDragPosition = { x: dx, y: dy };
+ document.addEventListener("pointermove", this.onPointerMove);
+ }
+ }
+
+
+ render() {
+ const reference = React.createRef<HTMLDivElement>();
+
+ return (
+ <div className="collectionSchema-col" ref={this.createColDropTarget}>
+ <div className="collectionSchema-col-wrapper" ref={this._header} onPointerEnter={this.onPointerEnter} onPointerLeave={this.onPointerLeave}>
+ <div className="col-dragger" ref={reference} onPointerDown={e => this.onPointerDown(e, reference)} onPointerUp={this.onPointerUp}>
+ {this.props.columnRenderer}
+ </div>
+ </div>
+ </div>
+ );
+ }
+}
diff --git a/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx
index 881246bd4..f48906ba5 100644
--- a/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx
@@ -2,131 +2,17 @@ import React = require("react");
import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { action } from "mobx";
import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table";
-import { Doc } from "../../../fields/Doc";
-import { SchemaHeaderField } from "../../../fields/SchemaHeaderField";
-import { Cast, FieldValue, StrCast } from "../../../fields/Types";
-import { DocumentManager } from "../../util/DocumentManager";
-import { DragManager, dropActionType, SetupDrag } from "../../util/DragManager";
-import { SnappingManager } from "../../util/SnappingManager";
-import { Transform } from "../../util/Transform";
-import { undoBatch } from "../../util/UndoManager";
-import { ContextMenu } from "../ContextMenu";
+import { Doc } from "../../../../fields/Doc";
+import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField";
+import { Cast, FieldValue, StrCast } from "../../../../fields/Types";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { DragManager, dropActionType, SetupDrag } from "../../../util/DragManager";
+import { SnappingManager } from "../../../util/SnappingManager";
+import { Transform } from "../../../util/Transform";
+import { undoBatch } from "../../../util/UndoManager";
+import { ContextMenu } from "../../ContextMenu";
import "./CollectionSchemaView.scss";
-export interface MovableColumnProps {
- columnRenderer: TableCellRenderer;
- columnValue: SchemaHeaderField;
- allColumns: SchemaHeaderField[];
- reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columns: SchemaHeaderField[]) => void;
- ScreenToLocalTransform: () => Transform;
-}
-export class MovableColumn extends React.Component<MovableColumnProps> {
- private _header?: React.RefObject<HTMLDivElement> = React.createRef();
- private _colDropDisposer?: DragManager.DragDropDisposer;
- private _startDragPosition: { x: number, y: number } = { x: 0, y: 0 };
- private _sensitivity: number = 16;
- private _dragRef: React.RefObject<HTMLDivElement> = React.createRef();
-
- onPointerEnter = (e: React.PointerEvent): void => {
- if (e.buttons === 1 && SnappingManager.GetIsDragging()) {
- this._header!.current!.className = "collectionSchema-col-wrapper";
- document.addEventListener("pointermove", this.onDragMove, true);
- }
- }
- onPointerLeave = (e: React.PointerEvent): void => {
- this._header!.current!.className = "collectionSchema-col-wrapper";
- document.removeEventListener("pointermove", this.onDragMove, true);
- !e.buttons && document.removeEventListener("pointermove", this.onPointerMove);
- }
- onDragMove = (e: PointerEvent): void => {
- const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY);
- const rect = this._header!.current!.getBoundingClientRect();
- const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top);
- const before = x[0] < bounds[0];
- this._header!.current!.className = "collectionSchema-col-wrapper";
- if (before) this._header!.current!.className += " col-before";
- if (!before) this._header!.current!.className += " col-after";
- e.stopPropagation();
- }
-
- createColDropTarget = (ele: HTMLDivElement) => {
- this._colDropDisposer?.();
- if (ele) {
- this._colDropDisposer = DragManager.MakeDropTarget(ele, this.colDrop.bind(this));
- }
- }
-
- colDrop = (e: Event, de: DragManager.DropEvent) => {
- document.removeEventListener("pointermove", this.onDragMove, true);
- const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y);
- const rect = this._header!.current!.getBoundingClientRect();
- const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top);
- const before = x[0] < bounds[0];
- const colDragData = de.complete.columnDragData;
- if (colDragData) {
- e.stopPropagation();
- this.props.reorderColumns(colDragData.colKey, this.props.columnValue, before, this.props.allColumns);
- return true;
- }
- return false;
- }
-
- onPointerMove = (e: PointerEvent) => {
- const onRowMove = (e: PointerEvent) => {
- e.stopPropagation();
- e.preventDefault();
-
- document.removeEventListener("pointermove", onRowMove);
- document.removeEventListener('pointerup', onRowUp);
- const dragData = new DragManager.ColumnDragData(this.props.columnValue);
- DragManager.StartColumnDrag(this._dragRef.current!, dragData, e.x, e.y);
- };
- const onRowUp = (): void => {
- document.removeEventListener("pointermove", onRowMove);
- document.removeEventListener('pointerup', onRowUp);
- };
- if (e.buttons === 1) {
- const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX - this._startDragPosition.x, e.clientY - this._startDragPosition.y);
- if (Math.abs(dx) + Math.abs(dy) > this._sensitivity) {
- document.removeEventListener("pointermove", this.onPointerMove);
- e.stopPropagation();
-
- document.addEventListener("pointermove", onRowMove);
- document.addEventListener("pointerup", onRowUp);
- }
- }
- }
-
- onPointerUp = (e: React.PointerEvent) => {
- document.removeEventListener("pointermove", this.onPointerMove);
- }
-
- @action
- onPointerDown = (e: React.PointerEvent, ref: React.RefObject<HTMLDivElement>) => {
- this._dragRef = ref;
- const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX, e.clientY);
- if (!(e.target as any)?.tagName.includes("INPUT")) {
- this._startDragPosition = { x: dx, y: dy };
- document.addEventListener("pointermove", this.onPointerMove);
- }
- }
-
-
- render() {
- const reference = React.createRef<HTMLDivElement>();
-
- return (
- <div className="collectionSchema-col" ref={this.createColDropTarget}>
- <div className="collectionSchema-col-wrapper" ref={this._header} onPointerEnter={this.onPointerEnter} onPointerLeave={this.onPointerLeave}>
- <div className="col-dragger" ref={reference} onPointerDown={e => this.onPointerDown(e, reference)} onPointerUp={this.onPointerUp}>
- {this.props.columnRenderer}
- </div>
- </div>
- </div>
- );
- }
-}
-
export interface MovableRowProps {
rowInfo: RowInfo;
ScreenToLocalTransform: () => Transform;
@@ -143,16 +29,20 @@ export class MovableRow extends React.Component<MovableRowProps> {
private _header?: React.RefObject<HTMLDivElement> = React.createRef();
private _rowDropDisposer?: DragManager.DragDropDisposer;
+ // Event listeners are only necessary when the user is hovering over the table
+ // Create one when the mouse starts hovering...
onPointerEnter = (e: React.PointerEvent): void => {
if (e.buttons === 1 && SnappingManager.GetIsDragging()) {
this._header!.current!.className = "collectionSchema-row-wrapper";
document.addEventListener("pointermove", this.onDragMove, true);
}
}
+ // ... and delete it when the mouse leaves
onPointerLeave = (e: React.PointerEvent): void => {
this._header!.current!.className = "collectionSchema-row-wrapper";
document.removeEventListener("pointermove", this.onDragMove, true);
}
+ // The method for the event listener, reorders columns when dragged to their new locations.
onDragMove = (e: PointerEvent): void => {
const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY);
const rect = this._header!.current!.getBoundingClientRect();
@@ -167,14 +57,14 @@ export class MovableRow extends React.Component<MovableRowProps> {
this._rowDropDisposer?.();
}
-
+ //
createRowDropTarget = (ele: HTMLDivElement) => {
this._rowDropDisposer?.();
if (ele) {
this._rowDropDisposer = DragManager.MakeDropTarget(ele, this.rowDrop.bind(this));
}
}
-
+ // Controls what hppens when a row is dragged and dropped
rowDrop = (e: Event, de: DragManager.DropEvent) => {
this.onPointerLeave(e as any);
const rowDoc = FieldValue(Cast(this.props.rowInfo.original, Doc));
@@ -201,7 +91,6 @@ export class MovableRow extends React.Component<MovableRowProps> {
}
onRowContextMenu = (e: React.MouseEvent): void => {
- e.preventDefault();
const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row";
ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" });
}
diff --git a/src/client/views/collections/CollectionSchemaView.scss b/src/client/views/collections/collectionSchema/CollectionSchemaView.scss
index 2bdd280ec..40cdcd14b 100644
--- a/src/client/views/collections/CollectionSchemaView.scss
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaView.scss
@@ -1,8 +1,7 @@
-@import "../globalCssVariables";
-
+@import "../../global/globalCssVariables.scss";
.collectionSchemaView-container {
border-width: $COLLECTION_BORDER_WIDTH;
- border-color: $intermediate-color;
+ border-color: $medium-gray;
border-style: solid;
border-radius: $border-radius;
box-sizing: border-box;
@@ -16,17 +15,13 @@
justify-content: space-between;
flex-wrap: nowrap;
touch-action: none;
-
div {
touch-action: none;
}
-
-
.collectionSchemaView-tableContainer {
width: 100%;
height: 100%;
}
-
.collectionSchemaView-dividerDragger {
position: relative;
height: 100%;
@@ -37,15 +32,14 @@
background: gray;
cursor: col-resize;
}
-
// .documentView-node:first-child {
- // background: $light-color;
+ // background: $white;
// }
}
.collectionSchemaView-searchContainer {
border-width: $COLLECTION_BORDER_WIDTH;
- border-color: $intermediate-color;
+ border-color: $medium-gray;
border-style: solid;
border-radius: $border-radius;
box-sizing: border-box;
@@ -60,17 +54,13 @@
flex-wrap: nowrap;
touch-action: none;
padding: 2px;
-
div {
touch-action: none;
}
-
-
.collectionSchemaView-tableContainer {
width: 100%;
height: 100%;
}
-
.collectionSchemaView-dividerDragger {
position: relative;
height: 100%;
@@ -81,9 +71,8 @@
background: gray;
cursor: col-resize;
}
-
// .documentView-node:first-child {
- // background: $light-color;
+ // background: $white;
// }
}
@@ -93,7 +82,6 @@
box-sizing: border-box;
border: none !important;
float: none !important;
-
.rt-table {
height: 100%;
display: -webkit-inline-box;
@@ -103,12 +91,10 @@
.rt-noData {
display: none;
}
-
.rt-thead {
width: 100%;
z-index: 100;
overflow-y: visible;
-
&.-header {
font-size: 12px;
height: 30px;
@@ -116,12 +102,10 @@
z-index: 100;
overflow-y: visible;
}
-
.rt-resizable-header-content {
height: 100%;
overflow: visible;
}
-
.rt-th {
padding: 0;
border: solid lightgray;
@@ -129,38 +113,31 @@
border-bottom: 2px solid lightgray;
}
}
-
.rt-th {
font-size: 13px;
text-align: center;
-
&:last-child {
overflow: visible;
}
}
-
.rt-tbody {
width: 100%;
direction: rtl;
overflow: visible;
-
.rt-td {
border-right: 1px solid rgba(0, 0, 0, 0.2);
}
}
-
.rt-tr-group {
direction: ltr;
flex: 0 1 auto;
min-height: 30px;
border: 0 !important;
}
-
.rt-tr {
width: 100%;
min-height: 30px;
}
-
.rt-td {
padding: 0;
font-size: 13px;
@@ -168,18 +145,15 @@
white-space: nowrap;
display: flex;
align-items: center;
-
.imageBox-cont {
position: relative;
max-height: 100%;
}
-
.imageBox-cont img {
object-fit: contain;
max-width: 100%;
height: 100%;
}
-
.videoBox-cont {
object-fit: contain;
width: auto;
@@ -191,20 +165,16 @@
align-items: center;
height: inherit;
}
-
.rt-resizer {
width: 8px;
right: -4px;
}
-
.rt-resizable-header {
padding: 0;
height: 30px;
}
-
.rt-resizable-header:last-child {
overflow: visible;
-
.rt-resizer {
width: 5px !important;
}
@@ -221,7 +191,6 @@
height: 100%;
}
-
.collectionSchema-header-menu {
height: auto;
z-index: 100;
@@ -231,7 +200,6 @@
position: fixed;
background: white;
border: black 1px solid;
-
.collectionSchema-header-toggler {
z-index: 100;
width: 100%;
@@ -239,7 +207,6 @@
padding: 4px;
letter-spacing: 2px;
text-transform: uppercase;
-
svg {
margin-right: 4px;
}
@@ -264,75 +231,62 @@ button.add-column {
color: black;
width: 180px;
text-align: left;
-
.collectionSchema-headerMenu-group {
padding: 7px 0;
border-bottom: 1px solid lightgray;
cursor: pointer;
-
&:first-child {
padding-top: 0;
}
-
&:last-child {
border: none;
text-align: center;
padding: 12px 0 0 0;
}
}
-
label {
- color: $main-accent;
+ color: $medium-gray;
font-weight: normal;
letter-spacing: 2px;
text-transform: uppercase;
}
-
input {
color: black;
width: 100%;
}
-
.columnMenu-option {
cursor: pointer;
padding: 3px;
background-color: white;
transition: background-color 0.2s;
-
&:hover {
- background-color: $light-color-secondary;
+ background-color: $light-gray;
}
-
&.active {
font-weight: bold;
- border: 2px solid $light-color-secondary;
+ border: 2px solid $light-gray;
}
-
svg {
color: gray;
margin-right: 5px;
width: 10px;
}
}
-
.keys-dropdown {
position: relative;
//width: 100%;
background-color: white;
-
input {
- border: 2px solid $light-color-secondary;
+ border: 2px solid $light-gray;
padding: 3px;
height: 28px;
font-weight: bold;
letter-spacing: "2px";
text-transform: "uppercase";
-
&:focus {
font-weight: normal;
}
}
-
.keys-options-wrapper {
width: 100%;
max-height: 150px;
@@ -341,34 +295,28 @@ button.add-column {
top: 28px;
box-shadow: 0 10px 16px rgba(0, 0, 0, 0.1);
background-color: white;
-
.key-option {
background-color: white;
border: 1px solid lightgray;
padding: 2px 3px;
-
&:not(:first-child) {
border-top: 0;
}
-
&:hover {
- background-color: $light-color-secondary;
+ background-color: $light-gray;
}
}
}
}
-
.columnMenu-colors {
display: flex;
justify-content: space-between;
flex-wrap: wrap;
-
.columnMenu-colorPicker {
cursor: pointer;
width: 20px;
height: 20px;
border-radius: 10px;
-
&.active {
border: 2px solid white;
box-shadow: 0 0 0 2px lightgray;
@@ -380,17 +328,14 @@ button.add-column {
.collectionSchema-row {
height: 100%;
background-color: white;
-
&.row-focused .rt-td {
- background-color: #bfffc0; //$light-color-secondary;
+ background-color: #bfffc0; //$light-gray;
}
-
&.row-wrapped {
.rt-td {
white-space: normal;
}
}
-
.row-dragger {
display: flex;
justify-content: space-around;
@@ -403,7 +348,6 @@ button.add-column {
color: lightgray;
background-color: white;
transition: color 0.1s ease;
-
.row-option {
// padding: 5px;
cursor: pointer;
@@ -413,27 +357,21 @@ button.add-column {
flex-direction: column;
justify-content: center;
z-index: 2;
-
&:hover {
color: gray;
}
}
}
-
.collectionSchema-row-wrapper {
-
&.row-above {
border-top: 1px solid red;
}
-
&.row-below {
border-bottom: 1px solid red;
}
-
&.row-inside {
border: 1px solid red;
}
-
.row-dragging {
background-color: blue;
}
@@ -450,16 +388,12 @@ button.add-column {
padding: 4px;
text-align: left;
padding-left: 19px;
-
position: relative;
-
&:focus {
outline: none;
}
-
&.editing {
padding: 0;
-
input {
outline: 0;
border: none;
@@ -470,50 +404,36 @@ button.add-column {
min-height: 26px;
}
}
-
&.focused {
-
&.inactive {
border: none;
}
}
-
p {
width: 100%;
height: 100%;
}
-
&:hover .collectionSchemaView-cellContents-docExpander {
display: block;
}
-
-
.collectionSchemaView-cellContents-document {
display: inline-block;
}
-
.collectionSchemaView-cellContents-docButton {
float: right;
width: "15px";
height: "15px";
}
-
.collectionSchemaView-dropdownWrapper {
-
border: grey;
border-style: solid;
border-width: 1px;
height: 30px;
-
.collectionSchemaView-dropdownButton {
-
//display: inline-block;
float: left;
height: 100%;
-
-
}
-
.collectionSchemaView-dropdownText {
display: inline-block;
//float: right;
@@ -523,14 +443,11 @@ button.add-column {
justify-content: "center";
align-items: "center";
}
-
}
-
.collectionSchemaView-dropdownContainer {
position: absolute;
border: 1px solid rgba(0, 0, 0, 0.04);
box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14);
-
.collectionSchemaView-dropdownOption:hover {
background-color: rgba(0, 0, 0, 0.14);
cursor: pointer;
@@ -546,7 +463,6 @@ button.add-column {
top: 0;
right: 0;
background-color: lightgray;
-
}
.doc-drag-over {
@@ -563,7 +479,6 @@ button.add-column {
justify-content: flex-end;
padding: 0 10px;
border-bottom: 2px solid gray;
-
.collectionSchemaView-toolbar-item {
display: flex;
flex-direction: column;
@@ -586,27 +501,24 @@ button.add-column {
.rt-td.rt-expandable {
overflow: visible;
position: relative;
- height:100%;
+ height: 100%;
z-index: 1;
}
+
.reactTable-sub {
background-color: rgb(252, 252, 252);
width: 100%;
-
.rt-thead {
display: none;
}
-
.row-dragger {
background-color: rgb(252, 252, 252);
}
-
.rt-table {
background-color: rgb(252, 252, 252);
}
-
.collectionSchemaView-table {
- width: 100%;
+ width: 100%;
border: solid 1px;
overflow: visible;
padding: 0px;
@@ -621,7 +533,6 @@ button.add-column {
width: 20;
height: auto;
left: 55;
-
svg {
position: absolute;
top: 50%;
diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx
new file mode 100644
index 000000000..fed64b620
--- /dev/null
+++ b/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx
@@ -0,0 +1,575 @@
+import React = require("react");
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
+import { action, computed, observable, untracked } from "mobx";
+import { observer } from "mobx-react";
+import Measure from "react-measure";
+import { Resize } from "react-table";
+import "react-table/react-table.css";
+import { Doc, Opt } from "../../../../fields/Doc";
+import { List } from "../../../../fields/List";
+import { listSpec } from "../../../../fields/Schema";
+import { PastelSchemaPalette, SchemaHeaderField } from "../../../../fields/SchemaHeaderField";
+import { Cast, NumCast } from "../../../../fields/Types";
+import { TraceMobx } from "../../../../fields/util";
+import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents } from "../../../../Utils";
+import { DocUtils } from "../../../documents/Documents";
+import { SelectionManager } from "../../../util/SelectionManager";
+import { SnappingManager } from "../../../util/SnappingManager";
+import { Transform } from "../../../util/Transform";
+import { undoBatch } from "../../../util/UndoManager";
+import '../../../views/DocumentDecorations.scss';
+import { ContextMenu } from "../../ContextMenu";
+import { ContextMenuProps } from "../../ContextMenuItem";
+import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../global/globalCssVariables.scss';
+import { DocumentView } from "../../nodes/DocumentView";
+import { DefaultStyleProvider } from "../../StyleProvider";
+import { CollectionSubView } from "../CollectionSubView";
+import "./CollectionSchemaView.scss";
+import { SchemaTable } from "./SchemaTable";
+// bcz: need to add drag and drop of rows and columns. This seems like it might work for rows: https://codesandbox.io/s/l94mn1q657
+
+export enum ColumnType {
+ Any,
+ Number,
+ String,
+ Boolean,
+ Doc,
+ Image,
+ List,
+ Date
+}
+// this map should be used for keys that should have a const type of value
+const columnTypes: Map<string, ColumnType> = new Map([
+ ["title", ColumnType.String],
+ ["x", ColumnType.Number], ["y", ColumnType.Number], ["_width", ColumnType.Number], ["_height", ColumnType.Number],
+ ["_nativeWidth", ColumnType.Number], ["_nativeHeight", ColumnType.Number], ["isPrototype", ColumnType.Boolean],
+ ["_curPage", ColumnType.Number], ["_currentTimecode", ColumnType.Number], ["zIndex", ColumnType.Number]
+]);
+
+@observer
+export class CollectionSchemaView extends CollectionSubView(doc => doc) {
+ private _previewCont?: HTMLDivElement;
+
+ @observable _previewDoc: Doc | undefined = undefined;
+ @observable _focusedTable: Doc = this.props.Document;
+ @observable _col: any = "";
+ @observable _menuWidth = 0;
+ @observable _headerOpen = false;
+ @observable _headerIsEditing = false;
+ @observable _menuHeight = 0;
+ @observable _pointerX = 0;
+ @observable _pointerY = 0;
+ @observable _openTypes: boolean = false;
+
+ @computed get previewWidth() { return () => NumCast(this.props.Document.schemaPreviewWidth); }
+ @computed get previewHeight() { return () => this.props.PanelHeight() - 2 * this.borderWidth; }
+ @computed get tableWidth() { return this.props.PanelWidth() - 2 * this.borderWidth - Number(SCHEMA_DIVIDER_WIDTH) - this.previewWidth(); }
+ @computed get borderWidth() { return Number(COLLECTION_BORDER_WIDTH); }
+ @computed get scale() { return this.props.ScreenToLocalTransform().Scale; }
+ @computed get columns() { return Cast(this.props.Document._schemaHeaders, listSpec(SchemaHeaderField), []); }
+ set columns(columns: SchemaHeaderField[]) { this.props.Document._schemaHeaders = new List<SchemaHeaderField>(columns); }
+
+ @computed get menuCoordinates() {
+ let searchx = 0;
+ let searchy = 0;
+ if (this.props.Document._searchDoc) {
+ const el = document.getElementsByClassName("collectionSchemaView-searchContainer")[0];
+ if (el !== undefined) {
+ const rect = el.getBoundingClientRect();
+ searchx = rect.x;
+ searchy = rect.y;
+ }
+ }
+ const x = Math.max(0, Math.min(document.body.clientWidth - this._menuWidth, this._pointerX)) - searchx;
+ const y = Math.max(0, Math.min(document.body.clientHeight - this._menuHeight, this._pointerY)) - searchy;
+ return this.props.ScreenToLocalTransform().transformPoint(x, y);
+ }
+
+ get documentKeys() {
+ const docs = this.childDocs;
+ const keys: { [key: string]: boolean } = {};
+ // bcz: ugh. this is untracked since otherwise a large collection of documents will blast the server for all their fields.
+ // then as each document's fields come back, we update the documents _proxies. Each time we do this, the whole schema will be
+ // invalidated and re-rendered. This workaround will inquire all of the document fields before the options button is clicked.
+ // then by the time the options button is clicked, all of the fields should be in place. If a new field is added while this menu
+ // is displayed (unlikely) it won't show up until something else changes.
+ //TODO Types
+ untracked(() => docs.map(doc => Doc.GetAllPrototypes(doc).map(proto => Object.keys(proto).forEach(key => keys[key] = false))));
+
+ this.columns.forEach(key => keys[key.heading] = true);
+ return Array.from(Object.keys(keys));
+ }
+
+ @action setHeaderIsEditing = (isEditing: boolean) => this._headerIsEditing = isEditing;
+
+ @undoBatch
+ setColumnType = action((columnField: SchemaHeaderField, type: ColumnType): void => {
+ this._openTypes = false;
+ if (columnTypes.get(columnField.heading)) return;
+
+ const columns = this.columns;
+ const index = columns.indexOf(columnField);
+ if (index > -1) {
+ columnField.setType(NumCast(type));
+ columns[index] = columnField;
+ this.columns = columns;
+ }
+ });
+
+ @undoBatch
+ setColumnColor = (columnField: SchemaHeaderField, color: string): void => {
+ const columns = this.columns;
+ const index = columns.indexOf(columnField);
+ if (index > -1) {
+ columnField.setColor(color);
+ columns[index] = columnField;
+ this.columns = columns; // need to set the columns to trigger rerender
+ }
+ }
+
+ @undoBatch
+ @action
+ setColumnSort = (columnField: SchemaHeaderField, descending: boolean | undefined) => {
+ const columns = this.columns;
+ columns.forEach(col => col.setDesc(undefined));
+
+ const index = columns.findIndex(c => c.heading === columnField.heading);
+ const column = columns[index];
+ column.setDesc(descending);
+ columns[index] = column;
+ this.columns = columns;
+ }
+
+ renderTypes = (col: any) => {
+ if (columnTypes.get(col.heading)) return (null);
+
+ const type = col.type;
+
+ const anyType = <div className={"columnMenu-option" + (type === ColumnType.Any ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Any)}>
+ <FontAwesomeIcon icon={"align-justify"} size="sm" />
+ Any
+ </div>;
+
+ const numType = <div className={"columnMenu-option" + (type === ColumnType.Number ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Number)}>
+ <FontAwesomeIcon icon={"hashtag"} size="sm" />
+ Number
+ </div>;
+
+ const textType = <div className={"columnMenu-option" + (type === ColumnType.String ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.String)}>
+ <FontAwesomeIcon icon={"font"} size="sm" />
+ Text
+ </div>;
+
+ const boolType = <div className={"columnMenu-option" + (type === ColumnType.Boolean ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Boolean)}>
+ <FontAwesomeIcon icon={"check-square"} size="sm" />
+ Checkbox
+ </div>;
+
+ const listType = <div className={"columnMenu-option" + (type === ColumnType.List ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.List)}>
+ <FontAwesomeIcon icon={"list-ul"} size="sm" />
+ List
+ </div>;
+
+ const docType = <div className={"columnMenu-option" + (type === ColumnType.Doc ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Doc)}>
+ <FontAwesomeIcon icon={"file"} size="sm" />
+ Document
+ </div>;
+
+ const imageType = <div className={"columnMenu-option" + (type === ColumnType.Image ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Image)}>
+ <FontAwesomeIcon icon={"image"} size="sm" />
+ Image
+ </div>;
+
+ const dateType = <div className={"columnMenu-option" + (type === ColumnType.Date ? " active" : "")} onClick={() => this.setColumnType(col, ColumnType.Date)}>
+ <FontAwesomeIcon icon={"calendar"} size="sm" />
+ Date
+ </div>;
+
+
+ const allColumnTypes = <div className="columnMenu-types">
+ {anyType}
+ {numType}
+ {textType}
+ {boolType}
+ {listType}
+ {docType}
+ {imageType}
+ {dateType}
+ </div>;
+
+ const justColType = type === ColumnType.Any ? anyType : type === ColumnType.Number ? numType :
+ type === ColumnType.String ? textType : type === ColumnType.Boolean ? boolType :
+ type === ColumnType.List ? listType : type === ColumnType.Doc ? docType :
+ type === ColumnType.Date ? dateType : imageType;
+
+ return (
+ <div className="collectionSchema-headerMenu-group" onClick={action(() => this._openTypes = !this._openTypes)}>
+ <div>
+ <label style={{ cursor: "pointer" }}>Column type:</label>
+ <FontAwesomeIcon icon={"caret-down"} size="lg" style={{ float: "right", transform: `rotate(${this._openTypes ? "180deg" : 0})`, transition: "0.2s all ease" }} />
+ </div>
+ {this._openTypes ? allColumnTypes : justColType}
+ </div >
+ );
+ }
+
+ renderSorting = (col: any) => {
+ const sort = col.desc;
+ return (
+ <div className="collectionSchema-headerMenu-group">
+ <label>Sort by:</label>
+ <div className="columnMenu-sort">
+ <div className={"columnMenu-option" + (sort === true ? " active" : "")} onClick={() => this.setColumnSort(col, true)}>
+ <FontAwesomeIcon icon="sort-amount-down" size="sm" />
+ Sort descending
+ </div>
+ <div className={"columnMenu-option" + (sort === false ? " active" : "")} onClick={() => this.setColumnSort(col, false)}>
+ <FontAwesomeIcon icon="sort-amount-up" size="sm" />
+ Sort ascending
+ </div>
+ <div className="columnMenu-option" onClick={() => this.setColumnSort(col, undefined)}>
+ <FontAwesomeIcon icon="times" size="sm" />
+ Clear sorting
+ </div>
+ </div>
+ </div>
+ );
+ }
+
+ renderColors = (col: any) => {
+ const selected = col.color;
+
+ const pink = PastelSchemaPalette.get("pink2");
+ const purple = PastelSchemaPalette.get("purple2");
+ const blue = PastelSchemaPalette.get("bluegreen1");
+ const yellow = PastelSchemaPalette.get("yellow4");
+ const red = PastelSchemaPalette.get("red2");
+ const gray = "#f1efeb";
+
+ return (
+ <div className="collectionSchema-headerMenu-group">
+ <label>Color:</label>
+ <div className="columnMenu-colors">
+ <div className={"columnMenu-colorPicker" + (selected === pink ? " active" : "")} style={{ backgroundColor: pink }} onClick={() => this.setColumnColor(col, pink!)}></div>
+ <div className={"columnMenu-colorPicker" + (selected === purple ? " active" : "")} style={{ backgroundColor: purple }} onClick={() => this.setColumnColor(col, purple!)}></div>
+ <div className={"columnMenu-colorPicker" + (selected === blue ? " active" : "")} style={{ backgroundColor: blue }} onClick={() => this.setColumnColor(col, blue!)}></div>
+ <div className={"columnMenu-colorPicker" + (selected === yellow ? " active" : "")} style={{ backgroundColor: yellow }} onClick={() => this.setColumnColor(col, yellow!)}></div>
+ <div className={"columnMenu-colorPicker" + (selected === red ? " active" : "")} style={{ backgroundColor: red }} onClick={() => this.setColumnColor(col, red!)}></div>
+ <div className={"columnMenu-colorPicker" + (selected === gray ? " active" : "")} style={{ backgroundColor: gray }} onClick={() => this.setColumnColor(col, gray)}></div>
+ </div>
+ </div>
+ );
+ }
+
+ @undoBatch
+ @action
+ changeColumns = (oldKey: string, newKey: string, addNew: boolean, filter?: string) => {
+ const columns = this.columns;
+ if (columns === undefined) {
+ this.columns = new List<SchemaHeaderField>([new SchemaHeaderField(newKey, "f1efeb")]);
+ } else {
+ if (addNew) {
+ columns.push(new SchemaHeaderField(newKey, "f1efeb"));
+ this.columns = columns;
+ } else {
+ const index = columns.map(c => c.heading).indexOf(oldKey);
+ if (index > -1) {
+ const column = columns[index];
+ column.setHeading(newKey);
+ columns[index] = column;
+ this.columns = columns;
+ if (filter) {
+ Doc.setDocFilter(this.props.Document, newKey, filter, "match");
+ }
+ else {
+ this.props.Document._docFilters = undefined;
+ }
+ }
+ }
+ }
+ }
+
+ @action
+ openHeader = (col: any, screenx: number, screeny: number) => {
+ this._col = col;
+ this._headerOpen = true;
+ this._pointerX = screenx;
+ this._pointerY = screeny;
+ }
+
+ @action
+ closeHeader = () => { this._headerOpen = false; }
+
+ @undoBatch
+ @action
+ deleteColumn = (key: string) => {
+ const columns = this.columns;
+ if (columns === undefined) {
+ this.columns = new List<SchemaHeaderField>([]);
+ } else {
+ const index = columns.map(c => c.heading).indexOf(key);
+ if (index > -1) {
+ columns.splice(index, 1);
+ this.columns = columns;
+ }
+ }
+ this.closeHeader();
+ }
+
+ getPreviewTransform = (): Transform => {
+ return this.props.ScreenToLocalTransform().translate(- this.borderWidth - NumCast(COLLECTION_BORDER_WIDTH) - this.tableWidth, - this.borderWidth);
+ }
+
+ @action
+ onHeaderClick = (e: React.PointerEvent) => {
+ e.stopPropagation();
+ }
+
+ @action
+ onWheel(e: React.WheelEvent) {
+ const scale = this.props.ScreenToLocalTransform().Scale;
+ this.props.isContentActive(true) && e.stopPropagation();
+ }
+
+ @computed get renderMenuContent() {
+ TraceMobx();
+ return <div className="collectionSchema-header-menuOptions">
+ {this.renderTypes(this._col)}
+ {this.renderColors(this._col)}
+ <div className="collectionSchema-headerMenu-group">
+ <button onClick={() => { this.deleteColumn(this._col.heading); }}
+ >Delete Column</button>
+ </div>
+ </div>;
+ }
+
+ private createTarget = (ele: HTMLDivElement) => {
+ this._previewCont = ele;
+ super.CreateDropTarget(ele);
+ }
+
+ isFocused = (doc: Doc, outsideReaction: boolean): boolean => this.props.isSelected(outsideReaction) && doc === this._focusedTable;
+
+ @action setFocused = (doc: Doc) => this._focusedTable = doc;
+
+ @action setPreviewDoc = (doc: Opt<Doc>) => {
+ SelectionManager.SelectSchemaView(this, doc);
+ this._previewDoc = doc;
+ }
+
+ //toggles preview side-panel of schema
+ @action
+ toggleExpander = () => {
+ this.props.Document.schemaPreviewWidth = this.previewWidth() === 0 ? Math.min(this.tableWidth / 3, 200) : 0;
+ }
+
+ onDividerDown = (e: React.PointerEvent) => {
+ setupMoveUpEvents(this, e, this.onDividerMove, emptyFunction, this.toggleExpander);
+ }
+ @action
+ onDividerMove = (e: PointerEvent, down: number[], delta: number[]) => {
+ const nativeWidth = this._previewCont!.getBoundingClientRect();
+ const minWidth = 40;
+ const maxWidth = 1000;
+ const movedWidth = this.props.ScreenToLocalTransform().transformDirection(nativeWidth.right - e.clientX, 0)[0];
+ const width = movedWidth < minWidth ? minWidth : movedWidth > maxWidth ? maxWidth : movedWidth;
+ this.props.Document.schemaPreviewWidth = width;
+ return false;
+ }
+
+ onPointerDown = (e: React.PointerEvent): void => {
+ if (e.button === 0 && !e.altKey && !e.ctrlKey && !e.metaKey) {
+ if (this.props.isSelected(true)) e.stopPropagation();
+ else this.props.select(false);
+ }
+ }
+
+ @computed
+ get previewDocument(): Doc | undefined { return this._previewDoc; }
+
+ @computed
+ get dividerDragger() {
+ return this.previewWidth() === 0 ? (null) :
+ <div className="collectionSchemaView-dividerDragger" onPointerDown={this.onDividerDown} >
+ <div className="collectionSchemaView-dividerDragger" />
+ </div>;
+ }
+
+ @computed
+ get previewPanel() {
+ return <div ref={this.createTarget} style={{ width: `${this.previewWidth()}px` }}>
+ {!this.previewDocument ? (null) :
+ <DocumentView
+ Document={this.previewDocument}
+ DataDoc={undefined}
+ fitContentsToDoc={returnTrue}
+ freezeDimensions={true}
+ dontCenter={"y"}
+ focus={DocUtils.DefaultFocus}
+ renderDepth={this.props.renderDepth}
+ rootSelected={this.rootSelected}
+ PanelWidth={this.previewWidth}
+ PanelHeight={this.previewHeight}
+ isContentActive={returnTrue}
+ isDocumentActive={returnFalse}
+ ScreenToLocalTransform={this.getPreviewTransform}
+ docFilters={this.childDocFilters}
+ docRangeFilters={this.childDocRangeFilters}
+ searchFilterDocs={this.searchFilterDocs}
+ styleProvider={DefaultStyleProvider}
+ layerProvider={undefined}
+ docViewPath={returnEmptyDoclist}
+ ContainingCollectionDoc={this.props.CollectionView?.props.Document}
+ ContainingCollectionView={this.props.CollectionView}
+ moveDocument={this.props.moveDocument}
+ addDocument={this.props.addDocument}
+ removeDocument={this.props.removeDocument}
+ whenChildContentsActiveChanged={this.props.whenChildContentsActiveChanged}
+ addDocTab={this.props.addDocTab}
+ pinToPres={this.props.pinToPres}
+ bringToFront={returnFalse}
+ />}
+ </div>;
+ }
+
+ @computed
+ get schemaTable() {
+ return <SchemaTable
+ Document={this.props.Document}
+ PanelHeight={this.props.PanelHeight}
+ PanelWidth={this.props.PanelWidth}
+ childDocs={this.childDocs}
+ CollectionView={this.props.CollectionView}
+ ContainingCollectionView={this.props.ContainingCollectionView}
+ ContainingCollectionDoc={this.props.ContainingCollectionDoc}
+ fieldKey={this.props.fieldKey}
+ renderDepth={this.props.renderDepth}
+ moveDocument={this.props.moveDocument}
+ ScreenToLocalTransform={this.props.ScreenToLocalTransform}
+ active={this.props.isContentActive}
+ onDrop={this.onExternalDrop}
+ addDocTab={this.props.addDocTab}
+ pinToPres={this.props.pinToPres}
+ isSelected={this.props.isSelected}
+ isFocused={this.isFocused}
+ setFocused={this.setFocused}
+ setPreviewDoc={this.setPreviewDoc}
+ deleteDocument={this.props.removeDocument}
+ addDocument={this.props.addDocument}
+ dataDoc={this.props.DataDoc}
+ columns={this.columns}
+ documentKeys={this.documentKeys}
+ headerIsEditing={this._headerIsEditing}
+ openHeader={this.openHeader}
+ onClick={this.onTableClick}
+ onPointerDown={emptyFunction}
+ onResizedChange={this.onResizedChange}
+ setColumns={this.setColumns}
+ reorderColumns={this.reorderColumns}
+ changeColumns={this.changeColumns}
+ setHeaderIsEditing={this.setHeaderIsEditing}
+ changeColumnSort={this.setColumnSort}
+ />;
+ }
+
+ @computed
+ public get schemaToolbar() {
+ return <div className="collectionSchemaView-toolbar">
+ <div className="collectionSchemaView-toolbar-item">
+ <div id="preview-schema-checkbox-div">
+ <input type="checkbox" key={"Show Preview"} checked={this.previewWidth() !== 0} onChange={this.toggleExpander} />
+ Show Preview
+ </div>
+ </div>
+ </div>;
+ }
+
+ onSpecificMenu = (e: React.MouseEvent) => {
+ if ((e.target as any)?.className?.includes?.("collectionSchemaView-cell") || (e.target instanceof HTMLSpanElement)) {
+ const cm = ContextMenu.Instance;
+ const options = cm.findByDescription("Options...");
+ const optionItems: ContextMenuProps[] = options && "subitems" in options ? options.subitems : [];
+ optionItems.push({ description: "remove", event: () => this._previewDoc && this.props.removeDocument?.(this._previewDoc), icon: "trash" });
+ !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "compass" });
+ cm.displayMenu(e.clientX, e.clientY);
+ (e.nativeEvent as any).SchemaHandled = true; // not sure why this is needed, but if you right-click quickly on a cell, the Document/Collection contextMenu handlers still fire without this.
+ e.stopPropagation();
+ }
+ }
+
+ @action
+ onTableClick = (e: React.MouseEvent): void => {
+ if (!(e.target as any)?.className?.includes?.("collectionSchemaView-cell") && !(e.target instanceof HTMLSpanElement)) {
+ this.setPreviewDoc(undefined);
+ } else {
+ e.stopPropagation();
+ }
+ this.setFocused(this.props.Document);
+ this.closeHeader();
+ }
+
+ onResizedChange = (newResized: Resize[], event: any) => {
+ const columns = this.columns;
+ newResized.forEach(resized => {
+ const index = columns.findIndex(c => c.heading === resized.id);
+ const column = columns[index];
+ column.setWidth(resized.value);
+ columns[index] = column;
+ });
+ this.columns = columns;
+ }
+
+ @action
+ setColumns = (columns: SchemaHeaderField[]) => this.columns = columns
+
+ @undoBatch
+ reorderColumns = (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columnsValues: SchemaHeaderField[]) => {
+ const columns = [...columnsValues];
+ const oldIndex = columns.indexOf(toMove);
+ const relIndex = columns.indexOf(relativeTo);
+ const newIndex = (oldIndex > relIndex && !before) ? relIndex + 1 : (oldIndex < relIndex && before) ? relIndex - 1 : relIndex;
+
+ if (oldIndex === newIndex) return;
+
+ columns.splice(newIndex, 0, columns.splice(oldIndex, 1)[0]);
+ this.columns = columns;
+ }
+
+ onZoomMenu = (e: React.WheelEvent) => this.props.isContentActive(true) && e.stopPropagation();
+
+ render() {
+ TraceMobx();
+ if (!this.props.isContentActive()) setTimeout(() => this.closeHeader(), 0);
+ const menuContent = this.renderMenuContent;
+ const menu = <div className="collectionSchema-header-menu"
+ onWheel={e => this.onZoomMenu(e)}
+ onPointerDown={e => this.onHeaderClick(e)}
+ style={{ transform: `translate(${(this.menuCoordinates[0])}px, ${(this.menuCoordinates[1])}px)` }}>
+ <Measure offset onResize={action((r: any) => {
+ const dim = this.props.ScreenToLocalTransform().inverse().transformDirection(r.offset.width, r.offset.height);
+ this._menuWidth = dim[0]; this._menuHeight = dim[1];
+ })}>
+ {({ measureRef }) => <div ref={measureRef}> {menuContent} </div>}
+ </Measure>
+ </div>;
+ return <div className={"collectionSchemaView" + (this.props.Document._searchDoc ? "-searchContainer" : "-container")}
+ style={{
+ overflow: this.props.scrollOverflow === true ? "scroll" : undefined, backgroundColor: "white",
+ pointerEvents: this.props.Document._searchDoc !== undefined && !this.props.isContentActive() && !SnappingManager.GetIsDragging() ? "none" : undefined,
+ width: name === "collectionSchemaView-searchContainer" ? "auto" : this.props.PanelWidth() || "100%", height: this.props.PanelHeight() || "100%", position: "relative",
+ }} >
+ <div className="collectionSchemaView-tableContainer"
+ style={{ width: `calc(100% - ${this.previewWidth()}px)` }}
+ onContextMenu={this.onSpecificMenu}
+ onPointerDown={this.onPointerDown}
+ onWheel={e => this.props.isContentActive(true) && e.stopPropagation()}
+ onDrop={e => this.onExternalDrop(e, {})}
+ ref={this.createTarget}>
+ {this.schemaTable}
+ </div>
+ {this.dividerDragger}
+ {!this.previewWidth() ? (null) : this.previewPanel}
+ {this._headerOpen && this.props.isContentActive() ? menu : null}
+ </div>;
+ }
+} \ No newline at end of file
diff --git a/src/client/views/collections/SchemaTable.tsx b/src/client/views/collections/collectionSchema/SchemaTable.tsx
index 0175b0dc2..abe549072 100644
--- a/src/client/views/collections/SchemaTable.tsx
+++ b/src/client/views/collections/collectionSchema/SchemaTable.tsx
@@ -5,32 +5,33 @@ import { action, computed, observable } from "mobx";
import { observer } from "mobx-react";
import ReactTable, { CellInfo, Column, ComponentPropsGetterR, Resize, SortingRule } from "react-table";
import "react-table/react-table.css";
-import { DateField } from "../../../fields/DateField";
-import { AclPrivate, AclReadonly, DataSym, Doc, DocListCast, Field, Opt } from "../../../fields/Doc";
-import { Id } from "../../../fields/FieldSymbols";
-import { List } from "../../../fields/List";
-import { listSpec } from "../../../fields/Schema";
-import { SchemaHeaderField } from "../../../fields/SchemaHeaderField";
-import { ComputedField } from "../../../fields/ScriptField";
-import { Cast, FieldValue, NumCast, StrCast } from "../../../fields/Types";
-import { ImageField } from "../../../fields/URLField";
-import { GetEffectiveAcl } from "../../../fields/util";
-import { emptyFunction, emptyPath, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from "../../../Utils";
-import { Docs, DocumentOptions, DocUtils } from "../../documents/Documents";
-import { DocumentType } from "../../documents/DocumentTypes";
-import { CompileScript, Transformer, ts } from "../../util/Scripting";
-import { Transform } from "../../util/Transform";
-import { undoBatch } from "../../util/UndoManager";
-import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/globalCssVariables.scss';
-import { ContextMenu } from "../ContextMenu";
-import '../DocumentDecorations.scss';
-import { DocumentView } from "../nodes/DocumentView";
-import { DefaultStyleProvider } from "../StyleProvider";
+import { DateField } from "../../../../fields/DateField";
+import { AclPrivate, AclReadonly, DataSym, Doc, DocListCast, Field, Opt } from "../../../../fields/Doc";
+import { Id } from "../../../../fields/FieldSymbols";
+import { List } from "../../../../fields/List";
+import { listSpec } from "../../../../fields/Schema";
+import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField";
+import { ComputedField } from "../../../../fields/ScriptField";
+import { Cast, FieldValue, NumCast, StrCast } from "../../../../fields/Types";
+import { ImageField } from "../../../../fields/URLField";
+import { GetEffectiveAcl } from "../../../../fields/util";
+import { emptyFunction, emptyPath, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from "../../../../Utils";
+import { Docs, DocumentOptions, DocUtils } from "../../../documents/Documents";
+import { DocumentType } from "../../../documents/DocumentTypes";
+import { CompileScript, Transformer, ts } from "../../../util/Scripting";
+import { Transform } from "../../../util/Transform";
+import { undoBatch } from "../../../util/UndoManager";
+import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../global/globalCssVariables.scss';
+import { ContextMenu } from "../../ContextMenu";
+import '../../../views/DocumentDecorations.scss';
+import { DocumentView } from "../../nodes/DocumentView";
+import { DefaultStyleProvider } from "../../StyleProvider";
import { CellProps, CollectionSchemaButtons, CollectionSchemaCell, CollectionSchemaCheckboxCell, CollectionSchemaDateCell, CollectionSchemaDocCell, CollectionSchemaImageCell, CollectionSchemaListCell, CollectionSchemaNumberCell, CollectionSchemaStringCell } from "./CollectionSchemaCells";
import { CollectionSchemaAddColumnHeader, KeysDropdown } from "./CollectionSchemaHeaders";
-import { MovableColumn, MovableRow } from "./CollectionSchemaMovableTableHOC";
+import { MovableColumn } from "./CollectionSchemaMovableColumn";
+import { MovableRow } from "./CollectionSchemaMovableRow";
import "./CollectionSchemaView.scss";
-import { CollectionView } from "./CollectionView";
+import { CollectionView } from "../CollectionView";
enum ColumnType {
@@ -458,8 +459,9 @@ export class SchemaTable extends React.Component<SchemaTableProps> {
expanded={expanded}
resized={this.resized}
onResizedChange={this.props.onResizedChange}
+ // if it has a child, render another table with the children
SubComponent={!hasCollectionChild ? undefined : row => (row.original.type !== DocumentType.COL) ? (null) :
- <div className="reactTable-sub"><SchemaTable {...this.props} Document={row.original} dataDoc={undefined} childDocs={undefined} /></div>}
+ <div style={{ paddingLeft: 57 + "px" }} className="reactTable-sub"><SchemaTable {...this.props} Document={row.original} dataDoc={undefined} childDocs={undefined} /></div>}
/>;
}
diff --git a/src/client/views/globalCssVariables.scss b/src/client/views/global/globalCssVariables.scss
index ccc9306c4..7556f8b8a 100644
--- a/src/client/views/globalCssVariables.scss
+++ b/src/client/views/global/globalCssVariables.scss
@@ -1,41 +1,55 @@
-@import url("https://fonts.googleapis.com/css?family=Noto+Sans:400,700|Crimson+Text:400,400i,700");
+@import url("https://fonts.googleapis.com/css2?family=Roboto&display=swap");
// colors
-$light-color: #fcfbf7;
-$light-color-secondary:#f1efeb;
-//$main-accent: #61aaa3;
-$main-accent: #aaaaa3;
-// $alt-accent: #cdd5ec;
-// $alt-accent: #cdeceb;
-//$alt-accent: #59dff7;
-$alt-accent: #c2c2c5;
-$lighter-alt-accent: rgb(207, 220, 240);
-$darker-alt-accent: #b2cef8;
-$intermediate-color: #9c9396;
-$dark-color: #121721;
-$link-color: #add8e6;
-$antimodemenu-height: 35px;
+$white: #ffffff;
+$light-gray: #dfdfdf;
+$medium-gray: #9f9f9f;
+$dark-gray: #323232;
+$black: #000000;
+
+$light-blue: #bdddf5;
+$medium-blue: #4476f7;
+$pink: #e0217d;
+$yellow: #f5d747;
+
+$close-red: #e48282;
+
+$drop-shadow: "#32323215";
+
+//padding
+$minimum-padding: 4px;
+$medium-padding: 16px;
+$large-padding: 32px;
+
+//icon sizes
+$icon-size: 28px;
+
// fonts
-$sans-serif: "Noto Sans",
-sans-serif;
+$sans-serif: "Roboto", sans-serif;
+$large-header: 16px;
+$body-text: 12px;
+$small-text: 9px;
// $sans-serif: "Roboto Slab", sans-serif;
-$serif: "Crimson Text",
-serif;
+
// misc values
$border-radius: 0.3em;
-//
$search-thumnail-size: 130;
+$topbar-height: 32px;
+$antimodemenu-height: 36px;
// dragged items
$contextMenu-zindex: 100000; // context menu shows up over everything
$radialMenu-zindex: 100000; // context menu shows up over everything
+// borders
+$standard-border: solid 1px #9f9f9f;
+
$searchpanel-height: 32px;
$mainTextInput-zindex: 999; // then text input overlay so that it's context menu will appear over decorations, etc
$docDecorations-zindex: 998; // then doc decorations appear over everything else
$remoteCursors-zindex: 997; // ... not sure what level the remote cursors should go -- is this right?
$COLLECTION_BORDER_WIDTH: 0;
$SCHEMA_DIVIDER_WIDTH: 4;
-$MINIMIZED_ICON_SIZE:25;
+$MINIMIZED_ICON_SIZE: 24;
$MAX_ROW_HEIGHT: 44px;
$DFLT_IMAGE_NATIVE_DIM: 900px;
$MENU_PANEL_WIDTH: 60px;
@@ -53,4 +67,4 @@ $TREE_BULLET_WIDTH: 20px;
DFLT_IMAGE_NATIVE_DIM: $DFLT_IMAGE_NATIVE_DIM;
MENU_PANEL_WIDTH: $MENU_PANEL_WIDTH;
TREE_BULLET_WIDTH: $TREE_BULLET_WIDTH;
-} \ No newline at end of file
+}
diff --git a/src/client/views/globalCssVariables.scss.d.ts b/src/client/views/global/globalCssVariables.scss.d.ts
index 11e62e1eb..11e62e1eb 100644
--- a/src/client/views/globalCssVariables.scss.d.ts
+++ b/src/client/views/global/globalCssVariables.scss.d.ts
diff --git a/src/client/views/global/globalEnums.tsx b/src/client/views/global/globalEnums.tsx
new file mode 100644
index 000000000..2aeb8e338
--- /dev/null
+++ b/src/client/views/global/globalEnums.tsx
@@ -0,0 +1,38 @@
+export enum Colors {
+ BLACK = "#000000",
+ DARK_GRAY = "#323232",
+ MEDIUM_GRAY = "#9F9F9F",
+ LIGHT_GRAY = "#DFDFDF",
+ WHITE = "#FFFFFF",
+ MEDIUM_BLUE = "#4476F7",
+ LIGHT_BLUE = "#BDDDF5",
+ PINK = "#E0217D",
+ YELLOW = "#F5D747",
+ DROP_SHADOW = "#32323215",
+}
+
+export enum FontSizes {
+ //Bolded
+ LARGE_HEADER = "16px",
+
+ //Bolded or unbolded
+ BODY_TEXT = "12px",
+
+ //Bolded
+ SMALL_TEXT = "9px",
+}
+
+export enum Padding {
+ MINIMUM_PADDING = "4px",
+ SMALL_PADDING = "8px",
+ MEDIUM_PADDING = "16px",
+ LARGE_PADDING = "32px",
+}
+
+export enum IconSizes {
+ ICON_SIZE = "28px",
+}
+
+export enum Borders {
+ STANDARD = "solid 1px #9F9F9F"
+} \ No newline at end of file
diff --git a/src/client/views/linking/LinkEditor.scss b/src/client/views/linking/LinkEditor.scss
index 7e6999cdc..e45a91d57 100644
--- a/src/client/views/linking/LinkEditor.scss
+++ b/src/client/views/linking/LinkEditor.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.linkEditor {
width: 100%;
@@ -20,9 +20,9 @@
}
.linkEditor-info {
- //border-bottom: 0.5px solid $light-color-secondary;
+ //border-bottom: 0.5px solid $light-gray;
//padding-bottom: 1px;
- padding-top: 5px;
+ padding: 12px;
padding-left: 5px;
//margin-bottom: 6px;
display: flex;
@@ -61,7 +61,7 @@
}
.linkEditor-description {
- padding-left: 6.5px;
+ padding-left: 26px;
padding-right: 6.5px;
padding-bottom: 3.5px;
@@ -107,9 +107,9 @@
}
.linkEditor-followingDropdown {
- padding-left: 6.5px;
+ padding-left: 26px;
padding-right: 6.5px;
- padding-bottom: 6px;
+ padding-bottom: 15px;
&:hover {
cursor: pointer;
@@ -195,7 +195,7 @@
}
.linkEditor-group {
- background-color: $light-color-secondary;
+ background-color: $light-gray;
padding: 6px;
margin: 3px 0;
border-radius: 3px;
@@ -254,8 +254,8 @@
}
.linkEditor-option {
- background-color: $light-color-secondary;
- border: 1px solid $intermediate-color;
+ background-color: $light-gray;
+ border: 1px solid $medium-gray;
border-top: 0;
padding: 3px;
cursor: pointer;
@@ -272,7 +272,7 @@
.linkEditor-typeButton {
background-color: transparent;
- color: $dark-color;
+ color: $dark-gray;
height: 20px;
padding: 0 3px;
padding-bottom: 2px;
@@ -285,7 +285,7 @@
width: calc(100% - 40px);
&:hover {
- background-color: $light-color;
+ background-color: $white;
}
}
diff --git a/src/client/views/linking/LinkMenu.scss b/src/client/views/linking/LinkMenu.scss
index a90bf8b0a..19c6463d3 100644
--- a/src/client/views/linking/LinkMenu.scss
+++ b/src/client/views/linking/LinkMenu.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.linkMenu {
width: auto;
@@ -7,20 +7,19 @@
z-index: 2001;
.linkMenu-list,
- .linkMenu-listEditor
- {
+ .linkMenu-listEditor {
display: inline-block;
position: relative;
- border: 1px solid black;
- box-shadow: 3px 3px 1.5px grey;
+ border: 1px solid #e4e4e4;
+ box-shadow: 0 10px 20px rgba(0, 0, 0, 0.19), 0 6px 6px rgba(0, 0, 0, 0.23);
background: white;
-
min-width: 170px;
- max-height: 170px;
+ max-height: 230px;
overflow-y: scroll;
z-index: 10;
- }
- .linkMenu-list {
+ }
+
+ .linkMenu-list {
white-space: nowrap;
overflow-x: hidden;
width: 240px;
@@ -46,13 +45,13 @@
}
.linkMenu-group-name {
+ padding: 10px;
&:hover {
- p {
- background-color: lightgray;
-
- }
+ // p {
+ // background-color: lightgray;
+ // }
p.expand-one {
width: calc(100% + 20px);
@@ -65,10 +64,9 @@
p {
width: 100%;
- //padding: 4px 6px;
line-height: 12px;
border-radius: 5px;
- font-weight: bold;
+ text-transform: capitalize;
}
.linkEditor-tableButton {
diff --git a/src/client/views/linking/LinkMenu.tsx b/src/client/views/linking/LinkMenu.tsx
index c7888c5ee..6fc860447 100644
--- a/src/client/views/linking/LinkMenu.tsx
+++ b/src/client/views/linking/LinkMenu.tsx
@@ -15,6 +15,9 @@ interface Props {
changeFlyout: () => void;
}
+/**
+ * the outermost component for the link menu of a node that contains a list of its linked nodes
+ */
@observer
export class LinkMenu extends React.Component<Props> {
private _editorRef = React.createRef<HTMLDivElement>();
@@ -36,6 +39,11 @@ export class LinkMenu extends React.Component<Props> {
}
}
+ /**
+ * maps each link to a JSX element to be rendered
+ * @param groups LinkManager containing info of all of the links
+ * @returns list of link JSX elements if there at least one linked element
+ */
renderAllGroups = (groups: Map<string, Array<Doc>>): Array<JSX.Element> => {
const linkItems = Array.from(groups.entries()).map(group =>
<LinkMenuGroup
diff --git a/src/client/views/linking/LinkMenuGroup.tsx b/src/client/views/linking/LinkMenuGroup.tsx
index 74af78234..c7586a467 100644
--- a/src/client/views/linking/LinkMenuGroup.tsx
+++ b/src/client/views/linking/LinkMenuGroup.tsx
@@ -40,7 +40,7 @@ export class LinkMenuGroup extends React.Component<LinkMenuGroupProps> {
return (
<div className="linkMenu-group" ref={this._menuRef}>
<div className="linkMenu-group-name">
- <p className={this.props.groupType === "*" || this.props.groupType === "" ? "" : "expand-one"} > {this.props.groupType}:</p>
+ <p className={this.props.groupType === "*" || this.props.groupType === "" ? "" : "expand-one"}> {this.props.groupType}:</p>
</div>
<div className="linkMenu-group-wrapper">
{groupItems}
diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss
index 4e13ef8c8..90722daf9 100644
--- a/src/client/views/linking/LinkMenuItem.scss
+++ b/src/client/views/linking/LinkMenuItem.scss
@@ -1,10 +1,10 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.linkMenu-item {
- // border-top: 0.5px solid $main-accent;
+ // border-top: 0.5px solid $medium-gray;
position: relative;
display: flex;
- border-bottom: 0.5px solid black;
+ border-top: 0.5px solid #cdcdcd;
padding-left: 6.5px;
padding-right: 2px;
@@ -55,8 +55,8 @@
.linkMenu-destination-title {
text-decoration: none;
- color: rgb(85, 120, 196);
- font-size: 14px;
+ color: #4476F7;
+ font-size: 16px;
padding-bottom: 2px;
padding-right: 4px;
margin-right: 4px;
@@ -76,7 +76,7 @@
text-decoration: none;
font-style: italic;
color: rgb(95, 97, 102);
- font-size: 10px;
+ font-size: 9px;
margin-left: 20px;
max-width: 125px;
height: auto;
@@ -102,7 +102,7 @@
.link-metadata {
padding: 0 10px 0 16px;
margin-bottom: 4px;
- color: $main-accent;
+ color: $medium-gray;
font-style: italic;
font-size: 10.5px;
}
@@ -143,8 +143,8 @@
padding-right: 6px;
border-radius: 50%;
pointer-events: auto;
- background-color: $dark-color;
- color: $light-color;
+ background-color: $dark-gray;
+ color: $white;
font-size: 65%;
transition: transform 0.2s;
text-align: center;
@@ -162,7 +162,7 @@
}
&:hover {
- background: $main-accent;
+ background: $medium-gray;
cursor: pointer;
}
}
diff --git a/src/client/views/linking/LinkPopup.scss b/src/client/views/linking/LinkPopup.scss
new file mode 100644
index 000000000..8ae65158d
--- /dev/null
+++ b/src/client/views/linking/LinkPopup.scss
@@ -0,0 +1,45 @@
+.linkPopup-container {
+ background: white;
+ box-shadow: 0 10px 20px rgba(0, 0, 0, 0.19), 0 6px 6px rgba(0, 0, 0, 0.23);
+ top: 35px;
+ height: 200px;
+ width: 200px;
+ position: absolute;
+ padding: 15px;
+ border-radius: 3px;
+
+ input {
+ border: 1px solid #b9b9b9;
+ border-radius: 20px;
+ height: 25px;
+ width: 100%;
+ padding-left: 10px;
+ }
+
+ .divider {
+ margin: 10px 0;
+ height: 20px;
+ width: 100%;
+
+ .line {
+ height: 1px;
+ background-color: #b9b9b9;
+ width: 100%;
+ position: relative;
+ top: 12px;
+ }
+
+ .divider-text {
+ width: 20px;
+ background-color: white;
+ text-align: center;
+ position: relative;
+ margin: auto;
+ }
+ }
+
+
+ .searchBox-container {
+ background: pink;
+ }
+} \ No newline at end of file
diff --git a/src/client/views/linking/LinkPopup.tsx b/src/client/views/linking/LinkPopup.tsx
new file mode 100644
index 000000000..2c4b718f4
--- /dev/null
+++ b/src/client/views/linking/LinkPopup.tsx
@@ -0,0 +1,114 @@
+import { IconProp } from '@fortawesome/fontawesome-svg-core';
+import { FontAwesomeIcon } from '@fortawesome/react-fontawesome';
+import { Tooltip } from '@material-ui/core';
+import { action, observable, runInAction } from 'mobx';
+import { observer } from "mobx-react";
+import { Doc, DocListCast } from '../../../fields/Doc';
+import { Cast, StrCast } from '../../../fields/Types';
+import { WebField } from '../../../fields/URLField';
+import { emptyFunction, setupMoveUpEvents, returnFalse, returnTrue, returnEmptyDoclist, returnEmptyFilter } from '../../../Utils';
+import { DocumentType } from '../../documents/DocumentTypes';
+import { DocumentManager } from '../../util/DocumentManager';
+import { DragManager } from '../../util/DragManager';
+import { Hypothesis } from '../../util/HypothesisUtils';
+import { LinkManager } from '../../util/LinkManager';
+import { undoBatch } from '../../util/UndoManager';
+import { DocumentLinksButton } from '../nodes/DocumentLinksButton';
+import { DocumentView, DocumentViewSharedProps } from '../nodes/DocumentView';
+import { LinkDocPreview } from '../nodes/LinkDocPreview';
+import './LinkPopup.scss';
+import React = require("react");
+import { CurrentUserUtils } from '../../util/CurrentUserUtils';
+import { DefaultStyleProvider } from '../StyleProvider';
+import { Transform } from '../../util/Transform';
+import { DocUtils } from '../../documents/Documents';
+import { SearchBox } from '../search/SearchBox';
+import { EditorView } from 'prosemirror-view';
+import { FormattedTextBox } from '../nodes/formattedText/FormattedTextBox';
+
+interface LinkPopupProps {
+ showPopup: boolean;
+ // groupType: string;
+ // linkDoc: Doc;
+ // docView: DocumentView;
+ // sourceDoc: Doc;
+}
+
+/**
+ * Popup component for creating links from text to Dash documents
+ */
+
+@observer
+export class LinkPopup extends React.Component<LinkPopupProps> {
+ @observable private linkURL: string = "";
+ @observable public view?: EditorView;
+
+
+
+ // TODO: should check for valid URL
+ @undoBatch
+ makeLinkToURL = (target: string, lcoation: string) => {
+ ((this.view as any)?.TextView as FormattedTextBox).makeLinkAnchor(undefined, "onRadd:rightight", target, target);
+ }
+
+ @action
+ onLinkChange = (e: React.ChangeEvent<HTMLInputElement>) => {
+ this.linkURL = e.target.value;
+ console.log(this.linkURL)
+ }
+
+
+ getPWidth = () => 500;
+ getPHeight = () => 500;
+
+ render() {
+ const popupVisibility = this.props.showPopup ? "block" : "none";
+ return (
+ <div className="linkPopup-container" style={{ display: popupVisibility }}>
+ <div className="linkPopup-url-container">
+ <input autoComplete="off" type="text" value={this.linkURL} placeholder="Enter URL..." onChange={this.onLinkChange} />
+ <button onPointerDown={e => this.makeLinkToURL(this.linkURL, "add:right")}
+ style={{ display: "block", margin: "10px auto", }}>Apply hyperlink</button>
+ </div>
+ <div className="divider">
+ <div className="line"></div>
+ <p className="divider-text">or</p>
+ </div>
+ <div className="linkPopup-document-search-container">
+ {/* <i></i>
+ <input defaultValue={""} autoComplete="off" type="text" placeholder="Search for Document..." id="search-input"
+ className="linkPopup-searchBox searchBox-input" /> */}
+
+ <SearchBox Document={CurrentUserUtils.MySearchPanelDoc}
+ DataDoc={CurrentUserUtils.MySearchPanelDoc}
+ fieldKey="data"
+ dropAction="move"
+ isSelected={returnTrue}
+ isContentActive={returnTrue}
+ select={returnTrue}
+ setHeight={returnFalse}
+ addDocument={undefined}
+ addDocTab={returnTrue}
+ pinToPres={emptyFunction}
+ rootSelected={returnTrue}
+ styleProvider={DefaultStyleProvider}
+ layerProvider={undefined}
+ removeDocument={undefined}
+ ScreenToLocalTransform={Transform.Identity}
+ PanelWidth={this.getPWidth}
+ PanelHeight={this.getPHeight}
+ renderDepth={0}
+ focus={DocUtils.DefaultFocus}
+ docViewPath={returnEmptyDoclist}
+ whenChildContentsActiveChanged={emptyFunction}
+ bringToFront={emptyFunction}
+ docFilters={returnEmptyFilter}
+ docRangeFilters={returnEmptyFilter}
+ searchFilterDocs={returnEmptyDoclist}
+ ContainingCollectionView={undefined}
+ ContainingCollectionDoc={undefined} />
+ </div>
+ </div>
+ );
+ }
+} \ No newline at end of file
diff --git a/src/client/views/nodes/AudioBox.tsx b/src/client/views/nodes/AudioBox.tsx
index a2e36f12e..82bad971d 100644
--- a/src/client/views/nodes/AudioBox.tsx
+++ b/src/client/views/nodes/AudioBox.tsx
@@ -196,7 +196,7 @@ export class AudioBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
this._recorder.ondataavailable = async (e: any) => {
const [{ result }] = await Networking.UploadFilesToServer(e.data);
if (!(result instanceof Error)) {
- this.props.Document[this.props.fieldKey] = new AudioField(Utils.prepend(result.accessPaths.agnostic.client));
+ this.props.Document[this.props.fieldKey] = new AudioField(result.accessPaths.agnostic.client);
}
};
this._recordStart = new Date().getTime();
diff --git a/src/client/views/nodes/DocumentContentsView.tsx b/src/client/views/nodes/DocumentContentsView.tsx
index f0a54e4ac..3d2cdf5a4 100644
--- a/src/client/views/nodes/DocumentContentsView.tsx
+++ b/src/client/views/nodes/DocumentContentsView.tsx
@@ -8,10 +8,10 @@ import { emptyPath, OmitKeys, Without } from "../../../Utils";
import { DirectoryImportBox } from "../../util/Import & Export/DirectoryImportBox";
import { CollectionDockingView } from "../collections/CollectionDockingView";
import { CollectionFreeFormView } from "../collections/collectionFreeForm/CollectionFreeFormView";
-import { CollectionSchemaView } from "../collections/CollectionSchemaView";
+import { CollectionSchemaView } from "../collections/collectionSchema/CollectionSchemaView";
import { CollectionView } from "../collections/CollectionView";
import { InkingStroke } from "../InkingStroke";
-import { PresElementBox } from "../presentationview/PresElementBox";
+import { PresElementBox } from "../nodes/trails/PresElementBox";
import { SearchBox } from "../search/SearchBox";
import { DashWebRTCVideo } from "../webcam/DashWebRTCVideo";
import { YoutubeBox } from "./../../apis/youtube/YoutubeBox";
@@ -32,7 +32,7 @@ import { LabelBox } from "./LabelBox";
import { LinkAnchorBox } from "./LinkAnchorBox";
import { LinkBox } from "./LinkBox";
import { PDFBox } from "./PDFBox";
-import { PresBox } from "./PresBox";
+import { PresBox } from "./trails/PresBox";
import { ScreenshotBox } from "./ScreenshotBox";
import { ScriptingBox } from "./ScriptingBox";
import { SliderBox } from "./SliderBox";
@@ -64,6 +64,7 @@ interface HTMLtagProps {
htmltag: string;
onClick?: ScriptField;
onInput?: ScriptField;
+ scaling: number;
}
//"<HTMLdiv borderRadius='100px' onClick={this.bannerColor=this.bannerColor==='red'?'green':'red'} overflow='hidden' position='absolute' width='100%' height='100%' transform='rotate({2*this.x+this.y}deg)'> <ImageBox {...props} fieldKey={'data'}/> <HTMLspan width='200px' top='0' height='35px' textAlign='center' paddingTop='10px' transform='translate(-40px, 45px) rotate(-45deg)' position='absolute' color='{this.bannerColor===`green`?`light`:`dark`}blue' backgroundColor='{this.bannerColor===`green`?`dark`:`light`}blue'> {this.title}</HTMLspan></HTMLdiv>"
@@ -82,7 +83,7 @@ interface HTMLtagProps {
export class HTMLtag extends React.Component<HTMLtagProps> {
click = (e: React.MouseEvent) => {
const clickScript = (this.props as any).onClick as Opt<ScriptField>;
- clickScript?.script.run({ this: this.props.Document, self: this.props.RootDoc });
+ clickScript?.script.run({ this: this.props.Document, self: this.props.RootDoc, scale: this.props.scaling });
}
onInput = (e: React.FormEvent<HTMLDivElement>) => {
const onInputScript = (this.props as any).onInput as Opt<ScriptField>;
@@ -90,9 +91,9 @@ export class HTMLtag extends React.Component<HTMLtagProps> {
}
render() {
const style: { [key: string]: any } = {};
- const divKeys = OmitKeys(this.props, ["children", "htmltag", "RootDoc", "Document", "key", "onInput", "onClick", "__proto__"]).omit;
+ const divKeys = OmitKeys(this.props, ["children", "htmltag", "RootDoc", "scaling", "Document", "key", "onInput", "onClick", "__proto__"]).omit;
const replacer = (match: any, expr: string, offset: any, string: any) => { // bcz: this executes a script to convert a propery expression string: { script } into a value
- return ScriptField.MakeFunction(expr, { self: Doc.name, this: Doc.name })?.script.run({ self: this.props.RootDoc, this: this.props.Document }).result as string || "";
+ return ScriptField.MakeFunction(expr, { self: Doc.name, this: Doc.name, scale: "number" })?.script.run({ self: this.props.RootDoc, this: this.props.Document, scale: this.props.scaling }).result as string || "";
};
Object.keys(divKeys).map((prop: string) => {
const p = (this.props as any)[prop] as string;
@@ -180,11 +181,11 @@ export class DocumentContentsView extends React.Component<DocumentViewProps & Fo
const replacer = (match: any, prefix: string, expr: string, postfix: string, offset: any, string: any) => {
return prefix + (ScriptField.MakeFunction(expr, { self: Doc.name, this: Doc.name })?.script.run({ this: this.props.Document }).result as string || "") + postfix;
};
- layoutFrame = layoutFrame.replace(/(>[^{]*)\{([^.'][^<}]+)\}([^}]*<)/g, replacer);
+ layoutFrame = layoutFrame.replace(/(>[^{]*)[^=]\{([^.'][^<}]+)\}([^}]*<)/g, replacer);
// replace HTML<tag> with corresponding HTML tag as in: <HTMLdiv> becomes <HTMLtag Document={props.Document} htmltag='div'>
const replacer2 = (match: any, p1: string, offset: any, string: any) => {
- return `<HTMLtag RootDoc={props.RootDoc} Document={props.Document} htmltag='${p1}'`;
+ return `<HTMLtag RootDoc={props.RootDoc} Document={props.Document} scaling='${this.props.scaling?.() || 1}' htmltag='${p1}'`;
};
layoutFrame = layoutFrame.replace(/<HTML([a-zA-Z0-9_-]+)/g, replacer2);
@@ -200,7 +201,7 @@ export class DocumentContentsView extends React.Component<DocumentViewProps & Fo
if (splits.length > 1) {
const code = XRegExp.matchRecursive(splits[1], "{", "}", "", { valueNames: ["between", "left", "match", "right", "between"] });
layoutFrame = splits[0] + ` ${func}={props.${func}} ` + splits[1].substring(code[1].end + 1);
- return ScriptField.MakeScript(code[1].value, { this: Doc.name, self: Doc.name, value: "string" });
+ return ScriptField.MakeScript(code[1].value, { this: Doc.name, self: Doc.name, scale: "number", value: "string" });
}
return undefined;
// add input function to props
diff --git a/src/client/views/nodes/DocumentLinksButton.scss b/src/client/views/nodes/DocumentLinksButton.scss
index 735aa669f..b37b68249 100644
--- a/src/client/views/nodes/DocumentLinksButton.scss
+++ b/src/client/views/nodes/DocumentLinksButton.scss
@@ -1,16 +1,27 @@
-@import "../globalCssVariables.scss";
+@import "../global/globalCssVariables.scss";
+.documentLinksButton-menu {
+ width: 100%;
+ height: 100%;
+ position: relative;
+ display: flex;
+ align-content: center;
+ justify-content: center;
+ align-items: center;
+}
+
.documentLinksButton-cont {
min-width: 20;
min-height: 20;
position: absolute;
}
+
.documentLinksButton,
.documentLinksButton-endLink,
.documentLinksButton-startLink {
- height: 20px;
- width: 20px;
+ height: 25px;
+ width: 25px;
position: absolute;
border-radius: 50%;
opacity: 0.9;
@@ -33,27 +44,43 @@
}
.documentLinksButton {
- background-color: black;
+ background-color: $dark-gray;
+ color: $white;
font-weight: bold;
+ width: 80%;
+ height: 80%;
+ font-size: 100%;
+ transition: 0.2s ease all;
&:hover {
- background: $main-accent;
- transform: scale(1.05);
- cursor: pointer;
+ background-color: $black;
}
}
-.documentLinksButton-endLink {
- border: red solid 2px;
+.documentLinksButton.startLink {
+ background-color: $medium-blue;
+ color: $white;
+ font-weight: bold;
+ width: 80%;
+ height: 80%;
+ font-size: 100%;
+ transition: 0.2s ease all;
&:hover {
- background: deepskyblue;
- transform: scale(1.05);
- cursor: pointer;
+ background-color: $black;
}
}
-.documentLinksButton-startLink {
- border: red solid 2px;
- background-color: rgba(255, 192, 203, 0.5);
+.documentLinksButton-endLink {
+ border: $medium-blue 2px dashed;
+ color: $medium-blue;
+ background-color: none !important;
+ width: 80%;
+ height: 80%;
+ font-size: 100%;
+ transition: 0.2s ease all;
+
+ &:hover {
+ background-color: $light-blue;
+ }
} \ No newline at end of file
diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx
index a6d07374a..b63174e54 100644
--- a/src/client/views/nodes/DocumentLinksButton.tsx
+++ b/src/client/views/nodes/DocumentLinksButton.tsx
@@ -20,6 +20,7 @@ import './DocumentLinksButton.scss';
import { DocServer } from "../../DocServer";
import { LightboxView } from "../LightboxView";
import { cat } from "shelljs";
+import { Colors } from "../global/globalEnums";
const higflyout = require("@hig/flyout");
export const { anchorPoints } = higflyout;
@@ -30,12 +31,12 @@ interface DocumentLinksButtonProps {
Offset?: (number | undefined)[];
AlwaysOn?: boolean;
InMenu?: boolean;
- StartLink?: boolean;
+ StartLink?: boolean; //whether the link HAS been started (i.e. now needs to be completed)
}
@observer
export class DocumentLinksButton extends React.Component<DocumentLinksButtonProps, {}> {
private _linkButton = React.createRef<HTMLDivElement>();
- @observable public static StartLink: Doc | undefined;
+ @observable public static StartLink: Doc | undefined; //origin's Doc, if defined
@observable public static StartLinkView: DocumentView | undefined;
@observable public static AnnotationId: string | undefined;
@observable public static AnnotationUri: string | undefined;
@@ -45,6 +46,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
public static invisibleWebRef = React.createRef<HTMLDivElement>();
@action public static ClearLinkEditor() { DocumentLinksButton.LinkEditorDocView = undefined; }
+
@action @undoBatch
onLinkButtonMoved = (e: PointerEvent) => {
if (this.props.InMenu && this.props.StartLink) {
@@ -66,6 +68,40 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
return false;
}
+ onLinkMenuOpen = (e: React.PointerEvent): void => {
+ setupMoveUpEvents(this, e, this.onLinkButtonMoved, emptyFunction, action((e, doubleTap) => {
+ if (doubleTap) {
+ const rootDoc = this.props.View.rootDoc;
+ const docid = Doc.CurrentUserEmail + Doc.GetProto(rootDoc)[Id] + "-pivotish";
+ DocServer.GetRefField(docid).then(async docx => {
+ const rootAlias = () => {
+ const rootAlias = Doc.MakeAlias(rootDoc);
+ rootAlias.x = rootAlias.y = 0;
+ return rootAlias;
+ };
+ let wid = rootDoc[WidthSym]();
+ const target = ((docx instanceof Doc) && docx) || Docs.Create.FreeformDocument([rootAlias()], { title: this.props.View.Document.title + "-pivot", _width: 500, _height: 500, }, docid);
+ const docs = await DocListCastAsync(Doc.GetProto(target).data);
+ if (!target.pivotFocusish) (Doc.GetProto(target).pivotFocusish = target);
+ DocListCast(rootDoc.links).forEach(link => {
+ const other = LinkManager.getOppositeAnchor(link, rootDoc);
+ const otherdoc = !other ? undefined : other.annotationOn ? Cast(other.annotationOn, Doc, null) : other;
+ if (otherdoc && !docs?.some(d => Doc.AreProtosEqual(d, otherdoc))) {
+ const alias = Doc.MakeAlias(otherdoc);
+ alias.x = wid;
+ alias.y = 0;
+ alias._lockedPosition = false;
+ wid += otherdoc[WidthSym]();
+ Doc.AddDocToList(Doc.GetProto(target), "data", alias);
+ }
+ });
+ LightboxView.SetLightboxDoc(target);
+ });
+ }
+ else DocumentLinksButton.LinkEditorDocView = this.props.View;
+ }));
+ }
+
@undoBatch
onLinkButtonDown = (e: React.PointerEvent): void => {
setupMoveUpEvents(this, e, this.onLinkButtonMoved, emptyFunction, action((e, doubleTap) => {
@@ -78,37 +114,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
DocumentLinksButton.StartLink = this.props.View.props.Document;
DocumentLinksButton.StartLinkView = this.props.View;
}
- } else if (!this.props.InMenu) {
- if (doubleTap) {
- const rootDoc = this.props.View.rootDoc;
- const docid = Doc.CurrentUserEmail + Doc.GetProto(rootDoc)[Id] + "-pivotish";
- DocServer.GetRefField(docid).then(async docx => {
- const rootAlias = () => {
- const rootAlias = Doc.MakeAlias(rootDoc);
- rootAlias.x = rootAlias.y = 0;
- return rootAlias;
- };
- let wid = rootDoc[WidthSym]();
- const target = ((docx instanceof Doc) && docx) || Docs.Create.FreeformDocument([rootAlias()], { title: this.props.View.Document.title + "-pivot", _width: 500, _height: 500, }, docid);
- const docs = await DocListCastAsync(Doc.GetProto(target).data);
- if (!target.pivotFocusish) (Doc.GetProto(target).pivotFocusish = target);
- DocListCast(rootDoc.links).forEach(link => {
- const other = LinkManager.getOppositeAnchor(link, rootDoc);
- const otherdoc = !other ? undefined : other.annotationOn ? Cast(other.annotationOn, Doc, null) : other;
- if (otherdoc && !docs?.some(d => Doc.AreProtosEqual(d, otherdoc))) {
- const alias = Doc.MakeAlias(otherdoc);
- alias.x = wid;
- alias.y = 0;
- alias._lockedPosition = false;
- wid += otherdoc[WidthSym]();
- Doc.AddDocToList(Doc.GetProto(target), "data", alias);
- }
- });
- LightboxView.SetLightboxDoc(target);
- });
- }
- else DocumentLinksButton.LinkEditorDocView = this.props.View;
- }
+ };
}));
}
@@ -120,17 +126,17 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
if (DocumentLinksButton.StartLink === this.props.View.props.Document) {
DocumentLinksButton.StartLink = undefined;
DocumentLinksButton.StartLinkView = undefined;
- } else {
+ } else { //if this LinkButton's Document is undefined
DocumentLinksButton.StartLink = this.props.View.props.Document;
DocumentLinksButton.StartLinkView = this.props.View;
}
-
//action(() => Doc.BrushDoc(this.props.View.Document));
} else if (!this.props.InMenu) {
DocumentLinksButton.LinkEditorDocView = this.props.View;
}
}
+
completeLink = (e: React.PointerEvent): void => {
setupMoveUpEvents(this, e, returnFalse, emptyFunction, undoBatch(action((e, doubleTap) => {
if (doubleTap && !this.props.StartLink) {
@@ -141,7 +147,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
} else if (DocumentLinksButton.StartLink && DocumentLinksButton.StartLink !== this.props.View.props.Document) {
const sourceDoc = DocumentLinksButton.StartLink;
const targetDoc = this.props.View.ComponentView?.getAnchor?.() || this.props.View.Document;
- const linkDoc = DocUtils.MakeLink({ doc: sourceDoc }, { doc: targetDoc }, "long drag");
+ const linkDoc = DocUtils.MakeLink({ doc: sourceDoc }, { doc: targetDoc }, "links"); //why is long drag here when this is used for completing links by clicking?
LinkManager.currentLink = linkDoc;
@@ -184,7 +190,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
} else if (startLink !== endLink) {
endLink = endLinkView?.docView?._componentView?.getAnchor?.() || endLink;
startLink = DocumentLinksButton.StartLinkView?.docView?._componentView?.getAnchor?.() || startLink;
- const linkDoc = DocUtils.MakeLink({ doc: startLink }, { doc: endLink }, DocumentLinksButton.AnnotationId ? "hypothes.is annotation" : "long drag", undefined, undefined, true);
+ const linkDoc = DocUtils.MakeLink({ doc: startLink }, { doc: endLink }, DocumentLinksButton.AnnotationId ? "hypothes.is annotation" : "link", undefined, undefined, true);
LinkManager.currentLink = linkDoc;
@@ -192,7 +198,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
Doc.GetProto(linkDoc as Doc).linksToAnnotation = true;
Doc.GetProto(linkDoc as Doc).annotationId = DocumentLinksButton.AnnotationId;
Doc.GetProto(linkDoc as Doc).annotationUri = DocumentLinksButton.AnnotationUri;
- const dashHyperlink = Utils.prepend("/doc/" + (startIsAnnotation ? endLink[Id] : startLink[Id]));
+ const dashHyperlink = Doc.globalServerPath(startIsAnnotation ? endLink : startLink);
Hypothesis.makeLink(StrCast(startIsAnnotation ? endLink.title : startLink.title), dashHyperlink, DocumentLinksButton.AnnotationId,
(startIsAnnotation ? startLink : endLink)); // edit annotation to add a Dash hyperlink to the linked doc
}
@@ -242,45 +248,50 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
return results;
}
+ /**
+ * gets the JSX of the link button (btn used to start/complete links) OR the link-view button (btn on bottom left of each linked node)
+ *
+ * todo:glr / anh seperate functionality such as onClick onPointerDown of link menu button
+ */
@computed get linkButtonInner() {
- const btnDim = this.props.InMenu ? "20px" : "30px";
+ const btnDim = "30px";
const link = <img style={{ width: "22px", height: "16px" }} src={`/assets/${"link.png"}`} />;
-
- return <div className="documentLinksButton-cont" ref={this._linkButton}
- style={{ left: this.props.Offset?.[0], top: this.props.Offset?.[1], right: this.props.Offset?.[2], bottom: this.props.Offset?.[3] }}
- >
- <div className={"documentLinksButton"}
- onPointerDown={this.onLinkButtonDown} onClick={this.onLinkClick}
- style={{
- backgroundColor: this.props.InMenu ? "" : "#add8e6",
- color: this.props.InMenu ? "white" : "black",
- width: btnDim,
- height: btnDim,
- }} >
- {this.props.InMenu ?
- this.props.StartLink ?
- <FontAwesomeIcon className="documentdecorations-icon" icon="link" size="sm" />
- : link
- : Array.from(this.filteredLinks).length}
- </div>
- {this.props.InMenu && !this.props.StartLink && DocumentLinksButton.StartLink !== this.props.View.props.Document ?
- <div className={"documentLinksButton-endLink"}
+ const isActive = (DocumentLinksButton.StartLink === this.props.View.props.Document) && this.props.StartLink;
+ return (!this.props.InMenu ?
+ <div className="documentLinksButton-cont"
+ style={{ left: this.props.Offset?.[0], top: this.props.Offset?.[1], right: this.props.Offset?.[2], bottom: this.props.Offset?.[3] }}
+ >
+ <div className={"documentLinksButton"}
+ onPointerDown={this.onLinkMenuOpen} onClick={this.onLinkClick}
style={{
- width: btnDim, height: btnDim,
- backgroundColor: DocumentLinksButton.StartLink ? "" : "grey",
- opacity: DocumentLinksButton.StartLink ? "" : "50%",
- border: DocumentLinksButton.StartLink ? "" : "none",
- cursor: DocumentLinksButton.StartLink ? "pointer" : "default"
- }}
- onPointerDown={DocumentLinksButton.StartLink && this.completeLink}
- onClick={e => DocumentLinksButton.StartLink && DocumentLinksButton.finishLinkClick(e.clientX, e.clientY, DocumentLinksButton.StartLink, this.props.View.props.Document, true, this.props.View)} />
- : (null)
- }
- {DocumentLinksButton.StartLink === this.props.View.props.Document && this.props.InMenu && this.props.StartLink ?
- <div className={"documentLinksButton-startLink"} onPointerDown={this.clearLinks} onClick={this.clearLinks} style={{ width: btnDim, height: btnDim }} />
- : (null)
- }
- </div >;
+ backgroundColor: Colors.LIGHT_BLUE,
+ color: Colors.BLACK,
+ width: btnDim,
+ height: btnDim,
+ }}>
+ {Array.from(this.filteredLinks).length}
+ </div>
+ </div>
+ :
+ <div className="documentLinksButton-menu" ref={this._linkButton}>
+ {this.props.InMenu && !this.props.StartLink && DocumentLinksButton.StartLink !== this.props.View.props.Document ? //if the origin node is not this node
+ <div className={"documentLinksButton-endLink"}
+ onPointerDown={DocumentLinksButton.StartLink && this.completeLink}
+ onClick={e => DocumentLinksButton.StartLink && DocumentLinksButton.finishLinkClick(e.clientX, e.clientY, DocumentLinksButton.StartLink, this.props.View.props.Document, true, this.props.View)}>
+ <FontAwesomeIcon className="documentdecorations-icon" icon="link" />
+ </div>
+ : (null)
+ }
+ {
+ this.props.InMenu && this.props.StartLink ? //if link has been started from current node, then set behavior of link button to deactivate linking when clicked again
+ <div className={`documentLinksButton ${isActive ? `startLink` : ``}`} onPointerDown={isActive ? undefined : this.onLinkButtonDown} onClick={isActive ? this.clearLinks : this.onLinkClick}>
+ <FontAwesomeIcon className="documentdecorations-icon" icon="link" />
+ </div>
+ :
+ (null)
+ }
+ </div>
+ )
}
render() {
@@ -290,6 +301,7 @@ export class DocumentLinksButton extends React.Component<DocumentLinksButtonProp
const buttonTitle = "Tap to view links; double tap to open link collection";
const title = this.props.InMenu ? menuTitle : buttonTitle;
+ //render circular tooltip if it isn't set to invisible and show the number of doc links the node has, and render inner-menu link button for starting/stopping links if currently in menu
return !Array.from(this.filteredLinks).length && !this.props.AlwaysOn ? (null) :
this.props.InMenu && (DocumentLinksButton.StartLink || this.props.StartLink) ?
<Tooltip title={<div className="dash-tooltip">{title}</div>}>
diff --git a/src/client/views/nodes/DocumentView.scss b/src/client/views/nodes/DocumentView.scss
index bdbece621..7f164ca48 100644
--- a/src/client/views/nodes/DocumentView.scss
+++ b/src/client/views/nodes/DocumentView.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.documentView-effectsWrapper {
border-radius: inherit;
@@ -22,7 +22,7 @@
transition: outline .3s linear;
cursor: grab;
- // background: $light-color; //overflow: hidden;
+ // background: $white; //overflow: hidden;
transform-origin: left top;
&.minimized {
@@ -147,7 +147,7 @@
.documentView-titleWrapper,
.documentView-titleWrapper-hover {
overflow: hidden;
- color: white;
+ color: $black;
transform-origin: top left;
top: 0;
width: 100%;
@@ -218,6 +218,6 @@
.documentView-node:first-child {
position: relative;
- background: "#B59B66"; //$light-color;
+ background: "#B59B66"; //$white;
}
} \ No newline at end of file
diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx
index b861669f8..bea219831 100644
--- a/src/client/views/nodes/DocumentView.tsx
+++ b/src/client/views/nodes/DocumentView.tsx
@@ -13,7 +13,7 @@ import { BoolCast, Cast, NumCast, ScriptCast, StrCast } from "../../../fields/Ty
import { AudioField } from "../../../fields/URLField";
import { GetEffectiveAcl, SharingPermissions, TraceMobx } from '../../../fields/util';
import { MobileInterface } from '../../../mobile/MobileInterface';
-import { emptyFunction, hasDescendantTarget, OmitKeys, returnVal, Utils } from "../../../Utils";
+import { emptyFunction, hasDescendantTarget, OmitKeys, returnVal, Utils, returnTrue } from "../../../Utils";
import { GooglePhotos } from '../../apis/google_docs/GooglePhotosClientUtils';
import { Docs, DocUtils } from "../../documents/Documents";
import { DocumentType } from '../../documents/DocumentTypes';
@@ -43,7 +43,7 @@ import { DocumentLinksButton } from './DocumentLinksButton';
import "./DocumentView.scss";
import { LinkAnchorBox } from './LinkAnchorBox';
import { LinkDocPreview } from "./LinkDocPreview";
-import { PresBox } from './PresBox';
+import { PresBox } from './trails/PresBox';
import { RadialMenu } from './RadialMenu';
import React = require("react");
import { ScriptingBox } from "./ScriptingBox";
@@ -64,7 +64,7 @@ export enum ViewAdjustment {
doNothing = 0
}
-export const ViewSpecPrefix = "_VIEW"; // field prefix for anchor fields that are immediately copied over to the target document when link is followed. Other anchor properties will be copied over in the specific setViewSpec() method on their view (which allows for seting preview values instead of writing to the document)
+export const ViewSpecPrefix = "viewSpec"; // field prefix for anchor fields that are immediately copied over to the target document when link is followed. Other anchor properties will be copied over in the specific setViewSpec() method on their view (which allows for seting preview values instead of writing to the document)
export interface DocFocusOptions {
originalTarget?: Doc; // set in JumpToDocument, used by TabDocView to determine whether to fit contents to tab
@@ -137,7 +137,7 @@ export interface DocumentViewProps extends DocumentViewSharedProps {
hideDecorationTitle?: boolean; // forces suppression of title. e.g, treeView document labels suppress titles in case they are globally active via settings
treeViewDoc?: Doc;
isDocumentActive?: () => boolean | undefined; // whether a document should handle pointer events
- isContentActive: () => boolean | undefined; // whether a document should handle pointer events
+ isContentActive: () => boolean | undefined; // whether document contents should handle pointer events
contentPointerEvents?: string; // pointer events allowed for content of a document view. eg. set to "none" in menuSidebar for sharedDocs so that you can select a document, but not interact with its contents
radialMenu?: String[];
LayoutTemplateString?: string;
@@ -421,7 +421,9 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
focus = (anchor: Doc, options?: DocFocusOptions) => {
LightboxView.SetCookie(StrCast(anchor["cookies-set"]));
// copying over _VIEW fields immediately allows the view type to switch to create the right _componentView
- Array.from(Object.keys(Doc.GetProto(anchor))).filter(key => key.startsWith(ViewSpecPrefix)).forEach(spec => this.layoutDoc[spec.replace(ViewSpecPrefix, "")] = ((field) => field instanceof ObjectField ? ObjectField.MakeCopy(field) : field)(anchor[spec]));
+ Array.from(Object.keys(Doc.GetProto(anchor))).filter(key => key.startsWith(ViewSpecPrefix)).forEach(spec => {
+ this.layoutDoc[spec.replace(ViewSpecPrefix, "")] = ((field) => field instanceof ObjectField ? ObjectField.MakeCopy(field) : field)(anchor[spec]);
+ });
// after a timeout, the right _componentView should have been created, so call it to update its view spec values
setTimeout(() => this._componentView?.setViewSpec?.(anchor, LinkDocPreview.LinkInfo ? true : false));
const focusSpeed = this._componentView?.scrollFocus?.(anchor, !LinkDocPreview.LinkInfo); // bcz: smooth parameter should really be passed into focus() instead of inferred here
@@ -746,7 +748,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
moreItems.push({ description: "Tag Child Images via Google Photos", event: () => GooglePhotos.Query.TagChildImages(this.props.Document), icon: "caret-square-right" });
moreItems.push({ description: "Write Back Link to Album", event: () => GooglePhotos.Transactions.AddTextEnrichment(this.props.Document), icon: "caret-square-right" });
}
- moreItems.push({ description: "Copy ID", event: () => Utils.CopyText(Utils.prepend("/doc/" + this.props.Document[Id])), icon: "fingerprint" });
+ moreItems.push({ description: "Copy ID", event: () => Utils.CopyText(Doc.globalServerPath(this.props.Document)), icon: "fingerprint" });
}
}
@@ -754,16 +756,15 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
moreItems.push({ description: "Close", event: this.deleteClicked, icon: "times" });
}
- !more && cm.addItem({ description: "More...", subitems: moreItems, icon: "hand-point-right" });
- cm.moveAfter(cm.findByDescription("More...")!, cm.findByDescription("OnClick...")!);
-
const help = cm.findByDescription("Help...");
const helpItems: ContextMenuProps[] = help && "subitems" in help ? help.subitems : [];
!Doc.UserDoc().novice && helpItems.push({ description: "Show Fields ", event: () => this.props.addDocTab(Docs.Create.KVPDocument(this.props.Document, { _width: 300, _height: 300 }), "add:right"), icon: "layer-group" });
- helpItems.push({ description: "Text Shortcuts Ctrl+/", event: () => this.props.addDocTab(Docs.Create.PdfDocument(Utils.prepend("/assets/cheat-sheet.pdf"), { _width: 300, _height: 300 }), "add:right"), icon: "keyboard" });
+ helpItems.push({ description: "Text Shortcuts Ctrl+/", event: () => this.props.addDocTab(Docs.Create.PdfDocument("/assets/cheat-sheet.pdf", { _width: 300, _height: 300 }), "add:right"), icon: "keyboard" });
!Doc.UserDoc().novice && helpItems.push({ description: "Print Document in Console", event: () => console.log(this.props.Document), icon: "hand-point-right" });
+ !Doc.UserDoc().novice && helpItems.push({ description: "Print DataDoc in Console", event: () => console.log(this.props.Document[DataSym]), icon: "hand-point-right" });
cm.addItem({ description: "Help...", noexpand: true, subitems: helpItems, icon: "question" });
}
+
if (!this.topMost) e?.stopPropagation(); // DocumentViews should stop propagation of this event
cm.displayMenu((e?.pageX || pageX || 0) - 15, (e?.pageY || pageY || 0) - 15);
DocumentViewInternal.SelectAfterContextMenu && !this.props.isSelected(true) && setTimeout(() => SelectionManager.SelectView(this.props.DocumentView(), false), 300); // on a mac, the context menu is triggered on mouse down, but a YouTube video becaomes interactive when selected which means that the context menu won't show up. by delaying the selection until hopefully after the pointer up, the context menu will appear.
@@ -838,7 +839,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
if (this.props.LayoutTemplateString?.includes(LinkAnchorBox.name)) return null;
if (this.layoutDoc.presBox || this.rootDoc.type === DocumentType.LINK || this.props.dontRegisterView) return (null);
// need to use allLinks for RTF since embedded linked text anchors are not rendered with DocumentViews. All other documents render their anchors with nested DocumentViews so we just need to render the directLinks here
- const filtered = DocUtils.FilterDocs(this.rootDoc.type === DocumentType.RTF ? this.allLinks : this.directLinks, this.props.docFilters(), []).filter(d => !d.hidden);
+ const filtered = DocUtils.FilterDocs(this.rootDoc.type === DocumentType.RTF ? this.allLinks : this.directLinks, this.props.docFilters?.() ?? [], []).filter(d => !d.hidden);
return filtered.map((link, i) =>
<div className="documentView-anchorCont" key={i + 1}>
<DocumentView {...this.props}
@@ -846,6 +847,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
PanelWidth={this.anchorPanelWidth}
PanelHeight={this.anchorPanelHeight}
dontRegisterView={false}
+ fitWidth={returnTrue}
styleProvider={this.anchorStyleProvider}
removeDocument={this.hideLinkAnchor}
LayoutTemplate={undefined}
@@ -884,7 +886,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
recorder.ondataavailable = async (e: any) => {
const [{ result }] = await Networking.UploadFilesToServer(e.data);
if (!(result instanceof Error)) {
- const audioDoc = Docs.Create.AudioDocument(Utils.prepend(result.accessPaths.agnostic.client), { title: "audio test", _width: 200, _height: 32 });
+ const audioDoc = Docs.Create.AudioDocument(result.accessPaths.agnostic.client, { title: "audio test", _width: 200, _height: 32 });
audioDoc.treeViewExpandedView = "layout";
const audioAnnos = Cast(self.dataDoc[self.LayoutFieldKey + "-audioAnnotations"], listSpec(Doc));
if (audioAnnos === undefined) {
@@ -970,7 +972,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
const highlightIndex = this.props.LayoutTemplateString ? (Doc.IsHighlighted(this.props.Document) ? 6 : 0) : Doc.isBrushedHighlightedDegree(this.props.Document); // bcz: Argh!! need to identify a tree view doc better than a LayoutTemlatString
const highlightColor = (CurrentUserUtils.ActiveDashboard?.darkScheme ?
["transparent", "#65350c", "#65350c", "yellow", "magenta", "cyan", "orange"] :
- ["transparent", "maroon", "maroon", "yellow", "magenta", "cyan", "orange"])[highlightIndex];
+ ["transparent", "#4476F7", "#4476F7", "yellow", "magenta", "cyan", "orange"])[highlightIndex];
const highlightStyle = ["solid", "dashed", "solid", "solid", "solid", "solid", "solid"][highlightIndex];
const excludeTypes = !this.props.treeViewDoc ? [DocumentType.FONTICON, DocumentType.INK] : [DocumentType.FONTICON];
let highlighting = !this.props.disableDocBrushing && highlightIndex && !excludeTypes.includes(this.layoutDoc.type as any) && this.layoutDoc._viewType !== CollectionViewType.Linear;
@@ -978,7 +980,7 @@ export class DocumentViewInternal extends DocComponent<DocumentViewInternalProps
const borderPath = this.props.styleProvider?.(this.props.Document, this.props, StyleProp.BorderPath) || { path: undefined };
const internal = PresBox.EffectsProvider(this.layoutDoc, this.renderDoc) || this.renderDoc;
- const boxShadow = highlighting && this.borderRounding && highlightStyle !== "dashed" ? `0 0 0 ${highlightIndex}px ${highlightColor}` :
+ const boxShadow = this.props.treeViewDoc ? null : highlighting && this.borderRounding && highlightStyle !== "dashed" ? `0 0 0 ${highlightIndex}px ${highlightColor}` :
this.boxShadow || (this.props.Document.isTemplateForField ? "black 0.2vw 0.2vw 0.8vw" : undefined);
return <div className={DocumentView.ROOT_DIV} ref={this._mainCont}
onContextMenu={this.onContextMenu}
diff --git a/src/client/views/nodes/FieldView.tsx b/src/client/views/nodes/FieldView.tsx
index 86250c9d1..ebbc1138a 100644
--- a/src/client/views/nodes/FieldView.tsx
+++ b/src/client/views/nodes/FieldView.tsx
@@ -64,9 +64,9 @@ export class FieldView extends React.Component<FieldViewProps> {
// else if (field instaceof PresBox) {
// return <PresBox {...this.props} />;
// }
- else if (field instanceof VideoField) {
- return <VideoBox {...this.props} />;
- }
+ // else if (field instanceof VideoField) {
+ // return <VideoBox {...this.props} />;
+ // }
// else if (field instanceof AudioField) {
// return <AudioBox {...this.props} />;
//}
diff --git a/src/client/views/nodes/FontIconBox.scss b/src/client/views/nodes/FontIconBox.scss
index 33ac85a0e..718af2c16 100644
--- a/src/client/views/nodes/FontIconBox.scss
+++ b/src/client/views/nodes/FontIconBox.scss
@@ -1,5 +1,7 @@
+@import "../global/globalCssVariables";
+
.fontIconBox-label {
- color: white;
+ color: $white;
margin-right: 4px;
margin-top: 1px;
position: relative;
@@ -22,8 +24,8 @@
position: absolute;
top: -10px;
right: -10px;
- color: white;
- background: #f44b42;
+ color: $white;
+ background: $pink;
font-weight: 300;
border-radius: 100%;
width: 25px;
@@ -37,7 +39,7 @@
.menuButton-circle,
.menuButton-round {
border-radius: 100%;
- background-color: black;
+ background-color: $dark-gray;
padding: 0;
.fontIconBox-label {
@@ -47,13 +49,14 @@
}
&:hover {
- background-color: #aaaaa3;
+ background-color: $light-gray;
}
}
.menuButton-square {
padding-top: 3px;
padding-bottom: 3px;
+ background-color: $dark-gray;
.fontIconBox-label {
border-radius: 0px;
diff --git a/src/client/views/nodes/FontIconBox.tsx b/src/client/views/nodes/FontIconBox.tsx
index 6ae4b9726..0d415e238 100644
--- a/src/client/views/nodes/FontIconBox.tsx
+++ b/src/client/views/nodes/FontIconBox.tsx
@@ -14,6 +14,7 @@ import { DocComponent } from '../DocComponent';
import { StyleProp } from '../StyleProvider';
import { FieldView, FieldViewProps } from './FieldView';
import './FontIconBox.scss';
+import { Colors } from '../global/globalEnums';
const FontIconSchema = createSchema({
icon: "string",
});
@@ -47,7 +48,7 @@ export class FontIconBox extends DocComponent<FieldViewProps, FontIconDocument>(
const icon = StrCast(this.dataDoc.icon, "user") as any;
const presSize = shape === 'round' ? 25 : 30;
const presTrailsIcon = <img src={`/assets/${"presTrails.png"}`}
- style={{ width: presSize, height: presSize, filter: `invert(${color === "white" ? "100%" : "0%"})`, marginBottom: "5px" }} />;
+ style={{ width: presSize, height: presSize, filter: `invert(${color === Colors.DARK_GRAY ? "0%" : "100%"})`, marginBottom: "5px" }} />;
const button = <button className={`menuButton-${shape}`} onContextMenu={this.specificContextMenu}
style={{ backgroundColor: backgroundColor, }}>
<div className="menuButton-wrap">
diff --git a/src/client/views/nodes/ImageBox.tsx b/src/client/views/nodes/ImageBox.tsx
index e2e08a0e6..2c0106960 100644
--- a/src/client/views/nodes/ImageBox.tsx
+++ b/src/client/views/nodes/ImageBox.tsx
@@ -7,10 +7,10 @@ import { List } from '../../../fields/List';
import { ObjectField } from '../../../fields/ObjectField';
import { createSchema, makeInterface } from '../../../fields/Schema';
import { ComputedField } from '../../../fields/ScriptField';
-import { Cast, NumCast } from '../../../fields/Types';
+import { Cast, NumCast, StrCast } from '../../../fields/Types';
import { ImageField } from '../../../fields/URLField';
import { TraceMobx } from '../../../fields/util';
-import { emptyFunction, OmitKeys, returnOne, Utils } from '../../../Utils';
+import { emptyFunction, OmitKeys, returnOne, Utils, returnFalse } from '../../../Utils';
import { GooglePhotos } from '../../apis/google_docs/GooglePhotosClientUtils';
import { CognitiveServices, Confidence, Service, Tag } from '../../cognitive_services/CognitiveServices';
import { Networking } from '../../Network';
@@ -26,6 +26,10 @@ import { FaceRectangles } from './FaceRectangles';
import { FieldView, FieldViewProps } from './FieldView';
import "./ImageBox.scss";
import React = require("react");
+import { InkTool } from '../../../fields/InkField';
+import { CurrentUserUtils } from '../../util/CurrentUserUtils';
+import { AnchorMenu } from '../pdf/AnchorMenu';
+import { Docs } from '../../documents/Documents';
const path = require('path');
export const pageSchema = createSchema({
@@ -60,6 +64,13 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
} // sets viewing information for a componentview, typically when following a link. 'preview' tells the view to use the values without writing to the document
+
+ getAnchor = () => {
+ const anchor = AnchorMenu.Instance?.GetAnchor(this._savedAnnotations);
+ anchor && this.addDocument(anchor);
+ return anchor ?? this.rootDoc;
+ }
+
componentDidMount() {
this.props.setContentView?.(this); // bcz: do not remove this. without it, stepping into an image in the lightbox causes an infinite loop....
this._disposers.sizer = reaction(() => (
@@ -72,8 +83,8 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
{ fireImmediately: true, delay: 1000 });
this._disposers.selection = reaction(() => this.props.isSelected(),
selected => !selected && setTimeout(() => {
- Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
- this._savedAnnotations.clear();
+ // Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
+ // this._savedAnnotations.clear();
}));
this._disposers.path = reaction(() => ({ nativeSize: this.nativeSize, width: this.layoutDoc[WidthSym]() }),
({ nativeSize, width }) => {
@@ -227,7 +238,7 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
let succeeded = true;
let data: ImageField | undefined;
try {
- data = new ImageField(Utils.prepend(accessPaths.agnostic.client));
+ data = new ImageField(accessPaths.agnostic.client);
} catch {
succeeded = false;
}
@@ -321,12 +332,15 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
}
@action
marqueeDown = (e: React.PointerEvent) => {
- if (!e.altKey && e.button === 0 && this.layoutDoc._viewScale === 1 && this.isContentActive(true)) this._marqueeing = [e.clientX, e.clientY];
+ if (!e.altKey && e.button === 0 && this.layoutDoc._viewScale === 1 && this.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) {
+ this._marqueeing = [e.clientX, e.clientY];
+ e.stopPropagation();
+ }
}
@action
finishMarquee = () => {
this._marqueeing = undefined;
- this.props.select(true);
+ this.props.select(false);
}
render() {
@@ -342,16 +356,16 @@ export class ImageBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
}} >
<CollectionFreeFormView {...OmitKeys(this.props, ["NativeWidth", "NativeHeight", "setContentView"]).omit}
renderDepth={this.props.renderDepth + 1}
+ isAnnotationOverlay={true}
fieldKey={this.annotationKey}
CollectionView={undefined}
- isAnnotationOverlay={true}
annotationLayerHostsContent={true}
PanelWidth={this.props.PanelWidth}
PanelHeight={this.props.PanelHeight}
ScreenToLocalTransform={this.screenToLocalTransform}
+ scaling={returnOne}
select={emptyFunction}
isContentActive={this.isContentActive}
- scaling={returnOne}
whenChildContentsActiveChanged={this.whenChildContentsActiveChanged}
removeDocument={this.removeDocument}
moveDocument={this.moveDocument}
diff --git a/src/client/views/nodes/KeyValueBox.scss b/src/client/views/nodes/KeyValueBox.scss
index eb7c2f32b..ffcba4981 100644
--- a/src/client/views/nodes/KeyValueBox.scss
+++ b/src/client/views/nodes/KeyValueBox.scss
@@ -1,10 +1,10 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.keyValueBox-cont {
overflow-y: scroll;
width:100%;
height: 100%;
- background-color: $light-color;
- border: 1px solid $intermediate-color;
+ background-color: $white;
+ border: 1px solid $medium-gray;
border-radius: $border-radius;
box-sizing: border-box;
display: inline-block;
@@ -56,8 +56,8 @@ $header-height: 30px;
width:100%;
position: relative;
display: inline-block;
- background: $intermediate-color;
- color: $light-color;
+ background: $medium-gray;
+ color: $white;
text-transform: uppercase;
letter-spacing: 2px;
font-size: 12px;
@@ -66,7 +66,7 @@ $header-height: 30px;
th {
font-weight: normal;
&:first-child {
- border-right: 1px solid $light-color;
+ border-right: 1px solid $white;
}
}
}
@@ -76,9 +76,9 @@ $header-height: 30px;
display: flex;
width:100%;
height:$header-height;
- background: $light-color;
+ background: $white;
.formattedTextBox-cont {
- background: $light-color;
+ background: $white;
}
}
.keyValueBox-cont {
@@ -116,8 +116,8 @@ $header-height: 30px;
display: flex;
width:100%;
height:30px;
- background: $light-color-secondary;
+ background: $light-gray;
.formattedTextBox-cont {
- background: $light-color-secondary;
+ background: $light-gray;
}
} \ No newline at end of file
diff --git a/src/client/views/nodes/KeyValuePair.scss b/src/client/views/nodes/KeyValuePair.scss
index f78767234..5b660e582 100644
--- a/src/client/views/nodes/KeyValuePair.scss
+++ b/src/client/views/nodes/KeyValuePair.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.keyValuePair-td-key {
diff --git a/src/client/views/nodes/LinkDescriptionPopup.scss b/src/client/views/nodes/LinkDescriptionPopup.scss
index d92823ccc..a8db5d360 100644
--- a/src/client/views/nodes/LinkDescriptionPopup.scss
+++ b/src/client/views/nodes/LinkDescriptionPopup.scss
@@ -1,9 +1,13 @@
+@import "../global/globalCssVariables.scss";
+
.linkDescriptionPopup {
display: flex;
-
- border: 1px solid rgb(170, 26, 26);
-
+ flex-direction: row;
+ justify-content: center;
+ align-items: center;
+ border: 2px solid $medium-blue;
+ background-color: $white;
width: auto;
position: absolute;
@@ -11,17 +15,11 @@
z-index: 10000;
border-radius: 10px;
font-size: 12px;
- //white-space: nowrap;
-
- background-color: rgba(250, 250, 250, 0.95);
- padding-top: 9px;
- padding-bottom: 9px;
- padding-left: 9px;
- padding-right: 9px;
+ gap: 5px;
+ padding: 9px;
.linkDescriptionPopup-input {
float: left;
- background-color: rgba(250, 250, 250, 0.95);
color: rgb(100, 100, 100);
border: none;
min-width: 160px;
@@ -30,46 +28,29 @@
.linkDescriptionPopup-btn {
float: right;
-
justify-content: center;
vertical-align: middle;
-
.linkDescriptionPopup-btn-dismiss {
- background-color: white;
- color: black;
+ cursor: pointer;
display: inline;
- right: 0;
- border-radius: 10px;
- border: 1px solid black;
- padding: 3px;
- font-size: 9px;
- text-align: center;
- position: relative;
- margin-right: 4px;
- justify-content: center;
-
- &:hover{
- cursor: pointer;
- }
+ white-space: nowrap;
+ padding: 5px;
+ vertical-align: middle;
+ background-color: $close-red;
+ border-radius: 3px;
+ color: black;
}
.linkDescriptionPopup-btn-add {
- background-color: black;
- color: white;
+ cursor: pointer;
display: inline;
- right: 0;
- border-radius: 10px;
- border: 1px solid black;
- padding: 3px;
- font-size: 9px;
- text-align: center;
- position: relative;
- justify-content: center;
-
- &:hover{
- cursor: pointer;
- }
+ white-space: nowrap;
+ padding: 5px;
+ vertical-align: middle;
+ background-color: $light-blue;
+ border-radius: 3px;
+ color: black;
}
}
diff --git a/src/client/views/nodes/LinkDocPreview.tsx b/src/client/views/nodes/LinkDocPreview.tsx
index b73fb10df..126a37eb8 100644
--- a/src/client/views/nodes/LinkDocPreview.tsx
+++ b/src/client/views/nodes/LinkDocPreview.tsx
@@ -72,14 +72,14 @@ export class LinkDocPreview extends React.Component<LinkDocPreviewProps> {
@computed get href() {
if (this.props.hrefs?.length) {
const href = this.props.hrefs[this._hrefInd];
- if (href.indexOf(Utils.prepend("/doc/")) !== 0) { // link to a web page URL -- try to show a preview
+ if (href.indexOf(Doc.localServerPath()) !== 0) { // link to a web page URL -- try to show a preview
if (href.startsWith("https://en.wikipedia.org/wiki/")) {
wiki().page(href.replace("https://en.wikipedia.org/wiki/", "")).then(page => page.summary().then(action(summary => this._toolTipText = summary.substring(0, 500))));
} else {
setTimeout(action(() => this._toolTipText = "url => " + href));
}
} else { // hyperlink to a document .. decode doc id and retrieve from the server. this will trigger vals() being invalidated
- const anchorDoc = href.replace(Utils.prepend("/doc/"), "").split("?")[0];
+ const anchorDoc = href.replace(Doc.localServerPath(), "").split("?")[0];
anchorDoc && DocServer.GetRefField(anchorDoc).then(action(anchor => {
if (anchor instanceof Doc && DocListCast(anchor.links).length) {
this._linkDoc = DocListCast(anchor.links)[0];
diff --git a/src/client/views/nodes/PDFBox.scss b/src/client/views/nodes/PDFBox.scss
index 0f46da294..72dec6e4c 100644
--- a/src/client/views/nodes/PDFBox.scss
+++ b/src/client/views/nodes/PDFBox.scss
@@ -7,7 +7,7 @@
overflow: hidden;
cursor: auto;
transform-origin: top left;
- z-index: 0;
+ //z-index: 0;
.pdfBox-ui {
position: absolute;
@@ -30,6 +30,7 @@
justify-content: center;
border-radius: 3px;
pointer-events: all;
+ z-index: 1; // so it appears on top of the document's title, if shown
}
.pdfBox-pageNums {
@@ -223,7 +224,7 @@
.pdfBox {
width: 100%;
height: 100%;
- pointer-events: none;
+ //pointer-events: none;
.pdfViewerDash-text {
.textLayer {
display: none;
diff --git a/src/client/views/nodes/PDFBox.tsx b/src/client/views/nodes/PDFBox.tsx
index feaeb9e21..fc8fa4eef 100644
--- a/src/client/views/nodes/PDFBox.tsx
+++ b/src/client/views/nodes/PDFBox.tsx
@@ -3,10 +3,10 @@ import { action, computed, IReactionDisposer, observable, reaction, runInAction
import { observer } from "mobx-react";
import * as Pdfjs from "pdfjs-dist";
import "pdfjs-dist/web/pdf_viewer.css";
-import { Doc, Opt, WidthSym } from "../../../fields/Doc";
+import { Doc, Opt, WidthSym, DocListCast } from "../../../fields/Doc";
import { documentSchema } from '../../../fields/documentSchemas';
import { makeInterface } from "../../../fields/Schema";
-import { Cast, NumCast, StrCast } from '../../../fields/Types';
+import { Cast, NumCast, StrCast, BoolCast } from '../../../fields/Types';
import { PdfField } from "../../../fields/URLField";
import { TraceMobx } from '../../../fields/util';
import { Utils, setupMoveUpEvents, emptyFunction } from '../../../Utils';
@@ -23,6 +23,7 @@ import { FieldView, FieldViewProps } from './FieldView';
import { pageSchema } from "./ImageBox";
import "./PDFBox.scss";
import React = require("react");
+import { AnchorMenu } from '../pdf/AnchorMenu';
type PdfDocument = makeInterface<[typeof documentSchema, typeof panZoomSchema, typeof pageSchema]>;
const PdfDocument = makeInterface(documentSchema, panZoomSchema, pageSchema);
@@ -52,30 +53,6 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
if (PDFBox.pdfcache.get(this.pdfUrl.url.href)) runInAction(() => this._pdf = PDFBox.pdfcache.get(this.pdfUrl!.url.href));
else if (PDFBox.pdfpromise.get(this.pdfUrl.url.href)) PDFBox.pdfpromise.get(this.pdfUrl.url.href)?.then(action(pdf => this._pdf = pdf));
}
-
- const backup = "oldPath";
- const href = this.pdfUrl?.url.href;
- if (href) {
- const pathCorrectionTest = /upload\_[a-z0-9]{32}.(.*)/g;
- const matches = pathCorrectionTest.exec(href);
- // console.log("\nHere's the { url } being fed into the outer regex:");
- // console.log(href);
- // console.log("And here's the 'properPath' build from the captured filename:\n");
- if (matches !== null && href.startsWith(window.location.origin)) {
- const properPath = Utils.prepend(`/files/pdfs/${matches[0]}`);
- //console.log(properPath);
- if (!properPath.includes(href)) {
- console.log(`The two (url and proper path) were not equal`);
- const proto = Doc.GetProto(this.props.Document);
- proto[this.props.fieldKey] = new PdfField(properPath);
- proto[backup] = href;
- } else {
- //console.log(`The two (url and proper path) were equal`);
- }
- } else {
- console.log("Outer matches was null!");
- }
- }
}
componentWillUnmount() { this._selectReactionDisposer?.(); }
@@ -89,16 +66,21 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
}
scrollFocus = (doc: Doc, smooth: boolean) => {
+ if (DocListCast(this.props.Document[this.fieldKey + "-sidebar"]).includes(doc) && !this.SidebarShown) {
+ this.toggleSidebar(!smooth);
+ }
if (this._sidebarRef?.current?.makeDocUnfiltered(doc)) return 1;
this._initialScrollTarget = doc;
return this._pdfViewer?.scrollFocus(doc, smooth);
}
getAnchor = () => {
- const anchor = Docs.Create.TextanchorDocument({
- title: StrCast(this.rootDoc.title + " " + this.layoutDoc._scrollTop),
- annotationOn: this.rootDoc,
- y: NumCast(this.layoutDoc._scrollTop),
- });
+ const anchor =
+ AnchorMenu.Instance?.GetAnchor() ??
+ Docs.Create.TextanchorDocument({
+ title: StrCast(this.rootDoc.title + " " + this.layoutDoc._scrollTop),
+ annotationOn: this.rootDoc,
+ y: NumCast(this.layoutDoc._scrollTop),
+ });
this.addDocument(anchor);
return anchor;
}
@@ -162,15 +144,18 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
this.layoutDoc._showSidebar = nativeWidth !== this.layoutDoc._nativeWidth;
}
return false;
- }, emptyFunction, this.toggleSidebar);
+ }, emptyFunction, () => this.toggleSidebar());
}
- toggleSidebar = action(() => {
+ toggleSidebar = action((preview: boolean = false) => {
const nativeWidth = NumCast(this.layoutDoc[this.fieldKey + "-nativeWidth"]);
const ratio = ((!this.layoutDoc.nativeWidth || this.layoutDoc.nativeWidth === nativeWidth ? 250 : 0) + nativeWidth) / nativeWidth;
const curNativeWidth = NumCast(this.layoutDoc.nativeWidth, nativeWidth);
- this.layoutDoc.nativeWidth = nativeWidth * ratio;
- this.layoutDoc._width = this.layoutDoc[WidthSym]() * nativeWidth * ratio / curNativeWidth;
- this.layoutDoc._showSidebar = nativeWidth !== this.layoutDoc._nativeWidth;
+ if (preview) this._showSidebar = true;
+ else {
+ this.layoutDoc.nativeWidth = nativeWidth * ratio;
+ this.layoutDoc._width = this.layoutDoc[WidthSym]() * nativeWidth * ratio / curNativeWidth;
+ this.layoutDoc._showSidebar = nativeWidth !== this.layoutDoc._nativeWidth;
+ }
});
settingsPanel() {
const pageBtns = <>
@@ -223,7 +208,7 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
</button>
</div>;
}
- sidebarWidth = () => !this.layoutDoc._showSidebar ? 0 : (NumCast(this.layoutDoc.nativeWidth) - Doc.NativeWidth(this.dataDoc)) * this.props.PanelWidth() / NumCast(this.layoutDoc.nativeWidth);
+ sidebarWidth = () => !this.SidebarShown ? 0 : (NumCast(this.layoutDoc.nativeWidth) - Doc.NativeWidth(this.dataDoc)) * this.props.PanelWidth() / NumCast(this.layoutDoc.nativeWidth);
specificContextMenu = (e: React.MouseEvent): void => {
const funcs: ContextMenuProps[] = [];
@@ -244,6 +229,9 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
}
anchorMenuClick = () => this._sidebarRef.current?.anchorMenuClick;
+ @observable _showSidebar = false;
+ @computed get SidebarShown() { return this._showSidebar || this.layoutDoc._showSidebar ? true : false; }
+
@computed get renderPdfView() {
TraceMobx();
@@ -276,6 +264,7 @@ export class PDFBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
rootDoc={this.rootDoc}
layoutDoc={this.layoutDoc}
dataDoc={this.dataDoc}
+ showSidebar={this.SidebarShown}
whenChildContentsActiveChanged={this.whenChildContentsActiveChanged}
sidebarAddDocument={this.sidebarAddDocument}
moveDocument={this.moveDocument}
diff --git a/src/client/views/nodes/RadialMenu.scss b/src/client/views/nodes/RadialMenu.scss
index daa620d12..312b51013 100644
--- a/src/client/views/nodes/RadialMenu.scss
+++ b/src/client/views/nodes/RadialMenu.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.radialMenu-cont {
position: absolute;
@@ -53,7 +53,7 @@ s
transition: all .1s;
border-width: .11px;
border-style: none;
- border-color: $intermediate-color; // rgb(187, 186, 186);
+ border-color: $medium-gray; // rgb(187, 186, 186);
// padding: 10px 0px 10px 0px;
white-space: nowrap;
font-size: 13px;
diff --git a/src/client/views/nodes/ScreenshotBox.tsx b/src/client/views/nodes/ScreenshotBox.tsx
index 252c029e4..0e235a62d 100644
--- a/src/client/views/nodes/ScreenshotBox.tsx
+++ b/src/client/views/nodes/ScreenshotBox.tsx
@@ -227,7 +227,7 @@ export class ScreenshotBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatabl
this._audioRec.onstop = async (e: any) => {
const [{ result }] = await Networking.UploadFilesToServer(aud_chunks);
if (!(result instanceof Error)) {
- this.dataDoc[this.props.fieldKey + "-audio"] = new AudioField(Utils.prepend(result.accessPaths.agnostic.client));
+ this.dataDoc[this.props.fieldKey + "-audio"] = new AudioField(result.accessPaths.agnostic.client);
}
};
this._videoRef!.srcObject = await (navigator.mediaDevices as any).getDisplayMedia({ video: true });
@@ -244,7 +244,7 @@ export class ScreenshotBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatabl
this.layoutDoc.layout = VideoBox.LayoutString(this.fieldKey);
this.dataDoc.nativeWidth = this.dataDoc.nativeHeight = undefined;
this.layoutDoc._fitWidth = undefined;
- this.dataDoc[this.props.fieldKey] = new VideoField(Utils.prepend(result.accessPaths.agnostic.client));
+ this.dataDoc[this.props.fieldKey] = new VideoField(result.accessPaths.agnostic.client);
} else alert("video conversion failed");
};
this._audioRec.start();
@@ -252,8 +252,8 @@ export class ScreenshotBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatabl
this.dataDoc.mediaState = "recording";
DocUtils.ActiveRecordings.push(this);
} else {
- this._audioRec.stop();
- this._videoRec.stop();
+ this._audioRec?.stop();
+ this._videoRec?.stop();
this.dataDoc.mediaState = "paused";
const ind = DocUtils.ActiveRecordings.indexOf(this);
ind !== -1 && (DocUtils.ActiveRecordings.splice(ind, 1));
diff --git a/src/client/views/nodes/VideoBox.tsx b/src/client/views/nodes/VideoBox.tsx
index 263fd5a19..ce45c01e6 100644
--- a/src/client/views/nodes/VideoBox.tsx
+++ b/src/client/views/nodes/VideoBox.tsx
@@ -75,10 +75,6 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
return CollectionStackedTimeline.createAnchor(this.rootDoc, this.dataDoc, this.annotationKey, "_timecodeToShow"/* videoStart */, "_timecodeToHide" /* videoEnd */, timecode ? timecode : undefined) || this.rootDoc;
}
- choosePath(url: string) {
- return url.indexOf(window.location.origin) === -1 ? Utils.CorsProxy(url) : url;
- }
-
videoLoad = () => {
const aspect = this.player!.videoWidth / this.player!.videoHeight;
Doc.SetNativeWidth(this.dataDoc, this.player!.videoWidth);
@@ -182,8 +178,8 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
}
}
- private createRealSummaryLink = (relative: string, downX?: number, downY?: number) => {
- const url = this.choosePath(Utils.prepend(relative));
+ private createRealSummaryLink = (imagePath: string, downX?: number, downY?: number) => {
+ const url = !imagePath.startsWith("/") ? Utils.CorsProxy(imagePath) : imagePath;
const width = this.layoutDoc._width || 1;
const height = this.layoutDoc._height || 0;
const imageSummary = Docs.Create.ImageDocument(url, {
@@ -543,7 +539,7 @@ export class VideoBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProp
}
marqueeDown = action((e: React.PointerEvent) => {
- if (!e.altKey && e.button === 0 && this.layoutDoc._viewScale === 1 && this.isContentActive(true)) this._marqueeing = [e.clientX, e.clientY];
+ if (!e.altKey && e.button === 0 && this.layoutDoc._viewScale === 1 && this.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) this._marqueeing = [e.clientX, e.clientY];
});
finishMarquee = action(() => {
diff --git a/src/client/views/nodes/WebBox.scss b/src/client/views/nodes/WebBox.scss
index ca82c049c..19b69ff5a 100644
--- a/src/client/views/nodes/WebBox.scss
+++ b/src/client/views/nodes/WebBox.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables.scss";
+@import "../global/globalCssVariables.scss";
.webBox {
@@ -17,6 +17,7 @@
justify-content: center;
border-radius: 3px;
pointer-events: all;
+ z-index: 1; // so it appears on top of the document's title, if shown
}
.pdfViewerDash-dragAnnotationBox {
diff --git a/src/client/views/nodes/WebBox.tsx b/src/client/views/nodes/WebBox.tsx
index cb7e58559..bb2c09fdf 100644
--- a/src/client/views/nodes/WebBox.tsx
+++ b/src/client/views/nodes/WebBox.tsx
@@ -88,9 +88,10 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
this._disposers.selection = reaction(() => this.props.isSelected(),
selected => !selected && setTimeout(() => {
- Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
- this._savedAnnotations.clear();
- }));
+ // Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
+ // this._savedAnnotations.clear();
+ })
+ );
if (this.webField?.href.indexOf("youtube") !== -1) {
const youtubeaspect = 400 / 315;
@@ -159,9 +160,13 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
menuControls = () => this.urlEditor; // controls to be added to the top bar when a document of this type is selected
scrollFocus = (doc: Doc, smooth: boolean) => {
+ if (DocListCast(this.props.Document[this.fieldKey + "-sidebar"]).includes(doc) && !this.SidebarShown) {
+ this.toggleSidebar(!smooth);
+ }
if (this._sidebarRef?.current?.makeDocUnfiltered(doc)) return 1;
if (doc !== this.rootDoc && this._outerRef.current) {
- const scrollTo = doc.type === DocumentType.TEXTANCHOR ? NumCast(doc.y) : Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.layoutDoc._scrollTop), this.props.PanelHeight() / (this.props.scaling?.() || 1));
+ const windowHeight = this.props.PanelHeight() / (this.props.scaling?.() || 1);
+ const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.layoutDoc._scrollTop), windowHeight, windowHeight * .1);
if (scrollTo !== undefined) {
const focusSpeed = smooth ? 500 : 0;
this._initialScroll !== undefined && (this._initialScroll = scrollTo);
@@ -174,11 +179,13 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
}
getAnchor = () => {
- const anchor = Docs.Create.TextanchorDocument({
- title: StrCast(this.rootDoc.title + " " + this.layoutDoc._scrollTop),
- annotationOn: this.rootDoc,
- y: NumCast(this.layoutDoc._scrollTop),
- });
+ const anchor =
+ AnchorMenu.Instance?.GetAnchor(this._savedAnnotations) ??
+ Docs.Create.TextanchorDocument({
+ title: StrCast(this.rootDoc.title + " " + this.layoutDoc._scrollTop),
+ annotationOn: this.rootDoc,
+ y: NumCast(this.layoutDoc._scrollTop),
+ });
this.addDocument(anchor);
return anchor;
}
@@ -395,7 +402,7 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
@action
onMarqueeDown = (e: React.PointerEvent) => {
- if (!e.altKey && e.button === 0 && this.isContentActive(true)) {
+ if (!e.altKey && e.button === 0 && this.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) {
this._marqueeing = [e.clientX, e.clientY];
this.props.select(false);
}
@@ -445,17 +452,20 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
this.layoutDoc._showSidebar = nativeWidth !== this.layoutDoc._nativeWidth;
}
return false;
- }, emptyFunction, this.toggleSidebar);
+ }, emptyFunction, () => this.toggleSidebar());
}
- toggleSidebar = action(() => {
+ toggleSidebar = action((preview: boolean = false) => {
const nativeWidth = NumCast(this.layoutDoc[this.fieldKey + "-nativeWidth"]);
const ratio = ((!this.layoutDoc.nativeWidth || this.layoutDoc.nativeWidth === nativeWidth ? 250 : 0) + nativeWidth) / nativeWidth;
const curNativeWidth = NumCast(this.layoutDoc.nativeWidth, nativeWidth);
- this.layoutDoc.nativeWidth = nativeWidth * ratio;
- this.layoutDoc._width = this.layoutDoc[WidthSym]() * nativeWidth * ratio / curNativeWidth;
- this.layoutDoc._showSidebar = nativeWidth !== this.layoutDoc._nativeWidth;
+ if (preview) this._showSidebar;
+ else {
+ this.layoutDoc.nativeWidth = nativeWidth * ratio;
+ this.layoutDoc._width = this.layoutDoc[WidthSym]() * nativeWidth * ratio / curNativeWidth;
+ this.layoutDoc._showSidebar = nativeWidth !== this.layoutDoc._nativeWidth;
+ }
});
- sidebarWidth = () => !this.layoutDoc._showSidebar ? 0 : (NumCast(this.layoutDoc.nativeWidth) - Doc.NativeWidth(this.dataDoc)) * this.props.PanelWidth() / NumCast(this.layoutDoc.nativeWidth);
+ sidebarWidth = () => !this.SidebarShown ? 0 : (NumCast(this.layoutDoc.nativeWidth) - Doc.NativeWidth(this.dataDoc)) * this.props.PanelWidth() / NumCast(this.layoutDoc.nativeWidth);
@computed get content() {
return <div className={"webBox-cont" + (!this.props.docViewPath().lastElement()?.docView?._pendingDoubleClick && this.isContentActive() && CurrentUserUtils.SelectedTool === InkTool.None && !DocumentDecorations.Instance?.Interacting ? "-interactive" : "")}
@@ -471,7 +481,10 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
<Annotation {...this.props} fieldKey={this.annotationKey} showInfo={this.showInfo} dataDoc={this.dataDoc} anno={anno} key={`${anno[Id]}-annotation`} />)
}
</div>;
+
}
+ @observable _showSidebar = false;
+ @computed get SidebarShown() { return this._showSidebar || this.layoutDoc._showSidebar ? true : false; }
showInfo = action((anno: Opt<Doc>) => this._overlayAnnoInfo = anno);
setPreviewCursor = (func?: (x: number, y: number, drag: boolean) => void) => this._setPreviewCursor = func;
@@ -505,11 +518,15 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
}}>
{this.content}
<CollectionFreeFormView {...OmitKeys(this.props, ["NativeWidth", "NativeHeight", "setContentView"]).omit}
+ renderDepth={this.props.renderDepth + 1}
isAnnotationOverlay={true}
fieldKey={this.annotationKey}
+ CollectionView={undefined}
setPreviewCursor={this.setPreviewCursor}
PanelWidth={this.panelWidth}
PanelHeight={this.panelHeight}
+ ScreenToLocalTransform={this.scrollXf}
+ scaling={returnOne}
dropAction={"alias"}
select={emptyFunction}
isContentActive={returnFalse}
@@ -519,10 +536,6 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
removeDocument={this.removeDocument}
moveDocument={this.moveDocument}
addDocument={this.sidebarAddDocument}
- CollectionView={undefined}
- ScreenToLocalTransform={this.scrollXf}
- renderDepth={this.props.renderDepth + 1}
- scaling={returnOne}
childPointerEvents={true}
pointerEvents={this._isAnnotating || SnappingManager.GetIsDragging() ? "all" : "none"} />
{this.annotationLayer}
@@ -544,10 +557,11 @@ export class WebBox extends ViewBoxAnnotatableComponent<ViewBoxAnnotatableProps
</div >
<SidebarAnnos ref={this._sidebarRef}
{...this.props}
- fieldKey={this.annotationKey}
+ fieldKey={this.fieldKey}
rootDoc={this.rootDoc}
layoutDoc={this.layoutDoc}
dataDoc={this.dataDoc}
+ showSidebar={this.SidebarShown}
sidebarAddDocument={this.sidebarAddDocument}
moveDocument={this.moveDocument}
removeDocument={this.removeDocument}
diff --git a/src/client/views/nodes/formattedText/DashFieldView.scss b/src/client/views/nodes/formattedText/DashFieldView.scss
index e16036000..e7dd286a5 100644
--- a/src/client/views/nodes/formattedText/DashFieldView.scss
+++ b/src/client/views/nodes/formattedText/DashFieldView.scss
@@ -1,6 +1,7 @@
.dashFieldView {
position: relative;
- display: inline-block;
+ display: inline-flex;
+ align-items: center;
.dashFieldView-enumerables {
width: 10px;
@@ -13,6 +14,8 @@
min-width: 12px;
position: relative;
display: inline-block;
+ margin: 0;
+ transform: scale(0.7);
background-color: rgba(155, 155, 155, 0.24);
}
.dashFieldView-labelSpan {
@@ -22,11 +25,11 @@
background: rgba(0,0,0,0.1);
}
.dashFieldView-fieldSpan {
- min-width: 20px;
+ min-width: 8px;
margin-left: 2px;
margin-right: 5px;
- position: relative;
- display: inline;
+ padding-left: 2px;
+ display: inline-block;
background-color: rgba(155, 155, 155, 0.24);
font-weight: bold;
span {
diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.scss b/src/client/views/nodes/formattedText/FormattedTextBox.scss
index 53aceb533..3cedab1a4 100644
--- a/src/client/views/nodes/formattedText/FormattedTextBox.scss
+++ b/src/client/views/nodes/formattedText/FormattedTextBox.scss
@@ -1,4 +1,4 @@
-@import "../../globalCssVariables";
+@import "../../global/globalCssVariables";
.ProseMirror {
width: 100%;
@@ -31,7 +31,7 @@ audiotag:hover {
padding: 0;
border-width: 0px;
border-radius: inherit;
- border-color: $intermediate-color;
+ border-color: $medium-gray;
box-sizing: border-box;
background-color: inherit;
border-style: solid;
@@ -363,7 +363,7 @@ footnote::after {
@media only screen and (max-width: 1000px) {
- @import "../../globalCssVariables";
+ @import "../../global/globalCssVariables";
.ProseMirror {
width: 100%;
@@ -381,7 +381,7 @@ footnote::after {
padding: 0;
border-width: 0px;
border-radius: inherit;
- border-color: $intermediate-color;
+ border-color: $medium-gray;
box-sizing: border-box;
background-color: inherit;
border-style: solid;
diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
index 911ec1560..d308345ec 100644
--- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx
+++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx
@@ -71,7 +71,8 @@ export interface FormattedTextBoxProps {
xPadding?: number; // used to override document's settings for xMargin --- see CollectionCarouselView
yPadding?: number;
noSidebar?: boolean;
- dontSelectOnLoad?: boolean; // suppress selecting the text box when loaded
+ dontScale?: boolean;
+ dontSelectOnLoad?: boolean; // suppress selecting the text box when loaded (and mark as not being associated with scrollTop document field)
}
export const GoogleRef = "googleDocId";
@@ -119,13 +120,14 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
public get EditorView() { return this._editorView; }
public get SidebarKey() { return this.fieldKey + "-sidebar"; }
- @computed get sidebarWidthPercent() { return StrCast(this.layoutDoc._sidebarWidthPercent, "0%"); }
+ @computed get sidebarWidthPercent() { return this._showSidebar ? "20%" : StrCast(this.layoutDoc._sidebarWidthPercent, "0%"); }
@computed get sidebarColor() { return StrCast(this.layoutDoc.sidebarColor, StrCast(this.layoutDoc[this.props.fieldKey + "-backgroundColor"], "#e4e4e4")); }
@computed get autoHeight() { return this.layoutDoc._autoHeight && !this.props.ignoreAutoHeight; }
@computed get textHeight() { return NumCast(this.rootDoc[this.fieldKey + "-height"]); }
@computed get scrollHeight() { return NumCast(this.rootDoc[this.fieldKey + "-scrollHeight"]); }
- @computed get sidebarHeight() { return NumCast(this.rootDoc[this.SidebarKey + "-height"]); }
+ @computed get sidebarHeight() { return !this.sidebarWidth() ? 0 : NumCast(this.rootDoc[this.SidebarKey + "-height"]); }
@computed get titleHeight() { return this.props.styleProvider?.(this.layoutDoc, this.props, StyleProp.HeaderMargin) || 0; }
+ @computed get autoHeightMargins() { return this.titleHeight + NumCast(this.layoutDoc._autoHeightMargins); }
@computed get _recording() { return this.dataDoc?.mediaState === "recording"; }
set _recording(value) {
!this.dataDoc.recordingSource && (this.dataDoc.mediaState = value ? "recording" : undefined);
@@ -213,6 +215,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
AnchorMenu.Instance.Status = "marquee";
AnchorMenu.Instance.Highlight = action((color: string, isLinkButton: boolean) => {
this._editorView?.state && RichTextMenu.Instance.insertHighlight(color, this._editorView.state, this._editorView?.dispatch);
+ console.log("highlight")
return undefined;
});
/**
@@ -368,7 +371,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
this._searchIndex = ++this._searchIndex > flattened.length - 1 ? 0 : this._searchIndex;
const anchor = Docs.Create.TextanchorDocument();
const alink = DocUtils.MakeLink({ doc: anchor }, { doc: target }, "automatic")!;
- const allAnchors = [{ href: Utils.prepend("/doc/" + anchor[Id]), title: "a link", anchorId: anchor[Id] }];
+ const allAnchors = [{ href: Doc.localServerPath(anchor), title: "a link", anchorId: anchor[Id] }];
const link = this._editorView!.state.schema.marks.linkAnchor.create({ allAnchors, title: "auto link", location });
tr = tr.addMark(flattened[i].from, flattened[i].to, link);
});
@@ -541,11 +544,16 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}
}
+ @observable _showSidebar = false;
+ @computed get SidebarShown() { return this._showSidebar || this.layoutDoc._showSidebar ? true : false; }
+
@action
- toggleSidebar = () => {
+ toggleSidebar = (preview: boolean = false) => {
const prevWidth = this.sidebarWidth();
- this.layoutDoc._showSidebar = ((this.layoutDoc._sidebarWidthPercent = StrCast(this.layoutDoc._sidebarWidthPercent, "0%") === "0%" ? "50%" : "0%")) !== "0%";
- this.layoutDoc._width = this.layoutDoc._showSidebar ? NumCast(this.layoutDoc._width) * 2 : Math.max(20, NumCast(this.layoutDoc._width) - prevWidth);
+ if (preview) this._showSidebar = true;
+ else this.layoutDoc._showSidebar = ((this.layoutDoc._sidebarWidthPercent = StrCast(this.layoutDoc._sidebarWidthPercent, "0%") === "0%" ? "50%" : "0%")) !== "0%";
+
+ this.layoutDoc._width = !preview && this.SidebarShown ? NumCast(this.layoutDoc._width) * 2 : Math.max(20, NumCast(this.layoutDoc._width) - prevWidth);
}
sidebarDown = (e: React.PointerEvent) => {
setupMoveUpEvents(this, e, this.sidebarMove, emptyFunction, () => setTimeout(this.toggleSidebar), false);
@@ -702,7 +710,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
let tr = state.tr.addMark(sel.from, sel.to, splitter);
if (sel.from !== sel.to) {
const anchor = anchorDoc ?? Docs.Create.TextanchorDocument({ title: this._editorView?.state.doc.textBetween(sel.from, sel.to) });
- const href = targetHref ?? Utils.prepend("/doc/" + anchor[Id]);
+ const href = targetHref ?? Doc.localServerPath(anchor);
if (anchor !== anchorDoc) this.addDocument(anchor);
tr.doc.nodesBetween(sel.from, sel.to, (node: any, pos: number, parent: any) => {
if (node.firstChild === null && node.marks.find((m: Mark) => m.type.name === schema.marks.splitter.name)) {
@@ -723,6 +731,9 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}
scrollFocus = (textAnchor: Doc, smooth: boolean) => {
+ if (DocListCast(this.Document[this.fieldKey + "-sidebar"]).includes(textAnchor) && !this.SidebarShown) {
+ this.toggleSidebar(!smooth);
+ }
const textAnchorId = textAnchor[Id];
const findAnchorFrag = (frag: Fragment, editor: EditorView) => {
const nodes: Node[] = [];
@@ -780,12 +791,12 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
// Since we also monitor all component height changes, this will update the document's height.
resetNativeHeight = (scrollHeight: number) => {
const nh = this.layoutDoc.isTemplateForField ? 0 : NumCast(this.layoutDoc._nativeHeight);
- this.rootDoc[this.fieldKey + "-height"] = scrollHeight + this.titleHeight;
+ this.rootDoc[this.fieldKey + "-height"] = scrollHeight;
if (nh) this.layoutDoc._nativeHeight = scrollHeight;
}
componentDidMount() {
- this.props.setContentView?.(this); // this tells the DocumentView that this AudioBox is the "content" of the document. this allows the DocumentView to indirectly call getAnchor() on the AudioBox when making a link.
+ !this.props.dontSelectOnLoad && this.props.setContentView?.(this); // this tells the DocumentView that this AudioBox is the "content" of the document. this allows the DocumentView to indirectly call getAnchor() on the AudioBox when making a link.
this._cachedLinks = DocListCast(this.Document.links);
this._disposers.breakupDictation = reaction(() => DocumentManager.Instance.RecordingEvent, this.breakupDictation);
this._disposers.autoHeight = reaction(() => this.autoHeight, autoHeight => autoHeight && this.tryUpdateScrollHeight());
@@ -793,8 +804,8 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
({ width, scrollHeight, autoHeight }) => width && autoHeight && this.resetNativeHeight(scrollHeight)
);
this._disposers.componentHeights = reaction( // set the document height when one of the component heights changes and autoHeight is on
- () => ({ sidebarHeight: this.sidebarHeight, textHeight: this.textHeight, autoHeight: this.autoHeight }),
- ({ sidebarHeight, textHeight, autoHeight }) => autoHeight && this.props.setHeight(Math.max(sidebarHeight, textHeight)));
+ () => ({ sidebarHeight: this.sidebarHeight, textHeight: this.textHeight, autoHeight: this.autoHeight, marginsHeight: this.autoHeightMargins }),
+ ({ sidebarHeight, textHeight, autoHeight, marginsHeight }) => autoHeight && this.props.setHeight(marginsHeight + Math.max(sidebarHeight, textHeight)));
this._disposers.links = reaction(() => DocListCast(this.Document.links), // if a link is deleted, then remove all hyperlinks that reference it from the text's marks
newLinks => {
this._cachedLinks.forEach(l => !newLinks.includes(l) && this.RemoveLinkFromDoc(l));
@@ -876,7 +887,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
var quickScroll: string | undefined = "";
this._disposers.scroll = reaction(() => NumCast(this.layoutDoc._scrollTop),
pos => {
- if (!this._ignoreScroll && this._scrollRef.current) {
+ if (!this._ignoreScroll && this._scrollRef.current && !this.props.dontSelectOnLoad) {
const viewTrans = quickScroll ?? StrCast(this.Document._viewTransition);
const durationMiliStr = viewTrans.match(/([0-9]*)ms/);
const durationSecStr = viewTrans.match(/([0-9.]*)s/);
@@ -1039,7 +1050,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}
const marks = [...node.marks];
const linkIndex = marks.findIndex(mark => mark.type.name === "link");
- const allLinks = [{ href: Utils.prepend(`/doc/${linkId}`), title, linkId }];
+ const allLinks = [{ href: Doc.globalServerPath(linkId), title, linkId }];
const link = view.state.schema.mark(view.state.schema.marks.linkAnchor, { allLinks, location: "add:right", title, docref: true });
marks.splice(linkIndex === -1 ? 0 : linkIndex, 1, link);
return node.mark(marks);
@@ -1413,23 +1424,24 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}
onScroll = (e: React.UIEvent) => {
if (!LinkDocPreview.LinkInfo && this._scrollRef.current) {
- this._ignoreScroll = true;
- this.layoutDoc._scrollTop = this._scrollRef.current.scrollTop;
- this._ignoreScroll = false;
+ if (!this.props.dontSelectOnLoad) {
+ this._ignoreScroll = true;
+ this.layoutDoc._scrollTop = this._scrollRef.current.scrollTop;
+ this._ignoreScroll = false;
+ }
}
}
tryUpdateScrollHeight() {
if (!LightboxView.LightboxDoc || LightboxView.IsLightboxDocView(this.props.docViewPath())) {
- setTimeout(() => { // bcz: don't know why this is needed, but without it, the size of the textbox is too big as it includes the size of the title header. after the timeout, the size seems to get computed correctly.
- const proseHeight = this.ProseRef?.scrollHeight || 0;
- const scrollHeight = this.ProseRef && Math.min(NumCast(this.layoutDoc.docMaxAutoHeight, proseHeight), proseHeight);
- if (scrollHeight && this.props.renderDepth && !this.props.dontRegisterView) { // if top === 0, then the text box is growing upward (as the overlay caption) which doesn't contribute to the height computation
- const setScrollHeight = () => this.rootDoc[this.fieldKey + "-scrollHeight"] = scrollHeight;
- if (this.rootDoc === this.layoutDoc.doc || this.layoutDoc.resolvedDataDoc) {
- setScrollHeight();
- } else setTimeout(setScrollHeight, 10); // if we have a template that hasn't been resolved yet, we can't set the height or we'd be setting it on the unresolved template. So set a timeout and hope its arrived...
- }
- });
+ const margins = 2 * NumCast(this.layoutDoc._yMargin, this.props.yPadding || 0);
+ const proseHeight = !this.ProseRef ? 0 : Array.from(this.ProseRef.children[0].children).reduce((p, child) => p + Number(getComputedStyle(child).height.replace("px", "")), margins);
+ const scrollHeight = this.ProseRef && Math.min(NumCast(this.layoutDoc.docMaxAutoHeight, proseHeight), proseHeight);
+ if (scrollHeight && this.props.renderDepth && !this.props.dontRegisterView) { // if top === 0, then the text box is growing upward (as the overlay caption) which doesn't contribute to the height computation
+ const setScrollHeight = () => this.rootDoc[this.fieldKey + "-scrollHeight"] = scrollHeight;
+ if (this.rootDoc === this.layoutDoc.doc || this.layoutDoc.resolvedDataDoc) {
+ setScrollHeight();
+ } else setTimeout(setScrollHeight, 10); // if we have a template that hasn't been resolved yet, we can't set the height or we'd be setting it on the unresolved template. So set a timeout and hope its arrived...
+ }
}
}
fitToBox = () => this.props.Document._fitToBox;
@@ -1464,11 +1476,13 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
return ComponentTag === CollectionStackingView ?
<SidebarAnnos ref={this._sidebarRef}
{...this.props}
- fieldKey={this.annotationKey}
+ fieldKey={this.fieldKey}
rootDoc={this.rootDoc}
layoutDoc={this.layoutDoc}
dataDoc={this.dataDoc}
+ showSidebar={this.SidebarShown}
PanelWidth={this.sidebarWidth}
+ setHeight={this.setSidebarHeight}
sidebarAddDocument={this.sidebarAddDocument}
moveDocument={this.moveDocument}
removeDocument={this.removeDocument}
@@ -1517,16 +1531,14 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
const selPad = Math.min(margins, 10);
const padding = Math.max(margins + ((selected && !this.layoutDoc._singleLine) || minimal ? -selPad : 0), 0);
const selPaddingClass = selected && !this.layoutDoc._singleLine && margins >= 10 ? "-selected" : "";
- const col = this.props.color ? this.props.color : this.props.styleProvider?.(this.layoutDoc, this.props, StyleProp.Color);
- const back = this.props.background ? this.props.background : this.props.styleProvider?.(this.layoutDoc, this.props, StyleProp.BackgroundColor);
return (
<div className="formattedTextBox-cont"
onWheel={e => this.isContentActive() && e.stopPropagation()}
style={{
- transform: `scale(${scale})`,
- transformOrigin: "top left",
- width: `${100 / scale}%`,
- height: `${100 / scale}%`,
+ transform: this.props.dontScale ? undefined : `scale(${scale})`,
+ transformOrigin: this.props.dontScale ? undefined : "top left",
+ width: this.props.dontScale ? undefined : `${100 / scale}%`,
+ height: this.props.dontScale ? undefined : `${100 / scale}%`,
// overflowY: this.layoutDoc._autoHeight ? "hidden" : undefined,
...this.styleFromLayoutString(scale) // this converts any expressions in the format string to style props. e.g., <FormattedTextBox height='{this._headerHeight}px' >
}}>
@@ -1554,7 +1566,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
>
<div className={`formattedTextBox-outer${selected ? "-selected" : ""}`} ref={this._scrollRef}
style={{
- width: `calc(100% - ${this.sidebarWidthPercent})`,
+ width: this.props.dontSelectOnLoad ? "100%" : `calc(100% - ${this.sidebarWidthPercent})`,
pointerEvents: !active && !SnappingManager.GetIsDragging() ? "none" : undefined,
overflow: this.layoutDoc._singleLine ? "hidden" : undefined,
}}
@@ -1566,8 +1578,8 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp
}}
/>
</div>
- {(this.props.noSidebar || this.Document._noSidebar) || !this.layoutDoc._showSidebar || this.sidebarWidthPercent === "0%" ? (null) : this.sidebarCollection}
- {(this.props.noSidebar || this.Document._noSidebar) || this.Document._singleLine ? (null) : this.sidebarHandle}
+ {(this.props.noSidebar || this.Document._noSidebar) || this.props.dontSelectOnLoad || !this.SidebarShown || this.sidebarWidthPercent === "0%" ? (null) : this.sidebarCollection}
+ {(this.props.noSidebar || this.Document._noSidebar) || this.props.dontSelectOnLoad || this.Document._singleLine ? (null) : this.sidebarHandle}
{!this.layoutDoc._showAudio ? (null) : this.audioHandle}
</div>
</div >
diff --git a/src/client/views/nodes/formattedText/RichTextMenu.scss b/src/client/views/nodes/formattedText/RichTextMenu.scss
index 1d24d6833..c94e93541 100644
--- a/src/client/views/nodes/formattedText/RichTextMenu.scss
+++ b/src/client/views/nodes/formattedText/RichTextMenu.scss
@@ -1,4 +1,4 @@
-@import "../../globalCssVariables";
+@import "../../global/globalCssVariables";
.button-dropdown-wrapper {
position: relative;
@@ -24,7 +24,7 @@
top: 35px;
left: 0;
background-color: #323232;
- color: $light-color-secondary;
+ color: $light-gray;
border: 1px solid #4d4d4d;
border-radius: 0 6px 6px 6px;
box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25);
diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx
index 071491463..82ad2b7db 100644
--- a/src/client/views/nodes/formattedText/RichTextMenu.tsx
+++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx
@@ -352,7 +352,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
function onClick(e: React.PointerEvent) {
e.preventDefault();
e.stopPropagation();
- self.TextView.endUndoTypingBatch();
+ self.TextView?.endUndoTypingBatch();
UndoManager.RunInBatch(() => {
self.view && command && command(self.view.state, self.view.dispatch, self.view);
self.view && onclick && onclick(self.view.state, self.view.dispatch, self.view);
@@ -821,8 +821,8 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
if (link) {
const href = link.attrs.allAnchors.length > 0 ? link.attrs.allAnchors[0].href : undefined;
if (href) {
- if (href.indexOf(Utils.prepend("/doc/")) === 0) {
- const linkclicked = href.replace(Utils.prepend("/doc/"), "").split("?")[0];
+ if (href.indexOf(Doc.localServerPath()) === 0) {
+ const linkclicked = href.replace(Doc.localServerPath(), "").split("?")[0];
if (linkclicked) {
const linkDoc = await DocServer.GetRefField(linkclicked);
if (linkDoc instanceof Doc) {
@@ -852,6 +852,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
@undoBatch
makeLinkToURL = (target: string, lcoation: string) => {
((this.view as any)?.TextView as FormattedTextBox).makeLinkAnchor(undefined, "onRadd:rightight", target, target);
+ console.log((this.view as any)?.TextView);
}
@undoBatch
@@ -863,8 +864,8 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
const allAnchors = linkAnchor.attrs.allAnchors.slice();
this.TextView.RemoveAnchorFromSelection(allAnchors);
// bcz: Argh ... this will remove the link from the document even it's anchored somewhere else in the text which happens if only part of the anchor text was selected.
- allAnchors.filter((aref: any) => aref?.href.indexOf(Utils.prepend("/doc/")) === 0).forEach((aref: any) => {
- const anchorId = aref.href.replace(Utils.prepend("/doc/"), "").split("?")[0];
+ allAnchors.filter((aref: any) => aref?.href.indexOf(Doc.localServerPath()) === 0).forEach((aref: any) => {
+ const anchorId = aref.href.replace(Doc.localServerPath(), "").split("?")[0];
anchorId && DocServer.GetRefField(anchorId).then(linkDoc => LinkManager.Instance.deleteLink(linkDoc as Doc));
});
}
@@ -963,7 +964,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
this.createHighlighterButton(),
this.createLinkButton(),
this.createBrushButton(),
- <div className="richTextMenu-divider" key="divider 2" />,
+ <div className="collectionMenu-divider" key="divider 2" />,
this.createButton("align-left", "Align Left", this.activeAlignment === "left", this.alignLeft),
this.createButton("align-center", "Align Center", this.activeAlignment === "center", this.alignCenter),
this.createButton("align-right", "Align Right", this.activeAlignment === "right", this.alignRight),
@@ -976,7 +977,7 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
const row2 = <div className="antimodeMenu-row row-2" key="row2">
{this.collapsed ? this.getDragger() : (null)}
<div key="row 2" style={{ display: this.collapsed ? "none" : undefined }}>
- <div className="richTextMenu-divider" key="divider 3" />
+ <div className="collectionMenu-divider" key="divider 3" />
{[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size", action((val: string) => {
this.activeFontSize = val;
SelectionManager.Views().map(dv => dv.props.Document._fontSize = val);
@@ -985,12 +986,12 @@ export class RichTextMenu extends AntimodeMenu<AntimodeMenuProps> {
this.activeFontFamily = val;
SelectionManager.Views().map(dv => dv.props.Document._fontFamily = val);
})),
- <div className="richTextMenu-divider" key="divider 4" />,
+ <div className="collectionMenu-divider" key="divider 4" />,
this.createNodesDropdown(this.activeListType, this.listTypeOptions, "list type", () => ({})),
this.createButton("sort-amount-down", "Summarize", undefined, this.insertSummarizer),
this.createButton("quote-left", "Blockquote", undefined, this.insertBlockquote),
- this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule),
- <div className="richTextMenu-divider" key="divider 5" />,]}
+ this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule)
+ ]}
</div>
{/* <div key="collapser">
{<div key="collapser">
diff --git a/src/client/views/nodes/formattedText/TooltipTextMenu.scss b/src/client/views/nodes/formattedText/TooltipTextMenu.scss
index 0e4b752ac..8c4d77da9 100644
--- a/src/client/views/nodes/formattedText/TooltipTextMenu.scss
+++ b/src/client/views/nodes/formattedText/TooltipTextMenu.scss
@@ -1,4 +1,4 @@
-@import "../views/globalCssVariables";
+@import "../views/global/globalCssVariables";
.ProseMirror-menu-dropdown-wrap {
display: inline-block;
position: relative;
@@ -50,7 +50,7 @@
padding: 3px;
&:hover {
- background-color: $light-color-secondary;
+ background-color: $light-gray;
}
}
}
@@ -294,9 +294,9 @@
top: 31px;
background-color: #323232;
border: 1px solid #4d4d4d;
- color: $light-color-secondary;
+ color: $light-gray;
// border: none;
- // border: 1px solid $light-color-secondary;
+ // border: 1px solid $light-gray;
border-radius: 0 6px 6px 6px;
padding: 3px;
box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25);
@@ -323,7 +323,7 @@
}
.separated-button {
- border-top: 1px solid $light-color-secondary;
+ border-top: 1px solid $light-gray;
padding-top: 6px;
}
diff --git a/src/client/views/nodes/PresBox.scss b/src/client/views/nodes/trails/PresBox.scss
index 1ba86232b..06932d145 100644
--- a/src/client/views/nodes/PresBox.scss
+++ b/src/client/views/nodes/trails/PresBox.scss
@@ -1,7 +1,4 @@
-$light-blue: #AEDDF8;
-$dark-blue: #5B9FDD;
-$light-background: #ececec;
-$dark-grey: #656565;
+@import "../../global/globalCssVariables";
.presBox-cont {
cursor: auto;
@@ -10,7 +7,6 @@ $dark-grey: #656565;
pointer-events: inherit;
z-index: 2;
font-family: Roboto;
- box-shadow: #AAAAAA .2vw .2vw .4vw;
width: 100%;
min-width: 20px;
height: 100%;
@@ -47,8 +43,8 @@ $dark-grey: #656565;
align-items: center;
height: 30px;
width: 100%;
- color: white;
- background-color: #323232;
+ color: $white;
+ background-color: $dark-gray;
.toolbar-button {
cursor: pointer;
@@ -110,7 +106,7 @@ $dark-grey: #656565;
}
.toolbar-divider {
- border-left: solid #ffffff70 0.5px;
+ border-left: solid $medium-gray 0.5px;
height: 20px;
}
}
@@ -118,7 +114,7 @@ $dark-grey: #656565;
.dropdown {
font-size: 10;
margin-left: 5px;
- color: darkgrey;
+ color: $medium-gray;
transition: 0.5s ease;
}
@@ -174,7 +170,7 @@ $dark-grey: #656565;
.ribbon-colorBox {
cursor: pointer;
- border: solid 1px black;
+ border: solid 1px $black;
display: flex;
margin-left: 5px;
margin-top: 5px;
@@ -191,9 +187,9 @@ $dark-grey: #656565;
font-size: 11;
font-weight: 200;
height: 20;
- background-color: #ececec;
- color: black;
- border: solid 1px black;
+ background-color: $white;
+ color: $black;
+ border: solid 1px $black;
display: flex;
margin-left: 5px;
margin-top: 5px;
@@ -220,11 +216,11 @@ $dark-grey: #656565;
align-items: center;
height: 100%;
width: 100%;
- background: black;
+ background: $black;
}
.ribbon-propertyUpDownItem:hover {
- background: darkgrey;
+ background: $medium-gray;
transform: scale(1.05);
}
}
@@ -239,7 +235,7 @@ $dark-grey: #656565;
.multiThumb-slider {
display: grid;
- background-color: $light-background;
+ background-color: $white;
height: 10px;
border-radius: 10px;
overflow: hidden;
@@ -257,8 +253,8 @@ $dark-grey: #656565;
-webkit-appearance: none;
height: 10px;
cursor: ew-resize;
- background: $dark-blue;
- box-shadow: -100vw 0 0 100vw $light-background;
+ background: $medium-blue;
+ box-shadow: -100vw 0 0 100vw $white;
}
.toolbar-slider.end::-webkit-slider-thumb {
@@ -267,7 +263,7 @@ $dark-grey: #656565;
-webkit-appearance: none;
height: 10px;
cursor: ew-resize;
- background: $dark-blue;
+ background: $medium-blue;
box-shadow: -100vw 0 0 100vw $light-blue;
}
}
@@ -282,7 +278,7 @@ $dark-grey: #656565;
height: 10px;
border-radius: 10px;
-webkit-appearance: none;
- background-color: $light-background;
+ background-color: $white;
}
.toolbar-slider:focus {
@@ -301,7 +297,7 @@ $dark-grey: #656565;
-webkit-appearance: none;
height: 10px;
cursor: ew-resize;
- background: $dark-blue;
+ background: $medium-blue;
box-shadow: -100vw 0 0 100vw $light-blue;
}
@@ -318,7 +314,7 @@ $dark-grey: #656565;
width: 15px;
min-width: 15px;
cursor: pointer;
- background: $light-background;
+ background: $white;
}
.presBox-checkbox:focus {
@@ -326,7 +322,7 @@ $dark-grey: #656565;
}
.presBox-checkbox:hover {
- background: #c0c0c0;
+ background: $light-gray;
}
.presBox-checkbox:checked {
@@ -381,9 +377,9 @@ $dark-grey: #656565;
text-align: center;
font-size: 16;
width: 90%;
- color: black;
+ color: $black;
transform: translate(5%, 0px);
- border-bottom: solid 2px darkgrey;
+ border-bottom: solid 2px $medium-gray;
}
@@ -396,8 +392,8 @@ $dark-grey: #656565;
justify-self: left;
margin-top: 5px;
padding-left: 10px;
- background-color: $light-background;
- border: solid 1px black;
+ background-color: $white;
+ border: solid 1px $black;
min-width: 80px;
max-width: 200px;
width: 100%;
@@ -416,7 +412,7 @@ $dark-grey: #656565;
}
.ribbon-frameSelector {
- border: black solid 1px;
+ border: $black solid 1px;
width: 60px;
height: 20px;
margin-top: 5px;
@@ -433,12 +429,12 @@ $dark-grey: #656565;
cursor: pointer;
position: relative;
height: 100%;
- background: $light-background;
+ background: $white;
display: flex;
align-items: center;
justify-content: center;
text-align: center;
- color: black;
+ color: $black;
}
.numKeyframe {
@@ -446,7 +442,7 @@ $dark-grey: #656565;
font-size: 10;
font-weight: 600;
position: relative;
- color: black;
+ color: $black;
display: flex;
width: 100%;
height: 100%;
@@ -489,7 +485,7 @@ $dark-grey: #656565;
padding-left: 10;
padding-right: 10;
border-radius: 10px;
- background-color: #979797;
+ background-color: $medium-gray;
}
.ribbon-final-button:hover {
@@ -508,13 +504,13 @@ $dark-grey: #656565;
align-items: center;
margin-bottom: 5px;
height: 25px;
- color: lightgrey;
+ color: $light-gray;
width: 100%;
max-width: 120;
padding-left: 10;
padding-right: 10;
border-radius: 10px;
- background-color: black;
+ background-color: $black;
}
.ribbon-final-button-hidden:hover {
@@ -525,15 +521,15 @@ $dark-grey: #656565;
.ribbon-frameList {
width: calc(100% - 5px);
height: 50px;
- background-color: #ececec;
- border: 1px solid #9f9f9f;
+ background-color: $white;
+ border: 1px solid $medium-gray;
grid-template-rows: max-content;
.frameList-header {
display: grid;
width: 100%;
height: 20px;
- background-color: #9f9f9f;
+ background-color: $medium-gray;
.frameList-headerButtons {
display: flex;
@@ -588,7 +584,7 @@ $dark-grey: #656565;
font-size: 10.5;
font-weight: 300;
height: 20;
- background-color: #979797;
+ background-color: $medium-gray;
color: white;
display: flex;
margin-top: 5px;
@@ -607,8 +603,8 @@ $dark-grey: #656565;
transition: all 0.4s;
font-weight: 400;
opacity: 1;
- color: white;
- background-color: black;
+ color: $white;
+ background-color: $black;
}
.ribbon-toggle {
@@ -616,10 +612,10 @@ $dark-grey: #656565;
font-size: 10.5;
font-weight: 200;
height: 20;
- background-color: $light-background;
+ background-color: $white;
border: solid 1px rgba(0, 0, 0, 0.5);
display: flex;
- color: black;
+ color: $black;
margin-top: 5px;
margin-bottom: 5px;
border-radius: 5px;
@@ -660,13 +656,13 @@ $dark-grey: #656565;
position: relative;
font-size: 13;
padding-bottom: 10px;
- border-bottom: solid 1px $dark-grey;
+ border-bottom: solid 1px $dark-gray;
.presBox-dropdown:hover {
- border: solid 1px $dark-blue;
+ border: solid 1px $medium-blue;
.presBox-dropdownIcon {
- color: $dark-blue;
+ color: $medium-blue;
}
}
@@ -675,12 +671,12 @@ $dark-grey: #656565;
display: grid;
grid-template-columns: auto 20%;
position: relative;
- border: solid 1px black;
- background-color: $light-background;
+ border: solid 1px $black;
+ background-color: $light-gray;
border-radius: 5px;
font-size: 10;
height: 25;
- color: black;
+ color: $black;
padding-left: 5px;
align-items: center;
margin-top: 5px;
@@ -744,7 +740,7 @@ $dark-grey: #656565;
height: 100px;
padding-top: 5px;
padding-bottom: 5px;
- border: solid 1px black;
+ border: solid 1px $black;
// overflow: auto;
::-webkit-scrollbar {
@@ -794,7 +790,7 @@ $dark-grey: #656565;
cursor: pointer;
position: relative;
text-align: center;
- border-left: solid 1px darkgrey;
+ border-left: solid 1px $medium-gray;
width: 20%;
height: 100%;
display: flex;
@@ -825,7 +821,7 @@ $dark-grey: #656565;
box-shadow: 0px 4px 10px rgba(0, 0, 0, 0.8);
z-index: 200;
background-color: white;
- color: black;
+ color: $black;
position: absolute;
overflow: hidden;
}
@@ -841,12 +837,12 @@ $dark-grey: #656565;
align-items: center;
justify-content: center;
transform: translate(0px, -1px);
- background-color: $light-background;
+ background-color: $white;
width: 40px;
height: 15px;
align-self: center;
justify-self: center;
- border: solid 1px black;
+ border: solid 1px $black;
border-top: 0px;
border-bottom-right-radius: 7px;
border-bottom-left-radius: 7px;
@@ -855,15 +851,15 @@ $dark-grey: #656565;
.layout-container {
padding: 5px;
display: grid;
- background-color: $light-background;
+ background-color: $white;
grid-template-columns: repeat(auto-fit, minmax(90px, 100px));
width: 100%;
- border: solid 1px black;
+ border: solid 1px $black;
min-width: 100px;
overflow: hidden;
.layout:hover {
- border: solid 2px #5c9edd;
+ border: solid 2px $medium-blue;
}
.layout {
@@ -878,7 +874,7 @@ $dark-grey: #656565;
width: 90px;
overflow: hidden;
background-color: white;
- border: solid darkgrey 1px;
+ border: solid $medium-gray 1px;
display: grid;
grid-template-rows: auto;
align-items: center;
@@ -893,7 +889,7 @@ $dark-grey: #656565;
height: 13;
font-size: 12;
display: flex;
- background-color: #f1efec;
+ background-color: $white;
}
.subtitle {
@@ -906,7 +902,7 @@ $dark-grey: #656565;
height: 13;
font-size: 9;
display: flex;
- background-color: #f1efec;
+ background-color: $white;
}
.content {
@@ -919,7 +915,7 @@ $dark-grey: #656565;
height: 13;
font-size: 10;
display: flex;
- background-color: #f1efec;
+ background-color: $white;
height: 33;
text-align: left;
font-size: 8px;
@@ -930,7 +926,7 @@ $dark-grey: #656565;
.presBox-buttons {
position: relative;
width: 100%;
- background: gray;
+ background: $medium-gray;
min-height: 35px;
padding-top: 5px;
padding-bottom: 5px;
@@ -960,8 +956,8 @@ $dark-grey: #656565;
select {
- background: #323232;
- color: white;
+ background: $dark-gray;
+ color: $white;
}
.presBox-button {
@@ -975,8 +971,8 @@ $dark-grey: #656565;
text-align: center;
letter-spacing: normal;
width: inherit;
- background: #323232;
- color: white;
+ background: $dark-gray;
+ color: $white;
}
.presBox-button.active {
@@ -984,7 +980,7 @@ $dark-grey: #656565;
}
.presBox-button.active:hover {
- background-color: #233163;
+ background-color: $medium-blue;
}
.presBox-button.edit {
@@ -1053,8 +1049,8 @@ $dark-grey: #656565;
font-size: 100;
display: flex;
align-items: center;
- background: #323232;
- color: white;
+ background: $dark-gray;
+ color: $white;
}
.presBox-viewPicker {
@@ -1086,7 +1082,7 @@ $dark-grey: #656565;
top: 10;
opacity: 0.1;
transition: all 0.4s;
- color: white;
+ color: $white;
}
.miniPres:hover {
@@ -1094,8 +1090,8 @@ $dark-grey: #656565;
}
.presPanelOverlay {
- background-color: #323232;
- color: white;
+ background-color: $dark-gray;
+ color: $white;
border-radius: 5px;
grid-template-rows: 100%;
height: 25;
@@ -1129,7 +1125,7 @@ $dark-grey: #656565;
.presPanel-divider {
width: 0.5px;
height: 80%;
- border-right: solid 1px #5a5a5a;
+ border-right: solid 1px $medium-gray;
}
.presPanel-button-frame {
@@ -1161,12 +1157,12 @@ $dark-grey: #656565;
}
.presPanel-button:hover {
- background-color: #5a5a5a;
+ background-color: $medium-gray;
transform: scale(1.2);
}
.presPanel-button-text:hover {
- background-color: #5a5a5a;
+ background-color: $medium-gray;
}
diff --git a/src/client/views/nodes/PresBox.tsx b/src/client/views/nodes/trails/PresBox.tsx
index f3fb6ff17..5cb9866f8 100644
--- a/src/client/views/nodes/PresBox.tsx
+++ b/src/client/views/nodes/trails/PresBox.tsx
@@ -5,67 +5,33 @@ import { action, computed, IReactionDisposer, observable, ObservableMap, reactio
import { observer } from "mobx-react";
import { ColorState, SketchPicker } from "react-color";
import { Bounce, Fade, Flip, LightSpeed, Roll, Rotate, Zoom } from 'react-reveal';
-import { Doc, DocListCast, DocListCastAsync, FieldResult } from "../../../fields/Doc";
-import { documentSchema } from "../../../fields/documentSchemas";
-import { InkTool } from "../../../fields/InkField";
-import { List } from "../../../fields/List";
-import { PrefetchProxy } from "../../../fields/Proxy";
-import { listSpec, makeInterface } from "../../../fields/Schema";
-import { ScriptField } from "../../../fields/ScriptField";
-import { BoolCast, Cast, NumCast, StrCast } from "../../../fields/Types";
-import { returnFalse, returnOne, returnTrue, emptyFunction } from '../../../Utils';
-import { Docs } from "../../documents/Documents";
-import { DocumentType } from "../../documents/DocumentTypes";
-import { CurrentUserUtils } from "../../util/CurrentUserUtils";
-import { DocumentManager } from "../../util/DocumentManager";
-import { Scripting } from "../../util/Scripting";
-import { SelectionManager } from "../../util/SelectionManager";
-import { undoBatch, UndoManager } from "../../util/UndoManager";
-import { CollectionDockingView } from "../collections/CollectionDockingView";
-import { CollectionView, CollectionViewType } from "../collections/CollectionView";
-import { TabDocView } from "../collections/TabDocView";
-import { ViewBoxBaseComponent } from "../DocComponent";
-import { CollectionFreeFormDocumentView } from "./CollectionFreeFormDocumentView";
-import { FieldView, FieldViewProps } from './FieldView';
+import { Doc, DocListCast, DocListCastAsync, FieldResult } from "../../../../fields/Doc";
+import { documentSchema } from "../../../../fields/documentSchemas";
+import { InkTool } from "../../../../fields/InkField";
+import { List } from "../../../../fields/List";
+import { PrefetchProxy } from "../../../../fields/Proxy";
+import { listSpec, makeInterface } from "../../../../fields/Schema";
+import { ScriptField } from "../../../../fields/ScriptField";
+import { BoolCast, Cast, NumCast, StrCast } from "../../../../fields/Types";
+import { emptyFunction, returnFalse, returnOne, returnTrue } from '../../../../Utils';
+import { Docs } from "../../../documents/Documents";
+import { DocumentType } from "../../../documents/DocumentTypes";
+import { CurrentUserUtils } from "../../../util/CurrentUserUtils";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { Scripting } from "../../../util/Scripting";
+import { SelectionManager } from "../../../util/SelectionManager";
+import { undoBatch, UndoManager } from "../../../util/UndoManager";
+import { CollectionDockingView } from "../../collections/CollectionDockingView";
+import { CollectionView, CollectionViewType } from "../../collections/CollectionView";
+import { TabDocView } from "../../collections/TabDocView";
+import { ViewBoxBaseComponent } from "../../DocComponent";
+import { Colors } from "../../global/globalEnums";
+import { LightboxView } from "../../LightboxView";
+import { CollectionFreeFormDocumentView } from "../CollectionFreeFormDocumentView";
+import { FieldView, FieldViewProps } from '../FieldView';
import "./PresBox.scss";
import Color = require("color");
-import { LightboxView } from "../LightboxView";
-
-export enum PresMovement {
- Zoom = "zoom",
- Pan = "pan",
- Jump = "jump",
- None = "none",
-}
-
-export enum PresEffect {
- Zoom = "Zoom",
- Lightspeed = "Lightspeed",
- Fade = "Fade in",
- Flip = "Flip",
- Rotate = "Rotate",
- Bounce = "Bounce",
- Roll = "Roll",
- None = "None",
- Left = "left",
- Right = "right",
- Center = "center",
- Top = "top",
- Bottom = "bottom"
-}
-
-enum PresStatus {
- Autoplay = "auto",
- Manual = "manual",
- Edit = "edit"
-}
-
-export enum PresColor {
- LightBlue = "#AEDDF8",
- DarkBlue = "#5B9FDD",
- LightBackground = "#ececec",
- SlideBackground = "#d5dce2",
-}
+import { PresEffect, PresStatus, PresMovement } from "./PresEnums";
export class PinProps {
audioRange?: boolean;
@@ -1198,9 +1164,9 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
{this.scrollable ? "Scroll to pinned view" : !isPinWithView ? "No movement" : "Pan & Zoom to pinned view"}
</div>
:
- <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openMovementDropdown = !this.openMovementDropdown; })} style={{ borderBottomLeftRadius: this.openMovementDropdown ? 0 : 5, border: this.openMovementDropdown ? `solid 2px ${PresColor.DarkBlue}` : 'solid 1px black' }}>
+ <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openMovementDropdown = !this.openMovementDropdown; })} style={{ borderBottomLeftRadius: this.openMovementDropdown ? 0 : 5, border: this.openMovementDropdown ? `solid 2px ${Colors.MEDIUM_BLUE}` : 'solid 1px black' }}>
{this.setMovementName(activeItem.presMovement, activeItem)}
- <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openMovementDropdown ? PresColor.DarkBlue : 'black' }} icon={"angle-down"} />
+ <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openMovementDropdown ? Colors.MEDIUM_BLUE : 'black' }} icon={"angle-down"} />
<div className={'presBox-dropdownOptions'} id={'presBoxMovementDropdown'} onPointerDown={e => e.stopPropagation()} style={{ display: this.openMovementDropdown ? "grid" : "none" }}>
<div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.None ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.None)}>None</div>
<div className={`presBox-dropdownOption ${activeItem.presMovement === PresMovement.Zoom ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateMovement(PresMovement.Zoom)}>Pan {"&"} Zoom</div>
@@ -1245,7 +1211,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="ribbon-doubleButton">
{isPresCollection ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Hide before presented"}</div></>}><div className={`ribbon-toggle ${activeItem.presHideBefore ? "active" : ""}`} onClick={() => this.updateHideBefore(activeItem)}>Hide before</div></Tooltip>}
{isPresCollection ? (null) : <Tooltip title={<><div className="dash-tooltip">{"Hide after presented"}</div></>}><div className={`ribbon-toggle ${activeItem.presHideAfter ? "active" : ""}`} onClick={() => this.updateHideAfter(activeItem)}>Hide after</div></Tooltip>}
- <Tooltip title={<><div className="dash-tooltip">{"Open in lightbox view"}</div></>}><div className="ribbon-toggle" style={{ backgroundColor: activeItem.openDocument ? PresColor.LightBlue : "" }} onClick={() => this.updateOpenDoc(activeItem)}>Lightbox</div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Open in lightbox view"}</div></>}><div className="ribbon-toggle" style={{ backgroundColor: activeItem.openDocument ? Colors.LIGHT_BLUE : "" }} onClick={() => this.updateOpenDoc(activeItem)}>Lightbox</div></Tooltip>
</div>
{(type === DocumentType.AUDIO || type === DocumentType.VID) ? (null) : <>
<div className="ribbon-doubleButton" >
@@ -1280,9 +1246,9 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
</div>
{isPresCollection ? (null) : <div className="ribbon-box">
Effects
- <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openEffectDropdown = !this.openEffectDropdown; })} style={{ borderBottomLeftRadius: this.openEffectDropdown ? 0 : 5, border: this.openEffectDropdown ? `solid 2px ${PresColor.DarkBlue}` : 'solid 1px black' }}>
+ <div className="presBox-dropdown" onClick={action(e => { e.stopPropagation(); this.openEffectDropdown = !this.openEffectDropdown; })} style={{ borderBottomLeftRadius: this.openEffectDropdown ? 0 : 5, border: this.openEffectDropdown ? `solid 2px ${Colors.MEDIUM_BLUE}` : 'solid 1px black' }}>
{effect}
- <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openEffectDropdown ? PresColor.DarkBlue : 'black' }} icon={"angle-down"} />
+ <FontAwesomeIcon className='presBox-dropdownIcon' style={{ gridColumn: 2, color: this.openEffectDropdown ? Colors.MEDIUM_BLUE : 'black' }} icon={"angle-down"} />
<div className={'presBox-dropdownOptions'} id={'presBoxMovementDropdown'} style={{ display: this.openEffectDropdown ? "grid" : "none" }} onPointerDown={e => e.stopPropagation()}>
<div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.None || !targetDoc.presEffect ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.None)}>None</div>
<div className={`presBox-dropdownOption ${targetDoc.presEffect === PresEffect.Fade ? "active" : ""}`} onPointerDown={e => e.stopPropagation()} onClick={() => this.updateEffect(PresEffect.Fade)}>Fade In</div>
@@ -1299,11 +1265,11 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
</div>
</div>
<div className="effectDirection" style={{ display: effect === 'None' ? "none" : "grid", width: 40 }}>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from left"}</div></>}><div style={{ gridColumn: 1, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Left ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Left)}><FontAwesomeIcon icon={"angle-right"} /></div></Tooltip>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from right"}</div></>}><div style={{ gridColumn: 3, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Right ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Right)}><FontAwesomeIcon icon={"angle-left"} /></div></Tooltip>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from top"}</div></>}><div style={{ gridColumn: 2, gridRow: 1, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Top ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Top)}><FontAwesomeIcon icon={"angle-down"} /></div></Tooltip>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from bottom"}</div></>}><div style={{ gridColumn: 2, gridRow: 3, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Bottom ? PresColor.LightBlue : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Bottom)}><FontAwesomeIcon icon={"angle-up"} /></div></Tooltip>
- <Tooltip title={<><div className="dash-tooltip">{"Enter from center"}</div></>}><div style={{ gridColumn: 2, gridRow: 2, width: 10, height: 10, alignSelf: 'center', justifySelf: 'center', border: targetDoc.presEffectDirection === PresEffect.Center || !targetDoc.presEffectDirection ? `solid 2px ${PresColor.LightBlue}` : "solid 2px black", borderRadius: "100%", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Center)}></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from left"}</div></>}><div style={{ gridColumn: 1, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Left ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Left)}><FontAwesomeIcon icon={"angle-right"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from right"}</div></>}><div style={{ gridColumn: 3, gridRow: 2, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Right ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Right)}><FontAwesomeIcon icon={"angle-left"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from top"}</div></>}><div style={{ gridColumn: 2, gridRow: 1, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Top ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Top)}><FontAwesomeIcon icon={"angle-down"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from bottom"}</div></>}><div style={{ gridColumn: 2, gridRow: 3, justifySelf: 'center', color: targetDoc.presEffectDirection === PresEffect.Bottom ? Colors.LIGHT_BLUE : "black", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Bottom)}><FontAwesomeIcon icon={"angle-up"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Enter from center"}</div></>}><div style={{ gridColumn: 2, gridRow: 2, width: 10, height: 10, alignSelf: 'center', justifySelf: 'center', border: targetDoc.presEffectDirection === PresEffect.Center || !targetDoc.presEffectDirection ? `solid 2px ${Colors.LIGHT_BLUE}` : "solid 2px black", borderRadius: "100%", cursor: "pointer" }} onClick={() => this.updateEffectDirection(PresEffect.Center)}></div></Tooltip>
</div>
</div>}
<div className="ribbon-final-box">
@@ -1356,7 +1322,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<>
{this.panable || this.scrollable || this.targetDoc.type === DocumentType.COMPARISON ? 'Pinned view' : (null)}
<div className="ribbon-doubleButton">
- <Tooltip title={<><div className="dash-tooltip">{activeItem.presPinView ? "Turn off pin with view" : "Turn on pin with view"}</div></>}><div className="ribbon-toggle" style={{ width: 20, padding: 0, backgroundColor: activeItem.presPinView ? PresColor.LightBlue : "" }}
+ <Tooltip title={<><div className="dash-tooltip">{activeItem.presPinView ? "Turn off pin with view" : "Turn on pin with view"}</div></>}><div className="ribbon-toggle" style={{ width: 20, padding: 0, backgroundColor: activeItem.presPinView ? Colors.LIGHT_BLUE : "" }}
onClick={() => {
activeItem.presPinView = !activeItem.presPinView;
targetDoc.presPinView = activeItem.presPinView;
@@ -1496,7 +1462,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="slider-text" style={{ fontWeight: 500 }}>
Start time (s)
</div>
- <div id={"startTime"} className="slider-number" style={{ backgroundColor: PresColor.LightBackground }}>
+ <div id={"startTime"} className="slider-number" style={{ backgroundColor: Colors.LIGHT_GRAY }}>
<input className="presBox-input"
style={{ textAlign: 'center', width: 30, height: 15, fontSize: 10 }}
type="number" value={NumCast(activeItem.presStartTime)}
@@ -1508,7 +1474,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="slider-text" style={{ fontWeight: 500 }}>
Duration (s)
</div>
- <div className="slider-number" style={{ backgroundColor: PresColor.LightBlue }}>
+ <div className="slider-number" style={{ backgroundColor: Colors.LIGHT_BLUE }}>
{Math.round((NumCast(activeItem.presEndTime) - NumCast(activeItem.presStartTime)) * 10) / 10}
</div>
</div>
@@ -1516,7 +1482,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="slider-text" style={{ fontWeight: 500 }}>
End time (s)
</div>
- <div id={"endTime"} className="slider-number" style={{ backgroundColor: PresColor.LightBackground }}>
+ <div id={"endTime"} className="slider-number" style={{ backgroundColor: Colors.LIGHT_GRAY }}>
<input className="presBox-input"
style={{ textAlign: 'center', width: 30, height: 15, fontSize: 10 }}
type="number" value={NumCast(activeItem.presEndTime)}
@@ -1534,16 +1500,16 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
this._batch = UndoManager.StartBatch("presEndTime");
const endBlock = document.getElementById("endTime");
if (endBlock) {
- endBlock.style.color = PresColor.LightBackground;
- endBlock.style.backgroundColor = PresColor.DarkBlue;
+ endBlock.style.color = Colors.LIGHT_GRAY;
+ endBlock.style.backgroundColor = Colors.MEDIUM_BLUE;
}
}}
onPointerUp={() => {
this._batch?.end();
const endBlock = document.getElementById("endTime");
if (endBlock) {
- endBlock.style.color = "black";
- endBlock.style.backgroundColor = PresColor.LightBackground;
+ endBlock.style.color = Colors.BLACK;
+ endBlock.style.backgroundColor = Colors.LIGHT_GRAY;
}
}}
onChange={(e: React.ChangeEvent<HTMLInputElement>) => {
@@ -1558,16 +1524,16 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
this._batch = UndoManager.StartBatch("presStartTime");
const startBlock = document.getElementById("startTime");
if (startBlock) {
- startBlock.style.color = PresColor.LightBackground;
- startBlock.style.backgroundColor = PresColor.DarkBlue;
+ startBlock.style.color = Colors.LIGHT_GRAY;
+ startBlock.style.backgroundColor = Colors.MEDIUM_BLUE;
}
}}
onPointerUp={() => {
this._batch?.end();
const startBlock = document.getElementById("startTime");
if (startBlock) {
- startBlock.style.color = "black";
- startBlock.style.backgroundColor = PresColor.LightBackground;
+ startBlock.style.color = Colors.BLACK;
+ startBlock.style.backgroundColor = Colors.LIGHT_GRAY;
}
}}
onChange={(e: React.ChangeEvent<HTMLInputElement>) => {
@@ -1651,15 +1617,15 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div>
<div className={'presBox-toolbar-dropdown'} style={{ display: this.newDocumentTools && this.layoutDoc.presStatus === "edit" ? "inline-flex" : "none" }} onClick={e => e.stopPropagation()} onPointerUp={e => e.stopPropagation()} onPointerDown={e => e.stopPropagation()}>
<div className="layout-container" style={{ height: 'max-content' }}>
- <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'blank'; this.createNewSlide(this.layout); })} />
- <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'title'; this.createNewSlide(this.layout); })}>
+ <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'blank'; this.createNewSlide(this.layout); })} />
+ <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'title'; this.createNewSlide(this.layout); })}>
<div className="title">Title</div>
<div className="subtitle">Subtitle</div>
</div>
- <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'header'; this.createNewSlide(this.layout); })}>
+ <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'header'; this.createNewSlide(this.layout); })}>
<div className="title" style={{ alignSelf: 'center', fontSize: 10 }}>Section header</div>
</div>
- <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => { this.layout = 'content'; this.createNewSlide(this.layout); })}>
+ <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => { this.layout = 'content'; this.createNewSlide(this.layout); })}>
<div className="title" style={{ alignSelf: 'center' }}>Title</div>
<div className="content">Text goes here</div>
</div>
@@ -1691,26 +1657,26 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="ribbon-box">
Choose type:
<div className="ribbon-doubleButton">
- <div title="Text" className={'ribbon-toggle'} style={{ background: this.addFreeform ? "" : PresColor.LightBlue }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Text</div>
- <div title="Freeform" className={'ribbon-toggle'} style={{ background: this.addFreeform ? PresColor.LightBlue : "" }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Freeform</div>
+ <div title="Text" className={'ribbon-toggle'} style={{ background: this.addFreeform ? "" : Colors.LIGHT_BLUE }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Text</div>
+ <div title="Freeform" className={'ribbon-toggle'} style={{ background: this.addFreeform ? Colors.LIGHT_BLUE : "" }} onClick={action(() => this.addFreeform = !this.addFreeform)}>Freeform</div>
</div>
</div>
<div className="ribbon-box" style={{ display: this.addFreeform ? "grid" : "none" }}>
Preset layouts:
<div className="layout-container" style={{ height: this.openLayouts ? 'max-content' : '75px' }}>
- <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'blank')} />
- <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'title')}>
+ <div className="layout" style={{ border: this.layout === 'blank' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'blank')} />
+ <div className="layout" style={{ border: this.layout === 'title' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'title')}>
<div className="title">Title</div>
<div className="subtitle">Subtitle</div>
</div>
- <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'header')}>
+ <div className="layout" style={{ border: this.layout === 'header' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'header')}>
<div className="title" style={{ alignSelf: 'center', fontSize: 10 }}>Section header</div>
</div>
- <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'content')}>
+ <div className="layout" style={{ border: this.layout === 'content' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'content')}>
<div className="title" style={{ alignSelf: 'center' }}>Title</div>
<div className="content">Text goes here</div>
</div>
- <div className="layout" style={{ border: this.layout === 'twoColumns' ? `solid 2px ${PresColor.DarkBlue}` : '' }} onClick={action(() => this.layout = 'twoColumns')}>
+ <div className="layout" style={{ border: this.layout === 'twoColumns' ? `solid 2px ${Colors.MEDIUM_BLUE}` : '' }} onClick={action(() => this.layout = 'twoColumns')}>
<div className="title" style={{ alignSelf: 'center', gridColumn: '1/3' }}>Title</div>
<div className="content" style={{ gridColumn: 1, gridRow: 2 }}>Column one text</div>
<div className="content" style={{ gridColumn: 2, gridRow: 2 }}>Column two text</div>
@@ -1869,8 +1835,8 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="ribbon-box">
{this.stringType} selected
<div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: (targetDoc.type === DocumentType.COL && targetDoc._viewType === 'freeform') || targetDoc.type === DocumentType.IMG || targetDoc.type === DocumentType.RTF ? "inline-flex" : "none" }}>
- <div className="ribbon-toggle" style={{ backgroundColor: activeItem.presProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeChild}>Contents</div>
- <div className="ribbon-toggle" style={{ opacity: activeItem.presProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editProgressivize ? PresColor.LightBlue : "" }} onClick={this.editProgressivize}>Edit</div>
+ <div className="ribbon-toggle" style={{ backgroundColor: activeItem.presProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeChild}>Contents</div>
+ <div className="ribbon-toggle" style={{ opacity: activeItem.presProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editProgressivize}>Edit</div>
</div>
<div className="ribbon-doubleButton" style={{ display: activeItem.presProgressivize ? "inline-flex" : "none" }}>
<div className="presBox-subheading">Active text color</div>
@@ -1885,12 +1851,12 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
</div>
{this.viewedColorPicker}
<div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: (targetDoc.type === DocumentType.COL && targetDoc._viewType === 'freeform') || targetDoc.type === DocumentType.IMG ? "inline-flex" : "none" }}>
- <div className="ribbon-toggle" style={{ backgroundColor: activeItem.zoomProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeZoom}>Zoom</div>
- <div className="ribbon-toggle" style={{ opacity: activeItem.zoomProgressivize ? 1 : 0.4, backgroundColor: activeItem.editZoomProgressivize ? PresColor.LightBlue : "" }} onClick={this.editZoomProgressivize}>Edit</div>
+ <div className="ribbon-toggle" style={{ backgroundColor: activeItem.zoomProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeZoom}>Zoom</div>
+ <div className="ribbon-toggle" style={{ opacity: activeItem.zoomProgressivize ? 1 : 0.4, backgroundColor: activeItem.editZoomProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editZoomProgressivize}>Edit</div>
</div>
<div className="ribbon-doubleButton" style={{ borderTop: 'solid 1px darkgrey', display: targetDoc._viewType === "stacking" || targetDoc.type === DocumentType.PDF || targetDoc.type === DocumentType.WEB || targetDoc.type === DocumentType.RTF ? "inline-flex" : "none" }}>
- <div className="ribbon-toggle" style={{ backgroundColor: activeItem.scrollProgressivize ? PresColor.LightBlue : "" }} onClick={this.progressivizeScroll}>Scroll</div>
- <div className="ribbon-toggle" style={{ opacity: activeItem.scrollProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editScrollProgressivize ? PresColor.LightBlue : "" }} onClick={this.editScrollProgressivize}>Edit</div>
+ <div className="ribbon-toggle" style={{ backgroundColor: activeItem.scrollProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.progressivizeScroll}>Scroll</div>
+ <div className="ribbon-toggle" style={{ opacity: activeItem.scrollProgressivize ? 1 : 0.4, backgroundColor: targetDoc.editScrollProgressivize ? Colors.LIGHT_BLUE : "" }} onClick={this.editScrollProgressivize}>Edit</div>
</div>
</div>
<div className="ribbon-final-box">
@@ -1900,7 +1866,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div key="back" title="back frame" className="backKeyframe" onClick={e => { e.stopPropagation(); this.prevKeyframe(targetDoc, activeItem); }}>
<FontAwesomeIcon icon={"caret-left"} size={"lg"} />
</div>
- <div key="num" title="toggle view all" className="numKeyframe" style={{ color: targetDoc.keyFrameEditing ? "white" : "black", backgroundColor: targetDoc.keyFrameEditing ? PresColor.DarkBlue : PresColor.LightBlue }}
+ <div key="num" title="toggle view all" className="numKeyframe" style={{ color: targetDoc.keyFrameEditing ? "white" : "black", backgroundColor: targetDoc.keyFrameEditing ? Colors.MEDIUM_BLUE : Colors.LIGHT_BLUE }}
onClick={action(() => targetDoc.keyFrameEditing = !targetDoc.keyFrameEditing)} >
{NumCast(targetDoc._currentFrame)}
</div>
@@ -1914,7 +1880,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
{this.frameListHeader}
{this.frameList}
</div>
- <div className="ribbon-toggle" style={{ height: 20, backgroundColor: PresColor.LightBlue }} onClick={() => console.log(" TODO: play frames")}>Play</div>
+ <div className="ribbon-toggle" style={{ height: 20, backgroundColor: Colors.LIGHT_BLUE }} onClick={() => console.log(" TODO: play frames")}>Play</div>
</div>
</div>
</div>
@@ -2130,7 +2096,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
tags.push(<div style={{ position: 'absolute', display: doc.displayMovement ? "block" : "none" }}>{this.checkMovementLists(doc, doc["x-indexed"], doc["y-indexed"])}</div>);
}
tags.push(
- <div className="progressivizeButton" key={index} onPointerLeave={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0; }} onPointerOver={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0.5; }} onClick={e => { this.toggleDisplayMovement(doc); e.stopPropagation(); }} style={{ backgroundColor: doc.displayMovement ? PresColor.LightBlue : "#c8c8c8", top: NumCast(doc.y), left: NumCast(doc.x) }}>
+ <div className="progressivizeButton" key={index} onPointerLeave={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0; }} onPointerOver={() => { if (NumCast(targetDoc._currentFrame) < NumCast(doc.appearFrame)) doc.opacity = 0.5; }} onClick={e => { this.toggleDisplayMovement(doc); e.stopPropagation(); }} style={{ backgroundColor: doc.displayMovement ? Colors.LIGHT_BLUE : "#c8c8c8", top: NumCast(doc.y), left: NumCast(doc.x) }}>
<div className="progressivizeButton-prev"><FontAwesomeIcon icon={"caret-left"} size={"lg"} onClick={e => { e.stopPropagation(); this.prevAppearFrame(doc, index); }} /></div>
<div className="progressivizeButton-frame">{doc.appearFrame}</div>
<div className="progressivizeButton-next"><FontAwesomeIcon icon={"caret-right"} size={"lg"} onClick={e => { e.stopPropagation(); this.nextAppearFrame(doc, index); }} /></div>
@@ -2213,6 +2179,8 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
const mode = StrCast(this.rootDoc._viewType) as CollectionViewType;
const isMini: boolean = this.toolbarWidth <= 100;
const presKeyEvents: boolean = (this.isPres && this._presKeyEventsActive && this.rootDoc === Doc.UserDoc().activePresentation);
+ const activeColor = Colors.LIGHT_BLUE;
+ const inactiveColor = Colors.WHITE;
return (mode === CollectionViewType.Carousel3D) ? (null) : (
<div id="toolbarContainer" className={'presBox-toolbar'}>
{/* <Tooltip title={<><div className="dash-tooltip">{"Add new slide"}</div></>}><div className={`toolbar-button ${this.newDocumentTools ? "active" : ""}`} onClick={action(() => this.newDocumentTools = !this.newDocumentTools)}>
@@ -2220,7 +2188,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<FontAwesomeIcon className={`dropdown ${this.newDocumentTools ? "active" : ""}`} icon={"angle-down"} />
</div></Tooltip> */}
<Tooltip title={<><div className="dash-tooltip">{"View paths"}</div></>}>
- <div style={{ opacity: this.childDocs.length > 1 && this.layoutDoc.presCollection ? 1 : 0.3, color: this._pathBoolean ? PresColor.DarkBlue : 'white', width: isMini ? "100%" : undefined }} className={"toolbar-button"} onClick={this.childDocs.length > 1 && this.layoutDoc.presCollection ? this.viewPaths : undefined}>
+ <div style={{ opacity: this.childDocs.length > 1 && this.layoutDoc.presCollection ? 1 : 0.3, color: this._pathBoolean ? Colors.MEDIUM_BLUE : 'white', width: isMini ? "100%" : undefined }} className={"toolbar-button"} onClick={this.childDocs.length > 1 && this.layoutDoc.presCollection ? this.viewPaths : undefined}>
<FontAwesomeIcon icon={"exchange-alt"} />
</div>
</Tooltip>
@@ -2229,7 +2197,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="toolbar-divider" />
{/* <Tooltip title={<><div className="dash-tooltip">{this._expandBoolean ? "Minimize all" : "Expand all"}</div></>}>
<div className={"toolbar-button"}
- style={{ color: this._expandBoolean ? PresColors.DarkBlue : 'white' }}
+ style={{ color: this._expandBoolean ? Colors.MEDIUM_BLUE : 'white' }}
onClick={this.toggleExpandMode}>
<FontAwesomeIcon icon={"eye"} />
</div>
@@ -2237,12 +2205,12 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
<div className="toolbar-divider" /> */}
<Tooltip title={<><div className="dash-tooltip">{presKeyEvents ? "Keys are active" : "Keys are not active - click anywhere on the presentation trail to activate keys"}</div></>}>
<div className="toolbar-button" style={{ cursor: presKeyEvents ? 'default' : 'pointer', position: 'absolute', right: 30, fontSize: 16 }}>
- <FontAwesomeIcon className={"toolbar-thumbtack"} icon={"keyboard"} style={{ color: presKeyEvents ? PresColor.DarkBlue : 'white' }} />
+ <FontAwesomeIcon className={"toolbar-thumbtack"} icon={"keyboard"} style={{ color: presKeyEvents ? activeColor : inactiveColor }} />
</div>
</Tooltip>
<Tooltip title={<><div className="dash-tooltip">{propTitle}</div></>}>
<div className="toolbar-button" style={{ position: 'absolute', right: 4, fontSize: 16 }} onClick={this.toggleProperties}>
- <FontAwesomeIcon className={"toolbar-thumbtack"} icon={propIcon} style={{ color: CurrentUserUtils.propertiesWidth > 0 ? PresColor.DarkBlue : 'white' }} />
+ <FontAwesomeIcon className={"toolbar-thumbtack"} icon={propIcon} style={{ color: CurrentUserUtils.propertiesWidth > 0 ? activeColor : inactiveColor }} />
</div>
</Tooltip>
</>
@@ -2379,7 +2347,7 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
const presStart: boolean = !this.layoutDoc.presLoop && (this.itemIndex === 0);
// Case 1: There are still other frames and should go through all frames before going to next slide
return (<div className="presPanelOverlay" style={{ display: this.layoutDoc.presStatus !== "edit" ? "inline-flex" : "none" }}>
- <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? PresColor.DarkBlue : 'white' }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
+ <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? Colors.MEDIUM_BLUE : 'white' }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
<div className="presPanel-divider"></div>
<div className="presPanel-button" style={{ opacity: presStart ? 0.4 : 1 }} onClick={() => { this.back(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-left"} /></div>
<Tooltip title={<><div className="dash-tooltip">{this.layoutDoc.presStatus === PresStatus.Autoplay ? "Pause" : "Autoplay"}</div></>}><div className="presPanel-button" onClick={this.startOrPause}><FontAwesomeIcon icon={this.layoutDoc.presStatus === PresStatus.Autoplay ? "pause" : "play"} /></div></Tooltip>
@@ -2418,8 +2386,8 @@ export class PresBox extends ViewBoxBaseComponent<FieldViewProps, PresBoxSchema>
const presStart: boolean = !this.layoutDoc.presLoop && (this.itemIndex === 0);
return CurrentUserUtils.OverlayDocs.includes(this.rootDoc) ?
<div className="miniPres">
- <div className="presPanelOverlay" style={{ display: "inline-flex", height: 30, background: '#323232', top: 0, zIndex: 3000000, boxShadow: presKeyEvents ? '0 0 0px 3px ' + PresColor.DarkBlue : undefined }}>
- <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? PresColor.DarkBlue : undefined }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
+ <div className="presPanelOverlay" style={{ display: "inline-flex", height: 30, background: '#323232', top: 0, zIndex: 3000000, boxShadow: presKeyEvents ? '0 0 0px 3px ' + Colors.MEDIUM_BLUE : undefined }}>
+ <Tooltip title={<><div className="dash-tooltip">{"Loop"}</div></>}><div className="presPanel-button" style={{ color: this.layoutDoc.presLoop ? Colors.MEDIUM_BLUE : undefined }} onClick={() => this.layoutDoc.presLoop = !this.layoutDoc.presLoop}><FontAwesomeIcon icon={"redo-alt"} /></div></Tooltip>
<div className="presPanel-divider"></div>
<div className="presPanel-button" style={{ opacity: presStart ? 0.4 : 1 }} onClick={() => { this.back(); if (this._presTimer) { clearTimeout(this._presTimer); this.layoutDoc.presStatus = PresStatus.Manual; } }}><FontAwesomeIcon icon={"arrow-left"} /></div>
<Tooltip title={<><div className="dash-tooltip">{this.layoutDoc.presStatus === PresStatus.Autoplay ? "Pause" : "Autoplay"}</div></>}><div className="presPanel-button" onClick={this.startOrPause}><FontAwesomeIcon icon={this.layoutDoc.presStatus === "auto" ? "pause" : "play"} /></div></Tooltip>
diff --git a/src/client/views/presentationview/PresElementBox.scss b/src/client/views/nodes/trails/PresElementBox.scss
index 1ad4b820e..1ad4b820e 100644
--- a/src/client/views/presentationview/PresElementBox.scss
+++ b/src/client/views/nodes/trails/PresElementBox.scss
diff --git a/src/client/views/presentationview/PresElementBox.tsx b/src/client/views/nodes/trails/PresElementBox.tsx
index f15d51764..5e713c3cf 100644
--- a/src/client/views/presentationview/PresElementBox.tsx
+++ b/src/client/views/nodes/trails/PresElementBox.tsx
@@ -2,27 +2,29 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { Tooltip } from "@material-ui/core";
import { action, computed, IReactionDisposer, observable, reaction } from "mobx";
import { observer } from "mobx-react";
-import { DataSym, Doc, Opt } from "../../../fields/Doc";
-import { documentSchema } from '../../../fields/documentSchemas';
-import { Id } from "../../../fields/FieldSymbols";
-import { createSchema, makeInterface } from '../../../fields/Schema';
-import { Cast, NumCast, StrCast } from "../../../fields/Types";
-import { emptyFunction, returnFalse, returnTrue, setupMoveUpEvents, emptyPath, returnEmptyDoclist } from "../../../Utils";
-import { DocumentType } from "../../documents/DocumentTypes";
-import { CurrentUserUtils } from "../../util/CurrentUserUtils";
-import { DocumentManager } from "../../util/DocumentManager";
-import { DragManager } from "../../util/DragManager";
-import { Transform } from "../../util/Transform";
-import { undoBatch } from "../../util/UndoManager";
-import { ViewBoxBaseComponent } from '../DocComponent';
-import { EditableView } from "../EditableView";
-import { DocumentView, DocumentViewProps } from "../nodes/DocumentView";
-import { FieldView, FieldViewProps } from '../nodes/FieldView';
-import { PresBox, PresColor, PresMovement } from "../nodes/PresBox";
-import { StyleProp } from "../StyleProvider";
+import { DataSym, Doc, Opt } from "../../../../fields/Doc";
+import { documentSchema } from '../../../../fields/documentSchemas';
+import { Id } from "../../../../fields/FieldSymbols";
+import { createSchema, makeInterface } from '../../../../fields/Schema';
+import { Cast, NumCast, StrCast } from "../../../../fields/Types";
+import { emptyFunction, returnFalse, returnTrue, setupMoveUpEvents, emptyPath, returnEmptyDoclist } from "../../../../Utils";
+import { DocumentType } from "../../../documents/DocumentTypes";
+import { CurrentUserUtils } from "../../../util/CurrentUserUtils";
+import { DocumentManager } from "../../../util/DocumentManager";
+import { DragManager } from "../../../util/DragManager";
+import { Transform } from "../../../util/Transform";
+import { undoBatch } from "../../../util/UndoManager";
+import { ViewBoxBaseComponent } from '../../DocComponent';
+import { EditableView } from "../../EditableView";
+import { DocumentView, DocumentViewProps } from "../../nodes/DocumentView";
+import { FieldView, FieldViewProps } from '../../nodes/FieldView';
+import { PresBox } from "./PresBox";
+import { Colors } from "../../global/globalEnums";
+import { StyleProp } from "../../StyleProvider";
import "./PresElementBox.scss";
import React = require("react");
-import { DocUtils } from "../../documents/Documents";
+import { DocUtils } from "../../../documents/Documents";
+import { PresMovement } from "./PresEnums";
export const presSchema = createSchema({
presentationTargetDoc: Doc,
@@ -210,11 +212,11 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc
const height = slide.clientHeight;
const halfLine = height / 2;
if (y <= halfLine) {
- slide.style.borderTop = "solid 2px #5B9FDD";
+ slide.style.borderTop = `solid 2px ${Colors.MEDIUM_BLUE}`;
slide.style.borderBottom = "0px";
} else if (y > halfLine) {
slide.style.borderTop = "0px";
- slide.style.borderBottom = "solid 2px #5B9FDD";
+ slide.style.borderBottom = `solid 2px ${Colors.MEDIUM_BLUE}`;
}
}
document.removeEventListener("pointermove", this.onPointerMove);
@@ -292,7 +294,7 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc
const miniView: boolean = this.toolbarWidth <= 110;
const presBox: Doc = this.presBox; //presBox
const presBoxColor: string = StrCast(presBox._backgroundColor);
- const presColorBool: boolean = presBoxColor ? (presBoxColor !== "white" && presBoxColor !== "transparent") : false;
+ const presColorBool: boolean = presBoxColor ? (presBoxColor !== Colors.WHITE && presBoxColor !== "transparent") : false;
const targetDoc: Doc = this.targetDoc;
const activeItem: Doc = this.rootDoc;
return (
@@ -300,7 +302,7 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc
key={this.props.Document[Id] + this.indexInPres}
ref={this._itemRef}
style={{
- backgroundColor: presColorBool ? isSelected ? "rgba(250,250,250,0.3)" : "transparent" : isSelected ? "#AEDDF8" : "transparent",
+ backgroundColor: presColorBool ? isSelected ? "rgba(250,250,250,0.3)" : "transparent" : isSelected ? Colors.LIGHT_BLUE : "transparent",
opacity: this._dragging ? 0.3 : 1
}}
onClick={e => {
@@ -356,7 +358,7 @@ export class PresElementBox extends ViewBoxBaseComponent<FieldViewProps, PresDoc
style={{
zIndex: 1000 - this.indexInPres,
fontWeight: 700,
- backgroundColor: activeItem.groupWithUp ? presColorBool ? presBoxColor : PresColor.DarkBlue : undefined,
+ backgroundColor: activeItem.groupWithUp ? presColorBool ? presBoxColor : Colors.MEDIUM_BLUE : undefined,
height: activeItem.groupWithUp ? 53 : 18,
transform: activeItem.groupWithUp ? "translate(0, -17px)" : undefined
}}>
diff --git a/src/client/views/nodes/trails/PresEnums.ts b/src/client/views/nodes/trails/PresEnums.ts
new file mode 100644
index 000000000..93ab323fb
--- /dev/null
+++ b/src/client/views/nodes/trails/PresEnums.ts
@@ -0,0 +1,28 @@
+export enum PresMovement {
+ Zoom = "zoom",
+ Pan = "pan",
+ Jump = "jump",
+ None = "none",
+}
+
+export enum PresEffect {
+ Zoom = "Zoom",
+ Lightspeed = "Lightspeed",
+ Fade = "Fade in",
+ Flip = "Flip",
+ Rotate = "Rotate",
+ Bounce = "Bounce",
+ Roll = "Roll",
+ None = "None",
+ Left = "left",
+ Right = "right",
+ Center = "center",
+ Top = "top",
+ Bottom = "bottom"
+}
+
+export enum PresStatus {
+ Autoplay = "auto",
+ Manual = "manual",
+ Edit = "edit"
+} \ No newline at end of file
diff --git a/src/client/views/nodes/trails/index.ts b/src/client/views/nodes/trails/index.ts
new file mode 100644
index 000000000..8f3f7b03a
--- /dev/null
+++ b/src/client/views/nodes/trails/index.ts
@@ -0,0 +1,3 @@
+export * from "./PresBox";
+export * from "./PresElementBox";
+export * from "./PresEnums"; \ No newline at end of file
diff --git a/src/client/views/pdf/AnchorMenu.tsx b/src/client/views/pdf/AnchorMenu.tsx
index 1e2d72254..55816ed52 100644
--- a/src/client/views/pdf/AnchorMenu.tsx
+++ b/src/client/views/pdf/AnchorMenu.tsx
@@ -1,7 +1,7 @@
import React = require("react");
import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
import { Tooltip } from "@material-ui/core";
-import { action, computed, observable, IReactionDisposer, reaction } from "mobx";
+import { action, computed, observable, IReactionDisposer, reaction, ObservableMap } from "mobx";
import { observer } from "mobx-react";
import { ColorState } from "react-color";
import { Doc, Opt } from "../../../fields/Doc";
@@ -10,6 +10,7 @@ import { AntimodeMenu, AntimodeMenuProps } from "../AntimodeMenu";
import { ButtonDropdown } from "../nodes/formattedText/RichTextMenu";
import "./AnchorMenu.scss";
import { SelectionManager } from "../../util/SelectionManager";
+import { LinkPopup } from "../linking/LinkPopup";
@observer
export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
@@ -38,6 +39,7 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
@observable private _valueValue: string = "";
@observable private _added: boolean = false;
@observable private highlightColor: string = "rgba(245, 230, 95, 0.616)";
+ @observable private _showLinkPopup: boolean = false;
@observable public _colorBtn = false;
@observable public Highlighting: boolean = false;
@@ -46,6 +48,7 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
public OnClick: (e: PointerEvent) => void = unimplementedFunction;
public StartDrag: (e: PointerEvent, ele: HTMLElement) => void = unimplementedFunction;
public Highlight: (color: string, isPushpin: boolean) => Opt<Doc> = (color: string, isPushpin: boolean) => undefined;
+ public GetAnchor: (savedAnnotations?: ObservableMap<number, HTMLDivElement[]>) => Opt<Doc> = () => undefined;
public Delete: () => void = unimplementedFunction;
public AddTag: (key: string, value: string) => boolean = returnFalse;
public PinToPres: () => void = unimplementedFunction;
@@ -79,6 +82,13 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
}
}
+ @action
+ toggleLinkPopup = (e: React.MouseEvent) => {
+ //ignore the potential null type error because this method cannot be called unless the user selects text and clicks the link button
+ //change popup visibility field to visible
+ this._showLinkPopup = !this._showLinkPopup;
+ }
+
@computed get highlighter() {
const button =
<button className="antimodeMenu-button color-preview-button" title="" key="highlighter-button" onClick={this.highlightClicked}>
@@ -135,6 +145,14 @@ export class AnchorMenu extends AntimodeMenu<AntimodeMenuProps> {
<FontAwesomeIcon icon="comment-alt" size="lg" />
</button>
</Tooltip>,
+
+ //NOTE: link popup is currently incomplete
+ // <Tooltip key="link" title={<div className="dash-tooltip">{"Link selected text to document or URL"}</div>}>
+ // <button className="antimodeMenu-button link" onPointerDown={this.toggleLinkPopup} style={{}}>
+ // <FontAwesomeIcon icon="link" size="lg" />
+ // </button>
+ // </Tooltip>,
+ // <LinkPopup showPopup={this._showLinkPopup} />
] : [
<Tooltip key="trash" title={<div className="dash-tooltip">{"Remove Link Anchor"}</div>}>
<button className="antimodeMenu-button" onPointerDown={this.Delete}>
diff --git a/src/client/views/pdf/PDFViewer.tsx b/src/client/views/pdf/PDFViewer.tsx
index 85cf5abd7..e8c7a4ab0 100644
--- a/src/client/views/pdf/PDFViewer.tsx
+++ b/src/client/views/pdf/PDFViewer.tsx
@@ -133,10 +133,10 @@ export class PDFViewer extends React.Component<IViewerProps> {
this._disposers.selected = reaction(() => this.props.isSelected(),
selected => {
- if (!selected) {
- Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
- Array.from(this._savedAnnotations.keys()).forEach(k => this._savedAnnotations.set(k, []));
- }
+ // if (!selected) {
+ // Array.from(this._savedAnnotations.values()).forEach(v => v.forEach(a => a.remove()));
+ // Array.from(this._savedAnnotations.keys()).forEach(k => this._savedAnnotations.set(k, []));
+ // }
(SelectionManager.Views().length === 1) && this.setupPdfJsViewer();
},
{ fireImmediately: true });
@@ -184,7 +184,8 @@ export class PDFViewer extends React.Component<IViewerProps> {
const mainCont = this._mainCont.current;
let focusSpeed: Opt<number>;
if (doc !== this.props.rootDoc && mainCont && this._pdfViewer) {
- const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.props.layoutDoc._scrollTop), this.props.PanelHeight() / (this.props.scaling?.() || 1));
+ const windowHeight = this.props.PanelHeight() / (this.props.scaling?.() || 1);
+ const scrollTo = Utils.scrollIntoView(NumCast(doc.y), doc[HeightSym](), NumCast(this.props.layoutDoc._scrollTop), windowHeight, .1 * windowHeight);
if (scrollTo !== undefined) {
focusSpeed = 500;
@@ -372,7 +373,7 @@ export class PDFViewer extends React.Component<IViewerProps> {
if ((e.button !== 0 || e.altKey) && this.props.isContentActive(true)) {
this._setPreviewCursor?.(e.clientX, e.clientY, true);
}
- if (!e.altKey && e.button === 0 && this.props.isContentActive(true)) {
+ if (!e.altKey && e.button === 0 && this.props.isContentActive(true) && ![InkTool.Highlighter, InkTool.Pen].includes(CurrentUserUtils.SelectedTool)) {
this.props.select(false);
this._marqueeing = [e.clientX, e.clientY];
if (e.target && ((e.target as any).className.includes("endOfContent") || ((e.target as any).parentElement.className !== "textLayer"))) {
diff --git a/src/client/views/search/CheckBox.scss b/src/client/views/search/CheckBox.scss
index cc858bec6..2a0085ade 100644
--- a/src/client/views/search/CheckBox.scss
+++ b/src/client/views/search/CheckBox.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.checkboxfilter {
display: flex;
@@ -13,7 +13,7 @@
margin-top: 0px;
.check-container:hover~.check-box {
- background-color: $darker-alt-accent;
+ background-color: $medium-blue;
}
.check-container {
@@ -40,7 +40,7 @@
overflow: visible;
background-color: transparent;
border-style: solid;
- border-color: $alt-accent;
+ border-color: $medium-gray;
border-width: 2px;
-webkit-transition: all 0.2s ease-in-out;
-moz-transition: all 0.2s ease-in-out;
diff --git a/src/client/views/search/CollectionFilters.scss b/src/client/views/search/CollectionFilters.scss
index b54cdcbd1..845b16f67 100644
--- a/src/client/views/search/CollectionFilters.scss
+++ b/src/client/views/search/CollectionFilters.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.collection-filters {
display: flex;
diff --git a/src/client/views/search/IconBar.scss b/src/client/views/search/IconBar.scss
index 013dcd57e..6aaf7918d 100644
--- a/src/client/views/search/IconBar.scss
+++ b/src/client/views/search/IconBar.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.icon-bar {
display: flex;
diff --git a/src/client/views/search/IconButton.scss b/src/client/views/search/IconButton.scss
index 4ec03c7c9..3cb08d756 100644
--- a/src/client/views/search/IconButton.scss
+++ b/src/client/views/search/IconButton.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.type-outer {
display: flex;
@@ -9,7 +9,7 @@
.type-icon {
height: 30px;
width: 30px;
- color: $light-color;
+ color: $white;
// background-color: rgb(194, 194, 197);
background-color: gray;
border-radius: 50%;
@@ -43,7 +43,7 @@
.type-icon:hover {
transform: scale(1.1);
- background-color: $darker-alt-accent;
+ background-color: $medium-blue;
opacity: 1;
+.filter-description {
diff --git a/src/client/views/search/IconButton.tsx b/src/client/views/search/IconButton.tsx
index 349690b20..2dd6b1b79 100644
--- a/src/client/views/search/IconButton.tsx
+++ b/src/client/views/search/IconButton.tsx
@@ -4,7 +4,7 @@ import { action, IReactionDisposer, observable, reaction, runInAction } from 'mo
import { observer } from 'mobx-react';
import * as React from 'react';
import { DocumentType } from "../../documents/DocumentTypes";
-import '../globalCssVariables.scss';
+import '../global/globalCssVariables.scss';
import { IconBar } from './IconBar';
import "./IconButton.scss";
import "./SearchBox.scss";
@@ -104,7 +104,7 @@ export class IconButton extends React.Component<IconButtonProps>{
hoverStyle = {
opacity: 1,
backgroundColor: "rgb(128, 128, 128)"
- //backgroundColor: "rgb(178, 206, 248)" //$darker-alt-accent
+ //backgroundColor: "rgb(178, 206, 248)" //$medium-blue
};
render() {
diff --git a/src/client/views/search/NaviconButton.scss b/src/client/views/search/NaviconButton.scss
index c23bab461..8a70b29de 100644
--- a/src/client/views/search/NaviconButton.scss
+++ b/src/client/views/search/NaviconButton.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
$height-icon: 15px;
$width-line: 30px;
@@ -20,7 +20,7 @@ $translateX: 0;
.line {
display: block;
- background: $alt-accent;
+ background: $medium-gray;
width: $width-line;
height: $height-line;
position: absolute;
diff --git a/src/client/views/search/SearchBox.scss b/src/client/views/search/SearchBox.scss
index e7526dac8..2586ef2ee 100644
--- a/src/client/views/search/SearchBox.scss
+++ b/src/client/views/search/SearchBox.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
@import "./NaviconButton.scss";
.searchBox-container {
diff --git a/src/client/views/search/SelectorContextMenu.scss b/src/client/views/search/SelectorContextMenu.scss
index 48cacc608..a114f679c 100644
--- a/src/client/views/search/SelectorContextMenu.scss
+++ b/src/client/views/search/SelectorContextMenu.scss
@@ -1,7 +1,7 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.parents {
- background: $lighter-alt-accent;
+ background: $light-blue;
padding: 10px;
// width: 300px;
@@ -10,7 +10,7 @@
}
.collection {
- border-color: $darker-alt-accent;
+ border-color: $medium-blue;
border-bottom-style: solid;
}
} \ No newline at end of file
diff --git a/src/client/views/search/ToggleBar.scss b/src/client/views/search/ToggleBar.scss
index 79f866acb..3a164f133 100644
--- a/src/client/views/search/ToggleBar.scss
+++ b/src/client/views/search/ToggleBar.scss
@@ -1,9 +1,9 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.toggle-title {
display: flex;
align-items: center;
- color: $light-color;
+ color: $white;
text-transform: uppercase;
flex-direction: row;
justify-content: space-around;
@@ -25,7 +25,7 @@
// height: 50px;
height: 30px;
width: 100px;
- background-color: $alt-accent;
+ background-color: $medium-gray;
border-radius: 10px;
padding: 5px;
display: flex;
@@ -36,6 +36,6 @@
width: 40px;
height: 100%;
border-radius: 10px;
- background-color: $light-color;
+ background-color: $white;
}
} \ No newline at end of file
diff --git a/src/client/views/topbar/TopBar.scss b/src/client/views/topbar/TopBar.scss
new file mode 100644
index 000000000..164cc29cd
--- /dev/null
+++ b/src/client/views/topbar/TopBar.scss
@@ -0,0 +1,217 @@
+@import "../global/globalCssVariables";
+
+.topbar-container {
+ display: flex;
+ flex-direction: column;
+ width: 100%;
+ position: relative;
+ font-size: 10px;
+ line-height: 1;
+ overflow-y: auto;
+ overflow-x: visible;
+ background: $dark-gray;
+ overflow: visible;
+ z-index: 1000;
+
+ .topbar-bar {
+ height: $topbar-height;
+ display: grid;
+ grid-auto-columns: 33.3% 33.3% 33.3%;
+ align-items: center;
+ background-color: $dark-gray;
+
+ .topBar-icon {
+ cursor: pointer;
+ font-size: 12px;
+ font-family: 'Roboto';
+ width: fit-content;
+ display: flex;
+ justify-content: center;
+ gap: 4px;
+ align-items: center;
+ justify-self: center;
+ align-self: center;
+ border-radius: 5px;
+ padding: 5px;
+ transition: linear 0.1s;
+ color: $black;
+ background-color: $light-gray;
+ }
+
+ .topBar-icon:hover {
+ background-color: $light-blue;
+ }
+
+
+ .topbar-center {
+ grid-column: 2;
+ display: inline-flex;
+ justify-content: center;
+ align-items: center;
+ gap: 5px;
+
+ .topbar-dashboards {
+ display: flex;
+ flex-direction: row;
+ }
+
+ .topbar-lozenge-dashboard {
+ display: flex;
+
+
+
+ .topbar-dashSelect {
+ border: none;
+ background-color: $dark-gray;
+ color: $white;
+ font-family: 'Roboto';
+ font-size: 17;
+ font-weight: 500;
+
+ &:hover {
+ cursor: pointer;
+ }
+ }
+ }
+ }
+
+
+ .topbar-right {
+ grid-column: 3;
+ position: relative;
+ display: flex;
+ justify-content: flex-end;
+ gap: 5px;
+ margin-right: 5px;
+ }
+
+ .topbar-left {
+ grid-column: 1;
+ color: black;
+ font-family: 'Roboto';
+ position: relative;
+ display: flex;
+ width: 450;
+ gap: 5px;
+
+ .topBar-icon:hover {
+ background-color: $close-red;
+ }
+
+ .topbar-lozenge-user,
+ .topbar-lozenge {
+ height: 23;
+ font-size: 12;
+ color: white;
+ font-family: 'Roboto';
+ font-weight: 400;
+ padding: 4px;
+ align-self: center;
+ margin-left: 7px;
+ display: flex;
+ align-items: center;
+
+ .topbar-dashSelect {
+ border: none;
+ background-color: transparent;
+ color: black;
+ font-family: 'Roboto';
+ font-size: 17;
+ font-weight: 500;
+
+ &:hover {
+ cursor: pointer;
+ }
+ }
+ }
+
+ .topbar-logoff {
+ border-radius: 3px;
+ background: olivedrab;
+ color: white;
+ display: none;
+ margin-left: 5px;
+ padding: 1px 2px 1px 2px;
+ cursor: pointer;
+ }
+
+ .topbar-logoff {
+ background: red;
+ }
+
+ .topbar-lozenge-user:hover {
+ .topbar-logoff {
+ display: inline-block;
+ }
+ }
+ }
+
+ .topbar-barChild {
+
+ &.topbar-collection {
+ flex: 0 1 auto;
+ margin-left: 2px;
+ margin-right: 2px
+ }
+
+ &.topbar-input {
+ margin:5px;
+ border-radius:20px;
+ border:$dark-gray;
+ display: block;
+ width: 130px;
+ -webkit-transition: width 0.4s;
+ transition: width 0.4s;
+ /* align-self: stretch; */
+ outline: none;
+
+ &:focus {
+ width: 500px;
+ outline: none;
+ }
+ }
+
+ &.topbar-filter {
+ align-self: stretch;
+
+ button {
+ transform: none;
+
+ &:hover {
+ transform: none;
+ }
+ }
+ }
+
+ &.topbar-submit {
+ margin-left: 2px;
+ margin-right: 2px
+ }
+
+ &.topbar-close {
+ color: $white;
+ max-height: $topbar-height;
+ }
+ }
+ }
+}
+
+.topbar-results {
+ display: flex;
+ flex-direction: column;
+ top: 300px;
+ display: flex;
+ flex-direction: column;
+ height: 100%;
+ overflow: visible;
+
+ .no-result {
+ width: 500px;
+ background: $light-gray;
+ padding: 10px;
+ height: 50px;
+ text-transform: uppercase;
+ text-align: left;
+ font-weight: bold;
+ }
+} \ No newline at end of file
diff --git a/src/client/views/topbar/TopBar.tsx b/src/client/views/topbar/TopBar.tsx
new file mode 100644
index 000000000..05edb975c
--- /dev/null
+++ b/src/client/views/topbar/TopBar.tsx
@@ -0,0 +1,66 @@
+import { FontAwesomeIcon } from "@fortawesome/react-fontawesome";
+import { observer } from "mobx-react";
+import * as React from 'react';
+import { Doc, DocListCast } from '../../../fields/Doc';
+import { Id } from '../../../fields/FieldSymbols';
+import { StrCast } from '../../../fields/Types';
+import { Utils } from '../../../Utils';
+import { CurrentUserUtils } from "../../util/CurrentUserUtils";
+import { SettingsManager } from "../../util/SettingsManager";
+import { undoBatch } from "../../util/UndoManager";
+import { Borders, Colors } from "../global/globalEnums";
+import "./TopBar.scss";
+
+/**
+ * ABOUT: This is the topbar in Dash, which included the current Dashboard as well as access to information on the user
+ * and settings and help buttons. Future scope for this bar is to include the collaborators that are on the same Dashboard.
+ */
+@observer
+export class TopBar extends React.Component {
+ render() {
+ const myDashboards = DocListCast(CurrentUserUtils.MyDashboards.data);
+ return (
+ //TODO:glr Add support for light / dark mode
+ <div style={{ pointerEvents: "all" }} className="topbar-container">
+ <div className="topbar-bar" style={{ background: Colors.DARK_GRAY, borderBottom: Borders.STANDARD }}>
+ <div className="topbar-left">
+ <div className="topbar-lozenge-user">
+ {`${Doc.CurrentUserEmail}`}
+ </div>
+ <div className="topbar-icon" onClick={() => window.location.assign(Utils.prepend("/logout"))}>
+ {"Sign out"}
+ </div>
+ </div>
+ <div className="topbar-center" >
+ <div className="topbar-lozenge-dashboard">
+ <select className="topbar-dashSelect" onChange={e => CurrentUserUtils.openDashboard(Doc.UserDoc(), myDashboards[Number(e.target.value)])}
+ value={myDashboards.indexOf(CurrentUserUtils.ActiveDashboard)}
+ style={{ color: Colors.WHITE }}>
+ {myDashboards.map((dash, i) => <option key={dash[Id]} value={i}> {StrCast(dash.title)} </option>)}
+ </select>
+ </div>
+ <div className="topbar-dashboards">
+ <div className="topbar-icon" onClick={undoBatch(() => CurrentUserUtils.createNewDashboard(Doc.UserDoc()))}
+ >
+ {"New"}<FontAwesomeIcon icon="plus"></FontAwesomeIcon>
+ </div>
+ {Doc.UserDoc().noviceMode ? (null) : <div className="topbar-icon" onClick={undoBatch(() => CurrentUserUtils.snapshotDashboard(Doc.UserDoc()))}
+ >
+ {"Snapshot"}<FontAwesomeIcon icon="camera"></FontAwesomeIcon>
+ </div>}
+ </div>
+ </div>
+ <div className="topbar-right" >
+ <div className="topbar-icon">
+ {"Help"}<FontAwesomeIcon icon="question-circle"></FontAwesomeIcon>
+ </div>
+ <div className="topbar-icon" onClick={() => SettingsManager.Instance.open()}>
+ {"Settings"}<FontAwesomeIcon icon="cog"></FontAwesomeIcon>
+ </div>
+
+ </div>
+ </div>
+ </div >
+ );
+ }
+} \ No newline at end of file
diff --git a/src/client/views/webcam/DashWebRTCVideo.scss b/src/client/views/webcam/DashWebRTCVideo.scss
index 41307a808..249aee9d6 100644
--- a/src/client/views/webcam/DashWebRTCVideo.scss
+++ b/src/client/views/webcam/DashWebRTCVideo.scss
@@ -1,4 +1,4 @@
-@import "../globalCssVariables";
+@import "../global/globalCssVariables";
.webcam-cont {
background: whitesmoke;