From 1cf3f477c3066a59158b6a26b5e3be2148e92574 Mon Sep 17 00:00:00 2001 From: 0x85FB9C51 <77808164+0x85FB9C51@users.noreply.github.com> Date: Mon, 21 Jun 2021 16:40:04 -0400 Subject: half-functional ability to add strings without putting quotes around them --- .../views/collections/CollectionSchemaCells.tsx | 32 ++++++++++++++++++++-- 1 file changed, 29 insertions(+), 3 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/views/collections/CollectionSchemaCells.tsx b/src/client/views/collections/CollectionSchemaCells.tsx index 2e6186680..b1dc82ce2 100644 --- a/src/client/views/collections/CollectionSchemaCells.tsx +++ b/src/client/views/collections/CollectionSchemaCells.tsx @@ -236,14 +236,40 @@ export class CollectionSchemaCell extends React.Component { Field.IsField(cfield) ? Field.toScriptString(cfield) : ""; }} SetValue={action((value: string) => { + // sets what is displayed after the user makes an input let retVal = false; if (value.startsWith(":=") || value.startsWith("=:=")) { + // decides how to compute a value when given either of the above strings const script = value.substring(value.startsWith("=:=") ? 3 : 2); retVal = this.props.setComputed(script, value.startsWith(":=") ? this._rowDataDoc : this._rowDoc, this.renderFieldKey, this.props.row, this.props.col); } else { - const inputscript = value.substring(value.startsWith("=") ? 1 : 0); - const script = CompileScript(inputscript, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - script.compiled && (retVal = this.applyToDoc(inputscript.length !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + const inputAsNum: number = parseInt(value); + // check if the input is a number + if (isNaN(inputAsNum)) { + // if it's not a number, it's a string, and should be processed as such + //TODO: maake the input not "thing" when it is being edited + const inputscript = value.substring(value.startsWith("=") ? 1 : 0); + let inputAsString = '"'; + // escape any quotes in the string + //TODO: remove this note to self: when the type is number, it behaves liek I want any to behave + for (const i of inputscript) { + if (i == '"') { + inputAsString += '\\"'; + } else { + inputAsString += i; + } + } + inputAsString += '"'; + //two options here: we can strip off outer quotes or we can figure out what's going on with the script + const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); + script.compiled && (retVal = this.applyToDoc(inputscript.length !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + } else { + //TODO: make accept numbers + const inputscript = value.substring(value.startsWith("=") ? 1 : 0); + const inputAsString = '"' + inputscript + '"'; + const script = CompileScript(inputscript, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); + script.compiled && (retVal = this.applyToDoc(inputscript.length !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + } } if (retVal) { this._isEditing = false; // need to set this here. otherwise, the assignment of the field will invalidate & cause render() to be called with the wrong value for 'editing' -- cgit v1.2.3-70-g09d2 From 8937d756513cd918371664aad25a8a9fa41878d1 Mon Sep 17 00:00:00 2001 From: 0x85FB9C51 <77808164+0x85FB9C51@users.noreply.github.com> Date: Mon, 21 Jun 2021 16:40:25 -0400 Subject: fixed bug pertaining to quotes --- src/client/views/collections/CollectionSchemaCells.tsx | 8 +++++++- 1 file changed, 7 insertions(+), 1 deletion(-) (limited to 'src/client/views/collections') diff --git a/src/client/views/collections/CollectionSchemaCells.tsx b/src/client/views/collections/CollectionSchemaCells.tsx index b1dc82ce2..045995faa 100644 --- a/src/client/views/collections/CollectionSchemaCells.tsx +++ b/src/client/views/collections/CollectionSchemaCells.tsx @@ -248,7 +248,13 @@ export class CollectionSchemaCell extends React.Component { if (isNaN(inputAsNum)) { // if it's not a number, it's a string, and should be processed as such //TODO: maake the input not "thing" when it is being edited - const inputscript = value.substring(value.startsWith("=") ? 1 : 0); + // strips the string of quotes when it is edited to prevent quotes form being added to the text automatically + // after each edit + let valueSansQuotes = value; + if (this._isEditing) { + valueSansQuotes = valueSansQuotes.substring(1, valueSansQuotes.length - 1); + } + const inputscript = valueSansQuotes.substring(value.startsWith("=") ? 1 : 0); let inputAsString = '"'; // escape any quotes in the string //TODO: remove this note to self: when the type is number, it behaves liek I want any to behave -- cgit v1.2.3-70-g09d2 From 40f52d119be06b60515e5058607633409f847e4f Mon Sep 17 00:00:00 2001 From: 0x85FB9C51 <77808164+0x85FB9C51@users.noreply.github.com> Date: Sat, 26 Jun 2021 17:15:59 -0400 Subject: numbers now recognized as numbers, other misc. bugfixes, some bugs remaining --- src/client/util/Scripting.ts | 1 + .../views/collections/CollectionSchemaCells.tsx | 39 ++++++++++++++++------ 2 files changed, 30 insertions(+), 10 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/util/Scripting.ts b/src/client/util/Scripting.ts index c3c3083be..3fe14a2a4 100644 --- a/src/client/util/Scripting.ts +++ b/src/client/util/Scripting.ts @@ -268,6 +268,7 @@ function forEachNode(node: ts.Node, onEnter: Traverser, onExit?: Traverser, inde export function CompileScript(script: string, options: ScriptOptions = {}): CompileResult { const { requiredType = "", addReturn = false, params = {}, capturedVariables = {}, typecheck = true } = options; + console.log("options: " + options.requiredType, options.addReturn, options.params); if (options.params && !options.params.this) options.params.this = Doc.name; if (options.params && !options.params.self) options.params.self = Doc.name; if (options.globals) { diff --git a/src/client/views/collections/CollectionSchemaCells.tsx b/src/client/views/collections/CollectionSchemaCells.tsx index 045995faa..38b3b1628 100644 --- a/src/client/views/collections/CollectionSchemaCells.tsx +++ b/src/client/views/collections/CollectionSchemaCells.tsx @@ -243,37 +243,56 @@ export class CollectionSchemaCell extends React.Component { const script = value.substring(value.startsWith("=:=") ? 3 : 2); retVal = this.props.setComputed(script, value.startsWith(":=") ? this._rowDataDoc : this._rowDoc, this.renderFieldKey, this.props.row, this.props.col); } else { - const inputAsNum: number = parseInt(value); // check if the input is a number - if (isNaN(inputAsNum)) { + let inputIsNum = true; + for (let s of value) { + if (isNaN(parseInt(s))) { + inputIsNum = false; + } + console.log(inputIsNum); + } + console.log("value: " + value); + if (!inputIsNum && !value.startsWith("=")) { + console.log("I don't beep because I'm not a computer."); // if it's not a number, it's a string, and should be processed as such - //TODO: maake the input not "thing" when it is being edited // strips the string of quotes when it is edited to prevent quotes form being added to the text automatically // after each edit let valueSansQuotes = value; if (this._isEditing) { - valueSansQuotes = valueSansQuotes.substring(1, valueSansQuotes.length - 1); + const vsqLength = valueSansQuotes.length; + // get rid of outer quotes + valueSansQuotes = valueSansQuotes.substring(value.startsWith("\"") ? 1 : 0, + valueSansQuotes.charAt(vsqLength - 1) == "\"" ? vsqLength - 1 : vsqLength); } - const inputscript = valueSansQuotes.substring(value.startsWith("=") ? 1 : 0); let inputAsString = '"'; // escape any quotes in the string - //TODO: remove this note to self: when the type is number, it behaves liek I want any to behave - for (const i of inputscript) { + //TODO: remove this note to self: when the type is number, it behaves like I want any to behave + //TODO: fix type laziness + for (const i of valueSansQuotes) { if (i == '"') { inputAsString += '\\"'; } else { inputAsString += i; } } + // add a closing quote inputAsString += '"'; + console.log(inputAsString); //two options here: we can strip off outer quotes or we can figure out what's going on with the script const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - script.compiled && (retVal = this.applyToDoc(inputscript.length !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + script.compiled && (retVal = this.applyToDoc(valueSansQuotes.length !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); } else { //TODO: make accept numbers + console.log("I beep because I'm a computer"); const inputscript = value.substring(value.startsWith("=") ? 1 : 0); - const inputAsString = '"' + inputscript + '"'; - const script = CompileScript(inputscript, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); + // if commas are not stripped, the parser only considers the numbers after the last comma + let inputSansCommas = ""; + for (let s of inputscript) { + if (!(s == ",")) { + inputSansCommas += s; + } + } + const script = CompileScript(inputSansCommas, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); script.compiled && (retVal = this.applyToDoc(inputscript.length !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); } } -- cgit v1.2.3-70-g09d2 From 501bf6a5d6c81ea1e58509e51ab8c252eaf178ca Mon Sep 17 00:00:00 2001 From: 0x85FB9C51 <77808164+0x85FB9C51@users.noreply.github.com> Date: Mon, 28 Jun 2021 16:57:56 -0400 Subject: resolved bugs and removes console.log --- src/client/util/Scripting.ts | 1 - .../views/collections/CollectionSchemaCells.tsx | 22 +++--- .../CollectionSchemaMovableTableHOC.tsx | 92 +++++++++++----------- 3 files changed, 60 insertions(+), 55 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/util/Scripting.ts b/src/client/util/Scripting.ts index 3fe14a2a4..c3c3083be 100644 --- a/src/client/util/Scripting.ts +++ b/src/client/util/Scripting.ts @@ -268,7 +268,6 @@ function forEachNode(node: ts.Node, onEnter: Traverser, onExit?: Traverser, inde export function CompileScript(script: string, options: ScriptOptions = {}): CompileResult { const { requiredType = "", addReturn = false, params = {}, capturedVariables = {}, typecheck = true } = options; - console.log("options: " + options.requiredType, options.addReturn, options.params); if (options.params && !options.params.this) options.params.this = Doc.name; if (options.params && !options.params.self) options.params.self = Doc.name; if (options.globals) { diff --git a/src/client/views/collections/CollectionSchemaCells.tsx b/src/client/views/collections/CollectionSchemaCells.tsx index 38b3b1628..42c5375ce 100644 --- a/src/client/views/collections/CollectionSchemaCells.tsx +++ b/src/client/views/collections/CollectionSchemaCells.tsx @@ -251,9 +251,10 @@ export class CollectionSchemaCell extends React.Component { } console.log(inputIsNum); } - console.log("value: " + value); - if (!inputIsNum && !value.startsWith("=")) { - console.log("I don't beep because I'm not a computer."); + // check if the input is a boolean + let inputIsBool: boolean = value == "false" || value == "true"; + + if (!inputIsNum && !inputIsBool && !value.startsWith("=")) { // if it's not a number, it's a string, and should be processed as such // strips the string of quotes when it is edited to prevent quotes form being added to the text automatically // after each edit @@ -266,8 +267,6 @@ export class CollectionSchemaCell extends React.Component { } let inputAsString = '"'; // escape any quotes in the string - //TODO: remove this note to self: when the type is number, it behaves like I want any to behave - //TODO: fix type laziness for (const i of valueSansQuotes) { if (i == '"') { inputAsString += '\\"'; @@ -277,13 +276,12 @@ export class CollectionSchemaCell extends React.Component { } // add a closing quote inputAsString += '"'; - console.log(inputAsString); //two options here: we can strip off outer quotes or we can figure out what's going on with the script const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - script.compiled && (retVal = this.applyToDoc(valueSansQuotes.length !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); - } else { + script.compiled && (retVal = this.applyToDoc(inputAsString.length !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + // handle numbers and expressions + } else if (inputIsNum || value.startsWith("=")) { //TODO: make accept numbers - console.log("I beep because I'm a computer"); const inputscript = value.substring(value.startsWith("=") ? 1 : 0); // if commas are not stripped, the parser only considers the numbers after the last comma let inputSansCommas = ""; @@ -293,7 +291,11 @@ export class CollectionSchemaCell extends React.Component { } } const script = CompileScript(inputSansCommas, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - script.compiled && (retVal = this.applyToDoc(inputscript.length !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + script.compiled && (retVal = this.applyToDoc(inputSansCommas.length + 2 !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + // handle booleans + } else if (inputIsBool) { + const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); + script.compiled && (retVal = this.applyToDoc(value.length + 2 !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); } } if (retVal) { diff --git a/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx b/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx index 881246bd4..a842d629e 100644 --- a/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx +++ b/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx @@ -143,16 +143,20 @@ export class MovableRow extends React.Component { private _header?: React.RefObject = React.createRef(); private _rowDropDisposer?: DragManager.DragDropDisposer; + // Event listeners are only necessary when the user is hovering over the table + // Create one when the mouse starts hovering... onPointerEnter = (e: React.PointerEvent): void => { if (e.buttons === 1 && SnappingManager.GetIsDragging()) { this._header!.current!.className = "collectionSchema-row-wrapper"; document.addEventListener("pointermove", this.onDragMove, true); } } + // ... and delete it when the mouse leaves onPointerLeave = (e: React.PointerEvent): void => { this._header!.current!.className = "collectionSchema-row-wrapper"; document.removeEventListener("pointermove", this.onDragMove, true); } + // The method for the event listener, reorders columns when dragged to their new locations. onDragMove = (e: PointerEvent): void => { const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); const rect = this._header!.current!.getBoundingClientRect(); @@ -167,14 +171,14 @@ export class MovableRow extends React.Component { this._rowDropDisposer?.(); } - + // createRowDropTarget = (ele: HTMLDivElement) => { this._rowDropDisposer?.(); if (ele) { this._rowDropDisposer = DragManager.MakeDropTarget(ele, this.rowDrop.bind(this)); } } - + // Controls what hppens when a row is dragged and dropped rowDrop = (e: Event, de: DragManager.DropEvent) => { this.onPointerLeave(e as any); const rowDoc = FieldValue(Cast(this.props.rowInfo.original, Doc)); @@ -200,59 +204,59 @@ export class MovableRow extends React.Component { return false; } - onRowContextMenu = (e: React.MouseEvent): void => { + onRowContextMenu = (e: React.MouseEvent): void => e.preventDefault(); - const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row"; - ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" }); + const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row"; + ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" }); } - @undoBatch - @action - move: DragManager.MoveFunction = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc) => { - const targetView = targetCollection && DocumentManager.Instance.getDocumentView(targetCollection); - return doc !== targetCollection && doc !== targetView?.props.ContainingCollectionDoc && this.props.removeDoc(doc) && addDoc(doc); - } +@undoBatch +@action +move: DragManager.MoveFunction = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc) => { + const targetView = targetCollection && DocumentManager.Instance.getDocumentView(targetCollection); + return doc !== targetCollection && doc !== targetView?.props.ContainingCollectionDoc && this.props.removeDoc(doc) && addDoc(doc); +} - @action - onKeyDown = (e: React.KeyboardEvent) => { - console.log("yes"); - if (e.key === "Backspace" || e.key === "Delete") { - undoBatch(() => this.props.removeDoc(this.props.rowInfo.original)); - } +@action +onKeyDown = (e: React.KeyboardEvent) => { + console.log("yes"); + if (e.key === "Backspace" || e.key === "Delete") { + undoBatch(() => this.props.removeDoc(this.props.rowInfo.original)); } +} - render() { - const { children = null, rowInfo } = this.props; +render() { + const { children = null, rowInfo } = this.props; - if (!rowInfo) { - return {children}; - } + if (!rowInfo) { + return {children}; + } - const { original } = rowInfo; - const doc = FieldValue(Cast(original, Doc)); + const { original } = rowInfo; + const doc = FieldValue(Cast(original, Doc)); - if (!doc) return (null); + if (!doc) return (null); - const reference = React.createRef(); - const onItemDown = SetupDrag(reference, () => doc, this.move, StrCast(this.props.dropAction) as dropActionType); + const reference = React.createRef(); + const onItemDown = SetupDrag(reference, () => doc, this.move, StrCast(this.props.dropAction) as dropActionType); - let className = "collectionSchema-row"; - if (this.props.rowFocused) className += " row-focused"; - if (this.props.rowWrapped) className += " row-wrapped"; + let className = "collectionSchema-row"; + if (this.props.rowFocused) className += " row-focused"; + if (this.props.rowWrapped) className += " row-wrapped"; - return ( -
-
- -
-
this.props.removeDoc(this.props.rowInfo.original))}>
-
-
this.props.addDocTab(this.props.rowInfo.original, "add:right")}>
-
- {children} -
-
+ return ( +
+
+ +
+
this.props.removeDoc(this.props.rowInfo.original))}>
+
+
this.props.addDocTab(this.props.rowInfo.original, "add:right")}>
+
+ {children} +
- ); - } +
+ ); +} } \ No newline at end of file -- cgit v1.2.3-70-g09d2 From 48640698459e073118a8a36d5428639c88cb6864 Mon Sep 17 00:00:00 2001 From: 0x85FB9C51 <77808164+0x85FB9C51@users.noreply.github.com> Date: Thu, 1 Jul 2021 16:55:16 -0400 Subject: fixed bizarre bug --- .../CollectionSchemaMovableTableHOC.tsx | 85 +++++++++++----------- 1 file changed, 42 insertions(+), 43 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx b/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx index a842d629e..149677976 100644 --- a/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx +++ b/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx @@ -204,59 +204,58 @@ export class MovableRow extends React.Component { return false; } - onRowContextMenu = (e: React.MouseEvent): void => - e.preventDefault(); - const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row"; - ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" }); + onRowContextMenu = (e: React.MouseEvent): void => { + const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row"; + ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" }); } -@undoBatch -@action -move: DragManager.MoveFunction = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc) => { - const targetView = targetCollection && DocumentManager.Instance.getDocumentView(targetCollection); - return doc !== targetCollection && doc !== targetView?.props.ContainingCollectionDoc && this.props.removeDoc(doc) && addDoc(doc); -} + @undoBatch + @action + move: DragManager.MoveFunction = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc) => { + const targetView = targetCollection && DocumentManager.Instance.getDocumentView(targetCollection); + return doc !== targetCollection && doc !== targetView?.props.ContainingCollectionDoc && this.props.removeDoc(doc) && addDoc(doc); + } -@action -onKeyDown = (e: React.KeyboardEvent) => { - console.log("yes"); - if (e.key === "Backspace" || e.key === "Delete") { - undoBatch(() => this.props.removeDoc(this.props.rowInfo.original)); + @action + onKeyDown = (e: React.KeyboardEvent) => { + console.log("yes"); + if (e.key === "Backspace" || e.key === "Delete") { + undoBatch(() => this.props.removeDoc(this.props.rowInfo.original)); + } } -} -render() { - const { children = null, rowInfo } = this.props; + render() { + const { children = null, rowInfo } = this.props; - if (!rowInfo) { - return {children}; - } + if (!rowInfo) { + return {children}; + } - const { original } = rowInfo; - const doc = FieldValue(Cast(original, Doc)); + const { original } = rowInfo; + const doc = FieldValue(Cast(original, Doc)); - if (!doc) return (null); + if (!doc) return (null); - const reference = React.createRef(); - const onItemDown = SetupDrag(reference, () => doc, this.move, StrCast(this.props.dropAction) as dropActionType); + const reference = React.createRef(); + const onItemDown = SetupDrag(reference, () => doc, this.move, StrCast(this.props.dropAction) as dropActionType); - let className = "collectionSchema-row"; - if (this.props.rowFocused) className += " row-focused"; - if (this.props.rowWrapped) className += " row-wrapped"; + let className = "collectionSchema-row"; + if (this.props.rowFocused) className += " row-focused"; + if (this.props.rowWrapped) className += " row-wrapped"; - return ( -
-
- -
-
this.props.removeDoc(this.props.rowInfo.original))}>
-
-
this.props.addDocTab(this.props.rowInfo.original, "add:right")}>
-
- {children} -
+ return ( +
+
+ +
+
this.props.removeDoc(this.props.rowInfo.original))}>
+
+
this.props.addDocTab(this.props.rowInfo.original, "add:right")}>
+
+ {children} +
+
-
- ); -} + ); + } } \ No newline at end of file -- cgit v1.2.3-70-g09d2 From be53a5a9122d0a6caa27810e34544578abb4c573 Mon Sep 17 00:00:00 2001 From: 0x85FB9C51 <77808164+0x85FB9C51@users.noreply.github.com> Date: Thu, 1 Jul 2021 17:08:57 -0400 Subject: fixed minor bug that prevented strings in quotes from being saved --- src/client/views/collections/CollectionSchemaCells.tsx | 5 ++--- 1 file changed, 2 insertions(+), 3 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/views/collections/CollectionSchemaCells.tsx b/src/client/views/collections/CollectionSchemaCells.tsx index 42c5375ce..e9c5c009f 100644 --- a/src/client/views/collections/CollectionSchemaCells.tsx +++ b/src/client/views/collections/CollectionSchemaCells.tsx @@ -249,11 +249,10 @@ export class CollectionSchemaCell extends React.Component { if (isNaN(parseInt(s))) { inputIsNum = false; } - console.log(inputIsNum); } // check if the input is a boolean let inputIsBool: boolean = value == "false" || value == "true"; - + // what to do in the case if (!inputIsNum && !inputIsBool && !value.startsWith("=")) { // if it's not a number, it's a string, and should be processed as such // strips the string of quotes when it is edited to prevent quotes form being added to the text automatically @@ -278,7 +277,7 @@ export class CollectionSchemaCell extends React.Component { inputAsString += '"'; //two options here: we can strip off outer quotes or we can figure out what's going on with the script const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - script.compiled && (retVal = this.applyToDoc(inputAsString.length !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + script.compiled && (retVal = this.applyToDoc((inputAsString.length !== value.length || inputAsString.length - 2 !== value.length) ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); // handle numbers and expressions } else if (inputIsNum || value.startsWith("=")) { //TODO: make accept numbers -- cgit v1.2.3-70-g09d2 From 2ddb05c1cfbd146c4bd0888c3502c7ad3ab5f961 Mon Sep 17 00:00:00 2001 From: 0x85FB9C51 <77808164+0x85FB9C51@users.noreply.github.com> Date: Thu, 1 Jul 2021 17:17:41 -0400 Subject: added bugfixes to other branches of the if-else --- src/client/views/collections/CollectionSchemaCells.tsx | 9 ++++++--- 1 file changed, 6 insertions(+), 3 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/views/collections/CollectionSchemaCells.tsx b/src/client/views/collections/CollectionSchemaCells.tsx index e9c5c009f..3fb9910b5 100644 --- a/src/client/views/collections/CollectionSchemaCells.tsx +++ b/src/client/views/collections/CollectionSchemaCells.tsx @@ -277,7 +277,8 @@ export class CollectionSchemaCell extends React.Component { inputAsString += '"'; //two options here: we can strip off outer quotes or we can figure out what's going on with the script const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - script.compiled && (retVal = this.applyToDoc((inputAsString.length !== value.length || inputAsString.length - 2 !== value.length) ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + const changeMade = inputAsString.length !== value.length || inputAsString.length - 2 !== value.length + script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); // handle numbers and expressions } else if (inputIsNum || value.startsWith("=")) { //TODO: make accept numbers @@ -290,11 +291,13 @@ export class CollectionSchemaCell extends React.Component { } } const script = CompileScript(inputSansCommas, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - script.compiled && (retVal = this.applyToDoc(inputSansCommas.length + 2 !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + const changeMade = value.length !== value.length || value.length - 2 !== value.length + script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); // handle booleans } else if (inputIsBool) { const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - script.compiled && (retVal = this.applyToDoc(value.length + 2 !== value.length ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + const changeMade = value.length !== value.length || value.length - 2 !== value.length + script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); } } if (retVal) { -- cgit v1.2.3-70-g09d2 From 7f42c98318899a51cb64080fc4f4e315e43bb150 Mon Sep 17 00:00:00 2001 From: 0x85FB9C51 <77808164+0x85FB9C51@users.noreply.github.com> Date: Tue, 6 Jul 2021 23:47:38 -0400 Subject: reoganization of schema view files, partial --- .idea/.gitignore | 3 + .idea/Dash-Web.iml | 9 + .idea/modules.xml | 8 + .idea/vcs.xml | 6 + .../views/collections/CollectionSchemaCells.tsx | 584 ------------------- .../views/collections/CollectionSchemaHeaders.tsx | 518 ----------------- .../CollectionSchemaMovableTableHOC.tsx | 261 --------- .../views/collections/CollectionSchemaView.scss | 641 --------------------- .../views/collections/CollectionSchemaView.tsx | 575 ------------------ src/client/views/collections/SchemaTable.tsx | 599 ------------------- .../schemaView/CollectionSchemaCells.tsx | 584 +++++++++++++++++++ .../schemaView/CollectionSchemaHeaders.tsx | 518 +++++++++++++++++ .../schemaView/CollectionSchemaMovableTableHOC.tsx | 261 +++++++++ .../schemaView/CollectionSchemaView.scss | 552 ++++++++++++++++++ .../schemaView/CollectionSchemaView.tsx | 575 ++++++++++++++++++ .../views/collections/schemaView/SchemaTable.tsx | 599 +++++++++++++++++++ src/client/views/nodes/DocumentContentsView.tsx | 2 +- 17 files changed, 3116 insertions(+), 3179 deletions(-) create mode 100644 .idea/.gitignore create mode 100644 .idea/Dash-Web.iml create mode 100644 .idea/modules.xml create mode 100644 .idea/vcs.xml delete mode 100644 src/client/views/collections/CollectionSchemaCells.tsx delete mode 100644 src/client/views/collections/CollectionSchemaHeaders.tsx delete mode 100644 src/client/views/collections/CollectionSchemaMovableTableHOC.tsx delete mode 100644 src/client/views/collections/CollectionSchemaView.scss delete mode 100644 src/client/views/collections/CollectionSchemaView.tsx delete mode 100644 src/client/views/collections/SchemaTable.tsx create mode 100644 src/client/views/collections/schemaView/CollectionSchemaCells.tsx create mode 100644 src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx create mode 100644 src/client/views/collections/schemaView/CollectionSchemaMovableTableHOC.tsx create mode 100644 src/client/views/collections/schemaView/CollectionSchemaView.scss create mode 100644 src/client/views/collections/schemaView/CollectionSchemaView.tsx create mode 100644 src/client/views/collections/schemaView/SchemaTable.tsx (limited to 'src/client/views/collections') diff --git a/.idea/.gitignore b/.idea/.gitignore new file mode 100644 index 000000000..26d33521a --- /dev/null +++ b/.idea/.gitignore @@ -0,0 +1,3 @@ +# Default ignored files +/shelf/ +/workspace.xml diff --git a/.idea/Dash-Web.iml b/.idea/Dash-Web.iml new file mode 100644 index 000000000..d6ebd4805 --- /dev/null +++ b/.idea/Dash-Web.iml @@ -0,0 +1,9 @@ + + + + + + + + + \ No newline at end of file diff --git a/.idea/modules.xml b/.idea/modules.xml new file mode 100644 index 000000000..35c51c015 --- /dev/null +++ b/.idea/modules.xml @@ -0,0 +1,8 @@ + + + + + + + + \ No newline at end of file diff --git a/.idea/vcs.xml b/.idea/vcs.xml new file mode 100644 index 000000000..35eb1ddfb --- /dev/null +++ b/.idea/vcs.xml @@ -0,0 +1,6 @@ + + + + + + \ No newline at end of file diff --git a/src/client/views/collections/CollectionSchemaCells.tsx b/src/client/views/collections/CollectionSchemaCells.tsx deleted file mode 100644 index 3fb9910b5..000000000 --- a/src/client/views/collections/CollectionSchemaCells.tsx +++ /dev/null @@ -1,584 +0,0 @@ -import React = require("react"); -import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { action, computed, observable } from "mobx"; -import { observer } from "mobx-react"; -import DatePicker from "react-datepicker"; -import "react-datepicker/dist/react-datepicker.css"; -import { CellInfo } from "react-table"; -import "react-table/react-table.css"; -import { DateField } from "../../../fields/DateField"; -import { Doc, DocListCast, Field, Opt } from "../../../fields/Doc"; -import { Id } from "../../../fields/FieldSymbols"; -import { List } from "../../../fields/List"; -import { SchemaHeaderField } from "../../../fields/SchemaHeaderField"; -import { ComputedField } from "../../../fields/ScriptField"; -import { BoolCast, Cast, DateCast, FieldValue, NumCast, StrCast } from "../../../fields/Types"; -import { ImageField } from "../../../fields/URLField"; -import { Utils, emptyFunction } from "../../../Utils"; -import { Docs } from "../../documents/Documents"; -import { DocumentType } from "../../documents/DocumentTypes"; -import { DocumentManager } from "../../util/DocumentManager"; -import { DragManager } from "../../util/DragManager"; -import { KeyCodes } from "../../util/KeyCodes"; -import { CompileScript } from "../../util/Scripting"; -import { SearchUtil } from "../../util/SearchUtil"; -import { SnappingManager } from "../../util/SnappingManager"; -import { undoBatch } from "../../util/UndoManager"; -import '../DocumentDecorations.scss'; -import { EditableView } from "../EditableView"; -import { MAX_ROW_HEIGHT } from '../globalCssVariables.scss'; -import { DocumentIconContainer } from "../nodes/DocumentIcon"; -import { OverlayView } from "../OverlayView"; -import "./CollectionSchemaView.scss"; -import { CollectionView } from "./CollectionView"; -const path = require('path'); - -export interface CellProps { - row: number; - col: number; - rowProps: CellInfo; - CollectionView: Opt; - ContainingCollection: Opt; - Document: Doc; - fieldKey: string; - renderDepth: number; - addDocTab: (document: Doc, where: string) => boolean; - pinToPres: (document: Doc) => void; - moveDocument?: (document: Doc | Doc[], targetCollection: Doc | undefined, - addDocument: (document: Doc | Doc[]) => boolean) => boolean; - isFocused: boolean; - changeFocusedCellByIndex: (row: number, col: number) => void; - setIsEditing: (isEditing: boolean) => void; - isEditable: boolean; - setPreviewDoc: (doc: Doc) => void; - setComputed: (script: string, doc: Doc, field: string, row: number, col: number) => boolean; - getField: (row: number, col?: number) => void; - showDoc: (doc: Doc | undefined, dataDoc?: any, screenX?: number, screenY?: number) => void; -} - -@observer -export class CollectionSchemaCell extends React.Component { - public static resolvedFieldKey(column: string, rowDoc: Doc) { - const fieldKey = column; - if (fieldKey.startsWith("*")) { - const rootKey = fieldKey.substring(1); - const allKeys = [...Array.from(Object.keys(rowDoc)), ...Array.from(Object.keys(Doc.GetProto(rowDoc)))]; - const matchedKeys = allKeys.filter(key => key.includes(rootKey)); - if (matchedKeys.length) return matchedKeys[0]; - } - return fieldKey; - } - @observable protected _isEditing: boolean = false; - protected _focusRef = React.createRef(); - protected _rowDoc = this.props.rowProps.original; - protected _rowDataDoc = Doc.GetProto(this.props.rowProps.original); - protected _dropDisposer?: DragManager.DragDropDisposer; - @observable contents: string = ""; - - componentDidMount() { document.addEventListener("keydown", this.onKeyDown); } - componentWillUnmount() { document.removeEventListener("keydown", this.onKeyDown); } - - @action - onKeyDown = (e: KeyboardEvent): void => { - if (this.props.isFocused && this.props.isEditable && e.keyCode === KeyCodes.ENTER) { - document.removeEventListener("keydown", this.onKeyDown); - this._isEditing = true; - this.props.setIsEditing(true); - } - } - - @action - isEditingCallback = (isEditing: boolean): void => { - document.removeEventListener("keydown", this.onKeyDown); - isEditing && document.addEventListener("keydown", this.onKeyDown); - this._isEditing = isEditing; - this.props.setIsEditing(isEditing); - this.props.changeFocusedCellByIndex(this.props.row, this.props.col); - } - - @action - onPointerDown = async (e: React.PointerEvent): Promise => { - this.onItemDown(e); - this.props.changeFocusedCellByIndex(this.props.row, this.props.col); - this.props.setPreviewDoc(this.props.rowProps.original); - - let url: string; - if (url = StrCast(this.props.rowProps.row.href)) { - try { - new URL(url); - const temp = window.open(url)!; - temp.blur(); - window.focus(); - } catch { } - } - - const doc = Cast(this._rowDoc[this.renderFieldKey], Doc, null); - doc && this.props.setPreviewDoc(doc); - } - - @undoBatch - applyToDoc = (doc: Doc, row: number, col: number, run: (args?: { [name: string]: any }) => any) => { - const res = run({ this: doc, $r: row, $c: col, $: (r: number = 0, c: number = 0) => this.props.getField(r + row, c + col) }); - if (!res.success) return false; - doc[this.renderFieldKey] = res.result; - return true; - } - - private drop = (e: Event, de: DragManager.DropEvent) => { - if (de.complete.docDragData) { - if (de.complete.docDragData.draggedDocuments.length === 1) { - this._rowDataDoc[this.renderFieldKey] = de.complete.docDragData.draggedDocuments[0]; - } - else { - const coll = Docs.Create.SchemaDocument([new SchemaHeaderField("title", "#f1efeb")], de.complete.docDragData.draggedDocuments, {}); - this._rowDataDoc[this.renderFieldKey] = coll; - } - e.stopPropagation(); - } - } - - protected dropRef = (ele: HTMLElement | null) => { - this._dropDisposer?.(); - ele && (this._dropDisposer = DragManager.MakeDropTarget(ele, this.drop.bind(this))); - } - - returnHighlights(contents: string, positions?: number[]) { - if (positions) { - const results = []; - StrCast(this.props.Document._searchString); - const length = StrCast(this.props.Document._searchString).length; - const color = contents ? "black" : "grey"; - - results.push({contents?.slice(0, positions[0])}); - positions.forEach((num, cur) => { - results.push({contents?.slice(num, num + length)}); - let end = 0; - cur === positions.length - 1 ? end = contents.length : end = positions[cur + 1]; - results.push({contents?.slice(num + length, end)}); - } - ); - return results; - } - return {contents ? contents?.valueOf() : "undefined"}; - } - - @computed get renderFieldKey() { return CollectionSchemaCell.resolvedFieldKey(this.props.rowProps.column.id!, this.props.rowProps.original); } - onItemDown = async (e: React.PointerEvent) => { - if (this.props.Document._searchDoc) { - const aliasdoc = await SearchUtil.GetAliasesOfDocument(this._rowDataDoc); - const targetContext = aliasdoc.length <= 0 ? undefined : Cast(aliasdoc[0].context, Doc, null); - DocumentManager.Instance.jumpToDocument(this._rowDoc, false, emptyFunction, targetContext, - undefined, undefined, undefined, () => this.props.setPreviewDoc(this._rowDoc)); - } - } - renderCellWithType(type: string | undefined) { - const dragRef: React.RefObject = React.createRef(); - - const fieldKey = this.renderFieldKey; - const field = this._rowDoc[fieldKey]; - - const onPointerEnter = (e: React.PointerEvent): void => { - if (e.buttons === 1 && SnappingManager.GetIsDragging() && (type === "document" || type === undefined)) { - dragRef.current!.className = "collectionSchemaView-cellContainer doc-drag-over"; - } - }; - const onPointerLeave = (e: React.PointerEvent): void => { - dragRef.current!.className = "collectionSchemaView-cellContainer"; - }; - - let contents = Field.toString(field as Field); - contents = contents === "" ? "--" : contents; - - let className = "collectionSchemaView-cellWrapper"; - if (this._isEditing) className += " editing"; - if (this.props.isFocused && this.props.isEditable) className += " focused"; - if (this.props.isFocused && !this.props.isEditable) className += " inactive"; - - const positions = []; - if (StrCast(this.props.Document._searchString).toLowerCase() !== "") { - let term = (field instanceof Promise) ? "...promise pending..." : contents.toLowerCase(); - const search = StrCast(this.props.Document._searchString).toLowerCase(); - let start = term.indexOf(search); - let tally = 0; - if (start !== -1) { - positions.push(start); - } - while (start < contents?.length && start !== -1) { - term = term.slice(start + search.length + 1); - tally += start + search.length + 1; - start = term.indexOf(search); - positions.push(tally + start); - } - if (positions.length > 1) { - positions.pop(); - } - } - const placeholder = type === "number" ? "0" : contents === "" ? "--" : "undefined"; - return ( -
this._isEditing = true)} onPointerEnter={onPointerEnter} onPointerLeave={onPointerLeave}> -
-
- {!this.props.Document._searchDoc ? - { - const cfield = ComputedField.WithoutComputed(() => FieldValue(field)); - const cscript = cfield instanceof ComputedField ? cfield.script.originalScript : undefined; - const cfinalScript = cscript?.split("return")[cscript.split("return").length - 1]; - return cscript ? (cfinalScript?.endsWith(";") ? `:=${cfinalScript?.substring(0, cfinalScript.length - 2)}` : cfinalScript) : - Field.IsField(cfield) ? Field.toScriptString(cfield) : ""; - }} - SetValue={action((value: string) => { - // sets what is displayed after the user makes an input - let retVal = false; - if (value.startsWith(":=") || value.startsWith("=:=")) { - // decides how to compute a value when given either of the above strings - const script = value.substring(value.startsWith("=:=") ? 3 : 2); - retVal = this.props.setComputed(script, value.startsWith(":=") ? this._rowDataDoc : this._rowDoc, this.renderFieldKey, this.props.row, this.props.col); - } else { - // check if the input is a number - let inputIsNum = true; - for (let s of value) { - if (isNaN(parseInt(s))) { - inputIsNum = false; - } - } - // check if the input is a boolean - let inputIsBool: boolean = value == "false" || value == "true"; - // what to do in the case - if (!inputIsNum && !inputIsBool && !value.startsWith("=")) { - // if it's not a number, it's a string, and should be processed as such - // strips the string of quotes when it is edited to prevent quotes form being added to the text automatically - // after each edit - let valueSansQuotes = value; - if (this._isEditing) { - const vsqLength = valueSansQuotes.length; - // get rid of outer quotes - valueSansQuotes = valueSansQuotes.substring(value.startsWith("\"") ? 1 : 0, - valueSansQuotes.charAt(vsqLength - 1) == "\"" ? vsqLength - 1 : vsqLength); - } - let inputAsString = '"'; - // escape any quotes in the string - for (const i of valueSansQuotes) { - if (i == '"') { - inputAsString += '\\"'; - } else { - inputAsString += i; - } - } - // add a closing quote - inputAsString += '"'; - //two options here: we can strip off outer quotes or we can figure out what's going on with the script - const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - const changeMade = inputAsString.length !== value.length || inputAsString.length - 2 !== value.length - script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); - // handle numbers and expressions - } else if (inputIsNum || value.startsWith("=")) { - //TODO: make accept numbers - const inputscript = value.substring(value.startsWith("=") ? 1 : 0); - // if commas are not stripped, the parser only considers the numbers after the last comma - let inputSansCommas = ""; - for (let s of inputscript) { - if (!(s == ",")) { - inputSansCommas += s; - } - } - const script = CompileScript(inputSansCommas, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - const changeMade = value.length !== value.length || value.length - 2 !== value.length - script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); - // handle booleans - } else if (inputIsBool) { - const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - const changeMade = value.length !== value.length || value.length - 2 !== value.length - script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); - } - } - if (retVal) { - this._isEditing = false; // need to set this here. otherwise, the assignment of the field will invalidate & cause render() to be called with the wrong value for 'editing' - this.props.setIsEditing(false); - } - return retVal; - })} - OnFillDown={async (value: string) => { - const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - script.compiled && DocListCast(this.props.Document[this.props.fieldKey]). - forEach((doc, i) => value.startsWith(":=") ? - this.props.setComputed(value.substring(2), Doc.GetProto(doc), this.renderFieldKey, i, this.props.col) : - this.applyToDoc(Doc.GetProto(doc), i, this.props.col, script.run)); - }} - /> - : - this.returnHighlights(contents, positions) - } -
-
-
- ); - } - - render() { return this.renderCellWithType(undefined); } -} - -@observer -export class CollectionSchemaNumberCell extends CollectionSchemaCell { render() { return this.renderCellWithType("number"); } } - -@observer -export class CollectionSchemaBooleanCell extends CollectionSchemaCell { render() { return this.renderCellWithType("boolean"); } } - -@observer -export class CollectionSchemaStringCell extends CollectionSchemaCell { render() { return this.renderCellWithType("string"); } } - -@observer -export class CollectionSchemaDateCell extends CollectionSchemaCell { - @computed get _date(): Opt { return this._rowDoc[this.renderFieldKey] instanceof DateField ? DateCast(this._rowDoc[this.renderFieldKey]) : undefined; } - - @action - handleChange = (date: any) => { - // const script = CompileScript(date.toString(), { requiredType: "Date", addReturn: true, params: { this: Doc.name } }); - // if (script.compiled) { - // this.applyToDoc(this._document, this.props.row, this.props.col, script.run); - // } else { - // ^ DateCast is always undefined for some reason, but that is what the field should be set to - this._rowDoc[this.renderFieldKey] = new DateField(date as Date); - //} - } - - render() { - return !this.props.isFocused ? {this._date ? Field.toString(this._date as Field) : "--"} : - this.handleChange(date)} - onChange={date => this.handleChange(date)} - />; - } -} - -@observer -export class CollectionSchemaDocCell extends CollectionSchemaCell { - - _overlayDisposer?: () => void; - - @computed get _doc() { return FieldValue(Cast(this._rowDoc[this.renderFieldKey], Doc)); } - - @action - onSetValue = (value: string) => { - this._doc && (Doc.GetProto(this._doc).title = value); - - const script = CompileScript(value, { - addReturn: true, - typecheck: false, - transformer: DocumentIconContainer.getTransformer() - }); - - const results = script.compiled && script.run(); - if (results && results.success) { - this._rowDoc[this.renderFieldKey] = results.result; - return true; - } - return false; - } - - componentWillUnmount() { this.onBlur(); } - - onBlur = () => { this._overlayDisposer?.(); }; - onFocus = () => { - this.onBlur(); - this._overlayDisposer = OverlayView.Instance.addElement(, { x: 0, y: 0 }); - } - - @action - isEditingCallback = (isEditing: boolean): void => { - document.removeEventListener("keydown", this.onKeyDown); - isEditing && document.addEventListener("keydown", this.onKeyDown); - this._isEditing = isEditing; - this.props.setIsEditing(isEditing); - this.props.changeFocusedCellByIndex(this.props.row, this.props.col); - } - - render() { - return !this._doc ? this.renderCellWithType("document") : -
-
- StrCast(this._doc?.title)} - SetValue={action((value: string) => { - this.onSetValue(value); - return true; - })} - /> -
-
this._doc && this.props.addDocTab(this._doc, "add:right")} className="collectionSchemaView-cellContents-docButton"> - -
-
; - } -} - -@observer -export class CollectionSchemaImageCell extends CollectionSchemaCell { - - choosePath(url: URL) { - if (url.protocol === "data") return url.href; - if (url.href.indexOf(window.location.origin) === -1) return Utils.CorsProxy(url.href); - if (!/\.(png|jpg|jpeg|gif|webp)$/.test(url.href.toLowerCase())) return url.href;//Why is this here - - const ext = path.extname(url.href); - return url.href.replace(ext, "_o" + path.extname(url.href)); - } - - render() { - const field = Cast(this._rowDoc[this.renderFieldKey], ImageField, null); // retrieve the primary image URL that is being rendered from the data doc - const alts = DocListCast(this._rowDoc[this.renderFieldKey + "-alternates"]); // retrieve alternate documents that may be rendered as alternate images - const altpaths = alts.map(doc => Cast(doc[Doc.LayoutFieldKey(doc)], ImageField, null)?.url).filter(url => url).map(url => this.choosePath(url)); // access the primary layout data of the alternate documents - const paths = field ? [this.choosePath(field.url), ...altpaths] : altpaths; - const url = paths.length ? paths : [Utils.CorsProxy("http://www.cs.brown.edu/~bcz/noImage.png")]; - - const aspect = Doc.NativeAspect(this._rowDoc); - let width = Math.min(75, this.props.rowProps.width); - const height = Math.min(75, width / aspect); - width = height * aspect; - - const reference = React.createRef(); - return
-
- -
-
; - } -} - - -@observer -export class CollectionSchemaListCell extends CollectionSchemaCell { - _overlayDisposer?: () => void; - - @computed get _field() { return this._rowDoc[this.renderFieldKey]; } - @computed get _optionsList() { return this._field as List; } - @observable private _opened = false; - @observable private _text = "select an item"; - @observable private _selectedNum = 0; - - @action - onSetValue = (value: string) => { - // change if its a document - this._optionsList[this._selectedNum] = this._text = value; - - (this._field as List).splice(this._selectedNum, 1, value); - } - - @action - onSelected = (element: string, index: number) => { - this._text = element; - this._selectedNum = index; - } - - onFocus = () => { - this._overlayDisposer?.(); - this._overlayDisposer = OverlayView.Instance.addElement(, { x: 0, y: 0 }); - } - - render() { - const link = false; - const reference = React.createRef(); - - if (this._optionsList?.length) { - const options = !this._opened ? (null) : -
- {this._optionsList.map((element, index) => { - const val = Field.toString(element); - return
this.onSelected(StrCast(element), index)} > - {val} -
; - })} -
; - - const plainText =
{this._text}
; - const textarea =
- this._text} - SetValue={action((value: string) => { - // add special for params - this.onSetValue(value); - return true; - })} - /> -
; - - //☰ - return ( -
-
-
- -
{link ? plainText : textarea}
-
- {options} -
-
- ); - } - return this.renderCellWithType("list"); - } -} - - -@observer -export class CollectionSchemaCheckboxCell extends CollectionSchemaCell { - @computed get _isChecked() { return BoolCast(this._rowDoc[this.renderFieldKey]); } - - render() { - const reference = React.createRef(); - return ( -
- this._rowDoc[this.renderFieldKey] = e.target.checked} /> -
- ); - } -} - - -@observer -export class CollectionSchemaButtons extends CollectionSchemaCell { - render() { - return !this.props.Document._searchDoc || ![DocumentType.PDF, DocumentType.RTF].includes(StrCast(this._rowDoc.type) as DocumentType) ? <> : -
- - -
; - } -} \ No newline at end of file diff --git a/src/client/views/collections/CollectionSchemaHeaders.tsx b/src/client/views/collections/CollectionSchemaHeaders.tsx deleted file mode 100644 index 3b52e6408..000000000 --- a/src/client/views/collections/CollectionSchemaHeaders.tsx +++ /dev/null @@ -1,518 +0,0 @@ -import React = require("react"); -import { IconProp, library } from "@fortawesome/fontawesome-svg-core"; -import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { action, computed, observable, runInAction } from "mobx"; -import { observer } from "mobx-react"; -import { Doc, DocListCast, Opt } from "../../../fields/Doc"; -import { listSpec } from "../../../fields/Schema"; -import { PastelSchemaPalette, SchemaHeaderField } from "../../../fields/SchemaHeaderField"; -import { ScriptField } from "../../../fields/ScriptField"; -import { Cast, StrCast } from "../../../fields/Types"; -import { undoBatch } from "../../util/UndoManager"; -import { SearchBox } from "../search/SearchBox"; -import { ColumnType } from "./CollectionSchemaView"; -import "./CollectionSchemaView.scss"; -import { CollectionView } from "./CollectionView"; - -const higflyout = require("@hig/flyout"); -export const { anchorPoints } = higflyout; -export const Flyout = higflyout.default; - - -export interface AddColumnHeaderProps { - createColumn: () => void; -} - -@observer -export class CollectionSchemaAddColumnHeader extends React.Component { - render() { - return ( - - ); - } -} - - -export interface ColumnMenuProps { - columnField: SchemaHeaderField; - // keyValue: string; - possibleKeys: string[]; - existingKeys: string[]; - // keyType: ColumnType; - typeConst: boolean; - menuButtonContent: JSX.Element; - addNew: boolean; - onSelect: (oldKey: string, newKey: string, addnew: boolean) => void; - setIsEditing: (isEditing: boolean) => void; - deleteColumn: (column: string) => void; - onlyShowOptions: boolean; - setColumnType: (column: SchemaHeaderField, type: ColumnType) => void; - setColumnSort: (column: SchemaHeaderField, desc: boolean | undefined) => void; - anchorPoint?: any; - setColumnColor: (column: SchemaHeaderField, color: string) => void; -} -@observer -export class CollectionSchemaColumnMenu extends React.Component { - @observable private _isOpen: boolean = false; - @observable private _node: HTMLDivElement | null = null; - - componentDidMount() { document.addEventListener("pointerdown", this.detectClick); } - - componentWillUnmount() { document.removeEventListener("pointerdown", this.detectClick); } - - @action - detectClick = (e: PointerEvent) => { - !this._node?.contains(e.target as Node) && this.props.setIsEditing(this._isOpen = false); - } - - @action - toggleIsOpen = (): void => { - this.props.setIsEditing(this._isOpen = !this._isOpen); - } - - changeColumnType = (type: ColumnType) => { - this.props.setColumnType(this.props.columnField, type); - } - - changeColumnSort = (desc: boolean | undefined) => { - this.props.setColumnSort(this.props.columnField, desc); - } - - changeColumnColor = (color: string) => { - this.props.setColumnColor(this.props.columnField, color); - } - - @action - setNode = (node: HTMLDivElement): void => { - if (node) { - this._node = node; - } - } - - renderTypes = () => { - if (this.props.typeConst) return (null); - - const type = this.props.columnField.type; - return ( -
- -
-
this.changeColumnType(ColumnType.Any)}> - - Any -
-
this.changeColumnType(ColumnType.Number)}> - - Number -
-
this.changeColumnType(ColumnType.String)}> - - Text -
-
this.changeColumnType(ColumnType.Boolean)}> - - Checkbox -
-
this.changeColumnType(ColumnType.List)}> - - List -
-
this.changeColumnType(ColumnType.Doc)}> - - Document -
-
this.changeColumnType(ColumnType.Image)}> - - Image -
-
this.changeColumnType(ColumnType.Date)}> - - Date -
-
-
- ); - } - - renderSorting = () => { - const sort = this.props.columnField.desc; - return ( -
- -
-
this.changeColumnSort(true)}> - - Sort descending -
-
this.changeColumnSort(false)}> - - Sort ascending -
-
this.changeColumnSort(undefined)}> - - Clear sorting -
-
-
- ); - } - - renderColors = () => { - const selected = this.props.columnField.color; - - const pink = PastelSchemaPalette.get("pink2"); - const purple = PastelSchemaPalette.get("purple2"); - const blue = PastelSchemaPalette.get("bluegreen1"); - const yellow = PastelSchemaPalette.get("yellow4"); - const red = PastelSchemaPalette.get("red2"); - const gray = "#f1efeb"; - - return ( -
- -
-
this.changeColumnColor(pink!)}>
-
this.changeColumnColor(purple!)}>
-
this.changeColumnColor(blue!)}>
-
this.changeColumnColor(yellow!)}>
-
this.changeColumnColor(red!)}>
-
this.changeColumnColor(gray)}>
-
-
- ); - } - - renderContent = () => { - return ( -
- {this.props.onlyShowOptions ? <> : - <> - {this.renderTypes()} - {this.renderSorting()} - {this.renderColors()} -
- -
- - } -
- ); - } - - render() { - return ( -
- -
this.toggleIsOpen()}>{this.props.menuButtonContent}
- -
- ); - } -} - - -export interface KeysDropdownProps { - keyValue: string; - possibleKeys: string[]; - existingKeys: string[]; - canAddNew: boolean; - addNew: boolean; - onSelect: (oldKey: string, newKey: string, addnew: boolean, filter?: string) => void; - setIsEditing: (isEditing: boolean) => void; - width?: string; - docs?: Doc[]; - Document: Doc; - dataDoc: Doc | undefined; - fieldKey: string; - ContainingCollectionDoc: Doc | undefined; - ContainingCollectionView: Opt; - active?: (outsideReaction?: boolean) => boolean; - openHeader: (column: any, screenx: number, screeny: number) => void; - col: SchemaHeaderField; - icon: IconProp; -} -@observer -export class KeysDropdown extends React.Component { - @observable private _key: string = this.props.keyValue; - @observable private _searchTerm: string = this.props.keyValue; - @observable private _isOpen: boolean = false; - @observable private _node: HTMLDivElement | null = null; - @observable private _inputRef: React.RefObject = React.createRef(); - - @action setSearchTerm = (value: string): void => { this._searchTerm = value; }; - @action setKey = (key: string): void => { this._key = key; }; - @action setIsOpen = (isOpen: boolean): void => { this._isOpen = isOpen; }; - - @action - onSelect = (key: string): void => { - this.props.onSelect(this._key, key, this.props.addNew); - this.setKey(key); - this._isOpen = false; - this.props.setIsEditing(false); - } - - @action - setNode = (node: HTMLDivElement): void => { - if (node) { - this._node = node; - } - } - - componentDidMount() { - document.addEventListener("pointerdown", this.detectClick); - const filters = Cast(this.props.Document._docFilters, listSpec("string")); - if (filters?.some(filter => filter.split(":")[0] === this._key)) { - runInAction(() => this.closeResultsVisibility = "contents"); - } - } - - @action - detectClick = (e: PointerEvent): void => { - if (this._node && this._node.contains(e.target as Node)) { - } else { - this._isOpen = false; - this.props.setIsEditing(false); - } - } - - private tempfilter: string = ""; - @undoBatch - onKeyDown = (e: React.KeyboardEvent): void => { - if (e.key === "Enter") { - if (this._searchTerm.includes(":")) { - const colpos = this._searchTerm.indexOf(":"); - const temp = this._searchTerm.slice(colpos + 1, this._searchTerm.length); - if (temp === "") { - Doc.setDocFilter(this.props.Document, this._key, this.tempfilter, "remove"); - this.updateFilter(); - } - else { - Doc.setDocFilter(this.props.Document, this._key, this.tempfilter, "remove"); - this.tempfilter = temp; - Doc.setDocFilter(this.props.Document, this._key, temp, "check"); - this.props.col.setColor("green"); - this.closeResultsVisibility = "contents"; - } - } - else { - Doc.setDocFilter(this.props.Document, this._key, this.tempfilter, "remove"); - this.updateFilter(); - if (this.showKeys.length) { - this.onSelect(this.showKeys[0]); - } else if (this._searchTerm !== "" && this.props.canAddNew) { - this.setSearchTerm(this._searchTerm || this._key); - this.onSelect(this._searchTerm); - } - } - } - } - - onChange = (val: string): void => { - this.setSearchTerm(val); - } - - @action - onFocus = (e: React.FocusEvent): void => { - this._isOpen = true; - this.props.setIsEditing(true); - } - - @computed get showKeys() { - const whitelistKeys = ["context", "author", "*lastModified", "text", "data", "tags", "creationDate"]; - const keyOptions = this._searchTerm === "" ? this.props.possibleKeys : this.props.possibleKeys.filter(key => key.toUpperCase().indexOf(this._searchTerm.toUpperCase()) > -1); - const showKeys = new Set(); - [...keyOptions, ...whitelistKeys].forEach(key => (!Doc.UserDoc().noviceMode || - whitelistKeys.includes(key) - || ((!key.startsWith("_") && key[0] === key[0].toUpperCase()) || key[0] === "#")) ? showKeys.add(key) : null); - return Array.from(showKeys.keys()).filter(key => !this._searchTerm || key.includes(this._searchTerm)); - } - @action - renderOptions = (): JSX.Element[] | JSX.Element => { - if (!this._isOpen) { - this.defaultMenuHeight = 0; - return <>; - } - const options = this.showKeys.map(key => { - return
{ - e.stopPropagation(); - }} - onClick={() => { - this.onSelect(key); - this.setSearchTerm(""); - }}>{key}
; - }); - - // if search term does not already exist as a group type, give option to create new group type - - if (this._key !== this._searchTerm.slice(0, this._key.length)) { - if (this._searchTerm !== "" && this.props.canAddNew) { - options.push(
{ this.onSelect(this._searchTerm); this.setSearchTerm(""); }}> - Create "{this._searchTerm}" key
); - } - } - - if (options.length === 0) { - this.defaultMenuHeight = 0; - } - else { - if (this.props.docs) { - const panesize = this.props.docs.length * 30; - options.length * 20 + 8 - 10 > panesize ? this.defaultMenuHeight = panesize : this.defaultMenuHeight = options.length * 20 + 8; - } - else { - options.length > 5 ? this.defaultMenuHeight = 108 : this.defaultMenuHeight = options.length * 20 + 8; - } - } - return options; - } - - docSafe: Doc[] = []; - - @action - renderFilterOptions = (): JSX.Element[] | JSX.Element => { - if (!this._isOpen || !this.props.dataDoc) { - this.defaultMenuHeight = 0; - return <>; - } - const keyOptions: string[] = []; - const colpos = this._searchTerm.indexOf(":"); - const temp = this._searchTerm.slice(colpos + 1, this._searchTerm.length); - if (this.docSafe.length === 0) { - this.docSafe = DocListCast(this.props.dataDoc[this.props.fieldKey]); - } - const docs = this.docSafe; - docs.forEach((doc) => { - const key = StrCast(doc[this._key]); - if (keyOptions.includes(key) === false && key.includes(temp) && key !== "") { - keyOptions.push(key); - } - }); - - const filters = Cast(this.props.Document._docFilters, listSpec("string")); - if (filters === undefined || filters.length === 0 || filters.some(filter => filter.split(":")[0] === this._key) === false) { - this.props.col.setColor("rgb(241, 239, 235)"); - this.closeResultsVisibility = "none"; - } - for (let i = 0; i < (filters?.length ?? 0) - 1; i++) { - if (filters![i] === this.props.col.heading && keyOptions.includes(filters![i].split(":")[1]) === false) { - keyOptions.push(filters![i + 1]); - } - } - const options = keyOptions.map(key => { - let bool = false; - if (filters !== undefined) { - const ind = filters.findIndex(filter => filter.split(":")[0] === key); - const fields = ind === -1 ? undefined : filters[ind].split(":"); - bool = fields ? fields[1] === "check" : false; - } - return
- e.stopPropagation()} - onClick={e => e.stopPropagation()} - onChange={(e) => { - e.target.checked === true ? Doc.setDocFilter(this.props.Document, this._key, key, "check") : Doc.setDocFilter(this.props.Document, this._key, key, "remove"); - e.target.checked === true ? this.closeResultsVisibility = "contents" : console.log(""); - e.target.checked === true ? this.props.col.setColor("green") : this.updateFilter(); - e.target.checked === true && SearchBox.Instance.filter === true ? Doc.setDocFilter(docs[0], this._key, key, "check") : Doc.setDocFilter(docs[0], this._key, key, "remove"); - }} - checked={bool} - /> - - {key} - - -
; - }); - if (options.length === 0) { - this.defaultMenuHeight = 0; - } - else { - if (this.props.docs) { - const panesize = this.props.docs.length * 30; - options.length * 20 + 8 - 10 > panesize ? this.defaultMenuHeight = panesize : this.defaultMenuHeight = options.length * 20 + 8; - } - else { - options.length > 5 ? this.defaultMenuHeight = 108 : this.defaultMenuHeight = options.length * 20 + 8; - } - - } - return options; - } - - @observable defaultMenuHeight = 0; - - - updateFilter() { - const filters = Cast(this.props.Document._docFilters, listSpec("string")); - if (filters === undefined || filters.length === 0 || filters.some(filter => filter.split(":")[0] === this._key) === false) { - this.props.col.setColor("rgb(241, 239, 235)"); - this.closeResultsVisibility = "none"; - } - } - - @computed get scriptField() { - const scriptText = "setDocFilter(containingTreeView, heading, this.title, checked)"; - const script = ScriptField.MakeScript(scriptText, { this: Doc.name, heading: "string", checked: "string", containingTreeView: Doc.name }); - return script ? () => script : undefined; - } - filterBackground = () => "rgba(105, 105, 105, 0.432)"; - @observable filterOpen: boolean | undefined = undefined; - closeResultsVisibility: string = "none"; - - removeFilters = (e: React.PointerEvent): void => { - const keyOptions: string[] = []; - if (this.docSafe.length === 0 && this.props.dataDoc) { - this.docSafe = DocListCast(this.props.dataDoc[this.props.fieldKey]); - } - const docs = this.docSafe; - docs.forEach((doc) => { - const key = StrCast(doc[this._key]); - if (keyOptions.includes(key) === false) { - keyOptions.push(key); - } - }); - - Doc.setDocFilter(this.props.Document, this._key, "", "remove"); - this.props.col.setColor("rgb(241, 239, 235)"); - this.closeResultsVisibility = "none"; - } - render() { - return ( -
- { this.props.openHeader(this.props.col, e.clientX, e.clientY); e.stopPropagation(); }} icon={this.props.icon} size="lg" style={{ display: "inline", paddingBottom: "1px", paddingTop: "4px", cursor: "hand" }} /> - - {/* { - runInAction(() => { this._isOpen === undefined ? this._isOpen = true : this._isOpen = !this._isOpen }) - }} /> */} - -
- this.onChange(e.target.value)} - onClick={(e) => { e.stopPropagation(); this._inputRef.current?.focus(); }} - onFocus={this.onFocus} > -
- -
- {!this._isOpen ? (null) :
- {this._searchTerm.includes(":") ? this.renderFilterOptions() : this.renderOptions()} -
} -
-
- ); - } -} diff --git a/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx b/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx deleted file mode 100644 index 149677976..000000000 --- a/src/client/views/collections/CollectionSchemaMovableTableHOC.tsx +++ /dev/null @@ -1,261 +0,0 @@ -import React = require("react"); -import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { action } from "mobx"; -import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table"; -import { Doc } from "../../../fields/Doc"; -import { SchemaHeaderField } from "../../../fields/SchemaHeaderField"; -import { Cast, FieldValue, StrCast } from "../../../fields/Types"; -import { DocumentManager } from "../../util/DocumentManager"; -import { DragManager, dropActionType, SetupDrag } from "../../util/DragManager"; -import { SnappingManager } from "../../util/SnappingManager"; -import { Transform } from "../../util/Transform"; -import { undoBatch } from "../../util/UndoManager"; -import { ContextMenu } from "../ContextMenu"; -import "./CollectionSchemaView.scss"; - -export interface MovableColumnProps { - columnRenderer: TableCellRenderer; - columnValue: SchemaHeaderField; - allColumns: SchemaHeaderField[]; - reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columns: SchemaHeaderField[]) => void; - ScreenToLocalTransform: () => Transform; -} -export class MovableColumn extends React.Component { - private _header?: React.RefObject = React.createRef(); - private _colDropDisposer?: DragManager.DragDropDisposer; - private _startDragPosition: { x: number, y: number } = { x: 0, y: 0 }; - private _sensitivity: number = 16; - private _dragRef: React.RefObject = React.createRef(); - - onPointerEnter = (e: React.PointerEvent): void => { - if (e.buttons === 1 && SnappingManager.GetIsDragging()) { - this._header!.current!.className = "collectionSchema-col-wrapper"; - document.addEventListener("pointermove", this.onDragMove, true); - } - } - onPointerLeave = (e: React.PointerEvent): void => { - this._header!.current!.className = "collectionSchema-col-wrapper"; - document.removeEventListener("pointermove", this.onDragMove, true); - !e.buttons && document.removeEventListener("pointermove", this.onPointerMove); - } - onDragMove = (e: PointerEvent): void => { - const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top); - const before = x[0] < bounds[0]; - this._header!.current!.className = "collectionSchema-col-wrapper"; - if (before) this._header!.current!.className += " col-before"; - if (!before) this._header!.current!.className += " col-after"; - e.stopPropagation(); - } - - createColDropTarget = (ele: HTMLDivElement) => { - this._colDropDisposer?.(); - if (ele) { - this._colDropDisposer = DragManager.MakeDropTarget(ele, this.colDrop.bind(this)); - } - } - - colDrop = (e: Event, de: DragManager.DropEvent) => { - document.removeEventListener("pointermove", this.onDragMove, true); - const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top); - const before = x[0] < bounds[0]; - const colDragData = de.complete.columnDragData; - if (colDragData) { - e.stopPropagation(); - this.props.reorderColumns(colDragData.colKey, this.props.columnValue, before, this.props.allColumns); - return true; - } - return false; - } - - onPointerMove = (e: PointerEvent) => { - const onRowMove = (e: PointerEvent) => { - e.stopPropagation(); - e.preventDefault(); - - document.removeEventListener("pointermove", onRowMove); - document.removeEventListener('pointerup', onRowUp); - const dragData = new DragManager.ColumnDragData(this.props.columnValue); - DragManager.StartColumnDrag(this._dragRef.current!, dragData, e.x, e.y); - }; - const onRowUp = (): void => { - document.removeEventListener("pointermove", onRowMove); - document.removeEventListener('pointerup', onRowUp); - }; - if (e.buttons === 1) { - const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX - this._startDragPosition.x, e.clientY - this._startDragPosition.y); - if (Math.abs(dx) + Math.abs(dy) > this._sensitivity) { - document.removeEventListener("pointermove", this.onPointerMove); - e.stopPropagation(); - - document.addEventListener("pointermove", onRowMove); - document.addEventListener("pointerup", onRowUp); - } - } - } - - onPointerUp = (e: React.PointerEvent) => { - document.removeEventListener("pointermove", this.onPointerMove); - } - - @action - onPointerDown = (e: React.PointerEvent, ref: React.RefObject) => { - this._dragRef = ref; - const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX, e.clientY); - if (!(e.target as any)?.tagName.includes("INPUT")) { - this._startDragPosition = { x: dx, y: dy }; - document.addEventListener("pointermove", this.onPointerMove); - } - } - - - render() { - const reference = React.createRef(); - - return ( -
-
-
this.onPointerDown(e, reference)} onPointerUp={this.onPointerUp}> - {this.props.columnRenderer} -
-
-
- ); - } -} - -export interface MovableRowProps { - rowInfo: RowInfo; - ScreenToLocalTransform: () => Transform; - addDoc: (doc: Doc | Doc[], relativeTo?: Doc, before?: boolean) => boolean; - removeDoc: (doc: Doc | Doc[]) => boolean; - rowFocused: boolean; - textWrapRow: (doc: Doc) => void; - rowWrapped: boolean; - dropAction: string; - addDocTab: any; -} - -export class MovableRow extends React.Component { - private _header?: React.RefObject = React.createRef(); - private _rowDropDisposer?: DragManager.DragDropDisposer; - - // Event listeners are only necessary when the user is hovering over the table - // Create one when the mouse starts hovering... - onPointerEnter = (e: React.PointerEvent): void => { - if (e.buttons === 1 && SnappingManager.GetIsDragging()) { - this._header!.current!.className = "collectionSchema-row-wrapper"; - document.addEventListener("pointermove", this.onDragMove, true); - } - } - // ... and delete it when the mouse leaves - onPointerLeave = (e: React.PointerEvent): void => { - this._header!.current!.className = "collectionSchema-row-wrapper"; - document.removeEventListener("pointermove", this.onDragMove, true); - } - // The method for the event listener, reorders columns when dragged to their new locations. - onDragMove = (e: PointerEvent): void => { - const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); - const before = x[1] < bounds[1]; - this._header!.current!.className = "collectionSchema-row-wrapper"; - if (before) this._header!.current!.className += " row-above"; - if (!before) this._header!.current!.className += " row-below"; - e.stopPropagation(); - } - componentWillUnmount() { - - this._rowDropDisposer?.(); - } - // - createRowDropTarget = (ele: HTMLDivElement) => { - this._rowDropDisposer?.(); - if (ele) { - this._rowDropDisposer = DragManager.MakeDropTarget(ele, this.rowDrop.bind(this)); - } - } - // Controls what hppens when a row is dragged and dropped - rowDrop = (e: Event, de: DragManager.DropEvent) => { - this.onPointerLeave(e as any); - const rowDoc = FieldValue(Cast(this.props.rowInfo.original, Doc)); - if (!rowDoc) return false; - - const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); - const before = x[1] < bounds[1]; - - const docDragData = de.complete.docDragData; - if (docDragData) { - e.stopPropagation(); - if (docDragData.draggedDocuments[0] === rowDoc) return true; - const addDocument = (doc: Doc | Doc[]) => this.props.addDoc(doc, rowDoc, before); - const movedDocs = docDragData.draggedDocuments; - return (docDragData.dropAction || docDragData.userDropAction) ? - docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before) || added, false) - : (docDragData.moveDocument) ? - movedDocs.reduce((added: boolean, d) => docDragData.moveDocument?.(d, rowDoc, addDocument) || added, false) - : docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before), false); - } - return false; - } - - onRowContextMenu = (e: React.MouseEvent): void => { - const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row"; - ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" }); - } - - @undoBatch - @action - move: DragManager.MoveFunction = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc) => { - const targetView = targetCollection && DocumentManager.Instance.getDocumentView(targetCollection); - return doc !== targetCollection && doc !== targetView?.props.ContainingCollectionDoc && this.props.removeDoc(doc) && addDoc(doc); - } - - @action - onKeyDown = (e: React.KeyboardEvent) => { - console.log("yes"); - if (e.key === "Backspace" || e.key === "Delete") { - undoBatch(() => this.props.removeDoc(this.props.rowInfo.original)); - } - } - - render() { - const { children = null, rowInfo } = this.props; - - if (!rowInfo) { - return {children}; - } - - const { original } = rowInfo; - const doc = FieldValue(Cast(original, Doc)); - - if (!doc) return (null); - - const reference = React.createRef(); - const onItemDown = SetupDrag(reference, () => doc, this.move, StrCast(this.props.dropAction) as dropActionType); - - let className = "collectionSchema-row"; - if (this.props.rowFocused) className += " row-focused"; - if (this.props.rowWrapped) className += " row-wrapped"; - - return ( -
-
- -
-
this.props.removeDoc(this.props.rowInfo.original))}>
-
-
this.props.addDocTab(this.props.rowInfo.original, "add:right")}>
-
- {children} -
-
-
- ); - } -} \ No newline at end of file diff --git a/src/client/views/collections/CollectionSchemaView.scss b/src/client/views/collections/CollectionSchemaView.scss deleted file mode 100644 index 2bdd280ec..000000000 --- a/src/client/views/collections/CollectionSchemaView.scss +++ /dev/null @@ -1,641 +0,0 @@ -@import "../globalCssVariables"; - -.collectionSchemaView-container { - border-width: $COLLECTION_BORDER_WIDTH; - border-color: $intermediate-color; - border-style: solid; - border-radius: $border-radius; - box-sizing: border-box; - position: relative; - top: 0; - width: 100%; - height: 100%; - margin-top: 0; - transition: top 0.5s; - display: flex; - justify-content: space-between; - flex-wrap: nowrap; - touch-action: none; - - div { - touch-action: none; - } - - - .collectionSchemaView-tableContainer { - width: 100%; - height: 100%; - } - - .collectionSchemaView-dividerDragger { - position: relative; - height: 100%; - width: $SCHEMA_DIVIDER_WIDTH; - z-index: 20; - right: 0; - top: 0; - background: gray; - cursor: col-resize; - } - - // .documentView-node:first-child { - // background: $light-color; - // } -} - -.collectionSchemaView-searchContainer { - border-width: $COLLECTION_BORDER_WIDTH; - border-color: $intermediate-color; - border-style: solid; - border-radius: $border-radius; - box-sizing: border-box; - position: relative; - top: 0; - width: 100%; - height: 100%; - margin-top: 0; - transition: top 0.5s; - display: flex; - justify-content: space-between; - flex-wrap: nowrap; - touch-action: none; - padding: 2px; - - div { - touch-action: none; - } - - - .collectionSchemaView-tableContainer { - width: 100%; - height: 100%; - } - - .collectionSchemaView-dividerDragger { - position: relative; - height: 100%; - width: 20px; - z-index: 20; - right: 0; - top: 0; - background: gray; - cursor: col-resize; - } - - // .documentView-node:first-child { - // background: $light-color; - // } -} - -.ReactTable { - width: 100%; - background: white; - box-sizing: border-box; - border: none !important; - float: none !important; - - .rt-table { - height: 100%; - display: -webkit-inline-box; - direction: ltr; - overflow: visible; - } - .rt-noData { - display: none; - } - - .rt-thead { - width: 100%; - z-index: 100; - overflow-y: visible; - - &.-header { - font-size: 12px; - height: 30px; - box-shadow: none; - z-index: 100; - overflow-y: visible; - } - - .rt-resizable-header-content { - height: 100%; - overflow: visible; - } - - .rt-th { - padding: 0; - border: solid lightgray; - border-width: 0 1px; - border-bottom: 2px solid lightgray; - } - } - - .rt-th { - font-size: 13px; - text-align: center; - - &:last-child { - overflow: visible; - } - } - - .rt-tbody { - width: 100%; - direction: rtl; - overflow: visible; - - .rt-td { - border-right: 1px solid rgba(0, 0, 0, 0.2); - } - } - - .rt-tr-group { - direction: ltr; - flex: 0 1 auto; - min-height: 30px; - border: 0 !important; - } - - .rt-tr { - width: 100%; - min-height: 30px; - } - - .rt-td { - padding: 0; - font-size: 13px; - text-align: center; - white-space: nowrap; - display: flex; - align-items: center; - - .imageBox-cont { - position: relative; - max-height: 100%; - } - - .imageBox-cont img { - object-fit: contain; - max-width: 100%; - height: 100%; - } - - .videoBox-cont { - object-fit: contain; - width: auto; - height: 100%; - } - } - .rt-td.rt-expandable { - display: flex; - align-items: center; - height: inherit; - } - - .rt-resizer { - width: 8px; - right: -4px; - } - - .rt-resizable-header { - padding: 0; - height: 30px; - } - - .rt-resizable-header:last-child { - overflow: visible; - - .rt-resizer { - width: 5px !important; - } - } -} - -.documentView-node-topmost { - text-align: left; - transform-origin: center top; - display: inline-block; -} - -.collectionSchema-col { - height: 100%; -} - - -.collectionSchema-header-menu { - height: auto; - z-index: 100; - position: absolute; - background: white; - padding: 5px; - position: fixed; - background: white; - border: black 1px solid; - - .collectionSchema-header-toggler { - z-index: 100; - width: 100%; - height: 100%; - padding: 4px; - letter-spacing: 2px; - text-transform: uppercase; - - svg { - margin-right: 4px; - } - } -} - -.collectionSchemaView-header { - height: 100%; - color: gray; - z-index: 100; - overflow-y: visible; - display: flex; - justify-content: space-between; - flex-wrap: wrap; -} - -button.add-column { - width: 28px; -} - -.collectionSchema-header-menuOptions { - color: black; - width: 180px; - text-align: left; - - .collectionSchema-headerMenu-group { - padding: 7px 0; - border-bottom: 1px solid lightgray; - cursor: pointer; - - &:first-child { - padding-top: 0; - } - - &:last-child { - border: none; - text-align: center; - padding: 12px 0 0 0; - } - } - - label { - color: $main-accent; - font-weight: normal; - letter-spacing: 2px; - text-transform: uppercase; - } - - input { - color: black; - width: 100%; - } - - .columnMenu-option { - cursor: pointer; - padding: 3px; - background-color: white; - transition: background-color 0.2s; - - &:hover { - background-color: $light-color-secondary; - } - - &.active { - font-weight: bold; - border: 2px solid $light-color-secondary; - } - - svg { - color: gray; - margin-right: 5px; - width: 10px; - } - } - - .keys-dropdown { - position: relative; - //width: 100%; - background-color: white; - - input { - border: 2px solid $light-color-secondary; - padding: 3px; - height: 28px; - font-weight: bold; - letter-spacing: "2px"; - text-transform: "uppercase"; - - &:focus { - font-weight: normal; - } - } - - .keys-options-wrapper { - width: 100%; - max-height: 150px; - overflow-y: scroll; - position: absolute; - top: 28px; - box-shadow: 0 10px 16px rgba(0, 0, 0, 0.1); - background-color: white; - - .key-option { - background-color: white; - border: 1px solid lightgray; - padding: 2px 3px; - - &:not(:first-child) { - border-top: 0; - } - - &:hover { - background-color: $light-color-secondary; - } - } - } - } - - .columnMenu-colors { - display: flex; - justify-content: space-between; - flex-wrap: wrap; - - .columnMenu-colorPicker { - cursor: pointer; - width: 20px; - height: 20px; - border-radius: 10px; - - &.active { - border: 2px solid white; - box-shadow: 0 0 0 2px lightgray; - } - } - } -} - -.collectionSchema-row { - height: 100%; - background-color: white; - - &.row-focused .rt-td { - background-color: #bfffc0; //$light-color-secondary; - } - - &.row-wrapped { - .rt-td { - white-space: normal; - } - } - - .row-dragger { - display: flex; - justify-content: space-around; - //flex: 50 0 auto; - width: 0; - max-width: 50px; - //height: 100%; - min-height: 30px; - align-items: center; - color: lightgray; - background-color: white; - transition: color 0.1s ease; - - .row-option { - // padding: 5px; - cursor: pointer; - position: absolute; - transition: color 0.1s ease; - display: flex; - flex-direction: column; - justify-content: center; - z-index: 2; - - &:hover { - color: gray; - } - } - } - - .collectionSchema-row-wrapper { - - &.row-above { - border-top: 1px solid red; - } - - &.row-below { - border-bottom: 1px solid red; - } - - &.row-inside { - border: 1px solid red; - } - - .row-dragging { - background-color: blue; - } - } -} - -.collectionSchemaView-cellContainer { - width: 100%; - height: unset; -} - -.collectionSchemaView-cellWrapper { - height: 100%; - padding: 4px; - text-align: left; - padding-left: 19px; - - position: relative; - - &:focus { - outline: none; - } - - &.editing { - padding: 0; - - input { - outline: 0; - border: none; - background-color: rgb(255, 217, 217); - width: 100%; - height: 100%; - padding: 2px 3px; - min-height: 26px; - } - } - - &.focused { - - &.inactive { - border: none; - } - } - - p { - width: 100%; - height: 100%; - } - - &:hover .collectionSchemaView-cellContents-docExpander { - display: block; - } - - - .collectionSchemaView-cellContents-document { - display: inline-block; - } - - .collectionSchemaView-cellContents-docButton { - float: right; - width: "15px"; - height: "15px"; - } - - .collectionSchemaView-dropdownWrapper { - - border: grey; - border-style: solid; - border-width: 1px; - height: 30px; - - .collectionSchemaView-dropdownButton { - - //display: inline-block; - float: left; - height: 100%; - - - } - - .collectionSchemaView-dropdownText { - display: inline-block; - //float: right; - height: 100%; - display: "flex"; - font-size: 13; - justify-content: "center"; - align-items: "center"; - } - - } - - .collectionSchemaView-dropdownContainer { - position: absolute; - border: 1px solid rgba(0, 0, 0, 0.04); - box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14); - - .collectionSchemaView-dropdownOption:hover { - background-color: rgba(0, 0, 0, 0.14); - cursor: pointer; - } - } -} - -.collectionSchemaView-cellContents-docExpander { - height: 30px; - width: 30px; - display: none; - position: absolute; - top: 0; - right: 0; - background-color: lightgray; - -} - -.doc-drag-over { - background-color: red; -} - -.collectionSchemaView-toolbar { - z-index: 100; -} - -.collectionSchemaView-toolbar { - height: 30px; - display: flex; - justify-content: flex-end; - padding: 0 10px; - border-bottom: 2px solid gray; - - .collectionSchemaView-toolbar-item { - display: flex; - flex-direction: column; - justify-content: center; - } -} - -#preview-schema-checkbox-div { - margin-left: 20px; - font-size: 12px; -} - -.collectionSchemaView-table { - width: 100%; - height: 100%; - overflow: auto; - padding: 3px; -} - -.rt-td.rt-expandable { - overflow: visible; - position: relative; - height:100%; - z-index: 1; -} -.reactTable-sub { - background-color: rgb(252, 252, 252); - width: 100%; - - .rt-thead { - display: none; - } - - .row-dragger { - background-color: rgb(252, 252, 252); - } - - .rt-table { - background-color: rgb(252, 252, 252); - } - - .collectionSchemaView-table { - width: 100%; - border: solid 1px; - overflow: visible; - padding: 0px; - } -} - -.collectionSchemaView-expander { - height: 100%; - min-height: 30px; - position: absolute; - color: gray; - width: 20; - height: auto; - left: 55; - - svg { - position: absolute; - top: 50%; - left: 10; - transform: translate(-50%, -50%); - } -} - -.collectionSchemaView-addRow { - color: gray; - letter-spacing: 2px; - text-transform: uppercase; - cursor: pointer; - font-size: 10.5px; - margin-left: 50px; - margin-top: 10px; -} \ No newline at end of file diff --git a/src/client/views/collections/CollectionSchemaView.tsx b/src/client/views/collections/CollectionSchemaView.tsx deleted file mode 100644 index b33c437a9..000000000 --- a/src/client/views/collections/CollectionSchemaView.tsx +++ /dev/null @@ -1,575 +0,0 @@ -import React = require("react"); -import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; -import { action, computed, observable, untracked } from "mobx"; -import { observer } from "mobx-react"; -import Measure from "react-measure"; -import { Resize } from "react-table"; -import "react-table/react-table.css"; -import { Doc, Opt } from "../../../fields/Doc"; -import { List } from "../../../fields/List"; -import { listSpec } from "../../../fields/Schema"; -import { PastelSchemaPalette, SchemaHeaderField } from "../../../fields/SchemaHeaderField"; -import { Cast, NumCast } from "../../../fields/Types"; -import { TraceMobx } from "../../../fields/util"; -import { emptyFunction, emptyPath, returnFalse, setupMoveUpEvents, returnEmptyDoclist, returnTrue } from "../../../Utils"; -import { SelectionManager } from "../../util/SelectionManager"; -import { SnappingManager } from "../../util/SnappingManager"; -import { Transform } from "../../util/Transform"; -import { undoBatch } from "../../util/UndoManager"; -import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/globalCssVariables.scss'; -import { ContextMenu } from "../ContextMenu"; -import { ContextMenuProps } from "../ContextMenuItem"; -import '../DocumentDecorations.scss'; -import { DocumentView } from "../nodes/DocumentView"; -import { DefaultStyleProvider } from "../StyleProvider"; -import "./CollectionSchemaView.scss"; -import { CollectionSubView } from "./CollectionSubView"; -import { SchemaTable } from "./SchemaTable"; -import { DocUtils } from "../../documents/Documents"; -// bcz: need to add drag and drop of rows and columns. This seems like it might work for rows: https://codesandbox.io/s/l94mn1q657 - -export enum ColumnType { - Any, - Number, - String, - Boolean, - Doc, - Image, - List, - Date -} -// this map should be used for keys that should have a const type of value -const columnTypes: Map = new Map([ - ["title", ColumnType.String], - ["x", ColumnType.Number], ["y", ColumnType.Number], ["_width", ColumnType.Number], ["_height", ColumnType.Number], - ["_nativeWidth", ColumnType.Number], ["_nativeHeight", ColumnType.Number], ["isPrototype", ColumnType.Boolean], - ["_curPage", ColumnType.Number], ["_currentTimecode", ColumnType.Number], ["zIndex", ColumnType.Number] -]); - -@observer -export class CollectionSchemaView extends CollectionSubView(doc => doc) { - private _previewCont?: HTMLDivElement; - - @observable _previewDoc: Doc | undefined = undefined; - @observable _focusedTable: Doc = this.props.Document; - @observable _col: any = ""; - @observable _menuWidth = 0; - @observable _headerOpen = false; - @observable _headerIsEditing = false; - @observable _menuHeight = 0; - @observable _pointerX = 0; - @observable _pointerY = 0; - @observable _openTypes: boolean = false; - - @computed get previewWidth() { return () => NumCast(this.props.Document.schemaPreviewWidth); } - @computed get previewHeight() { return () => this.props.PanelHeight() - 2 * this.borderWidth; } - @computed get tableWidth() { return this.props.PanelWidth() - 2 * this.borderWidth - Number(SCHEMA_DIVIDER_WIDTH) - this.previewWidth(); } - @computed get borderWidth() { return Number(COLLECTION_BORDER_WIDTH); } - @computed get scale() { return this.props.ScreenToLocalTransform().Scale; } - @computed get columns() { return Cast(this.props.Document._schemaHeaders, listSpec(SchemaHeaderField), []); } - set columns(columns: SchemaHeaderField[]) { this.props.Document._schemaHeaders = new List(columns); } - - @computed get menuCoordinates() { - let searchx = 0; - let searchy = 0; - if (this.props.Document._searchDoc) { - const el = document.getElementsByClassName("collectionSchemaView-searchContainer")[0]; - if (el !== undefined) { - const rect = el.getBoundingClientRect(); - searchx = rect.x; - searchy = rect.y; - } - } - const x = Math.max(0, Math.min(document.body.clientWidth - this._menuWidth, this._pointerX)) - searchx; - const y = Math.max(0, Math.min(document.body.clientHeight - this._menuHeight, this._pointerY)) - searchy; - return this.props.ScreenToLocalTransform().transformPoint(x, y); - } - - get documentKeys() { - const docs = this.childDocs; - const keys: { [key: string]: boolean } = {}; - // bcz: ugh. this is untracked since otherwise a large collection of documents will blast the server for all their fields. - // then as each document's fields come back, we update the documents _proxies. Each time we do this, the whole schema will be - // invalidated and re-rendered. This workaround will inquire all of the document fields before the options button is clicked. - // then by the time the options button is clicked, all of the fields should be in place. If a new field is added while this menu - // is displayed (unlikely) it won't show up until something else changes. - //TODO Types - untracked(() => docs.map(doc => Doc.GetAllPrototypes(doc).map(proto => Object.keys(proto).forEach(key => keys[key] = false)))); - - this.columns.forEach(key => keys[key.heading] = true); - return Array.from(Object.keys(keys)); - } - - @action setHeaderIsEditing = (isEditing: boolean) => this._headerIsEditing = isEditing; - - @undoBatch - setColumnType = action((columnField: SchemaHeaderField, type: ColumnType): void => { - this._openTypes = false; - if (columnTypes.get(columnField.heading)) return; - - const columns = this.columns; - const index = columns.indexOf(columnField); - if (index > -1) { - columnField.setType(NumCast(type)); - columns[index] = columnField; - this.columns = columns; - } - }); - - @undoBatch - setColumnColor = (columnField: SchemaHeaderField, color: string): void => { - const columns = this.columns; - const index = columns.indexOf(columnField); - if (index > -1) { - columnField.setColor(color); - columns[index] = columnField; - this.columns = columns; // need to set the columns to trigger rerender - } - } - - @undoBatch - @action - setColumnSort = (columnField: SchemaHeaderField, descending: boolean | undefined) => { - const columns = this.columns; - columns.forEach(col => col.setDesc(undefined)); - - const index = columns.findIndex(c => c.heading === columnField.heading); - const column = columns[index]; - column.setDesc(descending); - columns[index] = column; - this.columns = columns; - } - - renderTypes = (col: any) => { - if (columnTypes.get(col.heading)) return (null); - - const type = col.type; - - const anyType =
this.setColumnType(col, ColumnType.Any)}> - - Any -
; - - const numType =
this.setColumnType(col, ColumnType.Number)}> - - Number -
; - - const textType =
this.setColumnType(col, ColumnType.String)}> - - Text -
; - - const boolType =
this.setColumnType(col, ColumnType.Boolean)}> - - Checkbox -
; - - const listType =
this.setColumnType(col, ColumnType.List)}> - - List -
; - - const docType =
this.setColumnType(col, ColumnType.Doc)}> - - Document -
; - - const imageType =
this.setColumnType(col, ColumnType.Image)}> - - Image -
; - - const dateType =
this.setColumnType(col, ColumnType.Date)}> - - Date -
; - - - const allColumnTypes =
- {anyType} - {numType} - {textType} - {boolType} - {listType} - {docType} - {imageType} - {dateType} -
; - - const justColType = type === ColumnType.Any ? anyType : type === ColumnType.Number ? numType : - type === ColumnType.String ? textType : type === ColumnType.Boolean ? boolType : - type === ColumnType.List ? listType : type === ColumnType.Doc ? docType : - type === ColumnType.Date ? dateType : imageType; - - return ( -
this._openTypes = !this._openTypes)}> -
- - -
- {this._openTypes ? allColumnTypes : justColType} -
- ); - } - - renderSorting = (col: any) => { - const sort = col.desc; - return ( -
- -
-
this.setColumnSort(col, true)}> - - Sort descending -
-
this.setColumnSort(col, false)}> - - Sort ascending -
-
this.setColumnSort(col, undefined)}> - - Clear sorting -
-
-
- ); - } - - renderColors = (col: any) => { - const selected = col.color; - - const pink = PastelSchemaPalette.get("pink2"); - const purple = PastelSchemaPalette.get("purple2"); - const blue = PastelSchemaPalette.get("bluegreen1"); - const yellow = PastelSchemaPalette.get("yellow4"); - const red = PastelSchemaPalette.get("red2"); - const gray = "#f1efeb"; - - return ( -
- -
-
this.setColumnColor(col, pink!)}>
-
this.setColumnColor(col, purple!)}>
-
this.setColumnColor(col, blue!)}>
-
this.setColumnColor(col, yellow!)}>
-
this.setColumnColor(col, red!)}>
-
this.setColumnColor(col, gray)}>
-
-
- ); - } - - @undoBatch - @action - changeColumns = (oldKey: string, newKey: string, addNew: boolean, filter?: string) => { - const columns = this.columns; - if (columns === undefined) { - this.columns = new List([new SchemaHeaderField(newKey, "f1efeb")]); - } else { - if (addNew) { - columns.push(new SchemaHeaderField(newKey, "f1efeb")); - this.columns = columns; - } else { - const index = columns.map(c => c.heading).indexOf(oldKey); - if (index > -1) { - const column = columns[index]; - column.setHeading(newKey); - columns[index] = column; - this.columns = columns; - if (filter) { - Doc.setDocFilter(this.props.Document, newKey, filter, "match"); - } - else { - this.props.Document._docFilters = undefined; - } - } - } - } - } - - @action - openHeader = (col: any, screenx: number, screeny: number) => { - this._col = col; - this._headerOpen = true; - this._pointerX = screenx; - this._pointerY = screeny; - } - - @action - closeHeader = () => { this._headerOpen = false; } - - @undoBatch - @action - deleteColumn = (key: string) => { - const columns = this.columns; - if (columns === undefined) { - this.columns = new List([]); - } else { - const index = columns.map(c => c.heading).indexOf(key); - if (index > -1) { - columns.splice(index, 1); - this.columns = columns; - } - } - this.closeHeader(); - } - - getPreviewTransform = (): Transform => { - return this.props.ScreenToLocalTransform().translate(- this.borderWidth - NumCast(COLLECTION_BORDER_WIDTH) - this.tableWidth, - this.borderWidth); - } - - @action - onHeaderClick = (e: React.PointerEvent) => { - e.stopPropagation(); - } - - @action - onWheel(e: React.WheelEvent) { - const scale = this.props.ScreenToLocalTransform().Scale; - this.props.isContentActive(true) && e.stopPropagation(); - } - - @computed get renderMenuContent() { - TraceMobx(); - return
- {this.renderTypes(this._col)} - {this.renderColors(this._col)} -
- -
-
; - } - - private createTarget = (ele: HTMLDivElement) => { - this._previewCont = ele; - super.CreateDropTarget(ele); - } - - isFocused = (doc: Doc, outsideReaction: boolean): boolean => this.props.isSelected(outsideReaction) && doc === this._focusedTable; - - @action setFocused = (doc: Doc) => this._focusedTable = doc; - - @action setPreviewDoc = (doc: Opt) => { - SelectionManager.SelectSchemaView(this, doc); - this._previewDoc = doc; - } - - //toggles preview side-panel of schema - @action - toggleExpander = () => { - this.props.Document.schemaPreviewWidth = this.previewWidth() === 0 ? Math.min(this.tableWidth / 3, 200) : 0; - } - - onDividerDown = (e: React.PointerEvent) => { - setupMoveUpEvents(this, e, this.onDividerMove, emptyFunction, this.toggleExpander); - } - @action - onDividerMove = (e: PointerEvent, down: number[], delta: number[]) => { - const nativeWidth = this._previewCont!.getBoundingClientRect(); - const minWidth = 40; - const maxWidth = 1000; - const movedWidth = this.props.ScreenToLocalTransform().transformDirection(nativeWidth.right - e.clientX, 0)[0]; - const width = movedWidth < minWidth ? minWidth : movedWidth > maxWidth ? maxWidth : movedWidth; - this.props.Document.schemaPreviewWidth = width; - return false; - } - - onPointerDown = (e: React.PointerEvent): void => { - if (e.button === 0 && !e.altKey && !e.ctrlKey && !e.metaKey) { - if (this.props.isSelected(true)) e.stopPropagation(); - else this.props.select(false); - } - } - - @computed - get previewDocument(): Doc | undefined { return this._previewDoc; } - - @computed - get dividerDragger() { - return this.previewWidth() === 0 ? (null) : -
-
-
; - } - - @computed - get previewPanel() { - return
- {!this.previewDocument ? (null) : - } -
; - } - - @computed - get schemaTable() { - return ; - } - - @computed - public get schemaToolbar() { - return
-
-
- - Show Preview -
-
-
; - } - - onSpecificMenu = (e: React.MouseEvent) => { - if ((e.target as any)?.className?.includes?.("collectionSchemaView-cell") || (e.target instanceof HTMLSpanElement)) { - const cm = ContextMenu.Instance; - const options = cm.findByDescription("Options..."); - const optionItems: ContextMenuProps[] = options && "subitems" in options ? options.subitems : []; - optionItems.push({ description: "remove", event: () => this._previewDoc && this.props.removeDocument?.(this._previewDoc), icon: "trash" }); - !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "compass" }); - cm.displayMenu(e.clientX, e.clientY); - (e.nativeEvent as any).SchemaHandled = true; // not sure why this is needed, but if you right-click quickly on a cell, the Document/Collection contextMenu handlers still fire without this. - e.stopPropagation(); - } - } - - @action - onTableClick = (e: React.MouseEvent): void => { - if (!(e.target as any)?.className?.includes?.("collectionSchemaView-cell") && !(e.target instanceof HTMLSpanElement)) { - this.setPreviewDoc(undefined); - } else { - e.stopPropagation(); - } - this.setFocused(this.props.Document); - this.closeHeader(); - } - - onResizedChange = (newResized: Resize[], event: any) => { - const columns = this.columns; - newResized.forEach(resized => { - const index = columns.findIndex(c => c.heading === resized.id); - const column = columns[index]; - column.setWidth(resized.value); - columns[index] = column; - }); - this.columns = columns; - } - - @action - setColumns = (columns: SchemaHeaderField[]) => this.columns = columns - - @undoBatch - reorderColumns = (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columnsValues: SchemaHeaderField[]) => { - const columns = [...columnsValues]; - const oldIndex = columns.indexOf(toMove); - const relIndex = columns.indexOf(relativeTo); - const newIndex = (oldIndex > relIndex && !before) ? relIndex + 1 : (oldIndex < relIndex && before) ? relIndex - 1 : relIndex; - - if (oldIndex === newIndex) return; - - columns.splice(newIndex, 0, columns.splice(oldIndex, 1)[0]); - this.columns = columns; - } - - onZoomMenu = (e: React.WheelEvent) => this.props.isContentActive(true) && e.stopPropagation(); - - render() { - TraceMobx(); - if (!this.props.isContentActive()) setTimeout(() => this.closeHeader(), 0); - const menuContent = this.renderMenuContent; - const menu =
this.onZoomMenu(e)} - onPointerDown={e => this.onHeaderClick(e)} - style={{ transform: `translate(${(this.menuCoordinates[0])}px, ${(this.menuCoordinates[1])}px)` }}> - { - const dim = this.props.ScreenToLocalTransform().inverse().transformDirection(r.offset.width, r.offset.height); - this._menuWidth = dim[0]; this._menuHeight = dim[1]; - })}> - {({ measureRef }) =>
{menuContent}
} -
-
; - return
-
this.props.isContentActive(true) && e.stopPropagation()} - onDrop={e => this.onExternalDrop(e, {})} - ref={this.createTarget}> - {this.schemaTable} -
- {this.dividerDragger} - {!this.previewWidth() ? (null) : this.previewPanel} - {this._headerOpen && this.props.isContentActive() ? menu : null} -
; - } -} \ No newline at end of file diff --git a/src/client/views/collections/SchemaTable.tsx b/src/client/views/collections/SchemaTable.tsx deleted file mode 100644 index 0c69ee030..000000000 --- a/src/client/views/collections/SchemaTable.tsx +++ /dev/null @@ -1,599 +0,0 @@ -import React = require("react"); -import { IconProp } from '@fortawesome/fontawesome-svg-core'; -import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; -import { action, computed, observable } from "mobx"; -import { observer } from "mobx-react"; -import ReactTable, { CellInfo, Column, ComponentPropsGetterR, Resize, SortingRule } from "react-table"; -import "react-table/react-table.css"; -import { DateField } from "../../../fields/DateField"; -import { AclPrivate, AclReadonly, DataSym, Doc, DocListCast, Field, Opt } from "../../../fields/Doc"; -import { Id } from "../../../fields/FieldSymbols"; -import { List } from "../../../fields/List"; -import { listSpec } from "../../../fields/Schema"; -import { SchemaHeaderField } from "../../../fields/SchemaHeaderField"; -import { ComputedField } from "../../../fields/ScriptField"; -import { Cast, FieldValue, NumCast, StrCast } from "../../../fields/Types"; -import { ImageField } from "../../../fields/URLField"; -import { GetEffectiveAcl } from "../../../fields/util"; -import { emptyFunction, emptyPath, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from "../../../Utils"; -import { Docs, DocumentOptions, DocUtils } from "../../documents/Documents"; -import { DocumentType } from "../../documents/DocumentTypes"; -import { CompileScript, Transformer, ts } from "../../util/Scripting"; -import { Transform } from "../../util/Transform"; -import { undoBatch } from "../../util/UndoManager"; -import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/globalCssVariables.scss'; -import { ContextMenu } from "../ContextMenu"; -import '../DocumentDecorations.scss'; -import { DocumentView } from "../nodes/DocumentView"; -import { DefaultStyleProvider } from "../StyleProvider"; -import { CellProps, CollectionSchemaButtons, CollectionSchemaCell, CollectionSchemaCheckboxCell, CollectionSchemaDateCell, CollectionSchemaDocCell, CollectionSchemaImageCell, CollectionSchemaListCell, CollectionSchemaNumberCell, CollectionSchemaStringCell } from "./CollectionSchemaCells"; -import { CollectionSchemaAddColumnHeader, KeysDropdown } from "./CollectionSchemaHeaders"; -import { MovableColumn, MovableRow } from "./CollectionSchemaMovableTableHOC"; -import "./CollectionSchemaView.scss"; -import { CollectionView } from "./CollectionView"; - - -enum ColumnType { - Any, - Number, - String, - Boolean, - Doc, - Image, - List, - Date -} - -// this map should be used for keys that should have a const type of value -const columnTypes: Map = new Map([ - ["title", ColumnType.String], - ["x", ColumnType.Number], ["y", ColumnType.Number], ["_width", ColumnType.Number], ["_height", ColumnType.Number], - ["_nativeWidth", ColumnType.Number], ["_nativeHeight", ColumnType.Number], ["isPrototype", ColumnType.Boolean], - ["_curPage", ColumnType.Number], ["_currentTimecode", ColumnType.Number], ["zIndex", ColumnType.Number] -]); - -export interface SchemaTableProps { - Document: Doc; // child doc - dataDoc?: Doc; - PanelHeight: () => number; - PanelWidth: () => number; - childDocs?: Doc[]; - CollectionView: Opt; - ContainingCollectionView: Opt; - ContainingCollectionDoc: Opt; - fieldKey: string; - renderDepth: number; - deleteDocument?: (document: Doc | Doc[]) => boolean; - addDocument?: (document: Doc | Doc[]) => boolean; - moveDocument?: (document: Doc | Doc[], targetCollection: Doc | undefined, addDocument: (document: Doc | Doc[]) => boolean) => boolean; - ScreenToLocalTransform: () => Transform; - active: (outsideReaction: boolean | undefined) => boolean; - onDrop: (e: React.DragEvent, options: DocumentOptions, completed?: (() => void) | undefined) => void; - addDocTab: (document: Doc, where: string) => boolean; - pinToPres: (document: Doc) => void; - isSelected: (outsideReaction?: boolean) => boolean; - isFocused: (document: Doc, outsideReaction: boolean) => boolean; - setFocused: (document: Doc) => void; - setPreviewDoc: (document: Opt) => void; - columns: SchemaHeaderField[]; - documentKeys: any[]; - headerIsEditing: boolean; - openHeader: (column: any, screenx: number, screeny: number) => void; - onClick: (e: React.MouseEvent) => void; - onPointerDown: (e: React.PointerEvent) => void; - onResizedChange: (newResized: Resize[], event: any) => void; - setColumns: (columns: SchemaHeaderField[]) => void; - reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columnsValues: SchemaHeaderField[]) => void; - changeColumns: (oldKey: string, newKey: string, addNew: boolean) => void; - setHeaderIsEditing: (isEditing: boolean) => void; - changeColumnSort: (columnField: SchemaHeaderField, descending: boolean | undefined) => void; -} - -@observer -export class SchemaTable extends React.Component { - @observable _cellIsEditing: boolean = false; - @observable _focusedCell: { row: number, col: number } = { row: 0, col: 0 }; - @observable _openCollections: Set = new Set; - - @observable _showDoc: Doc | undefined; - @observable _showDataDoc: any = ""; - @observable _showDocPos: number[] = []; - - @observable _showTitleDropdown: boolean = false; - - @computed get previewWidth() { return () => NumCast(this.props.Document.schemaPreviewWidth); } - @computed get previewHeight() { return () => this.props.PanelHeight() - 2 * this.borderWidth; } - @computed get tableWidth() { return this.props.PanelWidth() - 2 * this.borderWidth - Number(SCHEMA_DIVIDER_WIDTH) - this.previewWidth(); } - - @computed get childDocs() { - if (this.props.childDocs) return this.props.childDocs; - - const doc = this.props.dataDoc ? this.props.dataDoc : this.props.Document; - return DocListCast(doc[this.props.fieldKey]); - } - set childDocs(docs: Doc[]) { - const doc = this.props.dataDoc ? this.props.dataDoc : this.props.Document; - doc[this.props.fieldKey] = new List(docs); - } - - @computed get textWrappedRows() { - return Cast(this.props.Document.textwrappedSchemaRows, listSpec("string"), []); - } - set textWrappedRows(textWrappedRows: string[]) { - this.props.Document.textwrappedSchemaRows = new List(textWrappedRows); - } - - @computed get resized(): { id: string, value: number }[] { - return this.props.columns.reduce((resized, shf) => { - (shf.width > -1) && resized.push({ id: shf.heading, value: shf.width }); - return resized; - }, [] as { id: string, value: number }[]); - } - @computed get sorted(): SortingRule[] { - return this.props.columns.reduce((sorted, shf) => { - shf.desc !== undefined && sorted.push({ id: shf.heading, desc: shf.desc }); - return sorted; - }, [] as SortingRule[]); - } - - @action - changeSorting = (col: any) => { - this.props.changeColumnSort(col, col.desc === true ? false : col.desc === false ? undefined : true); - } - - @action - changeTitleMode = () => this._showTitleDropdown = !this._showTitleDropdown - - @computed get borderWidth() { return Number(COLLECTION_BORDER_WIDTH); } - @computed get tableColumns(): Column[] { - const possibleKeys = this.props.documentKeys.filter(key => this.props.columns.findIndex(existingKey => existingKey.heading.toUpperCase() === key.toUpperCase()) === -1); - const columns: Column[] = []; - const tableIsFocused = this.props.isFocused(this.props.Document, false); - const focusedRow = this._focusedCell.row; - const focusedCol = this._focusedCell.col; - const isEditable = !this.props.headerIsEditing; - - columns.push({ - expander: true, Header: "", width: 58, - Expander: (rowInfo) => { - return rowInfo.original.type !== DocumentType.COL ? (null) : -
(this._openCollections[rowInfo.isExpanded ? "delete" : "add"])(rowInfo.viewIndex))}> - -
; - } - }); - columns.push(...this.props.columns.map(col => { - const icon: IconProp = this.getColumnType(col) === ColumnType.Number ? "hashtag" : this.getColumnType(col) === ColumnType.String ? "font" : - this.getColumnType(col) === ColumnType.Boolean ? "check-square" : this.getColumnType(col) === ColumnType.Doc ? "file" : - this.getColumnType(col) === ColumnType.Image ? "image" : this.getColumnType(col) === ColumnType.List ? "list-ul" : - this.getColumnType(col) === ColumnType.Date ? "calendar" : "align-justify"; - - const keysDropdown = c.heading)} - canAddNew={true} - addNew={false} - onSelect={this.props.changeColumns} - setIsEditing={this.props.setHeaderIsEditing} - docs={this.props.childDocs} - Document={this.props.Document} - dataDoc={this.props.dataDoc} - fieldKey={this.props.fieldKey} - ContainingCollectionDoc={this.props.ContainingCollectionDoc} - ContainingCollectionView={this.props.ContainingCollectionView} - active={this.props.active} - openHeader={this.props.openHeader} - icon={icon} - col={col} - // try commenting this out - width={"100%"} - />; - - const sortIcon = col.desc === undefined ? "caret-right" : col.desc === true ? "caret-down" : "caret-up"; - const header =
- {keysDropdown} -
this.changeSorting(col)} style={{ width: 21, padding: 1, display: "inline", zIndex: 1, background: "inherit", cursor: "hand" }}> - -
-
; - - return { - Header: , - accessor: (doc: Doc) => doc ? Field.toString(doc[col.heading] as Field) : 0, - id: col.heading, - Cell: (rowProps: CellInfo) => { - const rowIndex = rowProps.index; - const columnIndex = this.props.columns.map(c => c.heading).indexOf(rowProps.column.id!); - const isFocused = focusedRow === rowIndex && focusedCol === columnIndex && tableIsFocused; - - const props: CellProps = { - row: rowIndex, - col: columnIndex, - rowProps: rowProps, - isFocused: isFocused, - changeFocusedCellByIndex: this.changeFocusedCellByIndex, - CollectionView: this.props.CollectionView, - ContainingCollection: this.props.ContainingCollectionView, - Document: this.props.Document, - fieldKey: this.props.fieldKey, - renderDepth: this.props.renderDepth, - addDocTab: this.props.addDocTab, - pinToPres: this.props.pinToPres, - moveDocument: this.props.moveDocument, - setIsEditing: this.setCellIsEditing, - isEditable: isEditable, - setPreviewDoc: this.props.setPreviewDoc, - setComputed: this.setComputed, - getField: this.getField, - showDoc: this.showDoc, - }; - - - switch (this.getColumnType(col, rowProps.original, rowProps.column.id)) { - case ColumnType.Number: return ; - case ColumnType.String: return ; - case ColumnType.Boolean: return ; - case ColumnType.Doc: return ; - case ColumnType.Image: return ; - case ColumnType.List: return ; - case ColumnType.Date: return ; - default: - return ; - } - }, - minWidth: 200, - }; - })); - columns.push({ - Header: , - accessor: (doc: Doc) => 0, - id: "add", - Cell: (rowProps: CellInfo) => { - const rowIndex = rowProps.index; - const columnIndex = this.props.columns.map(c => c.heading).indexOf(rowProps.column.id!); - const isFocused = focusedRow === rowIndex && focusedCol === columnIndex && tableIsFocused; - return ; - }, - width: 28, - resizable: false - }); - return columns; - } - - - constructor(props: SchemaTableProps) { - super(props); - if (this.props.Document._schemaHeaders === undefined) { - this.props.Document._schemaHeaders = new List([new SchemaHeaderField("title", "#f1efeb"), new SchemaHeaderField("author", "#f1efeb"), new SchemaHeaderField("*lastModified", "#f1efeb", ColumnType.Date), - new SchemaHeaderField("text", "#f1efeb", ColumnType.String), new SchemaHeaderField("type", "#f1efeb"), new SchemaHeaderField("context", "#f1efeb", ColumnType.Doc)]); - } - } - - componentDidMount() { - document.addEventListener("keydown", this.onKeyDown); - } - - componentWillUnmount() { - document.removeEventListener("keydown", this.onKeyDown); - } - - tableAddDoc = (doc: Doc, relativeTo?: Doc, before?: boolean) => { - const tableDoc = this.props.Document[DataSym]; - const effectiveAcl = GetEffectiveAcl(tableDoc); - - if (effectiveAcl !== AclPrivate && effectiveAcl !== AclReadonly) { - doc.context = this.props.Document; - tableDoc[this.props.fieldKey + "-lastModified"] = new DateField(new Date(Date.now())); - return Doc.AddDocToList(this.props.Document, this.props.fieldKey, doc, relativeTo, before); - } - return false; - } - - private getTrProps: ComponentPropsGetterR = (state, rowInfo) => { - return !rowInfo ? {} : { - ScreenToLocalTransform: this.props.ScreenToLocalTransform, - addDoc: this.tableAddDoc, - removeDoc: this.props.deleteDocument, - rowInfo, - rowFocused: !this.props.headerIsEditing && rowInfo.index === this._focusedCell.row && this.props.isFocused(this.props.Document, true), - textWrapRow: this.toggleTextWrapRow, - rowWrapped: this.textWrappedRows.findIndex(id => rowInfo.original[Id] === id) > -1, - dropAction: StrCast(this.props.Document.childDropAction), - addDocTab: this.props.addDocTab - }; - } - - private getTdProps: ComponentPropsGetterR = (state, rowInfo, column, instance) => { - if (!rowInfo || column) return {}; - - const row = rowInfo.index; - //@ts-ignore - const col = this.columns.map(c => c.heading).indexOf(column!.id); - const isFocused = this._focusedCell.row === row && this._focusedCell.col === col && this.props.isFocused(this.props.Document, true); - // TODO: editing border doesn't work :( - return { - style: { border: !this.props.headerIsEditing && isFocused ? "2px solid rgb(255, 160, 160)" : "1px solid #f1efeb" } - }; - } - - @action setCellIsEditing = (isEditing: boolean) => this._cellIsEditing = isEditing; - - @action - onKeyDown = (e: KeyboardEvent): void => { - if (!this._cellIsEditing && !this.props.headerIsEditing && this.props.isFocused(this.props.Document, true)) {// && this.props.isSelected(true)) { - const direction = e.key === "Tab" ? "tab" : e.which === 39 ? "right" : e.which === 37 ? "left" : e.which === 38 ? "up" : e.which === 40 ? "down" : ""; - this._focusedCell = this.changeFocusedCellByDirection(direction, this._focusedCell.row, this._focusedCell.col); - - if (direction) { - const pdoc = FieldValue(this.childDocs[this._focusedCell.row]); - pdoc && this.props.setPreviewDoc(pdoc); - e.stopPropagation(); - } - } else if (e.keyCode === 27) { - this.props.setPreviewDoc(undefined); - e.stopPropagation(); // stopPropagation for left/right arrows - } - } - - changeFocusedCellByDirection = (direction: string, curRow: number, curCol: number) => { - switch (direction) { - case "tab": return { row: (curRow + 1 === this.childDocs.length ? 0 : curRow + 1), col: curCol + 1 === this.props.columns.length ? 0 : curCol + 1 }; - case "right": return { row: curRow, col: curCol + 1 === this.props.columns.length ? curCol : curCol + 1 }; - case "left": return { row: curRow, col: curCol === 0 ? curCol : curCol - 1 }; - case "up": return { row: curRow === 0 ? curRow : curRow - 1, col: curCol }; - case "down": return { row: curRow + 1 === this.childDocs.length ? curRow : curRow + 1, col: curCol }; - } - return this._focusedCell; - } - - @action - changeFocusedCellByIndex = (row: number, col: number): void => { - if (this._focusedCell.row !== row || this._focusedCell.col !== col) { - this._focusedCell = { row: row, col: col }; - } - this.props.setFocused(this.props.Document); - } - - @undoBatch - createRow = action(() => { - this.props.addDocument?.(Docs.Create.TextDocument("", { title: "", _width: 100, _height: 30 })); - this._focusedCell = { row: this.childDocs.length, col: this._focusedCell.col }; - }); - - @undoBatch - @action - createColumn = () => { - let index = 0; - let found = this.props.columns.findIndex(col => col.heading.toUpperCase() === "New field".toUpperCase()) > -1; - while (found) { - index++; - found = this.props.columns.findIndex(col => col.heading.toUpperCase() === ("New field (" + index + ")").toUpperCase()) > -1; - } - this.props.columns.push(new SchemaHeaderField(`New field ${index ? "(" + index + ")" : ""}`, "#f1efeb")); - } - - @action - getColumnType = (column: SchemaHeaderField, doc?: Doc, field?: string): ColumnType => { - if (doc && field && column.type === ColumnType.Any) { - const val = doc[CollectionSchemaCell.resolvedFieldKey(field, doc)]; - if (val instanceof ImageField) return ColumnType.Image; - if (val instanceof Doc) return ColumnType.Doc; - if (val instanceof DateField) return ColumnType.Date; - if (val instanceof List) return ColumnType.List; - } - if (column.type && column.type !== 0) { - return column.type; - } - if (columnTypes.get(column.heading)) { - return column.type = columnTypes.get(column.heading)!; - } - return column.type = ColumnType.Any; - } - - @undoBatch - @action - toggleTextwrap = async () => { - const textwrappedRows = Cast(this.props.Document.textwrappedSchemaRows, listSpec("string"), []); - if (textwrappedRows.length) { - this.props.Document.textwrappedSchemaRows = new List([]); - } else { - const docs = DocListCast(this.props.Document[this.props.fieldKey]); - const allRows = docs instanceof Doc ? [docs[Id]] : docs.map(doc => doc[Id]); - this.props.Document.textwrappedSchemaRows = new List(allRows); - } - } - - @action - toggleTextWrapRow = (doc: Doc): void => { - const textWrapped = this.textWrappedRows; - const index = textWrapped.findIndex(id => doc[Id] === id); - - index > -1 ? textWrapped.splice(index, 1) : textWrapped.push(doc[Id]); - - this.textWrappedRows = textWrapped; - } - - @computed - get reactTable() { - const children = this.childDocs; - const hasCollectionChild = children.reduce((found, doc) => found || doc.type === DocumentType.COL, false); - const expanded: { [name: string]: any } = {}; - Array.from(this._openCollections.keys()).map(col => expanded[col.toString()] = true); - const rerender = [...this.textWrappedRows]; // TODO: get component to rerender on text wrap change without needign to console.log :(((( - - return (row.original.type !== DocumentType.COL) ? (null) : -
} - - />; - } - - onContextMenu = (e: React.MouseEvent): void => { - ContextMenu.Instance.addItem({ description: "Toggle text wrapping", event: this.toggleTextwrap, icon: "table" }); - } - - getField = (row: number, col?: number) => { - const docs = this.childDocs; - - row = row % docs.length; - while (row < 0) row += docs.length; - const columns = this.props.columns; - const doc = docs[row]; - if (col === undefined) { - return doc; - } - if (col >= 0 && col < columns.length) { - const column = this.props.columns[col].heading; - return doc[column]; - } - return undefined; - } - - createTransformer = (row: number, col: number): Transformer => { - const self = this; - const captures: { [name: string]: Field } = {}; - - const transformer: ts.TransformerFactory = context => { - return root => { - function visit(node: ts.Node) { - node = ts.visitEachChild(node, visit, context); - if (ts.isIdentifier(node)) { - const isntPropAccess = !ts.isPropertyAccessExpression(node.parent) || node.parent.expression === node; - const isntPropAssign = !ts.isPropertyAssignment(node.parent) || node.parent.name !== node; - if (isntPropAccess && isntPropAssign) { - if (node.text === "$r") { - return ts.createNumericLiteral(row.toString()); - } else if (node.text === "$c") { - return ts.createNumericLiteral(col.toString()); - } else if (node.text === "$") { - if (ts.isCallExpression(node.parent)) { - // captures.doc = self.props.Document; - // captures.key = self.props.fieldKey; - } - } - } - } - - return node; - } - return ts.visitNode(root, visit); - }; - }; - - // const getVars = () => { - // return { capturedVariables: captures }; - // }; - - return { transformer, /*getVars*/ }; - } - - setComputed = (script: string, doc: Doc, field: string, row: number, col: number): boolean => { - script = - `const $ = (row:number, col?:number) => { - const rval = (doc as any)[key][row + ${row}]; - return col === undefined ? rval : rval[(doc as any)._schemaHeaders[col + ${col}].heading]; - } - return ${script}`; - const compiled = CompileScript(script, { params: { this: Doc.name }, capturedVariables: { doc: this.props.Document, key: this.props.fieldKey }, typecheck: false, transformer: this.createTransformer(row, col) }); - if (compiled.compiled) { - doc[field] = new ComputedField(compiled); - return true; - } - return false; - } - - @action - showDoc = (doc: Doc | undefined, dataDoc?: Doc, screenX?: number, screenY?: number) => { - this._showDoc = doc; - if (dataDoc && screenX && screenY) { - this._showDocPos = this.props.ScreenToLocalTransform().transformPoint(screenX, screenY); - } - } - - onOpenClick = () => { - this._showDoc && this.props.addDocTab(this._showDoc, "add:right"); - } - - getPreviewTransform = (): Transform => { - return this.props.ScreenToLocalTransform().translate(- this.borderWidth - 4 - this.tableWidth, - this.borderWidth); - } - - render() { - const preview = ""; - return
this.props.active(true) && e.stopPropagation()} - onDrop={e => this.props.onDrop(e, {})} onContextMenu={this.onContextMenu} > - {this.reactTable} - {this.props.Document._chromeHidden ? undefined :
+ new
} - {!this._showDoc ? (null) : -
- 150} - PanelHeight={() => 150} - ScreenToLocalTransform={this.getPreviewTransform} - docFilters={returnEmptyFilter} - docRangeFilters={returnEmptyFilter} - searchFilterDocs={returnEmptyDoclist} - ContainingCollectionDoc={this.props.CollectionView?.props.Document} - ContainingCollectionView={this.props.CollectionView} - moveDocument={this.props.moveDocument} - whenChildContentsActiveChanged={emptyFunction} - addDocTab={this.props.addDocTab} - pinToPres={this.props.pinToPres} - bringToFront={returnFalse}> - -
} -
; - } -} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/CollectionSchemaCells.tsx b/src/client/views/collections/schemaView/CollectionSchemaCells.tsx new file mode 100644 index 000000000..2549beaae --- /dev/null +++ b/src/client/views/collections/schemaView/CollectionSchemaCells.tsx @@ -0,0 +1,584 @@ +import React = require("react"); +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { action, computed, observable } from "mobx"; +import { observer } from "mobx-react"; +import DatePicker from "react-datepicker"; +import "react-datepicker/dist/react-datepicker.css"; +import { CellInfo } from "react-table"; +import "react-table/react-table.css"; +import { DateField } from "../../../../fields/DateField"; +import { Doc, DocListCast, Field, Opt } from "../../../../fields/Doc"; +import { Id } from "../../../../fields/FieldSymbols"; +import { List } from "../../../../fields/List"; +import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; +import { ComputedField } from "../../../../fields/ScriptField"; +import { BoolCast, Cast, DateCast, FieldValue, NumCast, StrCast } from "../../../../fields/Types"; +import { ImageField } from "../../../../fields/URLField"; +import { Utils, emptyFunction } from "../../../../Utils"; +import { Docs } from "../../../documents/Documents"; +import { DocumentType } from "../../../documents/DocumentTypes"; +import { DocumentManager } from "../../../util/DocumentManager"; +import { DragManager } from "../../../util/DragManager"; +import { KeyCodes } from "../../../util/KeyCodes"; +import { CompileScript } from "../../../util/Scripting"; +import { SearchUtil } from "../../../util/SearchUtil"; +import { SnappingManager } from "../../../util/SnappingManager"; +import { undoBatch } from "../../../util/UndoManager"; +import '../DocumentDecorations.scss'; +import { EditableView } from "../../EditableView"; +import { MAX_ROW_HEIGHT } from '../../globalCssVariables.scss'; +import { DocumentIconContainer } from "../../nodes/DocumentIcon"; +import { OverlayView } from "../../OverlayView"; +import "./CollectionSchemaView.scss"; +import { CollectionView } from "../CollectionView"; +const path = require('path'); + +export interface CellProps { + row: number; + col: number; + rowProps: CellInfo; + CollectionView: Opt; + ContainingCollection: Opt; + Document: Doc; + fieldKey: string; + renderDepth: number; + addDocTab: (document: Doc, where: string) => boolean; + pinToPres: (document: Doc) => void; + moveDocument?: (document: Doc | Doc[], targetCollection: Doc | undefined, + addDocument: (document: Doc | Doc[]) => boolean) => boolean; + isFocused: boolean; + changeFocusedCellByIndex: (row: number, col: number) => void; + setIsEditing: (isEditing: boolean) => void; + isEditable: boolean; + setPreviewDoc: (doc: Doc) => void; + setComputed: (script: string, doc: Doc, field: string, row: number, col: number) => boolean; + getField: (row: number, col?: number) => void; + showDoc: (doc: Doc | undefined, dataDoc?: any, screenX?: number, screenY?: number) => void; +} + +@observer +export class CollectionSchemaCell extends React.Component { + public static resolvedFieldKey(column: string, rowDoc: Doc) { + const fieldKey = column; + if (fieldKey.startsWith("*")) { + const rootKey = fieldKey.substring(1); + const allKeys = [...Array.from(Object.keys(rowDoc)), ...Array.from(Object.keys(Doc.GetProto(rowDoc)))]; + const matchedKeys = allKeys.filter(key => key.includes(rootKey)); + if (matchedKeys.length) return matchedKeys[0]; + } + return fieldKey; + } + @observable protected _isEditing: boolean = false; + protected _focusRef = React.createRef(); + protected _rowDoc = this.props.rowProps.original; + protected _rowDataDoc = Doc.GetProto(this.props.rowProps.original); + protected _dropDisposer?: DragManager.DragDropDisposer; + @observable contents: string = ""; + + componentDidMount() { document.addEventListener("keydown", this.onKeyDown); } + componentWillUnmount() { document.removeEventListener("keydown", this.onKeyDown); } + + @action + onKeyDown = (e: KeyboardEvent): void => { + if (this.props.isFocused && this.props.isEditable && e.keyCode === KeyCodes.ENTER) { + document.removeEventListener("keydown", this.onKeyDown); + this._isEditing = true; + this.props.setIsEditing(true); + } + } + + @action + isEditingCallback = (isEditing: boolean): void => { + document.removeEventListener("keydown", this.onKeyDown); + isEditing && document.addEventListener("keydown", this.onKeyDown); + this._isEditing = isEditing; + this.props.setIsEditing(isEditing); + this.props.changeFocusedCellByIndex(this.props.row, this.props.col); + } + + @action + onPointerDown = async (e: React.PointerEvent): Promise => { + this.onItemDown(e); + this.props.changeFocusedCellByIndex(this.props.row, this.props.col); + this.props.setPreviewDoc(this.props.rowProps.original); + + let url: string; + if (url = StrCast(this.props.rowProps.row.href)) { + try { + new URL(url); + const temp = window.open(url)!; + temp.blur(); + window.focus(); + } catch { } + } + + const doc = Cast(this._rowDoc[this.renderFieldKey], Doc, null); + doc && this.props.setPreviewDoc(doc); + } + + @undoBatch + applyToDoc = (doc: Doc, row: number, col: number, run: (args?: { [name: string]: any }) => any) => { + const res = run({ this: doc, $r: row, $c: col, $: (r: number = 0, c: number = 0) => this.props.getField(r + row, c + col) }); + if (!res.success) return false; + doc[this.renderFieldKey] = res.result; + return true; + } + + private drop = (e: Event, de: DragManager.DropEvent) => { + if (de.complete.docDragData) { + if (de.complete.docDragData.draggedDocuments.length === 1) { + this._rowDataDoc[this.renderFieldKey] = de.complete.docDragData.draggedDocuments[0]; + } + else { + const coll = Docs.Create.SchemaDocument([new SchemaHeaderField("title", "#f1efeb")], de.complete.docDragData.draggedDocuments, {}); + this._rowDataDoc[this.renderFieldKey] = coll; + } + e.stopPropagation(); + } + } + + protected dropRef = (ele: HTMLElement | null) => { + this._dropDisposer?.(); + ele && (this._dropDisposer = DragManager.MakeDropTarget(ele, this.drop.bind(this))); + } + + returnHighlights(contents: string, positions?: number[]) { + if (positions) { + const results = []; + StrCast(this.props.Document._searchString); + const length = StrCast(this.props.Document._searchString).length; + const color = contents ? "black" : "grey"; + + results.push({contents?.slice(0, positions[0])}); + positions.forEach((num, cur) => { + results.push({contents?.slice(num, num + length)}); + let end = 0; + cur === positions.length - 1 ? end = contents.length : end = positions[cur + 1]; + results.push({contents?.slice(num + length, end)}); + } + ); + return results; + } + return {contents ? contents?.valueOf() : "undefined"}; + } + + @computed get renderFieldKey() { return CollectionSchemaCell.resolvedFieldKey(this.props.rowProps.column.id!, this.props.rowProps.original); } + onItemDown = async (e: React.PointerEvent) => { + if (this.props.Document._searchDoc) { + const aliasdoc = await SearchUtil.GetAliasesOfDocument(this._rowDataDoc); + const targetContext = aliasdoc.length <= 0 ? undefined : Cast(aliasdoc[0].context, Doc, null); + DocumentManager.Instance.jumpToDocument(this._rowDoc, false, emptyFunction, targetContext, + undefined, undefined, undefined, () => this.props.setPreviewDoc(this._rowDoc)); + } + } + renderCellWithType(type: string | undefined) { + const dragRef: React.RefObject = React.createRef(); + + const fieldKey = this.renderFieldKey; + const field = this._rowDoc[fieldKey]; + + const onPointerEnter = (e: React.PointerEvent): void => { + if (e.buttons === 1 && SnappingManager.GetIsDragging() && (type === "document" || type === undefined)) { + dragRef.current!.className = "collectionSchemaView-cellContainer doc-drag-over"; + } + }; + const onPointerLeave = (e: React.PointerEvent): void => { + dragRef.current!.className = "collectionSchemaView-cellContainer"; + }; + + let contents = Field.toString(field as Field); + contents = contents === "" ? "--" : contents; + + let className = "collectionSchemaView-cellWrapper"; + if (this._isEditing) className += " editing"; + if (this.props.isFocused && this.props.isEditable) className += " focused"; + if (this.props.isFocused && !this.props.isEditable) className += " inactive"; + + const positions = []; + if (StrCast(this.props.Document._searchString).toLowerCase() !== "") { + let term = (field instanceof Promise) ? "...promise pending..." : contents.toLowerCase(); + const search = StrCast(this.props.Document._searchString).toLowerCase(); + let start = term.indexOf(search); + let tally = 0; + if (start !== -1) { + positions.push(start); + } + while (start < contents?.length && start !== -1) { + term = term.slice(start + search.length + 1); + tally += start + search.length + 1; + start = term.indexOf(search); + positions.push(tally + start); + } + if (positions.length > 1) { + positions.pop(); + } + } + const placeholder = type === "number" ? "0" : contents === "" ? "--" : "undefined"; + return ( +
this._isEditing = true)} onPointerEnter={onPointerEnter} onPointerLeave={onPointerLeave}> +
+
+ {!this.props.Document._searchDoc ? + { + const cfield = ComputedField.WithoutComputed(() => FieldValue(field)); + const cscript = cfield instanceof ComputedField ? cfield.script.originalScript : undefined; + const cfinalScript = cscript?.split("return")[cscript.split("return").length - 1]; + return cscript ? (cfinalScript?.endsWith(";") ? `:=${cfinalScript?.substring(0, cfinalScript.length - 2)}` : cfinalScript) : + Field.IsField(cfield) ? Field.toScriptString(cfield) : ""; + }} + SetValue={action((value: string) => { + // sets what is displayed after the user makes an input + let retVal = false; + if (value.startsWith(":=") || value.startsWith("=:=")) { + // decides how to compute a value when given either of the above strings + const script = value.substring(value.startsWith("=:=") ? 3 : 2); + retVal = this.props.setComputed(script, value.startsWith(":=") ? this._rowDataDoc : this._rowDoc, this.renderFieldKey, this.props.row, this.props.col); + } else { + // check if the input is a number + let inputIsNum = true; + for (let s of value) { + if (isNaN(parseInt(s))) { + inputIsNum = false; + } + } + // check if the input is a boolean + let inputIsBool: boolean = value == "false" || value == "true"; + // what to do in the case + if (!inputIsNum && !inputIsBool && !value.startsWith("=")) { + // if it's not a number, it's a string, and should be processed as such + // strips the string of quotes when it is edited to prevent quotes form being added to the text automatically + // after each edit + let valueSansQuotes = value; + if (this._isEditing) { + const vsqLength = valueSansQuotes.length; + // get rid of outer quotes + valueSansQuotes = valueSansQuotes.substring(value.startsWith("\"") ? 1 : 0, + valueSansQuotes.charAt(vsqLength - 1) == "\"" ? vsqLength - 1 : vsqLength); + } + let inputAsString = '"'; + // escape any quotes in the string + for (const i of valueSansQuotes) { + if (i == '"') { + inputAsString += '\\"'; + } else { + inputAsString += i; + } + } + // add a closing quote + inputAsString += '"'; + //two options here: we can strip off outer quotes or we can figure out what's going on with the script + const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); + const changeMade = inputAsString.length !== value.length || inputAsString.length - 2 !== value.length + script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + // handle numbers and expressions + } else if (inputIsNum || value.startsWith("=")) { + //TODO: make accept numbers + const inputscript = value.substring(value.startsWith("=") ? 1 : 0); + // if commas are not stripped, the parser only considers the numbers after the last comma + let inputSansCommas = ""; + for (let s of inputscript) { + if (!(s == ",")) { + inputSansCommas += s; + } + } + const script = CompileScript(inputSansCommas, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); + const changeMade = value.length !== value.length || value.length - 2 !== value.length + script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + // handle booleans + } else if (inputIsBool) { + const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); + const changeMade = value.length !== value.length || value.length - 2 !== value.length + script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + } + } + if (retVal) { + this._isEditing = false; // need to set this here. otherwise, the assignment of the field will invalidate & cause render() to be called with the wrong value for 'editing' + this.props.setIsEditing(false); + } + return retVal; + })} + OnFillDown={async (value: string) => { + const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); + script.compiled && DocListCast(this.props.Document[this.props.fieldKey]). + forEach((doc, i) => value.startsWith(":=") ? + this.props.setComputed(value.substring(2), Doc.GetProto(doc), this.renderFieldKey, i, this.props.col) : + this.applyToDoc(Doc.GetProto(doc), i, this.props.col, script.run)); + }} + /> + : + this.returnHighlights(contents, positions) + } +
+
+
+ ); + } + + render() { return this.renderCellWithType(undefined); } +} + +@observer +export class CollectionSchemaNumberCell extends CollectionSchemaCell { render() { return this.renderCellWithType("number"); } } + +@observer +export class CollectionSchemaBooleanCell extends CollectionSchemaCell { render() { return this.renderCellWithType("boolean"); } } + +@observer +export class CollectionSchemaStringCell extends CollectionSchemaCell { render() { return this.renderCellWithType("string"); } } + +@observer +export class CollectionSchemaDateCell extends CollectionSchemaCell { + @computed get _date(): Opt { return this._rowDoc[this.renderFieldKey] instanceof DateField ? DateCast(this._rowDoc[this.renderFieldKey]) : undefined; } + + @action + handleChange = (date: any) => { + // const script = CompileScript(date.toString(), { requiredType: "Date", addReturn: true, params: { this: Doc.name } }); + // if (script.compiled) { + // this.applyToDoc(this._document, this.props.row, this.props.col, script.run); + // } else { + // ^ DateCast is always undefined for some reason, but that is what the field should be set to + this._rowDoc[this.renderFieldKey] = new DateField(date as Date); + //} + } + + render() { + return !this.props.isFocused ? {this._date ? Field.toString(this._date as Field) : "--"} : + this.handleChange(date)} + onChange={date => this.handleChange(date)} + />; + } +} + +@observer +export class CollectionSchemaDocCell extends CollectionSchemaCell { + + _overlayDisposer?: () => void; + + @computed get _doc() { return FieldValue(Cast(this._rowDoc[this.renderFieldKey], Doc)); } + + @action + onSetValue = (value: string) => { + this._doc && (Doc.GetProto(this._doc).title = value); + + const script = CompileScript(value, { + addReturn: true, + typecheck: false, + transformer: DocumentIconContainer.getTransformer() + }); + + const results = script.compiled && script.run(); + if (results && results.success) { + this._rowDoc[this.renderFieldKey] = results.result; + return true; + } + return false; + } + + componentWillUnmount() { this.onBlur(); } + + onBlur = () => { this._overlayDisposer?.(); }; + onFocus = () => { + this.onBlur(); + this._overlayDisposer = OverlayView.Instance.addElement(, { x: 0, y: 0 }); + } + + @action + isEditingCallback = (isEditing: boolean): void => { + document.removeEventListener("keydown", this.onKeyDown); + isEditing && document.addEventListener("keydown", this.onKeyDown); + this._isEditing = isEditing; + this.props.setIsEditing(isEditing); + this.props.changeFocusedCellByIndex(this.props.row, this.props.col); + } + + render() { + return !this._doc ? this.renderCellWithType("document") : +
+
+ StrCast(this._doc?.title)} + SetValue={action((value: string) => { + this.onSetValue(value); + return true; + })} + /> +
+
this._doc && this.props.addDocTab(this._doc, "add:right")} className="collectionSchemaView-cellContents-docButton"> + +
+
; + } +} + +@observer +export class CollectionSchemaImageCell extends CollectionSchemaCell { + + choosePath(url: URL) { + if (url.protocol === "data") return url.href; + if (url.href.indexOf(window.location.origin) === -1) return Utils.CorsProxy(url.href); + if (!/\.(png|jpg|jpeg|gif|webp)$/.test(url.href.toLowerCase())) return url.href;//Why is this here + + const ext = path.extname(url.href); + return url.href.replace(ext, "_o" + path.extname(url.href)); + } + + render() { + const field = Cast(this._rowDoc[this.renderFieldKey], ImageField, null); // retrieve the primary image URL that is being rendered from the data doc + const alts = DocListCast(this._rowDoc[this.renderFieldKey + "-alternates"]); // retrieve alternate documents that may be rendered as alternate images + const altpaths = alts.map(doc => Cast(doc[Doc.LayoutFieldKey(doc)], ImageField, null)?.url).filter(url => url).map(url => this.choosePath(url)); // access the primary layout data of the alternate documents + const paths = field ? [this.choosePath(field.url), ...altpaths] : altpaths; + const url = paths.length ? paths : [Utils.CorsProxy("http://www.cs.brown.edu/~bcz/noImage.png")]; + + const aspect = Doc.NativeAspect(this._rowDoc); + let width = Math.min(75, this.props.rowProps.width); + const height = Math.min(75, width / aspect); + width = height * aspect; + + const reference = React.createRef(); + return
+
+ +
+
; + } +} + + +@observer +export class CollectionSchemaListCell extends CollectionSchemaCell { + _overlayDisposer?: () => void; + + @computed get _field() { return this._rowDoc[this.renderFieldKey]; } + @computed get _optionsList() { return this._field as List; } + @observable private _opened = false; + @observable private _text = "select an item"; + @observable private _selectedNum = 0; + + @action + onSetValue = (value: string) => { + // change if its a document + this._optionsList[this._selectedNum] = this._text = value; + + (this._field as List).splice(this._selectedNum, 1, value); + } + + @action + onSelected = (element: string, index: number) => { + this._text = element; + this._selectedNum = index; + } + + onFocus = () => { + this._overlayDisposer?.(); + this._overlayDisposer = OverlayView.Instance.addElement(, { x: 0, y: 0 }); + } + + render() { + const link = false; + const reference = React.createRef(); + + if (this._optionsList?.length) { + const options = !this._opened ? (null) : +
+ {this._optionsList.map((element, index) => { + const val = Field.toString(element); + return
this.onSelected(StrCast(element), index)} > + {val} +
; + })} +
; + + const plainText =
{this._text}
; + const textarea =
+ this._text} + SetValue={action((value: string) => { + // add special for params + this.onSetValue(value); + return true; + })} + /> +
; + + //☰ + return ( +
+
+
+ +
{link ? plainText : textarea}
+
+ {options} +
+
+ ); + } + return this.renderCellWithType("list"); + } +} + + +@observer +export class CollectionSchemaCheckboxCell extends CollectionSchemaCell { + @computed get _isChecked() { return BoolCast(this._rowDoc[this.renderFieldKey]); } + + render() { + const reference = React.createRef(); + return ( +
+ this._rowDoc[this.renderFieldKey] = e.target.checked} /> +
+ ); + } +} + + +@observer +export class CollectionSchemaButtons extends CollectionSchemaCell { + render() { + return !this.props.Document._searchDoc || ![DocumentType.PDF, DocumentType.RTF].includes(StrCast(this._rowDoc.type) as DocumentType) ? <> : +
+ + +
; + } +} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx b/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx new file mode 100644 index 000000000..b825d6d96 --- /dev/null +++ b/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx @@ -0,0 +1,518 @@ +import React = require("react"); +import { IconProp, library } from "@fortawesome/fontawesome-svg-core"; +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { action, computed, observable, runInAction } from "mobx"; +import { observer } from "mobx-react"; +import { Doc, DocListCast, Opt } from "../../../../fields/Doc"; +import { listSpec } from "../../../../fields/Schema"; +import { PastelSchemaPalette, SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; +import { ScriptField } from "../../../../fields/ScriptField"; +import { Cast, StrCast } from "../../../../fields/Types"; +import { undoBatch } from "../../../util/UndoManager"; +import { SearchBox } from "../../search/SearchBox"; +import { ColumnType } from "../CollectionSchemaView"; +import "./CollectionSchemaView.scss"; +import { CollectionView } from "../CollectionView"; + +const higflyout = require("@hig/flyout"); +export const { anchorPoints } = higflyout; +export const Flyout = higflyout.default; + + +export interface AddColumnHeaderProps { + createColumn: () => void; +} + +@observer +export class CollectionSchemaAddColumnHeader extends React.Component { + render() { + return ( + + ); + } +} + + +export interface ColumnMenuProps { + columnField: SchemaHeaderField; + // keyValue: string; + possibleKeys: string[]; + existingKeys: string[]; + // keyType: ColumnType; + typeConst: boolean; + menuButtonContent: JSX.Element; + addNew: boolean; + onSelect: (oldKey: string, newKey: string, addnew: boolean) => void; + setIsEditing: (isEditing: boolean) => void; + deleteColumn: (column: string) => void; + onlyShowOptions: boolean; + setColumnType: (column: SchemaHeaderField, type: ColumnType) => void; + setColumnSort: (column: SchemaHeaderField, desc: boolean | undefined) => void; + anchorPoint?: any; + setColumnColor: (column: SchemaHeaderField, color: string) => void; +} +@observer +export class CollectionSchemaColumnMenu extends React.Component { + @observable private _isOpen: boolean = false; + @observable private _node: HTMLDivElement | null = null; + + componentDidMount() { document.addEventListener("pointerdown", this.detectClick); } + + componentWillUnmount() { document.removeEventListener("pointerdown", this.detectClick); } + + @action + detectClick = (e: PointerEvent) => { + !this._node?.contains(e.target as Node) && this.props.setIsEditing(this._isOpen = false); + } + + @action + toggleIsOpen = (): void => { + this.props.setIsEditing(this._isOpen = !this._isOpen); + } + + changeColumnType = (type: ColumnType) => { + this.props.setColumnType(this.props.columnField, type); + } + + changeColumnSort = (desc: boolean | undefined) => { + this.props.setColumnSort(this.props.columnField, desc); + } + + changeColumnColor = (color: string) => { + this.props.setColumnColor(this.props.columnField, color); + } + + @action + setNode = (node: HTMLDivElement): void => { + if (node) { + this._node = node; + } + } + + renderTypes = () => { + if (this.props.typeConst) return (null); + + const type = this.props.columnField.type; + return ( +
+ +
+
this.changeColumnType(ColumnType.Any)}> + + Any +
+
this.changeColumnType(ColumnType.Number)}> + + Number +
+
this.changeColumnType(ColumnType.String)}> + + Text +
+
this.changeColumnType(ColumnType.Boolean)}> + + Checkbox +
+
this.changeColumnType(ColumnType.List)}> + + List +
+
this.changeColumnType(ColumnType.Doc)}> + + Document +
+
this.changeColumnType(ColumnType.Image)}> + + Image +
+
this.changeColumnType(ColumnType.Date)}> + + Date +
+
+
+ ); + } + + renderSorting = () => { + const sort = this.props.columnField.desc; + return ( +
+ +
+
this.changeColumnSort(true)}> + + Sort descending +
+
this.changeColumnSort(false)}> + + Sort ascending +
+
this.changeColumnSort(undefined)}> + + Clear sorting +
+
+
+ ); + } + + renderColors = () => { + const selected = this.props.columnField.color; + + const pink = PastelSchemaPalette.get("pink2"); + const purple = PastelSchemaPalette.get("purple2"); + const blue = PastelSchemaPalette.get("bluegreen1"); + const yellow = PastelSchemaPalette.get("yellow4"); + const red = PastelSchemaPalette.get("red2"); + const gray = "#f1efeb"; + + return ( +
+ +
+
this.changeColumnColor(pink!)}>
+
this.changeColumnColor(purple!)}>
+
this.changeColumnColor(blue!)}>
+
this.changeColumnColor(yellow!)}>
+
this.changeColumnColor(red!)}>
+
this.changeColumnColor(gray)}>
+
+
+ ); + } + + renderContent = () => { + return ( +
+ {this.props.onlyShowOptions ? <> : + <> + {this.renderTypes()} + {this.renderSorting()} + {this.renderColors()} +
+ +
+ + } +
+ ); + } + + render() { + return ( +
+ +
this.toggleIsOpen()}>{this.props.menuButtonContent}
+ +
+ ); + } +} + + +export interface KeysDropdownProps { + keyValue: string; + possibleKeys: string[]; + existingKeys: string[]; + canAddNew: boolean; + addNew: boolean; + onSelect: (oldKey: string, newKey: string, addnew: boolean, filter?: string) => void; + setIsEditing: (isEditing: boolean) => void; + width?: string; + docs?: Doc[]; + Document: Doc; + dataDoc: Doc | undefined; + fieldKey: string; + ContainingCollectionDoc: Doc | undefined; + ContainingCollectionView: Opt; + active?: (outsideReaction?: boolean) => boolean; + openHeader: (column: any, screenx: number, screeny: number) => void; + col: SchemaHeaderField; + icon: IconProp; +} +@observer +export class KeysDropdown extends React.Component { + @observable private _key: string = this.props.keyValue; + @observable private _searchTerm: string = this.props.keyValue; + @observable private _isOpen: boolean = false; + @observable private _node: HTMLDivElement | null = null; + @observable private _inputRef: React.RefObject = React.createRef(); + + @action setSearchTerm = (value: string): void => { this._searchTerm = value; }; + @action setKey = (key: string): void => { this._key = key; }; + @action setIsOpen = (isOpen: boolean): void => { this._isOpen = isOpen; }; + + @action + onSelect = (key: string): void => { + this.props.onSelect(this._key, key, this.props.addNew); + this.setKey(key); + this._isOpen = false; + this.props.setIsEditing(false); + } + + @action + setNode = (node: HTMLDivElement): void => { + if (node) { + this._node = node; + } + } + + componentDidMount() { + document.addEventListener("pointerdown", this.detectClick); + const filters = Cast(this.props.Document._docFilters, listSpec("string")); + if (filters?.some(filter => filter.split(":")[0] === this._key)) { + runInAction(() => this.closeResultsVisibility = "contents"); + } + } + + @action + detectClick = (e: PointerEvent): void => { + if (this._node && this._node.contains(e.target as Node)) { + } else { + this._isOpen = false; + this.props.setIsEditing(false); + } + } + + private tempfilter: string = ""; + @undoBatch + onKeyDown = (e: React.KeyboardEvent): void => { + if (e.key === "Enter") { + if (this._searchTerm.includes(":")) { + const colpos = this._searchTerm.indexOf(":"); + const temp = this._searchTerm.slice(colpos + 1, this._searchTerm.length); + if (temp === "") { + Doc.setDocFilter(this.props.Document, this._key, this.tempfilter, "remove"); + this.updateFilter(); + } + else { + Doc.setDocFilter(this.props.Document, this._key, this.tempfilter, "remove"); + this.tempfilter = temp; + Doc.setDocFilter(this.props.Document, this._key, temp, "check"); + this.props.col.setColor("green"); + this.closeResultsVisibility = "contents"; + } + } + else { + Doc.setDocFilter(this.props.Document, this._key, this.tempfilter, "remove"); + this.updateFilter(); + if (this.showKeys.length) { + this.onSelect(this.showKeys[0]); + } else if (this._searchTerm !== "" && this.props.canAddNew) { + this.setSearchTerm(this._searchTerm || this._key); + this.onSelect(this._searchTerm); + } + } + } + } + + onChange = (val: string): void => { + this.setSearchTerm(val); + } + + @action + onFocus = (e: React.FocusEvent): void => { + this._isOpen = true; + this.props.setIsEditing(true); + } + + @computed get showKeys() { + const whitelistKeys = ["context", "author", "*lastModified", "text", "data", "tags", "creationDate"]; + const keyOptions = this._searchTerm === "" ? this.props.possibleKeys : this.props.possibleKeys.filter(key => key.toUpperCase().indexOf(this._searchTerm.toUpperCase()) > -1); + const showKeys = new Set(); + [...keyOptions, ...whitelistKeys].forEach(key => (!Doc.UserDoc().noviceMode || + whitelistKeys.includes(key) + || ((!key.startsWith("_") && key[0] === key[0].toUpperCase()) || key[0] === "#")) ? showKeys.add(key) : null); + return Array.from(showKeys.keys()).filter(key => !this._searchTerm || key.includes(this._searchTerm)); + } + @action + renderOptions = (): JSX.Element[] | JSX.Element => { + if (!this._isOpen) { + this.defaultMenuHeight = 0; + return <>; + } + const options = this.showKeys.map(key => { + return
{ + e.stopPropagation(); + }} + onClick={() => { + this.onSelect(key); + this.setSearchTerm(""); + }}>{key}
; + }); + + // if search term does not already exist as a group type, give option to create new group type + + if (this._key !== this._searchTerm.slice(0, this._key.length)) { + if (this._searchTerm !== "" && this.props.canAddNew) { + options.push(
{ this.onSelect(this._searchTerm); this.setSearchTerm(""); }}> + Create "{this._searchTerm}" key
); + } + } + + if (options.length === 0) { + this.defaultMenuHeight = 0; + } + else { + if (this.props.docs) { + const panesize = this.props.docs.length * 30; + options.length * 20 + 8 - 10 > panesize ? this.defaultMenuHeight = panesize : this.defaultMenuHeight = options.length * 20 + 8; + } + else { + options.length > 5 ? this.defaultMenuHeight = 108 : this.defaultMenuHeight = options.length * 20 + 8; + } + } + return options; + } + + docSafe: Doc[] = []; + + @action + renderFilterOptions = (): JSX.Element[] | JSX.Element => { + if (!this._isOpen || !this.props.dataDoc) { + this.defaultMenuHeight = 0; + return <>; + } + const keyOptions: string[] = []; + const colpos = this._searchTerm.indexOf(":"); + const temp = this._searchTerm.slice(colpos + 1, this._searchTerm.length); + if (this.docSafe.length === 0) { + this.docSafe = DocListCast(this.props.dataDoc[this.props.fieldKey]); + } + const docs = this.docSafe; + docs.forEach((doc) => { + const key = StrCast(doc[this._key]); + if (keyOptions.includes(key) === false && key.includes(temp) && key !== "") { + keyOptions.push(key); + } + }); + + const filters = Cast(this.props.Document._docFilters, listSpec("string")); + if (filters === undefined || filters.length === 0 || filters.some(filter => filter.split(":")[0] === this._key) === false) { + this.props.col.setColor("rgb(241, 239, 235)"); + this.closeResultsVisibility = "none"; + } + for (let i = 0; i < (filters?.length ?? 0) - 1; i++) { + if (filters![i] === this.props.col.heading && keyOptions.includes(filters![i].split(":")[1]) === false) { + keyOptions.push(filters![i + 1]); + } + } + const options = keyOptions.map(key => { + let bool = false; + if (filters !== undefined) { + const ind = filters.findIndex(filter => filter.split(":")[0] === key); + const fields = ind === -1 ? undefined : filters[ind].split(":"); + bool = fields ? fields[1] === "check" : false; + } + return
+ e.stopPropagation()} + onClick={e => e.stopPropagation()} + onChange={(e) => { + e.target.checked === true ? Doc.setDocFilter(this.props.Document, this._key, key, "check") : Doc.setDocFilter(this.props.Document, this._key, key, "remove"); + e.target.checked === true ? this.closeResultsVisibility = "contents" : console.log(""); + e.target.checked === true ? this.props.col.setColor("green") : this.updateFilter(); + e.target.checked === true && SearchBox.Instance.filter === true ? Doc.setDocFilter(docs[0], this._key, key, "check") : Doc.setDocFilter(docs[0], this._key, key, "remove"); + }} + checked={bool} + /> + + {key} + + +
; + }); + if (options.length === 0) { + this.defaultMenuHeight = 0; + } + else { + if (this.props.docs) { + const panesize = this.props.docs.length * 30; + options.length * 20 + 8 - 10 > panesize ? this.defaultMenuHeight = panesize : this.defaultMenuHeight = options.length * 20 + 8; + } + else { + options.length > 5 ? this.defaultMenuHeight = 108 : this.defaultMenuHeight = options.length * 20 + 8; + } + + } + return options; + } + + @observable defaultMenuHeight = 0; + + + updateFilter() { + const filters = Cast(this.props.Document._docFilters, listSpec("string")); + if (filters === undefined || filters.length === 0 || filters.some(filter => filter.split(":")[0] === this._key) === false) { + this.props.col.setColor("rgb(241, 239, 235)"); + this.closeResultsVisibility = "none"; + } + } + + @computed get scriptField() { + const scriptText = "setDocFilter(containingTreeView, heading, this.title, checked)"; + const script = ScriptField.MakeScript(scriptText, { this: Doc.name, heading: "string", checked: "string", containingTreeView: Doc.name }); + return script ? () => script : undefined; + } + filterBackground = () => "rgba(105, 105, 105, 0.432)"; + @observable filterOpen: boolean | undefined = undefined; + closeResultsVisibility: string = "none"; + + removeFilters = (e: React.PointerEvent): void => { + const keyOptions: string[] = []; + if (this.docSafe.length === 0 && this.props.dataDoc) { + this.docSafe = DocListCast(this.props.dataDoc[this.props.fieldKey]); + } + const docs = this.docSafe; + docs.forEach((doc) => { + const key = StrCast(doc[this._key]); + if (keyOptions.includes(key) === false) { + keyOptions.push(key); + } + }); + + Doc.setDocFilter(this.props.Document, this._key, "", "remove"); + this.props.col.setColor("rgb(241, 239, 235)"); + this.closeResultsVisibility = "none"; + } + render() { + return ( +
+ { this.props.openHeader(this.props.col, e.clientX, e.clientY); e.stopPropagation(); }} icon={this.props.icon} size="lg" style={{ display: "inline", paddingBottom: "1px", paddingTop: "4px", cursor: "hand" }} /> + + {/* { + runInAction(() => { this._isOpen === undefined ? this._isOpen = true : this._isOpen = !this._isOpen }) + }} /> */} + +
+ this.onChange(e.target.value)} + onClick={(e) => { e.stopPropagation(); this._inputRef.current?.focus(); }} + onFocus={this.onFocus} > +
+ +
+ {!this._isOpen ? (null) :
+ {this._searchTerm.includes(":") ? this.renderFilterOptions() : this.renderOptions()} +
} +
+
+ ); + } +} diff --git a/src/client/views/collections/schemaView/CollectionSchemaMovableTableHOC.tsx b/src/client/views/collections/schemaView/CollectionSchemaMovableTableHOC.tsx new file mode 100644 index 000000000..149677976 --- /dev/null +++ b/src/client/views/collections/schemaView/CollectionSchemaMovableTableHOC.tsx @@ -0,0 +1,261 @@ +import React = require("react"); +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { action } from "mobx"; +import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table"; +import { Doc } from "../../../fields/Doc"; +import { SchemaHeaderField } from "../../../fields/SchemaHeaderField"; +import { Cast, FieldValue, StrCast } from "../../../fields/Types"; +import { DocumentManager } from "../../util/DocumentManager"; +import { DragManager, dropActionType, SetupDrag } from "../../util/DragManager"; +import { SnappingManager } from "../../util/SnappingManager"; +import { Transform } from "../../util/Transform"; +import { undoBatch } from "../../util/UndoManager"; +import { ContextMenu } from "../ContextMenu"; +import "./CollectionSchemaView.scss"; + +export interface MovableColumnProps { + columnRenderer: TableCellRenderer; + columnValue: SchemaHeaderField; + allColumns: SchemaHeaderField[]; + reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columns: SchemaHeaderField[]) => void; + ScreenToLocalTransform: () => Transform; +} +export class MovableColumn extends React.Component { + private _header?: React.RefObject = React.createRef(); + private _colDropDisposer?: DragManager.DragDropDisposer; + private _startDragPosition: { x: number, y: number } = { x: 0, y: 0 }; + private _sensitivity: number = 16; + private _dragRef: React.RefObject = React.createRef(); + + onPointerEnter = (e: React.PointerEvent): void => { + if (e.buttons === 1 && SnappingManager.GetIsDragging()) { + this._header!.current!.className = "collectionSchema-col-wrapper"; + document.addEventListener("pointermove", this.onDragMove, true); + } + } + onPointerLeave = (e: React.PointerEvent): void => { + this._header!.current!.className = "collectionSchema-col-wrapper"; + document.removeEventListener("pointermove", this.onDragMove, true); + !e.buttons && document.removeEventListener("pointermove", this.onPointerMove); + } + onDragMove = (e: PointerEvent): void => { + const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top); + const before = x[0] < bounds[0]; + this._header!.current!.className = "collectionSchema-col-wrapper"; + if (before) this._header!.current!.className += " col-before"; + if (!before) this._header!.current!.className += " col-after"; + e.stopPropagation(); + } + + createColDropTarget = (ele: HTMLDivElement) => { + this._colDropDisposer?.(); + if (ele) { + this._colDropDisposer = DragManager.MakeDropTarget(ele, this.colDrop.bind(this)); + } + } + + colDrop = (e: Event, de: DragManager.DropEvent) => { + document.removeEventListener("pointermove", this.onDragMove, true); + const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top); + const before = x[0] < bounds[0]; + const colDragData = de.complete.columnDragData; + if (colDragData) { + e.stopPropagation(); + this.props.reorderColumns(colDragData.colKey, this.props.columnValue, before, this.props.allColumns); + return true; + } + return false; + } + + onPointerMove = (e: PointerEvent) => { + const onRowMove = (e: PointerEvent) => { + e.stopPropagation(); + e.preventDefault(); + + document.removeEventListener("pointermove", onRowMove); + document.removeEventListener('pointerup', onRowUp); + const dragData = new DragManager.ColumnDragData(this.props.columnValue); + DragManager.StartColumnDrag(this._dragRef.current!, dragData, e.x, e.y); + }; + const onRowUp = (): void => { + document.removeEventListener("pointermove", onRowMove); + document.removeEventListener('pointerup', onRowUp); + }; + if (e.buttons === 1) { + const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX - this._startDragPosition.x, e.clientY - this._startDragPosition.y); + if (Math.abs(dx) + Math.abs(dy) > this._sensitivity) { + document.removeEventListener("pointermove", this.onPointerMove); + e.stopPropagation(); + + document.addEventListener("pointermove", onRowMove); + document.addEventListener("pointerup", onRowUp); + } + } + } + + onPointerUp = (e: React.PointerEvent) => { + document.removeEventListener("pointermove", this.onPointerMove); + } + + @action + onPointerDown = (e: React.PointerEvent, ref: React.RefObject) => { + this._dragRef = ref; + const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX, e.clientY); + if (!(e.target as any)?.tagName.includes("INPUT")) { + this._startDragPosition = { x: dx, y: dy }; + document.addEventListener("pointermove", this.onPointerMove); + } + } + + + render() { + const reference = React.createRef(); + + return ( +
+
+
this.onPointerDown(e, reference)} onPointerUp={this.onPointerUp}> + {this.props.columnRenderer} +
+
+
+ ); + } +} + +export interface MovableRowProps { + rowInfo: RowInfo; + ScreenToLocalTransform: () => Transform; + addDoc: (doc: Doc | Doc[], relativeTo?: Doc, before?: boolean) => boolean; + removeDoc: (doc: Doc | Doc[]) => boolean; + rowFocused: boolean; + textWrapRow: (doc: Doc) => void; + rowWrapped: boolean; + dropAction: string; + addDocTab: any; +} + +export class MovableRow extends React.Component { + private _header?: React.RefObject = React.createRef(); + private _rowDropDisposer?: DragManager.DragDropDisposer; + + // Event listeners are only necessary when the user is hovering over the table + // Create one when the mouse starts hovering... + onPointerEnter = (e: React.PointerEvent): void => { + if (e.buttons === 1 && SnappingManager.GetIsDragging()) { + this._header!.current!.className = "collectionSchema-row-wrapper"; + document.addEventListener("pointermove", this.onDragMove, true); + } + } + // ... and delete it when the mouse leaves + onPointerLeave = (e: React.PointerEvent): void => { + this._header!.current!.className = "collectionSchema-row-wrapper"; + document.removeEventListener("pointermove", this.onDragMove, true); + } + // The method for the event listener, reorders columns when dragged to their new locations. + onDragMove = (e: PointerEvent): void => { + const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); + const before = x[1] < bounds[1]; + this._header!.current!.className = "collectionSchema-row-wrapper"; + if (before) this._header!.current!.className += " row-above"; + if (!before) this._header!.current!.className += " row-below"; + e.stopPropagation(); + } + componentWillUnmount() { + + this._rowDropDisposer?.(); + } + // + createRowDropTarget = (ele: HTMLDivElement) => { + this._rowDropDisposer?.(); + if (ele) { + this._rowDropDisposer = DragManager.MakeDropTarget(ele, this.rowDrop.bind(this)); + } + } + // Controls what hppens when a row is dragged and dropped + rowDrop = (e: Event, de: DragManager.DropEvent) => { + this.onPointerLeave(e as any); + const rowDoc = FieldValue(Cast(this.props.rowInfo.original, Doc)); + if (!rowDoc) return false; + + const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); + const before = x[1] < bounds[1]; + + const docDragData = de.complete.docDragData; + if (docDragData) { + e.stopPropagation(); + if (docDragData.draggedDocuments[0] === rowDoc) return true; + const addDocument = (doc: Doc | Doc[]) => this.props.addDoc(doc, rowDoc, before); + const movedDocs = docDragData.draggedDocuments; + return (docDragData.dropAction || docDragData.userDropAction) ? + docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before) || added, false) + : (docDragData.moveDocument) ? + movedDocs.reduce((added: boolean, d) => docDragData.moveDocument?.(d, rowDoc, addDocument) || added, false) + : docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before), false); + } + return false; + } + + onRowContextMenu = (e: React.MouseEvent): void => { + const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row"; + ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" }); + } + + @undoBatch + @action + move: DragManager.MoveFunction = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc) => { + const targetView = targetCollection && DocumentManager.Instance.getDocumentView(targetCollection); + return doc !== targetCollection && doc !== targetView?.props.ContainingCollectionDoc && this.props.removeDoc(doc) && addDoc(doc); + } + + @action + onKeyDown = (e: React.KeyboardEvent) => { + console.log("yes"); + if (e.key === "Backspace" || e.key === "Delete") { + undoBatch(() => this.props.removeDoc(this.props.rowInfo.original)); + } + } + + render() { + const { children = null, rowInfo } = this.props; + + if (!rowInfo) { + return {children}; + } + + const { original } = rowInfo; + const doc = FieldValue(Cast(original, Doc)); + + if (!doc) return (null); + + const reference = React.createRef(); + const onItemDown = SetupDrag(reference, () => doc, this.move, StrCast(this.props.dropAction) as dropActionType); + + let className = "collectionSchema-row"; + if (this.props.rowFocused) className += " row-focused"; + if (this.props.rowWrapped) className += " row-wrapped"; + + return ( +
+
+ +
+
this.props.removeDoc(this.props.rowInfo.original))}>
+
+
this.props.addDocTab(this.props.rowInfo.original, "add:right")}>
+
+ {children} +
+
+
+ ); + } +} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/CollectionSchemaView.scss b/src/client/views/collections/schemaView/CollectionSchemaView.scss new file mode 100644 index 000000000..b57fee0e4 --- /dev/null +++ b/src/client/views/collections/schemaView/CollectionSchemaView.scss @@ -0,0 +1,552 @@ +@import "../../globalCssVariables"; +.collectionSchemaView-container { + border-width: $COLLECTION_BORDER_WIDTH; + border-color: $intermediate-color; + border-style: solid; + border-radius: $border-radius; + box-sizing: border-box; + position: relative; + top: 0; + width: 100%; + height: 100%; + margin-top: 0; + transition: top 0.5s; + display: flex; + justify-content: space-between; + flex-wrap: nowrap; + touch-action: none; + div { + touch-action: none; + } + .collectionSchemaView-tableContainer { + width: 100%; + height: 100%; + } + .collectionSchemaView-dividerDragger { + position: relative; + height: 100%; + width: $SCHEMA_DIVIDER_WIDTH; + z-index: 20; + right: 0; + top: 0; + background: gray; + cursor: col-resize; + } + // .documentView-node:first-child { + // background: $light-color; + // } +} + +.collectionSchemaView-searchContainer { + border-width: $COLLECTION_BORDER_WIDTH; + border-color: $intermediate-color; + border-style: solid; + border-radius: $border-radius; + box-sizing: border-box; + position: relative; + top: 0; + width: 100%; + height: 100%; + margin-top: 0; + transition: top 0.5s; + display: flex; + justify-content: space-between; + flex-wrap: nowrap; + touch-action: none; + padding: 2px; + div { + touch-action: none; + } + .collectionSchemaView-tableContainer { + width: 100%; + height: 100%; + } + .collectionSchemaView-dividerDragger { + position: relative; + height: 100%; + width: 20px; + z-index: 20; + right: 0; + top: 0; + background: gray; + cursor: col-resize; + } + // .documentView-node:first-child { + // background: $light-color; + // } +} + +.ReactTable { + width: 100%; + background: white; + box-sizing: border-box; + border: none !important; + float: none !important; + .rt-table { + height: 100%; + display: -webkit-inline-box; + direction: ltr; + overflow: visible; + } + .rt-noData { + display: none; + } + .rt-thead { + width: 100%; + z-index: 100; + overflow-y: visible; + &.-header { + font-size: 12px; + height: 30px; + box-shadow: none; + z-index: 100; + overflow-y: visible; + } + .rt-resizable-header-content { + height: 100%; + overflow: visible; + } + .rt-th { + padding: 0; + border: solid lightgray; + border-width: 0 1px; + border-bottom: 2px solid lightgray; + } + } + .rt-th { + font-size: 13px; + text-align: center; + &:last-child { + overflow: visible; + } + } + .rt-tbody { + width: 100%; + direction: rtl; + overflow: visible; + .rt-td { + border-right: 1px solid rgba(0, 0, 0, 0.2); + } + } + .rt-tr-group { + direction: ltr; + flex: 0 1 auto; + min-height: 30px; + border: 0 !important; + } + .rt-tr { + width: 100%; + min-height: 30px; + } + .rt-td { + padding: 0; + font-size: 13px; + text-align: center; + white-space: nowrap; + display: flex; + align-items: center; + .imageBox-cont { + position: relative; + max-height: 100%; + } + .imageBox-cont img { + object-fit: contain; + max-width: 100%; + height: 100%; + } + .videoBox-cont { + object-fit: contain; + width: auto; + height: 100%; + } + } + .rt-td.rt-expandable { + display: flex; + align-items: center; + height: inherit; + } + .rt-resizer { + width: 8px; + right: -4px; + } + .rt-resizable-header { + padding: 0; + height: 30px; + } + .rt-resizable-header:last-child { + overflow: visible; + .rt-resizer { + width: 5px !important; + } + } +} + +.documentView-node-topmost { + text-align: left; + transform-origin: center top; + display: inline-block; +} + +.collectionSchema-col { + height: 100%; +} + +.collectionSchema-header-menu { + height: auto; + z-index: 100; + position: absolute; + background: white; + padding: 5px; + position: fixed; + background: white; + border: black 1px solid; + .collectionSchema-header-toggler { + z-index: 100; + width: 100%; + height: 100%; + padding: 4px; + letter-spacing: 2px; + text-transform: uppercase; + svg { + margin-right: 4px; + } + } +} + +.collectionSchemaView-header { + height: 100%; + color: gray; + z-index: 100; + overflow-y: visible; + display: flex; + justify-content: space-between; + flex-wrap: wrap; +} + +button.add-column { + width: 28px; +} + +.collectionSchema-header-menuOptions { + color: black; + width: 180px; + text-align: left; + .collectionSchema-headerMenu-group { + padding: 7px 0; + border-bottom: 1px solid lightgray; + cursor: pointer; + &:first-child { + padding-top: 0; + } + &:last-child { + border: none; + text-align: center; + padding: 12px 0 0 0; + } + } + label { + color: $main-accent; + font-weight: normal; + letter-spacing: 2px; + text-transform: uppercase; + } + input { + color: black; + width: 100%; + } + .columnMenu-option { + cursor: pointer; + padding: 3px; + background-color: white; + transition: background-color 0.2s; + &:hover { + background-color: $light-color-secondary; + } + &.active { + font-weight: bold; + border: 2px solid $light-color-secondary; + } + svg { + color: gray; + margin-right: 5px; + width: 10px; + } + } + .keys-dropdown { + position: relative; + //width: 100%; + background-color: white; + input { + border: 2px solid $light-color-secondary; + padding: 3px; + height: 28px; + font-weight: bold; + letter-spacing: "2px"; + text-transform: "uppercase"; + &:focus { + font-weight: normal; + } + } + .keys-options-wrapper { + width: 100%; + max-height: 150px; + overflow-y: scroll; + position: absolute; + top: 28px; + box-shadow: 0 10px 16px rgba(0, 0, 0, 0.1); + background-color: white; + .key-option { + background-color: white; + border: 1px solid lightgray; + padding: 2px 3px; + &:not(:first-child) { + border-top: 0; + } + &:hover { + background-color: $light-color-secondary; + } + } + } + } + .columnMenu-colors { + display: flex; + justify-content: space-between; + flex-wrap: wrap; + .columnMenu-colorPicker { + cursor: pointer; + width: 20px; + height: 20px; + border-radius: 10px; + &.active { + border: 2px solid white; + box-shadow: 0 0 0 2px lightgray; + } + } + } +} + +.collectionSchema-row { + height: 100%; + background-color: white; + &.row-focused .rt-td { + background-color: #bfffc0; //$light-color-secondary; + } + &.row-wrapped { + .rt-td { + white-space: normal; + } + } + .row-dragger { + display: flex; + justify-content: space-around; + //flex: 50 0 auto; + width: 0; + max-width: 50px; + //height: 100%; + min-height: 30px; + align-items: center; + color: lightgray; + background-color: white; + transition: color 0.1s ease; + .row-option { + // padding: 5px; + cursor: pointer; + position: absolute; + transition: color 0.1s ease; + display: flex; + flex-direction: column; + justify-content: center; + z-index: 2; + &:hover { + color: gray; + } + } + } + .collectionSchema-row-wrapper { + &.row-above { + border-top: 1px solid red; + } + &.row-below { + border-bottom: 1px solid red; + } + &.row-inside { + border: 1px solid red; + } + .row-dragging { + background-color: blue; + } + } +} + +.collectionSchemaView-cellContainer { + width: 100%; + height: unset; +} + +.collectionSchemaView-cellWrapper { + height: 100%; + padding: 4px; + text-align: left; + padding-left: 19px; + position: relative; + &:focus { + outline: none; + } + &.editing { + padding: 0; + input { + outline: 0; + border: none; + background-color: rgb(255, 217, 217); + width: 100%; + height: 100%; + padding: 2px 3px; + min-height: 26px; + } + } + &.focused { + &.inactive { + border: none; + } + } + p { + width: 100%; + height: 100%; + } + &:hover .collectionSchemaView-cellContents-docExpander { + display: block; + } + .collectionSchemaView-cellContents-document { + display: inline-block; + } + .collectionSchemaView-cellContents-docButton { + float: right; + width: "15px"; + height: "15px"; + } + .collectionSchemaView-dropdownWrapper { + border: grey; + border-style: solid; + border-width: 1px; + height: 30px; + .collectionSchemaView-dropdownButton { + //display: inline-block; + float: left; + height: 100%; + } + .collectionSchemaView-dropdownText { + display: inline-block; + //float: right; + height: 100%; + display: "flex"; + font-size: 13; + justify-content: "center"; + align-items: "center"; + } + } + .collectionSchemaView-dropdownContainer { + position: absolute; + border: 1px solid rgba(0, 0, 0, 0.04); + box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14); + .collectionSchemaView-dropdownOption:hover { + background-color: rgba(0, 0, 0, 0.14); + cursor: pointer; + } + } +} + +.collectionSchemaView-cellContents-docExpander { + height: 30px; + width: 30px; + display: none; + position: absolute; + top: 0; + right: 0; + background-color: lightgray; +} + +.doc-drag-over { + background-color: red; +} + +.collectionSchemaView-toolbar { + z-index: 100; +} + +.collectionSchemaView-toolbar { + height: 30px; + display: flex; + justify-content: flex-end; + padding: 0 10px; + border-bottom: 2px solid gray; + .collectionSchemaView-toolbar-item { + display: flex; + flex-direction: column; + justify-content: center; + } +} + +#preview-schema-checkbox-div { + margin-left: 20px; + font-size: 12px; +} + +.collectionSchemaView-table { + width: 100%; + height: 100%; + overflow: auto; + padding: 3px; +} + +.rt-td.rt-expandable { + overflow: visible; + position: relative; + height: 100%; + z-index: 1; +} + +.reactTable-sub { + background-color: rgb(252, 252, 252); + width: 100%; + .rt-thead { + display: none; + } + .row-dragger { + background-color: rgb(252, 252, 252); + } + .rt-table { + background-color: rgb(252, 252, 252); + } + .collectionSchemaView-table { + width: 100%; + border: solid 1px; + overflow: visible; + padding: 0px; + } +} + +.collectionSchemaView-expander { + height: 100%; + min-height: 30px; + position: absolute; + color: gray; + width: 20; + height: auto; + left: 55; + svg { + position: absolute; + top: 50%; + left: 10; + transform: translate(-50%, -50%); + } +} + +.collectionSchemaView-addRow { + color: gray; + letter-spacing: 2px; + text-transform: uppercase; + cursor: pointer; + font-size: 10.5px; + margin-left: 50px; + margin-top: 10px; +} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/CollectionSchemaView.tsx b/src/client/views/collections/schemaView/CollectionSchemaView.tsx new file mode 100644 index 000000000..b33c437a9 --- /dev/null +++ b/src/client/views/collections/schemaView/CollectionSchemaView.tsx @@ -0,0 +1,575 @@ +import React = require("react"); +import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; +import { action, computed, observable, untracked } from "mobx"; +import { observer } from "mobx-react"; +import Measure from "react-measure"; +import { Resize } from "react-table"; +import "react-table/react-table.css"; +import { Doc, Opt } from "../../../fields/Doc"; +import { List } from "../../../fields/List"; +import { listSpec } from "../../../fields/Schema"; +import { PastelSchemaPalette, SchemaHeaderField } from "../../../fields/SchemaHeaderField"; +import { Cast, NumCast } from "../../../fields/Types"; +import { TraceMobx } from "../../../fields/util"; +import { emptyFunction, emptyPath, returnFalse, setupMoveUpEvents, returnEmptyDoclist, returnTrue } from "../../../Utils"; +import { SelectionManager } from "../../util/SelectionManager"; +import { SnappingManager } from "../../util/SnappingManager"; +import { Transform } from "../../util/Transform"; +import { undoBatch } from "../../util/UndoManager"; +import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/globalCssVariables.scss'; +import { ContextMenu } from "../ContextMenu"; +import { ContextMenuProps } from "../ContextMenuItem"; +import '../DocumentDecorations.scss'; +import { DocumentView } from "../nodes/DocumentView"; +import { DefaultStyleProvider } from "../StyleProvider"; +import "./CollectionSchemaView.scss"; +import { CollectionSubView } from "./CollectionSubView"; +import { SchemaTable } from "./SchemaTable"; +import { DocUtils } from "../../documents/Documents"; +// bcz: need to add drag and drop of rows and columns. This seems like it might work for rows: https://codesandbox.io/s/l94mn1q657 + +export enum ColumnType { + Any, + Number, + String, + Boolean, + Doc, + Image, + List, + Date +} +// this map should be used for keys that should have a const type of value +const columnTypes: Map = new Map([ + ["title", ColumnType.String], + ["x", ColumnType.Number], ["y", ColumnType.Number], ["_width", ColumnType.Number], ["_height", ColumnType.Number], + ["_nativeWidth", ColumnType.Number], ["_nativeHeight", ColumnType.Number], ["isPrototype", ColumnType.Boolean], + ["_curPage", ColumnType.Number], ["_currentTimecode", ColumnType.Number], ["zIndex", ColumnType.Number] +]); + +@observer +export class CollectionSchemaView extends CollectionSubView(doc => doc) { + private _previewCont?: HTMLDivElement; + + @observable _previewDoc: Doc | undefined = undefined; + @observable _focusedTable: Doc = this.props.Document; + @observable _col: any = ""; + @observable _menuWidth = 0; + @observable _headerOpen = false; + @observable _headerIsEditing = false; + @observable _menuHeight = 0; + @observable _pointerX = 0; + @observable _pointerY = 0; + @observable _openTypes: boolean = false; + + @computed get previewWidth() { return () => NumCast(this.props.Document.schemaPreviewWidth); } + @computed get previewHeight() { return () => this.props.PanelHeight() - 2 * this.borderWidth; } + @computed get tableWidth() { return this.props.PanelWidth() - 2 * this.borderWidth - Number(SCHEMA_DIVIDER_WIDTH) - this.previewWidth(); } + @computed get borderWidth() { return Number(COLLECTION_BORDER_WIDTH); } + @computed get scale() { return this.props.ScreenToLocalTransform().Scale; } + @computed get columns() { return Cast(this.props.Document._schemaHeaders, listSpec(SchemaHeaderField), []); } + set columns(columns: SchemaHeaderField[]) { this.props.Document._schemaHeaders = new List(columns); } + + @computed get menuCoordinates() { + let searchx = 0; + let searchy = 0; + if (this.props.Document._searchDoc) { + const el = document.getElementsByClassName("collectionSchemaView-searchContainer")[0]; + if (el !== undefined) { + const rect = el.getBoundingClientRect(); + searchx = rect.x; + searchy = rect.y; + } + } + const x = Math.max(0, Math.min(document.body.clientWidth - this._menuWidth, this._pointerX)) - searchx; + const y = Math.max(0, Math.min(document.body.clientHeight - this._menuHeight, this._pointerY)) - searchy; + return this.props.ScreenToLocalTransform().transformPoint(x, y); + } + + get documentKeys() { + const docs = this.childDocs; + const keys: { [key: string]: boolean } = {}; + // bcz: ugh. this is untracked since otherwise a large collection of documents will blast the server for all their fields. + // then as each document's fields come back, we update the documents _proxies. Each time we do this, the whole schema will be + // invalidated and re-rendered. This workaround will inquire all of the document fields before the options button is clicked. + // then by the time the options button is clicked, all of the fields should be in place. If a new field is added while this menu + // is displayed (unlikely) it won't show up until something else changes. + //TODO Types + untracked(() => docs.map(doc => Doc.GetAllPrototypes(doc).map(proto => Object.keys(proto).forEach(key => keys[key] = false)))); + + this.columns.forEach(key => keys[key.heading] = true); + return Array.from(Object.keys(keys)); + } + + @action setHeaderIsEditing = (isEditing: boolean) => this._headerIsEditing = isEditing; + + @undoBatch + setColumnType = action((columnField: SchemaHeaderField, type: ColumnType): void => { + this._openTypes = false; + if (columnTypes.get(columnField.heading)) return; + + const columns = this.columns; + const index = columns.indexOf(columnField); + if (index > -1) { + columnField.setType(NumCast(type)); + columns[index] = columnField; + this.columns = columns; + } + }); + + @undoBatch + setColumnColor = (columnField: SchemaHeaderField, color: string): void => { + const columns = this.columns; + const index = columns.indexOf(columnField); + if (index > -1) { + columnField.setColor(color); + columns[index] = columnField; + this.columns = columns; // need to set the columns to trigger rerender + } + } + + @undoBatch + @action + setColumnSort = (columnField: SchemaHeaderField, descending: boolean | undefined) => { + const columns = this.columns; + columns.forEach(col => col.setDesc(undefined)); + + const index = columns.findIndex(c => c.heading === columnField.heading); + const column = columns[index]; + column.setDesc(descending); + columns[index] = column; + this.columns = columns; + } + + renderTypes = (col: any) => { + if (columnTypes.get(col.heading)) return (null); + + const type = col.type; + + const anyType =
this.setColumnType(col, ColumnType.Any)}> + + Any +
; + + const numType =
this.setColumnType(col, ColumnType.Number)}> + + Number +
; + + const textType =
this.setColumnType(col, ColumnType.String)}> + + Text +
; + + const boolType =
this.setColumnType(col, ColumnType.Boolean)}> + + Checkbox +
; + + const listType =
this.setColumnType(col, ColumnType.List)}> + + List +
; + + const docType =
this.setColumnType(col, ColumnType.Doc)}> + + Document +
; + + const imageType =
this.setColumnType(col, ColumnType.Image)}> + + Image +
; + + const dateType =
this.setColumnType(col, ColumnType.Date)}> + + Date +
; + + + const allColumnTypes =
+ {anyType} + {numType} + {textType} + {boolType} + {listType} + {docType} + {imageType} + {dateType} +
; + + const justColType = type === ColumnType.Any ? anyType : type === ColumnType.Number ? numType : + type === ColumnType.String ? textType : type === ColumnType.Boolean ? boolType : + type === ColumnType.List ? listType : type === ColumnType.Doc ? docType : + type === ColumnType.Date ? dateType : imageType; + + return ( +
this._openTypes = !this._openTypes)}> +
+ + +
+ {this._openTypes ? allColumnTypes : justColType} +
+ ); + } + + renderSorting = (col: any) => { + const sort = col.desc; + return ( +
+ +
+
this.setColumnSort(col, true)}> + + Sort descending +
+
this.setColumnSort(col, false)}> + + Sort ascending +
+
this.setColumnSort(col, undefined)}> + + Clear sorting +
+
+
+ ); + } + + renderColors = (col: any) => { + const selected = col.color; + + const pink = PastelSchemaPalette.get("pink2"); + const purple = PastelSchemaPalette.get("purple2"); + const blue = PastelSchemaPalette.get("bluegreen1"); + const yellow = PastelSchemaPalette.get("yellow4"); + const red = PastelSchemaPalette.get("red2"); + const gray = "#f1efeb"; + + return ( +
+ +
+
this.setColumnColor(col, pink!)}>
+
this.setColumnColor(col, purple!)}>
+
this.setColumnColor(col, blue!)}>
+
this.setColumnColor(col, yellow!)}>
+
this.setColumnColor(col, red!)}>
+
this.setColumnColor(col, gray)}>
+
+
+ ); + } + + @undoBatch + @action + changeColumns = (oldKey: string, newKey: string, addNew: boolean, filter?: string) => { + const columns = this.columns; + if (columns === undefined) { + this.columns = new List([new SchemaHeaderField(newKey, "f1efeb")]); + } else { + if (addNew) { + columns.push(new SchemaHeaderField(newKey, "f1efeb")); + this.columns = columns; + } else { + const index = columns.map(c => c.heading).indexOf(oldKey); + if (index > -1) { + const column = columns[index]; + column.setHeading(newKey); + columns[index] = column; + this.columns = columns; + if (filter) { + Doc.setDocFilter(this.props.Document, newKey, filter, "match"); + } + else { + this.props.Document._docFilters = undefined; + } + } + } + } + } + + @action + openHeader = (col: any, screenx: number, screeny: number) => { + this._col = col; + this._headerOpen = true; + this._pointerX = screenx; + this._pointerY = screeny; + } + + @action + closeHeader = () => { this._headerOpen = false; } + + @undoBatch + @action + deleteColumn = (key: string) => { + const columns = this.columns; + if (columns === undefined) { + this.columns = new List([]); + } else { + const index = columns.map(c => c.heading).indexOf(key); + if (index > -1) { + columns.splice(index, 1); + this.columns = columns; + } + } + this.closeHeader(); + } + + getPreviewTransform = (): Transform => { + return this.props.ScreenToLocalTransform().translate(- this.borderWidth - NumCast(COLLECTION_BORDER_WIDTH) - this.tableWidth, - this.borderWidth); + } + + @action + onHeaderClick = (e: React.PointerEvent) => { + e.stopPropagation(); + } + + @action + onWheel(e: React.WheelEvent) { + const scale = this.props.ScreenToLocalTransform().Scale; + this.props.isContentActive(true) && e.stopPropagation(); + } + + @computed get renderMenuContent() { + TraceMobx(); + return
+ {this.renderTypes(this._col)} + {this.renderColors(this._col)} +
+ +
+
; + } + + private createTarget = (ele: HTMLDivElement) => { + this._previewCont = ele; + super.CreateDropTarget(ele); + } + + isFocused = (doc: Doc, outsideReaction: boolean): boolean => this.props.isSelected(outsideReaction) && doc === this._focusedTable; + + @action setFocused = (doc: Doc) => this._focusedTable = doc; + + @action setPreviewDoc = (doc: Opt) => { + SelectionManager.SelectSchemaView(this, doc); + this._previewDoc = doc; + } + + //toggles preview side-panel of schema + @action + toggleExpander = () => { + this.props.Document.schemaPreviewWidth = this.previewWidth() === 0 ? Math.min(this.tableWidth / 3, 200) : 0; + } + + onDividerDown = (e: React.PointerEvent) => { + setupMoveUpEvents(this, e, this.onDividerMove, emptyFunction, this.toggleExpander); + } + @action + onDividerMove = (e: PointerEvent, down: number[], delta: number[]) => { + const nativeWidth = this._previewCont!.getBoundingClientRect(); + const minWidth = 40; + const maxWidth = 1000; + const movedWidth = this.props.ScreenToLocalTransform().transformDirection(nativeWidth.right - e.clientX, 0)[0]; + const width = movedWidth < minWidth ? minWidth : movedWidth > maxWidth ? maxWidth : movedWidth; + this.props.Document.schemaPreviewWidth = width; + return false; + } + + onPointerDown = (e: React.PointerEvent): void => { + if (e.button === 0 && !e.altKey && !e.ctrlKey && !e.metaKey) { + if (this.props.isSelected(true)) e.stopPropagation(); + else this.props.select(false); + } + } + + @computed + get previewDocument(): Doc | undefined { return this._previewDoc; } + + @computed + get dividerDragger() { + return this.previewWidth() === 0 ? (null) : +
+
+
; + } + + @computed + get previewPanel() { + return
+ {!this.previewDocument ? (null) : + } +
; + } + + @computed + get schemaTable() { + return ; + } + + @computed + public get schemaToolbar() { + return
+
+
+ + Show Preview +
+
+
; + } + + onSpecificMenu = (e: React.MouseEvent) => { + if ((e.target as any)?.className?.includes?.("collectionSchemaView-cell") || (e.target instanceof HTMLSpanElement)) { + const cm = ContextMenu.Instance; + const options = cm.findByDescription("Options..."); + const optionItems: ContextMenuProps[] = options && "subitems" in options ? options.subitems : []; + optionItems.push({ description: "remove", event: () => this._previewDoc && this.props.removeDocument?.(this._previewDoc), icon: "trash" }); + !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "compass" }); + cm.displayMenu(e.clientX, e.clientY); + (e.nativeEvent as any).SchemaHandled = true; // not sure why this is needed, but if you right-click quickly on a cell, the Document/Collection contextMenu handlers still fire without this. + e.stopPropagation(); + } + } + + @action + onTableClick = (e: React.MouseEvent): void => { + if (!(e.target as any)?.className?.includes?.("collectionSchemaView-cell") && !(e.target instanceof HTMLSpanElement)) { + this.setPreviewDoc(undefined); + } else { + e.stopPropagation(); + } + this.setFocused(this.props.Document); + this.closeHeader(); + } + + onResizedChange = (newResized: Resize[], event: any) => { + const columns = this.columns; + newResized.forEach(resized => { + const index = columns.findIndex(c => c.heading === resized.id); + const column = columns[index]; + column.setWidth(resized.value); + columns[index] = column; + }); + this.columns = columns; + } + + @action + setColumns = (columns: SchemaHeaderField[]) => this.columns = columns + + @undoBatch + reorderColumns = (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columnsValues: SchemaHeaderField[]) => { + const columns = [...columnsValues]; + const oldIndex = columns.indexOf(toMove); + const relIndex = columns.indexOf(relativeTo); + const newIndex = (oldIndex > relIndex && !before) ? relIndex + 1 : (oldIndex < relIndex && before) ? relIndex - 1 : relIndex; + + if (oldIndex === newIndex) return; + + columns.splice(newIndex, 0, columns.splice(oldIndex, 1)[0]); + this.columns = columns; + } + + onZoomMenu = (e: React.WheelEvent) => this.props.isContentActive(true) && e.stopPropagation(); + + render() { + TraceMobx(); + if (!this.props.isContentActive()) setTimeout(() => this.closeHeader(), 0); + const menuContent = this.renderMenuContent; + const menu =
this.onZoomMenu(e)} + onPointerDown={e => this.onHeaderClick(e)} + style={{ transform: `translate(${(this.menuCoordinates[0])}px, ${(this.menuCoordinates[1])}px)` }}> + { + const dim = this.props.ScreenToLocalTransform().inverse().transformDirection(r.offset.width, r.offset.height); + this._menuWidth = dim[0]; this._menuHeight = dim[1]; + })}> + {({ measureRef }) =>
{menuContent}
} +
+
; + return
+
this.props.isContentActive(true) && e.stopPropagation()} + onDrop={e => this.onExternalDrop(e, {})} + ref={this.createTarget}> + {this.schemaTable} +
+ {this.dividerDragger} + {!this.previewWidth() ? (null) : this.previewPanel} + {this._headerOpen && this.props.isContentActive() ? menu : null} +
; + } +} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/SchemaTable.tsx b/src/client/views/collections/schemaView/SchemaTable.tsx new file mode 100644 index 000000000..c305f6806 --- /dev/null +++ b/src/client/views/collections/schemaView/SchemaTable.tsx @@ -0,0 +1,599 @@ +import React = require("react"); +import { IconProp } from '@fortawesome/fontawesome-svg-core'; +import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; +import { action, computed, observable } from "mobx"; +import { observer } from "mobx-react"; +import ReactTable, { CellInfo, Column, ComponentPropsGetterR, Resize, SortingRule } from "react-table"; +import "react-table/react-table.css"; +import { DateField } from "../../../../fields/DateField"; +import { AclPrivate, AclReadonly, DataSym, Doc, DocListCast, Field, Opt } from "../../../../fields/Doc"; +import { Id } from "../../../../fields/FieldSymbols"; +import { List } from "../../../../fields/List"; +import { listSpec } from "../../../../fields/Schema"; +import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; +import { ComputedField } from "../../../../fields/ScriptField"; +import { Cast, FieldValue, NumCast, StrCast } from "../../../../fields/Types"; +import { ImageField } from "../../../../fields/URLField"; +import { GetEffectiveAcl } from "../../../../fields/util"; +import { emptyFunction, emptyPath, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from "../../../../Utils"; +import { Docs, DocumentOptions, DocUtils } from "../../../documents/Documents"; +import { DocumentType } from "../../../documents/DocumentTypes"; +import { CompileScript, Transformer, ts } from "../../../util/Scripting"; +import { Transform } from "../../../util/Transform"; +import { undoBatch } from "../../../util/UndoManager"; +import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../globalCssVariables.scss'; +import { ContextMenu } from "../../ContextMenu"; +import '../DocumentDecorations.scss'; +import { DocumentView } from "../../nodes/DocumentView"; +import { DefaultStyleProvider } from "../../StyleProvider"; +import { CellProps, CollectionSchemaButtons, CollectionSchemaCell, CollectionSchemaCheckboxCell, CollectionSchemaDateCell, CollectionSchemaDocCell, CollectionSchemaImageCell, CollectionSchemaListCell, CollectionSchemaNumberCell, CollectionSchemaStringCell } from "./CollectionSchemaCells"; +import { CollectionSchemaAddColumnHeader, KeysDropdown } from "./CollectionSchemaHeaders"; +import { MovableColumn, MovableRow } from "./CollectionSchemaMovableTableHOC"; +import "./CollectionSchemaView.scss"; +import { CollectionView } from "../CollectionView"; + + +enum ColumnType { + Any, + Number, + String, + Boolean, + Doc, + Image, + List, + Date +} + +// this map should be used for keys that should have a const type of value +const columnTypes: Map = new Map([ + ["title", ColumnType.String], + ["x", ColumnType.Number], ["y", ColumnType.Number], ["_width", ColumnType.Number], ["_height", ColumnType.Number], + ["_nativeWidth", ColumnType.Number], ["_nativeHeight", ColumnType.Number], ["isPrototype", ColumnType.Boolean], + ["_curPage", ColumnType.Number], ["_currentTimecode", ColumnType.Number], ["zIndex", ColumnType.Number] +]); + +export interface SchemaTableProps { + Document: Doc; // child doc + dataDoc?: Doc; + PanelHeight: () => number; + PanelWidth: () => number; + childDocs?: Doc[]; + CollectionView: Opt; + ContainingCollectionView: Opt; + ContainingCollectionDoc: Opt; + fieldKey: string; + renderDepth: number; + deleteDocument?: (document: Doc | Doc[]) => boolean; + addDocument?: (document: Doc | Doc[]) => boolean; + moveDocument?: (document: Doc | Doc[], targetCollection: Doc | undefined, addDocument: (document: Doc | Doc[]) => boolean) => boolean; + ScreenToLocalTransform: () => Transform; + active: (outsideReaction: boolean | undefined) => boolean; + onDrop: (e: React.DragEvent, options: DocumentOptions, completed?: (() => void) | undefined) => void; + addDocTab: (document: Doc, where: string) => boolean; + pinToPres: (document: Doc) => void; + isSelected: (outsideReaction?: boolean) => boolean; + isFocused: (document: Doc, outsideReaction: boolean) => boolean; + setFocused: (document: Doc) => void; + setPreviewDoc: (document: Opt) => void; + columns: SchemaHeaderField[]; + documentKeys: any[]; + headerIsEditing: boolean; + openHeader: (column: any, screenx: number, screeny: number) => void; + onClick: (e: React.MouseEvent) => void; + onPointerDown: (e: React.PointerEvent) => void; + onResizedChange: (newResized: Resize[], event: any) => void; + setColumns: (columns: SchemaHeaderField[]) => void; + reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columnsValues: SchemaHeaderField[]) => void; + changeColumns: (oldKey: string, newKey: string, addNew: boolean) => void; + setHeaderIsEditing: (isEditing: boolean) => void; + changeColumnSort: (columnField: SchemaHeaderField, descending: boolean | undefined) => void; +} + +@observer +export class SchemaTable extends React.Component { + @observable _cellIsEditing: boolean = false; + @observable _focusedCell: { row: number, col: number } = { row: 0, col: 0 }; + @observable _openCollections: Set = new Set; + + @observable _showDoc: Doc | undefined; + @observable _showDataDoc: any = ""; + @observable _showDocPos: number[] = []; + + @observable _showTitleDropdown: boolean = false; + + @computed get previewWidth() { return () => NumCast(this.props.Document.schemaPreviewWidth); } + @computed get previewHeight() { return () => this.props.PanelHeight() - 2 * this.borderWidth; } + @computed get tableWidth() { return this.props.PanelWidth() - 2 * this.borderWidth - Number(SCHEMA_DIVIDER_WIDTH) - this.previewWidth(); } + + @computed get childDocs() { + if (this.props.childDocs) return this.props.childDocs; + + const doc = this.props.dataDoc ? this.props.dataDoc : this.props.Document; + return DocListCast(doc[this.props.fieldKey]); + } + set childDocs(docs: Doc[]) { + const doc = this.props.dataDoc ? this.props.dataDoc : this.props.Document; + doc[this.props.fieldKey] = new List(docs); + } + + @computed get textWrappedRows() { + return Cast(this.props.Document.textwrappedSchemaRows, listSpec("string"), []); + } + set textWrappedRows(textWrappedRows: string[]) { + this.props.Document.textwrappedSchemaRows = new List(textWrappedRows); + } + + @computed get resized(): { id: string, value: number }[] { + return this.props.columns.reduce((resized, shf) => { + (shf.width > -1) && resized.push({ id: shf.heading, value: shf.width }); + return resized; + }, [] as { id: string, value: number }[]); + } + @computed get sorted(): SortingRule[] { + return this.props.columns.reduce((sorted, shf) => { + shf.desc !== undefined && sorted.push({ id: shf.heading, desc: shf.desc }); + return sorted; + }, [] as SortingRule[]); + } + + @action + changeSorting = (col: any) => { + this.props.changeColumnSort(col, col.desc === true ? false : col.desc === false ? undefined : true); + } + + @action + changeTitleMode = () => this._showTitleDropdown = !this._showTitleDropdown + + @computed get borderWidth() { return Number(COLLECTION_BORDER_WIDTH); } + @computed get tableColumns(): Column[] { + const possibleKeys = this.props.documentKeys.filter(key => this.props.columns.findIndex(existingKey => existingKey.heading.toUpperCase() === key.toUpperCase()) === -1); + const columns: Column[] = []; + const tableIsFocused = this.props.isFocused(this.props.Document, false); + const focusedRow = this._focusedCell.row; + const focusedCol = this._focusedCell.col; + const isEditable = !this.props.headerIsEditing; + + columns.push({ + expander: true, Header: "", width: 58, + Expander: (rowInfo) => { + return rowInfo.original.type !== DocumentType.COL ? (null) : +
(this._openCollections[rowInfo.isExpanded ? "delete" : "add"])(rowInfo.viewIndex))}> + +
; + } + }); + columns.push(...this.props.columns.map(col => { + const icon: IconProp = this.getColumnType(col) === ColumnType.Number ? "hashtag" : this.getColumnType(col) === ColumnType.String ? "font" : + this.getColumnType(col) === ColumnType.Boolean ? "check-square" : this.getColumnType(col) === ColumnType.Doc ? "file" : + this.getColumnType(col) === ColumnType.Image ? "image" : this.getColumnType(col) === ColumnType.List ? "list-ul" : + this.getColumnType(col) === ColumnType.Date ? "calendar" : "align-justify"; + + const keysDropdown = c.heading)} + canAddNew={true} + addNew={false} + onSelect={this.props.changeColumns} + setIsEditing={this.props.setHeaderIsEditing} + docs={this.props.childDocs} + Document={this.props.Document} + dataDoc={this.props.dataDoc} + fieldKey={this.props.fieldKey} + ContainingCollectionDoc={this.props.ContainingCollectionDoc} + ContainingCollectionView={this.props.ContainingCollectionView} + active={this.props.active} + openHeader={this.props.openHeader} + icon={icon} + col={col} + // try commenting this out + width={"100%"} + />; + + const sortIcon = col.desc === undefined ? "caret-right" : col.desc === true ? "caret-down" : "caret-up"; + const header =
+ {keysDropdown} +
this.changeSorting(col)} style={{ width: 21, padding: 1, display: "inline", zIndex: 1, background: "inherit", cursor: "hand" }}> + +
+
; + + return { + Header: , + accessor: (doc: Doc) => doc ? Field.toString(doc[col.heading] as Field) : 0, + id: col.heading, + Cell: (rowProps: CellInfo) => { + const rowIndex = rowProps.index; + const columnIndex = this.props.columns.map(c => c.heading).indexOf(rowProps.column.id!); + const isFocused = focusedRow === rowIndex && focusedCol === columnIndex && tableIsFocused; + + const props: CellProps = { + row: rowIndex, + col: columnIndex, + rowProps: rowProps, + isFocused: isFocused, + changeFocusedCellByIndex: this.changeFocusedCellByIndex, + CollectionView: this.props.CollectionView, + ContainingCollection: this.props.ContainingCollectionView, + Document: this.props.Document, + fieldKey: this.props.fieldKey, + renderDepth: this.props.renderDepth, + addDocTab: this.props.addDocTab, + pinToPres: this.props.pinToPres, + moveDocument: this.props.moveDocument, + setIsEditing: this.setCellIsEditing, + isEditable: isEditable, + setPreviewDoc: this.props.setPreviewDoc, + setComputed: this.setComputed, + getField: this.getField, + showDoc: this.showDoc, + }; + + + switch (this.getColumnType(col, rowProps.original, rowProps.column.id)) { + case ColumnType.Number: return ; + case ColumnType.String: return ; + case ColumnType.Boolean: return ; + case ColumnType.Doc: return ; + case ColumnType.Image: return ; + case ColumnType.List: return ; + case ColumnType.Date: return ; + default: + return ; + } + }, + minWidth: 200, + }; + })); + columns.push({ + Header: , + accessor: (doc: Doc) => 0, + id: "add", + Cell: (rowProps: CellInfo) => { + const rowIndex = rowProps.index; + const columnIndex = this.props.columns.map(c => c.heading).indexOf(rowProps.column.id!); + const isFocused = focusedRow === rowIndex && focusedCol === columnIndex && tableIsFocused; + return ; + }, + width: 28, + resizable: false + }); + return columns; + } + + + constructor(props: SchemaTableProps) { + super(props); + if (this.props.Document._schemaHeaders === undefined) { + this.props.Document._schemaHeaders = new List([new SchemaHeaderField("title", "#f1efeb"), new SchemaHeaderField("author", "#f1efeb"), new SchemaHeaderField("*lastModified", "#f1efeb", ColumnType.Date), + new SchemaHeaderField("text", "#f1efeb", ColumnType.String), new SchemaHeaderField("type", "#f1efeb"), new SchemaHeaderField("context", "#f1efeb", ColumnType.Doc)]); + } + } + + componentDidMount() { + document.addEventListener("keydown", this.onKeyDown); + } + + componentWillUnmount() { + document.removeEventListener("keydown", this.onKeyDown); + } + + tableAddDoc = (doc: Doc, relativeTo?: Doc, before?: boolean) => { + const tableDoc = this.props.Document[DataSym]; + const effectiveAcl = GetEffectiveAcl(tableDoc); + + if (effectiveAcl !== AclPrivate && effectiveAcl !== AclReadonly) { + doc.context = this.props.Document; + tableDoc[this.props.fieldKey + "-lastModified"] = new DateField(new Date(Date.now())); + return Doc.AddDocToList(this.props.Document, this.props.fieldKey, doc, relativeTo, before); + } + return false; + } + + private getTrProps: ComponentPropsGetterR = (state, rowInfo) => { + return !rowInfo ? {} : { + ScreenToLocalTransform: this.props.ScreenToLocalTransform, + addDoc: this.tableAddDoc, + removeDoc: this.props.deleteDocument, + rowInfo, + rowFocused: !this.props.headerIsEditing && rowInfo.index === this._focusedCell.row && this.props.isFocused(this.props.Document, true), + textWrapRow: this.toggleTextWrapRow, + rowWrapped: this.textWrappedRows.findIndex(id => rowInfo.original[Id] === id) > -1, + dropAction: StrCast(this.props.Document.childDropAction), + addDocTab: this.props.addDocTab + }; + } + + private getTdProps: ComponentPropsGetterR = (state, rowInfo, column, instance) => { + if (!rowInfo || column) return {}; + + const row = rowInfo.index; + //@ts-ignore + const col = this.columns.map(c => c.heading).indexOf(column!.id); + const isFocused = this._focusedCell.row === row && this._focusedCell.col === col && this.props.isFocused(this.props.Document, true); + // TODO: editing border doesn't work :( + return { + style: { border: !this.props.headerIsEditing && isFocused ? "2px solid rgb(255, 160, 160)" : "1px solid #f1efeb" } + }; + } + + @action setCellIsEditing = (isEditing: boolean) => this._cellIsEditing = isEditing; + + @action + onKeyDown = (e: KeyboardEvent): void => { + if (!this._cellIsEditing && !this.props.headerIsEditing && this.props.isFocused(this.props.Document, true)) {// && this.props.isSelected(true)) { + const direction = e.key === "Tab" ? "tab" : e.which === 39 ? "right" : e.which === 37 ? "left" : e.which === 38 ? "up" : e.which === 40 ? "down" : ""; + this._focusedCell = this.changeFocusedCellByDirection(direction, this._focusedCell.row, this._focusedCell.col); + + if (direction) { + const pdoc = FieldValue(this.childDocs[this._focusedCell.row]); + pdoc && this.props.setPreviewDoc(pdoc); + e.stopPropagation(); + } + } else if (e.keyCode === 27) { + this.props.setPreviewDoc(undefined); + e.stopPropagation(); // stopPropagation for left/right arrows + } + } + + changeFocusedCellByDirection = (direction: string, curRow: number, curCol: number) => { + switch (direction) { + case "tab": return { row: (curRow + 1 === this.childDocs.length ? 0 : curRow + 1), col: curCol + 1 === this.props.columns.length ? 0 : curCol + 1 }; + case "right": return { row: curRow, col: curCol + 1 === this.props.columns.length ? curCol : curCol + 1 }; + case "left": return { row: curRow, col: curCol === 0 ? curCol : curCol - 1 }; + case "up": return { row: curRow === 0 ? curRow : curRow - 1, col: curCol }; + case "down": return { row: curRow + 1 === this.childDocs.length ? curRow : curRow + 1, col: curCol }; + } + return this._focusedCell; + } + + @action + changeFocusedCellByIndex = (row: number, col: number): void => { + if (this._focusedCell.row !== row || this._focusedCell.col !== col) { + this._focusedCell = { row: row, col: col }; + } + this.props.setFocused(this.props.Document); + } + + @undoBatch + createRow = action(() => { + this.props.addDocument?.(Docs.Create.TextDocument("", { title: "", _width: 100, _height: 30 })); + this._focusedCell = { row: this.childDocs.length, col: this._focusedCell.col }; + }); + + @undoBatch + @action + createColumn = () => { + let index = 0; + let found = this.props.columns.findIndex(col => col.heading.toUpperCase() === "New field".toUpperCase()) > -1; + while (found) { + index++; + found = this.props.columns.findIndex(col => col.heading.toUpperCase() === ("New field (" + index + ")").toUpperCase()) > -1; + } + this.props.columns.push(new SchemaHeaderField(`New field ${index ? "(" + index + ")" : ""}`, "#f1efeb")); + } + + @action + getColumnType = (column: SchemaHeaderField, doc?: Doc, field?: string): ColumnType => { + if (doc && field && column.type === ColumnType.Any) { + const val = doc[CollectionSchemaCell.resolvedFieldKey(field, doc)]; + if (val instanceof ImageField) return ColumnType.Image; + if (val instanceof Doc) return ColumnType.Doc; + if (val instanceof DateField) return ColumnType.Date; + if (val instanceof List) return ColumnType.List; + } + if (column.type && column.type !== 0) { + return column.type; + } + if (columnTypes.get(column.heading)) { + return column.type = columnTypes.get(column.heading)!; + } + return column.type = ColumnType.Any; + } + + @undoBatch + @action + toggleTextwrap = async () => { + const textwrappedRows = Cast(this.props.Document.textwrappedSchemaRows, listSpec("string"), []); + if (textwrappedRows.length) { + this.props.Document.textwrappedSchemaRows = new List([]); + } else { + const docs = DocListCast(this.props.Document[this.props.fieldKey]); + const allRows = docs instanceof Doc ? [docs[Id]] : docs.map(doc => doc[Id]); + this.props.Document.textwrappedSchemaRows = new List(allRows); + } + } + + @action + toggleTextWrapRow = (doc: Doc): void => { + const textWrapped = this.textWrappedRows; + const index = textWrapped.findIndex(id => doc[Id] === id); + + index > -1 ? textWrapped.splice(index, 1) : textWrapped.push(doc[Id]); + + this.textWrappedRows = textWrapped; + } + + @computed + get reactTable() { + const children = this.childDocs; + const hasCollectionChild = children.reduce((found, doc) => found || doc.type === DocumentType.COL, false); + const expanded: { [name: string]: any } = {}; + Array.from(this._openCollections.keys()).map(col => expanded[col.toString()] = true); + const rerender = [...this.textWrappedRows]; // TODO: get component to rerender on text wrap change without needign to console.log :(((( + + return (row.original.type !== DocumentType.COL) ? (null) : +
} + + />; + } + + onContextMenu = (e: React.MouseEvent): void => { + ContextMenu.Instance.addItem({ description: "Toggle text wrapping", event: this.toggleTextwrap, icon: "table" }); + } + + getField = (row: number, col?: number) => { + const docs = this.childDocs; + + row = row % docs.length; + while (row < 0) row += docs.length; + const columns = this.props.columns; + const doc = docs[row]; + if (col === undefined) { + return doc; + } + if (col >= 0 && col < columns.length) { + const column = this.props.columns[col].heading; + return doc[column]; + } + return undefined; + } + + createTransformer = (row: number, col: number): Transformer => { + const self = this; + const captures: { [name: string]: Field } = {}; + + const transformer: ts.TransformerFactory = context => { + return root => { + function visit(node: ts.Node) { + node = ts.visitEachChild(node, visit, context); + if (ts.isIdentifier(node)) { + const isntPropAccess = !ts.isPropertyAccessExpression(node.parent) || node.parent.expression === node; + const isntPropAssign = !ts.isPropertyAssignment(node.parent) || node.parent.name !== node; + if (isntPropAccess && isntPropAssign) { + if (node.text === "$r") { + return ts.createNumericLiteral(row.toString()); + } else if (node.text === "$c") { + return ts.createNumericLiteral(col.toString()); + } else if (node.text === "$") { + if (ts.isCallExpression(node.parent)) { + // captures.doc = self.props.Document; + // captures.key = self.props.fieldKey; + } + } + } + } + + return node; + } + return ts.visitNode(root, visit); + }; + }; + + // const getVars = () => { + // return { capturedVariables: captures }; + // }; + + return { transformer, /*getVars*/ }; + } + + setComputed = (script: string, doc: Doc, field: string, row: number, col: number): boolean => { + script = + `const $ = (row:number, col?:number) => { + const rval = (doc as any)[key][row + ${row}]; + return col === undefined ? rval : rval[(doc as any)._schemaHeaders[col + ${col}].heading]; + } + return ${script}`; + const compiled = CompileScript(script, { params: { this: Doc.name }, capturedVariables: { doc: this.props.Document, key: this.props.fieldKey }, typecheck: false, transformer: this.createTransformer(row, col) }); + if (compiled.compiled) { + doc[field] = new ComputedField(compiled); + return true; + } + return false; + } + + @action + showDoc = (doc: Doc | undefined, dataDoc?: Doc, screenX?: number, screenY?: number) => { + this._showDoc = doc; + if (dataDoc && screenX && screenY) { + this._showDocPos = this.props.ScreenToLocalTransform().transformPoint(screenX, screenY); + } + } + + onOpenClick = () => { + this._showDoc && this.props.addDocTab(this._showDoc, "add:right"); + } + + getPreviewTransform = (): Transform => { + return this.props.ScreenToLocalTransform().translate(- this.borderWidth - 4 - this.tableWidth, - this.borderWidth); + } + + render() { + const preview = ""; + return
this.props.active(true) && e.stopPropagation()} + onDrop={e => this.props.onDrop(e, {})} onContextMenu={this.onContextMenu} > + {this.reactTable} + {this.props.Document._chromeHidden ? undefined :
+ new
} + {!this._showDoc ? (null) : +
+ 150} + PanelHeight={() => 150} + ScreenToLocalTransform={this.getPreviewTransform} + docFilters={returnEmptyFilter} + docRangeFilters={returnEmptyFilter} + searchFilterDocs={returnEmptyDoclist} + ContainingCollectionDoc={this.props.CollectionView?.props.Document} + ContainingCollectionView={this.props.CollectionView} + moveDocument={this.props.moveDocument} + whenChildContentsActiveChanged={emptyFunction} + addDocTab={this.props.addDocTab} + pinToPres={this.props.pinToPres} + bringToFront={returnFalse}> + +
} +
; + } +} \ No newline at end of file diff --git a/src/client/views/nodes/DocumentContentsView.tsx b/src/client/views/nodes/DocumentContentsView.tsx index f0a54e4ac..ecf4c0901 100644 --- a/src/client/views/nodes/DocumentContentsView.tsx +++ b/src/client/views/nodes/DocumentContentsView.tsx @@ -8,7 +8,7 @@ import { emptyPath, OmitKeys, Without } from "../../../Utils"; import { DirectoryImportBox } from "../../util/Import & Export/DirectoryImportBox"; import { CollectionDockingView } from "../collections/CollectionDockingView"; import { CollectionFreeFormView } from "../collections/collectionFreeForm/CollectionFreeFormView"; -import { CollectionSchemaView } from "../collections/CollectionSchemaView"; +import { CollectionSchemaView } from "../collections/schemaView/CollectionSchemaView"; import { CollectionView } from "../collections/CollectionView"; import { InkingStroke } from "../InkingStroke"; import { PresElementBox } from "../presentationview/PresElementBox"; -- cgit v1.2.3-70-g09d2 From 0ac0b74de8578062aa7f700779613ff0e18a12ea Mon Sep 17 00:00:00 2001 From: 0x85FB9C51 <77808164+0x85FB9C51@users.noreply.github.com> Date: Thu, 8 Jul 2021 09:48:51 -0400 Subject: fixed file path mess --- src/client/views/collections/CollectionView.tsx | 2 +- .../schemaView/CollectionSchemaCells.tsx | 2 +- .../schemaView/CollectionSchemaHeaders.tsx | 3 +- .../schemaView/CollectionSchemaMovableTableHOC.tsx | 18 +++++----- .../schemaView/CollectionSchemaView.tsx | 38 +++++++++++----------- .../views/collections/schemaView/SchemaTable.tsx | 2 +- src/client/views/search/SearchBox.tsx | 4 +-- 7 files changed, 35 insertions(+), 34 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index fb60265e3..e5b1721f9 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -29,7 +29,7 @@ import CollectionMapView from './CollectionMapView'; import { CollectionMulticolumnView } from './collectionMulticolumn/CollectionMulticolumnView'; import { CollectionMultirowView } from './collectionMulticolumn/CollectionMultirowView'; import { CollectionPileView } from './CollectionPileView'; -import { CollectionSchemaView } from "./CollectionSchemaView"; +import { CollectionSchemaView } from "./schemaView/CollectionSchemaView"; import { CollectionStackingView } from './CollectionStackingView'; import { SubCollectionViewProps } from './CollectionSubView'; import { CollectionTimeView } from './CollectionTimeView'; diff --git a/src/client/views/collections/schemaView/CollectionSchemaCells.tsx b/src/client/views/collections/schemaView/CollectionSchemaCells.tsx index 2549beaae..f2df87d71 100644 --- a/src/client/views/collections/schemaView/CollectionSchemaCells.tsx +++ b/src/client/views/collections/schemaView/CollectionSchemaCells.tsx @@ -24,7 +24,7 @@ import { CompileScript } from "../../../util/Scripting"; import { SearchUtil } from "../../../util/SearchUtil"; import { SnappingManager } from "../../../util/SnappingManager"; import { undoBatch } from "../../../util/UndoManager"; -import '../DocumentDecorations.scss'; +import '../../../views/DocumentDecorations.scss'; import { EditableView } from "../../EditableView"; import { MAX_ROW_HEIGHT } from '../../globalCssVariables.scss'; import { DocumentIconContainer } from "../../nodes/DocumentIcon"; diff --git a/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx b/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx index b825d6d96..ab3076224 100644 --- a/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx +++ b/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx @@ -10,7 +10,8 @@ import { ScriptField } from "../../../../fields/ScriptField"; import { Cast, StrCast } from "../../../../fields/Types"; import { undoBatch } from "../../../util/UndoManager"; import { SearchBox } from "../../search/SearchBox"; -import { ColumnType } from "../CollectionSchemaView"; +import { ColumnType } from "./CollectionSchemaView"; +import { ColumnType2 } from "../CollectionSchemaView"; import "./CollectionSchemaView.scss"; import { CollectionView } from "../CollectionView"; diff --git a/src/client/views/collections/schemaView/CollectionSchemaMovableTableHOC.tsx b/src/client/views/collections/schemaView/CollectionSchemaMovableTableHOC.tsx index 149677976..e1066caf4 100644 --- a/src/client/views/collections/schemaView/CollectionSchemaMovableTableHOC.tsx +++ b/src/client/views/collections/schemaView/CollectionSchemaMovableTableHOC.tsx @@ -2,15 +2,15 @@ import React = require("react"); import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; import { action } from "mobx"; import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table"; -import { Doc } from "../../../fields/Doc"; -import { SchemaHeaderField } from "../../../fields/SchemaHeaderField"; -import { Cast, FieldValue, StrCast } from "../../../fields/Types"; -import { DocumentManager } from "../../util/DocumentManager"; -import { DragManager, dropActionType, SetupDrag } from "../../util/DragManager"; -import { SnappingManager } from "../../util/SnappingManager"; -import { Transform } from "../../util/Transform"; -import { undoBatch } from "../../util/UndoManager"; -import { ContextMenu } from "../ContextMenu"; +import { Doc } from "../../../../fields/Doc"; +import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; +import { Cast, FieldValue, StrCast } from "../../../../fields/Types"; +import { DocumentManager } from "../../../util/DocumentManager"; +import { DragManager, dropActionType, SetupDrag } from "../../../util/DragManager"; +import { SnappingManager } from "../../../util/SnappingManager"; +import { Transform } from "../../../util/Transform"; +import { undoBatch } from "../../../util/UndoManager"; +import { ContextMenu } from "../../ContextMenu"; import "./CollectionSchemaView.scss"; export interface MovableColumnProps { diff --git a/src/client/views/collections/schemaView/CollectionSchemaView.tsx b/src/client/views/collections/schemaView/CollectionSchemaView.tsx index b33c437a9..ef28f75c8 100644 --- a/src/client/views/collections/schemaView/CollectionSchemaView.tsx +++ b/src/client/views/collections/schemaView/CollectionSchemaView.tsx @@ -5,27 +5,27 @@ import { observer } from "mobx-react"; import Measure from "react-measure"; import { Resize } from "react-table"; import "react-table/react-table.css"; -import { Doc, Opt } from "../../../fields/Doc"; -import { List } from "../../../fields/List"; -import { listSpec } from "../../../fields/Schema"; -import { PastelSchemaPalette, SchemaHeaderField } from "../../../fields/SchemaHeaderField"; -import { Cast, NumCast } from "../../../fields/Types"; -import { TraceMobx } from "../../../fields/util"; -import { emptyFunction, emptyPath, returnFalse, setupMoveUpEvents, returnEmptyDoclist, returnTrue } from "../../../Utils"; -import { SelectionManager } from "../../util/SelectionManager"; -import { SnappingManager } from "../../util/SnappingManager"; -import { Transform } from "../../util/Transform"; -import { undoBatch } from "../../util/UndoManager"; -import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/globalCssVariables.scss'; -import { ContextMenu } from "../ContextMenu"; -import { ContextMenuProps } from "../ContextMenuItem"; -import '../DocumentDecorations.scss'; -import { DocumentView } from "../nodes/DocumentView"; -import { DefaultStyleProvider } from "../StyleProvider"; +import { Doc, Opt } from "../../../../fields/Doc"; +import { List } from "../../../../fields/List"; +import { listSpec } from "../../../../fields/Schema"; +import { PastelSchemaPalette, SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; +import { Cast, NumCast } from "../../../../fields/Types"; +import { TraceMobx } from "../../../../fields/util"; +import { emptyFunction, emptyPath, returnFalse, setupMoveUpEvents, returnEmptyDoclist, returnTrue } from "../../../../Utils"; +import { SelectionManager } from "../../../util/SelectionManager"; +import { SnappingManager } from "../../../util/SnappingManager"; +import { Transform } from "../../../util/Transform"; +import { undoBatch } from "../../../util/UndoManager"; +import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../globalCssVariables.scss'; +import { ContextMenu } from "../../ContextMenu"; +import { ContextMenuProps } from "../../ContextMenuItem"; +import '../../../views/DocumentDecorations.scss'; +import { DocumentView } from "../../nodes/DocumentView"; +import { DefaultStyleProvider } from "../../StyleProvider"; import "./CollectionSchemaView.scss"; -import { CollectionSubView } from "./CollectionSubView"; +import { CollectionSubView } from "../CollectionSubView"; import { SchemaTable } from "./SchemaTable"; -import { DocUtils } from "../../documents/Documents"; +import { DocUtils } from "../../../documents/Documents"; // bcz: need to add drag and drop of rows and columns. This seems like it might work for rows: https://codesandbox.io/s/l94mn1q657 export enum ColumnType { diff --git a/src/client/views/collections/schemaView/SchemaTable.tsx b/src/client/views/collections/schemaView/SchemaTable.tsx index c305f6806..05d77a739 100644 --- a/src/client/views/collections/schemaView/SchemaTable.tsx +++ b/src/client/views/collections/schemaView/SchemaTable.tsx @@ -23,7 +23,7 @@ import { Transform } from "../../../util/Transform"; import { undoBatch } from "../../../util/UndoManager"; import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../globalCssVariables.scss'; import { ContextMenu } from "../../ContextMenu"; -import '../DocumentDecorations.scss'; +import '../../../views/DocumentDecorations.scss'; import { DocumentView } from "../../nodes/DocumentView"; import { DefaultStyleProvider } from "../../StyleProvider"; import { CellProps, CollectionSchemaButtons, CollectionSchemaCell, CollectionSchemaCheckboxCell, CollectionSchemaDateCell, CollectionSchemaDocCell, CollectionSchemaImageCell, CollectionSchemaListCell, CollectionSchemaNumberCell, CollectionSchemaStringCell } from "./CollectionSchemaCells"; diff --git a/src/client/views/search/SearchBox.tsx b/src/client/views/search/SearchBox.tsx index 5c168d8a9..a671c955d 100644 --- a/src/client/views/search/SearchBox.tsx +++ b/src/client/views/search/SearchBox.tsx @@ -18,7 +18,7 @@ import { SetupDrag } from '../../util/DragManager'; import { SearchUtil } from '../../util/SearchUtil'; import { Transform } from '../../util/Transform'; import { CollectionDockingView } from "../collections/CollectionDockingView"; -import { CollectionSchemaView, ColumnType } from "../collections/CollectionSchemaView"; +import { CollectionSchemaView, ColumnType } from "../collections/schemaView/CollectionSchemaView"; import { CollectionViewType } from '../collections/CollectionView'; import { ViewBoxBaseComponent } from "../DocComponent"; import { FieldView, FieldViewProps } from '../nodes/FieldView'; @@ -119,7 +119,7 @@ export class SearchBox extends ViewBoxBaseComponent Date: Thu, 8 Jul 2021 10:28:08 -0400 Subject: minor bugfix for numbers with commas and periods --- src/client/views/collections/schemaView/CollectionSchemaCells.tsx | 5 +++-- 1 file changed, 3 insertions(+), 2 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/views/collections/schemaView/CollectionSchemaCells.tsx b/src/client/views/collections/schemaView/CollectionSchemaCells.tsx index f2df87d71..f75179cea 100644 --- a/src/client/views/collections/schemaView/CollectionSchemaCells.tsx +++ b/src/client/views/collections/schemaView/CollectionSchemaCells.tsx @@ -33,6 +33,7 @@ import "./CollectionSchemaView.scss"; import { CollectionView } from "../CollectionView"; const path = require('path'); +// intialize cell properties export interface CellProps { row: number; col: number; @@ -246,7 +247,7 @@ export class CollectionSchemaCell extends React.Component { // check if the input is a number let inputIsNum = true; for (let s of value) { - if (isNaN(parseInt(s))) { + if (isNaN(parseInt(s)) && !(s == ".") && !(s == ",")) { inputIsNum = false; } } @@ -373,7 +374,7 @@ export class CollectionSchemaDocCell extends CollectionSchemaCell { const script = CompileScript(value, { addReturn: true, - typecheck: false, + typecheck: true, transformer: DocumentIconContainer.getTransformer() }); -- cgit v1.2.3-70-g09d2 From 4fe24111c6eafc58927fcca9d8c46a5b92cc4078 Mon Sep 17 00:00:00 2001 From: Ashley Cai Date: Sat, 10 Jul 2021 00:17:09 -0700 Subject: Standardizing Colors, changing global CSS variables --- .VSCodeCounter/details.md | 4 +- .VSCodeCounter/results.csv | 4 +- .VSCodeCounter/results.txt | 4 +- package-lock.json | 23038 ++++++++++++++++++- src/client/ClientRecommender.scss | 2 +- src/client/documents/Documents.ts | 2 +- src/client/util/CaptureManager.scss | 2 +- src/client/util/DragManager.ts | 2 +- src/client/util/SettingsManager.scss | 4 +- src/client/views/AntimodeMenu.scss | 2 +- src/client/views/ContextMenu.scss | 18 +- src/client/views/DocumentButtonBar.scss | 12 +- src/client/views/DocumentDecorations.scss | 20 +- src/client/views/Main.scss | 6 +- src/client/views/MainView.scss | 2 +- src/client/views/MainView.tsx | 6 +- src/client/views/PropertiesButtons.scss | 16 +- src/client/views/TemplateMenu.scss | 6 +- src/client/views/animationtimeline/Keyframe.scss | 10 +- src/client/views/animationtimeline/Keyframe.tsx | 2 +- src/client/views/animationtimeline/Timeline.scss | 4 +- .../views/animationtimeline/TimelineMenu.scss | 6 +- .../views/animationtimeline/TimelineOverview.scss | 2 +- src/client/views/animationtimeline/Track.scss | 4 +- .../views/collections/CollectionDockingView.scss | 16 +- .../views/collections/CollectionLinearView.scss | 8 +- src/client/views/collections/CollectionMenu.scss | 6 +- .../views/collections/CollectionSchemaCells.tsx | 2 +- .../views/collections/CollectionSchemaView.scss | 22 +- .../views/collections/CollectionSchemaView.tsx | 24 +- .../views/collections/CollectionStackingView.scss | 12 +- .../views/collections/CollectionTreeView.scss | 8 +- src/client/views/collections/CollectionView.scss | 4 +- src/client/views/collections/SchemaTable.tsx | 2 +- src/client/views/collections/TreeView.scss | 6 +- src/client/views/collections/TreeView.tsx | 2 +- .../CollectionFreeFormRemoteCursors.scss | 2 +- .../collectionFreeForm/CollectionFreeFormView.scss | 4 +- .../collectionFreeForm/CollectionFreeFormView.tsx | 10 +- src/client/views/global/globalCssVariables.scss | 52 + .../views/global/globalCssVariables.scss.d.ts | 17 + src/client/views/global/globalEnums.tsx | 19 + src/client/views/globalCssVariables.scss | 56 - src/client/views/globalCssVariables.scss.d.ts | 17 - src/client/views/linking/LinkEditor.scss | 12 +- src/client/views/linking/LinkMenu.scss | 2 +- src/client/views/linking/LinkMenuItem.scss | 10 +- src/client/views/nodes/DocumentLinksButton.scss | 4 +- src/client/views/nodes/DocumentView.scss | 6 +- src/client/views/nodes/KeyValueBox.scss | 20 +- src/client/views/nodes/KeyValuePair.scss | 2 +- src/client/views/nodes/RadialMenu.scss | 4 +- src/client/views/nodes/WebBox.scss | 2 +- .../nodes/formattedText/FormattedTextBox.scss | 8 +- .../views/nodes/formattedText/RichTextMenu.scss | 4 +- .../views/nodes/formattedText/TooltipTextMenu.scss | 10 +- src/client/views/search/CheckBox.scss | 4 +- src/client/views/search/CollectionFilters.scss | 2 +- src/client/views/search/IconBar.scss | 2 +- src/client/views/search/IconButton.scss | 4 +- src/client/views/search/IconButton.tsx | 2 +- src/client/views/search/NaviconButton.scss | 4 +- src/client/views/search/SearchBox.scss | 10 +- src/client/views/search/SelectorContextMenu.scss | 2 +- src/client/views/search/ToggleBar.scss | 8 +- src/client/views/webcam/DashWebRTCVideo.scss | 2 +- src/mobile/AudioUpload.scss | 2 +- src/mobile/ImageUpload.scss | 2 +- src/mobile/ImageUpload.tsx | 2 +- 69 files changed, 23266 insertions(+), 331 deletions(-) create mode 100644 src/client/views/global/globalCssVariables.scss create mode 100644 src/client/views/global/globalCssVariables.scss.d.ts create mode 100644 src/client/views/global/globalEnums.tsx delete mode 100644 src/client/views/globalCssVariables.scss delete mode 100644 src/client/views/globalCssVariables.scss.d.ts (limited to 'src/client/views/collections') diff --git a/.VSCodeCounter/details.md b/.VSCodeCounter/details.md index 2f988953b..157c5ef33 100644 --- a/.VSCodeCounter/details.md +++ b/.VSCodeCounter/details.md @@ -424,8 +424,8 @@ Total : 646 files, 224911 codes, 32987 comments, 15880 blanks, all 273778 lines | [src/client/views/collections/collectionMulticolumn/MulticolumnWidthLabel.tsx](file:///Users/bcz/Documents/GitHub/Dash-Web/src/client/views/collections/collectionMulticolumn/MulticolumnWidthLabel.tsx) | TypeScript React | 51 | 0 | 5 | 56 | | [src/client/views/collections/collectionMulticolumn/MultirowHeightLabel.tsx](file:///Users/bcz/Documents/GitHub/Dash-Web/src/client/views/collections/collectionMulticolumn/MultirowHeightLabel.tsx) | TypeScript React | 51 | 0 | 5 | 56 | | [src/client/views/collections/collectionMulticolumn/MultirowResizer.tsx](file:///Users/bcz/Documents/GitHub/Dash-Web/src/client/views/collections/collectionMulticolumn/MultirowResizer.tsx) | TypeScript React | 92 | 0 | 9 | 101 | -| [src/client/views/globalCssVariables.scss](file:///Users/bcz/Documents/GitHub/Dash-Web/src/client/views/globalCssVariables.scss) | SCSS | 30 | 10 | 3 | 43 | -| [src/client/views/globalCssVariables.scss.d.ts](file:///Users/bcz/Documents/GitHub/Dash-Web/src/client/views/globalCssVariables.scss.d.ts) | TypeScript | 9 | 0 | 2 | 11 | +| [src/client/views/global/global/globalCssVariables.scss](file:///Users/bcz/Documents/GitHub/Dash-Web/src/client/views/global/global/globalCssVariables.scss) | SCSS | 30 | 10 | 3 | 43 | +| [src/client/views/global/global/globalCssVariables.scss.d.ts](file:///Users/bcz/Documents/GitHub/Dash-Web/src/client/views/global/global/globalCssVariables.scss.d.ts) | TypeScript | 9 | 0 | 2 | 11 | | [src/client/views/linking/LinkEditor.scss](file:///Users/bcz/Documents/GitHub/Dash-Web/src/client/views/linking/LinkEditor.scss) | SCSS | 124 | 1 | 25 | 150 | | [src/client/views/linking/LinkEditor.tsx](file:///Users/bcz/Documents/GitHub/Dash-Web/src/client/views/linking/LinkEditor.tsx) | TypeScript React | 252 | 7 | 50 | 309 | | [src/client/views/linking/LinkMenu.scss](file:///Users/bcz/Documents/GitHub/Dash-Web/src/client/views/linking/LinkMenu.scss) | SCSS | 40 | 0 | 13 | 53 | diff --git a/.VSCodeCounter/results.csv b/.VSCodeCounter/results.csv index b31bc8262..a346fa08d 100644 --- a/.VSCodeCounter/results.csv +++ b/.VSCodeCounter/results.csv @@ -412,8 +412,8 @@ src/client/views/collections/collectionMulticolumn/MulticolumnResizer.tsx, TypeS src/client/views/collections/collectionMulticolumn/MulticolumnWidthLabel.tsx, TypeScript React, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 51, 0, 0, 0, 0, 0, 0, 0, 5, 56 src/client/views/collections/collectionMulticolumn/MultirowHeightLabel.tsx, TypeScript React, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 51, 0, 0, 0, 0, 0, 0, 0, 5, 56 src/client/views/collections/collectionMulticolumn/MultirowResizer.tsx, TypeScript React, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 92, 0, 0, 0, 0, 0, 0, 0, 9, 101 -src/client/views/globalCssVariables.scss, SCSS, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 30, 0, 0, 0, 0, 0, 10, 3, 43 -src/client/views/globalCssVariables.scss.d.ts, TypeScript, 0, 0, 0, 0, 0, 9, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 2, 11 +src/client/views/global/globalCssVariables.scss, SCSS, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 30, 0, 0, 0, 0, 0, 10, 3, 43 +src/client/views/global/globalCssVariables.scss.d.ts, TypeScript, 0, 0, 0, 0, 0, 9, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 2, 11 src/client/views/linking/LinkEditor.scss, SCSS, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 124, 0, 0, 0, 0, 0, 1, 25, 150 src/client/views/linking/LinkEditor.tsx, TypeScript React, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 252, 0, 0, 0, 0, 0, 0, 7, 50, 309 src/client/views/linking/LinkMenu.scss, SCSS, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 40, 0, 0, 0, 0, 0, 0, 13, 53 diff --git a/.VSCodeCounter/results.txt b/.VSCodeCounter/results.txt index aaf54b147..c14fccb18 100644 --- a/.VSCodeCounter/results.txt +++ b/.VSCodeCounter/results.txt @@ -576,8 +576,8 @@ Files | src/client/views/collections/collectionMulticolumn/MulticolumnWidthLabel.tsx | TypeScript React | 51 | 0 | 5 | 56 | | src/client/views/collections/collectionMulticolumn/MultirowHeightLabel.tsx | TypeScript React | 51 | 0 | 5 | 56 | | src/client/views/collections/collectionMulticolumn/MultirowResizer.tsx | TypeScript React | 92 | 0 | 9 | 101 | -| src/client/views/globalCssVariables.scss | SCSS | 30 | 10 | 3 | 43 | -| src/client/views/globalCssVariables.scss.d.ts | TypeScript | 9 | 0 | 2 | 11 | +| src/client/views/global/globalCssVariables.scss | SCSS | 30 | 10 | 3 | 43 | +| src/client/views/global/globalCssVariables.scss.d.ts | TypeScript | 9 | 0 | 2 | 11 | | src/client/views/linking/LinkEditor.scss | SCSS | 124 | 1 | 25 | 150 | | src/client/views/linking/LinkEditor.tsx | TypeScript React | 252 | 7 | 50 | 309 | | src/client/views/linking/LinkMenu.scss | SCSS | 40 | 0 | 13 | 53 | diff --git a/package-lock.json b/package-lock.json index 3637b14ac..05e46ee09 100644 --- a/package-lock.json +++ b/package-lock.json @@ -1,8 +1,22928 @@ { "name": "dash", "version": "1.0.0", - "lockfileVersion": 1, + "lockfileVersion": 2, "requires": true, + "packages": { + "": { + "name": "dash", + "version": "1.0.0", + "dependencies": { + "@fortawesome/fontawesome-svg-core": "^1.2.29", + "@fortawesome/free-brands-svg-icons": "^5.14.0", + "@fortawesome/free-regular-svg-icons": "^5.13.1", + "@fortawesome/free-solid-svg-icons": "^5.13.1", + "@fortawesome/react-fontawesome": "^0.1.11", + "@hig/flyout": "^1.2.1", + "@hig/theme-context": "^2.1.3", + "@hig/theme-data": "^2.16.1", + "@material-ui/core": "^4.11.0", + "@react-three/fiber": "^6.0.16", + "@types/cors": "^2.8.8", + "@types/d3-axis": "^2.0.0", + "@types/d3-color": "^2.0.1", + "@types/d3-scale": "^3.2.2", + "@types/d3-selection": "^2.0.0", + "@types/google-maps": "^3.2.2", + "@types/react-reconciler": "^0.26.1", + "@types/reveal": "^3.3.33", + "@types/three": "^0.126.2", + "@types/webscopeio__react-textarea-autocomplete": "^4.6.1", + "@webscopeio/react-textarea-autocomplete": "^4.7.0", + "adm-zip": "^0.4.16", + "archiver": "^3.1.1", + "array-batcher": "^1.2.3", + "async": "^2.6.2", + "axios": "^0.19.2", + "babel-runtime": "^6.26.0", + "bcrypt-nodejs": "0.0.3", + "bezier-curve": "^1.0.0", + "bluebird": "^3.7.2", + "body-parser": "^1.18.3", + "bootstrap": "^4.5.0", + "canvas": "^2.5.0", + "child_process": "^1.0.2", + "chrome": "^0.1.0", + "class-transformer": "^0.2.0", + "color": "^3.1.2", + "colors": "^1.4.0", + "connect-flash": "^0.1.1", + "connect-mongo": "^2.0.3", + "cookie-parser": "^1.4.4", + "cookie-session": "^2.0.0-rc.1", + "cors": "^2.8.5", + "depcheck": "^0.9.2", + "equation-editor-react": "github:bobzel/equation-editor-react#useLocally", + "exif": "^0.6.0", + "express": "^4.16.4", + "express-flash": "0.0.2", + "express-session": "^1.17.0", + "express-validator": "^5.3.1", + "expressjs": "^1.0.1", + "file-saver": "^2.0.2", + "find-in-files": "^0.5.0", + "fit-curve": "^0.1.7", + "flexlayout-react": "^0.3.11", + "fluent-ffmpeg": "^2.1.2", + "formidable": "^1.2.1", + "function-plot": "^1.22.7", + "golden-layout": "^1.5.9", + "google-auth-library": "^4.2.4", + "google-maps-react": "^2.0.6", + "googleapis": "^40.0.0", + "googlephotos": "^0.2.5", + "howler": "^2.2.0", + "html-to-image": "^0.1.0", + "html-to-text": "^5.1.1", + "i": "^0.3.6", + "image-data-uri": "^2.0.1", + "image-size": "^0.7.5", + "image-size-stream": "^1.1.0", + "js-datepicker": "^4.6.6", + "jsonschema": "^1.2.5", + "jszip": "^3.5.0", + "libxmljs": "^0.19.7", + "lodash": "^4.17.15", + "material-ui": "^0.20.2", + "mobile-detect": "^1.4.4", + "mobx": "^5.15.7", + "mobx-react": "^5.4.4", + "mobx-react-devtools": "^6.1.1", + "mobx-utils": "^5.6.1", + "mongodb": "^3.5.9", + "mongoose": "^5.9.20", + "node-sass": "^4.14.1", + "node-stream-zip": "^1.11.2", + "nodemailer": "^5.1.1", + "nodemon": "^1.19.4", + "normalize.css": "^8.0.1", + "npm": "^6.14.5", + "p-limit": "^2.2.0", + "passport": "^0.4.0", + "passport-google-oauth20": "^2.0.0", + "passport-local": "^1.0.0", + "pdf-parse": "^1.1.1", + "pdfjs": "^2.3.9", + "pdfjs-dist": "^2.4.456", + "probe-image-size": "^4.0.0", + "prosemirror-commands": "^1.1.3", + "prosemirror-dev-tools": "^3.0.1", + "prosemirror-find-replace": "^0.9.0", + "prosemirror-history": "^1.1.3", + "prosemirror-inputrules": "^1.1.2", + "prosemirror-keymap": "^1.1.4", + "prosemirror-model": "^1.10.0", + "prosemirror-schema-list": "^1.1.2", + "prosemirror-state": "^1.3.2", + "prosemirror-transform": "^1.2.6", + "prosemirror-view": "^1.15.0", + "pug": "^2.0.4", + "puppeteer": "^3.3.0", + "query-string": "^6.13.1", + "raw-loader": "^1.0.0", + "rc-switch": "^1.9.0", + "react": "^16.12.0", + "react-audio-waveform": "0.0.5", + "react-autosuggest": "^9.4.3", + "react-beautiful-dnd": "^13.0.0", + "react-color": "^2.18.1", + "react-compound-slider": "^2.5.0", + "react-datepicker": "^3.0.0", + "react-dom": "^16.12.0", + "react-grid-layout": "^0.18.3", + "react-image-lightbox-with-rotate": "^5.1.1", + "react-jsx-parser": "^1.25.1", + "react-loading": "^2.0.3", + "react-measure": "^2.2.4", + "react-resizable": "^1.10.1", + "react-resizable-rotatable-draggable": "^0.2.0", + "react-reveal": "^1.2.2", + "react-select": "^3.1.0", + "react-table": "^6.11.5", + "readline": "^1.3.0", + "request": "^2.88.0", + "request-promise": "^4.2.5", + "reveal.js": "^4.0.2", + "rimraf": "^3.0.0", + "serializr": "^1.5.4", + "sharp": "^0.23.4", + "shelljs": "^0.8.3", + "socket.io": "^2.3.0", + "socket.io-client": "^2.3.0", + "solr-node": "^1.2.1", + "standard-http-error": "^2.0.1", + "styled-components": "^4.4.1", + "textarea-caret": "^3.1.0", + "three": "^0.127.0", + "translate-google-api": "^1.0.4", + "typescript-collections": "^1.3.3", + "typescript-language-server": "^0.4.0", + "url-loader": "^1.1.2", + "uuid": "^3.4.0", + "valid-url": "^1.0.9", + "web-request": "^1.0.7", + "webrtc-adapter": "^7.6.3", + "wikijs": "^6.0.1", + "words-to-numbers": "^1.5.1", + "xoauth2": "^1.2.0", + "xregexp": "^4.3.0" + }, + "devDependencies": { + "@types/adm-zip": "^0.4.32", + "@types/animejs": "^2.0.2", + "@types/archiver": "^3.0.0", + "@types/async": "^2.4.1", + "@types/bcrypt-nodejs": "0.0.30", + "@types/bluebird": "^3.5.32", + "@types/body-parser": "^1.17.1", + "@types/chai": "^4.2.7", + "@types/color": "^3.0.1", + "@types/connect-flash": "0.0.34", + "@types/cookie-parser": "^1.4.2", + "@types/cookie-session": "^2.0.41", + "@types/dotenv": "^6.1.1", + "@types/exif": "^0.6.1", + "@types/express": "^4.17.2", + "@types/express-flash": "0.0.0", + "@types/express-session": "^1.15.16", + "@types/express-validator": "^3.0.0", + "@types/file-saver": "^2.0.1", + "@types/formidable": "^1.0.31", + "@types/google-maps-react": "^2.0.5", + "@types/jquery": "^3.5.0", + "@types/libxmljs": "^0.18.5", + "@types/lodash": "^4.14.157", + "@types/mobile-detect": "^1.3.4", + "@types/mocha": "^5.2.6", + "@types/mongodb": "^3.5.25", + "@types/mongoose": "^5.7.28", + "@types/node": "^10.17.26", + "@types/nodemailer": "^4.6.6", + "@types/passport": "^1.0.2", + "@types/passport-google-oauth20": "^2.0.3", + "@types/passport-local": "^1.0.33", + "@types/pdfjs-dist": "^2.1.4", + "@types/prosemirror-commands": "^1.0.1", + "@types/prosemirror-dev-tools": "^2.1.0", + "@types/prosemirror-history": "^1.0.1", + "@types/prosemirror-inputrules": "^1.0.2", + "@types/prosemirror-keymap": "^1.0.2", + "@types/prosemirror-menu": "^1.0.2", + "@types/prosemirror-model": "^1.7.0", + "@types/prosemirror-schema-list": "^1.0.1", + "@types/prosemirror-state": "^1.2.4", + "@types/prosemirror-transform": "^1.1.1", + "@types/prosemirror-view": "^1.11.2", + "@types/rc-switch": "^1.9.0", + "@types/react": "^16.9.41", + "@types/react-autosuggest": "^9.3.14", + "@types/react-color": "^2.17.4", + "@types/react-datepicker": "^3.0.2", + "@types/react-dom": "^16.9.8", + "@types/react-grid-layout": "^0.17.1", + "@types/react-measure": "^2.0.6", + "@types/react-select": "^3.0.13", + "@types/react-table": "^6.8.6", + "@types/request": "^2.48.5", + "@types/request-promise": "^4.1.45", + "@types/rimraf": "^2.0.3", + "@types/sharp": "^0.23.1", + "@types/shelljs": "^0.8.8", + "@types/socket.io": "^2.1.8", + "@types/socket.io-client": "^1.4.33", + "@types/typescript": "^2.0.0", + "@types/uuid": "^3.4.6", + "@types/valid-url": "^1.0.3", + "@types/webpack": "^4.41.27", + "@types/webpack-dev-middleware": "^2.0.7", + "@types/webpack-hot-middleware": "^2.25.4", + "@types/xregexp": "^4.3.0", + "@types/youtube": "0.0.39", + "awesome-typescript-loader": "^5.2.1", + "chai": "^4.2.0", + "copy-webpack-plugin": "^4.6.0", + "cross-env": "^5.2.1", + "css-loader": "^2.1.1", + "dotenv": "^8.2.0", + "file-loader": "^3.0.1", + "fork-ts-checker-webpack-plugin": "^1.6.0", + "jsdom": "^15.2.1", + "mocha": "^5.2.0", + "sass-loader": "^7.3.1", + "scss-loader": "0.0.1", + "style-loader": "^0.23.1", + "ts-loader": "^5.3.3", + "ts-node": "^7.0.1", + "ts-node-dev": "^1.0.0-pre.49", + "tslint": "^5.20.1", + "tslint-loader": "^3.6.0", + "typescript": "^3.9.9", + "webpack": "^4.46.0", + "webpack-cli": "^3.3.12", + "webpack-dev-middleware": "^3.7.3", + "webpack-dev-server": "^3.11.0", + "webpack-hot-middleware": "^2.24.3" + } + }, + "node_modules/@babel/code-frame": { + "version": "7.8.3", + "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.8.3.tgz", + "integrity": "sha512-a9gxpmdXtZEInkCSHUJDLHZVBgb1QS0jhss4cPP93EW7s+uC5bikET2twEF3KV+7rDblJcmNvTR7VJejqd2C2g==", + "dependencies": { + "@babel/highlight": "^7.8.3" + } + }, + "node_modules/@babel/generator": { + "version": "7.9.6", + "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.9.6.tgz", + "integrity": "sha512-+htwWKJbH2bL72HRluF8zumBxzuX0ZZUFl3JLNyoUjM/Ho8wnVpPXM6aUz8cfKDqQ/h7zHqKt4xzJteUosckqQ==", + "dependencies": { + "@babel/types": "^7.9.6", + "jsesc": "^2.5.1", + "lodash": "^4.17.13", + "source-map": "^0.5.0" + } + }, + "node_modules/@babel/generator/node_modules/@babel/types": { + "version": "7.9.6", + "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.9.6.tgz", + "integrity": "sha512-qxXzvBO//jO9ZnoasKF1uJzHd2+M6Q2ZPIVfnFps8JJvXy0ZBbwbNOmE6SGIY5XOY6d1Bo5lb9d9RJ8nv3WSeA==", + "dependencies": { + "@babel/helper-validator-identifier": "^7.9.5", + "lodash": "^4.17.13", + "to-fast-properties": "^2.0.0" + } + }, + "node_modules/@babel/helper-annotate-as-pure": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/helper-annotate-as-pure/-/helper-annotate-as-pure-7.10.4.tgz", + "integrity": "sha512-XQlqKQP4vXFB7BN8fEEerrmYvHp3fK/rBkRFz9jaJbzK0B1DSfej9Kc7ZzE8Z/OnId1jpJdNAZ3BFQjWG68rcA==", + "dependencies": { + "@babel/types": "^7.10.4" + } + }, + "node_modules/@babel/helper-annotate-as-pure/node_modules/@babel/helper-validator-identifier": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.10.4.tgz", + "integrity": "sha512-3U9y+43hz7ZM+rzG24Qe2mufW5KhvFg/NhnNph+i9mgCtdTCtMJuI1TMkrIUiK7Ix4PYlRF9I5dhqaLYA/ADXw==" + }, + "node_modules/@babel/helper-annotate-as-pure/node_modules/@babel/types": { + "version": "7.10.5", + "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.10.5.tgz", + "integrity": "sha512-ixV66KWfCI6GKoA/2H9v6bQdbfXEwwpOdQ8cRvb4F+eyvhlaHxWFMQB4+3d9QFJXZsiiiqVrewNV0DFEQpyT4Q==", + "dependencies": { + "@babel/helper-validator-identifier": "^7.10.4", + "lodash": "^4.17.19", + "to-fast-properties": "^2.0.0" + } + }, + "node_modules/@babel/helper-annotate-as-pure/node_modules/lodash": { + "version": "4.17.19", + "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.19.tgz", + "integrity": "sha512-JNvd8XER9GQX0v2qJgsaN/mzFCNA5BRe/j8JN9d+tWyGLSodKQHKFicdwNYzWwI3wjRnaKPsGj1XkBjx/F96DQ==" + }, + "node_modules/@babel/helper-function-name": { + "version": "7.9.5", + "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.9.5.tgz", + "integrity": "sha512-JVcQZeXM59Cd1qanDUxv9fgJpt3NeKUaqBqUEvfmQ+BCOKq2xUgaWZW2hr0dkbyJgezYuplEoh5knmrnS68efw==", + "dependencies": { + "@babel/helper-get-function-arity": "^7.8.3", + "@babel/template": "^7.8.3", + "@babel/types": "^7.9.5" + } + }, + "node_modules/@babel/helper-get-function-arity": { + "version": "7.8.3", + "resolved": "https://registry.npmjs.org/@babel/helper-get-function-arity/-/helper-get-function-arity-7.8.3.tgz", + "integrity": "sha512-FVDR+Gd9iLjUMY1fzE2SR0IuaJToR4RkCDARVfsBBPSP53GEqSFjD8gNyxg246VUyc/ALRxFaAK8rVG7UT7xRA==", + "dependencies": { + "@babel/types": "^7.8.3" + } + }, + "node_modules/@babel/helper-module-imports": { + "version": "7.10.3", + "resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.10.3.tgz", + "integrity": "sha512-Jtqw5M9pahLSUWA+76nhK9OG8nwYXzhQzVIGFoNaHnXF/r4l7kz4Fl0UAW7B6mqC5myoJiBP5/YQlXQTMfHI9w==", + "dependencies": { + "@babel/types": "^7.10.3" + } + }, + "node_modules/@babel/helper-module-imports/node_modules/@babel/helper-validator-identifier": { + "version": "7.10.3", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.10.3.tgz", + "integrity": "sha512-bU8JvtlYpJSBPuj1VUmKpFGaDZuLxASky3LhaKj3bmpSTY6VWooSM8msk+Z0CZoErFye2tlABF6yDkT3FOPAXw==" + }, + "node_modules/@babel/helper-module-imports/node_modules/@babel/types": { + "version": "7.10.3", + "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.10.3.tgz", + "integrity": "sha512-nZxaJhBXBQ8HVoIcGsf9qWep3Oh3jCENK54V4mRF7qaJabVsAYdbTtmSD8WmAp1R6ytPiu5apMwSXyxB1WlaBA==", + "dependencies": { + "@babel/helper-validator-identifier": "^7.10.3", + "lodash": "^4.17.13", + "to-fast-properties": "^2.0.0" + } + }, + "node_modules/@babel/helper-split-export-declaration": { + "version": "7.8.3", + "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.8.3.tgz", + "integrity": "sha512-3x3yOeyBhW851hroze7ElzdkeRXQYQbFIb7gLK1WQYsw2GWDay5gAJNw1sWJ0VFP6z5J1whqeXH/WCdCjZv6dA==", + "dependencies": { + "@babel/types": "^7.8.3" + } + }, + "node_modules/@babel/helper-validator-identifier": { + "version": "7.9.5", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.9.5.tgz", + "integrity": "sha512-/8arLKUFq882w4tWGj9JYzRpAlZgiWUJ+dtteNTDqrRBz9Iguck9Rn3ykuBDoUwh2TO4tSAJlrxDUOXWklJe4g==" + }, + "node_modules/@babel/highlight": { + "version": "7.9.0", + "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.9.0.tgz", + "integrity": "sha512-lJZPilxX7Op3Nv/2cvFdnlepPXDxi29wxteT57Q965oc5R9v86ztx0jfxVrTcBk8C2kcPkkDa2Z4T3ZsPPVWsQ==", + "dependencies": { + "@babel/helper-validator-identifier": "^7.9.0", + "chalk": "^2.0.0", + "js-tokens": "^4.0.0" + } + }, + "node_modules/@babel/parser": { + "version": "7.9.6", + "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.9.6.tgz", + "integrity": "sha512-AoeIEJn8vt+d/6+PXDRPaksYhnlbMIiejioBZvvMQsOjW/JYK6k/0dKnvvP3EhK5GfMBWDPtrxRtegWdAcdq9Q==", + "bin": { + "parser": "bin/babel-parser.js" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@babel/runtime": { + "version": "7.9.2", + "resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.9.2.tgz", + "integrity": "sha512-NE2DtOdufG7R5vnfQUTehdTfNycfUANEtCa9PssN9O/xmTzP4E08UI797ixaei6hBEVL9BI/PsdJS5x7mWoB9Q==", + "dependencies": { + "regenerator-runtime": "^0.13.4" + } + }, + "node_modules/@babel/runtime-corejs3": { + "version": "7.9.2", + "resolved": "https://registry.npmjs.org/@babel/runtime-corejs3/-/runtime-corejs3-7.9.2.tgz", + "integrity": "sha512-HHxmgxbIzOfFlZ+tdeRKtaxWOMUoCG5Mu3wKeUmOxjYrwb3AAHgnmtCUbPPK11/raIWLIBK250t8E2BPO0p7jA==", + "dependencies": { + "core-js-pure": "^3.0.0", + "regenerator-runtime": "^0.13.4" + } + }, + "node_modules/@babel/template": { + "version": "7.8.6", + "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.8.6.tgz", + "integrity": "sha512-zbMsPMy/v0PWFZEhQJ66bqjhH+z0JgMoBWuikXybgG3Gkd/3t5oQ1Rw2WQhnSrsOmsKXnZOx15tkC4qON/+JPg==", + "dependencies": { + "@babel/code-frame": "^7.8.3", + "@babel/parser": "^7.8.6", + "@babel/types": "^7.8.6" + } + }, + "node_modules/@babel/traverse": { + "version": "7.9.6", + "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.9.6.tgz", + "integrity": "sha512-b3rAHSjbxy6VEAvlxM8OV/0X4XrG72zoxme6q1MOoe2vd0bEc+TwayhuC1+Dfgqh1QEG+pj7atQqvUprHIccsg==", + "dependencies": { + "@babel/code-frame": "^7.8.3", + "@babel/generator": "^7.9.6", + "@babel/helper-function-name": "^7.9.5", + "@babel/helper-split-export-declaration": "^7.8.3", + "@babel/parser": "^7.9.6", + "@babel/types": "^7.9.6", + "debug": "^4.1.0", + "globals": "^11.1.0", + "lodash": "^4.17.13" + } + }, + "node_modules/@babel/traverse/node_modules/@babel/types": { + "version": "7.9.6", + "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.9.6.tgz", + "integrity": "sha512-qxXzvBO//jO9ZnoasKF1uJzHd2+M6Q2ZPIVfnFps8JJvXy0ZBbwbNOmE6SGIY5XOY6d1Bo5lb9d9RJ8nv3WSeA==", + "dependencies": { + "@babel/helper-validator-identifier": "^7.9.5", + "lodash": "^4.17.13", + "to-fast-properties": "^2.0.0" + } + }, + "node_modules/@babel/traverse/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/@babel/types": { + "version": "7.9.5", + "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.9.5.tgz", + "integrity": "sha512-XjnvNqenk818r5zMaba+sLQjnbda31UfUURv3ei0qPQw4u+j2jMyJ5b11y8ZHYTRSI3NnInQkkkRT4fLqqPdHg==", + "dependencies": { + "@babel/helper-validator-identifier": "^7.9.5", + "lodash": "^4.17.13", + "to-fast-properties": "^2.0.0" + } + }, + "node_modules/@emotion/cache": { + "version": "10.0.29", + "resolved": "https://registry.npmjs.org/@emotion/cache/-/cache-10.0.29.tgz", + "integrity": "sha512-fU2VtSVlHiF27empSbxi1O2JFdNWZO+2NFHfwO0pxgTep6Xa3uGb+3pVKfLww2l/IBGLNEZl5Xf/++A4wAYDYQ==", + "dependencies": { + "@emotion/sheet": "0.9.4", + "@emotion/stylis": "0.8.5", + "@emotion/utils": "0.11.3", + "@emotion/weak-memoize": "0.2.5" + } + }, + "node_modules/@emotion/core": { + "version": "10.0.28", + "resolved": "https://registry.npmjs.org/@emotion/core/-/core-10.0.28.tgz", + "integrity": "sha512-pH8UueKYO5jgg0Iq+AmCLxBsvuGtvlmiDCOuv8fGNYn3cowFpLN98L8zO56U0H1PjDIyAlXymgL3Wu7u7v6hbA==", + "dependencies": { + "@babel/runtime": "^7.5.5", + "@emotion/cache": "^10.0.27", + "@emotion/css": "^10.0.27", + "@emotion/serialize": "^0.11.15", + "@emotion/sheet": "0.9.4", + "@emotion/utils": "0.11.3" + } + }, + "node_modules/@emotion/css": { + "version": "10.0.27", + "resolved": "https://registry.npmjs.org/@emotion/css/-/css-10.0.27.tgz", + "integrity": "sha512-6wZjsvYeBhyZQYNrGoR5yPMYbMBNEnanDrqmsqS1mzDm1cOTu12shvl2j4QHNS36UaTE0USIJawCH9C8oW34Zw==", + "dependencies": { + "@emotion/serialize": "^0.11.15", + "@emotion/utils": "0.11.3", + "babel-plugin-emotion": "^10.0.27" + } + }, + "node_modules/@emotion/hash": { + "version": "0.8.0", + "resolved": "https://registry.npmjs.org/@emotion/hash/-/hash-0.8.0.tgz", + "integrity": "sha512-kBJtf7PH6aWwZ6fka3zQ0p6SBYzx4fl1LoZXE2RrnYST9Xljm7WfKJrU4g/Xr3Beg72MLrp1AWNUmuYJTL7Cow==" + }, + "node_modules/@emotion/is-prop-valid": { + "version": "0.8.8", + "resolved": "https://registry.npmjs.org/@emotion/is-prop-valid/-/is-prop-valid-0.8.8.tgz", + "integrity": "sha512-u5WtneEAr5IDG2Wv65yhunPSMLIpuKsbuOktRojfrEiEvRyC85LgPMZI63cr7NUqT8ZIGdSVg8ZKGxIug4lXcA==", + "dependencies": { + "@emotion/memoize": "0.7.4" + } + }, + "node_modules/@emotion/memoize": { + "version": "0.7.4", + "resolved": "https://registry.npmjs.org/@emotion/memoize/-/memoize-0.7.4.tgz", + "integrity": "sha512-Ja/Vfqe3HpuzRsG1oBtWTHk2PGZ7GR+2Vz5iYGelAw8dx32K0y7PjVuxK6z1nMpZOqAFsRUPCkK1YjJ56qJlgw==" + }, + "node_modules/@emotion/serialize": { + "version": "0.11.16", + "resolved": "https://registry.npmjs.org/@emotion/serialize/-/serialize-0.11.16.tgz", + "integrity": "sha512-G3J4o8by0VRrO+PFeSc3js2myYNOXVJ3Ya+RGVxnshRYgsvErfAOglKAiy1Eo1vhzxqtUvjCyS5gtewzkmvSSg==", + "dependencies": { + "@emotion/hash": "0.8.0", + "@emotion/memoize": "0.7.4", + "@emotion/unitless": "0.7.5", + "@emotion/utils": "0.11.3", + "csstype": "^2.5.7" + } + }, + "node_modules/@emotion/sheet": { + "version": "0.9.4", + "resolved": "https://registry.npmjs.org/@emotion/sheet/-/sheet-0.9.4.tgz", + "integrity": "sha512-zM9PFmgVSqBw4zL101Q0HrBVTGmpAxFZH/pYx/cjJT5advXguvcgjHFTCaIO3enL/xr89vK2bh0Mfyj9aa0ANA==" + }, + "node_modules/@emotion/styled": { + "version": "10.0.27", + "resolved": "https://registry.npmjs.org/@emotion/styled/-/styled-10.0.27.tgz", + "integrity": "sha512-iK/8Sh7+NLJzyp9a5+vIQIXTYxfT4yB/OJbjzQanB2RZpvmzBQOHZWhpAMZWYEKRNNbsD6WfBw5sVWkb6WzS/Q==", + "dependencies": { + "@emotion/styled-base": "^10.0.27", + "babel-plugin-emotion": "^10.0.27" + } + }, + "node_modules/@emotion/styled-base": { + "version": "10.0.31", + "resolved": "https://registry.npmjs.org/@emotion/styled-base/-/styled-base-10.0.31.tgz", + "integrity": "sha512-wTOE1NcXmqMWlyrtwdkqg87Mu6Rj1MaukEoEmEkHirO5IoHDJ8LgCQL4MjJODgxWxXibGR3opGp1p7YvkNEdXQ==", + "dependencies": { + "@babel/runtime": "^7.5.5", + "@emotion/is-prop-valid": "0.8.8", + "@emotion/serialize": "^0.11.15", + "@emotion/utils": "0.11.3" + } + }, + "node_modules/@emotion/stylis": { + "version": "0.8.5", + "resolved": "https://registry.npmjs.org/@emotion/stylis/-/stylis-0.8.5.tgz", + "integrity": "sha512-h6KtPihKFn3T9fuIrwvXXUOwlx3rfUvfZIcP5a6rh8Y7zjE3O06hT5Ss4S/YI1AYhuZ1kjaE/5EaOOI2NqSylQ==" + }, + "node_modules/@emotion/unitless": { + "version": "0.7.5", + "resolved": "https://registry.npmjs.org/@emotion/unitless/-/unitless-0.7.5.tgz", + "integrity": "sha512-OWORNpfjMsSSUBVrRBVGECkhWcULOAJz9ZW8uK9qgxD+87M7jHRcvh/A96XXNhXTLmKcoYSQtBEX7lHMO7YRwg==" + }, + "node_modules/@emotion/utils": { + "version": "0.11.3", + "resolved": "https://registry.npmjs.org/@emotion/utils/-/utils-0.11.3.tgz", + "integrity": "sha512-0o4l6pZC+hI88+bzuaX/6BgOvQVhbt2PfmxauVaYOGgbsAw14wdKyvMCZXnsnsHys94iadcF+RG/wZyx6+ZZBw==" + }, + "node_modules/@emotion/weak-memoize": { + "version": "0.2.5", + "resolved": "https://registry.npmjs.org/@emotion/weak-memoize/-/weak-memoize-0.2.5.tgz", + "integrity": "sha512-6U71C2Wp7r5XtFtQzYrW5iKFT67OixrSxjI4MptCHzdSVlgabczzqLe0ZSgnub/5Kp4hSbpDB1tMytZY9pwxxA==" + }, + "node_modules/@fortawesome/fontawesome-common-types": { + "version": "0.2.29", + "resolved": "https://registry.npmjs.org/@fortawesome/fontawesome-common-types/-/fontawesome-common-types-0.2.29.tgz", + "integrity": "sha512-cY+QfDTbZ7XVxzx7jxbC98Oxr/zc7R2QpTLqTxqlfyXDrAJjzi/xUIqAUsygELB62JIrbsWxtSRhayKFkGI7MA==", + "engines": { + "node": ">=6" + } + }, + "node_modules/@fortawesome/fontawesome-svg-core": { + "version": "1.2.29", + "resolved": "https://registry.npmjs.org/@fortawesome/fontawesome-svg-core/-/fontawesome-svg-core-1.2.29.tgz", + "integrity": "sha512-xmPmP2t8qrdo8RyKihTkGb09RnZoc+7HFBCnr0/6ZhStdGDSLeEd7ajV181+2W29NWIFfylO13rU+s3fpy3cnA==", + "dependencies": { + "@fortawesome/fontawesome-common-types": "^0.2.29" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/@fortawesome/free-brands-svg-icons": { + "version": "5.14.0", + "resolved": "https://registry.npmjs.org/@fortawesome/free-brands-svg-icons/-/free-brands-svg-icons-5.14.0.tgz", + "integrity": "sha512-WsqPFTvJFI7MYkcy0jeFE2zY+blC4OrnB9MJOcn1NxRXT/sSfEEhrI7CwzIkiYajLiVDBKWeErYOvpsMeodmCQ==", + "dependencies": { + "@fortawesome/fontawesome-common-types": "^0.2.30" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/@fortawesome/free-brands-svg-icons/node_modules/@fortawesome/fontawesome-common-types": { + "version": "0.2.30", + "resolved": "https://registry.npmjs.org/@fortawesome/fontawesome-common-types/-/fontawesome-common-types-0.2.30.tgz", + "integrity": "sha512-TsRwpTuKwFNiPhk1UfKgw7zNPeV5RhNp2Uw3pws+9gDAkPGKrtjR1y2lI3SYn7+YzyfuNknflpBA1LRKjt7hMg==", + "engines": { + "node": ">=6" + } + }, + "node_modules/@fortawesome/free-regular-svg-icons": { + "version": "5.13.1", + "resolved": "https://registry.npmjs.org/@fortawesome/free-regular-svg-icons/-/free-regular-svg-icons-5.13.1.tgz", + "integrity": "sha512-sSeaqqmv2ovA5LKcrbh3VnEDZHVhaxijWKm4R0AdT0eG21pgxNsJbStD8lW9z6bgSuWXRNHhbhOmARuRCLS8tw==", + "dependencies": { + "@fortawesome/fontawesome-common-types": "^0.2.29" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/@fortawesome/free-solid-svg-icons": { + "version": "5.13.1", + "resolved": "https://registry.npmjs.org/@fortawesome/free-solid-svg-icons/-/free-solid-svg-icons-5.13.1.tgz", + "integrity": "sha512-LQH/0L1p4+rqtoSHa9qFYR84hpuRZKqaQ41cfBQx8b68p21zoWSekTAeA54I/2x9VlCHDLFlG74Nmdg4iTPQOg==", + "dependencies": { + "@fortawesome/fontawesome-common-types": "^0.2.29" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/@fortawesome/react-fontawesome": { + "version": "0.1.11", + "resolved": "https://registry.npmjs.org/@fortawesome/react-fontawesome/-/react-fontawesome-0.1.11.tgz", + "integrity": "sha512-sClfojasRifQKI0OPqTy8Ln8iIhnxR/Pv/hukBhWnBz9kQRmqi6JSH3nghlhAY7SUeIIM7B5/D2G8WjX0iepVg==", + "dependencies": { + "prop-types": "^15.7.2" + } + }, + "node_modules/@hig/flyout": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/@hig/flyout/-/flyout-1.2.1.tgz", + "integrity": "sha512-oNybmhStyMmEC07DPsjMZg4Dgm65X7Jcp2nDFR9zZghVof/1C3WJtJvdouVgqx7BJw2IedVj8CUGoPuoll/0IQ==", + "dependencies": { + "@hig/utils": "^0.4.0", + "emotion": "^10.0.0", + "prop-types": "^15.7.1", + "react-transition-group": "^2.3.1" + } + }, + "node_modules/@hig/theme-context": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/@hig/theme-context/-/theme-context-2.1.3.tgz", + "integrity": "sha512-c0Ju+Z8C532ZZtjwOLzN+XeO+pL3kqUawu6ZG3J084MH5RM9W8JCKyMf4D9Qr38jFWoiX6u8yiSxxjV/mz9Sqw==", + "dependencies": { + "create-react-context": "^0.2.3", + "prop-types": "^15.6.1" + } + }, + "node_modules/@hig/theme-data": { + "version": "2.16.1", + "resolved": "https://registry.npmjs.org/@hig/theme-data/-/theme-data-2.16.1.tgz", + "integrity": "sha512-3nBnzRqYyc6ejoCgA+zBjQGqe6LAXlcemTs0257E5bWu/JyZe8YyOLN+psq2zyjF+FUk35p38wWNPyaOcPnhvw==", + "dependencies": { + "tinycolor2": "^1.4.1" + } + }, + "node_modules/@hig/utils": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/@hig/utils/-/utils-0.4.0.tgz", + "integrity": "sha512-EQnMGZKdPh9UJaBUKLKXp92sSoCo+PTpgrGNd8q+71uRFdD0udMu/+yeVekTEtNOJcCk1gnKfyg1rRvIbTcpRw==", + "dependencies": { + "emotion": "^10.0.0", + "lodash.memoize": "^4.1.2" + } + }, + "node_modules/@icons/material": { + "version": "0.2.4", + "resolved": "https://registry.npmjs.org/@icons/material/-/material-0.2.4.tgz", + "integrity": "sha512-QPcGmICAPbGLGb6F/yNf/KzKqvFx8z5qx3D1yFqVAjoFmXK35EgyW+cJ57Te3CNsmzblwtzakLGFqHPqrfb4Tw==" + }, + "node_modules/@log4js-node/log4js-api": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/@log4js-node/log4js-api/-/log4js-api-1.0.2.tgz", + "integrity": "sha512-6SJfx949YEWooh/CUPpJ+F491y4BYJmknz4hUN1+RHvKoUEynKbRmhnwbk/VLmh4OthLLDNCyWXfbh4DG1cTXA==" + }, + "node_modules/@material-ui/core": { + "version": "4.11.0", + "resolved": "https://registry.npmjs.org/@material-ui/core/-/core-4.11.0.tgz", + "integrity": "sha512-bYo9uIub8wGhZySHqLQ833zi4ZML+XCBE1XwJ8EuUVSpTWWG57Pm+YugQToJNFsEyiKFhPh8DPD0bgupz8n01g==", + "dependencies": { + "@babel/runtime": "^7.4.4", + "@material-ui/styles": "^4.10.0", + "@material-ui/system": "^4.9.14", + "@material-ui/types": "^5.1.0", + "@material-ui/utils": "^4.10.2", + "@types/react-transition-group": "^4.2.0", + "clsx": "^1.0.4", + "hoist-non-react-statics": "^3.3.2", + "popper.js": "1.16.1-lts", + "prop-types": "^15.7.2", + "react-is": "^16.8.0", + "react-transition-group": "^4.4.0" + }, + "engines": { + "node": ">=8.0.0" + } + }, + "node_modules/@material-ui/core/node_modules/dom-helpers": { + "version": "5.1.4", + "resolved": "https://registry.npmjs.org/dom-helpers/-/dom-helpers-5.1.4.tgz", + "integrity": "sha512-TjMyeVUvNEnOnhzs6uAn9Ya47GmMo3qq7m+Lr/3ON0Rs5kHvb8I+SQYjLUSYn7qhEm0QjW0yrBkvz9yOrwwz1A==", + "dependencies": { + "@babel/runtime": "^7.8.7", + "csstype": "^2.6.7" + } + }, + "node_modules/@material-ui/core/node_modules/popper.js": { + "version": "1.16.1-lts", + "resolved": "https://registry.npmjs.org/popper.js/-/popper.js-1.16.1-lts.tgz", + "integrity": "sha512-Kjw8nKRl1m+VrSFCoVGPph93W/qrSO7ZkqPpTf7F4bk/sqcfWK019dWBUpE/fBOsOQY1dks/Bmcbfn1heM/IsA==" + }, + "node_modules/@material-ui/core/node_modules/react-transition-group": { + "version": "4.4.1", + "resolved": "https://registry.npmjs.org/react-transition-group/-/react-transition-group-4.4.1.tgz", + "integrity": "sha512-Djqr7OQ2aPUiYurhPalTrVy9ddmFCCzwhqQmtN+J3+3DzLO209Fdr70QrN8Z3DsglWql6iY1lDWAfpFiBtuKGw==", + "dependencies": { + "@babel/runtime": "^7.5.5", + "dom-helpers": "^5.0.1", + "loose-envify": "^1.4.0", + "prop-types": "^15.6.2" + } + }, + "node_modules/@material-ui/styles": { + "version": "4.10.0", + "resolved": "https://registry.npmjs.org/@material-ui/styles/-/styles-4.10.0.tgz", + "integrity": "sha512-XPwiVTpd3rlnbfrgtEJ1eJJdFCXZkHxy8TrdieaTvwxNYj42VnnCyFzxYeNW9Lhj4V1oD8YtQ6S5Gie7bZDf7Q==", + "dependencies": { + "@babel/runtime": "^7.4.4", + "@emotion/hash": "^0.8.0", + "@material-ui/types": "^5.1.0", + "@material-ui/utils": "^4.9.6", + "clsx": "^1.0.4", + "csstype": "^2.5.2", + "hoist-non-react-statics": "^3.3.2", + "jss": "^10.0.3", + "jss-plugin-camel-case": "^10.0.3", + "jss-plugin-default-unit": "^10.0.3", + "jss-plugin-global": "^10.0.3", + "jss-plugin-nested": "^10.0.3", + "jss-plugin-props-sort": "^10.0.3", + "jss-plugin-rule-value-function": "^10.0.3", + "jss-plugin-vendor-prefixer": "^10.0.3", + "prop-types": "^15.7.2" + }, + "engines": { + "node": ">=8.0.0" + } + }, + "node_modules/@material-ui/system": { + "version": "4.9.14", + "resolved": "https://registry.npmjs.org/@material-ui/system/-/system-4.9.14.tgz", + "integrity": "sha512-oQbaqfSnNlEkXEziDcJDDIy8pbvwUmZXWNqlmIwDqr/ZdCK8FuV3f4nxikUh7hvClKV2gnQ9djh5CZFTHkZj3w==", + "dependencies": { + "@babel/runtime": "^7.4.4", + "@material-ui/utils": "^4.9.6", + "csstype": "^2.5.2", + "prop-types": "^15.7.2" + }, + "engines": { + "node": ">=8.0.0" + } + }, + "node_modules/@material-ui/types": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/@material-ui/types/-/types-5.1.0.tgz", + "integrity": "sha512-7cqRjrY50b8QzRSYyhSpx4WRw2YuO0KKIGQEVk5J8uoz2BanawykgZGoWEqKm7pVIbzFDN0SpPcVV4IhOFkl8A==" + }, + "node_modules/@material-ui/utils": { + "version": "4.10.2", + "resolved": "https://registry.npmjs.org/@material-ui/utils/-/utils-4.10.2.tgz", + "integrity": "sha512-eg29v74P7W5r6a4tWWDAAfZldXIzfyO1am2fIsC39hdUUHm/33k6pGOKPbgDjg/U/4ifmgAePy/1OjkKN6rFRw==", + "dependencies": { + "@babel/runtime": "^7.4.4", + "prop-types": "^15.7.2", + "react-is": "^16.8.0" + }, + "engines": { + "node": ">=8.0.0" + } + }, + "node_modules/@react-three/fiber": { + "version": "6.0.16", + "resolved": "https://registry.npmjs.org/@react-three/fiber/-/fiber-6.0.16.tgz", + "integrity": "sha512-oKMYNJOd5t+V4o18aRMhaRhcDQ1NeeCDy52yJvXpu7zrsR04YZtXD4RacW0FDH0KnwkOLDst95LCCphm3Thk/A==", + "dependencies": { + "@babel/runtime": "^7.13.10", + "react-merge-refs": "^1.1.0", + "react-reconciler": "^0.26.2", + "react-three-fiber": "0.0.0-deprecated", + "react-use-measure": "^2.0.4", + "resize-observer-polyfill": "^1.5.1", + "scheduler": "^0.20.2", + "use-asset": "^1.0.4", + "utility-types": "^3.10.0", + "zustand": "^3.3.3" + } + }, + "node_modules/@react-three/fiber/node_modules/@babel/runtime": { + "version": "7.13.17", + "resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.13.17.tgz", + "integrity": "sha512-NCdgJEelPTSh+FEFylhnP1ylq848l1z9t9N0j1Lfbcw0+KXGjsTvUmkxy+voLLXB5SOKMbLLx4jxYliGrYQseA==", + "dependencies": { + "regenerator-runtime": "^0.13.4" + } + }, + "node_modules/@react-three/fiber/node_modules/scheduler": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/scheduler/-/scheduler-0.20.2.tgz", + "integrity": "sha512-2eWfGgAqqWFGqtdMmcL5zCMK1U8KlXv8SQFGglL3CEtd0aDVDWgeF/YoCmvln55m5zSk3J/20hTaSBeSObsQDQ==", + "dependencies": { + "loose-envify": "^1.1.0", + "object-assign": "^4.1.1" + } + }, + "node_modules/@rkusa/linebreak": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/@rkusa/linebreak/-/linebreak-1.0.0.tgz", + "integrity": "sha512-yCSm87XA1aYMgfcABSxcIkk3JtCw3AihNceHY+DnZGLvVP/g2z3UWZbi0xIoYpZWAJEVPr5Zt3QE37Q80wF1pA==", + "dependencies": { + "unicode-trie": "^0.3.0" + } + }, + "node_modules/@types/adm-zip": { + "version": "0.4.33", + "resolved": "https://registry.npmjs.org/@types/adm-zip/-/adm-zip-0.4.33.tgz", + "integrity": "sha512-WM0DCWFLjXtddl0fu0+iN2ZF+qz8RF9RddG5OSy/S90AQz01Fu8lHn/3oTIZDxvG8gVcnBLAHMHOdBLbV6m6Mw==", + "dev": true, + "dependencies": { + "@types/node": "*" + } + }, + "node_modules/@types/animejs": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/@types/animejs/-/animejs-2.0.2.tgz", + "integrity": "sha512-ACymFQ5qgSrZNR1Fqjk7Wv9gH6dFgejn2gpLkkceWxTKzivRJsshX4xhBVALgvF79gUdXiMCRIdusN728XpeGA==", + "dev": true + }, + "node_modules/@types/anymatch": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/@types/anymatch/-/anymatch-1.3.1.tgz", + "integrity": "sha512-/+CRPXpBDpo2RK9C68N3b2cOvO0Cf5B9aPijHsoDQTHivnGSObdOF2BRQOYjojWTDy6nQvMjmqRXIxH55VjxxA==", + "dev": true + }, + "node_modules/@types/archiver": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/@types/archiver/-/archiver-3.1.0.tgz", + "integrity": "sha512-nTvHwgWONL+iXG+9CX+gnQ/tTOV+qucAjwpXqeUn4OCRMxP42T29FFP/7XaOo0EqqO3TlENhObeZEe7RUJAriw==", + "dev": true, + "dependencies": { + "@types/glob": "*" + } + }, + "node_modules/@types/assert": { + "version": "1.5.4", + "resolved": "https://registry.npmjs.org/@types/assert/-/assert-1.5.4.tgz", + "integrity": "sha512-CaFVW21Ulu0J9sUaEWJjwmhkDkeoxa4fniVSERzZC13sU9v8NNM2lMlkfZZv60j47D+qDt0Lyo8skVP3CTXUdA==" + }, + "node_modules/@types/async": { + "version": "2.4.2", + "resolved": "https://registry.npmjs.org/@types/async/-/async-2.4.2.tgz", + "integrity": "sha512-bWBbC7VG2jdjbgZMX0qpds8U/3h3anfIqE81L8jmVrgFZw/urEDnBA78ymGGKTTK6ciBXmmJ/xlok+Re41S8ww==", + "dev": true + }, + "node_modules/@types/babel-types": { + "version": "7.0.7", + "resolved": "https://registry.npmjs.org/@types/babel-types/-/babel-types-7.0.7.tgz", + "integrity": "sha512-dBtBbrc+qTHy1WdfHYjBwRln4+LWqASWakLHsWHR2NWHIFkv4W3O070IGoGLEBrJBvct3r0L1BUPuvURi7kYUQ==" + }, + "node_modules/@types/babylon": { + "version": "6.16.5", + "resolved": "https://registry.npmjs.org/@types/babylon/-/babylon-6.16.5.tgz", + "integrity": "sha512-xH2e58elpj1X4ynnKp9qSnWlsRTIs6n3tgLGNfwAGHwePw0mulHQllV34n0T25uYSu1k0hRKkWXF890B1yS47w==", + "dependencies": { + "@types/babel-types": "*" + } + }, + "node_modules/@types/bcrypt-nodejs": { + "version": "0.0.30", + "resolved": "https://registry.npmjs.org/@types/bcrypt-nodejs/-/bcrypt-nodejs-0.0.30.tgz", + "integrity": "sha1-TN2WtJKTs5MhIuS34pVD415rrlg=", + "dev": true + }, + "node_modules/@types/bluebird": { + "version": "3.5.32", + "resolved": "https://registry.npmjs.org/@types/bluebird/-/bluebird-3.5.32.tgz", + "integrity": "sha512-dIOxFfI0C+jz89g6lQ+TqhGgPQ0MxSnh/E4xuC0blhFtyW269+mPG5QeLgbdwst/LvdP8o1y0o/Gz5EHXLec/g==", + "dev": true + }, + "node_modules/@types/body-parser": { + "version": "1.19.0", + "resolved": "https://registry.npmjs.org/@types/body-parser/-/body-parser-1.19.0.tgz", + "integrity": "sha512-W98JrE0j2K78swW4ukqMleo8R7h/pFETjM2DQ90MF6XK2i4LO4W3gQ71Lt4w3bfm2EvVSyWHplECvB5sK22yFQ==", + "dependencies": { + "@types/connect": "*", + "@types/node": "*" + } + }, + "node_modules/@types/bson": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/@types/bson/-/bson-4.0.2.tgz", + "integrity": "sha512-+uWmsejEHfmSjyyM/LkrP0orfE2m5Mx9Xel4tXNeqi1ldK5XMQcDsFkBmLDtuyKUbxj2jGDo0H240fbCRJZo7Q==", + "dev": true, + "dependencies": { + "@types/node": "*" + } + }, + "node_modules/@types/caseless": { + "version": "0.12.2", + "resolved": "https://registry.npmjs.org/@types/caseless/-/caseless-0.12.2.tgz", + "integrity": "sha512-6ckxMjBBD8URvjB6J3NcnuAn5Pkl7t3TizAg+xdlzzQGSPSmBcXf8KoIH0ua/i+tio+ZRUHEXp0HEmvaR4kt0w==", + "dev": true + }, + "node_modules/@types/chai": { + "version": "4.2.11", + "resolved": "https://registry.npmjs.org/@types/chai/-/chai-4.2.11.tgz", + "integrity": "sha512-t7uW6eFafjO+qJ3BIV2gGUyZs27egcNRkUdalkud+Qa3+kg//f129iuOFivHDXQ+vnU3fDXuwgv0cqMCbcE8sw==", + "dev": true + }, + "node_modules/@types/color": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/@types/color/-/color-3.0.1.tgz", + "integrity": "sha512-oeUWVaAwI+xINDUx+3F2vJkl/vVB03VChFF/Gl3iQCdbcakjuoJyMOba+3BXRtnBhxZ7uBYqQBi9EpLnvSoztA==", + "dev": true, + "dependencies": { + "@types/color-convert": "*" + } + }, + "node_modules/@types/color-convert": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@types/color-convert/-/color-convert-1.9.0.tgz", + "integrity": "sha512-OKGEfULrvSL2VRbkl/gnjjgbbF7ycIlpSsX7Nkab4MOWi5XxmgBYvuiQ7lcCFY5cPDz7MUNaKgxte2VRmtr4Fg==", + "dev": true, + "dependencies": { + "@types/color-name": "*" + } + }, + "node_modules/@types/color-name": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/@types/color-name/-/color-name-1.1.1.tgz", + "integrity": "sha512-rr+OQyAjxze7GgWrSaJwydHStIhHq2lvY3BOC2Mj7KnzI7XK0Uw1TOOdI9lDoajEbSWLiYgoo4f1R51erQfhPQ==" + }, + "node_modules/@types/connect": { + "version": "3.4.33", + "resolved": "https://registry.npmjs.org/@types/connect/-/connect-3.4.33.tgz", + "integrity": "sha512-2+FrkXY4zllzTNfJth7jOqEHC+enpLeGslEhpnTAkg21GkRrWV4SsAtqchtT4YS9/nODBU2/ZfsBY2X4J/dX7A==", + "dependencies": { + "@types/node": "*" + } + }, + "node_modules/@types/connect-flash": { + "version": "0.0.34", + "resolved": "https://registry.npmjs.org/@types/connect-flash/-/connect-flash-0.0.34.tgz", + "integrity": "sha512-QC93TwnTZ0sk//bfT81o7U4GOedbOZAcgvqi0v1vJqCESC8tqIVnhzB1CHiAUBUWFjoxG5JQF0TYaNa6DMb6Ig==", + "dev": true, + "dependencies": { + "@types/express": "*" + } + }, + "node_modules/@types/cookie-parser": { + "version": "1.4.2", + "resolved": "https://registry.npmjs.org/@types/cookie-parser/-/cookie-parser-1.4.2.tgz", + "integrity": "sha512-uwcY8m6SDQqciHsqcKDGbo10GdasYsPCYkH3hVegj9qAah6pX5HivOnOuI3WYmyQMnOATV39zv/Ybs0bC/6iVg==", + "dev": true, + "dependencies": { + "@types/express": "*" + } + }, + "node_modules/@types/cookie-session": { + "version": "2.0.41", + "resolved": "https://registry.npmjs.org/@types/cookie-session/-/cookie-session-2.0.41.tgz", + "integrity": "sha512-Ytd7zWY3WvC7TP9rKVjlnYHus8Hq+lJuioHOtKJ7dXg2Nt+O+9UpelygYy5Eb67QQN92HPO5qEG0vnmAlqRLLw==", + "dev": true, + "dependencies": { + "@types/express": "*", + "@types/keygrip": "*" + } + }, + "node_modules/@types/cors": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/@types/cors/-/cors-2.8.8.tgz", + "integrity": "sha512-fO3gf3DxU2Trcbr75O7obVndW/X5k8rJNZkLXlQWStTHhP71PkRqjwPIEI0yMnJdg9R9OasjU+Bsr+Hr1xy/0w==", + "dependencies": { + "@types/express": "*" + } + }, + "node_modules/@types/d3-axis": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/@types/d3-axis/-/d3-axis-2.0.0.tgz", + "integrity": "sha512-gUdlEwGBLl3tXGiBnBNmNzph9W3bCfa4tBgWZD60Z1eDQKTY4zyCAcZ3LksignGfKawYatmDYcBdjJ5h/54sqA==", + "dependencies": { + "@types/d3-selection": "*" + } + }, + "node_modules/@types/d3-color": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/@types/d3-color/-/d3-color-2.0.1.tgz", + "integrity": "sha512-u7LTCL7RnaavFSmob2rIAJLNwu50i6gFwY9cHFr80BrQURYQBRkJ+Yv47nA3Fm7FeRhdWTiVTeqvSeOuMAOzBQ==" + }, + "node_modules/@types/d3-scale": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/@types/d3-scale/-/d3-scale-3.2.2.tgz", + "integrity": "sha512-qpQe8G02tzUwt9sdWX1h8A/W0Q1+N48wMnYXVOkrzeLUkCfvzJYV9Ee3aORCS4dN4ONRLFmMvaXdziQ29XGLjQ==", + "dependencies": { + "@types/d3-time": "*" + } + }, + "node_modules/@types/d3-selection": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/@types/d3-selection/-/d3-selection-2.0.0.tgz", + "integrity": "sha512-EF0lWZ4tg7oDFg4YQFlbOU3936e3a9UmoQ2IXlBy1+cv2c2Pv7knhKUzGlH5Hq2sF/KeDTH1amiRPey2rrLMQA==" + }, + "node_modules/@types/d3-time": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/@types/d3-time/-/d3-time-2.0.0.tgz", + "integrity": "sha512-Abz8bTzy8UWDeYs9pCa3D37i29EWDjNTjemdk0ei1ApYVNqulYlGUKip/jLOpogkPSsPz/GvZCYiC7MFlEk0iQ==" + }, + "node_modules/@types/dotenv": { + "version": "6.1.1", + "resolved": "https://registry.npmjs.org/@types/dotenv/-/dotenv-6.1.1.tgz", + "integrity": "sha512-ftQl3DtBvqHl9L16tpqqzA4YzCSXZfi7g8cQceTz5rOlYtk/IZbFjAv3mLOQlNIgOaylCQWQoBdDQHPgEBJPHg==", + "dev": true, + "dependencies": { + "@types/node": "*" + } + }, + "node_modules/@types/engine.io": { + "version": "3.1.4", + "resolved": "https://registry.npmjs.org/@types/engine.io/-/engine.io-3.1.4.tgz", + "integrity": "sha512-98rXVukLD6/ozrQ2O80NAlWDGA4INg+tqsEReWJldqyi2fulC9V7Use/n28SWgROXKm6003ycWV4gZHoF8GA6w==", + "dev": true, + "dependencies": { + "@types/node": "*" + } + }, + "node_modules/@types/events": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/@types/events/-/events-3.0.0.tgz", + "integrity": "sha512-EaObqwIvayI5a8dCzhFrjKzVwKLxjoG9T6Ppd5CEo07LRKfQ8Yokw54r5+Wq7FaBQ+yXRvQAYPrHwya1/UFt9g==", + "dev": true + }, + "node_modules/@types/exif": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/@types/exif/-/exif-0.6.1.tgz", + "integrity": "sha512-hw4RQiuu+L//CpZ1vL3EopGY3L6mGvPFK2CpWCmvlwUAquvosWfCU3ZFq9jsZ2rmIun71XJm2I2KPx7tT1VuxA==", + "dev": true, + "dependencies": { + "@types/node": "*" + } + }, + "node_modules/@types/express": { + "version": "4.17.6", + "resolved": "https://registry.npmjs.org/@types/express/-/express-4.17.6.tgz", + "integrity": "sha512-n/mr9tZI83kd4azlPG5y997C/M4DNABK9yErhFM6hKdym4kkmd9j0vtsJyjFIwfRBxtrxZtAfGZCNRIBMFLK5w==", + "dependencies": { + "@types/body-parser": "*", + "@types/express-serve-static-core": "*", + "@types/qs": "*", + "@types/serve-static": "*" + } + }, + "node_modules/@types/express-flash": { + "version": "0.0.0", + "resolved": "https://registry.npmjs.org/@types/express-flash/-/express-flash-0.0.0.tgz", + "integrity": "sha512-zs1xXRIZOjghUBriJPSnhPmfDpqf/EQxT21ggi/9XZ9/RHYrUi+5vK2jnQrP2pD1abbuZvm7owLICiNCLBQzEQ==", + "dev": true, + "dependencies": { + "@types/connect-flash": "*", + "@types/express": "*" + } + }, + "node_modules/@types/express-serve-static-core": { + "version": "4.17.5", + "resolved": "https://registry.npmjs.org/@types/express-serve-static-core/-/express-serve-static-core-4.17.5.tgz", + "integrity": "sha512-578YH5Lt88AKoADy0b2jQGwJtrBxezXtVe/MBqWXKZpqx91SnC0pVkVCcxcytz3lWW+cHBYDi3Ysh0WXc+rAYw==", + "dependencies": { + "@types/node": "*", + "@types/range-parser": "*" + } + }, + "node_modules/@types/express-session": { + "version": "1.17.0", + "resolved": "https://registry.npmjs.org/@types/express-session/-/express-session-1.17.0.tgz", + "integrity": "sha512-OQEHeBFE1UhChVIBhRh9qElHUvTp4BzKKHxMDkGHT7WuYk5eL93hPG7D8YAIkoBSbhNEY0RjreF15zn+U0eLjA==", + "dev": true, + "dependencies": { + "@types/express": "*", + "@types/node": "*" + } + }, + "node_modules/@types/express-validator": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/@types/express-validator/-/express-validator-3.0.0.tgz", + "integrity": "sha512-LusnB0YhTXpBT25PXyGPQlK7leE1e41Vezq1hHEUwjfkopM1Pkv2X2Ppxqh9c+w/HZ6Udzki8AJotKNjDTGdkQ==", + "dev": true, + "dependencies": { + "express-validator": "*" + } + }, + "node_modules/@types/file-saver": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/@types/file-saver/-/file-saver-2.0.1.tgz", + "integrity": "sha512-g1QUuhYVVAamfCifK7oB7G3aIl4BbOyzDOqVyUfEr4tfBKrXfeH+M+Tg7HKCXSrbzxYdhyCP7z9WbKo0R2hBCw==", + "dev": true + }, + "node_modules/@types/formidable": { + "version": "1.0.31", + "resolved": "https://registry.npmjs.org/@types/formidable/-/formidable-1.0.31.tgz", + "integrity": "sha512-dIhM5t8lRP0oWe2HF8MuPvdd1TpPTjhDMAqemcq6oIZQCBQTovhBAdTQ5L5veJB4pdQChadmHuxtB0YzqvfU3Q==", + "dev": true, + "dependencies": { + "@types/events": "*", + "@types/node": "*" + } + }, + "node_modules/@types/glob": { + "version": "7.1.1", + "resolved": "https://registry.npmjs.org/@types/glob/-/glob-7.1.1.tgz", + "integrity": "sha512-1Bh06cbWJUHMC97acuD6UMG29nMt0Aqz1vF3guLfG+kHHJhy3AyohZFFxYk2f7Q1SQIrNwvncxAE0N/9s70F2w==", + "dev": true, + "dependencies": { + "@types/events": "*", + "@types/minimatch": "*", + "@types/node": "*" + } + }, + "node_modules/@types/google-maps": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/@types/google-maps/-/google-maps-3.2.2.tgz", + "integrity": "sha512-/XPVfS28VzUdE/HlmBRoe5ii1nNMyWujyRfRY08bD/JgmPlWSiY8enB2dqTe9mlc3kULq7LfFa1wcupM+lQfqA==", + "dependencies": { + "@types/googlemaps": "*" + } + }, + "node_modules/@types/google-maps-react": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/@types/google-maps-react/-/google-maps-react-2.0.5.tgz", + "integrity": "sha512-qcsYlHiNH169Vf7jmkEwbzBDqBfqqzYkTgK1vL7qkWVZI04wFESADYVITuQunrZ9swY/SG+tTWUIXMlY4W8byw==", + "dev": true, + "dependencies": { + "google-maps-react": "*" + } + }, + "node_modules/@types/googlemaps": { + "version": "3.39.8", + "resolved": "https://registry.npmjs.org/@types/googlemaps/-/googlemaps-3.39.8.tgz", + "integrity": "sha512-z03u79t1v8QIktoUXypWD06Fzl499/hA162hurA+eCDlWXxFynuU+hMZIaferILF5Gzr4PMX1ShHszT666sUHQ==" + }, + "node_modules/@types/jquery": { + "version": "3.5.0", + "resolved": "https://registry.npmjs.org/@types/jquery/-/jquery-3.5.0.tgz", + "integrity": "sha512-C7qQUjpMWDUNYQRTXsP5nbYYwCwwgy84yPgoTT7fPN69NH92wLeCtFaMsWeolJD1AF/6uQw3pYt62rzv83sMmw==", + "dev": true, + "dependencies": { + "@types/sizzle": "*" + } + }, + "node_modules/@types/keygrip": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/@types/keygrip/-/keygrip-1.0.2.tgz", + "integrity": "sha512-GJhpTepz2udxGexqos8wgaBx4I/zWIDPh/KOGEwAqtuGDkOUJu5eFvwmdBX4AmB8Odsr+9pHCQqiAqDL/yKMKw==", + "dev": true + }, + "node_modules/@types/libxmljs": { + "version": "0.18.6", + "resolved": "https://registry.npmjs.org/@types/libxmljs/-/libxmljs-0.18.6.tgz", + "integrity": "sha512-xVUs71CwL5wYYfx5oH344DYWdoE2hVWlnRxlXFYyA8BcueN+Ey/h4FyhzEikbIJSXBKyPpJKhGu5c3NOx15nww==", + "dev": true, + "dependencies": { + "@types/node": "*" + } + }, + "node_modules/@types/lodash": { + "version": "4.14.157", + "resolved": "https://registry.npmjs.org/@types/lodash/-/lodash-4.14.157.tgz", + "integrity": "sha512-Ft5BNFmv2pHDgxV5JDsndOWTRJ+56zte0ZpYLowp03tW+K+t8u8YMOzAnpuqPgzX6WO1XpDIUm7u04M8vdDiVQ==", + "dev": true + }, + "node_modules/@types/memory-fs": { + "version": "0.3.3", + "resolved": "https://registry.npmjs.org/@types/memory-fs/-/memory-fs-0.3.3.tgz", + "integrity": "sha512-rLEYzl1xODshz+Lm+YX8NYws8Xw7/qcYbQInMkotl96VpLZmUvoCfYYGxfajMSiugANV02QO5Fc+R98KKeE4gQ==", + "dev": true, + "dependencies": { + "@types/node": "*" + } + }, + "node_modules/@types/mime": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/@types/mime/-/mime-2.0.1.tgz", + "integrity": "sha512-FwI9gX75FgVBJ7ywgnq/P7tw+/o1GUbtP0KzbtusLigAOgIgNISRK0ZPl4qertvXSIE8YbsVJueQ90cDt9YYyw==" + }, + "node_modules/@types/minimatch": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@types/minimatch/-/minimatch-3.0.3.tgz", + "integrity": "sha512-tHq6qdbT9U1IRSGf14CL0pUlULksvY9OZ+5eEgl1N7t+OA3tGvNpxJCzuKQlsNgCVwbAs670L1vcVQi8j9HjnA==", + "dev": true + }, + "node_modules/@types/mobile-detect": { + "version": "1.3.4", + "resolved": "https://registry.npmjs.org/@types/mobile-detect/-/mobile-detect-1.3.4.tgz", + "integrity": "sha512-MGBTvT5c7aH8eX6szFYP3dWPryNLt5iGlo31XNaJtt8o6jsg6tjn99eEMq9l8T6cPZymsr+J4Jth8+/G/04ZDw==", + "dev": true, + "dependencies": { + "mobile-detect": "*" + } + }, + "node_modules/@types/mocha": { + "version": "5.2.7", + "resolved": "https://registry.npmjs.org/@types/mocha/-/mocha-5.2.7.tgz", + "integrity": "sha512-NYrtPht0wGzhwe9+/idPaBB+TqkY9AhTvOLMkThm0IoEfLaiVQZwBwyJ5puCkO3AUCWrmcoePjp2mbFocKy4SQ==", + "dev": true + }, + "node_modules/@types/mongodb": { + "version": "3.5.25", + "resolved": "https://registry.npmjs.org/@types/mongodb/-/mongodb-3.5.25.tgz", + "integrity": "sha512-2H/Owt+pHCl9YmBOYnXc3VdnxejJEjVdH+QCWL5ZAfPehEn3evygKBX3/vKRv7aTwfNbUd0E5vjJdQklH/9a6w==", + "dev": true, + "dependencies": { + "@types/bson": "*", + "@types/node": "*" + } + }, + "node_modules/@types/mongoose": { + "version": "5.7.28", + "resolved": "https://registry.npmjs.org/@types/mongoose/-/mongoose-5.7.28.tgz", + "integrity": "sha512-ll74S2QhC34MSSSk30NHlU8ILESIA2l4mDfAfDse/VM20tT9MRV9WGKWK3HglKRmdL77iMUYMcgHdKJebabtzA==", + "dev": true, + "dependencies": { + "@types/mongodb": "*", + "@types/node": "*" + } + }, + "node_modules/@types/node": { + "version": "10.17.26", + "resolved": "https://registry.npmjs.org/@types/node/-/node-10.17.26.tgz", + "integrity": "sha512-myMwkO2Cr82kirHY8uknNRHEVtn0wV3DTQfkrjx17jmkstDRZ24gNUdl8AHXVyVclTYI/bNjgTPTAWvWLqXqkw==" + }, + "node_modules/@types/nodemailer": { + "version": "4.6.8", + "resolved": "https://registry.npmjs.org/@types/nodemailer/-/nodemailer-4.6.8.tgz", + "integrity": "sha512-IX1P3bxDP1VIdZf6/kIWYNmSejkYm9MOyMEtoDFi4DVzKjJ3kY4GhOcOAKs6lZRjqVVmF9UjPOZXuQczlpZThw==", + "dev": true, + "dependencies": { + "@types/node": "*" + } + }, + "node_modules/@types/oauth": { + "version": "0.9.1", + "resolved": "https://registry.npmjs.org/@types/oauth/-/oauth-0.9.1.tgz", + "integrity": "sha512-a1iY62/a3yhZ7qH7cNUsxoI3U/0Fe9+RnuFrpTKr+0WVOzbKlSLojShCKe20aOD1Sppv+i8Zlq0pLDuTJnwS4A==", + "dev": true, + "dependencies": { + "@types/node": "*" + } + }, + "node_modules/@types/orderedmap": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/@types/orderedmap/-/orderedmap-1.0.0.tgz", + "integrity": "sha512-dxKo80TqYx3YtBipHwA/SdFmMMyLCnP+5mkEqN0eMjcTBzHkiiX0ES118DsjDBjvD+zeSsSU9jULTZ+frog+Gw==", + "dev": true + }, + "node_modules/@types/parse-json": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/@types/parse-json/-/parse-json-4.0.0.tgz", + "integrity": "sha512-//oorEZjL6sbPcKUaCdIGlIUeH26mgzimjBB77G6XRgnDl/L5wOnpyBGRe/Mmf5CVW3PwEBE1NjiMZ/ssFh4wA==" + }, + "node_modules/@types/passport": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/@types/passport/-/passport-1.0.3.tgz", + "integrity": "sha512-nyztuxtDPQv9utCzU0qW7Gl8BY2Dn8BKlYAFFyxKipFxjaVd96celbkLCV/tRqqBUZ+JB8If3UfgV8347DTo3Q==", + "dev": true, + "dependencies": { + "@types/express": "*" + } + }, + "node_modules/@types/passport-google-oauth20": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/@types/passport-google-oauth20/-/passport-google-oauth20-2.0.3.tgz", + "integrity": "sha512-6EUEGzEg4acwowvgR/yVZIj8S2Kkwc6JmlY2/wnM1wJHNz20o7s1TIGrxnah8ymLgJasYDpy95P3TMMqlmetPw==", + "dev": true, + "dependencies": { + "@types/express": "*", + "@types/passport": "*", + "@types/passport-oauth2": "*" + } + }, + "node_modules/@types/passport-local": { + "version": "1.0.33", + "resolved": "https://registry.npmjs.org/@types/passport-local/-/passport-local-1.0.33.tgz", + "integrity": "sha512-+rn6ZIxje0jZ2+DAiWFI8vGG7ZFKB0hXx2cUdMmudSWsigSq6ES7Emso46r4HJk0qCgrZVfI8sJiM7HIYf4SbA==", + "dev": true, + "dependencies": { + "@types/express": "*", + "@types/passport": "*", + "@types/passport-strategy": "*" + } + }, + "node_modules/@types/passport-oauth2": { + "version": "1.4.9", + "resolved": "https://registry.npmjs.org/@types/passport-oauth2/-/passport-oauth2-1.4.9.tgz", + "integrity": "sha512-QP0q+NVQOaIu2r0e10QWkiUA0Ya5mOBHRJN0UrI+LolMLOP1/VN4EVIpJ3xVwFo+xqNFRoFvFwJhBvKnk7kpUA==", + "dev": true, + "dependencies": { + "@types/express": "*", + "@types/oauth": "*", + "@types/passport": "*" + } + }, + "node_modules/@types/passport-strategy": { + "version": "0.2.35", + "resolved": "https://registry.npmjs.org/@types/passport-strategy/-/passport-strategy-0.2.35.tgz", + "integrity": "sha512-o5D19Jy2XPFoX2rKApykY15et3Apgax00RRLf0RUotPDUsYrQa7x4howLYr9El2mlUApHmCMv5CZ1IXqKFQ2+g==", + "dev": true, + "dependencies": { + "@types/express": "*", + "@types/passport": "*" + } + }, + "node_modules/@types/pdfjs-dist": { + "version": "2.1.4", + "resolved": "https://registry.npmjs.org/@types/pdfjs-dist/-/pdfjs-dist-2.1.4.tgz", + "integrity": "sha512-KnEc8W2IcntVL/SKfRWy2lcJax07xEaO7ghcT0/hc2Lp5UOcmaXAi887RKOLhP8BLKsVGJ7uYH0mYo1uSvbu2A==", + "dev": true + }, + "node_modules/@types/prop-types": { + "version": "15.7.3", + "resolved": "https://registry.npmjs.org/@types/prop-types/-/prop-types-15.7.3.tgz", + "integrity": "sha512-KfRL3PuHmqQLOG+2tGpRO26Ctg+Cq1E01D2DMriKEATHgWLfeNDmq9e29Q9WIky0dQ3NPkd1mzYH8Lm936Z9qw==" + }, + "node_modules/@types/prosemirror-commands": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/@types/prosemirror-commands/-/prosemirror-commands-1.0.1.tgz", + "integrity": "sha512-GeE12m8VT9N1JrzoY//946IX8ZyQOLNmvryJ+BNQs/HvhmXW9EWOcWUE6OBRtxK7Y8SrzSOwx4XmqSgVmK3tGQ==", + "dev": true, + "dependencies": { + "@types/prosemirror-model": "*", + "@types/prosemirror-state": "*", + "@types/prosemirror-view": "*" + } + }, + "node_modules/@types/prosemirror-dev-tools": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/@types/prosemirror-dev-tools/-/prosemirror-dev-tools-2.1.0.tgz", + "integrity": "sha512-OhnSaC4yrrEMLPRUkEWcHAIPVqgKlLkE4kISqL3cHeAYxASouSPvPMLqhBIbWkGwaozy43DjjVC1OXkxTo+y5Q==", + "dev": true, + "dependencies": { + "@types/prosemirror-state": "*", + "@types/prosemirror-view": "*" + } + }, + "node_modules/@types/prosemirror-history": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/@types/prosemirror-history/-/prosemirror-history-1.0.1.tgz", + "integrity": "sha512-BYyPJlWDo3VEnWS5X2DCHXrrAKEjdbCe1DUjGL6R/8hmwMFe3iMJGYdBkOXU1FfkTpw7Z+PlwY/pMyeelVydmg==", + "dev": true, + "dependencies": { + "@types/prosemirror-model": "*", + "@types/prosemirror-state": "*" + } + }, + "node_modules/@types/prosemirror-inputrules": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/@types/prosemirror-inputrules/-/prosemirror-inputrules-1.0.2.tgz", + "integrity": "sha512-bKFneQUPnkZmzCJ1uoitpKH6PFW0hc4q55NsC7mFUCvX0eZl0GRKxyfV47jkJbsbyUQoO/QFv0WwLDz2bo15sA==", + "dev": true, + "dependencies": { + "@types/prosemirror-model": "*", + "@types/prosemirror-state": "*" + } + }, + "node_modules/@types/prosemirror-keymap": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/@types/prosemirror-keymap/-/prosemirror-keymap-1.0.2.tgz", + "integrity": "sha512-94aDnpdrdI5S2UM7MQIjauFeo0MI5S7uU+SMT01m5NXT5CZ/NLHhzN0d1V5zKxe7Nh7fVxuZ7l9DTu5nSMN9sw==", + "dev": true, + "dependencies": { + "@types/prosemirror-model": "*", + "@types/prosemirror-state": "*", + "@types/prosemirror-view": "*" + } + }, + "node_modules/@types/prosemirror-menu": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/@types/prosemirror-menu/-/prosemirror-menu-1.0.2.tgz", + "integrity": "sha512-u79CwEQR271k/kjdvRXyPGG7Rn+vPKbJfgSO7vOR/zEYcvSz7lLhBg1OZiSKqfSuhnIAbQh53qLylmB8PTw+WA==", + "dev": true, + "dependencies": { + "@types/prosemirror-model": "*", + "@types/prosemirror-state": "*", + "@types/prosemirror-view": "*" + } + }, + "node_modules/@types/prosemirror-model": { + "version": "1.7.2", + "resolved": "https://registry.npmjs.org/@types/prosemirror-model/-/prosemirror-model-1.7.2.tgz", + "integrity": "sha512-2l+yXvidg3AUHN07mO4Jd8Q84fo6ksFsy7LHUurLYrZ74uTahBp2fzcO49AKZMzww2EulXJ40Kl/OFaQ/7A1fw==", + "dev": true, + "dependencies": { + "@types/orderedmap": "*" + } + }, + "node_modules/@types/prosemirror-schema-list": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/@types/prosemirror-schema-list/-/prosemirror-schema-list-1.0.1.tgz", + "integrity": "sha512-+iUYq+pj2wVHSThj0MjNDzkkGwq8aDQ6j0UJK8a0cNCL8v44Ftcx1noGPtBIEUJgitH960VnfBNoTWfQoQZfRA==", + "dev": true, + "dependencies": { + "@types/orderedmap": "*", + "@types/prosemirror-model": "*", + "@types/prosemirror-state": "*" + } + }, + "node_modules/@types/prosemirror-state": { + "version": "1.2.4", + "resolved": "https://registry.npmjs.org/@types/prosemirror-state/-/prosemirror-state-1.2.4.tgz", + "integrity": "sha512-Gch4THfZ9QNsRQ7myibU8cG99F3b8/3Gto083ZuutNG72E0VmS8yfQzA5ahbndr5GUIbmKyOD5LqKTBvx/M0qw==", + "dev": true, + "dependencies": { + "@types/prosemirror-model": "*", + "@types/prosemirror-transform": "*", + "@types/prosemirror-view": "*" + } + }, + "node_modules/@types/prosemirror-transform": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/@types/prosemirror-transform/-/prosemirror-transform-1.1.1.tgz", + "integrity": "sha512-yYCYSoiRH+Wcbl8GJc0PFCzeyMzNQ1vL2xrHHSXZuNcIlH75VoiKrZFeZ6BS9cl8mYXjZrlmdBe8YOxYvyKM6A==", + "dev": true, + "dependencies": { + "@types/prosemirror-model": "*" + } + }, + "node_modules/@types/prosemirror-view": { + "version": "1.11.4", + "resolved": "https://registry.npmjs.org/@types/prosemirror-view/-/prosemirror-view-1.11.4.tgz", + "integrity": "sha512-Hh8v2tpCEMaIesQuw7Y7Pz6imoC1T/bR5OlNGVtp944PZvctXiBvFRkQIb0YvZpt7vVkFzeq2kmR+7mnUfvWiw==", + "dev": true, + "dependencies": { + "@types/prosemirror-model": "*", + "@types/prosemirror-state": "*", + "@types/prosemirror-transform": "*" + } + }, + "node_modules/@types/qs": { + "version": "6.9.1", + "resolved": "https://registry.npmjs.org/@types/qs/-/qs-6.9.1.tgz", + "integrity": "sha512-lhbQXx9HKZAPgBkISrBcmAcMpZsmpe/Cd/hY7LGZS5OfkySUBItnPZHgQPssWYUET8elF+yCFBbP1Q0RZPTdaw==" + }, + "node_modules/@types/range-parser": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/@types/range-parser/-/range-parser-1.2.3.tgz", + "integrity": "sha512-ewFXqrQHlFsgc09MK5jP5iR7vumV/BYayNC6PgJO2LPe8vrnNFyjQjSppfEngITi0qvfKtzFvgKymGheFM9UOA==" + }, + "node_modules/@types/rc-switch": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@types/rc-switch/-/rc-switch-1.9.0.tgz", + "integrity": "sha512-L3ZQ2/1GAaiKuQTMO/2sRdhnNNVtnnvdE0ZOL3/+v54j5LguOvYqTSOHPk9nLPi5va3pdRN1MTce3JkJvGZ65A==", + "dev": true, + "dependencies": { + "@types/react": "*" + } + }, + "node_modules/@types/react": { + "version": "16.9.41", + "resolved": "https://registry.npmjs.org/@types/react/-/react-16.9.41.tgz", + "integrity": "sha512-6cFei7F7L4wwuM+IND/Q2cV1koQUvJ8iSV+Gwn0c3kvABZ691g7sp3hfEQHOUBJtccl1gPi+EyNjMIl9nGA0ug==", + "dependencies": { + "@types/prop-types": "*", + "csstype": "^2.2.0" + } + }, + "node_modules/@types/react-autosuggest": { + "version": "9.3.14", + "resolved": "https://registry.npmjs.org/@types/react-autosuggest/-/react-autosuggest-9.3.14.tgz", + "integrity": "sha512-cvGpKaQaNsFbDxTwP56VKVj2FO6SpJ9PsrQtlVzN7aVa/SsMZoQrBLEUx5HQKfIS4Zupb6K4tHmIyTjF7AEcow==", + "dev": true, + "dependencies": { + "@types/react": "*" + } + }, + "node_modules/@types/react-color": { + "version": "2.17.4", + "resolved": "https://registry.npmjs.org/@types/react-color/-/react-color-2.17.4.tgz", + "integrity": "sha512-pAO3+7uHoESg5QMqjnGjw9F7sALjEZsaU41yGiUZbmHiJMoSXH1UklFJ1bZkwhYskaJgiY+AS6wirl17yBh5GA==", + "dev": true, + "dependencies": { + "@types/react": "*", + "@types/reactcss": "*" + } + }, + "node_modules/@types/react-datepicker": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/@types/react-datepicker/-/react-datepicker-3.0.2.tgz", + "integrity": "sha512-xW04NZRF+9ZnzOD3XrlIzBEKgUsN6LVgZJJsXH8NIUlVjyPh+sdtLPfVoDp+GQzGq1M0TuMLNZsv0sJ3N9XwDA==", + "dev": true, + "dependencies": { + "@types/react": "*", + "date-fns": "^2.0.1", + "popper.js": "^1.14.1" + } + }, + "node_modules/@types/react-dom": { + "version": "16.9.8", + "resolved": "https://registry.npmjs.org/@types/react-dom/-/react-dom-16.9.8.tgz", + "integrity": "sha512-ykkPQ+5nFknnlU6lDd947WbQ6TE3NNzbQAkInC2EKY1qeYdTKp7onFusmYZb+ityzx2YviqT6BXSu+LyWWJwcA==", + "dev": true, + "dependencies": { + "@types/react": "*" + } + }, + "node_modules/@types/react-grid-layout": { + "version": "0.17.1", + "resolved": "https://registry.npmjs.org/@types/react-grid-layout/-/react-grid-layout-0.17.1.tgz", + "integrity": "sha512-1ssQjX3X2A89jx94jECJ0Ze2EHFRYlBHjRh2pnlwjJj1WaEijXUNvwKnUzKwgNFnyZ91Pzqu9Z3V7Atzi9ge7A==", + "dev": true, + "dependencies": { + "@types/react": "*" + } + }, + "node_modules/@types/react-measure": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/@types/react-measure/-/react-measure-2.0.6.tgz", + "integrity": "sha512-FxAwgDVKvxm4SPXu24x9cwzsty8x33UueazHcpxM1UWZlGJI57yIHM2djE3xUJhYVxuzNzi4E8UL3kmCkdh+4A==", + "dev": true, + "dependencies": { + "@types/react": "*" + } + }, + "node_modules/@types/react-reconciler": { + "version": "0.26.1", + "resolved": "https://registry.npmjs.org/@types/react-reconciler/-/react-reconciler-0.26.1.tgz", + "integrity": "sha512-jeizEH5o/k6tv42RYNbaulR9KvoSM4RAUq1Q2SXd2HZ7dqgTxN9OIf+GU/sErT7CohB/mUxy9hSjaRLiCPGF5w==", + "dependencies": { + "@types/react": "*" + } + }, + "node_modules/@types/react-select": { + "version": "3.0.13", + "resolved": "https://registry.npmjs.org/@types/react-select/-/react-select-3.0.13.tgz", + "integrity": "sha512-JxmSArGgzAOtb37+Jz2+3av8rVmp/3s3DGwlcP+g59/a3owkiuuU4/Jajd+qA32beDPHy4gJR2kkxagPY3j9kg==", + "dev": true, + "dependencies": { + "@types/react": "*", + "@types/react-dom": "*", + "@types/react-transition-group": "*" + } + }, + "node_modules/@types/react-table": { + "version": "6.8.7", + "resolved": "https://registry.npmjs.org/@types/react-table/-/react-table-6.8.7.tgz", + "integrity": "sha512-1U0xl47jk0BzE+HNHgxZYSLvtybSvnlLhOpW9Mfqf9iuRm/fGqgRab3TKivPCY6Tl7WPFM2hWEJ1GnsuSFc9AQ==", + "dependencies": { + "@types/react": "*" + } + }, + "node_modules/@types/react-transition-group": { + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/@types/react-transition-group/-/react-transition-group-4.4.0.tgz", + "integrity": "sha512-/QfLHGpu+2fQOqQaXh8MG9q03bFENooTb/it4jr5kKaZlDQfWvjqWZg48AwzPVMBHlRuTRAY7hRHCEOXz5kV6w==", + "dependencies": { + "@types/react": "*" + } + }, + "node_modules/@types/reactcss": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/@types/reactcss/-/reactcss-1.2.3.tgz", + "integrity": "sha512-d2gQQ0IL6hXLnoRfVYZukQNWHuVsE75DzFTLPUuyyEhJS8G2VvlE+qfQQ91SJjaMqlURRCNIsX7Jcsw6cEuJlA==", + "dev": true, + "dependencies": { + "@types/react": "*" + } + }, + "node_modules/@types/request": { + "version": "2.48.5", + "resolved": "https://registry.npmjs.org/@types/request/-/request-2.48.5.tgz", + "integrity": "sha512-/LO7xRVnL3DxJ1WkPGDQrp4VTV1reX9RkC85mJ+Qzykj2Bdw+mG15aAfDahc76HtknjzE16SX/Yddn6MxVbmGQ==", + "dev": true, + "dependencies": { + "@types/caseless": "*", + "@types/node": "*", + "@types/tough-cookie": "*", + "form-data": "^2.5.0" + } + }, + "node_modules/@types/request-promise": { + "version": "4.1.46", + "resolved": "https://registry.npmjs.org/@types/request-promise/-/request-promise-4.1.46.tgz", + "integrity": "sha512-3Thpj2Va5m0ji3spaCk8YKrjkZyZc6RqUVOphA0n/Xet66AW/AiOAs5vfXhQIL5NmkaO7Jnun7Nl9NEjJ2zBaw==", + "dev": true, + "dependencies": { + "@types/bluebird": "*", + "@types/request": "*" + } + }, + "node_modules/@types/reveal": { + "version": "3.3.33", + "resolved": "https://registry.npmjs.org/@types/reveal/-/reveal-3.3.33.tgz", + "integrity": "sha512-lKbezA9Oa5LfdSRwFDc/FHEGH4+FjiXh/a/PCSZAmN+KCeQJL/3ClOdAQwOxt3zdHc8XyioT+cNvIOletwRI7A==" + }, + "node_modules/@types/rimraf": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/@types/rimraf/-/rimraf-2.0.4.tgz", + "integrity": "sha512-8gBudvllD2A/c0CcEX/BivIDorHFt5UI5m46TsNj8DjWCCTTZT74kEe4g+QsY7P/B9WdO98d82zZgXO/RQzu2Q==", + "dev": true, + "dependencies": { + "@types/glob": "*", + "@types/node": "*" + } + }, + "node_modules/@types/serve-static": { + "version": "1.13.3", + "resolved": "https://registry.npmjs.org/@types/serve-static/-/serve-static-1.13.3.tgz", + "integrity": "sha512-oprSwp094zOglVrXdlo/4bAHtKTAxX6VT8FOZlBKrmyLbNvE1zxZyJ6yikMVtHIvwP45+ZQGJn+FdXGKTozq0g==", + "dependencies": { + "@types/express-serve-static-core": "*", + "@types/mime": "*" + } + }, + "node_modules/@types/sharp": { + "version": "0.23.1", + "resolved": "https://registry.npmjs.org/@types/sharp/-/sharp-0.23.1.tgz", + "integrity": "sha512-iBRM9RjRF9pkIkukk6imlxfaKMRuiRND8L0yYKl5PJu5uLvxuNzp5f0x8aoTG5VX85M8O//BwbttzFVZL1j/FQ==", + "dev": true, + "dependencies": { + "@types/node": "*" + } + }, + "node_modules/@types/shelljs": { + "version": "0.8.8", + "resolved": "https://registry.npmjs.org/@types/shelljs/-/shelljs-0.8.8.tgz", + "integrity": "sha512-lD3LWdg6j8r0VRBFahJVaxoW0SIcswxKaFUrmKl33RJVeeoNYQAz4uqCJ5Z6v4oIBOsC5GozX+I5SorIKiTcQA==", + "dev": true, + "dependencies": { + "@types/glob": "*", + "@types/node": "*" + } + }, + "node_modules/@types/sizzle": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/@types/sizzle/-/sizzle-2.3.2.tgz", + "integrity": "sha512-7EJYyKTL7tFR8+gDbB6Wwz/arpGa0Mywk1TJbNzKzHtzbwVmY4HR9WqS5VV7dsBUKQmPNr192jHr/VpBluj/hg==", + "dev": true + }, + "node_modules/@types/socket.io": { + "version": "2.1.8", + "resolved": "https://registry.npmjs.org/@types/socket.io/-/socket.io-2.1.8.tgz", + "integrity": "sha512-NIQfh9WwJuJKlgmby4NgwMpoBOmNPCDgaRNPiLYZBtkbHkszK/9R52B5yGkd5a34rbVdAADuo8FhOS/5AZDemw==", + "dev": true, + "dependencies": { + "@types/engine.io": "*", + "@types/node": "*" + } + }, + "node_modules/@types/socket.io-client": { + "version": "1.4.33", + "resolved": "https://registry.npmjs.org/@types/socket.io-client/-/socket.io-client-1.4.33.tgz", + "integrity": "sha512-m4LnxkljsI9fMsjwpW5QhRpMixo2BeeLpFmg0AE+sS4H1pzAd/cs/ftTiL60FLZgfFa8PFRPx5KsHu8O0bADKQ==", + "dev": true + }, + "node_modules/@types/source-list-map": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/@types/source-list-map/-/source-list-map-0.1.2.tgz", + "integrity": "sha512-K5K+yml8LTo9bWJI/rECfIPrGgxdpeNbj+d53lwN4QjW1MCwlkhUms+gtdzigTeUyBr09+u8BwOIY3MXvHdcsA==", + "dev": true + }, + "node_modules/@types/strip-bom": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/@types/strip-bom/-/strip-bom-3.0.0.tgz", + "integrity": "sha1-FKjsOVbC6B7bdSB5CuzyHCkK69I=", + "dev": true + }, + "node_modules/@types/strip-json-comments": { + "version": "0.0.30", + "resolved": "https://registry.npmjs.org/@types/strip-json-comments/-/strip-json-comments-0.0.30.tgz", + "integrity": "sha512-7NQmHra/JILCd1QqpSzl8+mJRc8ZHz3uDm8YV1Ks9IhK0epEiTw8aIErbvH9PI+6XbqhyIQy3462nEsn7UVzjQ==", + "dev": true + }, + "node_modules/@types/tapable": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/@types/tapable/-/tapable-1.0.7.tgz", + "integrity": "sha512-0VBprVqfgFD7Ehb2vd8Lh9TG3jP98gvr8rgehQqzztZNI7o8zS8Ad4jyZneKELphpuE212D8J70LnSNQSyO6bQ==", + "dev": true + }, + "node_modules/@types/three": { + "version": "0.126.2", + "resolved": "https://registry.npmjs.org/@types/three/-/three-0.126.2.tgz", + "integrity": "sha512-6JqTgijtfXcTJik8NtiNxr2L90ex6ElM00qilOGeUcrEsJLOdzLJSIkXHUYS+KPAYQYtRJQKD6XaXds3HjS+gg==" + }, + "node_modules/@types/tough-cookie": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/@types/tough-cookie/-/tough-cookie-4.0.0.tgz", + "integrity": "sha512-I99sngh224D0M7XgW1s120zxCt3VYQ3IQsuw3P3jbq5GG4yc79+ZjyKznyOGIQrflfylLgcfekeZW/vk0yng6A==", + "dev": true + }, + "node_modules/@types/typescript": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/@types/typescript/-/typescript-2.0.0.tgz", + "integrity": "sha1-xDNTnJi64oaCswfqp6D9IRW4PCg=", + "dev": true, + "dependencies": { + "typescript": "*" + } + }, + "node_modules/@types/uglify-js": { + "version": "3.13.0", + "resolved": "https://registry.npmjs.org/@types/uglify-js/-/uglify-js-3.13.0.tgz", + "integrity": "sha512-EGkrJD5Uy+Pg0NUR8uA4bJ5WMfljyad0G+784vLCNUkD+QwOJXUbBYExXfVGf7YtyzdQp3L/XMYcliB987kL5Q==", + "dev": true, + "dependencies": { + "source-map": "^0.6.1" + } + }, + "node_modules/@types/uglify-js/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/@types/uuid": { + "version": "3.4.9", + "resolved": "https://registry.npmjs.org/@types/uuid/-/uuid-3.4.9.tgz", + "integrity": "sha512-XDwyIlt/47l2kWLTzw/mtrpLdB+GPSskR2n/PIcPn+VYhVO77rGhRncIR5GPU0KRzXuqkDO+J5qqrG0Y8P6jzQ==", + "dev": true + }, + "node_modules/@types/valid-url": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/@types/valid-url/-/valid-url-1.0.3.tgz", + "integrity": "sha512-+33x29mg+ecU88ODdWpqaie2upIuRkhujVLA7TuJjM823cNMbeggfI6NhxewaRaRF8dy+g33e4uIg/m5Mb3xDQ==", + "dev": true + }, + "node_modules/@types/webpack": { + "version": "4.41.27", + "resolved": "https://registry.npmjs.org/@types/webpack/-/webpack-4.41.27.tgz", + "integrity": "sha512-wK/oi5gcHi72VMTbOaQ70VcDxSQ1uX8S2tukBK9ARuGXrYM/+u4ou73roc7trXDNmCxCoerE8zruQqX/wuHszA==", + "dev": true, + "dependencies": { + "@types/anymatch": "*", + "@types/node": "*", + "@types/tapable": "^1", + "@types/uglify-js": "*", + "@types/webpack-sources": "*", + "source-map": "^0.6.0" + } + }, + "node_modules/@types/webpack-dev-middleware": { + "version": "2.0.7", + "resolved": "https://registry.npmjs.org/@types/webpack-dev-middleware/-/webpack-dev-middleware-2.0.7.tgz", + "integrity": "sha512-pArv7YnqpbSCOBWiRlR1KgqVorlzkIiwto66hI8Gdgp5ATQAC+Ug4QVz69ZI1dP+D5Rs8QWnbT81tE4tcMuTag==", + "dev": true, + "dependencies": { + "@types/connect": "*", + "@types/memory-fs": "*", + "@types/webpack": "^4", + "loglevel": "^1.6.2" + } + }, + "node_modules/@types/webpack-hot-middleware": { + "version": "2.25.4", + "resolved": "https://registry.npmjs.org/@types/webpack-hot-middleware/-/webpack-hot-middleware-2.25.4.tgz", + "integrity": "sha512-6tQb9EBKIANZYUVLQYWiWfDFVe7FhXSj4bB2EF5QB7VtYWL3HDR+y/zqjZPAnCorv0spLqVMRqjRK8AmhfocMw==", + "dev": true, + "dependencies": { + "@types/connect": "*", + "@types/webpack": "^4" + } + }, + "node_modules/@types/webpack-sources": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/@types/webpack-sources/-/webpack-sources-2.1.0.tgz", + "integrity": "sha512-LXn/oYIpBeucgP1EIJbKQ2/4ZmpvRl+dlrFdX7+94SKRUV3Evy3FsfMZY318vGhkWUS5MPhtOM3w1/hCOAOXcg==", + "dev": true, + "dependencies": { + "@types/node": "*", + "@types/source-list-map": "*", + "source-map": "^0.7.3" + } + }, + "node_modules/@types/webpack-sources/node_modules/source-map": { + "version": "0.7.3", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.7.3.tgz", + "integrity": "sha512-CkCj6giN3S+n9qrYiBTX5gystlENnRW5jZeNLHpe6aue+SrHcG5VYwujhW9s4dY31mEGsxBDrHR6oI69fTXsaQ==", + "dev": true, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@types/webpack/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/@types/webscopeio__react-textarea-autocomplete": { + "version": "4.6.1", + "resolved": "https://registry.npmjs.org/@types/webscopeio__react-textarea-autocomplete/-/webscopeio__react-textarea-autocomplete-4.6.1.tgz", + "integrity": "sha512-rdiDMsTbyFJRbC2BYKIgiAFG/SFkaDGYQYfzo3U2T+EjMCE0JZ8IHZ9nZrJ2Tm83Blrj66cnaEc0H3iwwRqQMA==", + "dependencies": { + "@types/react": "*" + } + }, + "node_modules/@types/xregexp": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/@types/xregexp/-/xregexp-4.3.0.tgz", + "integrity": "sha512-3gJTS9gt27pS7U9q5IVqo4YvKSlkf2ck8ish6etuDj6LIRxkL/2Y8RMUtK/QzvE1Yv2zwWV5yemI2BS0GGGFnA==", + "dev": true + }, + "node_modules/@types/yauzl": { + "version": "2.9.1", + "resolved": "https://registry.npmjs.org/@types/yauzl/-/yauzl-2.9.1.tgz", + "integrity": "sha512-A1b8SU4D10uoPjwb0lnHmmu8wZhR9d+9o2PKBQT2jU5YPTKsxac6M2qGAdY7VcL+dHHhARVUDmeg0rOrcd9EjA==", + "optional": true, + "dependencies": { + "@types/node": "*" + } + }, + "node_modules/@types/youtube": { + "version": "0.0.39", + "resolved": "https://registry.npmjs.org/@types/youtube/-/youtube-0.0.39.tgz", + "integrity": "sha512-naVjyTZT/CoNwEQW3+mf9E/x6sgB7QIPbRDtVlPUpHlmuQTk+j6gQBy0T5CRkV8oC0GYQjMgfr3VdueTSVLTjw==", + "dev": true + }, + "node_modules/@webassemblyjs/ast": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/ast/-/ast-1.9.0.tgz", + "integrity": "sha512-C6wW5L+b7ogSDVqymbkkvuW9kruN//YisMED04xzeBBqjHa2FYnmvOlS6Xj68xWQRgWvI9cIglsjFowH/RJyEA==", + "dev": true, + "dependencies": { + "@webassemblyjs/helper-module-context": "1.9.0", + "@webassemblyjs/helper-wasm-bytecode": "1.9.0", + "@webassemblyjs/wast-parser": "1.9.0" + } + }, + "node_modules/@webassemblyjs/floating-point-hex-parser": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/floating-point-hex-parser/-/floating-point-hex-parser-1.9.0.tgz", + "integrity": "sha512-TG5qcFsS8QB4g4MhrxK5TqfdNe7Ey/7YL/xN+36rRjl/BlGE/NcBvJcqsRgCP6Z92mRE+7N50pRIi8SmKUbcQA==", + "dev": true + }, + "node_modules/@webassemblyjs/helper-api-error": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-api-error/-/helper-api-error-1.9.0.tgz", + "integrity": "sha512-NcMLjoFMXpsASZFxJ5h2HZRcEhDkvnNFOAKneP5RbKRzaWJN36NC4jqQHKwStIhGXu5mUWlUUk7ygdtrO8lbmw==", + "dev": true + }, + "node_modules/@webassemblyjs/helper-buffer": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-buffer/-/helper-buffer-1.9.0.tgz", + "integrity": "sha512-qZol43oqhq6yBPx7YM3m9Bv7WMV9Eevj6kMi6InKOuZxhw+q9hOkvq5e/PpKSiLfyetpaBnogSbNCfBwyB00CA==", + "dev": true + }, + "node_modules/@webassemblyjs/helper-code-frame": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-code-frame/-/helper-code-frame-1.9.0.tgz", + "integrity": "sha512-ERCYdJBkD9Vu4vtjUYe8LZruWuNIToYq/ME22igL+2vj2dQ2OOujIZr3MEFvfEaqKoVqpsFKAGsRdBSBjrIvZA==", + "dev": true, + "dependencies": { + "@webassemblyjs/wast-printer": "1.9.0" + } + }, + "node_modules/@webassemblyjs/helper-fsm": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-fsm/-/helper-fsm-1.9.0.tgz", + "integrity": "sha512-OPRowhGbshCb5PxJ8LocpdX9Kl0uB4XsAjl6jH/dWKlk/mzsANvhwbiULsaiqT5GZGT9qinTICdj6PLuM5gslw==", + "dev": true + }, + "node_modules/@webassemblyjs/helper-module-context": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-module-context/-/helper-module-context-1.9.0.tgz", + "integrity": "sha512-MJCW8iGC08tMk2enck1aPW+BE5Cw8/7ph/VGZxwyvGbJwjktKkDK7vy7gAmMDx88D7mhDTCNKAW5tED+gZ0W8g==", + "dev": true, + "dependencies": { + "@webassemblyjs/ast": "1.9.0" + } + }, + "node_modules/@webassemblyjs/helper-wasm-bytecode": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-bytecode/-/helper-wasm-bytecode-1.9.0.tgz", + "integrity": "sha512-R7FStIzyNcd7xKxCZH5lE0Bqy+hGTwS3LJjuv1ZVxd9O7eHCedSdrId/hMOd20I+v8wDXEn+bjfKDLzTepoaUw==", + "dev": true + }, + "node_modules/@webassemblyjs/helper-wasm-section": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-section/-/helper-wasm-section-1.9.0.tgz", + "integrity": "sha512-XnMB8l3ek4tvrKUUku+IVaXNHz2YsJyOOmz+MMkZvh8h1uSJpSen6vYnw3IoQ7WwEuAhL8Efjms1ZWjqh2agvw==", + "dev": true, + "dependencies": { + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/helper-buffer": "1.9.0", + "@webassemblyjs/helper-wasm-bytecode": "1.9.0", + "@webassemblyjs/wasm-gen": "1.9.0" + } + }, + "node_modules/@webassemblyjs/ieee754": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/ieee754/-/ieee754-1.9.0.tgz", + "integrity": "sha512-dcX8JuYU/gvymzIHc9DgxTzUUTLexWwt8uCTWP3otys596io0L5aW02Gb1RjYpx2+0Jus1h4ZFqjla7umFniTg==", + "dev": true, + "dependencies": { + "@xtuc/ieee754": "^1.2.0" + } + }, + "node_modules/@webassemblyjs/leb128": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/leb128/-/leb128-1.9.0.tgz", + "integrity": "sha512-ENVzM5VwV1ojs9jam6vPys97B/S65YQtv/aanqnU7D8aSoHFX8GyhGg0CMfyKNIHBuAVjy3tlzd5QMMINa7wpw==", + "dev": true, + "dependencies": { + "@xtuc/long": "4.2.2" + } + }, + "node_modules/@webassemblyjs/utf8": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/utf8/-/utf8-1.9.0.tgz", + "integrity": "sha512-GZbQlWtopBTP0u7cHrEx+73yZKrQoBMpwkGEIqlacljhXCkVM1kMQge/Mf+csMJAjEdSwhOyLAS0AoR3AG5P8w==", + "dev": true + }, + "node_modules/@webassemblyjs/wasm-edit": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-edit/-/wasm-edit-1.9.0.tgz", + "integrity": "sha512-FgHzBm80uwz5M8WKnMTn6j/sVbqilPdQXTWraSjBwFXSYGirpkSWE2R9Qvz9tNiTKQvoKILpCuTjBKzOIm0nxw==", + "dev": true, + "dependencies": { + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/helper-buffer": "1.9.0", + "@webassemblyjs/helper-wasm-bytecode": "1.9.0", + "@webassemblyjs/helper-wasm-section": "1.9.0", + "@webassemblyjs/wasm-gen": "1.9.0", + "@webassemblyjs/wasm-opt": "1.9.0", + "@webassemblyjs/wasm-parser": "1.9.0", + "@webassemblyjs/wast-printer": "1.9.0" + } + }, + "node_modules/@webassemblyjs/wasm-gen": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-gen/-/wasm-gen-1.9.0.tgz", + "integrity": "sha512-cPE3o44YzOOHvlsb4+E9qSqjc9Qf9Na1OO/BHFy4OI91XDE14MjFN4lTMezzaIWdPqHnsTodGGNP+iRSYfGkjA==", + "dev": true, + "dependencies": { + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/helper-wasm-bytecode": "1.9.0", + "@webassemblyjs/ieee754": "1.9.0", + "@webassemblyjs/leb128": "1.9.0", + "@webassemblyjs/utf8": "1.9.0" + } + }, + "node_modules/@webassemblyjs/wasm-opt": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-opt/-/wasm-opt-1.9.0.tgz", + "integrity": "sha512-Qkjgm6Anhm+OMbIL0iokO7meajkzQD71ioelnfPEj6r4eOFuqm4YC3VBPqXjFyyNwowzbMD+hizmprP/Fwkl2A==", + "dev": true, + "dependencies": { + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/helper-buffer": "1.9.0", + "@webassemblyjs/wasm-gen": "1.9.0", + "@webassemblyjs/wasm-parser": "1.9.0" + } + }, + "node_modules/@webassemblyjs/wasm-parser": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-parser/-/wasm-parser-1.9.0.tgz", + "integrity": "sha512-9+wkMowR2AmdSWQzsPEjFU7njh8HTO5MqO8vjwEHuM+AMHioNqSBONRdr0NQQ3dVQrzp0s8lTcYqzUdb7YgELA==", + "dev": true, + "dependencies": { + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/helper-api-error": "1.9.0", + "@webassemblyjs/helper-wasm-bytecode": "1.9.0", + "@webassemblyjs/ieee754": "1.9.0", + "@webassemblyjs/leb128": "1.9.0", + "@webassemblyjs/utf8": "1.9.0" + } + }, + "node_modules/@webassemblyjs/wast-parser": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-parser/-/wast-parser-1.9.0.tgz", + "integrity": "sha512-qsqSAP3QQ3LyZjNC/0jBJ/ToSxfYJ8kYyuiGvtn/8MK89VrNEfwj7BPQzJVHi0jGTRK2dGdJ5PRqhtjzoww+bw==", + "dev": true, + "dependencies": { + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/floating-point-hex-parser": "1.9.0", + "@webassemblyjs/helper-api-error": "1.9.0", + "@webassemblyjs/helper-code-frame": "1.9.0", + "@webassemblyjs/helper-fsm": "1.9.0", + "@xtuc/long": "4.2.2" + } + }, + "node_modules/@webassemblyjs/wast-printer": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-printer/-/wast-printer-1.9.0.tgz", + "integrity": "sha512-2J0nE95rHXHyQ24cWjMKJ1tqB/ds8z/cyeOZxJhcb+rW+SQASVjuznUSmdz5GpVJTzU8JkhYut0D3siFDD6wsA==", + "dev": true, + "dependencies": { + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/wast-parser": "1.9.0", + "@xtuc/long": "4.2.2" + } + }, + "node_modules/@webscopeio/react-textarea-autocomplete": { + "version": "4.7.0", + "resolved": "https://registry.npmjs.org/@webscopeio/react-textarea-autocomplete/-/react-textarea-autocomplete-4.7.0.tgz", + "integrity": "sha512-uzH7PUlXQk6jCTh1eGZdXjvjxveZpznhQywX5I5ojsXgre+XSzlK66chdDdfi+lQABC3N3TzfSq6Hlxa8hlrLA==", + "dependencies": { + "custom-event": "^1.0.1", + "textarea-caret": "3.0.2" + } + }, + "node_modules/@webscopeio/react-textarea-autocomplete/node_modules/textarea-caret": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/textarea-caret/-/textarea-caret-3.0.2.tgz", + "integrity": "sha1-82DEhpmqGr9xhoCkOjGoUGZcLK8=" + }, + "node_modules/@xtuc/ieee754": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/@xtuc/ieee754/-/ieee754-1.2.0.tgz", + "integrity": "sha512-DX8nKgqcGwsc0eJSqYt5lwP4DH5FlHnmuWWBRy7X0NcaGR0ZtuyeESgMwTYVEtxmsNGY+qit4QYT/MIYTOTPeA==", + "dev": true + }, + "node_modules/@xtuc/long": { + "version": "4.2.2", + "resolved": "https://registry.npmjs.org/@xtuc/long/-/long-4.2.2.tgz", + "integrity": "sha512-NuHqBY1PB/D8xU6s/thBgOAiAP7HOYDQ32+BFZILJ8ivkUkAHQnWfn6WhL79Owj1qmUnoN/YPhktdIoucipkAQ==", + "dev": true + }, + "node_modules/abab": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/abab/-/abab-2.0.3.tgz", + "integrity": "sha512-tsFzPpcttalNjFBCFMqsKYQcWxxen1pgJR56by//QwvJc4/OUS3kPOOttx2tSIfjsylB0pYu7f5D3K1RCxUnUg==", + "dev": true + }, + "node_modules/abbrev": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/abbrev/-/abbrev-1.1.1.tgz", + "integrity": "sha512-nne9/IiQ/hzIhY6pdDnbBtz7DjPTKrY00P/zvPSm5pOFkl6xuGrGnXn/VtTNNfNtAfZ9/1RtehkszU9qcTii0Q==" + }, + "node_modules/abort-controller": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/abort-controller/-/abort-controller-3.0.0.tgz", + "integrity": "sha512-h8lQ8tacZYnR3vNQTgibj+tODHI5/+l06Au2Pcriv/Gmet0eaj4TwWH41sO9wnHDiQsEj19q0drzdWdeAHtweg==", + "dependencies": { + "event-target-shim": "^5.0.0" + }, + "engines": { + "node": ">=6.5" + } + }, + "node_modules/accepts": { + "version": "1.3.7", + "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.7.tgz", + "integrity": "sha512-Il80Qs2WjYlJIBNzNkK6KYqlVMTbZLXgHx2oT0pU/fjRHyEp+PEfEPY0R3WCwAGVOtauxh1hOxNgIf5bv7dQpA==", + "dependencies": { + "mime-types": "~2.1.24", + "negotiator": "0.6.2" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/acorn": { + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-3.3.0.tgz", + "integrity": "sha1-ReN/s56No/JbruP/U2niu18iAXo=", + "bin": { + "acorn": "bin/acorn" + }, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/acorn-globals": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/acorn-globals/-/acorn-globals-3.1.0.tgz", + "integrity": "sha1-/YJw9x+7SZawBPqIDuXUZXOnMb8=", + "dependencies": { + "acorn": "^4.0.4" + } + }, + "node_modules/acorn-globals/node_modules/acorn": { + "version": "4.0.13", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-4.0.13.tgz", + "integrity": "sha1-EFSVrlNh1pe9GVyCUZLhrX8lN4c=", + "bin": { + "acorn": "bin/acorn" + }, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/acorn-jsx": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/acorn-jsx/-/acorn-jsx-5.2.0.tgz", + "integrity": "sha512-HiUX/+K2YpkpJ+SzBffkM/AQ2YE03S0U1kjTLVpoJdhZMOWy8qvXVN9JdLqv2QsaQ6MPYQIuNmwD8zOiYUofLQ==" + }, + "node_modules/acorn-walk": { + "version": "6.2.0", + "resolved": "https://registry.npmjs.org/acorn-walk/-/acorn-walk-6.2.0.tgz", + "integrity": "sha512-7evsyfH1cLOCdAzZAd43Cic04yKydNx0cF+7tiA19p1XnLLPU4dpCQOqpjqwokFe//vS0QqfqqjCS2JkiIs0cA==", + "dev": true, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/adm-zip": { + "version": "0.4.16", + "resolved": "https://registry.npmjs.org/adm-zip/-/adm-zip-0.4.16.tgz", + "integrity": "sha512-TFi4HBKSGfIKsK5YCkKaaFG2m4PEDyViZmEwof3MTIgzimHLto6muaHVpbrljdIvIrFZzEq/p4nafOeLcYegrg==", + "engines": { + "node": ">=0.3.0" + } + }, + "node_modules/after": { + "version": "0.8.2", + "resolved": "https://registry.npmjs.org/after/-/after-0.8.2.tgz", + "integrity": "sha1-/ts5T58OAqqXaOcCvaI7UF+ufh8=" + }, + "node_modules/agent-base": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/agent-base/-/agent-base-6.0.0.tgz", + "integrity": "sha512-j1Q7cSCqN+AwrmDd+pzgqc0/NpC655x2bUf5ZjRIO77DcNBFmh+OgRNzF6OKdCC9RSCb19fGd99+bhXFdkRNqw==", + "dependencies": { + "debug": "4" + }, + "engines": { + "node": ">= 6.0.0" + } + }, + "node_modules/agent-base/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/ajv": { + "version": "6.12.2", + "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.2.tgz", + "integrity": "sha512-k+V+hzjm5q/Mr8ef/1Y9goCmlsK4I6Sm74teeyGvFk1XrOsbsKLjEdrvny42CZ+a8sXbk8KWpY/bDwS+FLL2UQ==", + "dependencies": { + "fast-deep-equal": "^3.1.1", + "fast-json-stable-stringify": "^2.0.0", + "json-schema-traverse": "^0.4.1", + "uri-js": "^4.2.2" + } + }, + "node_modules/ajv-errors": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/ajv-errors/-/ajv-errors-1.0.1.tgz", + "integrity": "sha512-DCRfO/4nQ+89p/RK43i8Ezd41EqdGIU4ld7nGF8OQ14oc/we5rEntLCUa7+jrn3nn83BosfwZA0wb4pon2o8iQ==" + }, + "node_modules/ajv-keywords": { + "version": "3.4.1", + "resolved": "https://registry.npmjs.org/ajv-keywords/-/ajv-keywords-3.4.1.tgz", + "integrity": "sha512-RO1ibKvd27e6FEShVFfPALuHI3WjSVNeK5FIsmme/LYRNxjKuNj+Dt7bucLa6NdSv3JcVTyMlm9kGR84z1XpaQ==" + }, + "node_modules/align-text": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/align-text/-/align-text-0.1.4.tgz", + "integrity": "sha1-DNkKVhCT810KmSVsIrcGlDP60Rc=", + "dependencies": { + "kind-of": "^3.0.2", + "longest": "^1.0.1", + "repeat-string": "^1.5.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/align-text/node_modules/is-buffer": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz", + "integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==" + }, + "node_modules/align-text/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/amdefine": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/amdefine/-/amdefine-1.0.1.tgz", + "integrity": "sha1-SlKCrBZHKek2Gbz9OtFR+BfOkfU=", + "engines": { + "node": ">=0.4.2" + } + }, + "node_modules/ansi-align": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ansi-align/-/ansi-align-2.0.0.tgz", + "integrity": "sha1-w2rsy6VjuJzrVW82kPCx2eNUf38=", + "dependencies": { + "string-width": "^2.0.0" + } + }, + "node_modules/ansi-colors": { + "version": "3.2.3", + "resolved": "https://registry.npmjs.org/ansi-colors/-/ansi-colors-3.2.3.tgz", + "integrity": "sha512-LEHHyuhlPY3TmuUYMh2oz89lTShfvgbmzaBcxve9t/9Wuy7Dwf4yoAKcND7KFT1HAQfqZ12qtc+DUrBMeKF9nw==", + "engines": { + "node": ">=6" + } + }, + "node_modules/ansi-escape-sequences": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/ansi-escape-sequences/-/ansi-escape-sequences-4.1.0.tgz", + "integrity": "sha512-dzW9kHxH011uBsidTXd14JXgzye/YLb2LzeKZ4bsgl/Knwx8AtbSFkkGxagdNOoh0DlqHCmfiEjWKBaqjOanVw==", + "dependencies": { + "array-back": "^3.0.1" + }, + "engines": { + "node": ">=8.0.0" + } + }, + "node_modules/ansi-escape-sequences/node_modules/array-back": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/array-back/-/array-back-3.1.0.tgz", + "integrity": "sha512-TkuxA4UCOvxuDK6NZYXCalszEzj+TLszyASooky+i742l9TqsOdYCMJJupxRic61hwquNtppB3hgcuq9SVSH1Q==", + "engines": { + "node": ">=6" + } + }, + "node_modules/ansi-html": { + "version": "0.0.7", + "resolved": "https://registry.npmjs.org/ansi-html/-/ansi-html-0.0.7.tgz", + "integrity": "sha1-gTWEAhliqenm/QOflA0S9WynhZ4=", + "dev": true, + "engines": [ + "node >= 0.8.0" + ], + "bin": { + "ansi-html": "bin/ansi-html" + } + }, + "node_modules/ansi-regex": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz", + "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=", + "engines": { + "node": ">=4" + } + }, + "node_modules/ansi-styles": { + "version": "3.2.1", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", + "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", + "dependencies": { + "color-convert": "^1.9.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/any-promise": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/any-promise/-/any-promise-1.3.0.tgz", + "integrity": "sha1-q8av7tzqUugJzcA3au0845Y10X8=" + }, + "node_modules/anymatch": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz", + "integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==", + "dependencies": { + "micromatch": "^3.1.4", + "normalize-path": "^2.1.1" + } + }, + "node_modules/anymatch/node_modules/normalize-path": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz", + "integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=", + "dependencies": { + "remove-trailing-separator": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/aproba": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz", + "integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==" + }, + "node_modules/archiver": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/archiver/-/archiver-3.1.1.tgz", + "integrity": "sha512-5Hxxcig7gw5Jod/8Gq0OneVgLYET+oNHcxgWItq4TbhOzRLKNAFUb9edAftiMKXvXfCB0vbGrJdZDNq0dWMsxg==", + "dependencies": { + "archiver-utils": "^2.1.0", + "async": "^2.6.3", + "buffer-crc32": "^0.2.1", + "glob": "^7.1.4", + "readable-stream": "^3.4.0", + "tar-stream": "^2.1.0", + "zip-stream": "^2.1.2" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/archiver-utils": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/archiver-utils/-/archiver-utils-2.1.0.tgz", + "integrity": "sha512-bEL/yUb/fNNiNTuUz979Z0Yg5L+LzLxGJz8x79lYmR54fmTIb6ob/hNQgkQnIUDWIFjZVQwl9Xs356I6BAMHfw==", + "dependencies": { + "glob": "^7.1.4", + "graceful-fs": "^4.2.0", + "lazystream": "^1.0.0", + "lodash.defaults": "^4.2.0", + "lodash.difference": "^4.5.0", + "lodash.flatten": "^4.4.0", + "lodash.isplainobject": "^4.0.6", + "lodash.union": "^4.6.0", + "normalize-path": "^3.0.0", + "readable-stream": "^2.0.0" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/archiver-utils/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/are-we-there-yet": { + "version": "1.1.5", + "resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-1.1.5.tgz", + "integrity": "sha512-5hYdAkZlcG8tOLujVDTgCT+uPX0VnpAH28gWsLfzpXYm7wP6mp5Q/gYyR7YQ0cKVJcXJnl3j2kpBan13PtQf6w==", + "dependencies": { + "delegates": "^1.0.0", + "readable-stream": "^2.0.6" + } + }, + "node_modules/are-we-there-yet/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/arg": { + "version": "4.1.3", + "resolved": "https://registry.npmjs.org/arg/-/arg-4.1.3.tgz", + "integrity": "sha512-58S9QDqG0Xx27YwPSt9fJxivjYl432YCwfDMfZ+71RAqUrZef7LrKQZ3LHLOwCS4FLNBplP533Zx895SeOCHvA==", + "dev": true + }, + "node_modules/argparse": { + "version": "1.0.10", + "resolved": "https://registry.npmjs.org/argparse/-/argparse-1.0.10.tgz", + "integrity": "sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==", + "dependencies": { + "sprintf-js": "~1.0.2" + } + }, + "node_modules/arr-diff": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-4.0.0.tgz", + "integrity": "sha1-1kYQdP6/7HHn4VI1dhoyml3HxSA=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/arr-flatten": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/arr-flatten/-/arr-flatten-1.1.0.tgz", + "integrity": "sha512-L3hKV5R/p5o81R7O02IGnwpDmkp6E982XhtbuwSe3O4qOtMMMtodicASA1Cny2U+aCXcNpml+m4dPsvsJ3jatg==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/arr-union": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/arr-union/-/arr-union-3.1.0.tgz", + "integrity": "sha1-45sJrqne+Gao8gbiiK9jkZuuOcQ=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/array-back": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/array-back/-/array-back-2.0.0.tgz", + "integrity": "sha512-eJv4pLLufP3g5kcZry0j6WXpIbzYw9GUB4mVJZno9wfwiBxbizTnHCw3VJb07cBihbFX48Y7oSrW9y+gt4glyw==", + "dependencies": { + "typical": "^2.6.1" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/array-batcher": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/array-batcher/-/array-batcher-1.2.3.tgz", + "integrity": "sha512-/IOrwn4ZJi7YqTZrs3k+wQN5nKhjtTqL5ZKkzB+sKJlPeJzpMnRc3o8T9yt8/ZJiSldd+PwTHjM+//UsaszOOw==", + "dependencies": { + "@types/node": "^12.7.5", + "chai": "^4.2.0", + "mocha": "^6.2.0", + "request": "^2.88.0", + "request-promise": "^4.2.4" + } + }, + "node_modules/array-batcher/node_modules/@types/node": { + "version": "12.12.37", + "resolved": "https://registry.npmjs.org/@types/node/-/node-12.12.37.tgz", + "integrity": "sha512-4mXKoDptrXAwZErQHrLzpe0FN/0Wmf5JRniSVIdwUrtDf9wnmEV1teCNLBo/TwuXhkK/bVegoEn/wmb+x0AuPg==" + }, + "node_modules/array-batcher/node_modules/glob": { + "version": "7.1.3", + "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.3.tgz", + "integrity": "sha512-vcfuiIxogLV4DlGBHIUOwI0IbrJ8HWPc4MU7HzviGeNho/UJDfi6B5p3sHeWIQ0KGIU0Jpxi5ZHxemQfLkkAwQ==", + "dependencies": { + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.0.4", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" + }, + "engines": { + "node": "*" + } + }, + "node_modules/array-batcher/node_modules/mocha": { + "version": "6.2.3", + "resolved": "https://registry.npmjs.org/mocha/-/mocha-6.2.3.tgz", + "integrity": "sha512-0R/3FvjIGH3eEuG17ccFPk117XL2rWxatr81a57D+r/x2uTYZRbdZ4oVidEUMh2W2TJDa7MdAb12Lm2/qrKajg==", + "dependencies": { + "ansi-colors": "3.2.3", + "browser-stdout": "1.3.1", + "debug": "3.2.6", + "diff": "3.5.0", + "escape-string-regexp": "1.0.5", + "find-up": "3.0.0", + "glob": "7.1.3", + "growl": "1.10.5", + "he": "1.2.0", + "js-yaml": "3.13.1", + "log-symbols": "2.2.0", + "minimatch": "3.0.4", + "mkdirp": "0.5.4", + "ms": "2.1.1", + "node-environment-flags": "1.0.5", + "object.assign": "4.1.0", + "strip-json-comments": "2.0.1", + "supports-color": "6.0.0", + "which": "1.3.1", + "wide-align": "1.1.3", + "yargs": "13.3.2", + "yargs-parser": "13.1.2", + "yargs-unparser": "1.6.0" + }, + "bin": { + "_mocha": "bin/_mocha", + "mocha": "bin/mocha" + }, + "engines": { + "node": ">= 6.0.0" + } + }, + "node_modules/array-batcher/node_modules/supports-color": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-6.0.0.tgz", + "integrity": "sha512-on9Kwidc1IUQo+bQdhi8+Tijpo0e1SS6RoGo2guUwn5vdaxw8RXOF9Vb2ws+ihWOmh4JnCJOvaziZWP1VABaLg==", + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/array-equal": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/array-equal/-/array-equal-1.0.0.tgz", + "integrity": "sha1-jCpe8kcv2ep0KwTHenUJO6J1fJM=", + "dev": true + }, + "node_modules/array-find-index": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/array-find-index/-/array-find-index-1.0.2.tgz", + "integrity": "sha1-3wEKoSh+Fku9pvlyOwqWoexBh6E=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/array-flatten": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=" + }, + "node_modules/array-union": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/array-union/-/array-union-1.0.2.tgz", + "integrity": "sha1-mjRBDk9OPaI96jdb5b5w8kd47Dk=", + "dev": true, + "dependencies": { + "array-uniq": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/array-uniq": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/array-uniq/-/array-uniq-1.0.3.tgz", + "integrity": "sha1-r2rId6Jcx/dOBYiUdThY39sk/bY=", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/array-unique": { + "version": "0.3.2", + "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.3.2.tgz", + "integrity": "sha1-qJS3XUvE9s1nnvMkSp/Y9Gri1Cg=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/arraybuffer.slice": { + "version": "0.0.7", + "resolved": "https://registry.npmjs.org/arraybuffer.slice/-/arraybuffer.slice-0.0.7.tgz", + "integrity": "sha512-wGUIVQXuehL5TCqQun8OW81jGzAWycqzFF8lFp+GOM5BXLYj3bKNsYC4daB7n6XjCqxQA/qgTJ+8ANR3acjrog==" + }, + "node_modules/arrify": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/arrify/-/arrify-2.0.1.tgz", + "integrity": "sha512-3duEwti880xqi4eAMN8AyR4a0ByT90zoYdLlevfrvU43vb0YZwZVfxOgxWrLXXXpyugL0hNZc9G6BiB5B3nUug==", + "engines": { + "node": ">=8" + } + }, + "node_modules/asap": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/asap/-/asap-2.0.6.tgz", + "integrity": "sha1-5QNHYR1+aQlDIIu9r+vLwvuGbUY=" + }, + "node_modules/asn1": { + "version": "0.2.4", + "resolved": "https://registry.npmjs.org/asn1/-/asn1-0.2.4.tgz", + "integrity": "sha512-jxwzQpLQjSmWXgwaCZE9Nz+glAG01yF1QnWgbhGwHI5A6FRIEY6IVqtHhIepHqI7/kyEyQEagBC5mBEFlIYvdg==", + "dependencies": { + "safer-buffer": "~2.1.0" + } + }, + "node_modules/asn1.js": { + "version": "5.4.1", + "resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-5.4.1.tgz", + "integrity": "sha512-+I//4cYPccV8LdmBLiX8CYvf9Sp3vQsrqu2QNXRcrbiWvcx/UdlFiqUJJzxRQxgsZmvhXhn4cSKeSmoFjVdupA==", + "dev": true, + "dependencies": { + "bn.js": "^4.0.0", + "inherits": "^2.0.1", + "minimalistic-assert": "^1.0.0", + "safer-buffer": "^2.1.0" + } + }, + "node_modules/asn1.js/node_modules/bn.js": { + "version": "4.12.0", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", + "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==", + "dev": true + }, + "node_modules/assert": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/assert/-/assert-1.5.0.tgz", + "integrity": "sha512-EDsgawzwoun2CZkCgtxJbv392v4nbk9XDD06zI+kQYoBM/3RBWLlEyJARDOmhAAosBjWACEkKL6S+lIZtcAubA==", + "dev": true, + "dependencies": { + "object-assign": "^4.1.1", + "util": "0.10.3" + } + }, + "node_modules/assert-plus": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/assert-plus/-/assert-plus-1.0.0.tgz", + "integrity": "sha1-8S4PPF13sLHN2RRpQuTpbB5N1SU=", + "engines": { + "node": ">=0.8" + } + }, + "node_modules/assert/node_modules/inherits": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.1.tgz", + "integrity": "sha1-sX0I0ya0Qj5Wjv9xn5GwscvfafE=", + "dev": true + }, + "node_modules/assert/node_modules/util": { + "version": "0.10.3", + "resolved": "https://registry.npmjs.org/util/-/util-0.10.3.tgz", + "integrity": "sha1-evsa/lCAUkZInj23/g7TeTNqwPk=", + "dev": true, + "dependencies": { + "inherits": "2.0.1" + } + }, + "node_modules/assertion-error": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/assertion-error/-/assertion-error-1.1.0.tgz", + "integrity": "sha512-jgsaNduz+ndvGyFt3uSuWqvy4lCnIJiovtouQN5JZHOKCS2QuhEdbcQHFhVksz2N2U9hXJo8odG7ETyWlEeuDw==", + "engines": { + "node": "*" + } + }, + "node_modules/assign-symbols": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/assign-symbols/-/assign-symbols-1.0.0.tgz", + "integrity": "sha1-WWZ/QfrdTyDMvCu5a41Pf3jsA2c=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/async": { + "version": "2.6.3", + "resolved": "https://registry.npmjs.org/async/-/async-2.6.3.tgz", + "integrity": "sha512-zflvls11DCy+dQWzTW2dzuilv8Z5X/pjfmZOWba6TNIVDm+2UDaJmXSOXlasHKfNBs8oo3M0aT50fDEWfKZjXg==", + "dependencies": { + "lodash": "^4.17.14" + } + }, + "node_modules/async-each": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/async-each/-/async-each-1.0.3.tgz", + "integrity": "sha512-z/WhQ5FPySLdvREByI2vZiTWwCnF0moMJ1hK9YQwDTHKh6I7/uSckMetoRGb5UBZPC1z0jlw+n/XCgjeH7y1AQ==" + }, + "node_modules/async-foreach": { + "version": "0.1.3", + "resolved": "https://registry.npmjs.org/async-foreach/-/async-foreach-0.1.3.tgz", + "integrity": "sha1-NhIfhFwFeBct5Bmpfb6x0W7DRUI=", + "engines": { + "node": "*" + } + }, + "node_modules/async-limiter": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/async-limiter/-/async-limiter-1.0.1.tgz", + "integrity": "sha512-csOlWGAcRFJaI6m+F2WKdnMKr4HhdhFVBk0H/QbJFMCr+uO2kwohwXQPxw/9OCxp05r5ghVBFSyioixx3gfkNQ==" + }, + "node_modules/asynckit": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz", + "integrity": "sha1-x57Zf380y48robyXkLzDZkdLS3k=" + }, + "node_modules/atob": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/atob/-/atob-2.1.2.tgz", + "integrity": "sha512-Wm6ukoaOGJi/73p/cl2GvLjTI5JM1k/O14isD73YML8StrH/7/lRFgmg8nICZgD3bZZvjwCGxtMOD3wWNAu8cg==", + "bin": { + "atob": "bin/atob.js" + }, + "engines": { + "node": ">= 4.5.0" + } + }, + "node_modules/awesome-typescript-loader": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/awesome-typescript-loader/-/awesome-typescript-loader-5.2.1.tgz", + "integrity": "sha512-slv66OAJB8orL+UUaTI3pKlLorwIvS4ARZzYR9iJJyGsEgOqueMfOMdKySWzZ73vIkEe3fcwFgsKMg4d8zyb1g==", + "dev": true, + "dependencies": { + "chalk": "^2.4.1", + "enhanced-resolve": "^4.0.0", + "loader-utils": "^1.1.0", + "lodash": "^4.17.5", + "micromatch": "^3.1.9", + "mkdirp": "^0.5.1", + "source-map-support": "^0.5.3", + "webpack-log": "^1.2.0" + } + }, + "node_modules/aws-sign2": { + "version": "0.7.0", + "resolved": "https://registry.npmjs.org/aws-sign2/-/aws-sign2-0.7.0.tgz", + "integrity": "sha1-tG6JCTSpWR8tL2+G1+ap8bP+dqg=", + "engines": { + "node": "*" + } + }, + "node_modules/aws4": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/aws4/-/aws4-1.9.1.tgz", + "integrity": "sha512-wMHVg2EOHaMRxbzgFJ9gtjOOCrI80OHLG14rxi28XwOW8ux6IiEbRCGGGqCtdAIg4FQCbW20k9RsT4y3gJlFug==" + }, + "node_modules/axios": { + "version": "0.19.2", + "resolved": "https://registry.npmjs.org/axios/-/axios-0.19.2.tgz", + "integrity": "sha512-fjgm5MvRHLhx+osE2xoekY70AhARk3a6hkN+3Io1jc00jtquGvxYlKlsFUhmUET0V5te6CcZI7lcv2Ym61mjHA==", + "dependencies": { + "follow-redirects": "1.5.10" + } + }, + "node_modules/axios/node_modules/debug": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz", + "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/axios/node_modules/follow-redirects": { + "version": "1.5.10", + "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.5.10.tgz", + "integrity": "sha512-0V5l4Cizzvqt5D44aTXbFZz+FtyXV1vrDN6qrelxtfYQKW0KO0W2T/hkE8xvGa/540LkZlkaUjO4ailYTFtHVQ==", + "dependencies": { + "debug": "=3.1.0" + }, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/axios/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/babel-code-frame": { + "version": "6.26.0", + "resolved": "https://registry.npmjs.org/babel-code-frame/-/babel-code-frame-6.26.0.tgz", + "integrity": "sha1-Y/1D99weO7fONZR9uP42mj9Yx0s=", + "dev": true, + "dependencies": { + "chalk": "^1.1.3", + "esutils": "^2.0.2", + "js-tokens": "^3.0.2" + } + }, + "node_modules/babel-code-frame/node_modules/ansi-regex": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", + "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/babel-code-frame/node_modules/ansi-styles": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz", + "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/babel-code-frame/node_modules/chalk": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz", + "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=", + "dev": true, + "dependencies": { + "ansi-styles": "^2.2.1", + "escape-string-regexp": "^1.0.2", + "has-ansi": "^2.0.0", + "strip-ansi": "^3.0.0", + "supports-color": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/babel-code-frame/node_modules/js-tokens": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-3.0.2.tgz", + "integrity": "sha1-mGbfOVECEw449/mWvOtlRDIJwls=", + "dev": true + }, + "node_modules/babel-code-frame/node_modules/strip-ansi": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", + "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", + "dev": true, + "dependencies": { + "ansi-regex": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/babel-code-frame/node_modules/supports-color": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz", + "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=", + "dev": true, + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/babel-plugin-emotion": { + "version": "10.0.33", + "resolved": "https://registry.npmjs.org/babel-plugin-emotion/-/babel-plugin-emotion-10.0.33.tgz", + "integrity": "sha512-bxZbTTGz0AJQDHm8k6Rf3RQJ8tX2scsfsRyKVgAbiUPUNIRtlK+7JxP+TAd1kRLABFxe0CFm2VdK4ePkoA9FxQ==", + "dependencies": { + "@babel/helper-module-imports": "^7.0.0", + "@emotion/hash": "0.8.0", + "@emotion/memoize": "0.7.4", + "@emotion/serialize": "^0.11.16", + "babel-plugin-macros": "^2.0.0", + "babel-plugin-syntax-jsx": "^6.18.0", + "convert-source-map": "^1.5.0", + "escape-string-regexp": "^1.0.5", + "find-root": "^1.1.0", + "source-map": "^0.5.7" + } + }, + "node_modules/babel-plugin-macros": { + "version": "2.8.0", + "resolved": "https://registry.npmjs.org/babel-plugin-macros/-/babel-plugin-macros-2.8.0.tgz", + "integrity": "sha512-SEP5kJpfGYqYKpBrj5XU3ahw5p5GOHJ0U5ssOSQ/WBVdwkD2Dzlce95exQTs3jOVWPPKLBN2rlEWkCK7dSmLvg==", + "dependencies": { + "@babel/runtime": "^7.7.2", + "cosmiconfig": "^6.0.0", + "resolve": "^1.12.0" + } + }, + "node_modules/babel-plugin-styled-components": { + "version": "1.10.7", + "resolved": "https://registry.npmjs.org/babel-plugin-styled-components/-/babel-plugin-styled-components-1.10.7.tgz", + "integrity": "sha512-MBMHGcIA22996n9hZRf/UJLVVgkEOITuR2SvjHLb5dSTUyR4ZRGn+ngITapes36FI3WLxZHfRhkA1ffHxihOrg==", + "dependencies": { + "@babel/helper-annotate-as-pure": "^7.0.0", + "@babel/helper-module-imports": "^7.0.0", + "babel-plugin-syntax-jsx": "^6.18.0", + "lodash": "^4.17.11" + } + }, + "node_modules/babel-plugin-syntax-jsx": { + "version": "6.18.0", + "resolved": "https://registry.npmjs.org/babel-plugin-syntax-jsx/-/babel-plugin-syntax-jsx-6.18.0.tgz", + "integrity": "sha1-CvMqmm4Tyno/1QaeYtew9Y0NiUY=" + }, + "node_modules/babel-runtime": { + "version": "6.26.0", + "resolved": "https://registry.npmjs.org/babel-runtime/-/babel-runtime-6.26.0.tgz", + "integrity": "sha1-llxwWGaOgrVde/4E/yM3vItWR/4=", + "dependencies": { + "core-js": "^2.4.0", + "regenerator-runtime": "^0.11.0" + } + }, + "node_modules/babel-runtime/node_modules/core-js": { + "version": "2.6.11", + "resolved": "https://registry.npmjs.org/core-js/-/core-js-2.6.11.tgz", + "integrity": "sha512-5wjnpaT/3dV+XB4borEsnAYQchn00XSgTAWKDkEqv+K8KevjbzmofK6hfJ9TZIlpj2N0xQpazy7PiRQiWHqzWg==", + "hasInstallScript": true + }, + "node_modules/babel-runtime/node_modules/regenerator-runtime": { + "version": "0.11.1", + "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.11.1.tgz", + "integrity": "sha512-MguG95oij0fC3QV3URf4V2SDYGJhJnJGqvIIgdECeODCT98wSWDAJ94SSuVpYQUoTcGUIL6L4yNB7j1DFFHSBg==" + }, + "node_modules/babel-types": { + "version": "6.26.0", + "resolved": "https://registry.npmjs.org/babel-types/-/babel-types-6.26.0.tgz", + "integrity": "sha1-o7Bz+Uq0nrb6Vc1lInozQ4BjJJc=", + "dependencies": { + "babel-runtime": "^6.26.0", + "esutils": "^2.0.2", + "lodash": "^4.17.4", + "to-fast-properties": "^1.0.3" + } + }, + "node_modules/babel-types/node_modules/to-fast-properties": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.3.tgz", + "integrity": "sha1-uDVx+k2MJbguIxsG46MFXeTKGkc=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/babylon": { + "version": "6.18.0", + "resolved": "https://registry.npmjs.org/babylon/-/babylon-6.18.0.tgz", + "integrity": "sha512-q/UEjfGJ2Cm3oKV71DJz9d25TPnq5rhBVL2Q4fA5wcC3jcrdn7+SssEybFIxwAvvP+YCsCYNKughoF33GxgycQ==", + "bin": { + "babylon": "bin/babylon.js" + } + }, + "node_modules/backo2": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/backo2/-/backo2-1.0.2.tgz", + "integrity": "sha1-MasayLEpNjRj41s+u2n038+6eUc=" + }, + "node_modules/balanced-match": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz", + "integrity": "sha1-ibTRmasr7kneFk6gK4nORi1xt2c=" + }, + "node_modules/base": { + "version": "0.11.2", + "resolved": "https://registry.npmjs.org/base/-/base-0.11.2.tgz", + "integrity": "sha512-5T6P4xPgpp0YDFvSWwEZ4NoE3aM4QBQXDzmVbraCkFj8zHM+mba8SyqB5DbZWyR7mYHo6Y7BdQo3MoA4m0TeQg==", + "dependencies": { + "cache-base": "^1.0.1", + "class-utils": "^0.3.5", + "component-emitter": "^1.2.1", + "define-property": "^1.0.0", + "isobject": "^3.0.1", + "mixin-deep": "^1.2.0", + "pascalcase": "^0.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/base/node_modules/define-property": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", + "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", + "dependencies": { + "is-descriptor": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/base/node_modules/is-accessor-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", + "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/base/node_modules/is-data-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", + "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/base/node_modules/is-descriptor": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", + "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", + "dependencies": { + "is-accessor-descriptor": "^1.0.0", + "is-data-descriptor": "^1.0.0", + "kind-of": "^6.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/base16": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/base16/-/base16-1.0.0.tgz", + "integrity": "sha1-4pf2DX7BAUp6lxo568ipjAtoHnA=" + }, + "node_modules/base64-arraybuffer": { + "version": "0.1.5", + "resolved": "https://registry.npmjs.org/base64-arraybuffer/-/base64-arraybuffer-0.1.5.tgz", + "integrity": "sha1-c5JncZI7Whl0etZmqlzUv5xunOg=", + "engines": { + "node": ">= 0.6.0" + } + }, + "node_modules/base64-js": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.3.1.tgz", + "integrity": "sha512-mLQ4i2QO1ytvGWFWmcngKO//JXAQueZvwEKtjgQFM4jIK0kU+ytMfplL8j+n5mspOfjHwoAg+9yhb7BwAHm36g==" + }, + "node_modules/base64id": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/base64id/-/base64id-2.0.0.tgz", + "integrity": "sha512-lGe34o6EHj9y3Kts9R4ZYs/Gr+6N7MCaMlIFA3F1R2O5/m7K06AxfSeO5530PEERE6/WyEg3lsuyw4GHlPZHog==", + "engines": { + "node": "^4.5.0 || >= 5.9" + } + }, + "node_modules/base64url": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/base64url/-/base64url-3.0.1.tgz", + "integrity": "sha512-ir1UPr3dkwexU7FdV8qBBbNDRUhMmIekYMFZfi+C/sLNnRESKPl23nB9b2pltqfOQNnGzsDdId90AEtG5tCx4A==", + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/batch": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/batch/-/batch-0.6.1.tgz", + "integrity": "sha1-3DQxT05nkxgJP8dgJyUl+UvyXBY=", + "dev": true + }, + "node_modules/bcrypt-nodejs": { + "version": "0.0.3", + "resolved": "https://registry.npmjs.org/bcrypt-nodejs/-/bcrypt-nodejs-0.0.3.tgz", + "integrity": "sha1-xgkX8m3CNWYVZsaBBhwwPCsohCs=" + }, + "node_modules/bcrypt-pbkdf": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.2.tgz", + "integrity": "sha1-pDAdOJtqQ/m2f/PKEaP2Y342Dp4=", + "dependencies": { + "tweetnacl": "^0.14.3" + } + }, + "node_modules/better-assert": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/better-assert/-/better-assert-1.0.2.tgz", + "integrity": "sha1-QIZrnhueC1W0gYlDEeaPr/rrxSI=", + "dependencies": { + "callsite": "1.0.0" + }, + "engines": { + "node": "*" + } + }, + "node_modules/bezier-curve": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/bezier-curve/-/bezier-curve-1.0.0.tgz", + "integrity": "sha1-o9+v6rEqlMRicw1QeYxSqEBdc3k=" + }, + "node_modules/big.js": { + "version": "5.2.2", + "resolved": "https://registry.npmjs.org/big.js/-/big.js-5.2.2.tgz", + "integrity": "sha512-vyL2OymJxmarO8gxMr0mhChsO9QGwhynfuu4+MHTAW6czfq9humCB7rKpUjDd9YUiDPU4mzpyupFSvOClAwbmQ==", + "engines": { + "node": "*" + } + }, + "node_modules/bignumber.js": { + "version": "7.2.1", + "resolved": "https://registry.npmjs.org/bignumber.js/-/bignumber.js-7.2.1.tgz", + "integrity": "sha512-S4XzBk5sMB+Rcb/LNcpzXr57VRTxgAvaAEDAl1AwRx27j00hT84O6OkteE7u8UB3NuaaygCRrEpqox4uDOrbdQ==", + "engines": { + "node": "*" + } + }, + "node_modules/binary-extensions": { + "version": "1.13.1", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-1.13.1.tgz", + "integrity": "sha512-Un7MIEDdUC5gNpcGDV97op1Ywk748MpHcFTHoYs6qnj1Z3j7I53VG3nwZhKzoBZmbdRNnb6WRdFlwl7tSDuZGw==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/bindings": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/bindings/-/bindings-1.3.1.tgz", + "integrity": "sha512-i47mqjF9UbjxJhxGf+pZ6kSxrnI3wBLlnGI2ArWJ4r0VrvDS7ZYXkprq/pLaBWYq4GM0r4zdHY+NNRqEMU7uew==" + }, + "node_modules/bl": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/bl/-/bl-4.0.2.tgz", + "integrity": "sha512-j4OH8f6Qg2bGuWfRiltT2HYGx0e1QcBTrK9KAHNMwMZdQnDZFk0ZSYIpADjYCB3U12nicC5tVJwSIhwOWjb4RQ==", + "dependencies": { + "buffer": "^5.5.0", + "inherits": "^2.0.4", + "readable-stream": "^3.4.0" + } + }, + "node_modules/blob": { + "version": "0.0.5", + "resolved": "https://registry.npmjs.org/blob/-/blob-0.0.5.tgz", + "integrity": "sha512-gaqbzQPqOoamawKg0LGVd7SzLgXS+JH61oWprSLH+P+abTczqJbhTR8CmJ2u9/bUYNmHTGJx/UEmn6doAvvuig==" + }, + "node_modules/block-stream": { + "version": "0.0.9", + "resolved": "https://registry.npmjs.org/block-stream/-/block-stream-0.0.9.tgz", + "integrity": "sha1-E+v+d4oDIFz+A3UUgeu0szAMEmo=", + "dependencies": { + "inherits": "~2.0.0" + }, + "engines": { + "node": "0.4 || >=0.5.8" + } + }, + "node_modules/bluebird": { + "version": "3.7.2", + "resolved": "https://registry.npmjs.org/bluebird/-/bluebird-3.7.2.tgz", + "integrity": "sha512-XpNj6GDQzdfW+r2Wnn7xiSAd7TM3jzkxGXBGTtWKuSXv1xUV+azxAm8jdWZN06QTQk+2N2XB9jRDkvbmQmcRtg==" + }, + "node_modules/blueimp-load-image": { + "version": "2.31.0", + "resolved": "https://registry.npmjs.org/blueimp-load-image/-/blueimp-load-image-2.31.0.tgz", + "integrity": "sha512-6sTGh1OiUmuH8ftAYvUzALivoOmcnahinGmjZFI4puZVowXoKTn/bXtth7N1skW5AlezEOfjgFH4lNXHeNRQog==" + }, + "node_modules/bn.js": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-5.2.0.tgz", + "integrity": "sha512-D7iWRBvnZE8ecXiLj/9wbxH7Tk79fAh8IHaTNq1RWRixsS02W+5qS+iE9yq6RYl0asXx5tw0bLhmT5pIfbSquw==", + "dev": true + }, + "node_modules/body-parser": { + "version": "1.19.0", + "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.19.0.tgz", + "integrity": "sha512-dhEPs72UPbDnAQJ9ZKMNTP6ptJaionhP5cBb541nXPlW60Jepo9RV/a4fX4XWW9CuFNK22krhrj1+rgzifNCsw==", + "dependencies": { + "bytes": "3.1.0", + "content-type": "~1.0.4", + "debug": "2.6.9", + "depd": "~1.1.2", + "http-errors": "1.7.2", + "iconv-lite": "0.4.24", + "on-finished": "~2.3.0", + "qs": "6.7.0", + "raw-body": "2.4.0", + "type-is": "~1.6.17" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/body-parser/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/body-parser/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/body-parser/node_modules/qs": { + "version": "6.7.0", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.7.0.tgz", + "integrity": "sha512-VCdBRNFTX1fyE7Nb6FYoURo/SPe62QCaAyzJvUjwRaIsc+NePBEniHlvxFmmX56+HZphIGtV0XeCirBtpDrTyQ==", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/bonjour": { + "version": "3.5.0", + "resolved": "https://registry.npmjs.org/bonjour/-/bonjour-3.5.0.tgz", + "integrity": "sha1-jokKGD2O6aI5OzhExpGkK897yfU=", + "dev": true, + "dependencies": { + "array-flatten": "^2.1.0", + "deep-equal": "^1.0.1", + "dns-equal": "^1.0.0", + "dns-txt": "^2.0.2", + "multicast-dns": "^6.0.1", + "multicast-dns-service-types": "^1.1.0" + } + }, + "node_modules/bonjour/node_modules/array-flatten": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-2.1.2.tgz", + "integrity": "sha512-hNfzcOV8W4NdualtqBFPyVO+54DSJuZGY9qT4pRroB6S9e3iiido2ISIC5h9R2sPJ8H3FHCIiEnsv1lPXO3KtQ==", + "dev": true + }, + "node_modules/boolbase": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/boolbase/-/boolbase-1.0.0.tgz", + "integrity": "sha1-aN/1++YMUes3cl6p4+0xDcwed24=" + }, + "node_modules/bootstrap": { + "version": "4.5.0", + "resolved": "https://registry.npmjs.org/bootstrap/-/bootstrap-4.5.0.tgz", + "integrity": "sha512-Z93QoXvodoVslA+PWNdk23Hze4RBYIkpb5h8I2HY2Tu2h7A0LpAgLcyrhrSUyo2/Oxm2l1fRZPs1e5hnxnliXA==" + }, + "node_modules/bowser": { + "version": "1.9.4", + "resolved": "https://registry.npmjs.org/bowser/-/bowser-1.9.4.tgz", + "integrity": "sha512-9IdMmj2KjigRq6oWhmwv1W36pDuA4STQZ8q6YO9um+x07xgYNCD3Oou+WP/3L1HNz7iqythGet3/p4wvc8AAwQ==" + }, + "node_modules/boxen": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/boxen/-/boxen-1.3.0.tgz", + "integrity": "sha512-TNPjfTr432qx7yOjQyaXm3dSR0MH9vXp7eT1BFSl/C51g+EFnOR9hTg1IreahGBmDNCehscshe45f+C1TBZbLw==", + "dependencies": { + "ansi-align": "^2.0.0", + "camelcase": "^4.0.0", + "chalk": "^2.0.1", + "cli-boxes": "^1.0.0", + "string-width": "^2.0.0", + "term-size": "^1.2.0", + "widest-line": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/boxen/node_modules/camelcase": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz", + "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=", + "engines": { + "node": ">=4" + } + }, + "node_modules/brace-expansion": { + "version": "1.1.11", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/braces": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz", + "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==", + "dependencies": { + "arr-flatten": "^1.1.0", + "array-unique": "^0.3.2", + "extend-shallow": "^2.0.1", + "fill-range": "^4.0.0", + "isobject": "^3.0.1", + "repeat-element": "^1.1.2", + "snapdragon": "^0.8.1", + "snapdragon-node": "^2.0.1", + "split-string": "^3.0.2", + "to-regex": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/braces/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/braces/node_modules/is-extendable": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz", + "integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/brorand": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/brorand/-/brorand-1.1.0.tgz", + "integrity": "sha1-EsJe/kCkXjwyPrhnWgoM5XsiNx8=", + "dev": true + }, + "node_modules/browser-process-hrtime": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/browser-process-hrtime/-/browser-process-hrtime-1.0.0.tgz", + "integrity": "sha512-9o5UecI3GhkpM6DrXr69PblIuWxPKk9Y0jHBRhdocZ2y7YECBFCsHm79Pr3OyR2AvjhDkabFJaDJMYRazHgsow==", + "dev": true + }, + "node_modules/browser-stdout": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/browser-stdout/-/browser-stdout-1.3.1.tgz", + "integrity": "sha512-qhAVI1+Av2X7qelOfAIYwXONood6XlZE/fXaBSmW/T5SzLAmCgzi+eiWE7fUvbHaeNBQH13UftjpXxsfLkMpgw==" + }, + "node_modules/browserify-aes": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/browserify-aes/-/browserify-aes-1.2.0.tgz", + "integrity": "sha512-+7CHXqGuspUn/Sl5aO7Ea0xWGAtETPXNSAjHo48JfLdPWcMng33Xe4znFvQweqc/uzk5zSOI3H52CYnjCfb5hA==", + "dev": true, + "dependencies": { + "buffer-xor": "^1.0.3", + "cipher-base": "^1.0.0", + "create-hash": "^1.1.0", + "evp_bytestokey": "^1.0.3", + "inherits": "^2.0.1", + "safe-buffer": "^5.0.1" + } + }, + "node_modules/browserify-cipher": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/browserify-cipher/-/browserify-cipher-1.0.1.tgz", + "integrity": "sha512-sPhkz0ARKbf4rRQt2hTpAHqn47X3llLkUGn+xEJzLjwY8LRs2p0v7ljvI5EyoRO/mexrNunNECisZs+gw2zz1w==", + "dev": true, + "dependencies": { + "browserify-aes": "^1.0.4", + "browserify-des": "^1.0.0", + "evp_bytestokey": "^1.0.0" + } + }, + "node_modules/browserify-des": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/browserify-des/-/browserify-des-1.0.2.tgz", + "integrity": "sha512-BioO1xf3hFwz4kc6iBhI3ieDFompMhrMlnDFC4/0/vd5MokpuAc3R+LYbwTA9A5Yc9pq9UYPqffKpW2ObuwX5A==", + "dev": true, + "dependencies": { + "cipher-base": "^1.0.1", + "des.js": "^1.0.0", + "inherits": "^2.0.1", + "safe-buffer": "^5.1.2" + } + }, + "node_modules/browserify-rsa": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.1.0.tgz", + "integrity": "sha512-AdEER0Hkspgno2aR97SAf6vi0y0k8NuOpGnVH3O99rcA5Q6sh8QxcngtHuJ6uXwnfAXNM4Gn1Gb7/MV1+Ymbog==", + "dev": true, + "dependencies": { + "bn.js": "^5.0.0", + "randombytes": "^2.0.1" + } + }, + "node_modules/browserify-sign": { + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/browserify-sign/-/browserify-sign-4.2.1.tgz", + "integrity": "sha512-/vrA5fguVAKKAVTNJjgSm1tRQDHUU6DbwO9IROu/0WAzC8PKhucDSh18J0RMvVeHAn5puMd+QHC2erPRNf8lmg==", + "dev": true, + "dependencies": { + "bn.js": "^5.1.1", + "browserify-rsa": "^4.0.1", + "create-hash": "^1.2.0", + "create-hmac": "^1.1.7", + "elliptic": "^6.5.3", + "inherits": "^2.0.4", + "parse-asn1": "^5.1.5", + "readable-stream": "^3.6.0", + "safe-buffer": "^5.2.0" + } + }, + "node_modules/browserify-sign/node_modules/safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", + "dev": true + }, + "node_modules/browserify-zlib": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/browserify-zlib/-/browserify-zlib-0.2.0.tgz", + "integrity": "sha512-Z942RysHXmJrhqk88FmKBVq/v5tqmSkDz7p54G/MGyjMnCFFnC79XWNbg+Vta8W6Wb2qtSZTSxIGkJrRpCFEiA==", + "dev": true, + "dependencies": { + "pako": "~1.0.5" + } + }, + "node_modules/bson": { + "version": "1.0.9", + "resolved": "https://registry.npmjs.org/bson/-/bson-1.0.9.tgz", + "integrity": "sha512-IQX9/h7WdMBIW/q/++tGd+emQr0XMdeZ6icnT/74Xk9fnabWn+gZgpE+9V+gujL3hhJOoNrnDVY7tWdzc7NUTg==", + "engines": { + "node": ">=0.6.19" + } + }, + "node_modules/buffer": { + "version": "5.6.0", + "resolved": "https://registry.npmjs.org/buffer/-/buffer-5.6.0.tgz", + "integrity": "sha512-/gDYp/UtU0eA1ys8bOs9J6a+E/KWIY+DZ+Q2WESNUA0jFRsJOc0SNUO6xJ5SGA1xueg3NL65W6s+NY5l9cunuw==", + "dependencies": { + "base64-js": "^1.0.2", + "ieee754": "^1.1.4" + } + }, + "node_modules/buffer-crc32": { + "version": "0.2.13", + "resolved": "https://registry.npmjs.org/buffer-crc32/-/buffer-crc32-0.2.13.tgz", + "integrity": "sha1-DTM+PwDqxQqhRUq9MO+MKl2ackI=", + "engines": { + "node": "*" + } + }, + "node_modules/buffer-equal-constant-time": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/buffer-equal-constant-time/-/buffer-equal-constant-time-1.0.1.tgz", + "integrity": "sha1-+OcRMvf/5uAaXJaXpMbz5I1cyBk=" + }, + "node_modules/buffer-from": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/buffer-from/-/buffer-from-1.1.1.tgz", + "integrity": "sha512-MQcXEUbCKtEo7bhqEs6560Hyd4XaovZlO/k9V3hjVUF/zwW7KBVdSK4gIt/bzwS9MbR5qob+F5jusZsb0YQK2A==" + }, + "node_modules/buffer-indexof": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/buffer-indexof/-/buffer-indexof-1.1.1.tgz", + "integrity": "sha512-4/rOEg86jivtPTeOUUT61jJO1Ya1TrR/OkqCSZDyq84WJh3LuuiphBYJN+fm5xufIk4XAFcEwte/8WzC8If/1g==", + "dev": true + }, + "node_modules/buffer-shims": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/buffer-shims/-/buffer-shims-1.0.0.tgz", + "integrity": "sha1-mXjOMXOIxkmth5MCjDR37wRKi1E=" + }, + "node_modules/buffer-xor": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/buffer-xor/-/buffer-xor-1.0.3.tgz", + "integrity": "sha1-JuYe0UIvtw3ULm42cp7VHYVf6Nk=", + "dev": true + }, + "node_modules/built-in-math-eval": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/built-in-math-eval/-/built-in-math-eval-0.3.0.tgz", + "integrity": "sha1-JA3CHLOJQ5WIxhxGDrAHZJfvxBw=", + "dependencies": { + "math-codegen": "^0.3.5" + } + }, + "node_modules/builtin-modules": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/builtin-modules/-/builtin-modules-1.1.1.tgz", + "integrity": "sha1-Jw8HbFpywC9bZaR9+Uxf46J4iS8=", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/builtin-status-codes": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz", + "integrity": "sha1-hZgoeOIbmOHGZCXgPQF0eI9Wnug=", + "dev": true + }, + "node_modules/bytes": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.0.tgz", + "integrity": "sha512-zauLjrfCG+xvoyaqLoV8bLVXXNGC4JqlxFCutSDWA6fJrTo2ZuvLYTqZ7aHBLZSMOopbzwv8f+wZcVzfVTI2Dg==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/cacache": { + "version": "10.0.4", + "resolved": "https://registry.npmjs.org/cacache/-/cacache-10.0.4.tgz", + "integrity": "sha512-Dph0MzuH+rTQzGPNT9fAnrPmMmjKfST6trxJeK7NQuHRaVw24VzPRWTmg9MpcwOVQZO0E1FBICUlFeNaKPIfHA==", + "dev": true, + "dependencies": { + "bluebird": "^3.5.1", + "chownr": "^1.0.1", + "glob": "^7.1.2", + "graceful-fs": "^4.1.11", + "lru-cache": "^4.1.1", + "mississippi": "^2.0.0", + "mkdirp": "^0.5.1", + "move-concurrently": "^1.0.1", + "promise-inflight": "^1.0.1", + "rimraf": "^2.6.2", + "ssri": "^5.2.4", + "unique-filename": "^1.1.0", + "y18n": "^4.0.0" + } + }, + "node_modules/cacache/node_modules/lru-cache": { + "version": "4.1.5", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-4.1.5.tgz", + "integrity": "sha512-sWZlbEP2OsHNkXrMl5GYk/jKk70MBng6UU4YI/qGDYbgf6YbP4EvmqISbXCoJiRKs+1bSpFHVgQxvJ17F2li5g==", + "dev": true, + "dependencies": { + "pseudomap": "^1.0.2", + "yallist": "^2.1.2" + } + }, + "node_modules/cacache/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dev": true, + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/cacache/node_modules/yallist": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-2.1.2.tgz", + "integrity": "sha1-HBH5IY8HYImkfdUS+TxmmaaoHVI=", + "dev": true + }, + "node_modules/cache-base": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/cache-base/-/cache-base-1.0.1.tgz", + "integrity": "sha512-AKcdTnFSWATd5/GCPRxr2ChwIJ85CeyrEyjRHlKxQ56d4XJMGym0uAiKn0xbLOGOl3+yRpOTi484dVCEc5AUzQ==", + "dependencies": { + "collection-visit": "^1.0.0", + "component-emitter": "^1.2.1", + "get-value": "^2.0.6", + "has-value": "^1.0.0", + "isobject": "^3.0.1", + "set-value": "^2.0.0", + "to-object-path": "^0.3.0", + "union-value": "^1.0.0", + "unset-value": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/caller-callsite": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/caller-callsite/-/caller-callsite-2.0.0.tgz", + "integrity": "sha1-hH4PzgoiN1CpoCfFSzNzGtMVQTQ=", + "dependencies": { + "callsites": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/caller-callsite/node_modules/callsites": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/callsites/-/callsites-2.0.0.tgz", + "integrity": "sha1-BuuE8A7qQT2oav/vrL/7Ngk7PFA=", + "engines": { + "node": ">=4" + } + }, + "node_modules/caller-path": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/caller-path/-/caller-path-2.0.0.tgz", + "integrity": "sha1-Ro+DBE42mrIBD6xfBs7uFbsssfQ=", + "dependencies": { + "caller-callsite": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/callsite": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/callsite/-/callsite-1.0.0.tgz", + "integrity": "sha1-KAOY5dZkvXQDi28JBRU+borxvCA=", + "engines": { + "node": "*" + } + }, + "node_modules/callsites": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/callsites/-/callsites-3.1.0.tgz", + "integrity": "sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==", + "engines": { + "node": ">=6" + } + }, + "node_modules/camelcase": { + "version": "5.3.1", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", + "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", + "engines": { + "node": ">=6" + } + }, + "node_modules/camelcase-keys": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-2.1.0.tgz", + "integrity": "sha1-MIvur/3ygRkFHvodkyITyRuPkuc=", + "dependencies": { + "camelcase": "^2.0.0", + "map-obj": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/camelcase-keys/node_modules/camelcase": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-2.1.1.tgz", + "integrity": "sha1-fB0W1nmhu+WcoCys7PsBHiAfWh8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/camelize": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/camelize/-/camelize-1.0.0.tgz", + "integrity": "sha1-FkpUg+Yw+kMh5a8HAg5TGDGyYJs=" + }, + "node_modules/canvas": { + "version": "2.6.1", + "resolved": "https://registry.npmjs.org/canvas/-/canvas-2.6.1.tgz", + "integrity": "sha512-S98rKsPcuhfTcYbtF53UIJhcbgIAK533d1kJKMwsMwAIFgfd58MOyxRud3kktlzWiEkFliaJtvyZCBtud/XVEA==", + "hasInstallScript": true, + "dependencies": { + "nan": "^2.14.0", + "node-pre-gyp": "^0.11.0", + "simple-get": "^3.0.3" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/canvas/node_modules/node-pre-gyp": { + "version": "0.11.0", + "resolved": "https://registry.npmjs.org/node-pre-gyp/-/node-pre-gyp-0.11.0.tgz", + "integrity": "sha512-TwWAOZb0j7e9eGaf9esRx3ZcLaE5tQ2lvYy1pb5IAaG1a2e2Kv5Lms1Y4hpj+ciXJRofIxxlt5haeQ/2ANeE0Q==", + "dependencies": { + "detect-libc": "^1.0.2", + "mkdirp": "^0.5.1", + "needle": "^2.2.1", + "nopt": "^4.0.1", + "npm-packlist": "^1.1.6", + "npmlog": "^4.0.2", + "rc": "^1.2.7", + "rimraf": "^2.6.1", + "semver": "^5.3.0", + "tar": "^4" + }, + "bin": { + "node-pre-gyp": "bin/node-pre-gyp" + } + }, + "node_modules/canvas/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/capture-stack-trace": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/capture-stack-trace/-/capture-stack-trace-1.0.1.tgz", + "integrity": "sha512-mYQLZnx5Qt1JgB1WEiMCf2647plpGeQ2NMR/5L0HNZzGQo4fuSPnK+wjfPnKZV0aiJDgzmWqqkV/g7JD+DW0qw==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/caseless": { + "version": "0.12.0", + "resolved": "https://registry.npmjs.org/caseless/-/caseless-0.12.0.tgz", + "integrity": "sha1-G2gcIf+EAzyCZUMJBolCDRhxUdw=" + }, + "node_modules/center-align": { + "version": "0.1.3", + "resolved": "https://registry.npmjs.org/center-align/-/center-align-0.1.3.tgz", + "integrity": "sha1-qg0yYptu6XIgBBHL1EYckHvCt60=", + "dependencies": { + "align-text": "^0.1.3", + "lazy-cache": "^1.0.3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/chai": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/chai/-/chai-4.2.0.tgz", + "integrity": "sha512-XQU3bhBukrOsQCuwZndwGcCVQHyZi53fQ6Ys1Fym7E4olpIqqZZhhoFJoaKVvV17lWQoXYwgWN2nF5crA8J2jw==", + "dependencies": { + "assertion-error": "^1.1.0", + "check-error": "^1.0.2", + "deep-eql": "^3.0.1", + "get-func-name": "^2.0.0", + "pathval": "^1.1.0", + "type-detect": "^4.0.5" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/chain-function": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/chain-function/-/chain-function-1.0.1.tgz", + "integrity": "sha512-SxltgMwL9uCko5/ZCLiyG2B7R9fY4pDZUw7hJ4MhirdjBLosoDqkWABi3XMucddHdLiFJMb7PD2MZifZriuMTg==" + }, + "node_modules/chalk": { + "version": "2.4.2", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", + "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", + "dependencies": { + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/change-emitter": { + "version": "0.1.6", + "resolved": "https://registry.npmjs.org/change-emitter/-/change-emitter-0.1.6.tgz", + "integrity": "sha1-6LL+PX8at9aaMhma/5HqaTFAlRU=" + }, + "node_modules/character-parser": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/character-parser/-/character-parser-2.2.0.tgz", + "integrity": "sha1-x84o821LzZdE5f/CxfzeHHMmH8A=", + "dependencies": { + "is-regex": "^1.0.3" + } + }, + "node_modules/check-error": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/check-error/-/check-error-1.0.2.tgz", + "integrity": "sha1-V00xLt2Iu13YkS6Sht1sCu1KrII=", + "engines": { + "node": "*" + } + }, + "node_modules/cheerio": { + "version": "1.0.0-rc.3", + "resolved": "https://registry.npmjs.org/cheerio/-/cheerio-1.0.0-rc.3.tgz", + "integrity": "sha512-0td5ijfUPuubwLUu0OBoe98gZj8C/AA+RW3v67GPlGOrvxWjZmBXiBCRU+I8VEiNyJzjth40POfHiz2RB3gImA==", + "dependencies": { + "css-select": "~1.2.0", + "dom-serializer": "~0.1.1", + "entities": "~1.1.1", + "htmlparser2": "^3.9.1", + "lodash": "^4.15.0", + "parse5": "^3.0.1" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cheerio/node_modules/dom-serializer": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/dom-serializer/-/dom-serializer-0.1.1.tgz", + "integrity": "sha512-l0IU0pPzLWSHBcieZbpOKgkIn3ts3vAh7ZuFyXNwJxJXk/c4Gwj9xaTJwIDVQCXawWD0qb3IzMGH5rglQaO0XA==", + "dependencies": { + "domelementtype": "^1.3.0", + "entities": "^1.1.1" + } + }, + "node_modules/child_process": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/child_process/-/child_process-1.0.2.tgz", + "integrity": "sha1-sffn/HPSXn/R1FWtyU4UODAYK1o=" + }, + "node_modules/chokidar": { + "version": "2.1.8", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-2.1.8.tgz", + "integrity": "sha512-ZmZUazfOzf0Nve7duiCKD23PFSCs4JPoYyccjUFF3aQkQadqBhfzhjkwBH2mNOG9cTBwhamM37EIsIkZw3nRgg==", + "dependencies": { + "anymatch": "^2.0.0", + "async-each": "^1.0.1", + "braces": "^2.3.2", + "glob-parent": "^3.1.0", + "inherits": "^2.0.3", + "is-binary-path": "^1.0.0", + "is-glob": "^4.0.0", + "normalize-path": "^3.0.0", + "path-is-absolute": "^1.0.0", + "readdirp": "^2.2.1", + "upath": "^1.1.1" + }, + "optionalDependencies": { + "fsevents": "^1.2.7" + } + }, + "node_modules/chokidar/node_modules/bindings": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/bindings/-/bindings-1.5.0.tgz", + "integrity": "sha512-p2q/t/mhvuOj/UeLlV6566GD/guowlr0hHxClI0W9m7MWYkL1F0hLo+0Aexs9HSPCtR1SXQ0TD3MMKrXZajbiQ==", + "optional": true, + "dependencies": { + "file-uri-to-path": "1.0.0" + } + }, + "node_modules/chokidar/node_modules/fsevents": { + "version": "1.2.12", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-1.2.12.tgz", + "integrity": "sha512-Ggd/Ktt7E7I8pxZRbGIs7vwqAPscSESMrCSkx2FtWeqmheJgCo2R74fTsZFCifr0VTPwqRpPv17+6b8Zp7th0Q==", + "bundleDependencies": [ + "node-pre-gyp" + ], + "hasInstallScript": true, + "optional": true, + "os": [ + "darwin" + ], + "dependencies": { + "bindings": "^1.5.0", + "nan": "^2.12.1", + "node-pre-gyp": "*" + }, + "engines": { + "node": ">= 4.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/abbrev": { + "version": "1.1.1", + "inBundle": true, + "license": "ISC", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/ansi-regex": { + "version": "2.1.1", + "inBundle": true, + "license": "MIT", + "optional": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/aproba": { + "version": "1.2.0", + "inBundle": true, + "license": "ISC", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/are-we-there-yet": { + "version": "1.1.5", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "delegates": "^1.0.0", + "readable-stream": "^2.0.6" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/balanced-match": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/brace-expansion": { + "version": "1.1.11", + "inBundle": true, + "license": "MIT", + "optional": true, + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/chownr": { + "version": "1.1.4", + "inBundle": true, + "license": "ISC", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/code-point-at": { + "version": "1.1.0", + "inBundle": true, + "license": "MIT", + "optional": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/concat-map": { + "version": "0.0.1", + "inBundle": true, + "license": "MIT", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/console-control-strings": { + "version": "1.1.0", + "inBundle": true, + "license": "ISC", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/core-util-is": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/debug": { + "version": "3.2.6", + "inBundle": true, + "license": "MIT", + "optional": true, + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/deep-extend": { + "version": "0.6.0", + "inBundle": true, + "license": "MIT", + "optional": true, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/delegates": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/detect-libc": { + "version": "1.0.3", + "inBundle": true, + "license": "Apache-2.0", + "optional": true, + "bin": { + "detect-libc": "bin/detect-libc.js" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/fs-minipass": { + "version": "1.2.7", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "minipass": "^2.6.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/fs.realpath": { + "version": "1.0.0", + "inBundle": true, + "license": "ISC", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/gauge": { + "version": "2.7.4", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "aproba": "^1.0.3", + "console-control-strings": "^1.0.0", + "has-unicode": "^2.0.0", + "object-assign": "^4.1.0", + "signal-exit": "^3.0.0", + "string-width": "^1.0.1", + "strip-ansi": "^3.0.1", + "wide-align": "^1.1.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/glob": { + "version": "7.1.6", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.0.4", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" + }, + "engines": { + "node": "*" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/has-unicode": { + "version": "2.0.1", + "inBundle": true, + "license": "ISC", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/iconv-lite": { + "version": "0.4.24", + "inBundle": true, + "license": "MIT", + "optional": true, + "dependencies": { + "safer-buffer": ">= 2.1.2 < 3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/ignore-walk": { + "version": "3.0.3", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "minimatch": "^3.0.4" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/inflight": { + "version": "1.0.6", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "once": "^1.3.0", + "wrappy": "1" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/inherits": { + "version": "2.0.4", + "inBundle": true, + "license": "ISC", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/ini": { + "version": "1.3.5", + "inBundle": true, + "license": "ISC", + "optional": true, + "engines": { + "node": "*" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/is-fullwidth-code-point": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "optional": true, + "dependencies": { + "number-is-nan": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/isarray": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/minimatch": { + "version": "3.0.4", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "brace-expansion": "^1.1.7" + }, + "engines": { + "node": "*" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/minimist": { + "version": "1.2.5", + "inBundle": true, + "license": "MIT", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/minipass": { + "version": "2.9.0", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "safe-buffer": "^5.1.2", + "yallist": "^3.0.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/minizlib": { + "version": "1.3.3", + "inBundle": true, + "license": "MIT", + "optional": true, + "dependencies": { + "minipass": "^2.9.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/mkdirp": { + "version": "0.5.3", + "deprecated": "Legacy versions of mkdirp are no longer supported. Please update to mkdirp 1.x. (Note that the API surface has changed to use Promises in 1.x.)", + "inBundle": true, + "license": "MIT", + "optional": true, + "dependencies": { + "minimist": "^1.2.5" + }, + "bin": { + "mkdirp": "bin/cmd.js" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/ms": { + "version": "2.1.2", + "inBundle": true, + "license": "MIT", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/needle": { + "version": "2.3.3", + "inBundle": true, + "license": "MIT", + "optional": true, + "dependencies": { + "debug": "^3.2.6", + "iconv-lite": "^0.4.4", + "sax": "^1.2.4" + }, + "bin": { + "needle": "bin/needle" + }, + "engines": { + "node": ">= 4.4.x" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/node-pre-gyp": { + "version": "0.14.0", + "inBundle": true, + "license": "BSD-3-Clause", + "optional": true, + "dependencies": { + "detect-libc": "^1.0.2", + "mkdirp": "^0.5.1", + "needle": "^2.2.1", + "nopt": "^4.0.1", + "npm-packlist": "^1.1.6", + "npmlog": "^4.0.2", + "rc": "^1.2.7", + "rimraf": "^2.6.1", + "semver": "^5.3.0", + "tar": "^4.4.2" + }, + "bin": { + "node-pre-gyp": "bin/node-pre-gyp" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/nopt": { + "version": "4.0.3", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "abbrev": "1", + "osenv": "^0.1.4" + }, + "bin": { + "nopt": "bin/nopt.js" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/npm-bundled": { + "version": "1.1.1", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "npm-normalize-package-bin": "^1.0.1" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/npm-normalize-package-bin": { + "version": "1.0.1", + "inBundle": true, + "license": "ISC", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/npm-packlist": { + "version": "1.4.8", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "ignore-walk": "^3.0.1", + "npm-bundled": "^1.0.1", + "npm-normalize-package-bin": "^1.0.1" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/npmlog": { + "version": "4.1.2", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "are-we-there-yet": "~1.1.2", + "console-control-strings": "~1.1.0", + "gauge": "~2.7.3", + "set-blocking": "~2.0.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/number-is-nan": { + "version": "1.0.1", + "inBundle": true, + "license": "MIT", + "optional": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/object-assign": { + "version": "4.1.1", + "inBundle": true, + "license": "MIT", + "optional": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/once": { + "version": "1.4.0", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "wrappy": "1" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/os-homedir": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT", + "optional": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/os-tmpdir": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT", + "optional": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/osenv": { + "version": "0.1.5", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "os-homedir": "^1.0.0", + "os-tmpdir": "^1.0.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/path-is-absolute": { + "version": "1.0.1", + "inBundle": true, + "license": "MIT", + "optional": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/process-nextick-args": { + "version": "2.0.1", + "inBundle": true, + "license": "MIT", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/rc": { + "version": "1.2.8", + "inBundle": true, + "license": "(BSD-2-Clause OR MIT OR Apache-2.0)", + "optional": true, + "dependencies": { + "deep-extend": "^0.6.0", + "ini": "~1.3.0", + "minimist": "^1.2.0", + "strip-json-comments": "~2.0.1" + }, + "bin": { + "rc": "cli.js" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/readable-stream": { + "version": "2.3.7", + "inBundle": true, + "license": "MIT", + "optional": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/rimraf": { + "version": "2.7.1", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/safe-buffer": { + "version": "5.1.2", + "inBundle": true, + "license": "MIT", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/safer-buffer": { + "version": "2.1.2", + "inBundle": true, + "license": "MIT", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/sax": { + "version": "1.2.4", + "inBundle": true, + "license": "ISC", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/semver": { + "version": "5.7.1", + "inBundle": true, + "license": "ISC", + "optional": true, + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/set-blocking": { + "version": "2.0.0", + "inBundle": true, + "license": "ISC", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/signal-exit": { + "version": "3.0.2", + "inBundle": true, + "license": "ISC", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/string_decoder": { + "version": "1.1.1", + "inBundle": true, + "license": "MIT", + "optional": true, + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/string-width": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT", + "optional": true, + "dependencies": { + "code-point-at": "^1.0.0", + "is-fullwidth-code-point": "^1.0.0", + "strip-ansi": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/strip-ansi": { + "version": "3.0.1", + "inBundle": true, + "license": "MIT", + "optional": true, + "dependencies": { + "ansi-regex": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/strip-json-comments": { + "version": "2.0.1", + "inBundle": true, + "license": "MIT", + "optional": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/tar": { + "version": "4.4.13", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "chownr": "^1.1.1", + "fs-minipass": "^1.2.5", + "minipass": "^2.8.6", + "minizlib": "^1.2.1", + "mkdirp": "^0.5.0", + "safe-buffer": "^5.1.2", + "yallist": "^3.0.3" + }, + "engines": { + "node": ">=4.5" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/util-deprecate": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/wide-align": { + "version": "1.1.3", + "inBundle": true, + "license": "ISC", + "optional": true, + "dependencies": { + "string-width": "^1.0.2 || 2" + } + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/wrappy": { + "version": "1.0.2", + "inBundle": true, + "license": "ISC", + "optional": true + }, + "node_modules/chokidar/node_modules/fsevents/node_modules/yallist": { + "version": "3.1.1", + "inBundle": true, + "license": "ISC", + "optional": true + }, + "node_modules/chownr": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/chownr/-/chownr-1.1.4.tgz", + "integrity": "sha512-jJ0bqzaylmJtVnNgzTeSOs8DPavpbYgEr/b0YL8/2GO3xJEhInFmhKMUnEJQjZumK7KXGFhUy89PrsJWlakBVg==" + }, + "node_modules/chrome": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/chrome/-/chrome-0.1.0.tgz", + "integrity": "sha1-9h2beS/v6MGUxwVt3BAscmqGQyk=", + "dependencies": { + "exeq": "^2.2.0", + "plist": "^1.1.0" + }, + "bin": { + "chrome": "index.js" + } + }, + "node_modules/chrome-trace-event": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/chrome-trace-event/-/chrome-trace-event-1.0.3.tgz", + "integrity": "sha512-p3KULyQg4S7NIHixdwbGX+nFHkoBiA4YQmyWtjb8XngSKV124nJmRysgAeujbUVb15vh+RvFUfCPqU7rXk+hZg==", + "dev": true, + "engines": { + "node": ">=6.0" + } + }, + "node_modules/ci-info": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/ci-info/-/ci-info-1.6.0.tgz", + "integrity": "sha512-vsGdkwSCDpWmP80ncATX7iea5DWQemg1UgCW5J8tqjU3lYw4FBYuj89J0CTVomA7BEfvSZd84GmHko+MxFQU2A==" + }, + "node_modules/cipher-base": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/cipher-base/-/cipher-base-1.0.4.tgz", + "integrity": "sha512-Kkht5ye6ZGmwv40uUDZztayT2ThLQGfnj/T71N/XzeZeo3nf8foyW7zGTsPYkEya3m5f3cAypH+qe7YOrM1U2Q==", + "dev": true, + "dependencies": { + "inherits": "^2.0.1", + "safe-buffer": "^5.0.1" + } + }, + "node_modules/clamp": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/clamp/-/clamp-1.0.1.tgz", + "integrity": "sha1-ZqDmQBGBbjcZaCj9yMjBRzEshjQ=" + }, + "node_modules/class-transformer": { + "version": "0.2.3", + "resolved": "https://registry.npmjs.org/class-transformer/-/class-transformer-0.2.3.tgz", + "integrity": "sha512-qsP+0xoavpOlJHuYsQJsN58HXSl8Jvveo+T37rEvCEeRfMWoytAyR0Ua/YsFgpM6AZYZ/og2PJwArwzJl1aXtQ==" + }, + "node_modules/class-utils": { + "version": "0.3.6", + "resolved": "https://registry.npmjs.org/class-utils/-/class-utils-0.3.6.tgz", + "integrity": "sha512-qOhPa/Fj7s6TY8H8esGu5QNpMMQxz79h+urzrNYN6mn+9BnxlDGf5QZ+XeCDsxSjPqsSR56XOZOJmpeurnLMeg==", + "dependencies": { + "arr-union": "^3.1.0", + "define-property": "^0.2.5", + "isobject": "^3.0.0", + "static-extend": "^0.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/class-utils/node_modules/define-property": { + "version": "0.2.5", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", + "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", + "dependencies": { + "is-descriptor": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/classnames": { + "version": "2.2.6", + "resolved": "https://registry.npmjs.org/classnames/-/classnames-2.2.6.tgz", + "integrity": "sha512-JR/iSQOSt+LQIWwrwEzJ9uk0xfN3mTVYMwt1Ir5mUcSN6pU+V4zQFFaJsclJbPuAUQH+yfWef6tm7l1quW3C8Q==" + }, + "node_modules/clean-css": { + "version": "4.2.3", + "resolved": "https://registry.npmjs.org/clean-css/-/clean-css-4.2.3.tgz", + "integrity": "sha512-VcMWDN54ZN/DS+g58HYL5/n4Zrqe8vHJpGA8KdgUXFU4fuP/aHNw8eld9SyEIyabIMJX/0RaY/fplOo5hYLSFA==", + "dependencies": { + "source-map": "~0.6.0" + }, + "engines": { + "node": ">= 4.0" + } + }, + "node_modules/clean-css/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/cli-boxes": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/cli-boxes/-/cli-boxes-1.0.0.tgz", + "integrity": "sha1-T6kXw+WclKAEzWH47lCdplFocUM=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/cliss": { + "version": "0.0.2", + "resolved": "https://registry.npmjs.org/cliss/-/cliss-0.0.2.tgz", + "integrity": "sha512-6rj9pgdukjT994Md13JCUAgTk91abAKrygL9sAvmHY4F6AKMOV8ccGaxhUUfcBuyg3sundWnn3JE0Mc9W6ZYqw==", + "dependencies": { + "command-line-usage": "^4.0.1", + "deepmerge": "^2.0.0", + "get-stdin": "^5.0.1", + "inspect-parameters-declaration": "0.0.9", + "object-to-arguments": "0.0.8", + "pipe-functions": "^1.3.0", + "strip-ansi": "^4.0.0", + "yargs-parser": "^7.0.0" + } + }, + "node_modules/cliss/node_modules/camelcase": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz", + "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=", + "engines": { + "node": ">=4" + } + }, + "node_modules/cliss/node_modules/yargs-parser": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-7.0.0.tgz", + "integrity": "sha1-jQrELxbqVd69MyyvTEA4s+P139k=", + "dependencies": { + "camelcase": "^4.1.0" + } + }, + "node_modules/cliui": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/cliui/-/cliui-5.0.0.tgz", + "integrity": "sha512-PYeGSEmmHM6zvoef2w8TPzlrnNpXIjTipYK780YswmIP9vjxmd6Y2a3CB2Ks6/AU8NHjZugXvo8w3oWM2qnwXA==", + "dependencies": { + "string-width": "^3.1.0", + "strip-ansi": "^5.2.0", + "wrap-ansi": "^5.1.0" + } + }, + "node_modules/cliui/node_modules/ansi-regex": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", + "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==", + "engines": { + "node": ">=6" + } + }, + "node_modules/cliui/node_modules/string-width": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz", + "integrity": "sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==", + "dependencies": { + "emoji-regex": "^7.0.1", + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^5.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/cliui/node_modules/strip-ansi": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", + "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", + "dependencies": { + "ansi-regex": "^4.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/clj-fuzzy": { + "version": "0.3.3", + "resolved": "https://registry.npmjs.org/clj-fuzzy/-/clj-fuzzy-0.3.3.tgz", + "integrity": "sha1-seU0MJHFIC28UlMoY+HEp4RX8D0=" + }, + "node_modules/clone-deep": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/clone-deep/-/clone-deep-4.0.1.tgz", + "integrity": "sha512-neHB9xuzh/wk0dIHweyAXv2aPGZIVk3pLMe+/RNzINf17fe0OG96QroktYAUm7SM1PBnzTabaLboqqxDyMU+SQ==", + "dev": true, + "dependencies": { + "is-plain-object": "^2.0.4", + "kind-of": "^6.0.2", + "shallow-clone": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/clsx": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/clsx/-/clsx-1.1.1.tgz", + "integrity": "sha512-6/bPho624p3S2pMyvP5kKBPXnI3ufHLObBFCfgx+LkeR5lg2XYy2hqZqUf45ypD8COn2bhgGJSUE+l5dhNBieA==", + "engines": { + "node": ">=6" + } + }, + "node_modules/code-point-at": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/code-point-at/-/code-point-at-1.1.0.tgz", + "integrity": "sha1-DQcLTQQ6W+ozovGkDi7bPZpMz3c=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/collection-visit": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/collection-visit/-/collection-visit-1.0.0.tgz", + "integrity": "sha1-S8A3PBZLwykbTTaMgpzxqApZ3KA=", + "dependencies": { + "map-visit": "^1.0.0", + "object-visit": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/color": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/color/-/color-3.1.2.tgz", + "integrity": "sha512-vXTJhHebByxZn3lDvDJYw4lR5+uB3vuoHsuYA5AKuxRVn5wzzIfQKGLBmgdVRHKTJYeK5rvJcHnrd0Li49CFpg==", + "dependencies": { + "color-convert": "^1.9.1", + "color-string": "^1.5.2" + } + }, + "node_modules/color-convert": { + "version": "1.9.3", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", + "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", + "dependencies": { + "color-name": "1.1.3" + } + }, + "node_modules/color-name": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", + "integrity": "sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=" + }, + "node_modules/color-string": { + "version": "1.5.3", + "resolved": "https://registry.npmjs.org/color-string/-/color-string-1.5.3.tgz", + "integrity": "sha512-dC2C5qeWoYkxki5UAXapdjqO672AM4vZuPGRQfO8b5HKuKGBbKWpITyDYN7TOFKvRW7kOgAn3746clDBMDJyQw==", + "dependencies": { + "color-name": "^1.0.0", + "simple-swizzle": "^0.2.2" + } + }, + "node_modules/colors": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/colors/-/colors-1.4.0.tgz", + "integrity": "sha512-a+UqTh4kgZg/SlGvfbzDHpgRu7AAQOmmqRHJnxhRZICKFUT91brVhNNt58CMWU9PsBbv3PDCZUHbVxuDiH2mtA==", + "engines": { + "node": ">=0.1.90" + } + }, + "node_modules/combined-stream": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.8.tgz", + "integrity": "sha512-FQN4MRfuJeHf7cBbBMJFXhKSDq+2kAArBlmRBvcvFE5BB1HZKXtSFASDhdlz9zOYwxh8lDdnvmMOe/+5cdoEdg==", + "dependencies": { + "delayed-stream": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/command-exists": { + "version": "1.2.6", + "resolved": "https://registry.npmjs.org/command-exists/-/command-exists-1.2.6.tgz", + "integrity": "sha512-Qst/zUUNmS/z3WziPxyqjrcz09pm+2Knbs5mAZL4VAE0sSrNY1/w8+/YxeHcoBTsO6iojA6BW7eFf27Eg2MRuw==" + }, + "node_modules/command-line-usage": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/command-line-usage/-/command-line-usage-4.1.0.tgz", + "integrity": "sha512-MxS8Ad995KpdAC0Jopo/ovGIroV/m0KHwzKfXxKag6FHOkGsH8/lv5yjgablcRxCJJC0oJeUMuO/gmaq+Wq46g==", + "dependencies": { + "ansi-escape-sequences": "^4.0.0", + "array-back": "^2.0.0", + "table-layout": "^0.4.2", + "typical": "^2.6.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/commander": { + "version": "2.20.3", + "resolved": "https://registry.npmjs.org/commander/-/commander-2.20.3.tgz", + "integrity": "sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ==" + }, + "node_modules/commondir": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/commondir/-/commondir-1.0.1.tgz", + "integrity": "sha1-3dgA2gxmEnOTzKWVDqloo6rxJTs=", + "dev": true + }, + "node_modules/component-bind": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/component-bind/-/component-bind-1.0.0.tgz", + "integrity": "sha1-AMYIq33Nk4l8AAllGx06jh5zu9E=" + }, + "node_modules/component-emitter": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.3.0.tgz", + "integrity": "sha512-Rd3se6QB+sO1TwqZjscQrurpEPIfO0/yYnSin6Q/rD3mOutHvUrCAhJub3r90uNb+SESBuE0QYoB90YdfatsRg==" + }, + "node_modules/component-inherit": { + "version": "0.0.3", + "resolved": "https://registry.npmjs.org/component-inherit/-/component-inherit-0.0.3.tgz", + "integrity": "sha1-ZF/ErfWLcrZJ1crmUTVhnbJv8UM=" + }, + "node_modules/compress-commons": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/compress-commons/-/compress-commons-2.1.1.tgz", + "integrity": "sha512-eVw6n7CnEMFzc3duyFVrQEuY1BlHR3rYsSztyG32ibGMW722i3C6IizEGMFmfMU+A+fALvBIwxN3czffTcdA+Q==", + "dependencies": { + "buffer-crc32": "^0.2.13", + "crc32-stream": "^3.0.1", + "normalize-path": "^3.0.0", + "readable-stream": "^2.3.6" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/compress-commons/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/compressible": { + "version": "2.0.18", + "resolved": "https://registry.npmjs.org/compressible/-/compressible-2.0.18.tgz", + "integrity": "sha512-AF3r7P5dWxL8MxyITRMlORQNaOA2IkAFaTr4k7BUumjPtRpGDTZpl0Pb1XCO6JeDCBdp126Cgs9sMxqSjgYyRg==", + "dev": true, + "dependencies": { + "mime-db": ">= 1.43.0 < 2" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/compression": { + "version": "1.7.4", + "resolved": "https://registry.npmjs.org/compression/-/compression-1.7.4.tgz", + "integrity": "sha512-jaSIDzP9pZVS4ZfQ+TzvtiWhdpFhE2RDHz8QJkpX9SIpLq88VueF5jJw6t+6CUQcAoA6t+x89MLrWAqpfDE8iQ==", + "dev": true, + "dependencies": { + "accepts": "~1.3.5", + "bytes": "3.0.0", + "compressible": "~2.0.16", + "debug": "2.6.9", + "on-headers": "~1.0.2", + "safe-buffer": "5.1.2", + "vary": "~1.1.2" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/compression/node_modules/bytes": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.0.0.tgz", + "integrity": "sha1-0ygVQE1olpn4Wk6k+odV3ROpYEg=", + "dev": true, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/compression/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dev": true, + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/compression/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=", + "dev": true + }, + "node_modules/concat-map": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", + "integrity": "sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=" + }, + "node_modules/concat-stream": { + "version": "1.6.2", + "resolved": "https://registry.npmjs.org/concat-stream/-/concat-stream-1.6.2.tgz", + "integrity": "sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==", + "engines": [ + "node >= 0.8" + ], + "dependencies": { + "buffer-from": "^1.0.0", + "inherits": "^2.0.3", + "readable-stream": "^2.2.2", + "typedarray": "^0.0.6" + } + }, + "node_modules/concat-stream/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/configstore": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/configstore/-/configstore-3.1.2.tgz", + "integrity": "sha512-vtv5HtGjcYUgFrXc6Kx747B83MRRVS5R1VTEQoXvuP+kMI+if6uywV0nDGoiydJRy4yk7h9od5Og0kxx4zUXmw==", + "dependencies": { + "dot-prop": "^4.1.0", + "graceful-fs": "^4.1.2", + "make-dir": "^1.0.0", + "unique-string": "^1.0.0", + "write-file-atomic": "^2.0.0", + "xdg-basedir": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/connect-flash": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/connect-flash/-/connect-flash-0.1.1.tgz", + "integrity": "sha1-2GMPJtlaf4UfmVax6MxnMvO2qjA=", + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/connect-history-api-fallback": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/connect-history-api-fallback/-/connect-history-api-fallback-1.6.0.tgz", + "integrity": "sha512-e54B99q/OUoH64zYYRf3HBP5z24G38h5D3qXu23JGRoigpX5Ss4r9ZnDk3g0Z8uQC2x2lPaJ+UlWBc1ZWBWdLg==", + "dev": true, + "engines": { + "node": ">=0.8" + } + }, + "node_modules/connect-mongo": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/connect-mongo/-/connect-mongo-2.0.3.tgz", + "integrity": "sha512-Vs+QZ/6X6gbCrP1Ls7Oh/wlyY6pgpbPSrUKF5yRT+zd+4GZPNbjNquxquZ+Clv2+03HBXE7T4lVM0PUcaBhihg==", + "dependencies": { + "mongodb": "^2.0.36" + } + }, + "node_modules/connect-mongo/node_modules/mongodb": { + "version": "2.2.36", + "resolved": "https://registry.npmjs.org/mongodb/-/mongodb-2.2.36.tgz", + "integrity": "sha512-P2SBLQ8Z0PVx71ngoXwo12+FiSfbNfGOClAao03/bant5DgLNkOPAck5IaJcEk4gKlQhDEURzfR3xuBG1/B+IA==", + "dependencies": { + "es6-promise": "3.2.1", + "mongodb-core": "2.1.20", + "readable-stream": "2.2.7" + }, + "engines": { + "node": ">=0.10.3" + } + }, + "node_modules/connect-mongo/node_modules/process-nextick-args": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-1.0.7.tgz", + "integrity": "sha1-FQ4gt1ZZCtP5EJPyWk8q2L/zC6M=" + }, + "node_modules/connect-mongo/node_modules/readable-stream": { + "version": "2.2.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.2.7.tgz", + "integrity": "sha1-BwV6y+JGeyIELTb5jFrVBwVOlbE=", + "dependencies": { + "buffer-shims": "~1.0.0", + "core-util-is": "~1.0.0", + "inherits": "~2.0.1", + "isarray": "~1.0.0", + "process-nextick-args": "~1.0.6", + "string_decoder": "~1.0.0", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/connect-mongo/node_modules/string_decoder": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.0.3.tgz", + "integrity": "sha512-4AH6Z5fzNNBcH+6XDMfA/BTt87skxqJlO0lAh3Dker5zThcAxG6mKz+iGu308UKoPPQ8Dcqx/4JhujzltRa+hQ==", + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/console-browserify": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/console-browserify/-/console-browserify-1.2.0.tgz", + "integrity": "sha512-ZMkYO/LkF17QvCPqM0gxw8yUzigAOZOSWSHg91FH6orS7vcEj5dVZTidN2fQ14yBSdg97RqhSNwLUXInd52OTA==", + "dev": true + }, + "node_modules/console-control-strings": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/console-control-strings/-/console-control-strings-1.1.0.tgz", + "integrity": "sha1-PXz0Rk22RG6mRL9LOVB/mFEAjo4=" + }, + "node_modules/constantinople": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/constantinople/-/constantinople-3.1.2.tgz", + "integrity": "sha512-yePcBqEFhLOqSBtwYOGGS1exHo/s1xjekXiinh4itpNQGCu4KA1euPh1fg07N2wMITZXQkBz75Ntdt1ctGZouw==", + "dependencies": { + "@types/babel-types": "^7.0.0", + "@types/babylon": "^6.16.2", + "babel-types": "^6.26.0", + "babylon": "^6.18.0" + } + }, + "node_modules/constants-browserify": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/constants-browserify/-/constants-browserify-1.0.0.tgz", + "integrity": "sha1-wguW2MYXdIqvHBYCF2DNJ/y4y3U=", + "dev": true + }, + "node_modules/content-disposition": { + "version": "0.5.3", + "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.3.tgz", + "integrity": "sha512-ExO0774ikEObIAEV9kDo50o+79VCUdEB6n6lzKgGwupcVeRlhrj3qGAfwq8G6uBJjkqLrhT0qEYFcWng8z1z0g==", + "dependencies": { + "safe-buffer": "5.1.2" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/content-type": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.4.tgz", + "integrity": "sha512-hIP3EEPs8tB9AT1L+NUqtwOAps4mk2Zob89MWXMHjHWg9milF/j4osnnQLXBCBFBk/tvIG/tUc9mOUJiPBhPXA==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/convert-source-map": { + "version": "1.7.0", + "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.7.0.tgz", + "integrity": "sha512-4FJkXzKXEDB1snCFZlLP4gpC3JILicCpGbzG9f9G7tGqGCzETQ2hWPrcinA9oU4wtf2biUaEH5065UnMeR33oA==", + "dependencies": { + "safe-buffer": "~5.1.1" + } + }, + "node_modules/cookie": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.4.0.tgz", + "integrity": "sha512-+Hp8fLp57wnUSt0tY0tHEXh4voZRDnoIrZPqlo3DPiI4y9lwg/jqx+1Om94/W6ZaPDOUbnjOt/99w66zk+l1Xg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cookie-parser": { + "version": "1.4.5", + "resolved": "https://registry.npmjs.org/cookie-parser/-/cookie-parser-1.4.5.tgz", + "integrity": "sha512-f13bPUj/gG/5mDr+xLmSxxDsB9DQiTIfhJS/sqjrmfAWiAN+x2O4i/XguTL9yDZ+/IFDanJ+5x7hC4CXT9Tdzw==", + "dependencies": { + "cookie": "0.4.0", + "cookie-signature": "1.0.6" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/cookie-session": { + "version": "2.0.0-rc.1", + "resolved": "https://registry.npmjs.org/cookie-session/-/cookie-session-2.0.0-rc.1.tgz", + "integrity": "sha512-zg80EsLe7S1J4y0XxV7SZ8Fbi90ZZoampuX2bfYDOvJfc//98sSlZC41YDzTTjtVbeU1VlVdBbldXOOyi5xzEw==", + "dependencies": { + "cookies": "0.8.0", + "debug": "3.2.6", + "on-headers": "~1.0.2", + "safe-buffer": "5.2.0" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/cookie-session/node_modules/safe-buffer": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.0.tgz", + "integrity": "sha512-fZEwUGbVl7kouZs1jCdMLdt95hdIv0ZeHg6L7qPeciMZhZ+/gdesW4wgTARkrFWEpspjEATAzUGPG8N2jJiwbg==" + }, + "node_modules/cookie-signature": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz", + "integrity": "sha1-4wOogrNCzD7oylE6eZmXNNqzriw=" + }, + "node_modules/cookies": { + "version": "0.8.0", + "resolved": "https://registry.npmjs.org/cookies/-/cookies-0.8.0.tgz", + "integrity": "sha512-8aPsApQfebXnuI+537McwYsDtjVxGm8gTIzQI3FDW6t5t/DAhERxtnbEPN/8RX+uZthoz4eCOgloXaE5cYyNow==", + "dependencies": { + "depd": "~2.0.0", + "keygrip": "~1.1.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/cookies/node_modules/depd": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz", + "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/copy-concurrently": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/copy-concurrently/-/copy-concurrently-1.0.5.tgz", + "integrity": "sha512-f2domd9fsVDFtaFcbaRZuYXwtdmnzqbADSwhSWYxYB/Q8zsdUUFMXVRwXGDMWmbEzAn1kdRrtI1T/KTFOL4X2A==", + "dev": true, + "dependencies": { + "aproba": "^1.1.1", + "fs-write-stream-atomic": "^1.0.8", + "iferr": "^0.1.5", + "mkdirp": "^0.5.1", + "rimraf": "^2.5.4", + "run-queue": "^1.0.0" + } + }, + "node_modules/copy-concurrently/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dev": true, + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/copy-descriptor": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/copy-descriptor/-/copy-descriptor-0.1.1.tgz", + "integrity": "sha1-Z29us8OZl8LuGsOpJP1hJHSPV40=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/copy-webpack-plugin": { + "version": "4.6.0", + "resolved": "https://registry.npmjs.org/copy-webpack-plugin/-/copy-webpack-plugin-4.6.0.tgz", + "integrity": "sha512-Y+SQCF+0NoWQryez2zXn5J5knmr9z/9qSQt7fbL78u83rxmigOy8X5+BFn8CFSuX+nKT8gpYwJX68ekqtQt6ZA==", + "dev": true, + "dependencies": { + "cacache": "^10.0.4", + "find-cache-dir": "^1.0.0", + "globby": "^7.1.1", + "is-glob": "^4.0.0", + "loader-utils": "^1.1.0", + "minimatch": "^3.0.4", + "p-limit": "^1.0.0", + "serialize-javascript": "^1.4.0" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/copy-webpack-plugin/node_modules/p-limit": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-1.3.0.tgz", + "integrity": "sha512-vvcXsLAJ9Dr5rQOPk7toZQZJApBl2K4J6dANSsEuh6QI41JYcsS/qhTGa9ErIUUgK3WNQoJYvylxvjqmiqEA9Q==", + "dev": true, + "dependencies": { + "p-try": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/copy-webpack-plugin/node_modules/p-try": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/p-try/-/p-try-1.0.0.tgz", + "integrity": "sha1-y8ec26+P1CKOE/Yh8rGiN8GyB7M=", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/core-js": { + "version": "1.2.7", + "resolved": "https://registry.npmjs.org/core-js/-/core-js-1.2.7.tgz", + "integrity": "sha1-ZSKUwUZR2yj6k70tX/KYOk8IxjY=" + }, + "node_modules/core-js-pure": { + "version": "3.6.5", + "resolved": "https://registry.npmjs.org/core-js-pure/-/core-js-pure-3.6.5.tgz", + "integrity": "sha512-lacdXOimsiD0QyNf9BC/mxivNJ/ybBGJXQFKzRekp1WTHoVUWsUHEn+2T8GJAzzIhyOuXA+gOxCVN3l+5PLPUA==", + "hasInstallScript": true + }, + "node_modules/core-util-is": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz", + "integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=" + }, + "node_modules/cors": { + "version": "2.8.5", + "resolved": "https://registry.npmjs.org/cors/-/cors-2.8.5.tgz", + "integrity": "sha512-KIHbLJqu73RGr/hnbrO9uBeixNGuvSQjul/jdFvS/KFSIH1hWVd1ng7zOHx+YrEfInLG7q4n6GHQ9cDtxv/P6g==", + "dependencies": { + "object-assign": "^4", + "vary": "^1" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/cosmiconfig": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/cosmiconfig/-/cosmiconfig-6.0.0.tgz", + "integrity": "sha512-xb3ZL6+L8b9JLLCx3ZdoZy4+2ECphCMo2PwqgP1tlfVq6M6YReyzBJtvWWtbDSpNr9hn96pkCiZqUcFEc+54Qg==", + "dependencies": { + "@types/parse-json": "^4.0.0", + "import-fresh": "^3.1.0", + "parse-json": "^5.0.0", + "path-type": "^4.0.0", + "yaml": "^1.7.2" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/crc": { + "version": "3.8.0", + "resolved": "https://registry.npmjs.org/crc/-/crc-3.8.0.tgz", + "integrity": "sha512-iX3mfgcTMIq3ZKLIsVFAbv7+Mc10kxabAGQb8HvjA1o3T1PIYprbakQ65d3I+2HGHt6nSKkM9PYjgoJO2KcFBQ==", + "dependencies": { + "buffer": "^5.1.0" + } + }, + "node_modules/crc32-stream": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/crc32-stream/-/crc32-stream-3.0.1.tgz", + "integrity": "sha512-mctvpXlbzsvK+6z8kJwSJ5crm7yBwrQMTybJzMw1O4lLGJqjlDCXY2Zw7KheiA6XBEcBmfLx1D88mjRGVJtY9w==", + "dependencies": { + "crc": "^3.4.4", + "readable-stream": "^3.4.0" + }, + "engines": { + "node": ">= 6.9.0" + } + }, + "node_modules/create-ecdh": { + "version": "4.0.4", + "resolved": "https://registry.npmjs.org/create-ecdh/-/create-ecdh-4.0.4.tgz", + "integrity": "sha512-mf+TCx8wWc9VpuxfP2ht0iSISLZnt0JgWlrOKZiNqyUZWnjIaCIVNQArMHnCZKfEYRg6IM7A+NeJoN8gf/Ws0A==", + "dev": true, + "dependencies": { + "bn.js": "^4.1.0", + "elliptic": "^6.5.3" + } + }, + "node_modules/create-ecdh/node_modules/bn.js": { + "version": "4.12.0", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", + "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==", + "dev": true + }, + "node_modules/create-emotion": { + "version": "10.0.27", + "resolved": "https://registry.npmjs.org/create-emotion/-/create-emotion-10.0.27.tgz", + "integrity": "sha512-fIK73w82HPPn/RsAij7+Zt8eCE8SptcJ3WoRMfxMtjteYxud8GDTKKld7MYwAX2TVhrw29uR1N/bVGxeStHILg==", + "dependencies": { + "@emotion/cache": "^10.0.27", + "@emotion/serialize": "^0.11.15", + "@emotion/sheet": "0.9.4", + "@emotion/utils": "0.11.3" + } + }, + "node_modules/create-error-class": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/create-error-class/-/create-error-class-3.0.2.tgz", + "integrity": "sha1-Br56vvlHo/FKMP1hBnHUAbyot7Y=", + "dependencies": { + "capture-stack-trace": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/create-hash": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/create-hash/-/create-hash-1.2.0.tgz", + "integrity": "sha512-z00bCGNHDG8mHAkP7CtT1qVu+bFQUPjYq/4Iv3C3kWjTFV10zIjfSoeqXo9Asws8gwSHDGj/hl2u4OGIjapeCg==", + "dev": true, + "dependencies": { + "cipher-base": "^1.0.1", + "inherits": "^2.0.1", + "md5.js": "^1.3.4", + "ripemd160": "^2.0.1", + "sha.js": "^2.4.0" + } + }, + "node_modules/create-hmac": { + "version": "1.1.7", + "resolved": "https://registry.npmjs.org/create-hmac/-/create-hmac-1.1.7.tgz", + "integrity": "sha512-MJG9liiZ+ogc4TzUwuvbER1JRdgvUFSB5+VR/g5h82fGaIRWMWddtKBHi7/sVhfjQZ6SehlyhvQYrcYkaUIpLg==", + "dev": true, + "dependencies": { + "cipher-base": "^1.0.3", + "create-hash": "^1.1.0", + "inherits": "^2.0.1", + "ripemd160": "^2.0.0", + "safe-buffer": "^5.0.1", + "sha.js": "^2.4.8" + } + }, + "node_modules/create-react-context": { + "version": "0.2.3", + "resolved": "https://registry.npmjs.org/create-react-context/-/create-react-context-0.2.3.tgz", + "integrity": "sha512-CQBmD0+QGgTaxDL3OX1IDXYqjkp2It4RIbcb99jS6AEg27Ga+a9G3JtK6SIu0HBwPLZlmwt9F7UwWA4Bn92Rag==", + "dependencies": { + "fbjs": "^0.8.0", + "gud": "^1.0.0" + } + }, + "node_modules/cross-env": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/cross-env/-/cross-env-5.2.1.tgz", + "integrity": "sha512-1yHhtcfAd1r4nwQgknowuUNfIT9E8dOMMspC36g45dN+iD1blloi7xp8X/xAIDnjHWyt1uQ8PHk2fkNaym7soQ==", + "dev": true, + "dependencies": { + "cross-spawn": "^6.0.5" + }, + "bin": { + "cross-env": "dist/bin/cross-env.js", + "cross-env-shell": "dist/bin/cross-env-shell.js" + }, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/cross-env/node_modules/cross-spawn": { + "version": "6.0.5", + "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-6.0.5.tgz", + "integrity": "sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==", + "dev": true, + "dependencies": { + "nice-try": "^1.0.4", + "path-key": "^2.0.1", + "semver": "^5.5.0", + "shebang-command": "^1.2.0", + "which": "^1.2.9" + }, + "engines": { + "node": ">=4.8" + } + }, + "node_modules/cross-fetch": { + "version": "3.0.4", + "resolved": "https://registry.npmjs.org/cross-fetch/-/cross-fetch-3.0.4.tgz", + "integrity": "sha512-MSHgpjQqgbT/94D4CyADeNoYh52zMkCX4pcJvPP5WqPsLFMKjr2TCMg381ox5qI0ii2dPwaLx/00477knXqXVw==", + "dependencies": { + "node-fetch": "2.6.0", + "whatwg-fetch": "3.0.0" + } + }, + "node_modules/cross-fetch/node_modules/node-fetch": { + "version": "2.6.0", + "resolved": "https://registry.npmjs.org/node-fetch/-/node-fetch-2.6.0.tgz", + "integrity": "sha512-8dG4H5ujfvFiqDmVu9fQ5bOHUC15JMjMY/Zumv26oOvvVJjM67KF8koCWIabKQ1GJIa9r2mMZscBq/TbdOcmNA==", + "engines": { + "node": "4.x || >=6.0.0" + } + }, + "node_modules/cross-spawn": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-3.0.1.tgz", + "integrity": "sha1-ElYDfsufDF9549bvE14wdwGEuYI=", + "dependencies": { + "lru-cache": "^4.0.1", + "which": "^1.2.9" + } + }, + "node_modules/cross-spawn/node_modules/lru-cache": { + "version": "4.1.5", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-4.1.5.tgz", + "integrity": "sha512-sWZlbEP2OsHNkXrMl5GYk/jKk70MBng6UU4YI/qGDYbgf6YbP4EvmqISbXCoJiRKs+1bSpFHVgQxvJ17F2li5g==", + "dependencies": { + "pseudomap": "^1.0.2", + "yallist": "^2.1.2" + } + }, + "node_modules/cross-spawn/node_modules/yallist": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-2.1.2.tgz", + "integrity": "sha1-HBH5IY8HYImkfdUS+TxmmaaoHVI=" + }, + "node_modules/crypto-browserify": { + "version": "3.12.0", + "resolved": "https://registry.npmjs.org/crypto-browserify/-/crypto-browserify-3.12.0.tgz", + "integrity": "sha512-fz4spIh+znjO2VjL+IdhEpRJ3YN6sMzITSBijk6FK2UvTqruSQW+/cCZTSNsMiZNvUeq0CqurF+dAbyiGOY6Wg==", + "dev": true, + "dependencies": { + "browserify-cipher": "^1.0.0", + "browserify-sign": "^4.0.0", + "create-ecdh": "^4.0.0", + "create-hash": "^1.1.0", + "create-hmac": "^1.1.0", + "diffie-hellman": "^5.0.0", + "inherits": "^2.0.1", + "pbkdf2": "^3.0.3", + "public-encrypt": "^4.0.0", + "randombytes": "^2.0.0", + "randomfill": "^1.0.3" + }, + "engines": { + "node": "*" + } + }, + "node_modules/crypto-random-string": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/crypto-random-string/-/crypto-random-string-1.0.0.tgz", + "integrity": "sha1-ojD2T1aDEOFJgAmUB5DsmVRbyn4=", + "engines": { + "node": ">=4" + } + }, + "node_modules/css-box-model": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/css-box-model/-/css-box-model-1.2.1.tgz", + "integrity": "sha512-a7Vr4Q/kd/aw96bnJG332W9V9LkJO69JRcaCYDUqjp6/z0w6VcZjgAcTbgFxEPfBgdnAwlh3iwu+hLopa+flJw==", + "dependencies": { + "tiny-invariant": "^1.0.6" + } + }, + "node_modules/css-color-keywords": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/css-color-keywords/-/css-color-keywords-1.0.0.tgz", + "integrity": "sha1-/qJhbcZ2spYmhrOvjb2+GAskTgU=", + "engines": { + "node": ">=4" + } + }, + "node_modules/css-in-js-utils": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/css-in-js-utils/-/css-in-js-utils-2.0.1.tgz", + "integrity": "sha512-PJF0SpJT+WdbVVt0AOYp9C8GnuruRlL/UFW7932nLWmFLQTaWEzTBQEx7/hn4BuV+WON75iAViSUJLiU3PKbpA==", + "dependencies": { + "hyphenate-style-name": "^1.0.2", + "isobject": "^3.0.1" + } + }, + "node_modules/css-loader": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/css-loader/-/css-loader-2.1.1.tgz", + "integrity": "sha512-OcKJU/lt232vl1P9EEDamhoO9iKY3tIjY5GU+XDLblAykTdgs6Ux9P1hTHve8nFKy5KPpOXOsVI/hIwi3841+w==", + "dev": true, + "dependencies": { + "camelcase": "^5.2.0", + "icss-utils": "^4.1.0", + "loader-utils": "^1.2.3", + "normalize-path": "^3.0.0", + "postcss": "^7.0.14", + "postcss-modules-extract-imports": "^2.0.0", + "postcss-modules-local-by-default": "^2.0.6", + "postcss-modules-scope": "^2.1.0", + "postcss-modules-values": "^2.0.0", + "postcss-value-parser": "^3.3.0", + "schema-utils": "^1.0.0" + }, + "engines": { + "node": ">= 6.9.0" + } + }, + "node_modules/css-loader/node_modules/schema-utils": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", + "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", + "dev": true, + "dependencies": { + "ajv": "^6.1.0", + "ajv-errors": "^1.0.0", + "ajv-keywords": "^3.1.0" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/css-select": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/css-select/-/css-select-1.2.0.tgz", + "integrity": "sha1-KzoRBTnFNV8c2NMUYj6HCxIeyFg=", + "dependencies": { + "boolbase": "~1.0.0", + "css-what": "2.1", + "domutils": "1.5.1", + "nth-check": "~1.0.1" + } + }, + "node_modules/css-select/node_modules/domutils": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/domutils/-/domutils-1.5.1.tgz", + "integrity": "sha1-3NhIiib1Y9YQeeSMn3t+Mjc2gs8=", + "dependencies": { + "dom-serializer": "0", + "domelementtype": "1" + } + }, + "node_modules/css-to-react-native": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/css-to-react-native/-/css-to-react-native-2.3.2.tgz", + "integrity": "sha512-VOFaeZA053BqvvvqIA8c9n0+9vFppVBAHCp6JgFTtTMU3Mzi+XnelJ9XC9ul3BqFzZyQ5N+H0SnwsWT2Ebchxw==", + "dependencies": { + "camelize": "^1.0.0", + "css-color-keywords": "^1.0.0", + "postcss-value-parser": "^3.3.0" + } + }, + "node_modules/css-vendor": { + "version": "2.0.8", + "resolved": "https://registry.npmjs.org/css-vendor/-/css-vendor-2.0.8.tgz", + "integrity": "sha512-x9Aq0XTInxrkuFeHKbYC7zWY8ai7qJ04Kxd9MnvbC1uO5DagxoHQjm4JvG+vCdXOoFtCjbL2XSZfxmoYa9uQVQ==", + "dependencies": { + "@babel/runtime": "^7.8.3", + "is-in-browser": "^1.0.2" + } + }, + "node_modules/css-what": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/css-what/-/css-what-2.1.3.tgz", + "integrity": "sha512-a+EPoD+uZiNfh+5fxw2nO9QwFa6nJe2Or35fGY6Ipw1R3R4AGz1d1TEZrCegvw2YTmZ0jXirGYlzxxpYSHwpEg==", + "engines": { + "node": "*" + } + }, + "node_modules/cssesc": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/cssesc/-/cssesc-3.0.0.tgz", + "integrity": "sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg==", + "dev": true, + "bin": { + "cssesc": "bin/cssesc" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/cssom": { + "version": "0.4.4", + "resolved": "https://registry.npmjs.org/cssom/-/cssom-0.4.4.tgz", + "integrity": "sha512-p3pvU7r1MyyqbTk+WbNJIgJjG2VmTIaB10rI93LzVPrmDJKkzKYMtxxyAvQXR/NS6otuzveI7+7BBq3SjBS2mw==", + "dev": true + }, + "node_modules/cssstyle": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/cssstyle/-/cssstyle-2.2.0.tgz", + "integrity": "sha512-sEb3XFPx3jNnCAMtqrXPDeSgQr+jojtCeNf8cvMNMh1cG970+lljssvQDzPq6lmmJu2Vhqood/gtEomBiHOGnA==", + "dev": true, + "dependencies": { + "cssom": "~0.3.6" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/cssstyle/node_modules/cssom": { + "version": "0.3.8", + "resolved": "https://registry.npmjs.org/cssom/-/cssom-0.3.8.tgz", + "integrity": "sha512-b0tGHbfegbhPJpxpiBPU2sCkigAqtM9O121le6bbOlgyV+NyGyCmVfJ6QW9eRjz8CpNfWEOYBIMIGRYkLwsIYg==", + "dev": true + }, + "node_modules/csstype": { + "version": "2.6.10", + "resolved": "https://registry.npmjs.org/csstype/-/csstype-2.6.10.tgz", + "integrity": "sha512-D34BqZU4cIlMCY93rZHbrq9pjTAQJ3U8S8rfBqjwHxkGPThWFjzZDQpgMJY0QViLxth6ZKYiwFBo14RdN44U/w==" + }, + "node_modules/currently-unhandled": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/currently-unhandled/-/currently-unhandled-0.4.1.tgz", + "integrity": "sha1-mI3zP+qxke95mmE2nddsF635V+o=", + "dependencies": { + "array-find-index": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/custom-event": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/custom-event/-/custom-event-1.0.1.tgz", + "integrity": "sha1-XQKkaFCt8bSjF5RqOSj8y1v9BCU=" + }, + "node_modules/cyclist": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/cyclist/-/cyclist-1.0.1.tgz", + "integrity": "sha1-WW6WmP0MgOEgOMK4LW6xs1tiJNk=", + "dev": true + }, + "node_modules/d": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/d/-/d-1.0.1.tgz", + "integrity": "sha512-m62ShEObQ39CfralilEQRjH6oAMtNCV1xJyEx5LpRYUVN+EviphDgUc/F3hnYbADmkiNs67Y+3ylmlG7Lnu+FA==", + "dev": true, + "dependencies": { + "es5-ext": "^0.10.50", + "type": "^1.0.1" + } + }, + "node_modules/d3-array": { + "version": "1.2.4", + "resolved": "https://registry.npmjs.org/d3-array/-/d3-array-1.2.4.tgz", + "integrity": "sha512-KHW6M86R+FUPYGb3R5XiYjXPq7VzwxZ22buHhAEVG5ztoEcZZMLov530mmccaqA1GghZArjQV46fuc8kUqhhHw==" + }, + "node_modules/d3-axis": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/d3-axis/-/d3-axis-2.0.0.tgz", + "integrity": "sha512-9nzB0uePtb+u9+dWir+HTuEAKJOEUYJoEwbJPsZ1B4K3iZUgzJcSENQ05Nj7S4CIfbZZ8/jQGoUzGKFznBhiiQ==" + }, + "node_modules/d3-color": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/d3-color/-/d3-color-2.0.0.tgz", + "integrity": "sha512-SPXi0TSKPD4g9tw0NMZFnR95XVgUZiBH+uUTqQuDu1OsE2zomHU7ho0FISciaPvosimixwHFl3WHLGabv6dDgQ==" + }, + "node_modules/d3-dispatch": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/d3-dispatch/-/d3-dispatch-2.0.0.tgz", + "integrity": "sha512-S/m2VsXI7gAti2pBoLClFFTMOO1HTtT0j99AuXLoGFKO6deHDdnv6ZGTxSTTUTgO1zVcv82fCOtDjYK4EECmWA==" + }, + "node_modules/d3-drag": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/d3-drag/-/d3-drag-2.0.0.tgz", + "integrity": "sha512-g9y9WbMnF5uqB9qKqwIIa/921RYWzlUDv9Jl1/yONQwxbOfszAWTCm8u7HOTgJgRDXiRZN56cHT9pd24dmXs8w==", + "dependencies": { + "d3-dispatch": "1 - 2", + "d3-selection": "2" + } + }, + "node_modules/d3-ease": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/d3-ease/-/d3-ease-2.0.0.tgz", + "integrity": "sha512-68/n9JWarxXkOWMshcT5IcjbB+agblQUaIsbnXmrzejn2O82n3p2A9R2zEB9HIEFWKFwPAEDDN8gR0VdSAyyAQ==" + }, + "node_modules/d3-format": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/d3-format/-/d3-format-2.0.0.tgz", + "integrity": "sha512-Ab3S6XuE/Q+flY96HXT0jOXcM4EAClYFnRGY5zsjRGNy6qCYrQsMffs7cV5Q9xejb35zxW5hf/guKw34kvIKsA==" + }, + "node_modules/d3-interpolate": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/d3-interpolate/-/d3-interpolate-2.0.1.tgz", + "integrity": "sha512-c5UhwwTs/yybcmTpAVqwSFl6vrQ8JZJoT5F7xNFK9pymv5C0Ymcc9/LIJHtYIggg/yS9YHw8i8O8tgb9pupjeQ==", + "dependencies": { + "d3-color": "1 - 2" + } + }, + "node_modules/d3-path": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/d3-path/-/d3-path-2.0.0.tgz", + "integrity": "sha512-ZwZQxKhBnv9yHaiWd6ZU4x5BtCQ7pXszEV9CU6kRgwIQVQGLMv1oiL4M+MK/n79sYzsj+gcgpPQSctJUsLN7fA==" + }, + "node_modules/d3-scale": { + "version": "3.2.3", + "resolved": "https://registry.npmjs.org/d3-scale/-/d3-scale-3.2.3.tgz", + "integrity": "sha512-8E37oWEmEzj57bHcnjPVOBS3n4jqakOeuv1EDdQSiSrYnMCBdMd3nc4HtKk7uia8DUHcY/CGuJ42xxgtEYrX0g==", + "dependencies": { + "d3-array": "^2.3.0", + "d3-format": "1 - 2", + "d3-interpolate": "1.2.0 - 2", + "d3-time": "1 - 2", + "d3-time-format": "2 - 3" + } + }, + "node_modules/d3-scale/node_modules/d3-array": { + "version": "2.11.0", + "resolved": "https://registry.npmjs.org/d3-array/-/d3-array-2.11.0.tgz", + "integrity": "sha512-26clcwmHQEdsLv34oNKq5Ia9tQ26Y/4HqS3dQzF42QBUqymZJ+9PORcN1G52bt37NsL2ABoX4lvyYZc+A9Y0zw==", + "dependencies": { + "internmap": "^1.0.0" + } + }, + "node_modules/d3-selection": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/d3-selection/-/d3-selection-2.0.0.tgz", + "integrity": "sha512-XoGGqhLUN/W14NmaqcO/bb1nqjDAw5WtSYb2X8wiuQWvSZUsUVYsOSkOybUrNvcBjaywBdYPy03eXHMXjk9nZA==" + }, + "node_modules/d3-shape": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/d3-shape/-/d3-shape-2.0.0.tgz", + "integrity": "sha512-djpGlA779ua+rImicYyyjnOjeubyhql1Jyn1HK0bTyawuH76UQRWXd+pftr67H6Fa8hSwetkgb/0id3agKWykw==", + "dependencies": { + "d3-path": "1 - 2" + } + }, + "node_modules/d3-time": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/d3-time/-/d3-time-2.0.0.tgz", + "integrity": "sha512-2mvhstTFcMvwStWd9Tj3e6CEqtOivtD8AUiHT8ido/xmzrI9ijrUUihZ6nHuf/vsScRBonagOdj0Vv+SEL5G3Q==" + }, + "node_modules/d3-time-format": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/d3-time-format/-/d3-time-format-3.0.0.tgz", + "integrity": "sha512-UXJh6EKsHBTjopVqZBhFysQcoXSv/5yLONZvkQ5Kk3qbwiUYkdX17Xa1PT6U1ZWXGGfB1ey5L8dKMlFq2DO0Ag==", + "dependencies": { + "d3-time": "1 - 2" + } + }, + "node_modules/d3-timer": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/d3-timer/-/d3-timer-2.0.0.tgz", + "integrity": "sha512-TO4VLh0/420Y/9dO3+f9abDEFYeCUr2WZRlxJvbp4HPTQcSylXNiL6yZa9FIUvV1yRiFufl1bszTCLDqv9PWNA==" + }, + "node_modules/d3-transition": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/d3-transition/-/d3-transition-2.0.0.tgz", + "integrity": "sha512-42ltAGgJesfQE3u9LuuBHNbGrI/AJjNL2OAUdclE70UE6Vy239GCBEYD38uBPoLeNsOhFStGpPI0BAOV+HMxog==", + "dependencies": { + "d3-color": "1 - 2", + "d3-dispatch": "1 - 2", + "d3-ease": "1 - 2", + "d3-interpolate": "1 - 2", + "d3-timer": "1 - 2" + } + }, + "node_modules/d3-zoom": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/d3-zoom/-/d3-zoom-2.0.0.tgz", + "integrity": "sha512-fFg7aoaEm9/jf+qfstak0IYpnesZLiMX6GZvXtUSdv8RH2o4E2qeelgdU09eKS6wGuiGMfcnMI0nTIqWzRHGpw==", + "dependencies": { + "d3-dispatch": "1 - 2", + "d3-drag": "2", + "d3-interpolate": "1 - 2", + "d3-selection": "2", + "d3-transition": "2" + } + }, + "node_modules/dashdash": { + "version": "1.14.1", + "resolved": "https://registry.npmjs.org/dashdash/-/dashdash-1.14.1.tgz", + "integrity": "sha1-hTz6D3y+L+1d4gMmuN1YEDX24vA=", + "dependencies": { + "assert-plus": "^1.0.0" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/data-urls": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/data-urls/-/data-urls-1.1.0.tgz", + "integrity": "sha512-YTWYI9se1P55u58gL5GkQHW4P6VJBJ5iBT+B5a7i2Tjadhv52paJG0qHX4A0OR6/t52odI64KP2YvFpkDOi3eQ==", + "dev": true, + "dependencies": { + "abab": "^2.0.0", + "whatwg-mimetype": "^2.2.0", + "whatwg-url": "^7.0.0" + } + }, + "node_modules/date-fns": { + "version": "2.14.0", + "resolved": "https://registry.npmjs.org/date-fns/-/date-fns-2.14.0.tgz", + "integrity": "sha512-1zD+68jhFgDIM0rF05rcwYO8cExdNqxjq4xP1QKM60Q45mnO6zaMWB4tOzrIr4M4GSLntsKeE4c9Bdl2jhL/yw==" + }, + "node_modules/dateformat": { + "version": "1.0.12", + "resolved": "https://registry.npmjs.org/dateformat/-/dateformat-1.0.12.tgz", + "integrity": "sha1-nxJLZ1lMk3/3BpMuSmQsyo27/uk=", + "dev": true, + "dependencies": { + "get-stdin": "^4.0.1", + "meow": "^3.3.0" + }, + "bin": { + "dateformat": "bin/cli.js" + }, + "engines": { + "node": "*" + } + }, + "node_modules/dateformat/node_modules/get-stdin": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/get-stdin/-/get-stdin-4.0.1.tgz", + "integrity": "sha1-uWjGsKBDhDJJAui/Gl3zJXmkUP4=", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/de-indent": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/de-indent/-/de-indent-1.0.2.tgz", + "integrity": "sha1-sgOOhG3DO6pXlhKNCAS0VbjB4h0=" + }, + "node_modules/debounce": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/debounce/-/debounce-1.2.1.tgz", + "integrity": "sha512-XRRe6Glud4rd/ZGQfiV1ruXSfbvfJedlV9Y6zOlP+2K04vBYiJEte6stfFkCP03aMnY5tsipamumUjL14fofug==" + }, + "node_modules/debug": { + "version": "3.2.6", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.6.tgz", + "integrity": "sha512-mel+jf7nrtEl5Pn1Qx46zARXKDpBbvzezse7p7LqINmdoIk8PYP5SySaxEmYv6TZ0JyEKA1hsCId6DIhgITtWQ==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/decamelize": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/decamelize/-/decamelize-1.2.0.tgz", + "integrity": "sha1-9lNNFRSCabIDUue+4m9QH5oZEpA=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/decode-uri-component": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/decode-uri-component/-/decode-uri-component-0.2.0.tgz", + "integrity": "sha1-6zkTMzRYd1y4TNGh+uBiEGu4dUU=", + "engines": { + "node": ">=0.10" + } + }, + "node_modules/decompress-response": { + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/decompress-response/-/decompress-response-4.2.1.tgz", + "integrity": "sha512-jOSne2qbyE+/r8G1VU+G/82LBs2Fs4LAsTiLSHOCOMZQl2OKZ6i8i4IyHemTe+/yIXOtTcRQMzPcgyhoFlqPkw==", + "dependencies": { + "mimic-response": "^2.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/deep-eql": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/deep-eql/-/deep-eql-3.0.1.tgz", + "integrity": "sha512-+QeIQyN5ZuO+3Uk5DYh6/1eKO0m0YmJFGNmFHGACpf1ClL1nmlV/p4gNgbl2pJGxgXb4faqo6UE+M5ACEMyVcw==", + "dependencies": { + "type-detect": "^4.0.0" + }, + "engines": { + "node": ">=0.12" + } + }, + "node_modules/deep-equal": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/deep-equal/-/deep-equal-1.1.1.tgz", + "integrity": "sha512-yd9c5AdiqVcR+JjcwUQb9DkhJc8ngNr0MahEBGvDiJw8puWab2yZlh+nkasOnZP+EGTAP6rRp2JzJhJZzvNF8g==", + "dependencies": { + "is-arguments": "^1.0.4", + "is-date-object": "^1.0.1", + "is-regex": "^1.0.4", + "object-is": "^1.0.1", + "object-keys": "^1.1.1", + "regexp.prototype.flags": "^1.2.0" + } + }, + "node_modules/deep-extend": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/deep-extend/-/deep-extend-0.6.0.tgz", + "integrity": "sha512-LOHxIOaPYdHlJRtCQfDIVZtfw/ufM8+rVj649RIHzcm/vGwQRXFt6OPqIFWsm2XEMrNIEtWR64sY1LEKD2vAOA==", + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/deep-is": { + "version": "0.1.3", + "resolved": "https://registry.npmjs.org/deep-is/-/deep-is-0.1.3.tgz", + "integrity": "sha1-s2nW+128E+7PUk+RsHD+7cNXzzQ=", + "dev": true + }, + "node_modules/deepmerge": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/deepmerge/-/deepmerge-2.2.1.tgz", + "integrity": "sha512-R9hc1Xa/NOBi9WRVUWg19rl1UB7Tt4kuPd+thNJgFZoxXsTz7ncaPaeIm+40oSGuP33DfMb4sZt1QIGiJzC4EA==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/default-gateway": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/default-gateway/-/default-gateway-4.2.0.tgz", + "integrity": "sha512-h6sMrVB1VMWVrW13mSc6ia/DwYYw5MN6+exNu1OaJeFac5aSAvwM7lZ0NVfTABuSkQelr4h5oebg3KB1XPdjgA==", + "dev": true, + "dependencies": { + "execa": "^1.0.0", + "ip-regex": "^2.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/default-gateway/node_modules/cross-spawn": { + "version": "6.0.5", + "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-6.0.5.tgz", + "integrity": "sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==", + "dev": true, + "dependencies": { + "nice-try": "^1.0.4", + "path-key": "^2.0.1", + "semver": "^5.5.0", + "shebang-command": "^1.2.0", + "which": "^1.2.9" + }, + "engines": { + "node": ">=4.8" + } + }, + "node_modules/default-gateway/node_modules/execa": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/execa/-/execa-1.0.0.tgz", + "integrity": "sha512-adbxcyWV46qiHyvSp50TKt05tB4tK3HcmF7/nxfAdhnox83seTDbwnaqKO4sXRy7roHAIFqJP/Rw/AuEbX61LA==", + "dev": true, + "dependencies": { + "cross-spawn": "^6.0.0", + "get-stream": "^4.0.0", + "is-stream": "^1.1.0", + "npm-run-path": "^2.0.0", + "p-finally": "^1.0.0", + "signal-exit": "^3.0.0", + "strip-eof": "^1.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/default-gateway/node_modules/get-stream": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-4.1.0.tgz", + "integrity": "sha512-GMat4EJ5161kIy2HevLlr4luNjBgvmj413KaQA7jt4V8B4RDsfpHk7WQ9GVqfYyyx8OS/L66Kox+rJRNklLK7w==", + "dev": true, + "dependencies": { + "pump": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/define-properties": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.1.3.tgz", + "integrity": "sha512-3MqfYKj2lLzdMSf8ZIZE/V+Zuy+BgD6f164e8K2w7dgnpKArBDerGYpM46IYYcjnkdPNMjPk9A6VFB8+3SKlXQ==", + "dependencies": { + "object-keys": "^1.0.12" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/define-property": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-2.0.2.tgz", + "integrity": "sha512-jwK2UV4cnPpbcG7+VRARKTZPUWowwXA8bzH5NP6ud0oeAxyYPuGZUAC7hMugpCdz4BeSZl2Dl9k66CHJ/46ZYQ==", + "dependencies": { + "is-descriptor": "^1.0.2", + "isobject": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/define-property/node_modules/is-accessor-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", + "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/define-property/node_modules/is-data-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", + "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/define-property/node_modules/is-descriptor": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", + "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", + "dependencies": { + "is-accessor-descriptor": "^1.0.0", + "is-data-descriptor": "^1.0.0", + "kind-of": "^6.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/del": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/del/-/del-4.1.1.tgz", + "integrity": "sha512-QwGuEUouP2kVwQenAsOof5Fv8K9t3D8Ca8NxcXKrIpEHjTXK5J2nXLdP+ALI1cgv8wj7KuwBhTwBkOZSJKM5XQ==", + "dev": true, + "dependencies": { + "@types/glob": "^7.1.1", + "globby": "^6.1.0", + "is-path-cwd": "^2.0.0", + "is-path-in-cwd": "^2.0.0", + "p-map": "^2.0.0", + "pify": "^4.0.1", + "rimraf": "^2.6.3" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/del/node_modules/globby": { + "version": "6.1.0", + "resolved": "https://registry.npmjs.org/globby/-/globby-6.1.0.tgz", + "integrity": "sha1-9abXDoOV4hyFj7BInWTfAkJNUGw=", + "dev": true, + "dependencies": { + "array-union": "^1.0.1", + "glob": "^7.0.3", + "object-assign": "^4.0.1", + "pify": "^2.0.0", + "pinkie-promise": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/del/node_modules/globby/node_modules/pify": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz", + "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/del/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dev": true, + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/delayed-stream": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz", + "integrity": "sha1-3zrhmayt+31ECqrgsp4icrJOxhk=", + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/delegates": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/delegates/-/delegates-1.0.0.tgz", + "integrity": "sha1-hMbhWbgZBP3KWaDvRM2HDTElD5o=" + }, + "node_modules/denque": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/denque/-/denque-1.4.1.tgz", + "integrity": "sha512-OfzPuSZKGcgr96rf1oODnfjqBFmr1DVoc/TrItj3Ohe0Ah1C5WX5Baquw/9U9KovnQ88EqmJbD66rKYUQYN1tQ==", + "engines": { + "node": ">=0.10" + } + }, + "node_modules/depcheck": { + "version": "0.9.2", + "resolved": "https://registry.npmjs.org/depcheck/-/depcheck-0.9.2.tgz", + "integrity": "sha512-w5f+lSZqLJJkk58s44eOd0Vor7hLZot4PlFL0y2JsIX5LuHQ2eAjHlDVeGBD4Mj6ZQSKakvKWRRCcPlvrdU2Sg==", + "dependencies": { + "@babel/parser": "^7.7.7", + "@babel/traverse": "^7.7.4", + "builtin-modules": "^3.0.0", + "camelcase": "^5.3.1", + "cosmiconfig": "^5.2.1", + "debug": "^4.1.1", + "deps-regex": "^0.1.4", + "js-yaml": "^3.4.2", + "lodash": "^4.17.15", + "minimatch": "^3.0.2", + "node-sass-tilde-importer": "^1.0.2", + "please-upgrade-node": "^3.2.0", + "require-package-name": "^2.0.1", + "resolve": "^1.14.1", + "vue-template-compiler": "^2.6.11", + "walkdir": "^0.4.1", + "yargs": "^15.0.2" + }, + "bin": { + "depcheck": "bin/depcheck.js" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/depcheck/node_modules/ansi-regex": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.0.tgz", + "integrity": "sha512-bY6fj56OUQ0hU1KjFNDQuJFezqKdrAyFdIevADiqrWHwSlbmBNMHp5ak2f40Pm8JTFyM2mqxkG6ngkHO11f/lg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/depcheck/node_modules/ansi-styles": { + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.2.1.tgz", + "integrity": "sha512-9VGjrMsG1vePxcSweQsN20KY/c4zN0h9fLjqAbwbPfahM3t+NL+M9HC8xeXG2I8pX5NoamTGNuomEUFI7fcUjA==", + "dependencies": { + "@types/color-name": "^1.1.1", + "color-convert": "^2.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/depcheck/node_modules/builtin-modules": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/builtin-modules/-/builtin-modules-3.1.0.tgz", + "integrity": "sha512-k0KL0aWZuBt2lrxrcASWDfwOLMnodeQjodT/1SxEQAXsHANgo6ZC/VEaSEHCXt7aSTZ4/4H5LKa+tBXmW7Vtvw==", + "engines": { + "node": ">=6" + } + }, + "node_modules/depcheck/node_modules/cliui": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/cliui/-/cliui-6.0.0.tgz", + "integrity": "sha512-t6wbgtoCXvAzst7QgXxJYqPt0usEfbgQdftEPbLL/cvv6HPE5VgvqCuAIDR0NgU52ds6rFwqrgakNLrHEjCbrQ==", + "dependencies": { + "string-width": "^4.2.0", + "strip-ansi": "^6.0.0", + "wrap-ansi": "^6.2.0" + } + }, + "node_modules/depcheck/node_modules/color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dependencies": { + "color-name": "~1.1.4" + }, + "engines": { + "node": ">=7.0.0" + } + }, + "node_modules/depcheck/node_modules/color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==" + }, + "node_modules/depcheck/node_modules/cosmiconfig": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/cosmiconfig/-/cosmiconfig-5.2.1.tgz", + "integrity": "sha512-H65gsXo1SKjf8zmrJ67eJk8aIRKV5ff2D4uKZIBZShbhGSpEmsQOPW/SKMKYhSTrqR7ufy6RP69rPogdaPh/kA==", + "dependencies": { + "import-fresh": "^2.0.0", + "is-directory": "^0.3.1", + "js-yaml": "^3.13.1", + "parse-json": "^4.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/depcheck/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/depcheck/node_modules/emoji-regex": { + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", + "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==" + }, + "node_modules/depcheck/node_modules/find-up": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", + "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", + "dependencies": { + "locate-path": "^5.0.0", + "path-exists": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/depcheck/node_modules/import-fresh": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/import-fresh/-/import-fresh-2.0.0.tgz", + "integrity": "sha1-2BNVwVYS04bGH53dOSLUMEgipUY=", + "dependencies": { + "caller-path": "^2.0.0", + "resolve-from": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/depcheck/node_modules/is-fullwidth-code-point": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", + "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/depcheck/node_modules/locate-path": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-5.0.0.tgz", + "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==", + "dependencies": { + "p-locate": "^4.1.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/depcheck/node_modules/p-locate": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-4.1.0.tgz", + "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==", + "dependencies": { + "p-limit": "^2.2.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/depcheck/node_modules/parse-json": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz", + "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=", + "dependencies": { + "error-ex": "^1.3.1", + "json-parse-better-errors": "^1.0.1" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/depcheck/node_modules/path-exists": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", + "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", + "engines": { + "node": ">=8" + } + }, + "node_modules/depcheck/node_modules/resolve-from": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-3.0.0.tgz", + "integrity": "sha1-six699nWiBvItuZTM17rywoYh0g=", + "engines": { + "node": ">=4" + } + }, + "node_modules/depcheck/node_modules/string-width": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.0.tgz", + "integrity": "sha512-zUz5JD+tgqtuDjMhwIg5uFVV3dtqZ9yQJlZVfq4I01/K5Paj5UHj7VyrQOJvzawSVlKpObApbfD0Ed6yJc+1eg==", + "dependencies": { + "emoji-regex": "^8.0.0", + "is-fullwidth-code-point": "^3.0.0", + "strip-ansi": "^6.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/depcheck/node_modules/strip-ansi": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", + "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", + "dependencies": { + "ansi-regex": "^5.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/depcheck/node_modules/wrap-ansi": { + "version": "6.2.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-6.2.0.tgz", + "integrity": "sha512-r6lPcBGxZXlIcymEu7InxDMhdW0KDxpLgoFLcguasxCaJ/SOIZwINatK9KY/tf+ZrlywOKU0UDj3ATXUBfxJXA==", + "dependencies": { + "ansi-styles": "^4.0.0", + "string-width": "^4.1.0", + "strip-ansi": "^6.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/depcheck/node_modules/yargs": { + "version": "15.3.1", + "resolved": "https://registry.npmjs.org/yargs/-/yargs-15.3.1.tgz", + "integrity": "sha512-92O1HWEjw27sBfgmXiixJWT5hRBp2eobqXicLtPBIDBhYB+1HpwZlXmbW2luivBJHBzki+7VyCLRtAkScbTBQA==", + "dependencies": { + "cliui": "^6.0.0", + "decamelize": "^1.2.0", + "find-up": "^4.1.0", + "get-caller-file": "^2.0.1", + "require-directory": "^2.1.1", + "require-main-filename": "^2.0.0", + "set-blocking": "^2.0.0", + "string-width": "^4.2.0", + "which-module": "^2.0.0", + "y18n": "^4.0.0", + "yargs-parser": "^18.1.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/depcheck/node_modules/yargs-parser": { + "version": "18.1.3", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-18.1.3.tgz", + "integrity": "sha512-o50j0JeToy/4K6OZcaQmW6lyXXKhq7csREXcDwk2omFPJEwUNOVtJKvmDr9EI1fAJZUyZcRF7kxGBWmRXudrCQ==", + "dependencies": { + "camelcase": "^5.0.0", + "decamelize": "^1.2.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/depd": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/depd/-/depd-1.1.2.tgz", + "integrity": "sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/deps-regex": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/deps-regex/-/deps-regex-0.1.4.tgz", + "integrity": "sha1-UYZnt2kUYKXn4KNBvnbrfOgJAYQ=" + }, + "node_modules/des.js": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/des.js/-/des.js-1.0.1.tgz", + "integrity": "sha512-Q0I4pfFrv2VPd34/vfLrFOoRmlYj3OV50i7fskps1jZWK1kApMWWT9G6RRUeYedLcBDIhnSDaUvJMb3AhUlaEA==", + "dev": true, + "dependencies": { + "inherits": "^2.0.1", + "minimalistic-assert": "^1.0.0" + } + }, + "node_modules/destroy": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz", + "integrity": "sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA=" + }, + "node_modules/detect-file": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/detect-file/-/detect-file-1.0.0.tgz", + "integrity": "sha1-8NZtA2cqglyxtzvbP+YjEMjlUrc=", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/detect-libc": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-1.0.3.tgz", + "integrity": "sha1-+hN8S9aY7fVc1c0CrFWfkaTEups=", + "bin": { + "detect-libc": "bin/detect-libc.js" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/detect-node": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/detect-node/-/detect-node-2.0.4.tgz", + "integrity": "sha512-ZIzRpLJrOj7jjP2miAtgqIfmzbxa4ZOr5jJc601zklsfEx9oTzmmj2nVpIPRpNlRTIh8lc1kyViIY7BWSGNmKw==", + "dev": true + }, + "node_modules/diff": { + "version": "3.5.0", + "resolved": "https://registry.npmjs.org/diff/-/diff-3.5.0.tgz", + "integrity": "sha512-A46qtFgd+g7pDZinpnwiRJtxbC1hpgf0uzP3iG89scHk0AUC7A1TGxf5OiiOUv/JMZR8GOt8hL900hV0bOy5xA==", + "engines": { + "node": ">=0.3.1" + } + }, + "node_modules/diff-match-patch": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/diff-match-patch/-/diff-match-patch-1.0.5.tgz", + "integrity": "sha512-IayShXAgj/QMXgB0IWmKx+rOPuGMhqm5w6jvFxmVenXKIzRqTAAsbBPT3kWQeGANj3jGgvcvv4yK6SxqYmikgw==" + }, + "node_modules/diffie-hellman": { + "version": "5.0.3", + "resolved": "https://registry.npmjs.org/diffie-hellman/-/diffie-hellman-5.0.3.tgz", + "integrity": "sha512-kqag/Nl+f3GwyK25fhUMYj81BUOrZ9IuJsjIcDE5icNM9FJHAVm3VcUDxdLPoQtTuUylWm6ZIknYJwwaPxsUzg==", + "dev": true, + "dependencies": { + "bn.js": "^4.1.0", + "miller-rabin": "^4.0.0", + "randombytes": "^2.0.0" + } + }, + "node_modules/diffie-hellman/node_modules/bn.js": { + "version": "4.12.0", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", + "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==", + "dev": true + }, + "node_modules/dir-glob": { + "version": "2.2.2", + "resolved": "https://registry.npmjs.org/dir-glob/-/dir-glob-2.2.2.tgz", + "integrity": "sha512-f9LBi5QWzIW3I6e//uxZoLBlUt9kcp66qo0sSCxL6YZKc75R1c4MFCoe/LaZiBGmgujvQdxc5Bn3QhfyvK5Hsw==", + "dev": true, + "dependencies": { + "path-type": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/dir-glob/node_modules/path-type": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/path-type/-/path-type-3.0.0.tgz", + "integrity": "sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg==", + "dev": true, + "dependencies": { + "pify": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/dir-glob/node_modules/pify": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz", + "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/dns-equal": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/dns-equal/-/dns-equal-1.0.0.tgz", + "integrity": "sha1-s55/HabrCnW6nBcySzR1PEfgZU0=", + "dev": true + }, + "node_modules/dns-packet": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/dns-packet/-/dns-packet-1.3.1.tgz", + "integrity": "sha512-0UxfQkMhYAUaZI+xrNZOz/as5KgDU0M/fQ9b6SpkyLbk3GEswDi6PADJVaYJradtRVsRIlF1zLyOodbcTCDzUg==", + "dev": true, + "dependencies": { + "ip": "^1.1.0", + "safe-buffer": "^5.0.1" + } + }, + "node_modules/dns-txt": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/dns-txt/-/dns-txt-2.0.2.tgz", + "integrity": "sha1-uR2Ab10nGI5Ks+fRB9iBocxGQrY=", + "dev": true, + "dependencies": { + "buffer-indexof": "^1.0.0" + } + }, + "node_modules/doctypes": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/doctypes/-/doctypes-1.1.0.tgz", + "integrity": "sha1-6oCxBqh1OHdOijpKWv4pPeSJ4Kk=" + }, + "node_modules/dom-helpers": { + "version": "3.4.0", + "resolved": "https://registry.npmjs.org/dom-helpers/-/dom-helpers-3.4.0.tgz", + "integrity": "sha512-LnuPJ+dwqKDIyotW1VzmOZ5TONUN7CwkCR5hrgawTUbkBGYdeoNLZo6nNfGkCrjtE1nXXaj7iMMpDa8/d9WoIA==", + "dependencies": { + "@babel/runtime": "^7.1.2" + } + }, + "node_modules/dom-serializer": { + "version": "0.2.2", + "resolved": "https://registry.npmjs.org/dom-serializer/-/dom-serializer-0.2.2.tgz", + "integrity": "sha512-2/xPb3ORsQ42nHYiSunXkDjPLBaEj/xTwUO4B7XCZQTRk7EBtTOPaygh10YAAh2OI1Qrp6NWfpAhzswj0ydt9g==", + "dependencies": { + "domelementtype": "^2.0.1", + "entities": "^2.0.0" + } + }, + "node_modules/dom-serializer/node_modules/domelementtype": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/domelementtype/-/domelementtype-2.0.1.tgz", + "integrity": "sha512-5HOHUDsYZWV8FGWN0Njbr/Rn7f/eWSQi1v7+HsUVwXgn8nWWlL64zKDkS0n8ZmQ3mlWOMuXOnR+7Nx/5tMO5AQ==" + }, + "node_modules/dom-serializer/node_modules/entities": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/entities/-/entities-2.0.0.tgz", + "integrity": "sha512-D9f7V0JSRwIxlRI2mjMqufDrRDnx8p+eEOz7aUM9SuvF8gsBzra0/6tbjl1m8eQHrZlYj6PxqE00hZ1SAIKPLw==" + }, + "node_modules/domain-browser": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/domain-browser/-/domain-browser-1.2.0.tgz", + "integrity": "sha512-jnjyiM6eRyZl2H+W8Q/zLMA481hzi0eszAaBUzIVnmYVDBbnLxVNnfu1HgEBvCbL+71FrxMl3E6lpKH7Ge3OXA==", + "dev": true, + "engines": { + "node": ">=0.4", + "npm": ">=1.2" + } + }, + "node_modules/domelementtype": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/domelementtype/-/domelementtype-1.3.1.tgz", + "integrity": "sha512-BSKB+TSpMpFI/HOxCNr1O8aMOTZ8hT3pM3GQ0w/mWRmkhEDSFJkkyzz4XQsBV44BChwGkrDfMyjVD0eA2aFV3w==" + }, + "node_modules/domexception": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/domexception/-/domexception-1.0.1.tgz", + "integrity": "sha512-raigMkn7CJNNo6Ihro1fzG7wr3fHuYVytzquZKX5n0yizGsTcYgzdIUwj1X9pK0VvjeihV+XiclP+DjwbsSKug==", + "dev": true, + "dependencies": { + "webidl-conversions": "^4.0.2" + } + }, + "node_modules/domhandler": { + "version": "2.4.2", + "resolved": "https://registry.npmjs.org/domhandler/-/domhandler-2.4.2.tgz", + "integrity": "sha512-JiK04h0Ht5u/80fdLMCEmV4zkNh2BcoMFBmZ/91WtYZ8qVXSKjiw7fXMgFPnHcSZgOo3XdinHvmnDUeMf5R4wA==", + "dependencies": { + "domelementtype": "1" + } + }, + "node_modules/domutils": { + "version": "1.7.0", + "resolved": "https://registry.npmjs.org/domutils/-/domutils-1.7.0.tgz", + "integrity": "sha512-Lgd2XcJ/NjEw+7tFvfKxOzCYKZsdct5lczQ2ZaQY8Djz7pfAD3Gbp8ySJWtreII/vDlMVmxwa6pHmdxIYgttDg==", + "dependencies": { + "dom-serializer": "0", + "domelementtype": "1" + } + }, + "node_modules/dot-prop": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/dot-prop/-/dot-prop-4.2.0.tgz", + "integrity": "sha512-tUMXrxlExSW6U2EXiiKGSBVdYgtV8qlHL+C10TsW4PURY/ic+eaysnSkwB4kA/mBlCyy/IKDJ+Lc3wbWeaXtuQ==", + "dependencies": { + "is-obj": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/dotenv": { + "version": "8.2.0", + "resolved": "https://registry.npmjs.org/dotenv/-/dotenv-8.2.0.tgz", + "integrity": "sha512-8sJ78ElpbDJBHNeBzUbUVLsqKdccaa/BXF1uPTw3GrvQTBgrQrtObr2mUrE38vzYd8cEv+m/JBfDLioYcfXoaw==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/double-bits": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/double-bits/-/double-bits-1.1.1.tgz", + "integrity": "sha1-WKu6RUlNpND6Nrc60RoobJGEscY=" + }, + "node_modules/duplexer3": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/duplexer3/-/duplexer3-0.1.4.tgz", + "integrity": "sha1-7gHdHKwO08vH/b6jfcCo8c4ALOI=" + }, + "node_modules/duplexify": { + "version": "3.7.1", + "resolved": "https://registry.npmjs.org/duplexify/-/duplexify-3.7.1.tgz", + "integrity": "sha512-07z8uv2wMyS51kKhD1KsdXJg5WQ6t93RneqRxUHnskXVtlYYkLqM0gqStQZ3pj073g687jPCHrqNfCzawLYh5g==", + "dev": true, + "dependencies": { + "end-of-stream": "^1.0.0", + "inherits": "^2.0.1", + "readable-stream": "^2.0.0", + "stream-shift": "^1.0.0" + } + }, + "node_modules/duplexify/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/dynamic-dedupe": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/dynamic-dedupe/-/dynamic-dedupe-0.3.0.tgz", + "integrity": "sha1-BuRMIj9eTpTXjvnbI6ZRXOL5YqE=", + "dev": true, + "dependencies": { + "xtend": "^4.0.0" + } + }, + "node_modules/ecc-jsbn": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/ecc-jsbn/-/ecc-jsbn-0.1.2.tgz", + "integrity": "sha1-OoOpBOVDUyh4dMVkt1SThoSamMk=", + "dependencies": { + "jsbn": "~0.1.0", + "safer-buffer": "^2.1.0" + } + }, + "node_modules/ecdsa-sig-formatter": { + "version": "1.0.11", + "resolved": "https://registry.npmjs.org/ecdsa-sig-formatter/-/ecdsa-sig-formatter-1.0.11.tgz", + "integrity": "sha512-nagl3RYrbNv6kQkeJIpt6NJZy8twLB/2vtz6yN9Z4vRKHN4/QZJIEbqohALSgwKdnksuY3k5Addp5lg8sVoVcQ==", + "dependencies": { + "safe-buffer": "^5.0.1" + } + }, + "node_modules/ee-first": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "integrity": "sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0=" + }, + "node_modules/elliptic": { + "version": "6.5.4", + "resolved": "https://registry.npmjs.org/elliptic/-/elliptic-6.5.4.tgz", + "integrity": "sha512-iLhC6ULemrljPZb+QutR5TQGB+pdW6KGD5RSegS+8sorOZT+rdQFbsQFJgvN3eRqNALqJer4oQ16YvJHlU8hzQ==", + "dev": true, + "dependencies": { + "bn.js": "^4.11.9", + "brorand": "^1.1.0", + "hash.js": "^1.0.0", + "hmac-drbg": "^1.0.1", + "inherits": "^2.0.4", + "minimalistic-assert": "^1.0.1", + "minimalistic-crypto-utils": "^1.0.1" + } + }, + "node_modules/elliptic/node_modules/bn.js": { + "version": "4.12.0", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", + "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==", + "dev": true + }, + "node_modules/emoji-regex": { + "version": "7.0.3", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-7.0.3.tgz", + "integrity": "sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA==" + }, + "node_modules/emojis-list": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-3.0.0.tgz", + "integrity": "sha512-/kyM18EfinwXZbno9FyUGeFh87KC8HRQBQGildHZbEuRyWFOmv1U10o9BBp8XVZDVNNuQKyIGIu5ZYAAXJ0V2Q==", + "engines": { + "node": ">= 4" + } + }, + "node_modules/emotion": { + "version": "10.0.27", + "resolved": "https://registry.npmjs.org/emotion/-/emotion-10.0.27.tgz", + "integrity": "sha512-2xdDzdWWzue8R8lu4G76uWX5WhyQuzATon9LmNeCy/2BHVC6dsEpfhN1a0qhELgtDVdjyEA6J8Y/VlI5ZnaH0g==", + "dependencies": { + "babel-plugin-emotion": "^10.0.27", + "create-emotion": "^10.0.27" + } + }, + "node_modules/encodeurl": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz", + "integrity": "sha1-rT/0yG7C0CkyL1oCw6mmBslbP1k=", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/encoding": { + "version": "0.1.12", + "resolved": "https://registry.npmjs.org/encoding/-/encoding-0.1.12.tgz", + "integrity": "sha1-U4tm8+5izRq1HsMjgp0flIDHS+s=", + "dependencies": { + "iconv-lite": "~0.4.13" + } + }, + "node_modules/end-of-stream": { + "version": "1.4.4", + "resolved": "https://registry.npmjs.org/end-of-stream/-/end-of-stream-1.4.4.tgz", + "integrity": "sha512-+uw1inIHVPQoaVuHzRyXd21icM+cnt4CzD5rW+NC1wjOUSTOs+Te7FOv7AhN7vS9x/oIyhLP5PR1H+phQAHu5Q==", + "dependencies": { + "once": "^1.4.0" + } + }, + "node_modules/engine.io": { + "version": "3.4.1", + "resolved": "https://registry.npmjs.org/engine.io/-/engine.io-3.4.1.tgz", + "integrity": "sha512-8MfIfF1/IIfxuc2gv5K+XlFZczw/BpTvqBdl0E2fBLkYQp4miv4LuDTVtYt4yMyaIFLEr4vtaSgV4mjvll8Crw==", + "dependencies": { + "accepts": "~1.3.4", + "base64id": "2.0.0", + "cookie": "0.3.1", + "debug": "~4.1.0", + "engine.io-parser": "~2.2.0", + "ws": "^7.1.2" + }, + "engines": { + "node": ">=8.0.0" + } + }, + "node_modules/engine.io-client": { + "version": "3.4.1", + "resolved": "https://registry.npmjs.org/engine.io-client/-/engine.io-client-3.4.1.tgz", + "integrity": "sha512-RJNmA+A9Js+8Aoq815xpGAsgWH1VoSYM//2VgIiu9lNOaHFfLpTjH4tOzktBpjIs5lvOfiNY1dwf+NuU6D38Mw==", + "dependencies": { + "component-emitter": "1.2.1", + "component-inherit": "0.0.3", + "debug": "~4.1.0", + "engine.io-parser": "~2.2.0", + "has-cors": "1.1.0", + "indexof": "0.0.1", + "parseqs": "0.0.5", + "parseuri": "0.0.5", + "ws": "~6.1.0", + "xmlhttprequest-ssl": "~1.5.4", + "yeast": "0.1.2" + } + }, + "node_modules/engine.io-client/node_modules/component-emitter": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.2.1.tgz", + "integrity": "sha1-E3kY1teCg/ffemt8WmPhQOaUJeY=" + }, + "node_modules/engine.io-client/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/engine.io-client/node_modules/ws": { + "version": "6.1.4", + "resolved": "https://registry.npmjs.org/ws/-/ws-6.1.4.tgz", + "integrity": "sha512-eqZfL+NE/YQc1/ZynhojeV8q+H050oR8AZ2uIev7RU10svA9ZnJUddHcOUZTJLinZ9yEfdA2kSATS2qZK5fhJA==", + "dependencies": { + "async-limiter": "~1.0.0" + } + }, + "node_modules/engine.io-parser": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/engine.io-parser/-/engine.io-parser-2.2.0.tgz", + "integrity": "sha512-6I3qD9iUxotsC5HEMuuGsKA0cXerGz+4uGcXQEkfBidgKf0amsjrrtwcbwK/nzpZBxclXlV7gGl9dgWvu4LF6w==", + "dependencies": { + "after": "0.8.2", + "arraybuffer.slice": "~0.0.7", + "base64-arraybuffer": "0.1.5", + "blob": "0.0.5", + "has-binary2": "~1.0.2" + } + }, + "node_modules/engine.io/node_modules/cookie": { + "version": "0.3.1", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.3.1.tgz", + "integrity": "sha1-5+Ch+e9DtMi6klxcWpboBtFoc7s=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/engine.io/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/enhanced-resolve": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.1.tgz", + "integrity": "sha512-98p2zE+rL7/g/DzMHMTF4zZlCgeVdJ7yr6xzEpJRYwFYrGi9ANdn5DnJURg6RpBkyk60XYDnWIv51VfIhfNGuA==", + "dev": true, + "dependencies": { + "graceful-fs": "^4.1.2", + "memory-fs": "^0.5.0", + "tapable": "^1.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/entities": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/entities/-/entities-1.1.2.tgz", + "integrity": "sha512-f2LZMYl1Fzu7YSBKg+RoROelpOaNrcGmE9AZubeDfrCEia483oW4MI4VyFd5VNHIgQ/7qm1I0wUHK1eJnn2y2w==" + }, + "node_modules/equation-editor-react": { + "resolved": "git+ssh://git@github.com/bobzel/equation-editor-react.git#75915e852b4b36a6a4cd3e1cbc80598da6b65227", + "dependencies": { + "jquery": "^3.4.1", + "mathquill": "^0.10.1-a" + } + }, + "node_modules/errno": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/errno/-/errno-0.1.7.tgz", + "integrity": "sha512-MfrRBDWzIWifgq6tJj60gkAwtLNb6sQPlcFrSOflcP1aFmmruKQ2wRnze/8V6kgyz7H3FF8Npzv78mZ7XLLflg==", + "dev": true, + "dependencies": { + "prr": "~1.0.1" + }, + "bin": { + "errno": "cli.js" + } + }, + "node_modules/error-ex": { + "version": "1.3.2", + "resolved": "https://registry.npmjs.org/error-ex/-/error-ex-1.3.2.tgz", + "integrity": "sha512-7dFHNmqeFSEt2ZBsCriorKnn3Z2pj+fd9kmI6QoWw4//DL+icEBfc0U7qJCisqrTsKTjw4fNFy2pW9OqStD84g==", + "dependencies": { + "is-arrayish": "^0.2.1" + } + }, + "node_modules/es-abstract": { + "version": "1.17.5", + "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.17.5.tgz", + "integrity": "sha512-BR9auzDbySxOcfog0tLECW8l28eRGpDpU3Dm3Hp4q/N+VtLTmyj4EUN088XZWQDW/hzj6sYRDXeOFsaAODKvpg==", + "dependencies": { + "es-to-primitive": "^1.2.1", + "function-bind": "^1.1.1", + "has": "^1.0.3", + "has-symbols": "^1.0.1", + "is-callable": "^1.1.5", + "is-regex": "^1.0.5", + "object-inspect": "^1.7.0", + "object-keys": "^1.1.1", + "object.assign": "^4.1.0", + "string.prototype.trimleft": "^2.1.1", + "string.prototype.trimright": "^2.1.1" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-to-primitive": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/es-to-primitive/-/es-to-primitive-1.2.1.tgz", + "integrity": "sha512-QCOllgZJtaUo9miYBcLChTUaHNjJF3PYs1VidD7AwiEj1kYxKeQTctLAezAOH5ZKRH0g2IgPn6KwB4IT8iRpvA==", + "dependencies": { + "is-callable": "^1.1.4", + "is-date-object": "^1.0.1", + "is-symbol": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es5-ext": { + "version": "0.10.53", + "resolved": "https://registry.npmjs.org/es5-ext/-/es5-ext-0.10.53.tgz", + "integrity": "sha512-Xs2Stw6NiNHWypzRTY1MtaG/uJlwCk8kH81920ma8mvN8Xq1gsfhZvpkImLQArw8AHnv8MT2I45J3c0R8slE+Q==", + "dev": true, + "dependencies": { + "es6-iterator": "~2.0.3", + "es6-symbol": "~3.1.3", + "next-tick": "~1.0.0" + } + }, + "node_modules/es6-iterator": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/es6-iterator/-/es6-iterator-2.0.3.tgz", + "integrity": "sha1-p96IkUGgWpSwhUQDstCg+/qY87c=", + "dev": true, + "dependencies": { + "d": "1", + "es5-ext": "^0.10.35", + "es6-symbol": "^3.1.1" + } + }, + "node_modules/es6-promise": { + "version": "3.2.1", + "resolved": "https://registry.npmjs.org/es6-promise/-/es6-promise-3.2.1.tgz", + "integrity": "sha1-7FYjOGgDKQkgcXDDlEjiREndH8Q=" + }, + "node_modules/es6-symbol": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/es6-symbol/-/es6-symbol-3.1.3.tgz", + "integrity": "sha512-NJ6Yn3FuDinBaBRWl/q5X/s4koRHBrgKAu+yGI6JCBeiu3qrcbJhwT2GeR/EXVfylRk8dpQVJoLEFhK+Mu31NA==", + "dev": true, + "dependencies": { + "d": "^1.0.1", + "ext": "^1.1.2" + } + }, + "node_modules/escape-html": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg=" + }, + "node_modules/escape-string-regexp": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz", + "integrity": "sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=", + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/escodegen": { + "version": "1.14.1", + "resolved": "https://registry.npmjs.org/escodegen/-/escodegen-1.14.1.tgz", + "integrity": "sha512-Bmt7NcRySdIfNPfU2ZoXDrrXsG9ZjvDxcAlMfDUgRBjLOWTuIACXPBFJH7Z+cLb40JeQco5toikyc9t9P8E9SQ==", + "dev": true, + "dependencies": { + "esprima": "^4.0.1", + "estraverse": "^4.2.0", + "esutils": "^2.0.2", + "optionator": "^0.8.1" + }, + "bin": { + "escodegen": "bin/escodegen.js", + "esgenerate": "bin/esgenerate.js" + }, + "engines": { + "node": ">=4.0" + }, + "optionalDependencies": { + "source-map": "~0.6.1" + } + }, + "node_modules/escodegen/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "dev": true, + "optional": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/eslint-scope": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-4.0.3.tgz", + "integrity": "sha512-p7VutNr1O/QrxysMo3E45FjYDTeXBy0iTltPFNSqKAIfjDSXC+4dj+qfyuD8bfAXrW/y6lW3O76VaYNPKfpKrg==", + "dev": true, + "dependencies": { + "esrecurse": "^4.1.0", + "estraverse": "^4.1.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/esprima": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/esprima/-/esprima-4.0.1.tgz", + "integrity": "sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==", + "bin": { + "esparse": "bin/esparse.js", + "esvalidate": "bin/esvalidate.js" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/esrecurse": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.3.0.tgz", + "integrity": "sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==", + "dev": true, + "dependencies": { + "estraverse": "^5.2.0" + }, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/esrecurse/node_modules/estraverse": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-5.2.0.tgz", + "integrity": "sha512-BxbNGGNm0RyRYvUdHpIwv9IWzeM9XClbOxwoATuFdOE7ZE6wHL+HQ5T8hoPM+zHvmKzzsEqhgy0GrQ5X13afiQ==", + "dev": true, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/estraverse": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-4.3.0.tgz", + "integrity": "sha512-39nnKffWz8xN1BU/2c79n9nB9HDzo0niYUqx6xyqUnyoAnQyyWpOTdZEeiCch8BBu515t4wp9ZmgVfVhn9EBpw==", + "dev": true, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/esutils": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz", + "integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/etag": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", + "integrity": "sha1-Qa4u62XvpiJorr/qg6x9eSmbCIc=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/event-target-shim": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/event-target-shim/-/event-target-shim-5.0.1.tgz", + "integrity": "sha512-i/2XbnSz/uxRCU6+NdVJgKWDTM427+MqYbkQzD321DuCQJUqOuJKIA0IM2+W2xtYHdKOmZ4dR6fExsd4SXL+WQ==", + "engines": { + "node": ">=6" + } + }, + "node_modules/eventemitter3": { + "version": "4.0.4", + "resolved": "https://registry.npmjs.org/eventemitter3/-/eventemitter3-4.0.4.tgz", + "integrity": "sha512-rlaVLnVxtxvoyLsQQFBx53YmXHDxRIzzTLbdfxqi4yocpSjAxXwkU0cScM5JgSKMqEhrZpnvQ2D9gjylR0AimQ==", + "dev": true + }, + "node_modules/events": { + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/events/-/events-3.3.0.tgz", + "integrity": "sha512-mQw+2fkQbALzQ7V0MY0IqdnXNOeTtP4r0lN9z7AAawCXgqea7bDii20AYrIBrFd/Hx0M2Ocz6S111CaFkUcb0Q==", + "dev": true, + "engines": { + "node": ">=0.8.x" + } + }, + "node_modules/eventsource": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/eventsource/-/eventsource-1.0.7.tgz", + "integrity": "sha512-4Ln17+vVT0k8aWq+t/bF5arcS3EpT9gYtW66EPacdj/mAFevznsnyoHLPy2BA8gbIQeIHoPsvwmfBftfcG//BQ==", + "dev": true, + "dependencies": { + "original": "^1.0.0" + }, + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/evp_bytestokey": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/evp_bytestokey/-/evp_bytestokey-1.0.3.tgz", + "integrity": "sha512-/f2Go4TognH/KvCISP7OUsHn85hT9nUkxxA9BEWxFn+Oj9o8ZNLm/40hdlgSLyuOimsrTKLUMEorQexp/aPQeA==", + "dev": true, + "dependencies": { + "md5.js": "^1.3.4", + "safe-buffer": "^5.1.1" + } + }, + "node_modules/execa": { + "version": "0.7.0", + "resolved": "https://registry.npmjs.org/execa/-/execa-0.7.0.tgz", + "integrity": "sha1-lEvs00zEHuMqY6n68nrVpl/Fl3c=", + "dependencies": { + "cross-spawn": "^5.0.1", + "get-stream": "^3.0.0", + "is-stream": "^1.1.0", + "npm-run-path": "^2.0.0", + "p-finally": "^1.0.0", + "signal-exit": "^3.0.0", + "strip-eof": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/execa/node_modules/cross-spawn": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-5.1.0.tgz", + "integrity": "sha1-6L0O/uWPz/b4+UUQoKVUu/ojVEk=", + "dependencies": { + "lru-cache": "^4.0.1", + "shebang-command": "^1.2.0", + "which": "^1.2.9" + } + }, + "node_modules/execa/node_modules/lru-cache": { + "version": "4.1.5", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-4.1.5.tgz", + "integrity": "sha512-sWZlbEP2OsHNkXrMl5GYk/jKk70MBng6UU4YI/qGDYbgf6YbP4EvmqISbXCoJiRKs+1bSpFHVgQxvJ17F2li5g==", + "dependencies": { + "pseudomap": "^1.0.2", + "yallist": "^2.1.2" + } + }, + "node_modules/execa/node_modules/yallist": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-2.1.2.tgz", + "integrity": "sha1-HBH5IY8HYImkfdUS+TxmmaaoHVI=" + }, + "node_modules/exenv": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/exenv/-/exenv-1.2.2.tgz", + "integrity": "sha1-KueOhdmJQVhnCwPUe+wfA72Ru50=" + }, + "node_modules/exeq": { + "version": "2.4.0", + "resolved": "https://registry.npmjs.org/exeq/-/exeq-2.4.0.tgz", + "integrity": "sha1-Td8qaEZIxCeteZNJzzO9dTWPiEo=", + "dependencies": { + "bluebird": "^3.0.3", + "native-or-bluebird": "^1.2.0" + }, + "engines": { + "node": ">= 0.10.0" + } + }, + "node_modules/exif": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/exif/-/exif-0.6.0.tgz", + "integrity": "sha1-YKYmaAdlQst+T1cZnUrG830sX0o=", + "dependencies": { + "debug": "^2.2" + } + }, + "node_modules/exif/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/exif/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/expand-brackets": { + "version": "2.1.4", + "resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-2.1.4.tgz", + "integrity": "sha1-t3c14xXOMPa27/D4OwQVGiJEliI=", + "dependencies": { + "debug": "^2.3.3", + "define-property": "^0.2.5", + "extend-shallow": "^2.0.1", + "posix-character-classes": "^0.1.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/expand-brackets/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/expand-brackets/node_modules/define-property": { + "version": "0.2.5", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", + "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", + "dependencies": { + "is-descriptor": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/expand-brackets/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/expand-brackets/node_modules/is-extendable": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz", + "integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/expand-brackets/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/expand-template": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/expand-template/-/expand-template-2.0.3.tgz", + "integrity": "sha512-XYfuKMvj4O35f/pOXLObndIRvyQ+/+6AhODh+OKWj9S9498pHHn/IMszH+gt0fBCRWMNfk1ZSp5x3AifmnI2vg==", + "engines": { + "node": ">=6" + } + }, + "node_modules/expand-tilde": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/expand-tilde/-/expand-tilde-2.0.2.tgz", + "integrity": "sha1-l+gBqgUt8CRU3kawK/YhZCzchQI=", + "dev": true, + "dependencies": { + "homedir-polyfill": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/express": { + "version": "4.17.1", + "resolved": "https://registry.npmjs.org/express/-/express-4.17.1.tgz", + "integrity": "sha512-mHJ9O79RqluphRrcw2X/GTh3k9tVv8YcoyY4Kkh4WDMUYKRZUq0h1o0w2rrrxBqM7VoeUVqgb27xlEMXTnYt4g==", + "dependencies": { + "accepts": "~1.3.7", + "array-flatten": "1.1.1", + "body-parser": "1.19.0", + "content-disposition": "0.5.3", + "content-type": "~1.0.4", + "cookie": "0.4.0", + "cookie-signature": "1.0.6", + "debug": "2.6.9", + "depd": "~1.1.2", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "finalhandler": "~1.1.2", + "fresh": "0.5.2", + "merge-descriptors": "1.0.1", + "methods": "~1.1.2", + "on-finished": "~2.3.0", + "parseurl": "~1.3.3", + "path-to-regexp": "0.1.7", + "proxy-addr": "~2.0.5", + "qs": "6.7.0", + "range-parser": "~1.2.1", + "safe-buffer": "5.1.2", + "send": "0.17.1", + "serve-static": "1.14.1", + "setprototypeof": "1.1.1", + "statuses": "~1.5.0", + "type-is": "~1.6.18", + "utils-merge": "1.0.1", + "vary": "~1.1.2" + }, + "engines": { + "node": ">= 0.10.0" + } + }, + "node_modules/express-flash": { + "version": "0.0.2", + "resolved": "https://registry.npmjs.org/express-flash/-/express-flash-0.0.2.tgz", + "integrity": "sha1-I9GovPP5DXB5KOSJ+Whp7K0KzaI=", + "dependencies": { + "connect-flash": "0.1.x" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/express-session": { + "version": "1.17.1", + "resolved": "https://registry.npmjs.org/express-session/-/express-session-1.17.1.tgz", + "integrity": "sha512-UbHwgqjxQZJiWRTMyhvWGvjBQduGCSBDhhZXYenziMFjxst5rMV+aJZ6hKPHZnPyHGsrqRICxtX8jtEbm/z36Q==", + "dependencies": { + "cookie": "0.4.0", + "cookie-signature": "1.0.6", + "debug": "2.6.9", + "depd": "~2.0.0", + "on-headers": "~1.0.2", + "parseurl": "~1.3.3", + "safe-buffer": "5.2.0", + "uid-safe": "~2.1.5" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/express-session/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/express-session/node_modules/depd": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz", + "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/express-session/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/express-session/node_modules/safe-buffer": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.0.tgz", + "integrity": "sha512-fZEwUGbVl7kouZs1jCdMLdt95hdIv0ZeHg6L7qPeciMZhZ+/gdesW4wgTARkrFWEpspjEATAzUGPG8N2jJiwbg==" + }, + "node_modules/express-validator": { + "version": "5.3.1", + "resolved": "https://registry.npmjs.org/express-validator/-/express-validator-5.3.1.tgz", + "integrity": "sha512-g8xkipBF6VxHbO1+ksC7nxUU7+pWif0+OZXjZTybKJ/V0aTVhuCoHbyhIPgSYVldwQLocGExPtB2pE0DqK4jsw==", + "dependencies": { + "lodash": "^4.17.10", + "validator": "^10.4.0" + }, + "engines": { + "node": ">= 6.0.0" + } + }, + "node_modules/express/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/express/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/express/node_modules/qs": { + "version": "6.7.0", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.7.0.tgz", + "integrity": "sha512-VCdBRNFTX1fyE7Nb6FYoURo/SPe62QCaAyzJvUjwRaIsc+NePBEniHlvxFmmX56+HZphIGtV0XeCirBtpDrTyQ==", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/expressjs": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/expressjs/-/expressjs-1.0.1.tgz", + "integrity": "sha1-IgMoRpoY31rWFeK3oM6ZXxf7ru8=" + }, + "node_modules/ext": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/ext/-/ext-1.4.0.tgz", + "integrity": "sha512-Key5NIsUxdqKg3vIsdw9dSuXpPCQ297y6wBjL30edxwPgt2E44WcWBZey/ZvUc6sERLTxKdyCu4gZFmUbk1Q7A==", + "dev": true, + "dependencies": { + "type": "^2.0.0" + } + }, + "node_modules/ext/node_modules/type": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/type/-/type-2.0.0.tgz", + "integrity": "sha512-KBt58xCHry4Cejnc2ISQAF7QY+ORngsWfxezO68+12hKV6lQY8P/psIkcbjeHWn7MqcgciWJyCCevFMJdIXpow==", + "dev": true + }, + "node_modules/extend": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/extend/-/extend-3.0.2.tgz", + "integrity": "sha512-fjquC59cD7CyW6urNXK0FBufkZcoiGG80wTuPujX590cB5Ttln20E2UB4S/WARVqhXffZl2LNgS+gQdPIIim/g==" + }, + "node_modules/extend-shallow": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-3.0.2.tgz", + "integrity": "sha1-Jqcarwc7OfshJxcnRhMcJwQCjbg=", + "dependencies": { + "assign-symbols": "^1.0.0", + "is-extendable": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extglob": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/extglob/-/extglob-2.0.4.tgz", + "integrity": "sha512-Nmb6QXkELsuBr24CJSkilo6UHHgbekK5UiZgfE6UHD3Eb27YC6oD+bhcT+tJ6cl8dmsgdQxnWlcry8ksBIBLpw==", + "dependencies": { + "array-unique": "^0.3.2", + "define-property": "^1.0.0", + "expand-brackets": "^2.1.4", + "extend-shallow": "^2.0.1", + "fragment-cache": "^0.2.1", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extglob/node_modules/define-property": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", + "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", + "dependencies": { + "is-descriptor": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extglob/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extglob/node_modules/is-accessor-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", + "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extglob/node_modules/is-data-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", + "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extglob/node_modules/is-descriptor": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", + "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", + "dependencies": { + "is-accessor-descriptor": "^1.0.0", + "is-data-descriptor": "^1.0.0", + "kind-of": "^6.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extglob/node_modules/is-extendable": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz", + "integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/extract-zip": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extract-zip/-/extract-zip-2.0.1.tgz", + "integrity": "sha512-GDhU9ntwuKyGXdZBUgTIe+vXnWj0fppUEtMDL0+idd5Sta8TGpHssn/eusA9mrPr9qNDym6SxAYZjNvCn/9RBg==", + "dependencies": { + "debug": "^4.1.1", + "get-stream": "^5.1.0", + "yauzl": "^2.10.0" + }, + "bin": { + "extract-zip": "cli.js" + }, + "engines": { + "node": ">= 10.17.0" + }, + "optionalDependencies": { + "@types/yauzl": "^2.9.1" + } + }, + "node_modules/extract-zip/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/extract-zip/node_modules/get-stream": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-5.1.0.tgz", + "integrity": "sha512-EXr1FOzrzTfGeL0gQdeFEvOMm2mzMOglyiOXSTpPC+iAjAKftbr3jpCMWynogwYnM+eSj9sHGc6wjIcDvYiygw==", + "dependencies": { + "pump": "^3.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/extsprintf": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/extsprintf/-/extsprintf-1.3.0.tgz", + "integrity": "sha1-lpGEQOMEGnpBT4xS48V06zw+HgU=", + "engines": [ + "node >=0.6.0" + ] + }, + "node_modules/fast-deep-equal": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.1.tgz", + "integrity": "sha512-8UEa58QDLauDNfpbrX55Q9jrGHThw2ZMdOky5Gl1CDtVeJDPVrG4Jxx1N8jw2gkWaff5UUuX1KJd+9zGe2B+ZA==" + }, + "node_modules/fast-json-stable-stringify": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz", + "integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==" + }, + "node_modules/fast-levenshtein": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz", + "integrity": "sha1-PYpcZog6FqMMqGQ+hR8Zuqd5eRc=", + "dev": true + }, + "node_modules/fast-text-encoding": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/fast-text-encoding/-/fast-text-encoding-1.0.2.tgz", + "integrity": "sha512-5rQdinSsycpzvAoHga2EDn+LRX1d5xLFsuNG0Kg61JrAT/tASXcLL0nf/33v+sAxlQcfYmWbTURa1mmAf55jGw==" + }, + "node_modules/faye-websocket": { + "version": "0.10.0", + "resolved": "https://registry.npmjs.org/faye-websocket/-/faye-websocket-0.10.0.tgz", + "integrity": "sha1-TkkvjQTftviQA1B/btvy1QHnxvQ=", + "dev": true, + "dependencies": { + "websocket-driver": ">=0.5.1" + }, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/fbjs": { + "version": "0.8.17", + "resolved": "https://registry.npmjs.org/fbjs/-/fbjs-0.8.17.tgz", + "integrity": "sha1-xNWY6taUkRJlPWWIsBpc3Nn5D90=", + "dependencies": { + "core-js": "^1.0.0", + "isomorphic-fetch": "^2.1.1", + "loose-envify": "^1.0.0", + "object-assign": "^4.1.0", + "promise": "^7.1.1", + "setimmediate": "^1.0.5", + "ua-parser-js": "^0.7.18" + } + }, + "node_modules/fd-slicer": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/fd-slicer/-/fd-slicer-1.1.0.tgz", + "integrity": "sha1-JcfInLH5B3+IkbvmHY85Dq4lbx4=", + "dependencies": { + "pend": "~1.2.0" + } + }, + "node_modules/figgy-pudding": { + "version": "3.5.2", + "resolved": "https://registry.npmjs.org/figgy-pudding/-/figgy-pudding-3.5.2.tgz", + "integrity": "sha512-0btnI/H8f2pavGMN8w40mlSKOfTK2SVJmBfBeVIj3kNw0swwgzyRq0d5TJVOwodFmtvpPeWPN/MCcfuWF0Ezbw==", + "dev": true + }, + "node_modules/file-loader": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/file-loader/-/file-loader-3.0.1.tgz", + "integrity": "sha512-4sNIOXgtH/9WZq4NvlfU3Opn5ynUsqBwSLyM+I7UOwdGigTBYfVVQEwe/msZNX/j4pCJTIM14Fsw66Svo1oVrw==", + "dev": true, + "dependencies": { + "loader-utils": "^1.0.2", + "schema-utils": "^1.0.0" + }, + "engines": { + "node": ">= 6.9.0" + } + }, + "node_modules/file-loader/node_modules/schema-utils": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", + "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", + "dev": true, + "dependencies": { + "ajv": "^6.1.0", + "ajv-errors": "^1.0.0", + "ajv-keywords": "^3.1.0" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/file-saver": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/file-saver/-/file-saver-2.0.2.tgz", + "integrity": "sha512-Wz3c3XQ5xroCxd1G8b7yL0Ehkf0TC9oYC6buPFkNnU9EnaPlifeAFCyCh+iewXTyFRcg0a6j3J7FmJsIhlhBdw==" + }, + "node_modules/file-uri-to-path": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/file-uri-to-path/-/file-uri-to-path-1.0.0.tgz", + "integrity": "sha512-0Zt+s3L7Vf1biwWZ29aARiVYLx7iMGnEUl9x33fbB/j3jR81u/O2LbqK+Bm1CDSNDKVtJ/YjwY7TUd5SkeLQLw==", + "optional": true + }, + "node_modules/fill-range": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz", + "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=", + "dependencies": { + "extend-shallow": "^2.0.1", + "is-number": "^3.0.0", + "repeat-string": "^1.6.1", + "to-regex-range": "^2.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/fill-range/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/fill-range/node_modules/is-extendable": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz", + "integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/finalhandler": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.1.2.tgz", + "integrity": "sha512-aAWcW57uxVNrQZqFXjITpW3sIUQmHGG3qSb9mUah9MgMC4NeWhNOlNjXEYq3HjRAvL6arUviZGGJsBg6z0zsWA==", + "dependencies": { + "debug": "2.6.9", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "on-finished": "~2.3.0", + "parseurl": "~1.3.3", + "statuses": "~1.5.0", + "unpipe": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/finalhandler/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/finalhandler/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/find": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/find/-/find-0.1.7.tgz", + "integrity": "sha1-yGyHrxqxjyIrvjjeyGy8dg0Wpvs=", + "dependencies": { + "traverse-chain": "~0.1.0" + } + }, + "node_modules/find-cache-dir": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-1.0.0.tgz", + "integrity": "sha1-kojj6ePMN0hxfTnq3hfPcfww7m8=", + "dev": true, + "dependencies": { + "commondir": "^1.0.1", + "make-dir": "^1.0.0", + "pkg-dir": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/find-in-files": { + "version": "0.5.0", + "resolved": "https://registry.npmjs.org/find-in-files/-/find-in-files-0.5.0.tgz", + "integrity": "sha512-VraTc6HdtdSHmAp0yJpAy20yPttGKzyBWc7b7FPnnsX9TOgmKx0g9xajizpF/iuu4IvNK4TP0SpyBT9zAlwG+g==", + "dependencies": { + "find": "^0.1.5", + "q": "^1.0.1" + } + }, + "node_modules/find-parent-dir": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/find-parent-dir/-/find-parent-dir-0.3.0.tgz", + "integrity": "sha1-M8RLQpqysvBkYpnF+fcY83b/jVQ=" + }, + "node_modules/find-root": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/find-root/-/find-root-1.1.0.tgz", + "integrity": "sha512-NKfW6bec6GfKc0SGx1e07QZY9PE99u0Bft/0rzSD5k3sO/vwkVUpDUKVm5Gpp5Ue3YfShPFTX2070tDs5kB9Ng==" + }, + "node_modules/find-up": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz", + "integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==", + "dependencies": { + "locate-path": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/findup-sync": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/findup-sync/-/findup-sync-3.0.0.tgz", + "integrity": "sha512-YbffarhcicEhOrm4CtrwdKBdCuz576RLdhJDsIfvNtxUuhdRet1qZcsMjqbePtAseKdAnDyM/IyXbu7PRPRLYg==", + "dev": true, + "dependencies": { + "detect-file": "^1.0.0", + "is-glob": "^4.0.0", + "micromatch": "^3.0.4", + "resolve-dir": "^1.0.1" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/fit-curve": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/fit-curve/-/fit-curve-0.1.7.tgz", + "integrity": "sha512-Md3b3ReA/qJwwYvKXeHpOV1fhPqwhJ9/29zc9lfi8ijyg00J0S9C7+5XMZDFhlDAKbwOvVgBxVIG1EHoMSC3vw==" + }, + "node_modules/flat": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/flat/-/flat-4.1.0.tgz", + "integrity": "sha512-Px/TiLIznH7gEDlPXcUD4KnBusa6kR6ayRUVcnEAbreRIuhkqow/mun59BuRXwoYk7ZQOLW1ZM05ilIvK38hFw==", + "dependencies": { + "is-buffer": "~2.0.3" + }, + "bin": { + "flat": "cli.js" + } + }, + "node_modules/flexlayout-react": { + "version": "0.3.11", + "resolved": "https://registry.npmjs.org/flexlayout-react/-/flexlayout-react-0.3.11.tgz", + "integrity": "sha512-V+rEfyYJBqNk9oBgotPoXg8rmom4/ji9Mvr6f7T8sIJs83RuyK1D3oOrya2ydZIUCP2T6BIvj7rFTmRRkzpU8w==" + }, + "node_modules/fluent-ffmpeg": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/fluent-ffmpeg/-/fluent-ffmpeg-2.1.2.tgz", + "integrity": "sha1-yVLeIkD4EuvaCqgAbXd27irPfXQ=", + "dependencies": { + "async": ">=0.2.9", + "which": "^1.1.1" + }, + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/flush-write-stream": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/flush-write-stream/-/flush-write-stream-1.1.1.tgz", + "integrity": "sha512-3Z4XhFZ3992uIq0XOqb9AreonueSYphE6oYbpt5+3u06JWklbsPkNv3ZKkP9Bz/r+1MWCaMoSQ28P85+1Yc77w==", + "dev": true, + "dependencies": { + "inherits": "^2.0.3", + "readable-stream": "^2.3.6" + } + }, + "node_modules/flush-write-stream/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/follow-redirects": { + "version": "1.12.1", + "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.12.1.tgz", + "integrity": "sha512-tmRv0AVuR7ZyouUHLeNSiO6pqulF7dYa3s19c6t+wz9LD69/uSzdMxJ2S91nTI9U3rt/IldxpzMOFejp6f0hjg==", + "engines": { + "node": ">=4.0" + } + }, + "node_modules/for-each-property": { + "version": "0.0.4", + "resolved": "https://registry.npmjs.org/for-each-property/-/for-each-property-0.0.4.tgz", + "integrity": "sha1-z6hXrsFCLh0Sb/CHhPz2Jim8g/Y=", + "dependencies": { + "get-prototype-chain": "^1.0.1" + } + }, + "node_modules/for-each-property-deep": { + "version": "0.0.3", + "resolved": "https://registry.npmjs.org/for-each-property-deep/-/for-each-property-deep-0.0.3.tgz", + "integrity": "sha1-MTCaSvw4qcygbxsiP1PWSm0IP60=", + "dependencies": { + "for-each-property": "0.0.4" + } + }, + "node_modules/for-in": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/for-in/-/for-in-1.0.2.tgz", + "integrity": "sha1-gQaNKVqBQuwKxybG4iAMMPttXoA=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/forever-agent": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/forever-agent/-/forever-agent-0.6.1.tgz", + "integrity": "sha1-+8cfDEGt6zf5bFd60e1C2P2sypE=", + "engines": { + "node": "*" + } + }, + "node_modules/fork-ts-checker-webpack-plugin": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/fork-ts-checker-webpack-plugin/-/fork-ts-checker-webpack-plugin-1.6.0.tgz", + "integrity": "sha512-vqOY5gakcoon2s12V7MMe01OPwfgqulUWFzm+geQaPPOBKjW1I7aqqoBVlU0ECn97liMB0ECs16pRdIGe9qdRw==", + "dev": true, + "dependencies": { + "babel-code-frame": "^6.22.0", + "chalk": "^2.4.1", + "chokidar": "^2.0.4", + "micromatch": "^3.1.10", + "minimatch": "^3.0.4", + "semver": "^5.6.0", + "tapable": "^1.0.0", + "worker-rpc": "^0.1.0" + }, + "engines": { + "node": ">=6.11.5", + "yarn": ">=1.0.0" + } + }, + "node_modules/form-data": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/form-data/-/form-data-2.5.1.tgz", + "integrity": "sha512-m21N3WOmEEURgk6B9GLOE4RuWOFf28Lhh9qGYeNlGq4VDXUlJy2th2slBNU8Gp8EzloYZOibZJ7t5ecIrFSjVA==", + "dev": true, + "dependencies": { + "asynckit": "^0.4.0", + "combined-stream": "^1.0.6", + "mime-types": "^2.1.12" + }, + "engines": { + "node": ">= 0.12" + } + }, + "node_modules/formidable": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/formidable/-/formidable-1.2.2.tgz", + "integrity": "sha512-V8gLm+41I/8kguQ4/o1D3RIHRmhYFG4pnNyonvua+40rqcEmT4+V71yaZ3B457xbbgCsCfjSPi65u/W6vK1U5Q==" + }, + "node_modules/forwarded": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.1.2.tgz", + "integrity": "sha1-mMI9qxF1ZXuMBXPozszZGw/xjIQ=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/fragment-cache": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/fragment-cache/-/fragment-cache-0.2.1.tgz", + "integrity": "sha1-QpD60n8T6Jvn8zeZxrxaCr//DRk=", + "dependencies": { + "map-cache": "^0.2.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/fresh": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz", + "integrity": "sha1-PYyt2Q2XZWn6g1qx+OSyOhBWBac=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/from2": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/from2/-/from2-2.3.0.tgz", + "integrity": "sha1-i/tVAr3kpNNs/e6gB/zKIdfjgq8=", + "dev": true, + "dependencies": { + "inherits": "^2.0.1", + "readable-stream": "^2.0.0" + } + }, + "node_modules/from2/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/fs-constants": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/fs-constants/-/fs-constants-1.0.0.tgz", + "integrity": "sha512-y6OAwoSIf7FyjMIv94u+b5rdheZEjzR63GTyZJm5qh4Bi+2YgwLCcI/fPFZkL5PSixOt6ZNKm+w+Hfp/Bciwow==" + }, + "node_modules/fs-extra": { + "version": "0.26.7", + "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-0.26.7.tgz", + "integrity": "sha1-muH92UiXeY7at20JGM9C0MMYT6k=", + "dependencies": { + "graceful-fs": "^4.1.2", + "jsonfile": "^2.1.0", + "klaw": "^1.0.0", + "path-is-absolute": "^1.0.0", + "rimraf": "^2.2.8" + } + }, + "node_modules/fs-extra/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/fs-minipass": { + "version": "1.2.7", + "resolved": "https://registry.npmjs.org/fs-minipass/-/fs-minipass-1.2.7.tgz", + "integrity": "sha512-GWSSJGFy4e9GUeCcbIkED+bgAoFyj7XF1mV8rma3QW4NIqX9Kyx79N/PF61H5udOV3aY1IaMLs6pGbH71nlCTA==", + "dependencies": { + "minipass": "^2.6.0" + } + }, + "node_modules/fs-write-stream-atomic": { + "version": "1.0.10", + "resolved": "https://registry.npmjs.org/fs-write-stream-atomic/-/fs-write-stream-atomic-1.0.10.tgz", + "integrity": "sha1-tH31NJPvkR33VzHnCp3tAYnbQMk=", + "dev": true, + "dependencies": { + "graceful-fs": "^4.1.2", + "iferr": "^0.1.5", + "imurmurhash": "^0.1.4", + "readable-stream": "1 || 2" + } + }, + "node_modules/fs-write-stream-atomic/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/fs.realpath": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", + "integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8=" + }, + "node_modules/fsevents": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.1.3.tgz", + "integrity": "sha512-Auw9a4AxqWpa9GUfj370BMPzzyncfBABW8Mab7BGWBYDj4Isgq+cDKtx0i6u9jcX9pQDnswsaaOTgTmA5pEjuQ==", + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": "^8.16.0 || ^10.6.0 || >=11.0.0" + } + }, + "node_modules/fstream": { + "version": "1.0.12", + "resolved": "https://registry.npmjs.org/fstream/-/fstream-1.0.12.tgz", + "integrity": "sha512-WvJ193OHa0GHPEL+AycEJgxvBEwyfRkN1vhjca23OaPVMCaLCXTd5qAu82AjTcgP1UJmytkOKb63Ypde7raDIg==", + "dependencies": { + "graceful-fs": "^4.1.2", + "inherits": "~2.0.0", + "mkdirp": ">=0.5 0", + "rimraf": "2" + }, + "engines": { + "node": ">=0.6" + } + }, + "node_modules/fstream/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/function-bind": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz", + "integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==" + }, + "node_modules/function-plot": { + "version": "1.22.7", + "resolved": "https://registry.npmjs.org/function-plot/-/function-plot-1.22.7.tgz", + "integrity": "sha512-rB6FeVqvgNECmt5PhIvFFEOyEjM9AWLIpMkj9Nzbzq9f81Irgn3ZrXAuv5+qnuzM99jPL7ZM4kK3+ImiKXcSHA==", + "dependencies": { + "built-in-math-eval": "^0.3.0", + "clamp": "^1.0.1", + "d3-axis": "^2.0.0", + "d3-color": "^2.0.0", + "d3-format": "^2.0.0", + "d3-interpolate": "^2.0.1", + "d3-scale": "^3.2.2", + "d3-selection": "^2.0.0", + "d3-shape": "^2.0.0", + "d3-zoom": "^2.0.0", + "interval-arithmetic-eval": "^0.4.7" + } + }, + "node_modules/gauge": { + "version": "2.7.4", + "resolved": "https://registry.npmjs.org/gauge/-/gauge-2.7.4.tgz", + "integrity": "sha1-LANAXHU4w51+s3sxcCLjJfsBi/c=", + "dependencies": { + "aproba": "^1.0.3", + "console-control-strings": "^1.0.0", + "has-unicode": "^2.0.0", + "object-assign": "^4.1.0", + "signal-exit": "^3.0.0", + "string-width": "^1.0.1", + "strip-ansi": "^3.0.1", + "wide-align": "^1.1.0" + } + }, + "node_modules/gauge/node_modules/ansi-regex": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", + "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/gauge/node_modules/is-fullwidth-code-point": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz", + "integrity": "sha1-754xOG8DGn8NZDr4L95QxFfvAMs=", + "dependencies": { + "number-is-nan": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/gauge/node_modules/string-width": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-1.0.2.tgz", + "integrity": "sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=", + "dependencies": { + "code-point-at": "^1.0.0", + "is-fullwidth-code-point": "^1.0.0", + "strip-ansi": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/gauge/node_modules/strip-ansi": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", + "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", + "dependencies": { + "ansi-regex": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/gaxios": { + "version": "2.3.4", + "resolved": "https://registry.npmjs.org/gaxios/-/gaxios-2.3.4.tgz", + "integrity": "sha512-US8UMj8C5pRnao3Zykc4AAVr+cffoNKRTg9Rsf2GiuZCW69vgJj38VK2PzlPuQU73FZ/nTk9/Av6/JGcE1N9vA==", + "dependencies": { + "abort-controller": "^3.0.0", + "extend": "^3.0.2", + "https-proxy-agent": "^5.0.0", + "is-stream": "^2.0.0", + "node-fetch": "^2.3.0" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/gaxios/node_modules/is-stream": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-stream/-/is-stream-2.0.0.tgz", + "integrity": "sha512-XCoy+WlUr7d1+Z8GgSuXmpuUFC9fOhRXglJMx+dwLKTkL44Cjd4W1Z5P+BQZpr+cR93aGP4S/s7Ftw6Nd/kiEw==", + "engines": { + "node": ">=8" + } + }, + "node_modules/gaxios/node_modules/node-fetch": { + "version": "2.6.0", + "resolved": "https://registry.npmjs.org/node-fetch/-/node-fetch-2.6.0.tgz", + "integrity": "sha512-8dG4H5ujfvFiqDmVu9fQ5bOHUC15JMjMY/Zumv26oOvvVJjM67KF8koCWIabKQ1GJIa9r2mMZscBq/TbdOcmNA==", + "engines": { + "node": "4.x || >=6.0.0" + } + }, + "node_modules/gaze": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/gaze/-/gaze-1.1.3.tgz", + "integrity": "sha512-BRdNm8hbWzFzWHERTrejLqwHDfS4GibPoq5wjTPIoJHoBtKGPg3xAFfxmM+9ztbXelxcf2hwQcaz1PtmFeue8g==", + "dependencies": { + "globule": "^1.0.0" + }, + "engines": { + "node": ">= 4.0.0" + } + }, + "node_modules/gcp-metadata": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/gcp-metadata/-/gcp-metadata-2.0.4.tgz", + "integrity": "sha512-p1lXhJvcKvJHWfQXhkd4Za1kyXRsGZA0JH7Cjs07W9hrg84d/j5tqQhbGewlSLx9gNyuQUid69uLux48YbggLg==", + "dependencies": { + "gaxios": "^2.0.1", + "json-bigint": "^0.3.0" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/get-caller-file": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", + "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==", + "engines": { + "node": "6.* || 8.* || >= 10.*" + } + }, + "node_modules/get-func-name": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/get-func-name/-/get-func-name-2.0.0.tgz", + "integrity": "sha1-6td0q+5y4gQJQzoGY2YCPdaIekE=", + "engines": { + "node": "*" + } + }, + "node_modules/get-node-dimensions": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/get-node-dimensions/-/get-node-dimensions-1.2.1.tgz", + "integrity": "sha512-2MSPMu7S1iOTL+BOa6K1S62hB2zUAYNF/lV0gSVlOaacd087lc6nR1H1r0e3B1CerTo+RceOmi1iJW+vp21xcQ==" + }, + "node_modules/get-prototype-chain": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/get-prototype-chain/-/get-prototype-chain-1.0.1.tgz", + "integrity": "sha1-oXGhFeoeSQbG7ThDofABwYUQQW8=", + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/get-stdin": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/get-stdin/-/get-stdin-5.0.1.tgz", + "integrity": "sha1-Ei4WFZHiH/TFJTAwVpPyDmOTo5g=", + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/get-stream": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-3.0.0.tgz", + "integrity": "sha1-jpQ9E1jcN1VQVOy+LtsFqhdO3hQ=", + "engines": { + "node": ">=4" + } + }, + "node_modules/get-value": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/get-value/-/get-value-2.0.6.tgz", + "integrity": "sha1-3BXKHGcjh8p2vTesCjlbogQqLCg=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/getpass": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/getpass/-/getpass-0.1.7.tgz", + "integrity": "sha1-Xv+OPmhNVprkyysSgmBOi6YhSfo=", + "dependencies": { + "assert-plus": "^1.0.0" + } + }, + "node_modules/github-from-package": { + "version": "0.0.0", + "resolved": "https://registry.npmjs.org/github-from-package/-/github-from-package-0.0.0.tgz", + "integrity": "sha1-l/tdlr/eiXMxPyDoKI75oWf6ZM4=" + }, + "node_modules/glob": { + "version": "7.1.6", + "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.6.tgz", + "integrity": "sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==", + "dependencies": { + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.0.4", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" + }, + "engines": { + "node": "*" + } + }, + "node_modules/glob-parent": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-3.1.0.tgz", + "integrity": "sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=", + "dependencies": { + "is-glob": "^3.1.0", + "path-dirname": "^1.0.0" + } + }, + "node_modules/glob-parent/node_modules/is-glob": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz", + "integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=", + "dependencies": { + "is-extglob": "^2.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/global-dirs": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/global-dirs/-/global-dirs-0.1.1.tgz", + "integrity": "sha1-sxnA3UYH81PzvpzKTHL8FIxJ9EU=", + "dependencies": { + "ini": "^1.3.4" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/global-modules": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/global-modules/-/global-modules-2.0.0.tgz", + "integrity": "sha512-NGbfmJBp9x8IxyJSd1P+otYK8vonoJactOogrVfFRIAEY1ukil8RSKDz2Yo7wh1oihl51l/r6W4epkeKJHqL8A==", + "dev": true, + "dependencies": { + "global-prefix": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/global-modules/node_modules/global-prefix": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/global-prefix/-/global-prefix-3.0.0.tgz", + "integrity": "sha512-awConJSVCHVGND6x3tmMaKcQvwXLhjdkmomy2W+Goaui8YPgYgXJZewhg3fWC+DlfqqQuWg8AwqjGTD2nAPVWg==", + "dev": true, + "dependencies": { + "ini": "^1.3.5", + "kind-of": "^6.0.2", + "which": "^1.3.1" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/global-prefix": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/global-prefix/-/global-prefix-1.0.2.tgz", + "integrity": "sha1-2/dDxsFJklk8ZVVoy2btMsASLr4=", + "dev": true, + "dependencies": { + "expand-tilde": "^2.0.2", + "homedir-polyfill": "^1.0.1", + "ini": "^1.3.4", + "is-windows": "^1.0.1", + "which": "^1.2.14" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/globals": { + "version": "11.12.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", + "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", + "engines": { + "node": ">=4" + } + }, + "node_modules/globby": { + "version": "7.1.1", + "resolved": "https://registry.npmjs.org/globby/-/globby-7.1.1.tgz", + "integrity": "sha1-+yzP+UAfhgCUXfral0QMypcrhoA=", + "dev": true, + "dependencies": { + "array-union": "^1.0.1", + "dir-glob": "^2.0.0", + "glob": "^7.1.2", + "ignore": "^3.3.5", + "pify": "^3.0.0", + "slash": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/globby/node_modules/pify": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz", + "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/globule": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/globule/-/globule-1.3.1.tgz", + "integrity": "sha512-OVyWOHgw29yosRHCHo7NncwR1hW5ew0W/UrvtwvjefVJeQ26q4/8r8FmPsSF1hJ93IgWkyv16pCTz6WblMzm/g==", + "dependencies": { + "glob": "~7.1.1", + "lodash": "~4.17.12", + "minimatch": "~3.0.2" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/golden-layout": { + "version": "1.5.9", + "resolved": "https://registry.npmjs.org/golden-layout/-/golden-layout-1.5.9.tgz", + "integrity": "sha1-o5vB9qZ+b4hreXwBbdkk6UJrp38=", + "dependencies": { + "jquery": "*" + } + }, + "node_modules/google-auth-library": { + "version": "4.2.6", + "resolved": "https://registry.npmjs.org/google-auth-library/-/google-auth-library-4.2.6.tgz", + "integrity": "sha512-oJ6tCA9rbsYeIVY+mcLPFHa2hatz3XO6idYIrlI/KhhlMxZrO3tKyU8O2Pxu5KnSBBP7Wj4HtbM1LLKngNFaFw==", + "dependencies": { + "arrify": "^2.0.0", + "base64-js": "^1.3.0", + "fast-text-encoding": "^1.0.0", + "gaxios": "^2.0.0", + "gcp-metadata": "^2.0.0", + "gtoken": "^3.0.0", + "jws": "^3.1.5", + "lru-cache": "^5.0.0" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/google-maps-react": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/google-maps-react/-/google-maps-react-2.0.6.tgz", + "integrity": "sha512-M8Eo9WndfQEfxcmm6yRq03qdJgw1x6rQmJ9DN+a+xPQ3K7yNDGkVDbinrf4/8vcox7nELbeopbm4bpefKewWfQ==" + }, + "node_modules/google-p12-pem": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/google-p12-pem/-/google-p12-pem-2.0.4.tgz", + "integrity": "sha512-S4blHBQWZRnEW44OcR7TL9WR+QCqByRvhNDZ/uuQfpxywfupikf/miba8js1jZi6ZOGv5slgSuoshCWh6EMDzg==", + "dependencies": { + "node-forge": "^0.9.0" + }, + "bin": { + "gp12-pem": "build/src/bin/gp12-pem.js" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/googleapis": { + "version": "40.0.1", + "resolved": "https://registry.npmjs.org/googleapis/-/googleapis-40.0.1.tgz", + "integrity": "sha512-B6qZVCautOOspEhru9GZ814I+ztkGWyA4ZEUfaXwXHBruX/HAWqedbsuUEx1w3nCECywK/FLTNUdcbH9zpaMaw==", + "dependencies": { + "google-auth-library": "^4.0.0", + "googleapis-common": "^2.0.2" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/googleapis-common": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/googleapis-common/-/googleapis-common-2.0.4.tgz", + "integrity": "sha512-8RRkxr24v1jIKCC1onFWA8RGnwFV55m3Qpil9DLX1yLc9e5qvOJsRoDOhhD2e7jFRONYEhT/BzT8vJZANqSr9w==", + "dependencies": { + "extend": "^3.0.2", + "gaxios": "^2.0.1", + "google-auth-library": "^4.2.5", + "qs": "^6.7.0", + "url-template": "^2.0.8", + "uuid": "^3.3.2" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/googleapis-common/node_modules/qs": { + "version": "6.9.3", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.9.3.tgz", + "integrity": "sha512-EbZYNarm6138UKKq46tdx08Yo/q9ZhFoAXAI1meAFd2GtbRDhbZY2WQSICskT0c5q99aFzLG1D4nvTk9tqfXIw==", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/googlephotos": { + "version": "0.2.5", + "resolved": "https://registry.npmjs.org/googlephotos/-/googlephotos-0.2.5.tgz", + "integrity": "sha512-XPmD3gu8aMVuwauKVzzahD2Vn8Cn8WtBRGgSF5J9A85Fn6N2GM0OToxWbEoTfyKahK+ryGHGcIYzDX98ndxE9g==", + "dependencies": { + "lodash.chunk": "^4.2.0", + "request": "^2.86.0", + "request-promise": "^4.2.2" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/got": { + "version": "6.7.1", + "resolved": "https://registry.npmjs.org/got/-/got-6.7.1.tgz", + "integrity": "sha1-JAzQV4WpoY5WHcG0S0HHY+8ejbA=", + "dependencies": { + "create-error-class": "^3.0.0", + "duplexer3": "^0.1.4", + "get-stream": "^3.0.0", + "is-redirect": "^1.0.0", + "is-retry-allowed": "^1.0.0", + "is-stream": "^1.0.0", + "lowercase-keys": "^1.0.0", + "safe-buffer": "^5.0.1", + "timed-out": "^4.0.0", + "unzip-response": "^2.0.1", + "url-parse-lax": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/graceful-fs": { + "version": "4.2.4", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.4.tgz", + "integrity": "sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw==" + }, + "node_modules/growl": { + "version": "1.10.5", + "resolved": "https://registry.npmjs.org/growl/-/growl-1.10.5.tgz", + "integrity": "sha512-qBr4OuELkhPenW6goKVXiv47US3clb3/IbuWF9KNKEijAy9oeHxU9IgzjvJhHkUzhaj7rOUD7+YGWqUjLp5oSA==", + "engines": { + "node": ">=4.x" + } + }, + "node_modules/growly": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/growly/-/growly-1.3.0.tgz", + "integrity": "sha1-8QdIy+dq+WS3yWyTxrzCivEgwIE=", + "dev": true + }, + "node_modules/gtoken": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/gtoken/-/gtoken-3.0.2.tgz", + "integrity": "sha512-BOBi6Zz31JfxhSHRZBIDdbwIbOPyux10WxJHdx8wz/FMP1zyN1xFrsAWsgcLe5ww5v/OZu/MePUEZAjgJXSauA==", + "dependencies": { + "gaxios": "^2.0.0", + "google-p12-pem": "^2.0.0", + "jws": "^3.1.5", + "mime": "^2.2.0" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/gtoken/node_modules/mime": { + "version": "2.4.4", + "resolved": "https://registry.npmjs.org/mime/-/mime-2.4.4.tgz", + "integrity": "sha512-LRxmNwziLPT828z+4YkNzloCFC2YM4wrB99k+AV5ZbEyfGNWfG8SO1FUXLmLDBSo89NrJZ4DIWeLjy1CHGhMGA==", + "bin": { + "mime": "cli.js" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/gud": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/gud/-/gud-1.0.0.tgz", + "integrity": "sha512-zGEOVKFM5sVPPrYs7J5/hYEw2Pof8KCyOwyhG8sAF26mCAeUFAcYPu1mwB7hhpIP29zOIBaDqwuHdLp0jvZXjw==" + }, + "node_modules/handle-thing": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/handle-thing/-/handle-thing-2.0.1.tgz", + "integrity": "sha512-9Qn4yBxelxoh2Ow62nP+Ka/kMnOXRi8BXnRaUwezLNhqelnN49xKz4F/dPP8OYLxLxq6JDtZb2i9XznUQbNPTg==", + "dev": true + }, + "node_modules/har-schema": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/har-schema/-/har-schema-2.0.0.tgz", + "integrity": "sha1-qUwiJOvKwEeCoNkDVSHyRzW37JI=", + "engines": { + "node": ">=4" + } + }, + "node_modules/har-validator": { + "version": "5.1.3", + "resolved": "https://registry.npmjs.org/har-validator/-/har-validator-5.1.3.tgz", + "integrity": "sha512-sNvOCzEQNr/qrvJgc3UG/kD4QtlHycrzwS+6mfTrrSq97BvaYcPZZI1ZSqGSPR73Cxn4LKTD4PttRwfU7jWq5g==", + "dependencies": { + "ajv": "^6.5.5", + "har-schema": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/has": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has/-/has-1.0.3.tgz", + "integrity": "sha512-f2dvO0VU6Oej7RkWJGrehjbzMAjFp5/VKPp5tTpWIV4JHHZK1/BxbFRtf/siA2SWTe09caDmVtYYzWEIbBS4zw==", + "dependencies": { + "function-bind": "^1.1.1" + }, + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/has-ansi": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/has-ansi/-/has-ansi-2.0.0.tgz", + "integrity": "sha1-NPUEnOHs3ysGSa8+8k5F7TVBbZE=", + "dependencies": { + "ansi-regex": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/has-ansi/node_modules/ansi-regex": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", + "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/has-binary2": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has-binary2/-/has-binary2-1.0.3.tgz", + "integrity": "sha512-G1LWKhDSvhGeAQ8mPVQlqNcOB2sJdwATtZKl2pDKKHfpf/rYj24lkinxf69blJbnsvtqqNU+L3SL50vzZhXOnw==", + "dependencies": { + "isarray": "2.0.1" + } + }, + "node_modules/has-binary2/node_modules/isarray": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/isarray/-/isarray-2.0.1.tgz", + "integrity": "sha1-o32U7ZzaLVmGXJ92/llu4fM4dB4=" + }, + "node_modules/has-cors": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/has-cors/-/has-cors-1.1.0.tgz", + "integrity": "sha1-XkdHk/fqmEPRu5nCPu9J/xJv/zk=" + }, + "node_modules/has-flag": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", + "integrity": "sha1-tdRU3CGZriJWmfNGfloH87lVuv0=", + "engines": { + "node": ">=4" + } + }, + "node_modules/has-symbols": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.1.tgz", + "integrity": "sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/has-unicode": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/has-unicode/-/has-unicode-2.0.1.tgz", + "integrity": "sha1-4Ob+aijPUROIVeCG0Wkedx3iqLk=" + }, + "node_modules/has-value": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/has-value/-/has-value-1.0.0.tgz", + "integrity": "sha1-GLKB2lhbHFxR3vJMkw7SmgvmsXc=", + "dependencies": { + "get-value": "^2.0.6", + "has-values": "^1.0.0", + "isobject": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/has-values": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/has-values/-/has-values-1.0.0.tgz", + "integrity": "sha1-lbC2P+whRmGab+V/51Yo1aOe/k8=", + "dependencies": { + "is-number": "^3.0.0", + "kind-of": "^4.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/has-values/node_modules/is-buffer": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz", + "integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==" + }, + "node_modules/has-values/node_modules/kind-of": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-4.0.0.tgz", + "integrity": "sha1-IIE989cSkosgc3hpGkUGb65y3Vc=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/hash-base": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/hash-base/-/hash-base-3.1.0.tgz", + "integrity": "sha512-1nmYp/rhMDiE7AYkDw+lLwlAzz0AntGIe51F3RfFfEqyQ3feY2eI/NcwC6umIQVOASPMsWJLJScWKSSvzL9IVA==", + "dev": true, + "dependencies": { + "inherits": "^2.0.4", + "readable-stream": "^3.6.0", + "safe-buffer": "^5.2.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/hash-base/node_modules/safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", + "dev": true + }, + "node_modules/hash.js": { + "version": "1.1.7", + "resolved": "https://registry.npmjs.org/hash.js/-/hash.js-1.1.7.tgz", + "integrity": "sha512-taOaskGt4z4SOANNseOviYDvjEJinIkRgmp7LbKP2YTTmVxWBl87s/uzK9r+44BclBSp2X7K1hqeNfz9JbBeXA==", + "dev": true, + "dependencies": { + "inherits": "^2.0.3", + "minimalistic-assert": "^1.0.1" + } + }, + "node_modules/he": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/he/-/he-1.2.0.tgz", + "integrity": "sha512-F/1DnUGPopORZi0ni+CvrCgHQ5FyEAHRLSApuYWMmrbSwoN2Mn/7k+Gl38gJnR7yyDZk6WLXwiGod1JOWNDKGw==", + "bin": { + "he": "bin/he" + } + }, + "node_modules/hmac-drbg": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/hmac-drbg/-/hmac-drbg-1.0.1.tgz", + "integrity": "sha1-0nRXAQJabHdabFRXk+1QL8DGSaE=", + "dev": true, + "dependencies": { + "hash.js": "^1.0.3", + "minimalistic-assert": "^1.0.0", + "minimalistic-crypto-utils": "^1.0.1" + } + }, + "node_modules/hoist-non-react-statics": { + "version": "3.3.2", + "resolved": "https://registry.npmjs.org/hoist-non-react-statics/-/hoist-non-react-statics-3.3.2.tgz", + "integrity": "sha512-/gGivxi8JPKWNm/W0jSmzcMPpfpPLc3dY/6GxhX2hQ9iGj3aDfklV4ET7NjKpSinLpJ5vafa9iiGIEZg10SfBw==", + "dependencies": { + "react-is": "^16.7.0" + } + }, + "node_modules/homedir-polyfill": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/homedir-polyfill/-/homedir-polyfill-1.0.3.tgz", + "integrity": "sha512-eSmmWE5bZTK2Nou4g0AI3zZ9rswp7GRKoKXS1BLUkvPviOqs4YTN1djQIqrXy9k5gEtdLPy86JjRwsNM9tnDcA==", + "dev": true, + "dependencies": { + "parse-passwd": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/hosted-git-info": { + "version": "2.8.8", + "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.8.8.tgz", + "integrity": "sha512-f/wzC2QaWBs7t9IYqB4T3sR1xviIViXJRJTWBlx2Gf3g0Xi5vI7Yy4koXQ1c9OYDGHN9sBy1DQ2AB8fqZBWhUg==" + }, + "node_modules/howler": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/howler/-/howler-2.2.0.tgz", + "integrity": "sha512-sGPkrAQy7jh5mNDbkRNG0F82R2HFDYNsQXBcX4smXQT0y0F4UMsa/+jXaGwWvcrajWr2tDB7JUkH7G5qSnuIyQ==" + }, + "node_modules/hpack.js": { + "version": "2.1.6", + "resolved": "https://registry.npmjs.org/hpack.js/-/hpack.js-2.1.6.tgz", + "integrity": "sha1-h3dMCUnlE/QuhFdbPEVoH63ioLI=", + "dev": true, + "dependencies": { + "inherits": "^2.0.1", + "obuf": "^1.0.0", + "readable-stream": "^2.0.1", + "wbuf": "^1.1.0" + } + }, + "node_modules/hpack.js/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/html": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/html/-/html-1.0.0.tgz", + "integrity": "sha1-pUT6nqVJK/s6LMqCEKEL57WvH2E=", + "dependencies": { + "concat-stream": "^1.4.7" + }, + "bin": { + "html": "bin/html.js" + } + }, + "node_modules/html-encoding-sniffer": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/html-encoding-sniffer/-/html-encoding-sniffer-1.0.2.tgz", + "integrity": "sha512-71lZziiDnsuabfdYiUeWdCVyKuqwWi23L8YeIgV9jSSZHCtb6wB1BKWooH7L3tn4/FuZJMVWyNaIDr4RGmaSYw==", + "dev": true, + "dependencies": { + "whatwg-encoding": "^1.0.1" + } + }, + "node_modules/html-entities": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/html-entities/-/html-entities-1.3.1.tgz", + "integrity": "sha512-rhE/4Z3hIhzHAUKbW8jVcCyuT5oJCXXqhN/6mXXVCpzTmvJnoH2HL/bt3EZ6p55jbFJBeAe1ZNpL5BugLujxNA==", + "dev": true + }, + "node_modules/html-to-image": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/html-to-image/-/html-to-image-0.1.1.tgz", + "integrity": "sha512-UAjpXmokENeOyzfLwL0+zQ502lXyg6pkzVUmRjtljOH9dR/YdEYQhWrQ/O14hmH5/1L7jv1aOupU4Zi3Y8+iow==" + }, + "node_modules/html-to-text": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/html-to-text/-/html-to-text-5.1.1.tgz", + "integrity": "sha512-Bci6bD/JIfZSvG4s0gW/9mMKwBRoe/1RWLxUME/d6WUSZCdY7T60bssf/jFf7EYXRyqU4P5xdClVqiYU0/ypdA==", + "dependencies": { + "he": "^1.2.0", + "htmlparser2": "^3.10.1", + "lodash": "^4.17.11", + "minimist": "^1.2.0" + }, + "bin": { + "html-to-text": "bin/cli.js" + }, + "engines": { + "node": ">= 4.0.0" + } + }, + "node_modules/htmlparser2": { + "version": "3.10.1", + "resolved": "https://registry.npmjs.org/htmlparser2/-/htmlparser2-3.10.1.tgz", + "integrity": "sha512-IgieNijUMbkDovyoKObU1DUhm1iwNYE/fuifEoEHfd1oZKZDaONBSkal7Y01shxsM49R4XaMdGez3WnF9UfiCQ==", + "dependencies": { + "domelementtype": "^1.3.1", + "domhandler": "^2.3.0", + "domutils": "^1.5.1", + "entities": "^1.1.1", + "inherits": "^2.0.1", + "readable-stream": "^3.1.1" + } + }, + "node_modules/http-deceiver": { + "version": "1.2.7", + "resolved": "https://registry.npmjs.org/http-deceiver/-/http-deceiver-1.2.7.tgz", + "integrity": "sha1-+nFolEq5pRnTN8sL7HKE3D5yPYc=", + "dev": true + }, + "node_modules/http-errors": { + "version": "1.7.2", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.7.2.tgz", + "integrity": "sha512-uUQBt3H/cSIVfch6i1EuPNy/YsRSOUBXTVfZ+yR7Zjez3qjBz6i9+i4zjNaoqcoFVI4lQJ5plg63TvGfRSDCRg==", + "dependencies": { + "depd": "~1.1.2", + "inherits": "2.0.3", + "setprototypeof": "1.1.1", + "statuses": ">= 1.5.0 < 2", + "toidentifier": "1.0.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/http-errors/node_modules/inherits": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", + "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=" + }, + "node_modules/http-proxy": { + "version": "1.18.1", + "resolved": "https://registry.npmjs.org/http-proxy/-/http-proxy-1.18.1.tgz", + "integrity": "sha512-7mz/721AbnJwIVbnaSv1Cz3Am0ZLT/UBwkC92VlxhXv/k/BBQfM2fXElQNC27BVGr0uwUpplYPQM9LnaBMR5NQ==", + "dev": true, + "dependencies": { + "eventemitter3": "^4.0.0", + "follow-redirects": "^1.0.0", + "requires-port": "^1.0.0" + }, + "engines": { + "node": ">=8.0.0" + } + }, + "node_modules/http-proxy-middleware": { + "version": "0.19.1", + "resolved": "https://registry.npmjs.org/http-proxy-middleware/-/http-proxy-middleware-0.19.1.tgz", + "integrity": "sha512-yHYTgWMQO8VvwNS22eLLloAkvungsKdKTLO8AJlftYIKNfJr3GK3zK0ZCfzDDGUBttdGc8xFy1mCitvNKQtC3Q==", + "dev": true, + "dependencies": { + "http-proxy": "^1.17.0", + "is-glob": "^4.0.0", + "lodash": "^4.17.11", + "micromatch": "^3.1.10" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/http-signature": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/http-signature/-/http-signature-1.2.0.tgz", + "integrity": "sha1-muzZJRFHcvPZW2WmCruPfBj7rOE=", + "dependencies": { + "assert-plus": "^1.0.0", + "jsprim": "^1.2.2", + "sshpk": "^1.7.0" + }, + "engines": { + "node": ">=0.8", + "npm": ">=1.3.7" + } + }, + "node_modules/https-browserify": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/https-browserify/-/https-browserify-1.0.0.tgz", + "integrity": "sha1-7AbBDgo0wPL68Zn3/X/Hj//QPHM=", + "dev": true + }, + "node_modules/https-proxy-agent": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/https-proxy-agent/-/https-proxy-agent-5.0.0.tgz", + "integrity": "sha512-EkYm5BcKUGiduxzSt3Eppko+PiNWNEpa4ySk9vTC6wDsQJW9rHSa+UhGNJoRYp7bz6Ht1eaRIa6QaJqO5rCFbA==", + "dependencies": { + "agent-base": "6", + "debug": "4" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/https-proxy-agent/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/hyphenate-style-name": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/hyphenate-style-name/-/hyphenate-style-name-1.0.3.tgz", + "integrity": "sha512-EcuixamT82oplpoJ2XU4pDtKGWQ7b00CD9f1ug9IaQ3p1bkHMiKCZ9ut9QDI6qsa6cpUuB+A/I+zLtdNK4n2DQ==" + }, + "node_modules/i": { + "version": "0.3.6", + "resolved": "https://registry.npmjs.org/i/-/i-0.3.6.tgz", + "integrity": "sha1-2WyScyB28HJxG2sQ/X1PZa2O4j0=", + "engines": { + "node": ">=0.4" + } + }, + "node_modules/iconv-lite": { + "version": "0.4.24", + "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", + "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", + "dependencies": { + "safer-buffer": ">= 2.1.2 < 3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/icss-replace-symbols": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/icss-replace-symbols/-/icss-replace-symbols-1.1.0.tgz", + "integrity": "sha1-Bupvg2ead0njhs/h/oEq5dsiPe0=", + "dev": true + }, + "node_modules/icss-utils": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/icss-utils/-/icss-utils-4.1.1.tgz", + "integrity": "sha512-4aFq7wvWyMHKgxsH8QQtGpvbASCf+eM3wPRLI6R+MgAnTCZ6STYsRvttLvRWK0Nfif5piF394St3HeJDaljGPA==", + "dev": true, + "dependencies": { + "postcss": "^7.0.14" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/ieee754": { + "version": "1.1.13", + "resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.1.13.tgz", + "integrity": "sha512-4vf7I2LYV/HaWerSo3XmlMkp5eZ83i+/CDluXi/IGTs/O1sejBNhTtnxzmRZfvOUqj7lZjqHkeTvpgSFDlWZTg==" + }, + "node_modules/iferr": { + "version": "0.1.5", + "resolved": "https://registry.npmjs.org/iferr/-/iferr-0.1.5.tgz", + "integrity": "sha1-xg7taebY/bazEEofy8ocGS3FtQE=", + "dev": true + }, + "node_modules/ignore": { + "version": "3.3.10", + "resolved": "https://registry.npmjs.org/ignore/-/ignore-3.3.10.tgz", + "integrity": "sha512-Pgs951kaMm5GXP7MOvxERINe3gsaVjUWFm+UZPSq9xYriQAksyhg0csnS0KXSNRD5NmNdapXEpjxG49+AKh/ug==", + "dev": true + }, + "node_modules/ignore-by-default": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/ignore-by-default/-/ignore-by-default-1.0.1.tgz", + "integrity": "sha1-SMptcvbGo68Aqa1K5odr44ieKwk=" + }, + "node_modules/ignore-walk": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/ignore-walk/-/ignore-walk-3.0.3.tgz", + "integrity": "sha512-m7o6xuOaT1aqheYHKf8W6J5pYH85ZI9w077erOzLje3JsB1gkafkAhHHY19dqjulgIZHFm32Cp5uNZgcQqdJKw==", + "dependencies": { + "minimatch": "^3.0.4" + } + }, + "node_modules/image-data-uri": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/image-data-uri/-/image-data-uri-2.0.1.tgz", + "integrity": "sha512-BZh721F2Q5TwBdwpiqrBrHEdj8daj8KuMZK/DOCyqQlz1CqFhhuZWbK5ZCUnAvFJr8LaKHTaWl9ja3/a3DC2Ew==", + "dependencies": { + "fs-extra": "^0.26.7", + "magicli": "0.0.8", + "mime-types": "^2.1.18", + "request": "^2.88.0" + }, + "bin": { + "image-data-uri": "bin/magicli.js" + } + }, + "node_modules/image-size": { + "version": "0.7.5", + "resolved": "https://registry.npmjs.org/image-size/-/image-size-0.7.5.tgz", + "integrity": "sha512-Hiyv+mXHfFEP7LzUL/llg9RwFxxY+o9N3JVLIeG5E7iFIFAalxvRU9UZthBdYDEVnzHMgjnKJPPpay5BWf1g9g==", + "bin": { + "image-size": "bin/image-size.js" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/image-size-stream": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/image-size-stream/-/image-size-stream-1.1.0.tgz", + "integrity": "sha1-Ivou2mbG31AQh0bacUkmSy0l+Gs=", + "dependencies": { + "image-size": "github:netroy/image-size#da2c863807a3e9602617bdd357b0de3ab4a064c1", + "readable-stream": "^1.0.33", + "tryit": "^1.0.1" + } + }, + "node_modules/image-size-stream/node_modules/image-size": { + "resolved": "git+ssh://git@github.com/netroy/image-size.git#da2c863807a3e9602617bdd357b0de3ab4a064c1", + "bin": { + "image-size": "bin/image-size" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/image-size-stream/node_modules/isarray": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz", + "integrity": "sha1-ihis/Kmo9Bd+Cav8YDiTmwXR7t8=" + }, + "node_modules/image-size-stream/node_modules/readable-stream": { + "version": "1.1.14", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-1.1.14.tgz", + "integrity": "sha1-fPTFTvZI44EwhMY23SB54WbAgdk=", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.1", + "isarray": "0.0.1", + "string_decoder": "~0.10.x" + } + }, + "node_modules/image-size-stream/node_modules/string_decoder": { + "version": "0.10.31", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-0.10.31.tgz", + "integrity": "sha1-YuIDvEF2bGwoyfyEMB2rHFMQ+pQ=" + }, + "node_modules/immediate": { + "version": "3.0.6", + "resolved": "https://registry.npmjs.org/immediate/-/immediate-3.0.6.tgz", + "integrity": "sha1-nbHb0Pr43m++D13V5Wu2BigN5ps=" + }, + "node_modules/import-fresh": { + "version": "3.2.1", + "resolved": "https://registry.npmjs.org/import-fresh/-/import-fresh-3.2.1.tgz", + "integrity": "sha512-6e1q1cnWP2RXD9/keSkxHScg508CdXqXWgWBaETNhyuBFz+kUZlKboh+ISK+bU++DmbHimVBrOz/zzPe0sZ3sQ==", + "dependencies": { + "parent-module": "^1.0.0", + "resolve-from": "^4.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/import-lazy": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/import-lazy/-/import-lazy-2.1.0.tgz", + "integrity": "sha1-BWmOPUXIjo1+nZLLBYTnfwlvPkM=", + "engines": { + "node": ">=4" + } + }, + "node_modules/import-local": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/import-local/-/import-local-2.0.0.tgz", + "integrity": "sha512-b6s04m3O+s3CGSbqDIyP4R6aAwAeYlVq9+WUWep6iHa8ETRf9yei1U48C5MmfJmV9AiLYYBKPMq/W+/WRpQmCQ==", + "dev": true, + "dependencies": { + "pkg-dir": "^3.0.0", + "resolve-cwd": "^2.0.0" + }, + "bin": { + "import-local-fixture": "fixtures/cli.js" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/import-local/node_modules/pkg-dir": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-3.0.0.tgz", + "integrity": "sha512-/E57AYkoeQ25qkxMj5PBOVgF8Kiu/h7cYS30Z5+R7WaiCCBfLq58ZI/dSeaEKb9WVJV5n/03QwrN3IeWIFllvw==", + "dev": true, + "dependencies": { + "find-up": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/imurmurhash": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz", + "integrity": "sha1-khi5srkoojixPcT7a21XbyMUU+o=", + "engines": { + "node": ">=0.8.19" + } + }, + "node_modules/in-publish": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/in-publish/-/in-publish-2.0.1.tgz", + "integrity": "sha512-oDM0kUSNFC31ShNxHKUyfZKy8ZeXZBWMjMdZHKLOk13uvT27VTL/QzRGfRUcevJhpkZAvlhPYuXkF7eNWrtyxQ==", + "bin": { + "in-install": "in-install.js", + "in-publish": "in-publish.js", + "not-in-install": "not-in-install.js", + "not-in-publish": "not-in-publish.js" + } + }, + "node_modules/indent-string": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-2.1.0.tgz", + "integrity": "sha1-ji1INIdCEhtKghi3oTfppSBJ3IA=", + "dependencies": { + "repeating": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/indexes-of": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/indexes-of/-/indexes-of-1.0.1.tgz", + "integrity": "sha1-8w9xbI4r00bHtn0985FVZqfAVgc=", + "dev": true + }, + "node_modules/indexof": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/indexof/-/indexof-0.0.1.tgz", + "integrity": "sha1-gtwzbSMrkGIXnQWrMpOmYFn9Q10=" + }, + "node_modules/infer-owner": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/infer-owner/-/infer-owner-1.0.4.tgz", + "integrity": "sha512-IClj+Xz94+d7irH5qRyfJonOdfTzuDaifE6ZPWfx0N0+/ATZCbuTPq2prFl526urkQd90WyUKIh1DfBQ2hMz9A==", + "dev": true + }, + "node_modules/inflight": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", + "integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=", + "dependencies": { + "once": "^1.3.0", + "wrappy": "1" + } + }, + "node_modules/infobox-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/infobox-parser/-/infobox-parser-3.3.1.tgz", + "integrity": "sha512-Aj1uF/taawGhet8cazhXz2uEDFMOqH8hnuw720wvi7Zw6bJWmA45Ta2FI9xMG5wvvo4CB6GR9S1/RUFtC6EtAg==", + "dependencies": { + "camelcase": "^4.1.0" + } + }, + "node_modules/infobox-parser/node_modules/camelcase": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz", + "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=", + "engines": { + "node": ">=4" + } + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==" + }, + "node_modules/ini": { + "version": "1.3.5", + "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.5.tgz", + "integrity": "sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==", + "engines": { + "node": "*" + } + }, + "node_modules/inline-style-prefixer": { + "version": "3.0.8", + "resolved": "https://registry.npmjs.org/inline-style-prefixer/-/inline-style-prefixer-3.0.8.tgz", + "integrity": "sha1-hVG45bTVcyROZqNLBPfTIHaitTQ=", + "dependencies": { + "bowser": "^1.7.3", + "css-in-js-utils": "^2.0.0" + } + }, + "node_modules/inspect-function": { + "version": "0.2.2", + "resolved": "https://registry.npmjs.org/inspect-function/-/inspect-function-0.2.2.tgz", + "integrity": "sha1-hdoMUli8TDMK4yg7Z0fgdZ2QpjU=", + "dependencies": { + "split-skip": "0.0.1", + "unpack-string": "0.0.2" + } + }, + "node_modules/inspect-function/node_modules/split-skip": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/split-skip/-/split-skip-0.0.1.tgz", + "integrity": "sha1-gK2ONumOV2RUzDtmfB3SXYZejwA=" + }, + "node_modules/inspect-parameters-declaration": { + "version": "0.0.9", + "resolved": "https://registry.npmjs.org/inspect-parameters-declaration/-/inspect-parameters-declaration-0.0.9.tgz", + "integrity": "sha512-c3jrKKA1rwwrsjdGMAo2hFWV0vNe3/RKHxpE/OBt41LP3ynOVI1qmgxpZYK5SQu3jtWCyaho8L7AZzCjJ4mEUw==", + "dependencies": { + "magicli": "0.0.5", + "split-skip": "0.0.2", + "stringify-parameters": "0.0.4", + "unpack-string": "0.0.2" + }, + "bin": { + "inspect-parameters-declaration": "bin/cli.js" + } + }, + "node_modules/inspect-parameters-declaration/node_modules/magicli": { + "version": "0.0.5", + "resolved": "https://registry.npmjs.org/magicli/-/magicli-0.0.5.tgz", + "integrity": "sha1-zufQ+7THBRiqyxHsPrfiX/SaSSE=", + "dependencies": { + "commander": "^2.9.0", + "get-stdin": "^5.0.1", + "inspect-function": "^0.2.1", + "pipe-functions": "^1.2.0" + } + }, + "node_modules/inspect-property": { + "version": "0.0.6", + "resolved": "https://registry.npmjs.org/inspect-property/-/inspect-property-0.0.6.tgz", + "integrity": "sha512-LgjHkRl9W6bj2n+kWrAOgvCYPTYt+LanE4rtd/vKNq6yEb+SvVV7UTLzoSPpDX6/U1cAz7VfqPr+lPAIz7wHaQ==", + "dependencies": { + "for-each-property": "0.0.4", + "for-each-property-deep": "0.0.3", + "inspect-function": "^0.3.1" + } + }, + "node_modules/inspect-property/node_modules/inspect-function": { + "version": "0.3.4", + "resolved": "https://registry.npmjs.org/inspect-function/-/inspect-function-0.3.4.tgz", + "integrity": "sha512-s0RsbJqK/sNZ+U1mykGoTickog3ea1A9Qk4mXniogOBu4PgkkZ56elScO7QC/r8D94lhGmJ2NyDI1ipOA/uq/g==", + "dependencies": { + "inspect-parameters-declaration": "0.0.8", + "magicli": "0.0.8", + "split-skip": "0.0.1", + "stringify-parameters": "0.0.4", + "unpack-string": "0.0.2" + }, + "bin": { + "inspect-function": "bin/magicli.js" + } + }, + "node_modules/inspect-property/node_modules/inspect-parameters-declaration": { + "version": "0.0.8", + "resolved": "https://registry.npmjs.org/inspect-parameters-declaration/-/inspect-parameters-declaration-0.0.8.tgz", + "integrity": "sha512-W4QzN1LgFmasKOM+NoLlDd2OAZM3enNZlVUOXoGQKmYBDFgxoPDOyebF55ALaf8avyM9TavNwibXxg347RrzCg==", + "dependencies": { + "magicli": "0.0.5", + "split-skip": "0.0.2", + "stringify-parameters": "0.0.4", + "unpack-string": "0.0.2" + }, + "bin": { + "inspect-parameters-declaration": "bin/cli.js" + } + }, + "node_modules/inspect-property/node_modules/inspect-parameters-declaration/node_modules/inspect-function": { + "version": "0.2.2", + "resolved": "https://registry.npmjs.org/inspect-function/-/inspect-function-0.2.2.tgz", + "integrity": "sha1-hdoMUli8TDMK4yg7Z0fgdZ2QpjU=", + "dependencies": { + "split-skip": "0.0.1", + "unpack-string": "0.0.2" + } + }, + "node_modules/inspect-property/node_modules/inspect-parameters-declaration/node_modules/inspect-function/node_modules/split-skip": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/split-skip/-/split-skip-0.0.1.tgz", + "integrity": "sha1-gK2ONumOV2RUzDtmfB3SXYZejwA=" + }, + "node_modules/inspect-property/node_modules/inspect-parameters-declaration/node_modules/magicli": { + "version": "0.0.5", + "resolved": "https://registry.npmjs.org/magicli/-/magicli-0.0.5.tgz", + "integrity": "sha1-zufQ+7THBRiqyxHsPrfiX/SaSSE=", + "dependencies": { + "commander": "^2.9.0", + "get-stdin": "^5.0.1", + "inspect-function": "^0.2.1", + "pipe-functions": "^1.2.0" + } + }, + "node_modules/inspect-property/node_modules/inspect-parameters-declaration/node_modules/split-skip": { + "version": "0.0.2", + "resolved": "https://registry.npmjs.org/split-skip/-/split-skip-0.0.2.tgz", + "integrity": "sha1-2J2Iu9L3Pka1FYqjcKVhIk6A1GE=" + }, + "node_modules/inspect-property/node_modules/split-skip": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/split-skip/-/split-skip-0.0.1.tgz", + "integrity": "sha1-gK2ONumOV2RUzDtmfB3SXYZejwA=" + }, + "node_modules/internal-ip": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/internal-ip/-/internal-ip-4.3.0.tgz", + "integrity": "sha512-S1zBo1D6zcsyuC6PMmY5+55YMILQ9av8lotMx447Bq6SAgo/sDK6y6uUKmuYhW7eacnIhFfsPmCNYdDzsnnDCg==", + "dev": true, + "dependencies": { + "default-gateway": "^4.2.0", + "ipaddr.js": "^1.9.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/internmap": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/internmap/-/internmap-1.0.0.tgz", + "integrity": "sha512-SdoDWwNOTE2n4JWUsLn4KXZGuZPjPF9yyOGc8bnfWnBQh7BD/l80rzSznKc/r4Y0aQ7z3RTk9X+tV4tHBpu+dA==" + }, + "node_modules/interpret": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/interpret/-/interpret-1.2.0.tgz", + "integrity": "sha512-mT34yGKMNceBQUoVn7iCDKDntA7SC6gycMAWzGx1z/CMCTV7b2AAtXlo3nRyHZ1FelRkQbQjprHSYGwzLtkVbw==", + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/interval-arithmetic": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/interval-arithmetic/-/interval-arithmetic-1.0.6.tgz", + "integrity": "sha512-eVotDGYPNiEaJ63oa4CeEHgOczZJ3gNHqG5wfVQ2o8sN2CEczQyR82Sjey/Bp36x8e7PtBcBvitcMnw6VUpjgQ==", + "dependencies": { + "@types/assert": "^1.4.6", + "is-safe-integer": "^2.0.0", + "nextafter": "^1.0.0", + "typedarray": "0.0.6" + } + }, + "node_modules/interval-arithmetic-eval": { + "version": "0.4.7", + "resolved": "https://registry.npmjs.org/interval-arithmetic-eval/-/interval-arithmetic-eval-0.4.7.tgz", + "integrity": "sha512-ClK+N4efbsgjlZR8h0qd0LQbyzUzJ9IkrjmTnD5MVb4Ytebd0lesoVP4AxLclcsEI+nIieskQ8cepHIWUPaRhQ==", + "dependencies": { + "interval-arithmetic": "^1.0.6", + "math-codegen": "^0.3.5" + } + }, + "node_modules/ip": { + "version": "1.1.5", + "resolved": "https://registry.npmjs.org/ip/-/ip-1.1.5.tgz", + "integrity": "sha1-vd7XARQpCCjAoDnnLvJfWq7ENUo=", + "dev": true + }, + "node_modules/ip-regex": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/ip-regex/-/ip-regex-2.1.0.tgz", + "integrity": "sha1-+ni/XS5pE8kRzp+BnuUUa7bYROk=", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/ipaddr.js": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.1.tgz", + "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==", + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/is-absolute-url": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/is-absolute-url/-/is-absolute-url-3.0.3.tgz", + "integrity": "sha512-opmNIX7uFnS96NtPmhWQgQx6/NYFgsUXYMllcfzwWKUMwfo8kku1TvE6hkNcH+Q1ts5cMVrsY7j0bxXQDciu9Q==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/is-accessor-descriptor": { + "version": "0.1.6", + "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz", + "integrity": "sha1-qeEss66Nh2cn7u84Q/igiXtcmNY=", + "dependencies": { + "kind-of": "^3.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-accessor-descriptor/node_modules/is-buffer": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz", + "integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==" + }, + "node_modules/is-accessor-descriptor/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-arguments": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/is-arguments/-/is-arguments-1.0.4.tgz", + "integrity": "sha512-xPh0Rmt8NE65sNzvyUmWgI1tz3mKq74lGA0mL8LYZcoIzKOzDh6HmrYm3d18k60nHerC8A9Km8kYu87zfSFnLA==", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/is-arrayish": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/is-arrayish/-/is-arrayish-0.2.1.tgz", + "integrity": "sha1-d8mYQFJ6qOyxqLppe4BkWnqSap0=" + }, + "node_modules/is-binary-path": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-1.0.1.tgz", + "integrity": "sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=", + "dependencies": { + "binary-extensions": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-buffer": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-2.0.4.tgz", + "integrity": "sha512-Kq1rokWXOPXWuaMAqZiJW4XxsmD9zGx9q4aePabbn3qCRGedtH7Cm+zV8WETitMfu1wdh+Rvd6w5egwSngUX2A==", + "engines": { + "node": ">=4" + } + }, + "node_modules/is-callable": { + "version": "1.1.5", + "resolved": "https://registry.npmjs.org/is-callable/-/is-callable-1.1.5.tgz", + "integrity": "sha512-ESKv5sMCJB2jnHTWZ3O5itG+O128Hsus4K4Qh1h2/cgn2vbgnLSVqfV46AeJA9D5EeeLa9w81KUXMtn34zhX+Q==", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/is-ci": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/is-ci/-/is-ci-1.2.1.tgz", + "integrity": "sha512-s6tfsaQaQi3JNciBH6shVqEDvhGut0SUXr31ag8Pd8BBbVVlcGfWhpPmEOoM6RJ5TFhbypvf5yyRw/VXW1IiWg==", + "dependencies": { + "ci-info": "^1.5.0" + }, + "bin": { + "is-ci": "bin.js" + } + }, + "node_modules/is-data-descriptor": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz", + "integrity": "sha1-C17mSDiOLIYCgueT8YVv7D8wG1Y=", + "dependencies": { + "kind-of": "^3.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-data-descriptor/node_modules/is-buffer": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz", + "integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==" + }, + "node_modules/is-data-descriptor/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-date-object": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-date-object/-/is-date-object-1.0.2.tgz", + "integrity": "sha512-USlDT524woQ08aoZFzh3/Z6ch9Y/EWXEHQ/AaRN0SkKq4t2Jw2R2339tSXmwuVoY7LLlBCbOIlx2myP/L5zk0g==", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/is-descriptor": { + "version": "0.1.6", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.6.tgz", + "integrity": "sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==", + "dependencies": { + "is-accessor-descriptor": "^0.1.6", + "is-data-descriptor": "^0.1.4", + "kind-of": "^5.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-descriptor/node_modules/kind-of": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz", + "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-directory": { + "version": "0.3.1", + "resolved": "https://registry.npmjs.org/is-directory/-/is-directory-0.3.1.tgz", + "integrity": "sha1-YTObbyR1/Hcv2cnYP1yFddwVSuE=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-expression": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-expression/-/is-expression-3.0.0.tgz", + "integrity": "sha1-Oayqa+f9HzRx3ELHQW5hwkMXrJ8=", + "dependencies": { + "acorn": "~4.0.2", + "object-assign": "^4.0.1" + } + }, + "node_modules/is-expression/node_modules/acorn": { + "version": "4.0.13", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-4.0.13.tgz", + "integrity": "sha1-EFSVrlNh1pe9GVyCUZLhrX8lN4c=", + "bin": { + "acorn": "bin/acorn" + }, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/is-extendable": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz", + "integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==", + "dependencies": { + "is-plain-object": "^2.0.4" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-extglob": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", + "integrity": "sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-finite": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-finite/-/is-finite-1.1.0.tgz", + "integrity": "sha512-cdyMtqX/BOqqNBBiKlIVkytNHm49MtMlYyn1zxzvJKWmFMlGzm+ry5BBfYyeY9YmNKbRSo/o7OX9w9ale0wg3w==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-fullwidth-code-point": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz", + "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=", + "engines": { + "node": ">=4" + } + }, + "node_modules/is-glob": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.1.tgz", + "integrity": "sha512-5G0tKtBTFImOqDnLB2hG6Bp2qcKEFduo4tZu9MT/H6NQv/ghhy30o55ufafxJ/LdH79LLs2Kfrn85TLKyA7BUg==", + "dependencies": { + "is-extglob": "^2.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-in-browser": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/is-in-browser/-/is-in-browser-1.1.3.tgz", + "integrity": "sha1-Vv9NtoOgeMYILrldrX3GLh0E+DU=" + }, + "node_modules/is-installed-globally": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/is-installed-globally/-/is-installed-globally-0.1.0.tgz", + "integrity": "sha1-Df2Y9akRFxbdU13aZJL2e/PSWoA=", + "dependencies": { + "global-dirs": "^0.1.0", + "is-path-inside": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/is-npm": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-npm/-/is-npm-1.0.0.tgz", + "integrity": "sha1-8vtjpl5JBbQGyGBydloaTceTufQ=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-number": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz", + "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=", + "dependencies": { + "kind-of": "^3.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-number/node_modules/is-buffer": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz", + "integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==" + }, + "node_modules/is-number/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-obj": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-obj/-/is-obj-1.0.1.tgz", + "integrity": "sha1-PkcprB9f3gJc19g6iW2rn09n2w8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-path-cwd": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/is-path-cwd/-/is-path-cwd-2.2.0.tgz", + "integrity": "sha512-w942bTcih8fdJPJmQHFzkS76NEP8Kzzvmw92cXsazb8intwLqPibPPdXf4ANdKV3rYMuuQYGIWtvz9JilB3NFQ==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/is-path-in-cwd": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-path-in-cwd/-/is-path-in-cwd-2.1.0.tgz", + "integrity": "sha512-rNocXHgipO+rvnP6dk3zI20RpOtrAM/kzbB258Uw5BWr3TpXi861yzjo16Dn4hUox07iw5AyeMLHWsujkjzvRQ==", + "dev": true, + "dependencies": { + "is-path-inside": "^2.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/is-path-in-cwd/node_modules/is-path-inside": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-path-inside/-/is-path-inside-2.1.0.tgz", + "integrity": "sha512-wiyhTzfDWsvwAW53OBWF5zuvaOGlZ6PwYxAbPVDhpm+gM09xKQGjBq/8uYN12aDvMxnAnq3dxTyoSoRNmg5YFg==", + "dev": true, + "dependencies": { + "path-is-inside": "^1.0.2" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/is-path-inside": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-path-inside/-/is-path-inside-1.0.1.tgz", + "integrity": "sha1-jvW33lBDej/cprToZe96pVy0gDY=", + "dependencies": { + "path-is-inside": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-plain-object": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/is-plain-object/-/is-plain-object-2.0.4.tgz", + "integrity": "sha512-h5PpgXkWitc38BBMYawTYMWJHFZJVnBquFE57xFpjB8pJFiF6gZ+bU+WyI/yqXiFR5mdLsgYNaPe8uao6Uv9Og==", + "dependencies": { + "isobject": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-promise": { + "version": "2.2.2", + "resolved": "https://registry.npmjs.org/is-promise/-/is-promise-2.2.2.tgz", + "integrity": "sha512-+lP4/6lKUBfQjZ2pdxThZvLUAafmZb8OAxFb8XXtiQmS35INgr85hdOGoEs124ez1FCnZJt6jau/T+alh58QFQ==" + }, + "node_modules/is-redirect": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-redirect/-/is-redirect-1.0.0.tgz", + "integrity": "sha1-HQPd7VO9jbDzDCbk+V02/HyH3CQ=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-regex": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.0.5.tgz", + "integrity": "sha512-vlKW17SNq44owv5AQR3Cq0bQPEb8+kF3UKZ2fiZNOWtztYE5i0CzCZxFDwO58qAOWtxdBRVO/V5Qin1wjCqFYQ==", + "dependencies": { + "has": "^1.0.3" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/is-retry-allowed": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/is-retry-allowed/-/is-retry-allowed-1.2.0.tgz", + "integrity": "sha512-RUbUeKwvm3XG2VYamhJL1xFktgjvPzL0Hq8C+6yrWIswDy3BIXGqCxhxkc30N9jqK311gVU137K8Ei55/zVJRg==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-safe-integer": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-safe-integer/-/is-safe-integer-2.0.0.tgz", + "integrity": "sha512-eDaA39/1+3SNtYTRP28lRYOHMwiB1gfqXQaXcf/+f4mLwKgm8TTDkwJldsdtbgrK1R5CoDbf6AQ0KqP7BKoGtQ==", + "dependencies": { + "max-safe-integer": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-stream": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-stream/-/is-stream-1.1.0.tgz", + "integrity": "sha1-EtSj3U5o4Lec6428hBc66A2RykQ=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-symbol": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/is-symbol/-/is-symbol-1.0.3.tgz", + "integrity": "sha512-OwijhaRSgqvhm/0ZdAcXNZt9lYdKFpcRDT5ULUuYXPoT794UNOdU+gpT6Rzo7b4V2HUl/op6GqY894AZwv9faQ==", + "dependencies": { + "has-symbols": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/is-typedarray": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-typedarray/-/is-typedarray-1.0.0.tgz", + "integrity": "sha1-5HnICFjfDBsR3dppQPlgEfzaSpo=" + }, + "node_modules/is-utf8": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/is-utf8/-/is-utf8-0.2.1.tgz", + "integrity": "sha1-Sw2hRCEE0bM2NA6AeX6GXPOffXI=" + }, + "node_modules/is-what": { + "version": "3.10.0", + "resolved": "https://registry.npmjs.org/is-what/-/is-what-3.10.0.tgz", + "integrity": "sha512-U4RYCXNOmATQHlOPlOCHCfXyKEFIPqvyaKDqYRuLbD6EYKcTTfc3YXkAYjzOVxO3zt34L+Wh2feIyWrYiZ7kng==" + }, + "node_modules/is-windows": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-windows/-/is-windows-1.0.2.tgz", + "integrity": "sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-wsl": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-1.1.0.tgz", + "integrity": "sha1-HxbkqiKwTRM2tmGIpmrzxgDDpm0=", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/isarray": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz", + "integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=" + }, + "node_modules/isexe": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz", + "integrity": "sha1-6PvzdNxVb/iUehDcsFctYz8s+hA=" + }, + "node_modules/isobject": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/isobject/-/isobject-3.0.1.tgz", + "integrity": "sha1-TkMekrEalzFjaqH5yNHMvP2reN8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/isomorphic-fetch": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/isomorphic-fetch/-/isomorphic-fetch-2.2.1.tgz", + "integrity": "sha1-YRrhrPFPXoH3KVB0coGf6XM1WKk=", + "dependencies": { + "node-fetch": "^1.0.1", + "whatwg-fetch": ">=0.10.0" + } + }, + "node_modules/isstream": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/isstream/-/isstream-0.1.2.tgz", + "integrity": "sha1-R+Y/evVa+m+S4VAOaQ64uFKcCZo=" + }, + "node_modules/its-set": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/its-set/-/its-set-1.2.3.tgz", + "integrity": "sha512-UQc+xLLn+0a8KKRXRj3OS2kERK8G7zcayPpPULqZnPwuJ1hGWEO8+j0T5eycu7DKXYjezw3pyF8oV1fJkJxV5w==", + "dependencies": { + "babel-runtime": "6.x.x", + "lodash.get": "^4.4.2" + } + }, + "node_modules/jquery": { + "version": "3.5.1", + "resolved": "https://registry.npmjs.org/jquery/-/jquery-3.5.1.tgz", + "integrity": "sha512-XwIBPqcMn57FxfT+Go5pzySnm4KWkT1Tv7gjrpT1srtf8Weynl6R273VJ5GjkRb51IzMp5nbaPjJXMWeju2MKg==" + }, + "node_modules/js-base64": { + "version": "2.5.2", + "resolved": "https://registry.npmjs.org/js-base64/-/js-base64-2.5.2.tgz", + "integrity": "sha512-Vg8czh0Q7sFBSUMWWArX/miJeBWYBPpdU/3M/DKSaekLMqrqVPaedp+5mZhie/r0lgrcaYBfwXatEew6gwgiQQ==" + }, + "node_modules/js-datepicker": { + "version": "4.6.6", + "resolved": "https://registry.npmjs.org/js-datepicker/-/js-datepicker-4.6.6.tgz", + "integrity": "sha512-kLsE2oHfQM6pzdWNA7Y8HwCHaZIVURItPds7YVJnbe1z1OmQFzN7lfg6yFbDDWOyNjdHZGzWDy3jSDN2W0pNZQ==" + }, + "node_modules/js-stringify": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/js-stringify/-/js-stringify-1.0.2.tgz", + "integrity": "sha1-Fzb939lyTyijaCrcYjCufk6Weds=" + }, + "node_modules/js-tokens": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", + "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==" + }, + "node_modules/js-yaml": { + "version": "3.13.1", + "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-3.13.1.tgz", + "integrity": "sha512-YfbcO7jXDdyj0DGxYVSlSeQNHbD7XPWvrVWeVUujrQEoZzWJIRrCPoyk6kL6IAjAG2IolMK4T0hNUe0HOUs5Jw==", + "dependencies": { + "argparse": "^1.0.7", + "esprima": "^4.0.0" + }, + "bin": { + "js-yaml": "bin/js-yaml.js" + } + }, + "node_modules/jsbn": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/jsbn/-/jsbn-0.1.1.tgz", + "integrity": "sha1-peZUwuWi3rXyAdls77yoDA7y9RM=" + }, + "node_modules/jsdom": { + "version": "15.2.1", + "resolved": "https://registry.npmjs.org/jsdom/-/jsdom-15.2.1.tgz", + "integrity": "sha512-fAl1W0/7T2G5vURSyxBzrJ1LSdQn6Tr5UX/xD4PXDx/PDgwygedfW6El/KIj3xJ7FU61TTYnc/l/B7P49Eqt6g==", + "dev": true, + "dependencies": { + "abab": "^2.0.0", + "acorn": "^7.1.0", + "acorn-globals": "^4.3.2", + "array-equal": "^1.0.0", + "cssom": "^0.4.1", + "cssstyle": "^2.0.0", + "data-urls": "^1.1.0", + "domexception": "^1.0.1", + "escodegen": "^1.11.1", + "html-encoding-sniffer": "^1.0.2", + "nwsapi": "^2.2.0", + "parse5": "5.1.0", + "pn": "^1.1.0", + "request": "^2.88.0", + "request-promise-native": "^1.0.7", + "saxes": "^3.1.9", + "symbol-tree": "^3.2.2", + "tough-cookie": "^3.0.1", + "w3c-hr-time": "^1.0.1", + "w3c-xmlserializer": "^1.1.2", + "webidl-conversions": "^4.0.2", + "whatwg-encoding": "^1.0.5", + "whatwg-mimetype": "^2.3.0", + "whatwg-url": "^7.0.0", + "ws": "^7.0.0", + "xml-name-validator": "^3.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/jsdom/node_modules/acorn": { + "version": "7.1.1", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-7.1.1.tgz", + "integrity": "sha512-add7dgA5ppRPxCFJoAGfMDi7PIBXq1RtGo7BhbLaxwrXPOmw8gq48Y9ozT01hUKy9byMjlR20EJhu5zlkErEkg==", + "dev": true, + "bin": { + "acorn": "bin/acorn" + }, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/jsdom/node_modules/acorn-globals": { + "version": "4.3.4", + "resolved": "https://registry.npmjs.org/acorn-globals/-/acorn-globals-4.3.4.tgz", + "integrity": "sha512-clfQEh21R+D0leSbUdWf3OcfqyaCSAQ8Ryq00bofSekfr9W8u1jyYZo6ir0xu9Gtcf7BjcHJpnbZH7JOCpP60A==", + "dev": true, + "dependencies": { + "acorn": "^6.0.1", + "acorn-walk": "^6.0.1" + } + }, + "node_modules/jsdom/node_modules/acorn-globals/node_modules/acorn": { + "version": "6.4.1", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-6.4.1.tgz", + "integrity": "sha512-ZVA9k326Nwrj3Cj9jlh3wGFutC2ZornPNARZwsNYqQYgN0EsV2d53w5RN/co65Ohn4sUAUtb1rSUAOD6XN9idA==", + "dev": true, + "bin": { + "acorn": "bin/acorn" + }, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/jsdom/node_modules/parse5": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/parse5/-/parse5-5.1.0.tgz", + "integrity": "sha512-fxNG2sQjHvlVAYmzBZS9YlDp6PTSSDwa98vkD4QgVDDCAo84z5X1t5XyJQ62ImdLXx5NdIIfihey6xpum9/gRQ==", + "dev": true + }, + "node_modules/jsdom/node_modules/tough-cookie": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/tough-cookie/-/tough-cookie-3.0.1.tgz", + "integrity": "sha512-yQyJ0u4pZsv9D4clxO69OEjLWYw+jbgspjTue4lTQZLfV0c5l1VmK2y1JK8E9ahdpltPOaAThPcp5nKPUgSnsg==", + "dev": true, + "dependencies": { + "ip-regex": "^2.1.0", + "psl": "^1.1.28", + "punycode": "^2.1.1" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/jsesc": { + "version": "2.5.2", + "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz", + "integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==", + "bin": { + "jsesc": "bin/jsesc" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/json-bigint": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/json-bigint/-/json-bigint-0.3.0.tgz", + "integrity": "sha1-DM2RLEuCcNBfBW+9E4FLU9OCWx4=", + "dependencies": { + "bignumber.js": "^7.0.0" + } + }, + "node_modules/json-parse-better-errors": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/json-parse-better-errors/-/json-parse-better-errors-1.0.2.tgz", + "integrity": "sha512-mrqyZKfX5EhL7hvqcV6WG1yYjnjeuYDzDhhcAAUrq8Po85NBQBJP+ZDUT75qZQ98IkUoBqdkExkukOU7Ts2wrw==" + }, + "node_modules/json-schema": { + "version": "0.2.3", + "resolved": "https://registry.npmjs.org/json-schema/-/json-schema-0.2.3.tgz", + "integrity": "sha1-tIDIkuWaLwWVTOcnvT8qTogvnhM=" + }, + "node_modules/json-schema-traverse": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz", + "integrity": "sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==" + }, + "node_modules/json-stringify-safe": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/json-stringify-safe/-/json-stringify-safe-5.0.1.tgz", + "integrity": "sha1-Epai1Y/UXxmg9s4B1lcB4sc1tus=" + }, + "node_modules/json3": { + "version": "3.3.3", + "resolved": "https://registry.npmjs.org/json3/-/json3-3.3.3.tgz", + "integrity": "sha512-c7/8mbUsKigAbLkD5B010BK4D9LZm7A1pNItkEwiUZRpIN66exu/e7YQWysGun+TRKaJp8MhemM+VkfWv42aCA==", + "dev": true + }, + "node_modules/jsondiffpatch": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/jsondiffpatch/-/jsondiffpatch-0.4.1.tgz", + "integrity": "sha512-t0etAxTUk1w5MYdNOkZBZ8rvYYN5iL+2dHCCx/DpkFm/bW28M6y5nUS83D4XdZiHy35Fpaw6LBb+F88fHZnVCw==", + "dependencies": { + "chalk": "^2.3.0", + "diff-match-patch": "^1.0.0" + }, + "bin": { + "jsondiffpatch": "bin/jsondiffpatch" + }, + "engines": { + "node": ">=8.17.0" + } + }, + "node_modules/jsonfile": { + "version": "2.4.0", + "resolved": "https://registry.npmjs.org/jsonfile/-/jsonfile-2.4.0.tgz", + "integrity": "sha1-NzaitCi4e72gzIO1P6PWM6NcKug=", + "dependencies": { + "graceful-fs": "^4.1.6" + } + }, + "node_modules/jsonschema": { + "version": "1.2.6", + "resolved": "https://registry.npmjs.org/jsonschema/-/jsonschema-1.2.6.tgz", + "integrity": "sha512-SqhURKZG07JyKKeo/ir24QnS4/BV7a6gQy93bUSe4lUdNp0QNpIz2c9elWJQ9dpc5cQYY6cvCzgRwy0MQCLyqA==", + "engines": { + "node": "*" + } + }, + "node_modules/jsprim": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/jsprim/-/jsprim-1.4.1.tgz", + "integrity": "sha1-MT5mvB5cwG5Di8G3SZwuXFastqI=", + "engines": [ + "node >=0.6.0" + ], + "dependencies": { + "assert-plus": "1.0.0", + "extsprintf": "1.3.0", + "json-schema": "0.2.3", + "verror": "1.10.0" + } + }, + "node_modules/jss": { + "version": "10.3.0", + "resolved": "https://registry.npmjs.org/jss/-/jss-10.3.0.tgz", + "integrity": "sha512-B5sTRW9B6uHaUVzSo9YiMEOEp3UX8lWevU0Fsv+xtRnsShmgCfIYX44bTH8bPJe6LQKqEXku3ulKuHLbxBS97Q==", + "dependencies": { + "@babel/runtime": "^7.3.1", + "csstype": "^2.6.5", + "is-in-browser": "^1.1.3", + "tiny-warning": "^1.0.2" + } + }, + "node_modules/jss-plugin-camel-case": { + "version": "10.3.0", + "resolved": "https://registry.npmjs.org/jss-plugin-camel-case/-/jss-plugin-camel-case-10.3.0.tgz", + "integrity": "sha512-tadWRi/SLWqLK3EUZEdDNJL71F3ST93Zrl9JYMjV0QDqKPAl0Liue81q7m/nFUpnSTXczbKDy4wq8rI8o7WFqA==", + "dependencies": { + "@babel/runtime": "^7.3.1", + "hyphenate-style-name": "^1.0.3", + "jss": "^10.3.0" + } + }, + "node_modules/jss-plugin-default-unit": { + "version": "10.3.0", + "resolved": "https://registry.npmjs.org/jss-plugin-default-unit/-/jss-plugin-default-unit-10.3.0.tgz", + "integrity": "sha512-tT5KkIXAsZOSS9WDSe8m8lEHIjoEOj4Pr0WrG0WZZsMXZ1mVLFCSsD2jdWarQWDaRNyMj/I4d7czRRObhOxSuw==", + "dependencies": { + "@babel/runtime": "^7.3.1", + "jss": "^10.3.0" + } + }, + "node_modules/jss-plugin-global": { + "version": "10.3.0", + "resolved": "https://registry.npmjs.org/jss-plugin-global/-/jss-plugin-global-10.3.0.tgz", + "integrity": "sha512-etYTG/y3qIR/vxZnKY+J3wXwObyBDNhBiB3l/EW9/pE3WHE//BZdK8LFvQcrCO48sZW1Z6paHo6klxUPP7WbzA==", + "dependencies": { + "@babel/runtime": "^7.3.1", + "jss": "^10.3.0" + } + }, + "node_modules/jss-plugin-nested": { + "version": "10.3.0", + "resolved": "https://registry.npmjs.org/jss-plugin-nested/-/jss-plugin-nested-10.3.0.tgz", + "integrity": "sha512-qWiEkoXNEkkZ+FZrWmUGpf+zBsnEOmKXhkjNX85/ZfWhH9dfGxUCKuJFuOWFM+rjQfxV4csfesq4hY0jk8Qt0w==", + "dependencies": { + "@babel/runtime": "^7.3.1", + "jss": "^10.3.0", + "tiny-warning": "^1.0.2" + } + }, + "node_modules/jss-plugin-props-sort": { + "version": "10.3.0", + "resolved": "https://registry.npmjs.org/jss-plugin-props-sort/-/jss-plugin-props-sort-10.3.0.tgz", + "integrity": "sha512-boetORqL/lfd7BWeFD3K+IyPqyIC+l3CRrdZr+NPq7Noqp+xyg/0MR7QisgzpxCEulk+j2CRcEUoZsvgPC4nTg==", + "dependencies": { + "@babel/runtime": "^7.3.1", + "jss": "^10.3.0" + } + }, + "node_modules/jss-plugin-rule-value-function": { + "version": "10.3.0", + "resolved": "https://registry.npmjs.org/jss-plugin-rule-value-function/-/jss-plugin-rule-value-function-10.3.0.tgz", + "integrity": "sha512-7WiMrKIHH3rwxTuJki9+7nY11r1UXqaUZRhHvqTD4/ZE+SVhvtD5Tx21ivNxotwUSleucA/8boX+NF21oXzr5Q==", + "dependencies": { + "@babel/runtime": "^7.3.1", + "jss": "^10.3.0", + "tiny-warning": "^1.0.2" + } + }, + "node_modules/jss-plugin-vendor-prefixer": { + "version": "10.3.0", + "resolved": "https://registry.npmjs.org/jss-plugin-vendor-prefixer/-/jss-plugin-vendor-prefixer-10.3.0.tgz", + "integrity": "sha512-sZQbrcZyP5V0ADjCLwUA1spVWoaZvM7XZ+2fSeieZFBj31cRsnV7X70FFDerMHeiHAXKWzYek+67nMDjhrZAVQ==", + "dependencies": { + "@babel/runtime": "^7.3.1", + "css-vendor": "^2.0.8", + "jss": "^10.3.0" + } + }, + "node_modules/jstransformer": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/jstransformer/-/jstransformer-1.0.0.tgz", + "integrity": "sha1-7Yvwkh4vPx7U1cGkT2hwntJHIsM=", + "dependencies": { + "is-promise": "^2.0.0", + "promise": "^7.0.1" + } + }, + "node_modules/jszip": { + "version": "3.5.0", + "resolved": "https://registry.npmjs.org/jszip/-/jszip-3.5.0.tgz", + "integrity": "sha512-WRtu7TPCmYePR1nazfrtuF216cIVon/3GWOvHS9QR5bIwSbnxtdpma6un3jyGGNhHsKCSzn5Ypk+EkDRvTGiFA==", + "dependencies": { + "lie": "~3.3.0", + "pako": "~1.0.2", + "readable-stream": "~2.3.6", + "set-immediate-shim": "~1.0.1" + } + }, + "node_modules/jszip/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/jwa": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/jwa/-/jwa-1.4.1.tgz", + "integrity": "sha512-qiLX/xhEEFKUAJ6FiBMbes3w9ATzyk5W7Hvzpa/SLYdxNtng+gcurvrI7TbACjIXlsJyr05/S1oUhZrc63evQA==", + "dependencies": { + "buffer-equal-constant-time": "1.0.1", + "ecdsa-sig-formatter": "1.0.11", + "safe-buffer": "^5.0.1" + } + }, + "node_modules/jws": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/jws/-/jws-3.2.2.tgz", + "integrity": "sha512-YHlZCB6lMTllWDtSPHz/ZXTsi8S00usEV6v1tjq8tOUZzw7DpSDWVXjXDre6ed1w/pd495ODpHZYSdkRTsa0HA==", + "dependencies": { + "jwa": "^1.4.1", + "safe-buffer": "^5.0.1" + } + }, + "node_modules/kareem": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/kareem/-/kareem-2.3.1.tgz", + "integrity": "sha512-l3hLhffs9zqoDe8zjmb/mAN4B8VT3L56EUvKNqLFVs9YlFA+zx7ke1DO8STAdDyYNkeSo1nKmjuvQeI12So8Xw==" + }, + "node_modules/keycode": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/keycode/-/keycode-2.2.0.tgz", + "integrity": "sha1-PQr1bce4uOXLqNCpfxByBO7CKwQ=" + }, + "node_modules/keygrip": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/keygrip/-/keygrip-1.1.0.tgz", + "integrity": "sha512-iYSchDJ+liQ8iwbSI2QqsQOvqv58eJCEanyJPJi+Khyu8smkcKSFUCbPwzFcL7YVtZ6eONjqRX/38caJ7QjRAQ==", + "dependencies": { + "tsscmp": "1.0.6" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/killable": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/killable/-/killable-1.0.1.tgz", + "integrity": "sha512-LzqtLKlUwirEUyl/nicirVmNiPvYs7l5n8wOPP7fyJVpUPkvCnW/vuiXGpylGUlnPDnB7311rARzAt3Mhswpjg==", + "dev": true + }, + "node_modules/kind-of": { + "version": "6.0.3", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-6.0.3.tgz", + "integrity": "sha512-dcS1ul+9tmeD95T+x28/ehLgd9mENa3LsvDTtzm3vyBEO7RPptvAD+t44WVXaUjTBRcrpFeFlC8WCruUR456hw==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/klaw": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/klaw/-/klaw-1.3.1.tgz", + "integrity": "sha1-QIhDO0azsbolnXh4XY6W9zugJDk=", + "dependencies": { + "graceful-fs": "^4.1.9" + } + }, + "node_modules/latest-version": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/latest-version/-/latest-version-3.1.0.tgz", + "integrity": "sha1-ogU4P+oyKzO1rjsYq+4NwvNW7hU=", + "dependencies": { + "package-json": "^4.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/lazy-cache": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/lazy-cache/-/lazy-cache-1.0.4.tgz", + "integrity": "sha1-odePw6UEdMuAhF07O24dpJpEbo4=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/lazystream": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/lazystream/-/lazystream-1.0.0.tgz", + "integrity": "sha1-9plf4PggOS9hOWvolGJAe7dxaOQ=", + "dependencies": { + "readable-stream": "^2.0.5" + }, + "engines": { + "node": ">= 0.6.3" + } + }, + "node_modules/lazystream/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/levn": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/levn/-/levn-0.3.0.tgz", + "integrity": "sha1-OwmSTt+fCDwEkP3UwLxEIeBHZO4=", + "dev": true, + "dependencies": { + "prelude-ls": "~1.1.2", + "type-check": "~0.3.2" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/libxmljs": { + "version": "0.19.7", + "resolved": "https://registry.npmjs.org/libxmljs/-/libxmljs-0.19.7.tgz", + "integrity": "sha512-lFJyG9T1mVwTzNTw6ZkvIt0O+NsIR+FTE+RcC2QDFGU8YMnQrnyEOGrj6HWSe1AdwQK7s37BOp4NL+pcAqfK2g==", + "hasInstallScript": true, + "dependencies": { + "bindings": "~1.3.0", + "nan": "~2.14.0", + "node-pre-gyp": "~0.11.0" + }, + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/libxmljs/node_modules/node-pre-gyp": { + "version": "0.11.0", + "resolved": "https://registry.npmjs.org/node-pre-gyp/-/node-pre-gyp-0.11.0.tgz", + "integrity": "sha512-TwWAOZb0j7e9eGaf9esRx3ZcLaE5tQ2lvYy1pb5IAaG1a2e2Kv5Lms1Y4hpj+ciXJRofIxxlt5haeQ/2ANeE0Q==", + "dependencies": { + "detect-libc": "^1.0.2", + "mkdirp": "^0.5.1", + "needle": "^2.2.1", + "nopt": "^4.0.1", + "npm-packlist": "^1.1.6", + "npmlog": "^4.0.2", + "rc": "^1.2.7", + "rimraf": "^2.6.1", + "semver": "^5.3.0", + "tar": "^4" + }, + "bin": { + "node-pre-gyp": "bin/node-pre-gyp" + } + }, + "node_modules/libxmljs/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/lie": { + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/lie/-/lie-3.3.0.tgz", + "integrity": "sha512-UaiMJzeWRlEujzAuw5LokY1L5ecNQYZKfmyZ9L7wDHb/p5etKaxXhohBcrw0EYby+G/NA52vRSN4N39dxHAIwQ==", + "dependencies": { + "immediate": "~3.0.5" + } + }, + "node_modules/lines-and-columns": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/lines-and-columns/-/lines-and-columns-1.1.6.tgz", + "integrity": "sha1-HADHQ7QzzQpOgHWPe2SldEDZ/wA=" + }, + "node_modules/load-json-file": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-1.1.0.tgz", + "integrity": "sha1-lWkFcI1YtLq0wiYbBPWfMcmTdMA=", + "dependencies": { + "graceful-fs": "^4.1.2", + "parse-json": "^2.2.0", + "pify": "^2.0.0", + "pinkie-promise": "^2.0.0", + "strip-bom": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/load-json-file/node_modules/parse-json": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-2.2.0.tgz", + "integrity": "sha1-9ID0BDTvgHQfhGkJn43qGPVaTck=", + "dependencies": { + "error-ex": "^1.2.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/load-json-file/node_modules/pify": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz", + "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/loader-runner": { + "version": "2.4.0", + "resolved": "https://registry.npmjs.org/loader-runner/-/loader-runner-2.4.0.tgz", + "integrity": "sha512-Jsmr89RcXGIwivFY21FcRrisYZfvLMTWx5kOLc+JTxtpBOG6xML0vzbc6SEQG2FO9/4Fc3wW4LVcB5DmGflaRw==", + "dev": true, + "engines": { + "node": ">=4.3.0 <5.0.0 || >=5.10" + } + }, + "node_modules/loader-utils": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.4.0.tgz", + "integrity": "sha512-qH0WSMBtn/oHuwjy/NucEgbx5dbxxnxup9s4PVXJUDHZBQY+s0NWA9rJf53RBnQZxfch7euUui7hpoAPvALZdA==", + "dependencies": { + "big.js": "^5.2.2", + "emojis-list": "^3.0.0", + "json5": "^1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/loader-utils/node_modules/json5": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", + "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", + "dependencies": { + "minimist": "^1.2.0" + }, + "bin": { + "json5": "lib/cli.js" + } + }, + "node_modules/locate-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz", + "integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==", + "dependencies": { + "p-locate": "^3.0.0", + "path-exists": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/lodash": { + "version": "4.17.15", + "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.15.tgz", + "integrity": "sha512-8xOcRHvCjnocdS5cpwXQXVzmmh5e5+saE2QGoeQmbKmRS6J3VQppPOIt0MnmE+4xlZoumy0GPG0D0MVIQbNA1A==" + }, + "node_modules/lodash._getnative": { + "version": "3.9.1", + "resolved": "https://registry.npmjs.org/lodash._getnative/-/lodash._getnative-3.9.1.tgz", + "integrity": "sha1-VwvH3t5G1hzc3mh9ZdPuy6o6r/U=" + }, + "node_modules/lodash.chunk": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/lodash.chunk/-/lodash.chunk-4.2.0.tgz", + "integrity": "sha1-ZuXOH3btJ7QwPYxlEujRIW6BBrw=" + }, + "node_modules/lodash.curry": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/lodash.curry/-/lodash.curry-4.1.1.tgz", + "integrity": "sha1-JI42By7ekGUB11lmIAqG2riyMXA=" + }, + "node_modules/lodash.debounce": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/lodash.debounce/-/lodash.debounce-3.1.1.tgz", + "integrity": "sha1-gSIRw3ipTMKdWqTjNGzwv846ffU=", + "dependencies": { + "lodash._getnative": "^3.0.0" + } + }, + "node_modules/lodash.defaults": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/lodash.defaults/-/lodash.defaults-4.2.0.tgz", + "integrity": "sha1-0JF4cW/+pN3p5ft7N/bwgCJ0WAw=" + }, + "node_modules/lodash.difference": { + "version": "4.5.0", + "resolved": "https://registry.npmjs.org/lodash.difference/-/lodash.difference-4.5.0.tgz", + "integrity": "sha1-nMtOUF1Ia5FlE0V3KIWi3yf9AXw=" + }, + "node_modules/lodash.flatten": { + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/lodash.flatten/-/lodash.flatten-4.4.0.tgz", + "integrity": "sha1-8xwiIlqWMtK7+OSt2+8kCqdlph8=" + }, + "node_modules/lodash.flow": { + "version": "3.5.0", + "resolved": "https://registry.npmjs.org/lodash.flow/-/lodash.flow-3.5.0.tgz", + "integrity": "sha1-h79AKSuM+D5OjOGjrkIJ4gBxZ1o=" + }, + "node_modules/lodash.get": { + "version": "4.4.2", + "resolved": "https://registry.npmjs.org/lodash.get/-/lodash.get-4.4.2.tgz", + "integrity": "sha1-LRd/ZS+jHpObRDjVNBSZ36OCXpk=" + }, + "node_modules/lodash.isequal": { + "version": "4.5.0", + "resolved": "https://registry.npmjs.org/lodash.isequal/-/lodash.isequal-4.5.0.tgz", + "integrity": "sha1-QVxEePK8wwEgwizhDtMib30+GOA=" + }, + "node_modules/lodash.isplainobject": { + "version": "4.0.6", + "resolved": "https://registry.npmjs.org/lodash.isplainobject/-/lodash.isplainobject-4.0.6.tgz", + "integrity": "sha1-fFJqUtibRcRcxpC4gWO+BJf1UMs=" + }, + "node_modules/lodash.memoize": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/lodash.memoize/-/lodash.memoize-4.1.2.tgz", + "integrity": "sha1-vMbEmkKihA7Zl/Mj6tpezRguC/4=" + }, + "node_modules/lodash.merge": { + "version": "4.6.2", + "resolved": "https://registry.npmjs.org/lodash.merge/-/lodash.merge-4.6.2.tgz", + "integrity": "sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==" + }, + "node_modules/lodash.padend": { + "version": "4.6.1", + "resolved": "https://registry.npmjs.org/lodash.padend/-/lodash.padend-4.6.1.tgz", + "integrity": "sha1-U8y6BH0G4VjTEfRdpiX05J5vFm4=" + }, + "node_modules/lodash.sortby": { + "version": "4.7.0", + "resolved": "https://registry.npmjs.org/lodash.sortby/-/lodash.sortby-4.7.0.tgz", + "integrity": "sha1-7dFMgk4sycHgsKG0K7UhBRakJDg=", + "dev": true + }, + "node_modules/lodash.throttle": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/lodash.throttle/-/lodash.throttle-4.1.1.tgz", + "integrity": "sha1-wj6RtxAkKscMN/HhzaknTMOb8vQ=" + }, + "node_modules/lodash.union": { + "version": "4.6.0", + "resolved": "https://registry.npmjs.org/lodash.union/-/lodash.union-4.6.0.tgz", + "integrity": "sha1-SLtQiECfFvGCFmZkHETdGqrjzYg=" + }, + "node_modules/log-symbols": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/log-symbols/-/log-symbols-2.2.0.tgz", + "integrity": "sha512-VeIAFslyIerEJLXHziedo2basKbMKtTw3vfn5IzG0XTjhAVEJyNHnL2p7vc+wBDSdQuUpNw3M2u6xb9QsAY5Eg==", + "dependencies": { + "chalk": "^2.0.1" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/loglevel": { + "version": "1.6.8", + "resolved": "https://registry.npmjs.org/loglevel/-/loglevel-1.6.8.tgz", + "integrity": "sha512-bsU7+gc9AJ2SqpzxwU3+1fedl8zAntbtC5XYlt3s2j1hJcn2PsXSmgN8TaLG/J1/2mod4+cE/3vNL70/c1RNCA==", + "dev": true, + "engines": { + "node": ">= 0.6.0" + } + }, + "node_modules/loglevelnext": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/loglevelnext/-/loglevelnext-1.0.5.tgz", + "integrity": "sha512-V/73qkPuJmx4BcBF19xPBr+0ZRVBhc4POxvZTZdMeXpJ4NItXSJ/MSwuFT0kQJlCbXvdlZoQQ/418bS1y9Jh6A==", + "dev": true, + "dependencies": { + "es6-symbol": "^3.1.1", + "object.assign": "^4.1.0" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/longest": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/longest/-/longest-1.0.1.tgz", + "integrity": "sha1-MKCy2jj3N3DoKUoNIuZiXtd9AJc=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/loose-envify": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz", + "integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==", + "dependencies": { + "js-tokens": "^3.0.0 || ^4.0.0" + }, + "bin": { + "loose-envify": "cli.js" + } + }, + "node_modules/loud-rejection": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/loud-rejection/-/loud-rejection-1.6.0.tgz", + "integrity": "sha1-W0b4AUft7leIcPCG0Eghz5mOVR8=", + "dependencies": { + "currently-unhandled": "^0.4.1", + "signal-exit": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/lowercase-keys": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/lowercase-keys/-/lowercase-keys-1.0.1.tgz", + "integrity": "sha512-G2Lj61tXDnVFFOi8VZds+SoQjtQC3dgokKdDG2mTm1tx4m50NUHBOZSBwQQHyy0V12A0JTG4icfZQH+xPyh8VA==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/lru-cache": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz", + "integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==", + "dependencies": { + "yallist": "^3.0.2" + } + }, + "node_modules/magicli": { + "version": "0.0.8", + "resolved": "https://registry.npmjs.org/magicli/-/magicli-0.0.8.tgz", + "integrity": "sha512-x/eBenweAHF+DsYy172sK4doRxZl0yrJnfxhLJiN7H6hPM3Ya0PfI6uBZshZ3ScFFSQD7HXgBqMdbnXKEZsO1g==", + "dependencies": { + "cliss": "0.0.2", + "find-up": "^2.1.0", + "for-each-property": "0.0.4", + "inspect-property": "0.0.6" + } + }, + "node_modules/magicli/node_modules/find-up": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-2.1.0.tgz", + "integrity": "sha1-RdG35QbHF93UgndaK3eSCjwMV6c=", + "dependencies": { + "locate-path": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/magicli/node_modules/locate-path": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-2.0.0.tgz", + "integrity": "sha1-K1aLJl7slExtnA3pw9u7ygNUzY4=", + "dependencies": { + "p-locate": "^2.0.0", + "path-exists": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/magicli/node_modules/p-limit": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-1.3.0.tgz", + "integrity": "sha512-vvcXsLAJ9Dr5rQOPk7toZQZJApBl2K4J6dANSsEuh6QI41JYcsS/qhTGa9ErIUUgK3WNQoJYvylxvjqmiqEA9Q==", + "dependencies": { + "p-try": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/magicli/node_modules/p-locate": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-2.0.0.tgz", + "integrity": "sha1-IKAQOyIqcMj9OcwuWAaA893l7EM=", + "dependencies": { + "p-limit": "^1.1.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/magicli/node_modules/p-try": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/p-try/-/p-try-1.0.0.tgz", + "integrity": "sha1-y8ec26+P1CKOE/Yh8rGiN8GyB7M=", + "engines": { + "node": ">=4" + } + }, + "node_modules/make-dir": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-1.3.0.tgz", + "integrity": "sha512-2w31R7SJtieJJnQtGc7RVL2StM2vGYVfqUOvUDxH6bC6aJTxPxTF0GnIgCyu7tjockiUWAYQRbxa7vKn34s5sQ==", + "dependencies": { + "pify": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/make-dir/node_modules/pify": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz", + "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=", + "engines": { + "node": ">=4" + } + }, + "node_modules/make-error": { + "version": "1.3.6", + "resolved": "https://registry.npmjs.org/make-error/-/make-error-1.3.6.tgz", + "integrity": "sha512-s8UhlNe7vPKomQhC1qFelMokr/Sc3AgNbso3n74mVPA5LTZwkB9NlXf4XPamLxJE8h0gh73rM94xvwRT2CVInw==", + "dev": true + }, + "node_modules/map-cache": { + "version": "0.2.2", + "resolved": "https://registry.npmjs.org/map-cache/-/map-cache-0.2.2.tgz", + "integrity": "sha1-wyq9C9ZSXZsFFkW7TyasXcmKDb8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/map-obj": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-1.0.1.tgz", + "integrity": "sha1-2TPOuSBdgr3PSIb2dCvcK03qFG0=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/map-visit": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/map-visit/-/map-visit-1.0.0.tgz", + "integrity": "sha1-7Nyo8TFE5mDxtb1B8S80edmN+48=", + "dependencies": { + "object-visit": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/material-colors": { + "version": "1.2.6", + "resolved": "https://registry.npmjs.org/material-colors/-/material-colors-1.2.6.tgz", + "integrity": "sha512-6qE4B9deFBIa9YSpOc9O0Sgc43zTeVYbgDT5veRKSlB2+ZuHNoVVxA1L/ckMUayV9Ay9y7Z/SZCLcGteW9i7bg==" + }, + "node_modules/material-ui": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/material-ui/-/material-ui-0.20.2.tgz", + "integrity": "sha512-VeqgQkdvtK193w+FFvXDEwlVxI4rWk83eWbpYLeOIHDPWr3rbB9B075JRnJt/8IsI2X8q5Aia5W3+7m4KkleDg==", + "dependencies": { + "babel-runtime": "^6.23.0", + "inline-style-prefixer": "^3.0.8", + "keycode": "^2.1.8", + "lodash.merge": "^4.6.0", + "lodash.throttle": "^4.1.1", + "prop-types": "^15.5.7", + "react-event-listener": "^0.6.2", + "react-transition-group": "^1.2.1", + "recompose": "^0.26.0", + "simple-assign": "^0.1.0", + "warning": "^3.0.0" + } + }, + "node_modules/material-ui/node_modules/react-transition-group": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/react-transition-group/-/react-transition-group-1.2.1.tgz", + "integrity": "sha512-CWaL3laCmgAFdxdKbhhps+c0HRGF4c+hdM4H23+FI1QBNUyx/AMeIJGWorehPNSaKnQNOAxL7PQmqMu78CDj3Q==", + "dependencies": { + "chain-function": "^1.0.0", + "dom-helpers": "^3.2.0", + "loose-envify": "^1.3.1", + "prop-types": "^15.5.6", + "warning": "^3.0.0" + } + }, + "node_modules/math-codegen": { + "version": "0.3.5", + "resolved": "https://registry.npmjs.org/math-codegen/-/math-codegen-0.3.5.tgz", + "integrity": "sha1-R5nuRnfe0Ud2bQA8ykt4ee3UDMo=", + "dependencies": { + "extend": "^3.0.0", + "mr-parser": "^0.2.1" + } + }, + "node_modules/mathquill": { + "version": "0.10.1-a", + "resolved": "https://registry.npmjs.org/mathquill/-/mathquill-0.10.1-a.tgz", + "integrity": "sha1-vyylaQEAY6w0vNXVKa3Ag3zVPD8=", + "dependencies": { + "jquery": "^1.12.3" + } + }, + "node_modules/mathquill/node_modules/jquery": { + "version": "1.12.4", + "resolved": "https://registry.npmjs.org/jquery/-/jquery-1.12.4.tgz", + "integrity": "sha1-AeHfuikP5z3rp3zurLD5ui/sngw=" + }, + "node_modules/max-safe-integer": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/max-safe-integer/-/max-safe-integer-1.0.1.tgz", + "integrity": "sha1-84BgvixWPYwC5tSK85Ei/YO29BA=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/md5.js": { + "version": "1.3.5", + "resolved": "https://registry.npmjs.org/md5.js/-/md5.js-1.3.5.tgz", + "integrity": "sha512-xitP+WxNPcTTOgnTJcrhM0xvdPepipPSf3I8EIpGKeFLjt3PlJLIDG3u8EX53ZIubkb+5U2+3rELYpEhHhzdkg==", + "dev": true, + "dependencies": { + "hash-base": "^3.0.0", + "inherits": "^2.0.1", + "safe-buffer": "^5.1.2" + } + }, + "node_modules/media-typer": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "integrity": "sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/memoize-one": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/memoize-one/-/memoize-one-5.1.1.tgz", + "integrity": "sha512-HKeeBpWvqiVJD57ZUAsJNm71eHTykffzcLZVYWiVfQeI1rJtuEaS7hQiEpWfVVk18donPwJEcFKIkCmPJNOhHA==" + }, + "node_modules/memory-fs": { + "version": "0.5.0", + "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.5.0.tgz", + "integrity": "sha512-jA0rdU5KoQMC0e6ppoNRtpp6vjFq6+NY7r8hywnC7V+1Xj/MtHwGIbB1QaK/dunyjWteJzmkpd7ooeWg10T7GA==", + "dev": true, + "dependencies": { + "errno": "^0.1.3", + "readable-stream": "^2.0.1" + }, + "engines": { + "node": ">=4.3.0 <5.0.0 || >=5.10" + } + }, + "node_modules/memory-fs/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/memory-pager": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/memory-pager/-/memory-pager-1.5.0.tgz", + "integrity": "sha512-ZS4Bp4r/Zoeq6+NLJpP+0Zzm0pR8whtGPf1XExKLJBAczGMnSi3It14OiNCStjQjM6NU1okjQGSxgEZN8eBYKg==", + "optional": true + }, + "node_modules/meow": { + "version": "3.7.0", + "resolved": "https://registry.npmjs.org/meow/-/meow-3.7.0.tgz", + "integrity": "sha1-cstmi0JSKCkKu/qFaJJYcwioAfs=", + "dependencies": { + "camelcase-keys": "^2.0.0", + "decamelize": "^1.1.2", + "loud-rejection": "^1.0.0", + "map-obj": "^1.0.1", + "minimist": "^1.1.3", + "normalize-package-data": "^2.3.4", + "object-assign": "^4.0.1", + "read-pkg-up": "^1.0.1", + "redent": "^1.0.0", + "trim-newlines": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/merge-anything": { + "version": "2.4.4", + "resolved": "https://registry.npmjs.org/merge-anything/-/merge-anything-2.4.4.tgz", + "integrity": "sha512-l5XlriUDJKQT12bH+rVhAHjwIuXWdAIecGwsYjv2LJo+dA1AeRTmeQS+3QBpO6lEthBMDi2IUMpLC1yyRvGlwQ==", + "dependencies": { + "is-what": "^3.3.1" + } + }, + "node_modules/merge-descriptors": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz", + "integrity": "sha1-sAqqVW3YtEVoFQ7J0blT8/kMu2E=" + }, + "node_modules/methods": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz", + "integrity": "sha1-VSmk1nZUE07cxSZmVoNbD4Ua/O4=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/microevent.ts": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/microevent.ts/-/microevent.ts-0.1.1.tgz", + "integrity": "sha512-jo1OfR4TaEwd5HOrt5+tAZ9mqT4jmpNAusXtyfNzqVm9uiSYFZlKM1wYL4oU7azZW/PxQW53wM0S6OR1JHNa2g==", + "dev": true + }, + "node_modules/micromatch": { + "version": "3.1.10", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz", + "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==", + "dependencies": { + "arr-diff": "^4.0.0", + "array-unique": "^0.3.2", + "braces": "^2.3.1", + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "extglob": "^2.0.4", + "fragment-cache": "^0.2.1", + "kind-of": "^6.0.2", + "nanomatch": "^1.2.9", + "object.pick": "^1.3.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/miller-rabin": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/miller-rabin/-/miller-rabin-4.0.1.tgz", + "integrity": "sha512-115fLhvZVqWwHPbClyntxEVfVDfl9DLLTuJvq3g2O/Oxi8AiNouAHvDSzHS0viUJc+V5vm3eq91Xwqn9dp4jRA==", + "dev": true, + "dependencies": { + "bn.js": "^4.0.0", + "brorand": "^1.0.1" + }, + "bin": { + "miller-rabin": "bin/miller-rabin" + } + }, + "node_modules/miller-rabin/node_modules/bn.js": { + "version": "4.12.0", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", + "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==", + "dev": true + }, + "node_modules/mime": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz", + "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==", + "bin": { + "mime": "cli.js" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/mime-db": { + "version": "1.44.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.44.0.tgz", + "integrity": "sha512-/NOTfLrsPBVeH7YtFPgsVWveuL+4SjjYxaQ1xtM1KMFj7HdxlBlxeyNLzhyJVx7r4rZGJAZ/6lkKCitSc/Nmpg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime-types": { + "version": "2.1.27", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.27.tgz", + "integrity": "sha512-JIhqnCasI9yD+SsmkquHBxTSEuZdQX5BuQnS2Vc7puQQQ+8yiP5AY5uWhpdv4YL4VM5c6iliiYWPgJ/nJQLp7w==", + "dependencies": { + "mime-db": "1.44.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mimic-response": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/mimic-response/-/mimic-response-2.1.0.tgz", + "integrity": "sha512-wXqjST+SLt7R009ySCglWBCFpjUygmCIfD790/kVbiGmUgfYGuB14PiTd5DwVxSV4NcYHjzMkoj5LjQZwTQLEA==", + "engines": { + "node": ">=8" + } + }, + "node_modules/minimalistic-assert": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz", + "integrity": "sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A==", + "dev": true + }, + "node_modules/minimalistic-crypto-utils": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/minimalistic-crypto-utils/-/minimalistic-crypto-utils-1.0.1.tgz", + "integrity": "sha1-9sAMHAsIIkblxNmd+4x8CDsrWCo=", + "dev": true + }, + "node_modules/minimatch": { + "version": "3.0.4", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz", + "integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==", + "dependencies": { + "brace-expansion": "^1.1.7" + }, + "engines": { + "node": "*" + } + }, + "node_modules/minimist": { + "version": "1.2.5", + "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", + "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==" + }, + "node_modules/minipass": { + "version": "2.9.0", + "resolved": "https://registry.npmjs.org/minipass/-/minipass-2.9.0.tgz", + "integrity": "sha512-wxfUjg9WebH+CUDX/CdbRlh5SmfZiy/hpkxaRI16Y9W56Pa75sWgd/rvFilSgrauD9NyFymP/+JFV3KwzIsJeg==", + "dependencies": { + "safe-buffer": "^5.1.2", + "yallist": "^3.0.0" + } + }, + "node_modules/minizlib": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/minizlib/-/minizlib-1.3.3.tgz", + "integrity": "sha512-6ZYMOEnmVsdCeTJVE0W9ZD+pVnE8h9Hma/iOwwRDsdQoePpoX56/8B6z3P9VNwppJuBKNRuFDRNRqRWexT9G9Q==", + "dependencies": { + "minipass": "^2.9.0" + } + }, + "node_modules/mississippi": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/mississippi/-/mississippi-2.0.0.tgz", + "integrity": "sha512-zHo8v+otD1J10j/tC+VNoGK9keCuByhKovAvdn74dmxJl9+mWHnx6EMsDN4lgRoMI/eYo2nchAxniIbUPb5onw==", + "dev": true, + "dependencies": { + "concat-stream": "^1.5.0", + "duplexify": "^3.4.2", + "end-of-stream": "^1.1.0", + "flush-write-stream": "^1.0.0", + "from2": "^2.1.0", + "parallel-transform": "^1.1.0", + "pump": "^2.0.1", + "pumpify": "^1.3.3", + "stream-each": "^1.1.0", + "through2": "^2.0.0" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/mississippi/node_modules/pump": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/pump/-/pump-2.0.1.tgz", + "integrity": "sha512-ruPMNRkN3MHP1cWJc9OWr+T/xDP0jhXYCLfJcBuX54hhfIBnaQmAUMfDcG4DM5UMWByBbJY69QSphm3jtDKIkA==", + "dev": true, + "dependencies": { + "end-of-stream": "^1.1.0", + "once": "^1.3.1" + } + }, + "node_modules/mixin-deep": { + "version": "1.3.2", + "resolved": "https://registry.npmjs.org/mixin-deep/-/mixin-deep-1.3.2.tgz", + "integrity": "sha512-WRoDn//mXBiJ1H40rqa3vH0toePwSsGb45iInWlTySa+Uu4k3tYUSxa2v1KqAiLtvlrSzaExqS1gtk96A9zvEA==", + "dependencies": { + "for-in": "^1.0.2", + "is-extendable": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/mkdirp": { + "version": "0.5.4", + "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.4.tgz", + "integrity": "sha512-iG9AK/dJLtJ0XNgTuDbSyNS3zECqDlAhnQW4CsNxBG3LQJBbHmRX1egw39DmtOdCAqY+dKXV+sgPgilNWUKMVw==", + "dependencies": { + "minimist": "^1.2.5" + }, + "bin": { + "mkdirp": "bin/cmd.js" + } + }, + "node_modules/mkdirp-classic": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/mkdirp-classic/-/mkdirp-classic-0.5.2.tgz", + "integrity": "sha512-ejdnDQcR75gwknmMw/tx02AuRs8jCtqFoFqDZMjiNxsu85sRIJVXDKHuLYvUUPRBUtV2FpSZa9bL1BUa3BdR2g==" + }, + "node_modules/mobile-detect": { + "version": "1.4.4", + "resolved": "https://registry.npmjs.org/mobile-detect/-/mobile-detect-1.4.4.tgz", + "integrity": "sha512-vTgEjKjS89C5yHL5qWPpT6BzKuOVqABp+A3Szpbx34pIy3sngxlGaFpgHhfj6fKze1w0QKeOSDbU7SKu7wDvRQ==" + }, + "node_modules/mobx": { + "version": "5.15.7", + "resolved": "https://registry.npmjs.org/mobx/-/mobx-5.15.7.tgz", + "integrity": "sha512-wyM3FghTkhmC+hQjyPGGFdpehrcX1KOXsDuERhfK2YbJemkUhEB+6wzEN639T21onxlfYBmriA1PFnvxTUhcKw==" + }, + "node_modules/mobx-react": { + "version": "5.4.4", + "resolved": "https://registry.npmjs.org/mobx-react/-/mobx-react-5.4.4.tgz", + "integrity": "sha512-2mTzpyEjVB/RGk2i6KbcmP4HWcAUFox5ZRCrGvSyz49w20I4C4qql63grPpYrS9E9GKwgydBHQlA4y665LuRCQ==", + "dependencies": { + "hoist-non-react-statics": "^3.0.0", + "react-lifecycles-compat": "^3.0.2" + } + }, + "node_modules/mobx-react-devtools": { + "version": "6.1.1", + "resolved": "https://registry.npmjs.org/mobx-react-devtools/-/mobx-react-devtools-6.1.1.tgz", + "integrity": "sha512-nc5IXLdEUFLn3wZal65KF3/JFEFd+mbH4KTz/IG5BOPyw7jo8z29w/8qm7+wiCyqVfUIgJ1gL4+HVKmcXIOgqA==" + }, + "node_modules/mobx-utils": { + "version": "5.6.1", + "resolved": "https://registry.npmjs.org/mobx-utils/-/mobx-utils-5.6.1.tgz", + "integrity": "sha512-bpTJzM8MXniGnXCZY+ImjPDqBKQ3+G3g/QFSPtNkH6HM3x14DAPqKH7No7NDyhbXBMv3FaVetsgnoEPozbi45Q==" + }, + "node_modules/mocha": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/mocha/-/mocha-5.2.0.tgz", + "integrity": "sha512-2IUgKDhc3J7Uug+FxMXuqIyYzH7gJjXECKe/w43IGgQHTSj3InJi+yAA7T24L9bQMRKiUEHxEX37G5JpVUGLcQ==", + "dev": true, + "dependencies": { + "browser-stdout": "1.3.1", + "commander": "2.15.1", + "debug": "3.1.0", + "diff": "3.5.0", + "escape-string-regexp": "1.0.5", + "glob": "7.1.2", + "growl": "1.10.5", + "he": "1.1.1", + "minimatch": "3.0.4", + "mkdirp": "0.5.1", + "supports-color": "5.4.0" + }, + "bin": { + "_mocha": "bin/_mocha", + "mocha": "bin/mocha" + }, + "engines": { + "node": ">= 4.0.0" + } + }, + "node_modules/mocha/node_modules/commander": { + "version": "2.15.1", + "resolved": "https://registry.npmjs.org/commander/-/commander-2.15.1.tgz", + "integrity": "sha512-VlfT9F3V0v+jr4yxPc5gg9s62/fIVWsd2Bk2iD435um1NlGMYdVCq+MjcXnhYq2icNOizHr1kK+5TI6H0Hy0ag==", + "dev": true + }, + "node_modules/mocha/node_modules/debug": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz", + "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==", + "dev": true, + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/mocha/node_modules/glob": { + "version": "7.1.2", + "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.2.tgz", + "integrity": "sha512-MJTUg1kjuLeQCJ+ccE4Vpa6kKVXkPYJ2mOCQyUuKLcLQsdrMCpBPUi8qVE6+YuaJkozeA9NusTAw3hLr8Xe5EQ==", + "dev": true, + "dependencies": { + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.0.4", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" + }, + "engines": { + "node": "*" + } + }, + "node_modules/mocha/node_modules/he": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/he/-/he-1.1.1.tgz", + "integrity": "sha1-k0EP0hsAlzUVH4howvJx80J+I/0=", + "dev": true, + "bin": { + "he": "bin/he" + } + }, + "node_modules/mocha/node_modules/minimist": { + "version": "0.0.8", + "resolved": "https://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz", + "integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=", + "dev": true + }, + "node_modules/mocha/node_modules/mkdirp": { + "version": "0.5.1", + "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz", + "integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=", + "dev": true, + "dependencies": { + "minimist": "0.0.8" + }, + "bin": { + "mkdirp": "bin/cmd.js" + } + }, + "node_modules/mocha/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=", + "dev": true + }, + "node_modules/mocha/node_modules/supports-color": { + "version": "5.4.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.4.0.tgz", + "integrity": "sha512-zjaXglF5nnWpsq470jSv6P9DwPvgLkuapYmfDm3JWOm0vkNTVF2tI4UrN2r6jH1qM/uc/WtxYY1hYoA2dOKj5w==", + "dev": true, + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/mongodb": { + "version": "3.5.9", + "resolved": "https://registry.npmjs.org/mongodb/-/mongodb-3.5.9.tgz", + "integrity": "sha512-vXHBY1CsGYcEPoVWhwgxIBeWqP3dSu9RuRDsoLRPTITrcrgm1f0Ubu1xqF9ozMwv53agmEiZm0YGo+7WL3Nbug==", + "dependencies": { + "bl": "^2.2.0", + "bson": "^1.1.4", + "denque": "^1.4.1", + "require_optional": "^1.0.1", + "safe-buffer": "^5.1.2" + }, + "engines": { + "node": ">=4" + }, + "optionalDependencies": { + "saslprep": "^1.0.0" + } + }, + "node_modules/mongodb-core": { + "version": "2.1.20", + "resolved": "https://registry.npmjs.org/mongodb-core/-/mongodb-core-2.1.20.tgz", + "integrity": "sha512-IN57CX5/Q1bhDq6ShAR6gIv4koFsZP7L8WOK1S0lR0pVDQaScffSMV5jxubLsmZ7J+UdqmykKw4r9hG3XQEGgQ==", + "dependencies": { + "bson": "~1.0.4", + "require_optional": "~1.0.0" + } + }, + "node_modules/mongodb/node_modules/bl": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/bl/-/bl-2.2.0.tgz", + "integrity": "sha512-wbgvOpqopSr7uq6fJrLH8EsvYMJf9gzfo2jCsL2eTy75qXPukA4pCgHamOQkZtY5vmfVtjB+P3LNlMHW5CEZXA==", + "dependencies": { + "readable-stream": "^2.3.5", + "safe-buffer": "^5.1.1" + } + }, + "node_modules/mongodb/node_modules/bson": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/bson/-/bson-1.1.4.tgz", + "integrity": "sha512-S/yKGU1syOMzO86+dGpg2qGoDL0zvzcb262G+gqEy6TgP6rt6z6qxSFX/8X6vLC91P7G7C3nLs0+bvDzmvBA3Q==", + "engines": { + "node": ">=0.6.19" + } + }, + "node_modules/mongodb/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/mongoose": { + "version": "5.9.20", + "resolved": "https://registry.npmjs.org/mongoose/-/mongoose-5.9.20.tgz", + "integrity": "sha512-vRP6Csu2obzSl3ed7kTQMrolBNgweiRJ/eBU1PSe/rJfjqWS1oqDE2D1ZPGxkVOsKXs7Gyd84GAXerj8IB2UWg==", + "dependencies": { + "bson": "^1.1.4", + "kareem": "2.3.1", + "mongodb": "3.5.9", + "mongoose-legacy-pluralize": "1.0.2", + "mpath": "0.7.0", + "mquery": "3.2.2", + "ms": "2.1.2", + "regexp-clone": "1.0.0", + "safe-buffer": "5.1.2", + "sift": "7.0.1", + "sliced": "1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/mongoose-legacy-pluralize": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/mongoose-legacy-pluralize/-/mongoose-legacy-pluralize-1.0.2.tgz", + "integrity": "sha512-Yo/7qQU4/EyIS8YDFSeenIvXxZN+ld7YdV9LqFVQJzTLye8unujAWPZ4NWKfFA+RNjh+wvTWKY9Z3E5XM6ZZiQ==" + }, + "node_modules/mongoose/node_modules/bson": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/bson/-/bson-1.1.4.tgz", + "integrity": "sha512-S/yKGU1syOMzO86+dGpg2qGoDL0zvzcb262G+gqEy6TgP6rt6z6qxSFX/8X6vLC91P7G7C3nLs0+bvDzmvBA3Q==", + "engines": { + "node": ">=0.6.19" + } + }, + "node_modules/mongoose/node_modules/ms": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==" + }, + "node_modules/move-concurrently": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/move-concurrently/-/move-concurrently-1.0.1.tgz", + "integrity": "sha1-viwAX9oy4LKa8fBdfEszIUxwH5I=", + "dev": true, + "dependencies": { + "aproba": "^1.1.1", + "copy-concurrently": "^1.0.0", + "fs-write-stream-atomic": "^1.0.8", + "mkdirp": "^0.5.1", + "rimraf": "^2.5.4", + "run-queue": "^1.0.3" + } + }, + "node_modules/move-concurrently/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dev": true, + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/mpath": { + "version": "0.7.0", + "resolved": "https://registry.npmjs.org/mpath/-/mpath-0.7.0.tgz", + "integrity": "sha512-Aiq04hILxhz1L+f7sjGyn7IxYzWm1zLNNXcfhDtx04kZ2Gk7uvFdgZ8ts1cWa/6d0TQmag2yR8zSGZUmp0tFNg==", + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/mquery": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/mquery/-/mquery-3.2.2.tgz", + "integrity": "sha512-XB52992COp0KP230I3qloVUbkLUxJIu328HBP2t2EsxSFtf4W1HPSOBWOXf1bqxK4Xbb66lfMJ+Bpfd9/yZE1Q==", + "dependencies": { + "bluebird": "3.5.1", + "debug": "3.1.0", + "regexp-clone": "^1.0.0", + "safe-buffer": "5.1.2", + "sliced": "1.0.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/mquery/node_modules/bluebird": { + "version": "3.5.1", + "resolved": "https://registry.npmjs.org/bluebird/-/bluebird-3.5.1.tgz", + "integrity": "sha512-MKiLiV+I1AA596t9w1sQJ8jkiSr5+ZKi0WKrYGUn6d1Fx+Ij4tIj+m2WMQSGczs5jZVxV339chE8iwk6F64wjA==" + }, + "node_modules/mquery/node_modules/debug": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz", + "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/mquery/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/mr-parser": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/mr-parser/-/mr-parser-0.2.1.tgz", + "integrity": "sha1-hhi5ukF+KOn0OaQcaVtVTq/u2Sc=" + }, + "node_modules/ms": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.1.tgz", + "integrity": "sha512-tgp+dl5cGk28utYktBsrFqA7HKgrhgPsg6Z/EfhWI4gl1Hwq8B/GmY/0oXZ6nF8hDVesS/FpnYaD/kOWhYQvyg==" + }, + "node_modules/multicast-dns": { + "version": "6.2.3", + "resolved": "https://registry.npmjs.org/multicast-dns/-/multicast-dns-6.2.3.tgz", + "integrity": "sha512-ji6J5enbMyGRHIAkAOu3WdV8nggqviKCEKtXcOqfphZZtQrmHKycfynJ2V7eVPUA4NhJ6V7Wf4TmGbTwKE9B6g==", + "dev": true, + "dependencies": { + "dns-packet": "^1.3.1", + "thunky": "^1.0.2" + }, + "bin": { + "multicast-dns": "cli.js" + } + }, + "node_modules/multicast-dns-service-types": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/multicast-dns-service-types/-/multicast-dns-service-types-1.1.0.tgz", + "integrity": "sha1-iZ8R2WhuXgXLkbNdXw5jt3PPyQE=", + "dev": true + }, + "node_modules/nan": { + "version": "2.14.1", + "resolved": "https://registry.npmjs.org/nan/-/nan-2.14.1.tgz", + "integrity": "sha512-isWHgVjnFjh2x2yuJ/tj3JbwoHu3UC2dX5G/88Cm24yB6YopVgxvBObDY7n5xW6ExmFhJpSEQqFPvq9zaXc8Jw==" + }, + "node_modules/nanoid": { + "version": "3.1.10", + "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.1.10.tgz", + "integrity": "sha512-iZFMXKeXWkxzlfmMfM91gw7YhN2sdJtixY+eZh9V6QWJWTOiurhpKhBMgr82pfzgSqglQgqYSCowEYsz8D++6w==", + "bin": { + "nanoid": "bin/nanoid.cjs" + }, + "engines": { + "node": "^10 || ^12 || >=13.7" + } + }, + "node_modules/nanomatch": { + "version": "1.2.13", + "resolved": "https://registry.npmjs.org/nanomatch/-/nanomatch-1.2.13.tgz", + "integrity": "sha512-fpoe2T0RbHwBTBUOftAfBPaDEi06ufaUai0mE6Yn1kacc3SnTErfb/h+X94VXzI64rKFHYImXSvdwGGCmwOqCA==", + "dependencies": { + "arr-diff": "^4.0.0", + "array-unique": "^0.3.2", + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "fragment-cache": "^0.2.1", + "is-windows": "^1.0.2", + "kind-of": "^6.0.2", + "object.pick": "^1.3.0", + "regex-not": "^1.0.0", + "snapdragon": "^0.8.1", + "to-regex": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/napi-build-utils": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/napi-build-utils/-/napi-build-utils-1.0.2.tgz", + "integrity": "sha512-ONmRUqK7zj7DWX0D9ADe03wbwOBZxNAfF20PlGfCWQcD3+/MakShIHrMqx9YwPTfxDdF1zLeL+RGZiR9kGMLdg==" + }, + "node_modules/native-or-bluebird": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/native-or-bluebird/-/native-or-bluebird-1.2.0.tgz", + "integrity": "sha1-OcR7/Xgl0fuf+tMiEK4l2q3xAck=" + }, + "node_modules/needle": { + "version": "2.4.1", + "resolved": "https://registry.npmjs.org/needle/-/needle-2.4.1.tgz", + "integrity": "sha512-x/gi6ijr4B7fwl6WYL9FwlCvRQKGlUNvnceho8wxkwXqN8jvVmmmATTmZPRRG7b/yC1eode26C2HO9jl78Du9g==", + "dependencies": { + "debug": "^3.2.6", + "iconv-lite": "^0.4.4", + "sax": "^1.2.4" + }, + "bin": { + "needle": "bin/needle" + }, + "engines": { + "node": ">= 4.4.x" + } + }, + "node_modules/negotiator": { + "version": "0.6.2", + "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.2.tgz", + "integrity": "sha512-hZXc7K2e+PgeI1eDBe/10Ard4ekbfrrqG8Ep+8Jmf4JID2bNg7NvCPOZN+kfF574pFQI7mum2AUqDidoKqcTOw==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/neo-async": { + "version": "2.6.1", + "resolved": "https://registry.npmjs.org/neo-async/-/neo-async-2.6.1.tgz", + "integrity": "sha512-iyam8fBuCUpWeKPGpaNMetEocMt364qkCsfL9JuhjXX6dRnguRVOfk2GZaDpPjcOKiiXCPINZC1GczQ7iTq3Zw==", + "dev": true + }, + "node_modules/next-tick": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/next-tick/-/next-tick-1.0.0.tgz", + "integrity": "sha1-yobR/ogoFpsBICCOPchCS524NCw=" + }, + "node_modules/nextafter": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/nextafter/-/nextafter-1.0.0.tgz", + "integrity": "sha1-t9d7U1MQ4+CX5gJauwqQNHfsGjo=", + "dependencies": { + "double-bits": "^1.1.0" + } + }, + "node_modules/nice-try": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/nice-try/-/nice-try-1.0.5.tgz", + "integrity": "sha512-1nh45deeb5olNY7eX82BkPO7SSxR5SSYJiPTrTdFUVYwAl8CKMA5N9PjTYkHiRjisVcxcQ1HXdLhx2qxxJzLNQ==", + "dev": true + }, + "node_modules/node-abi": { + "version": "2.16.0", + "resolved": "https://registry.npmjs.org/node-abi/-/node-abi-2.16.0.tgz", + "integrity": "sha512-+sa0XNlWDA6T+bDLmkCUYn6W5k5W6BPRL6mqzSCs6H/xUgtl4D5x2fORKDzopKiU6wsyn/+wXlRXwXeSp+mtoA==", + "dependencies": { + "semver": "^5.4.1" + } + }, + "node_modules/node-ensure": { + "version": "0.0.0", + "resolved": "https://registry.npmjs.org/node-ensure/-/node-ensure-0.0.0.tgz", + "integrity": "sha1-7K52QVDemYYexcgQ/V0Jaxg5Mqc=" + }, + "node_modules/node-environment-flags": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/node-environment-flags/-/node-environment-flags-1.0.5.tgz", + "integrity": "sha512-VNYPRfGfmZLx0Ye20jWzHUjyTW/c+6Wq+iLhDzUI4XmhrDd9l/FozXV3F2xOaXjvp0co0+v1YSR3CMP6g+VvLQ==", + "dependencies": { + "object.getownpropertydescriptors": "^2.0.3", + "semver": "^5.7.0" + } + }, + "node_modules/node-fetch": { + "version": "1.7.3", + "resolved": "https://registry.npmjs.org/node-fetch/-/node-fetch-1.7.3.tgz", + "integrity": "sha512-NhZ4CsKx7cYm2vSrBAr2PvFOe6sWDf0UYLRqA6svUYg7+/TSfVAu49jYC4BvQ4Sms9SZgdqGBgroqfDhJdTyKQ==", + "dependencies": { + "encoding": "^0.1.11", + "is-stream": "^1.0.1" + } + }, + "node_modules/node-forge": { + "version": "0.9.1", + "resolved": "https://registry.npmjs.org/node-forge/-/node-forge-0.9.1.tgz", + "integrity": "sha512-G6RlQt5Sb4GMBzXvhfkeFmbqR6MzhtnT7VTHuLadjkii3rdYHNdw0m8zA4BTxVIh68FicCQ2NSUANpsqkr9jvQ==", + "engines": { + "node": ">= 4.5.0" + } + }, + "node_modules/node-gyp": { + "version": "3.8.0", + "resolved": "https://registry.npmjs.org/node-gyp/-/node-gyp-3.8.0.tgz", + "integrity": "sha512-3g8lYefrRRzvGeSowdJKAKyks8oUpLEd/DyPV4eMhVlhJ0aNaZqIrNUIPuEWWTAoPqyFkfGrM67MC69baqn6vA==", + "dependencies": { + "fstream": "^1.0.0", + "glob": "^7.0.3", + "graceful-fs": "^4.1.2", + "mkdirp": "^0.5.0", + "nopt": "2 || 3", + "npmlog": "0 || 1 || 2 || 3 || 4", + "osenv": "0", + "request": "^2.87.0", + "rimraf": "2", + "semver": "~5.3.0", + "tar": "^2.0.0", + "which": "1" + }, + "bin": { + "node-gyp": "bin/node-gyp.js" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/node-gyp/node_modules/nopt": { + "version": "3.0.6", + "resolved": "https://registry.npmjs.org/nopt/-/nopt-3.0.6.tgz", + "integrity": "sha1-xkZdvwirzU2zWTF/eaxopkayj/k=", + "dependencies": { + "abbrev": "1" + }, + "bin": { + "nopt": "bin/nopt.js" + } + }, + "node_modules/node-gyp/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/node-gyp/node_modules/semver": { + "version": "5.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.3.0.tgz", + "integrity": "sha1-myzl094C0XxgEq0yaqa00M9U+U8=", + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/node-gyp/node_modules/tar": { + "version": "2.2.2", + "resolved": "https://registry.npmjs.org/tar/-/tar-2.2.2.tgz", + "integrity": "sha512-FCEhQ/4rE1zYv9rYXJw/msRqsnmlje5jHP6huWeBZ704jUTy02c5AZyWujpMR1ax6mVw9NyJMfuK2CMDWVIfgA==", + "dependencies": { + "block-stream": "*", + "fstream": "^1.0.12", + "inherits": "2" + } + }, + "node_modules/node-libs-browser": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/node-libs-browser/-/node-libs-browser-2.2.1.tgz", + "integrity": "sha512-h/zcD8H9kaDZ9ALUWwlBUDo6TKF8a7qBSCSEGfjTVIYeqsioSKaAX+BN7NgiMGp6iSIXZ3PxgCu8KS3b71YK5Q==", + "dev": true, + "dependencies": { + "assert": "^1.1.1", + "browserify-zlib": "^0.2.0", + "buffer": "^4.3.0", + "console-browserify": "^1.1.0", + "constants-browserify": "^1.0.0", + "crypto-browserify": "^3.11.0", + "domain-browser": "^1.1.1", + "events": "^3.0.0", + "https-browserify": "^1.0.0", + "os-browserify": "^0.3.0", + "path-browserify": "0.0.1", + "process": "^0.11.10", + "punycode": "^1.2.4", + "querystring-es3": "^0.2.0", + "readable-stream": "^2.3.3", + "stream-browserify": "^2.0.1", + "stream-http": "^2.7.2", + "string_decoder": "^1.0.0", + "timers-browserify": "^2.0.4", + "tty-browserify": "0.0.0", + "url": "^0.11.0", + "util": "^0.11.0", + "vm-browserify": "^1.0.1" + } + }, + "node_modules/node-libs-browser/node_modules/buffer": { + "version": "4.9.2", + "resolved": "https://registry.npmjs.org/buffer/-/buffer-4.9.2.tgz", + "integrity": "sha512-xq+q3SRMOxGivLhBNaUdC64hDTQwejJ+H0T/NB1XMtTVEwNTrfFF3gAxiyW0Bu/xWEGhjVKgUcMhCrUy2+uCWg==", + "dev": true, + "dependencies": { + "base64-js": "^1.0.2", + "ieee754": "^1.1.4", + "isarray": "^1.0.0" + } + }, + "node_modules/node-libs-browser/node_modules/punycode": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz", + "integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4=", + "dev": true + }, + "node_modules/node-libs-browser/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/node-notifier": { + "version": "5.4.3", + "resolved": "https://registry.npmjs.org/node-notifier/-/node-notifier-5.4.3.tgz", + "integrity": "sha512-M4UBGcs4jeOK9CjTsYwkvH6/MzuUmGCyTW+kCY7uO+1ZVr0+FHGdPdIf5CCLqAaxnRrWidyoQlNkMIIVwbKB8Q==", + "dev": true, + "dependencies": { + "growly": "^1.3.0", + "is-wsl": "^1.1.0", + "semver": "^5.5.0", + "shellwords": "^0.1.1", + "which": "^1.3.0" + } + }, + "node_modules/node-sass": { + "version": "4.14.1", + "resolved": "https://registry.npmjs.org/node-sass/-/node-sass-4.14.1.tgz", + "integrity": "sha512-sjCuOlvGyCJS40R8BscF5vhVlQjNN069NtQ1gSxyK1u9iqvn6tf7O1R4GNowVZfiZUCRt5MmMs1xd+4V/7Yr0g==", + "hasInstallScript": true, + "dependencies": { + "async-foreach": "^0.1.3", + "chalk": "^1.1.1", + "cross-spawn": "^3.0.0", + "gaze": "^1.0.0", + "get-stdin": "^4.0.1", + "glob": "^7.0.3", + "in-publish": "^2.0.0", + "lodash": "^4.17.15", + "meow": "^3.7.0", + "mkdirp": "^0.5.1", + "nan": "^2.13.2", + "node-gyp": "^3.8.0", + "npmlog": "^4.0.0", + "request": "^2.88.0", + "sass-graph": "2.2.5", + "stdout-stream": "^1.4.0", + "true-case-path": "^1.0.2" + }, + "bin": { + "node-sass": "bin/node-sass" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/node-sass-tilde-importer": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/node-sass-tilde-importer/-/node-sass-tilde-importer-1.0.2.tgz", + "integrity": "sha512-Swcmr38Y7uB78itQeBm3mThjxBy9/Ah/ykPIaURY/L6Nec9AyRoL/jJ7ECfMR+oZeCTVQNxVMu/aHU+TLRVbdg==", + "dependencies": { + "find-parent-dir": "^0.3.0" + } + }, + "node_modules/node-sass/node_modules/ansi-regex": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", + "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/node-sass/node_modules/ansi-styles": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz", + "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/node-sass/node_modules/chalk": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz", + "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=", + "dependencies": { + "ansi-styles": "^2.2.1", + "escape-string-regexp": "^1.0.2", + "has-ansi": "^2.0.0", + "strip-ansi": "^3.0.0", + "supports-color": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/node-sass/node_modules/get-stdin": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/get-stdin/-/get-stdin-4.0.1.tgz", + "integrity": "sha1-uWjGsKBDhDJJAui/Gl3zJXmkUP4=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/node-sass/node_modules/strip-ansi": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", + "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", + "dependencies": { + "ansi-regex": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/node-sass/node_modules/supports-color": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz", + "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=", + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/node-stream-zip": { + "version": "1.11.2", + "resolved": "https://registry.npmjs.org/node-stream-zip/-/node-stream-zip-1.11.2.tgz", + "integrity": "sha512-cowCX+OyzS3tN2i4BMMFxCr/pE6cQlEMTbVCugmos0TNEJQNtcG04tR41CY8lumO1I7F5GFiLaU4WavomJthaA==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/nodemailer": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/nodemailer/-/nodemailer-5.1.1.tgz", + "integrity": "sha512-hKGCoeNdFL2W7S76J/Oucbw0/qRlfG815tENdhzcqTpSjKgAN91mFOqU2lQUflRRxFM7iZvCyaFcAR9noc/CqQ==", + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/nodemon": { + "version": "1.19.4", + "resolved": "https://registry.npmjs.org/nodemon/-/nodemon-1.19.4.tgz", + "integrity": "sha512-VGPaqQBNk193lrJFotBU8nvWZPqEZY2eIzymy2jjY0fJ9qIsxA0sxQ8ATPl0gZC645gijYEc1jtZvpS8QWzJGQ==", + "hasInstallScript": true, + "dependencies": { + "chokidar": "^2.1.8", + "debug": "^3.2.6", + "ignore-by-default": "^1.0.1", + "minimatch": "^3.0.4", + "pstree.remy": "^1.1.7", + "semver": "^5.7.1", + "supports-color": "^5.5.0", + "touch": "^3.1.0", + "undefsafe": "^2.0.2", + "update-notifier": "^2.5.0" + }, + "bin": { + "nodemon": "bin/nodemon.js" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/noop-logger": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/noop-logger/-/noop-logger-0.1.1.tgz", + "integrity": "sha1-lKKxYzxPExdVMAfYlm/Q6EG2pMI=" + }, + "node_modules/nopt": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/nopt/-/nopt-4.0.3.tgz", + "integrity": "sha512-CvaGwVMztSMJLOeXPrez7fyfObdZqNUK1cPAEzLHrTybIua9pMdmmPR5YwtfNftIOMv3DPUhFaxsZMNTQO20Kg==", + "dependencies": { + "abbrev": "1", + "osenv": "^0.1.4" + }, + "bin": { + "nopt": "bin/nopt.js" + } + }, + "node_modules/normalize-package-data": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.5.0.tgz", + "integrity": "sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA==", + "dependencies": { + "hosted-git-info": "^2.1.4", + "resolve": "^1.10.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" + } + }, + "node_modules/normalize-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", + "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/normalize.css": { + "version": "8.0.1", + "resolved": "https://registry.npmjs.org/normalize.css/-/normalize.css-8.0.1.tgz", + "integrity": "sha512-qizSNPO93t1YUuUhP22btGOo3chcvDFqFaj2TRybP0DMxkHOCTYwp3n34fel4a31ORXy4m1Xq0Gyqpb5m33qIg==" + }, + "node_modules/npm": { + "version": "6.14.5", + "resolved": "https://registry.npmjs.org/npm/-/npm-6.14.5.tgz", + "integrity": "sha512-CDwa3FJd0XJpKDbWCST484H+mCNjF26dPrU+xnREW+upR0UODjMEfXPl3bxWuAwZIX6c2ASg1plLO7jP8ehWeA==", + "bundleDependencies": [ + "JSONStream", + "abbrev", + "ansicolors", + "ansistyles", + "aproba", + "archy", + "bin-links", + "bluebird", + "byte-size", + "cacache", + "call-limit", + "chownr", + "ci-info", + "cli-columns", + "cli-table3", + "cmd-shim", + "columnify", + "config-chain", + "debuglog", + "detect-indent", + "detect-newline", + "dezalgo", + "editor", + "figgy-pudding", + "find-npm-prefix", + "fs-vacuum", + "fs-write-stream-atomic", + "gentle-fs", + "glob", + "graceful-fs", + "has-unicode", + "hosted-git-info", + "iferr", + "imurmurhash", + "infer-owner", + "inflight", + "inherits", + "ini", + "init-package-json", + "is-cidr", + "json-parse-better-errors", + "lazy-property", + "libcipm", + "libnpm", + "libnpmaccess", + "libnpmhook", + "libnpmorg", + "libnpmsearch", + "libnpmteam", + "libnpx", + "lock-verify", + "lockfile", + "lodash._baseindexof", + "lodash._baseuniq", + "lodash._bindcallback", + "lodash._cacheindexof", + "lodash._createcache", + "lodash._getnative", + "lodash.clonedeep", + "lodash.restparam", + "lodash.union", + "lodash.uniq", + "lodash.without", + "lru-cache", + "meant", + "mississippi", + "mkdirp", + "move-concurrently", + "node-gyp", + "nopt", + "normalize-package-data", + "npm-audit-report", + "npm-cache-filename", + "npm-install-checks", + "npm-lifecycle", + "npm-package-arg", + "npm-packlist", + "npm-pick-manifest", + "npm-profile", + "npm-registry-fetch", + "npm-user-validate", + "npmlog", + "once", + "opener", + "osenv", + "pacote", + "path-is-inside", + "promise-inflight", + "qrcode-terminal", + "query-string", + "qw", + "read", + "read-cmd-shim", + "read-installed", + "read-package-json", + "read-package-tree", + "readable-stream", + "readdir-scoped-modules", + "request", + "retry", + "rimraf", + "safe-buffer", + "semver", + "sha", + "slide", + "sorted-object", + "sorted-union-stream", + "ssri", + "stringify-package", + "tar", + "text-table", + "tiny-relative-date", + "uid-number", + "umask", + "unique-filename", + "unpipe", + "update-notifier", + "uuid", + "validate-npm-package-license", + "validate-npm-package-name", + "which", + "worker-farm", + "write-file-atomic" + ], + "dependencies": { + "abbrev": "~1.1.1", + "ansicolors": "~0.3.2", + "ansistyles": "~0.1.3", + "aproba": "^2.0.0", + "archy": "~1.0.0", + "bin-links": "^1.1.7", + "bluebird": "^3.5.5", + "byte-size": "^5.0.1", + "cacache": "^12.0.3", + "call-limit": "^1.1.1", + "chownr": "^1.1.4", + "ci-info": "^2.0.0", + "cli-columns": "^3.1.2", + "cli-table3": "^0.5.1", + "cmd-shim": "^3.0.3", + "columnify": "~1.5.4", + "config-chain": "^1.1.12", + "debuglog": "*", + "detect-indent": "~5.0.0", + "detect-newline": "^2.1.0", + "dezalgo": "~1.0.3", + "editor": "~1.0.0", + "figgy-pudding": "^3.5.1", + "find-npm-prefix": "^1.0.2", + "fs-vacuum": "~1.2.10", + "fs-write-stream-atomic": "~1.0.10", + "gentle-fs": "^2.3.0", + "glob": "^7.1.6", + "graceful-fs": "^4.2.4", + "has-unicode": "~2.0.1", + "hosted-git-info": "^2.8.8", + "iferr": "^1.0.2", + "imurmurhash": "*", + "infer-owner": "^1.0.4", + "inflight": "~1.0.6", + "inherits": "^2.0.4", + "ini": "^1.3.5", + "init-package-json": "^1.10.3", + "is-cidr": "^3.0.0", + "json-parse-better-errors": "^1.0.2", + "JSONStream": "^1.3.5", + "lazy-property": "~1.0.0", + "libcipm": "^4.0.7", + "libnpm": "^3.0.1", + "libnpmaccess": "^3.0.2", + "libnpmhook": "^5.0.3", + "libnpmorg": "^1.0.1", + "libnpmsearch": "^2.0.2", + "libnpmteam": "^1.0.2", + "libnpx": "^10.2.2", + "lock-verify": "^2.1.0", + "lockfile": "^1.0.4", + "lodash._baseindexof": "*", + "lodash._baseuniq": "~4.6.0", + "lodash._bindcallback": "*", + "lodash._cacheindexof": "*", + "lodash._createcache": "*", + "lodash._getnative": "*", + "lodash.clonedeep": "~4.5.0", + "lodash.restparam": "*", + "lodash.union": "~4.6.0", + "lodash.uniq": "~4.5.0", + "lodash.without": "~4.4.0", + "lru-cache": "^5.1.1", + "meant": "~1.0.1", + "mississippi": "^3.0.0", + "mkdirp": "^0.5.5", + "move-concurrently": "^1.0.1", + "node-gyp": "^5.1.0", + "nopt": "^4.0.3", + "normalize-package-data": "^2.5.0", + "npm-audit-report": "^1.3.2", + "npm-cache-filename": "~1.0.2", + "npm-install-checks": "^3.0.2", + "npm-lifecycle": "^3.1.4", + "npm-package-arg": "^6.1.1", + "npm-packlist": "^1.4.8", + "npm-pick-manifest": "^3.0.2", + "npm-profile": "^4.0.4", + "npm-registry-fetch": "^4.0.4", + "npm-user-validate": "~1.0.0", + "npmlog": "~4.1.2", + "once": "~1.4.0", + "opener": "^1.5.1", + "osenv": "^0.1.5", + "pacote": "^9.5.12", + "path-is-inside": "~1.0.2", + "promise-inflight": "~1.0.1", + "qrcode-terminal": "^0.12.0", + "query-string": "^6.8.2", + "qw": "~1.0.1", + "read": "~1.0.7", + "read-cmd-shim": "^1.0.5", + "read-installed": "~4.0.3", + "read-package-json": "^2.1.1", + "read-package-tree": "^5.3.1", + "readable-stream": "^3.6.0", + "readdir-scoped-modules": "^1.1.0", + "request": "^2.88.0", + "retry": "^0.12.0", + "rimraf": "^2.7.1", + "safe-buffer": "^5.1.2", + "semver": "^5.7.1", + "sha": "^3.0.0", + "slide": "~1.1.6", + "sorted-object": "~2.0.1", + "sorted-union-stream": "~2.1.3", + "ssri": "^6.0.1", + "stringify-package": "^1.0.1", + "tar": "^4.4.13", + "text-table": "~0.2.0", + "tiny-relative-date": "^1.3.0", + "uid-number": "0.0.6", + "umask": "~1.1.0", + "unique-filename": "^1.1.1", + "unpipe": "~1.0.0", + "update-notifier": "^2.5.0", + "uuid": "^3.3.3", + "validate-npm-package-license": "^3.0.4", + "validate-npm-package-name": "~3.0.0", + "which": "^1.3.1", + "worker-farm": "^1.7.0", + "write-file-atomic": "^2.4.3" + }, + "bin": { + "npm": "bin/npm-cli.js", + "npx": "bin/npx-cli.js" + }, + "engines": { + "node": "6 >=6.2.0 || 8 || >=9.3.0" + } + }, + "node_modules/npm-bundled": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/npm-bundled/-/npm-bundled-1.1.1.tgz", + "integrity": "sha512-gqkfgGePhTpAEgUsGEgcq1rqPXA+tv/aVBlgEzfXwA1yiUJF7xtEt3CtVwOjNYQOVknDk0F20w58Fnm3EtG0fA==", + "dependencies": { + "npm-normalize-package-bin": "^1.0.1" + } + }, + "node_modules/npm-normalize-package-bin": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/npm-normalize-package-bin/-/npm-normalize-package-bin-1.0.1.tgz", + "integrity": "sha512-EPfafl6JL5/rU+ot6P3gRSCpPDW5VmIzX959Ob1+ySFUuuYHWHekXpwdUZcKP5C+DS4GEtdJluwBjnsNDl+fSA==" + }, + "node_modules/npm-packlist": { + "version": "1.4.8", + "resolved": "https://registry.npmjs.org/npm-packlist/-/npm-packlist-1.4.8.tgz", + "integrity": "sha512-5+AZgwru5IevF5ZdnFglB5wNlHG1AOOuw28WhUq8/8emhBmLv6jX5by4WJCh7lW0uSYZYS6DXqIsyZVIXRZU9A==", + "dependencies": { + "ignore-walk": "^3.0.1", + "npm-bundled": "^1.0.1", + "npm-normalize-package-bin": "^1.0.1" + } + }, + "node_modules/npm-run-path": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/npm-run-path/-/npm-run-path-2.0.2.tgz", + "integrity": "sha1-NakjLfo11wZ7TLLd8jV7GHFTbF8=", + "dependencies": { + "path-key": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/abbrev": { + "version": "1.1.1", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/agent-base": { + "version": "4.3.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "es6-promisify": "^5.0.0" + }, + "engines": { + "node": ">= 4.0.0" + } + }, + "node_modules/npm/node_modules/agentkeepalive": { + "version": "3.5.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "humanize-ms": "^1.2.1" + }, + "engines": { + "node": ">= 4.0.0" + } + }, + "node_modules/npm/node_modules/ajv": { + "version": "5.5.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "co": "^4.6.0", + "fast-deep-equal": "^1.0.0", + "fast-json-stable-stringify": "^2.0.0", + "json-schema-traverse": "^0.3.0" + } + }, + "node_modules/npm/node_modules/ansi-align": { + "version": "2.0.0", + "inBundle": true, + "license": "ISC", + "dependencies": { + "string-width": "^2.0.0" + } + }, + "node_modules/npm/node_modules/ansi-regex": { + "version": "2.1.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/ansi-styles": { + "version": "3.2.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "color-convert": "^1.9.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/ansicolors": { + "version": "0.3.2", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/ansistyles": { + "version": "0.1.3", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/aproba": { + "version": "2.0.0", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/archy": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/are-we-there-yet": { + "version": "1.1.4", + "inBundle": true, + "license": "ISC", + "dependencies": { + "delegates": "^1.0.0", + "readable-stream": "^2.0.6" + } + }, + "node_modules/npm/node_modules/are-we-there-yet/node_modules/readable-stream": { + "version": "2.3.6", + "inBundle": true, + "license": "MIT", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/npm/node_modules/are-we-there-yet/node_modules/string_decoder": { + "version": "1.1.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/npm/node_modules/asap": { + "version": "2.0.6", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/asn1": { + "version": "0.2.4", + "inBundle": true, + "license": "MIT", + "dependencies": { + "safer-buffer": "~2.1.0" + } + }, + "node_modules/npm/node_modules/assert-plus": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.8" + } + }, + "node_modules/npm/node_modules/asynckit": { + "version": "0.4.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/aws-sign2": { + "version": "0.7.0", + "inBundle": true, + "license": "Apache-2.0", + "engines": { + "node": "*" + } + }, + "node_modules/npm/node_modules/aws4": { + "version": "1.8.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/balanced-match": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/bcrypt-pbkdf": { + "version": "1.0.2", + "inBundle": true, + "license": "BSD-3-Clause", + "optional": true, + "dependencies": { + "tweetnacl": "^0.14.3" + } + }, + "node_modules/npm/node_modules/bin-links": { + "version": "1.1.7", + "inBundle": true, + "license": "Artistic-2.0", + "dependencies": { + "bluebird": "^3.5.3", + "cmd-shim": "^3.0.0", + "gentle-fs": "^2.3.0", + "graceful-fs": "^4.1.15", + "npm-normalize-package-bin": "^1.0.0", + "write-file-atomic": "^2.3.0" + } + }, + "node_modules/npm/node_modules/bluebird": { + "version": "3.5.5", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/boxen": { + "version": "1.3.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "ansi-align": "^2.0.0", + "camelcase": "^4.0.0", + "chalk": "^2.0.1", + "cli-boxes": "^1.0.0", + "string-width": "^2.0.0", + "term-size": "^1.2.0", + "widest-line": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/brace-expansion": { + "version": "1.1.11", + "inBundle": true, + "license": "MIT", + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/npm/node_modules/buffer-from": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/builtins": { + "version": "1.0.3", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/byline": { + "version": "5.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/byte-size": { + "version": "5.0.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/npm/node_modules/cacache": { + "version": "12.0.3", + "inBundle": true, + "license": "ISC", + "dependencies": { + "bluebird": "^3.5.5", + "chownr": "^1.1.1", + "figgy-pudding": "^3.5.1", + "glob": "^7.1.4", + "graceful-fs": "^4.1.15", + "infer-owner": "^1.0.3", + "lru-cache": "^5.1.1", + "mississippi": "^3.0.0", + "mkdirp": "^0.5.1", + "move-concurrently": "^1.0.1", + "promise-inflight": "^1.0.1", + "rimraf": "^2.6.3", + "ssri": "^6.0.1", + "unique-filename": "^1.1.1", + "y18n": "^4.0.0" + } + }, + "node_modules/npm/node_modules/call-limit": { + "version": "1.1.1", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/camelcase": { + "version": "4.1.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/capture-stack-trace": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/caseless": { + "version": "0.12.0", + "inBundle": true, + "license": "Apache-2.0" + }, + "node_modules/npm/node_modules/chalk": { + "version": "2.4.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/chownr": { + "version": "1.1.4", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/ci-info": { + "version": "2.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/cidr-regex": { + "version": "2.0.10", + "inBundle": true, + "license": "BSD-2-Clause", + "dependencies": { + "ip-regex": "^2.1.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/cli-boxes": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/cli-columns": { + "version": "3.1.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "string-width": "^2.0.0", + "strip-ansi": "^3.0.1" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/npm/node_modules/cli-table3": { + "version": "0.5.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "object-assign": "^4.1.0", + "string-width": "^2.1.1" + }, + "engines": { + "node": ">=6" + }, + "optionalDependencies": { + "colors": "^1.1.2" + } + }, + "node_modules/npm/node_modules/cliui": { + "version": "4.1.0", + "inBundle": true, + "license": "ISC", + "dependencies": { + "string-width": "^2.1.1", + "strip-ansi": "^4.0.0", + "wrap-ansi": "^2.0.0" + } + }, + "node_modules/npm/node_modules/cliui/node_modules/ansi-regex": { + "version": "3.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/cliui/node_modules/strip-ansi": { + "version": "4.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "ansi-regex": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/clone": { + "version": "1.0.4", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.8" + } + }, + "node_modules/npm/node_modules/cmd-shim": { + "version": "3.0.3", + "inBundle": true, + "license": "ISC", + "dependencies": { + "graceful-fs": "^4.1.2", + "mkdirp": "~0.5.0" + } + }, + "node_modules/npm/node_modules/co": { + "version": "4.6.0", + "inBundle": true, + "license": "MIT", + "engines": { + "iojs": ">= 1.0.0", + "node": ">= 0.12.0" + } + }, + "node_modules/npm/node_modules/code-point-at": { + "version": "1.1.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/color-convert": { + "version": "1.9.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "color-name": "^1.1.1" + } + }, + "node_modules/npm/node_modules/color-name": { + "version": "1.1.3", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/colors": { + "version": "1.3.3", + "inBundle": true, + "license": "MIT", + "optional": true, + "engines": { + "node": ">=0.1.90" + } + }, + "node_modules/npm/node_modules/columnify": { + "version": "1.5.4", + "inBundle": true, + "license": "MIT", + "dependencies": { + "strip-ansi": "^3.0.0", + "wcwidth": "^1.0.0" + } + }, + "node_modules/npm/node_modules/combined-stream": { + "version": "1.0.6", + "inBundle": true, + "license": "MIT", + "dependencies": { + "delayed-stream": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/npm/node_modules/concat-map": { + "version": "0.0.1", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/concat-stream": { + "version": "1.6.2", + "engines": [ + "node >= 0.8" + ], + "inBundle": true, + "license": "MIT", + "dependencies": { + "buffer-from": "^1.0.0", + "inherits": "^2.0.3", + "readable-stream": "^2.2.2", + "typedarray": "^0.0.6" + } + }, + "node_modules/npm/node_modules/concat-stream/node_modules/readable-stream": { + "version": "2.3.6", + "inBundle": true, + "license": "MIT", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/npm/node_modules/concat-stream/node_modules/string_decoder": { + "version": "1.1.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/npm/node_modules/config-chain": { + "version": "1.1.12", + "inBundle": true, + "dependencies": { + "ini": "^1.3.4", + "proto-list": "~1.2.1" + } + }, + "node_modules/npm/node_modules/configstore": { + "version": "3.1.2", + "inBundle": true, + "license": "BSD-2-Clause", + "dependencies": { + "dot-prop": "^4.1.0", + "graceful-fs": "^4.1.2", + "make-dir": "^1.0.0", + "unique-string": "^1.0.0", + "write-file-atomic": "^2.0.0", + "xdg-basedir": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/console-control-strings": { + "version": "1.1.0", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/copy-concurrently": { + "version": "1.0.5", + "inBundle": true, + "license": "ISC", + "dependencies": { + "aproba": "^1.1.1", + "fs-write-stream-atomic": "^1.0.8", + "iferr": "^0.1.5", + "mkdirp": "^0.5.1", + "rimraf": "^2.5.4", + "run-queue": "^1.0.0" + } + }, + "node_modules/npm/node_modules/copy-concurrently/node_modules/aproba": { + "version": "1.2.0", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/copy-concurrently/node_modules/iferr": { + "version": "0.1.5", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/core-util-is": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/create-error-class": { + "version": "3.0.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "capture-stack-trace": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/cross-spawn": { + "version": "5.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "lru-cache": "^4.0.1", + "shebang-command": "^1.2.0", + "which": "^1.2.9" + } + }, + "node_modules/npm/node_modules/cross-spawn/node_modules/lru-cache": { + "version": "4.1.5", + "inBundle": true, + "license": "ISC", + "dependencies": { + "pseudomap": "^1.0.2", + "yallist": "^2.1.2" + } + }, + "node_modules/npm/node_modules/cross-spawn/node_modules/yallist": { + "version": "2.1.2", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/crypto-random-string": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/cyclist": { + "version": "0.2.2", + "inBundle": true + }, + "node_modules/npm/node_modules/dashdash": { + "version": "1.14.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "assert-plus": "^1.0.0" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/npm/node_modules/debug": { + "version": "3.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/npm/node_modules/debug/node_modules/ms": { + "version": "2.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/debuglog": { + "version": "1.0.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": "*" + } + }, + "node_modules/npm/node_modules/decamelize": { + "version": "1.2.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/decode-uri-component": { + "version": "0.2.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10" + } + }, + "node_modules/npm/node_modules/deep-extend": { + "version": "0.6.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/npm/node_modules/defaults": { + "version": "1.0.3", + "inBundle": true, + "license": "MIT", + "dependencies": { + "clone": "^1.0.2" + } + }, + "node_modules/npm/node_modules/define-properties": { + "version": "1.1.3", + "inBundle": true, + "license": "MIT", + "dependencies": { + "object-keys": "^1.0.12" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/npm/node_modules/delayed-stream": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/npm/node_modules/delegates": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/detect-indent": { + "version": "5.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/detect-newline": { + "version": "2.1.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/dezalgo": { + "version": "1.0.3", + "inBundle": true, + "license": "ISC", + "dependencies": { + "asap": "^2.0.0", + "wrappy": "1" + } + }, + "node_modules/npm/node_modules/dot-prop": { + "version": "4.2.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "is-obj": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/dotenv": { + "version": "5.0.1", + "inBundle": true, + "license": "BSD-2-Clause", + "engines": { + "node": ">=4.6.0" + } + }, + "node_modules/npm/node_modules/duplexer3": { + "version": "0.1.4", + "inBundle": true, + "license": "BSD-3-Clause" + }, + "node_modules/npm/node_modules/duplexify": { + "version": "3.6.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "end-of-stream": "^1.0.0", + "inherits": "^2.0.1", + "readable-stream": "^2.0.0", + "stream-shift": "^1.0.0" + } + }, + "node_modules/npm/node_modules/duplexify/node_modules/readable-stream": { + "version": "2.3.6", + "inBundle": true, + "license": "MIT", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/npm/node_modules/duplexify/node_modules/string_decoder": { + "version": "1.1.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/npm/node_modules/ecc-jsbn": { + "version": "0.1.2", + "inBundle": true, + "license": "MIT", + "optional": true, + "dependencies": { + "jsbn": "~0.1.0", + "safer-buffer": "^2.1.0" + } + }, + "node_modules/npm/node_modules/editor": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/encoding": { + "version": "0.1.12", + "inBundle": true, + "license": "MIT", + "dependencies": { + "iconv-lite": "~0.4.13" + } + }, + "node_modules/npm/node_modules/end-of-stream": { + "version": "1.4.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "once": "^1.4.0" + } + }, + "node_modules/npm/node_modules/env-paths": { + "version": "2.2.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/err-code": { + "version": "1.1.2", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/errno": { + "version": "0.1.7", + "inBundle": true, + "license": "MIT", + "dependencies": { + "prr": "~1.0.1" + }, + "bin": { + "errno": "cli.js" + } + }, + "node_modules/npm/node_modules/es-abstract": { + "version": "1.12.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "es-to-primitive": "^1.1.1", + "function-bind": "^1.1.1", + "has": "^1.0.1", + "is-callable": "^1.1.3", + "is-regex": "^1.0.4" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/npm/node_modules/es-to-primitive": { + "version": "1.2.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "is-callable": "^1.1.4", + "is-date-object": "^1.0.1", + "is-symbol": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/npm/node_modules/es6-promise": { + "version": "4.2.8", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/es6-promisify": { + "version": "5.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "es6-promise": "^4.0.3" + } + }, + "node_modules/npm/node_modules/escape-string-regexp": { + "version": "1.0.5", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/npm/node_modules/execa": { + "version": "0.7.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "cross-spawn": "^5.0.1", + "get-stream": "^3.0.0", + "is-stream": "^1.1.0", + "npm-run-path": "^2.0.0", + "p-finally": "^1.0.0", + "signal-exit": "^3.0.0", + "strip-eof": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/execa/node_modules/get-stream": { + "version": "3.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/extend": { + "version": "3.0.2", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/extsprintf": { + "version": "1.3.0", + "engines": [ + "node >=0.6.0" + ], + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/fast-deep-equal": { + "version": "1.1.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/fast-json-stable-stringify": { + "version": "2.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/figgy-pudding": { + "version": "3.5.1", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/find-npm-prefix": { + "version": "1.0.2", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/find-up": { + "version": "2.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "locate-path": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/flush-write-stream": { + "version": "1.0.3", + "inBundle": true, + "license": "MIT", + "dependencies": { + "inherits": "^2.0.1", + "readable-stream": "^2.0.4" + } + }, + "node_modules/npm/node_modules/flush-write-stream/node_modules/readable-stream": { + "version": "2.3.6", + "inBundle": true, + "license": "MIT", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/npm/node_modules/flush-write-stream/node_modules/string_decoder": { + "version": "1.1.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/npm/node_modules/forever-agent": { + "version": "0.6.1", + "inBundle": true, + "license": "Apache-2.0", + "engines": { + "node": "*" + } + }, + "node_modules/npm/node_modules/form-data": { + "version": "2.3.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "asynckit": "^0.4.0", + "combined-stream": "1.0.6", + "mime-types": "^2.1.12" + }, + "engines": { + "node": ">= 0.12" + } + }, + "node_modules/npm/node_modules/from2": { + "version": "2.3.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "inherits": "^2.0.1", + "readable-stream": "^2.0.0" + } + }, + "node_modules/npm/node_modules/from2/node_modules/readable-stream": { + "version": "2.3.6", + "inBundle": true, + "license": "MIT", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/npm/node_modules/from2/node_modules/string_decoder": { + "version": "1.1.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/npm/node_modules/fs-minipass": { + "version": "1.2.7", + "inBundle": true, + "license": "ISC", + "dependencies": { + "minipass": "^2.6.0" + } + }, + "node_modules/npm/node_modules/fs-minipass/node_modules/minipass": { + "version": "2.9.0", + "inBundle": true, + "license": "ISC", + "dependencies": { + "safe-buffer": "^5.1.2", + "yallist": "^3.0.0" + } + }, + "node_modules/npm/node_modules/fs-vacuum": { + "version": "1.2.10", + "inBundle": true, + "license": "ISC", + "dependencies": { + "graceful-fs": "^4.1.2", + "path-is-inside": "^1.0.1", + "rimraf": "^2.5.2" + } + }, + "node_modules/npm/node_modules/fs-write-stream-atomic": { + "version": "1.0.10", + "inBundle": true, + "license": "ISC", + "dependencies": { + "graceful-fs": "^4.1.2", + "iferr": "^0.1.5", + "imurmurhash": "^0.1.4", + "readable-stream": "1 || 2" + } + }, + "node_modules/npm/node_modules/fs-write-stream-atomic/node_modules/iferr": { + "version": "0.1.5", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/fs-write-stream-atomic/node_modules/readable-stream": { + "version": "2.3.6", + "inBundle": true, + "license": "MIT", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/npm/node_modules/fs-write-stream-atomic/node_modules/string_decoder": { + "version": "1.1.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/npm/node_modules/fs.realpath": { + "version": "1.0.0", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/function-bind": { + "version": "1.1.1", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/gauge": { + "version": "2.7.4", + "inBundle": true, + "license": "ISC", + "dependencies": { + "aproba": "^1.0.3", + "console-control-strings": "^1.0.0", + "has-unicode": "^2.0.0", + "object-assign": "^4.1.0", + "signal-exit": "^3.0.0", + "string-width": "^1.0.1", + "strip-ansi": "^3.0.1", + "wide-align": "^1.1.0" + } + }, + "node_modules/npm/node_modules/gauge/node_modules/aproba": { + "version": "1.2.0", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/gauge/node_modules/string-width": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "code-point-at": "^1.0.0", + "is-fullwidth-code-point": "^1.0.0", + "strip-ansi": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/genfun": { + "version": "5.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/gentle-fs": { + "version": "2.3.0", + "inBundle": true, + "license": "Artistic-2.0", + "dependencies": { + "aproba": "^1.1.2", + "chownr": "^1.1.2", + "cmd-shim": "^3.0.3", + "fs-vacuum": "^1.2.10", + "graceful-fs": "^4.1.11", + "iferr": "^0.1.5", + "infer-owner": "^1.0.4", + "mkdirp": "^0.5.1", + "path-is-inside": "^1.0.2", + "read-cmd-shim": "^1.0.1", + "slide": "^1.1.6" + } + }, + "node_modules/npm/node_modules/gentle-fs/node_modules/aproba": { + "version": "1.2.0", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/gentle-fs/node_modules/iferr": { + "version": "0.1.5", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/get-caller-file": { + "version": "1.0.3", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/get-stream": { + "version": "4.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "pump": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/getpass": { + "version": "0.1.7", + "inBundle": true, + "license": "MIT", + "dependencies": { + "assert-plus": "^1.0.0" + } + }, + "node_modules/npm/node_modules/glob": { + "version": "7.1.6", + "inBundle": true, + "license": "ISC", + "dependencies": { + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.0.4", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" + }, + "engines": { + "node": "*" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/npm/node_modules/global-dirs": { + "version": "0.1.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "ini": "^1.3.4" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/got": { + "version": "6.7.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "create-error-class": "^3.0.0", + "duplexer3": "^0.1.4", + "get-stream": "^3.0.0", + "is-redirect": "^1.0.0", + "is-retry-allowed": "^1.0.0", + "is-stream": "^1.0.0", + "lowercase-keys": "^1.0.0", + "safe-buffer": "^5.0.1", + "timed-out": "^4.0.0", + "unzip-response": "^2.0.1", + "url-parse-lax": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/got/node_modules/get-stream": { + "version": "3.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/graceful-fs": { + "version": "4.2.4", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/har-schema": { + "version": "2.0.0", + "inBundle": true, + "license": "ISC", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/har-validator": { + "version": "5.1.0", + "inBundle": true, + "license": "ISC", + "dependencies": { + "ajv": "^5.3.0", + "har-schema": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/has": { + "version": "1.0.3", + "inBundle": true, + "license": "MIT", + "dependencies": { + "function-bind": "^1.1.1" + }, + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/npm/node_modules/has-flag": { + "version": "3.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/has-symbols": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/npm/node_modules/has-unicode": { + "version": "2.0.1", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/hosted-git-info": { + "version": "2.8.8", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/http-cache-semantics": { + "version": "3.8.1", + "inBundle": true, + "license": "BSD-2-Clause" + }, + "node_modules/npm/node_modules/http-proxy-agent": { + "version": "2.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "agent-base": "4", + "debug": "3.1.0" + }, + "engines": { + "node": ">= 4.5.0" + } + }, + "node_modules/npm/node_modules/http-signature": { + "version": "1.2.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "assert-plus": "^1.0.0", + "jsprim": "^1.2.2", + "sshpk": "^1.7.0" + }, + "engines": { + "node": ">=0.8", + "npm": ">=1.3.7" + } + }, + "node_modules/npm/node_modules/https-proxy-agent": { + "version": "2.2.4", + "inBundle": true, + "license": "MIT", + "dependencies": { + "agent-base": "^4.3.0", + "debug": "^3.1.0" + }, + "engines": { + "node": ">= 4.5.0" + } + }, + "node_modules/npm/node_modules/humanize-ms": { + "version": "1.2.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "ms": "^2.0.0" + } + }, + "node_modules/npm/node_modules/iconv-lite": { + "version": "0.4.23", + "inBundle": true, + "license": "MIT", + "dependencies": { + "safer-buffer": ">= 2.1.2 < 3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/iferr": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/npm/node_modules/ignore-walk": { + "version": "3.0.3", + "inBundle": true, + "license": "ISC", + "dependencies": { + "minimatch": "^3.0.4" + } + }, + "node_modules/npm/node_modules/import-lazy": { + "version": "2.1.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/imurmurhash": { + "version": "0.1.4", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.8.19" + } + }, + "node_modules/npm/node_modules/infer-owner": { + "version": "1.0.4", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/inflight": { + "version": "1.0.6", + "inBundle": true, + "license": "ISC", + "dependencies": { + "once": "^1.3.0", + "wrappy": "1" + } + }, + "node_modules/npm/node_modules/inherits": { + "version": "2.0.4", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/ini": { + "version": "1.3.5", + "inBundle": true, + "license": "ISC", + "engines": { + "node": "*" + } + }, + "node_modules/npm/node_modules/init-package-json": { + "version": "1.10.3", + "inBundle": true, + "license": "ISC", + "dependencies": { + "glob": "^7.1.1", + "npm-package-arg": "^4.0.0 || ^5.0.0 || ^6.0.0", + "promzard": "^0.3.0", + "read": "~1.0.1", + "read-package-json": "1 || 2", + "semver": "2.x || 3.x || 4 || 5", + "validate-npm-package-license": "^3.0.1", + "validate-npm-package-name": "^3.0.0" + } + }, + "node_modules/npm/node_modules/invert-kv": { + "version": "2.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/ip": { + "version": "1.1.5", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/ip-regex": { + "version": "2.1.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/is-callable": { + "version": "1.1.4", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/npm/node_modules/is-ci": { + "version": "1.2.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "ci-info": "^1.5.0" + }, + "bin": { + "is-ci": "bin.js" + } + }, + "node_modules/npm/node_modules/is-ci/node_modules/ci-info": { + "version": "1.6.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/is-cidr": { + "version": "3.0.0", + "inBundle": true, + "license": "BSD-2-Clause", + "dependencies": { + "cidr-regex": "^2.0.10" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/is-date-object": { + "version": "1.0.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/npm/node_modules/is-fullwidth-code-point": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "number-is-nan": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/is-installed-globally": { + "version": "0.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "global-dirs": "^0.1.0", + "is-path-inside": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/is-npm": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/is-obj": { + "version": "1.0.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/is-path-inside": { + "version": "1.0.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "path-is-inside": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/is-redirect": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/is-regex": { + "version": "1.0.4", + "inBundle": true, + "license": "MIT", + "dependencies": { + "has": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/npm/node_modules/is-retry-allowed": { + "version": "1.2.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/is-stream": { + "version": "1.1.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/is-symbol": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "has-symbols": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/npm/node_modules/is-typedarray": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/isarray": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/isexe": { + "version": "2.0.0", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/isstream": { + "version": "0.1.2", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/jsbn": { + "version": "0.1.1", + "inBundle": true, + "license": "MIT", + "optional": true + }, + "node_modules/npm/node_modules/json-parse-better-errors": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/json-schema": { + "version": "0.2.3", + "inBundle": true + }, + "node_modules/npm/node_modules/json-schema-traverse": { + "version": "0.3.1", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/json-stringify-safe": { + "version": "5.0.1", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/jsonparse": { + "version": "1.3.1", + "engines": [ + "node >= 0.2.0" + ], + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/JSONStream": { + "version": "1.3.5", + "inBundle": true, + "license": "(MIT OR Apache-2.0)", + "dependencies": { + "jsonparse": "^1.2.0", + "through": ">=2.2.7 <3" + }, + "bin": { + "JSONStream": "bin.js" + }, + "engines": { + "node": "*" + } + }, + "node_modules/npm/node_modules/jsprim": { + "version": "1.4.1", + "engines": [ + "node >=0.6.0" + ], + "inBundle": true, + "license": "MIT", + "dependencies": { + "assert-plus": "1.0.0", + "extsprintf": "1.3.0", + "json-schema": "0.2.3", + "verror": "1.10.0" + } + }, + "node_modules/npm/node_modules/latest-version": { + "version": "3.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "package-json": "^4.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/lazy-property": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/lcid": { + "version": "2.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "invert-kv": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/libcipm": { + "version": "4.0.7", + "inBundle": true, + "license": "MIT", + "dependencies": { + "bin-links": "^1.1.2", + "bluebird": "^3.5.1", + "figgy-pudding": "^3.5.1", + "find-npm-prefix": "^1.0.2", + "graceful-fs": "^4.1.11", + "ini": "^1.3.5", + "lock-verify": "^2.0.2", + "mkdirp": "^0.5.1", + "npm-lifecycle": "^3.0.0", + "npm-logical-tree": "^1.2.1", + "npm-package-arg": "^6.1.0", + "pacote": "^9.1.0", + "read-package-json": "^2.0.13", + "rimraf": "^2.6.2", + "worker-farm": "^1.6.0" + } + }, + "node_modules/npm/node_modules/libnpm": { + "version": "3.0.1", + "inBundle": true, + "license": "ISC", + "dependencies": { + "bin-links": "^1.1.2", + "bluebird": "^3.5.3", + "find-npm-prefix": "^1.0.2", + "libnpmaccess": "^3.0.2", + "libnpmconfig": "^1.2.1", + "libnpmhook": "^5.0.3", + "libnpmorg": "^1.0.1", + "libnpmpublish": "^1.1.2", + "libnpmsearch": "^2.0.2", + "libnpmteam": "^1.0.2", + "lock-verify": "^2.0.2", + "npm-lifecycle": "^3.0.0", + "npm-logical-tree": "^1.2.1", + "npm-package-arg": "^6.1.0", + "npm-profile": "^4.0.2", + "npm-registry-fetch": "^4.0.0", + "npmlog": "^4.1.2", + "pacote": "^9.5.3", + "read-package-json": "^2.0.13", + "stringify-package": "^1.0.0" + } + }, + "node_modules/npm/node_modules/libnpmaccess": { + "version": "3.0.2", + "inBundle": true, + "license": "ISC", + "dependencies": { + "aproba": "^2.0.0", + "get-stream": "^4.0.0", + "npm-package-arg": "^6.1.0", + "npm-registry-fetch": "^4.0.0" + } + }, + "node_modules/npm/node_modules/libnpmconfig": { + "version": "1.2.1", + "inBundle": true, + "license": "ISC", + "dependencies": { + "figgy-pudding": "^3.5.1", + "find-up": "^3.0.0", + "ini": "^1.3.5" + } + }, + "node_modules/npm/node_modules/libnpmconfig/node_modules/find-up": { + "version": "3.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "locate-path": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/libnpmconfig/node_modules/locate-path": { + "version": "3.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "p-locate": "^3.0.0", + "path-exists": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/libnpmconfig/node_modules/p-limit": { + "version": "2.2.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "p-try": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/libnpmconfig/node_modules/p-locate": { + "version": "3.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "p-limit": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/libnpmconfig/node_modules/p-try": { + "version": "2.2.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/libnpmhook": { + "version": "5.0.3", + "inBundle": true, + "license": "ISC", + "dependencies": { + "aproba": "^2.0.0", + "figgy-pudding": "^3.4.1", + "get-stream": "^4.0.0", + "npm-registry-fetch": "^4.0.0" + } + }, + "node_modules/npm/node_modules/libnpmorg": { + "version": "1.0.1", + "inBundle": true, + "license": "ISC", + "dependencies": { + "aproba": "^2.0.0", + "figgy-pudding": "^3.4.1", + "get-stream": "^4.0.0", + "npm-registry-fetch": "^4.0.0" + } + }, + "node_modules/npm/node_modules/libnpmpublish": { + "version": "1.1.2", + "inBundle": true, + "license": "ISC", + "dependencies": { + "aproba": "^2.0.0", + "figgy-pudding": "^3.5.1", + "get-stream": "^4.0.0", + "lodash.clonedeep": "^4.5.0", + "normalize-package-data": "^2.4.0", + "npm-package-arg": "^6.1.0", + "npm-registry-fetch": "^4.0.0", + "semver": "^5.5.1", + "ssri": "^6.0.1" + } + }, + "node_modules/npm/node_modules/libnpmsearch": { + "version": "2.0.2", + "inBundle": true, + "license": "ISC", + "dependencies": { + "figgy-pudding": "^3.5.1", + "get-stream": "^4.0.0", + "npm-registry-fetch": "^4.0.0" + } + }, + "node_modules/npm/node_modules/libnpmteam": { + "version": "1.0.2", + "inBundle": true, + "license": "ISC", + "dependencies": { + "aproba": "^2.0.0", + "figgy-pudding": "^3.4.1", + "get-stream": "^4.0.0", + "npm-registry-fetch": "^4.0.0" + } + }, + "node_modules/npm/node_modules/libnpx": { + "version": "10.2.2", + "inBundle": true, + "license": "ISC", + "dependencies": { + "dotenv": "^5.0.1", + "npm-package-arg": "^6.0.0", + "rimraf": "^2.6.2", + "safe-buffer": "^5.1.0", + "update-notifier": "^2.3.0", + "which": "^1.3.0", + "y18n": "^4.0.0", + "yargs": "^11.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/locate-path": { + "version": "2.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "p-locate": "^2.0.0", + "path-exists": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/lock-verify": { + "version": "2.1.0", + "inBundle": true, + "license": "ISC", + "dependencies": { + "npm-package-arg": "^6.1.0", + "semver": "^5.4.1" + } + }, + "node_modules/npm/node_modules/lockfile": { + "version": "1.0.4", + "inBundle": true, + "license": "ISC", + "dependencies": { + "signal-exit": "^3.0.2" + } + }, + "node_modules/npm/node_modules/lodash._baseindexof": { + "version": "3.1.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/lodash._baseuniq": { + "version": "4.6.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "lodash._createset": "~4.0.0", + "lodash._root": "~3.0.0" + } + }, + "node_modules/npm/node_modules/lodash._bindcallback": { + "version": "3.0.1", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/lodash._cacheindexof": { + "version": "3.0.2", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/lodash._createcache": { + "version": "3.1.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "lodash._getnative": "^3.0.0" + } + }, + "node_modules/npm/node_modules/lodash._createset": { + "version": "4.0.3", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/lodash._getnative": { + "version": "3.9.1", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/lodash._root": { + "version": "3.0.1", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/lodash.clonedeep": { + "version": "4.5.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/lodash.restparam": { + "version": "3.6.1", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/lodash.union": { + "version": "4.6.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/lodash.uniq": { + "version": "4.5.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/lodash.without": { + "version": "4.4.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/lowercase-keys": { + "version": "1.0.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/lru-cache": { + "version": "5.1.1", + "inBundle": true, + "license": "ISC", + "dependencies": { + "yallist": "^3.0.2" + } + }, + "node_modules/npm/node_modules/make-dir": { + "version": "1.3.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "pify": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/make-fetch-happen": { + "version": "5.0.2", + "inBundle": true, + "license": "ISC", + "dependencies": { + "agentkeepalive": "^3.4.1", + "cacache": "^12.0.0", + "http-cache-semantics": "^3.8.1", + "http-proxy-agent": "^2.1.0", + "https-proxy-agent": "^2.2.3", + "lru-cache": "^5.1.1", + "mississippi": "^3.0.0", + "node-fetch-npm": "^2.0.2", + "promise-retry": "^1.1.1", + "socks-proxy-agent": "^4.0.0", + "ssri": "^6.0.0" + } + }, + "node_modules/npm/node_modules/map-age-cleaner": { + "version": "0.1.3", + "inBundle": true, + "license": "MIT", + "dependencies": { + "p-defer": "^1.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/meant": { + "version": "1.0.1", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/mem": { + "version": "4.3.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "map-age-cleaner": "^0.1.1", + "mimic-fn": "^2.0.0", + "p-is-promise": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/mem/node_modules/mimic-fn": { + "version": "2.1.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/mime-db": { + "version": "1.35.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/npm/node_modules/mime-types": { + "version": "2.1.19", + "inBundle": true, + "license": "MIT", + "dependencies": { + "mime-db": "~1.35.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/npm/node_modules/minimatch": { + "version": "3.0.4", + "inBundle": true, + "license": "ISC", + "dependencies": { + "brace-expansion": "^1.1.7" + }, + "engines": { + "node": "*" + } + }, + "node_modules/npm/node_modules/minizlib": { + "version": "1.3.3", + "inBundle": true, + "license": "MIT", + "dependencies": { + "minipass": "^2.9.0" + } + }, + "node_modules/npm/node_modules/minizlib/node_modules/minipass": { + "version": "2.9.0", + "inBundle": true, + "license": "ISC", + "dependencies": { + "safe-buffer": "^5.1.2", + "yallist": "^3.0.0" + } + }, + "node_modules/npm/node_modules/mississippi": { + "version": "3.0.0", + "inBundle": true, + "license": "BSD-2-Clause", + "dependencies": { + "concat-stream": "^1.5.0", + "duplexify": "^3.4.2", + "end-of-stream": "^1.1.0", + "flush-write-stream": "^1.0.0", + "from2": "^2.1.0", + "parallel-transform": "^1.1.0", + "pump": "^3.0.0", + "pumpify": "^1.3.3", + "stream-each": "^1.1.0", + "through2": "^2.0.0" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/npm/node_modules/mkdirp": { + "version": "0.5.5", + "inBundle": true, + "license": "MIT", + "dependencies": { + "minimist": "^1.2.5" + }, + "bin": { + "mkdirp": "bin/cmd.js" + } + }, + "node_modules/npm/node_modules/mkdirp/node_modules/minimist": { + "version": "1.2.5", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/move-concurrently": { + "version": "1.0.1", + "inBundle": true, + "license": "ISC", + "dependencies": { + "aproba": "^1.1.1", + "copy-concurrently": "^1.0.0", + "fs-write-stream-atomic": "^1.0.8", + "mkdirp": "^0.5.1", + "rimraf": "^2.5.4", + "run-queue": "^1.0.3" + } + }, + "node_modules/npm/node_modules/move-concurrently/node_modules/aproba": { + "version": "1.2.0", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/ms": { + "version": "2.1.1", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/mute-stream": { + "version": "0.0.7", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/nice-try": { + "version": "1.0.5", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/node-fetch-npm": { + "version": "2.0.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "encoding": "^0.1.11", + "json-parse-better-errors": "^1.0.0", + "safe-buffer": "^5.1.1" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/node-gyp": { + "version": "5.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "env-paths": "^2.2.0", + "glob": "^7.1.4", + "graceful-fs": "^4.2.2", + "mkdirp": "^0.5.1", + "nopt": "^4.0.1", + "npmlog": "^4.1.2", + "request": "^2.88.0", + "rimraf": "^2.6.3", + "semver": "^5.7.1", + "tar": "^4.4.12", + "which": "^1.3.1" + }, + "bin": { + "node-gyp": "bin/node-gyp.js" + }, + "engines": { + "node": ">= 6.0.0" + } + }, + "node_modules/npm/node_modules/nopt": { + "version": "4.0.3", + "inBundle": true, + "license": "ISC", + "dependencies": { + "abbrev": "1", + "osenv": "^0.1.4" + }, + "bin": { + "nopt": "bin/nopt.js" + } + }, + "node_modules/npm/node_modules/normalize-package-data": { + "version": "2.5.0", + "inBundle": true, + "license": "BSD-2-Clause", + "dependencies": { + "hosted-git-info": "^2.1.4", + "resolve": "^1.10.0", + "semver": "2 || 3 || 4 || 5", + "validate-npm-package-license": "^3.0.1" + } + }, + "node_modules/npm/node_modules/normalize-package-data/node_modules/resolve": { + "version": "1.10.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "path-parse": "^1.0.6" + } + }, + "node_modules/npm/node_modules/npm-audit-report": { + "version": "1.3.2", + "inBundle": true, + "license": "ISC", + "dependencies": { + "cli-table3": "^0.5.0", + "console-control-strings": "^1.1.0" + } + }, + "node_modules/npm/node_modules/npm-bundled": { + "version": "1.1.1", + "inBundle": true, + "license": "ISC", + "dependencies": { + "npm-normalize-package-bin": "^1.0.1" + } + }, + "node_modules/npm/node_modules/npm-cache-filename": { + "version": "1.0.2", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/npm-install-checks": { + "version": "3.0.2", + "inBundle": true, + "license": "BSD-2-Clause", + "dependencies": { + "semver": "^2.3.0 || 3.x || 4 || 5" + } + }, + "node_modules/npm/node_modules/npm-lifecycle": { + "version": "3.1.4", + "inBundle": true, + "license": "Artistic-2.0", + "dependencies": { + "byline": "^5.0.0", + "graceful-fs": "^4.1.15", + "node-gyp": "^5.0.2", + "resolve-from": "^4.0.0", + "slide": "^1.1.6", + "uid-number": "0.0.6", + "umask": "^1.1.0", + "which": "^1.3.1" + } + }, + "node_modules/npm/node_modules/npm-logical-tree": { + "version": "1.2.1", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/npm-normalize-package-bin": { + "version": "1.0.1", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/npm-package-arg": { + "version": "6.1.1", + "inBundle": true, + "license": "ISC", + "dependencies": { + "hosted-git-info": "^2.7.1", + "osenv": "^0.1.5", + "semver": "^5.6.0", + "validate-npm-package-name": "^3.0.0" + } + }, + "node_modules/npm/node_modules/npm-packlist": { + "version": "1.4.8", + "inBundle": true, + "license": "ISC", + "dependencies": { + "ignore-walk": "^3.0.1", + "npm-bundled": "^1.0.1", + "npm-normalize-package-bin": "^1.0.1" + } + }, + "node_modules/npm/node_modules/npm-pick-manifest": { + "version": "3.0.2", + "inBundle": true, + "license": "ISC", + "dependencies": { + "figgy-pudding": "^3.5.1", + "npm-package-arg": "^6.0.0", + "semver": "^5.4.1" + } + }, + "node_modules/npm/node_modules/npm-profile": { + "version": "4.0.4", + "inBundle": true, + "license": "ISC", + "dependencies": { + "aproba": "^1.1.2 || 2", + "figgy-pudding": "^3.4.1", + "npm-registry-fetch": "^4.0.0" + } + }, + "node_modules/npm/node_modules/npm-registry-fetch": { + "version": "4.0.4", + "inBundle": true, + "license": "ISC", + "dependencies": { + "bluebird": "^3.5.1", + "figgy-pudding": "^3.4.1", + "JSONStream": "^1.3.4", + "lru-cache": "^5.1.1", + "make-fetch-happen": "^5.0.0", + "npm-package-arg": "^6.1.0", + "safe-buffer": "^5.2.0" + } + }, + "node_modules/npm/node_modules/npm-registry-fetch/node_modules/safe-buffer": { + "version": "5.2.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/npm-run-path": { + "version": "2.0.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "path-key": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/npm-user-validate": { + "version": "1.0.0", + "inBundle": true, + "license": "BSD-2-Clause" + }, + "node_modules/npm/node_modules/npmlog": { + "version": "4.1.2", + "inBundle": true, + "license": "ISC", + "dependencies": { + "are-we-there-yet": "~1.1.2", + "console-control-strings": "~1.1.0", + "gauge": "~2.7.3", + "set-blocking": "~2.0.0" + } + }, + "node_modules/npm/node_modules/number-is-nan": { + "version": "1.0.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/oauth-sign": { + "version": "0.9.0", + "inBundle": true, + "license": "Apache-2.0", + "engines": { + "node": "*" + } + }, + "node_modules/npm/node_modules/object-assign": { + "version": "4.1.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/object-keys": { + "version": "1.0.12", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/npm/node_modules/object.getownpropertydescriptors": { + "version": "2.0.3", + "inBundle": true, + "license": "MIT", + "dependencies": { + "define-properties": "^1.1.2", + "es-abstract": "^1.5.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/npm/node_modules/once": { + "version": "1.4.0", + "inBundle": true, + "license": "ISC", + "dependencies": { + "wrappy": "1" + } + }, + "node_modules/npm/node_modules/opener": { + "version": "1.5.1", + "inBundle": true, + "license": "(WTFPL OR MIT)", + "bin": { + "opener": "bin/opener-bin.js" + } + }, + "node_modules/npm/node_modules/os-homedir": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/os-locale": { + "version": "3.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "execa": "^1.0.0", + "lcid": "^2.0.0", + "mem": "^4.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/os-locale/node_modules/cross-spawn": { + "version": "6.0.5", + "inBundle": true, + "license": "MIT", + "dependencies": { + "nice-try": "^1.0.4", + "path-key": "^2.0.1", + "semver": "^5.5.0", + "shebang-command": "^1.2.0", + "which": "^1.2.9" + }, + "engines": { + "node": ">=4.8" + } + }, + "node_modules/npm/node_modules/os-locale/node_modules/execa": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "cross-spawn": "^6.0.0", + "get-stream": "^4.0.0", + "is-stream": "^1.1.0", + "npm-run-path": "^2.0.0", + "p-finally": "^1.0.0", + "signal-exit": "^3.0.0", + "strip-eof": "^1.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/os-tmpdir": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/osenv": { + "version": "0.1.5", + "inBundle": true, + "license": "ISC", + "dependencies": { + "os-homedir": "^1.0.0", + "os-tmpdir": "^1.0.0" + } + }, + "node_modules/npm/node_modules/p-defer": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/p-finally": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/p-is-promise": { + "version": "2.1.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/p-limit": { + "version": "1.2.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "p-try": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/p-locate": { + "version": "2.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "p-limit": "^1.1.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/p-try": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/package-json": { + "version": "4.0.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "got": "^6.7.1", + "registry-auth-token": "^3.0.1", + "registry-url": "^3.0.3", + "semver": "^5.1.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/pacote": { + "version": "9.5.12", + "inBundle": true, + "license": "MIT", + "dependencies": { + "bluebird": "^3.5.3", + "cacache": "^12.0.2", + "chownr": "^1.1.2", + "figgy-pudding": "^3.5.1", + "get-stream": "^4.1.0", + "glob": "^7.1.3", + "infer-owner": "^1.0.4", + "lru-cache": "^5.1.1", + "make-fetch-happen": "^5.0.0", + "minimatch": "^3.0.4", + "minipass": "^2.3.5", + "mississippi": "^3.0.0", + "mkdirp": "^0.5.1", + "normalize-package-data": "^2.4.0", + "npm-normalize-package-bin": "^1.0.0", + "npm-package-arg": "^6.1.0", + "npm-packlist": "^1.1.12", + "npm-pick-manifest": "^3.0.0", + "npm-registry-fetch": "^4.0.0", + "osenv": "^0.1.5", + "promise-inflight": "^1.0.1", + "promise-retry": "^1.1.1", + "protoduck": "^5.0.1", + "rimraf": "^2.6.2", + "safe-buffer": "^5.1.2", + "semver": "^5.6.0", + "ssri": "^6.0.1", + "tar": "^4.4.10", + "unique-filename": "^1.1.1", + "which": "^1.3.1" + } + }, + "node_modules/npm/node_modules/pacote/node_modules/minipass": { + "version": "2.9.0", + "inBundle": true, + "license": "ISC", + "dependencies": { + "safe-buffer": "^5.1.2", + "yallist": "^3.0.0" + } + }, + "node_modules/npm/node_modules/parallel-transform": { + "version": "1.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "cyclist": "~0.2.2", + "inherits": "^2.0.3", + "readable-stream": "^2.1.5" + } + }, + "node_modules/npm/node_modules/parallel-transform/node_modules/readable-stream": { + "version": "2.3.6", + "inBundle": true, + "license": "MIT", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/npm/node_modules/parallel-transform/node_modules/string_decoder": { + "version": "1.1.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/npm/node_modules/path-exists": { + "version": "3.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/path-is-absolute": { + "version": "1.0.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/path-is-inside": { + "version": "1.0.2", + "inBundle": true, + "license": "(WTFPL OR MIT)" + }, + "node_modules/npm/node_modules/path-key": { + "version": "2.0.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/path-parse": { + "version": "1.0.6", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/performance-now": { + "version": "2.1.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/pify": { + "version": "3.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/prepend-http": { + "version": "1.0.4", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/process-nextick-args": { + "version": "2.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/promise-inflight": { + "version": "1.0.1", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/promise-retry": { + "version": "1.1.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "err-code": "^1.0.0", + "retry": "^0.10.0" + }, + "engines": { + "node": ">=0.12" + } + }, + "node_modules/npm/node_modules/promise-retry/node_modules/retry": { + "version": "0.10.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": "*" + } + }, + "node_modules/npm/node_modules/promzard": { + "version": "0.3.0", + "inBundle": true, + "license": "ISC", + "dependencies": { + "read": "1" + } + }, + "node_modules/npm/node_modules/proto-list": { + "version": "1.2.4", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/protoduck": { + "version": "5.0.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "genfun": "^5.0.0" + } + }, + "node_modules/npm/node_modules/prr": { + "version": "1.0.1", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/pseudomap": { + "version": "1.0.2", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/psl": { + "version": "1.1.29", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/pump": { + "version": "3.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "end-of-stream": "^1.1.0", + "once": "^1.3.1" + } + }, + "node_modules/npm/node_modules/pumpify": { + "version": "1.5.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "duplexify": "^3.6.0", + "inherits": "^2.0.3", + "pump": "^2.0.0" + } + }, + "node_modules/npm/node_modules/pumpify/node_modules/pump": { + "version": "2.0.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "end-of-stream": "^1.1.0", + "once": "^1.3.1" + } + }, + "node_modules/npm/node_modules/punycode": { + "version": "1.4.1", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/qrcode-terminal": { + "version": "0.12.0", + "inBundle": true, + "bin": { + "qrcode-terminal": "bin/qrcode-terminal.js" + } + }, + "node_modules/npm/node_modules/qs": { + "version": "6.5.2", + "inBundle": true, + "license": "BSD-3-Clause", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/npm/node_modules/query-string": { + "version": "6.8.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "decode-uri-component": "^0.2.0", + "split-on-first": "^1.0.0", + "strict-uri-encode": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/qw": { + "version": "1.0.1", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/rc": { + "version": "1.2.8", + "inBundle": true, + "license": "(BSD-2-Clause OR MIT OR Apache-2.0)", + "dependencies": { + "deep-extend": "^0.6.0", + "ini": "~1.3.0", + "minimist": "^1.2.0", + "strip-json-comments": "~2.0.1" + }, + "bin": { + "rc": "cli.js" + } + }, + "node_modules/npm/node_modules/rc/node_modules/minimist": { + "version": "1.2.5", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/read": { + "version": "1.0.7", + "inBundle": true, + "license": "ISC", + "dependencies": { + "mute-stream": "~0.0.4" + }, + "engines": { + "node": ">=0.8" + } + }, + "node_modules/npm/node_modules/read-cmd-shim": { + "version": "1.0.5", + "inBundle": true, + "license": "ISC", + "dependencies": { + "graceful-fs": "^4.1.2" + } + }, + "node_modules/npm/node_modules/read-installed": { + "version": "4.0.3", + "inBundle": true, + "license": "ISC", + "dependencies": { + "debuglog": "^1.0.1", + "read-package-json": "^2.0.0", + "readdir-scoped-modules": "^1.0.0", + "semver": "2 || 3 || 4 || 5", + "slide": "~1.1.3", + "util-extend": "^1.0.1" + }, + "optionalDependencies": { + "graceful-fs": "^4.1.2" + } + }, + "node_modules/npm/node_modules/read-package-json": { + "version": "2.1.1", + "inBundle": true, + "license": "ISC", + "dependencies": { + "glob": "^7.1.1", + "json-parse-better-errors": "^1.0.1", + "normalize-package-data": "^2.0.0", + "npm-normalize-package-bin": "^1.0.0" + }, + "optionalDependencies": { + "graceful-fs": "^4.1.2" + } + }, + "node_modules/npm/node_modules/read-package-tree": { + "version": "5.3.1", + "inBundle": true, + "license": "ISC", + "dependencies": { + "read-package-json": "^2.0.0", + "readdir-scoped-modules": "^1.0.0", + "util-promisify": "^2.1.0" + } + }, + "node_modules/npm/node_modules/readable-stream": { + "version": "3.6.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/npm/node_modules/readdir-scoped-modules": { + "version": "1.1.0", + "inBundle": true, + "license": "ISC", + "dependencies": { + "debuglog": "^1.0.1", + "dezalgo": "^1.0.0", + "graceful-fs": "^4.1.2", + "once": "^1.3.0" + } + }, + "node_modules/npm/node_modules/registry-auth-token": { + "version": "3.4.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "rc": "^1.1.6", + "safe-buffer": "^5.0.1" + } + }, + "node_modules/npm/node_modules/registry-url": { + "version": "3.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "rc": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/request": { + "version": "2.88.0", + "inBundle": true, + "license": "Apache-2.0", + "dependencies": { + "aws-sign2": "~0.7.0", + "aws4": "^1.8.0", + "caseless": "~0.12.0", + "combined-stream": "~1.0.6", + "extend": "~3.0.2", + "forever-agent": "~0.6.1", + "form-data": "~2.3.2", + "har-validator": "~5.1.0", + "http-signature": "~1.2.0", + "is-typedarray": "~1.0.0", + "isstream": "~0.1.2", + "json-stringify-safe": "~5.0.1", + "mime-types": "~2.1.19", + "oauth-sign": "~0.9.0", + "performance-now": "^2.1.0", + "qs": "~6.5.2", + "safe-buffer": "^5.1.2", + "tough-cookie": "~2.4.3", + "tunnel-agent": "^0.6.0", + "uuid": "^3.3.2" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/npm/node_modules/require-directory": { + "version": "2.1.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/require-main-filename": { + "version": "1.0.1", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/resolve-from": { + "version": "4.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/retry": { + "version": "0.12.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">= 4" + } + }, + "node_modules/npm/node_modules/rimraf": { + "version": "2.7.1", + "inBundle": true, + "license": "ISC", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/npm/node_modules/run-queue": { + "version": "1.0.3", + "inBundle": true, + "license": "ISC", + "dependencies": { + "aproba": "^1.1.1" + } + }, + "node_modules/npm/node_modules/run-queue/node_modules/aproba": { + "version": "1.2.0", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/safe-buffer": { + "version": "5.1.2", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/safer-buffer": { + "version": "2.1.2", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/semver": { + "version": "5.7.1", + "inBundle": true, + "license": "ISC", + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/npm/node_modules/semver-diff": { + "version": "2.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "semver": "^5.0.3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/set-blocking": { + "version": "2.0.0", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/sha": { + "version": "3.0.0", + "inBundle": true, + "license": "(BSD-2-Clause OR MIT)", + "dependencies": { + "graceful-fs": "^4.1.2" + } + }, + "node_modules/npm/node_modules/shebang-command": { + "version": "1.2.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "shebang-regex": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/shebang-regex": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/signal-exit": { + "version": "3.0.2", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/slide": { + "version": "1.1.6", + "inBundle": true, + "license": "ISC", + "engines": { + "node": "*" + } + }, + "node_modules/npm/node_modules/smart-buffer": { + "version": "4.1.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">= 6.0.0", + "npm": ">= 3.0.0" + } + }, + "node_modules/npm/node_modules/socks": { + "version": "2.3.3", + "inBundle": true, + "license": "MIT", + "dependencies": { + "ip": "1.1.5", + "smart-buffer": "^4.1.0" + }, + "engines": { + "node": ">= 6.0.0", + "npm": ">= 3.0.0" + } + }, + "node_modules/npm/node_modules/socks-proxy-agent": { + "version": "4.0.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "agent-base": "~4.2.1", + "socks": "~2.3.2" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/npm/node_modules/socks-proxy-agent/node_modules/agent-base": { + "version": "4.2.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "es6-promisify": "^5.0.0" + }, + "engines": { + "node": ">= 4.0.0" + } + }, + "node_modules/npm/node_modules/sorted-object": { + "version": "2.0.1", + "inBundle": true, + "license": "(WTFPL OR MIT)" + }, + "node_modules/npm/node_modules/sorted-union-stream": { + "version": "2.1.3", + "inBundle": true, + "license": "MIT", + "dependencies": { + "from2": "^1.3.0", + "stream-iterate": "^1.1.0" + } + }, + "node_modules/npm/node_modules/sorted-union-stream/node_modules/from2": { + "version": "1.3.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "inherits": "~2.0.1", + "readable-stream": "~1.1.10" + } + }, + "node_modules/npm/node_modules/sorted-union-stream/node_modules/isarray": { + "version": "0.0.1", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/sorted-union-stream/node_modules/readable-stream": { + "version": "1.1.14", + "inBundle": true, + "license": "MIT", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.1", + "isarray": "0.0.1", + "string_decoder": "~0.10.x" + } + }, + "node_modules/npm/node_modules/sorted-union-stream/node_modules/string_decoder": { + "version": "0.10.31", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/spdx-correct": { + "version": "3.0.0", + "inBundle": true, + "license": "Apache-2.0", + "dependencies": { + "spdx-expression-parse": "^3.0.0", + "spdx-license-ids": "^3.0.0" + } + }, + "node_modules/npm/node_modules/spdx-exceptions": { + "version": "2.1.0", + "inBundle": true, + "license": "CC-BY-3.0" + }, + "node_modules/npm/node_modules/spdx-expression-parse": { + "version": "3.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "spdx-exceptions": "^2.1.0", + "spdx-license-ids": "^3.0.0" + } + }, + "node_modules/npm/node_modules/spdx-license-ids": { + "version": "3.0.3", + "inBundle": true, + "license": "CC0-1.0" + }, + "node_modules/npm/node_modules/split-on-first": { + "version": "1.1.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=6" + } + }, + "node_modules/npm/node_modules/sshpk": { + "version": "1.14.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "asn1": "~0.2.3", + "assert-plus": "^1.0.0", + "dashdash": "^1.12.0", + "getpass": "^0.1.1", + "safer-buffer": "^2.0.2" + }, + "bin": { + "sshpk-conv": "bin/sshpk-conv", + "sshpk-sign": "bin/sshpk-sign", + "sshpk-verify": "bin/sshpk-verify" + }, + "engines": { + "node": ">=0.10.0" + }, + "optionalDependencies": { + "bcrypt-pbkdf": "^1.0.0", + "ecc-jsbn": "~0.1.1", + "jsbn": "~0.1.0", + "tweetnacl": "~0.14.0" + } + }, + "node_modules/npm/node_modules/ssri": { + "version": "6.0.1", + "inBundle": true, + "license": "ISC", + "dependencies": { + "figgy-pudding": "^3.5.1" + } + }, + "node_modules/npm/node_modules/stream-each": { + "version": "1.2.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "end-of-stream": "^1.1.0", + "stream-shift": "^1.0.0" + } + }, + "node_modules/npm/node_modules/stream-iterate": { + "version": "1.2.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "readable-stream": "^2.1.5", + "stream-shift": "^1.0.0" + } + }, + "node_modules/npm/node_modules/stream-iterate/node_modules/readable-stream": { + "version": "2.3.6", + "inBundle": true, + "license": "MIT", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/npm/node_modules/stream-iterate/node_modules/string_decoder": { + "version": "1.1.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/npm/node_modules/stream-shift": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/strict-uri-encode": { + "version": "2.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/string_decoder": { + "version": "1.3.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "safe-buffer": "~5.2.0" + } + }, + "node_modules/npm/node_modules/string_decoder/node_modules/safe-buffer": { + "version": "5.2.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/string-width": { + "version": "2.1.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^4.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/string-width/node_modules/ansi-regex": { + "version": "3.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/string-width/node_modules/is-fullwidth-code-point": { + "version": "2.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/string-width/node_modules/strip-ansi": { + "version": "4.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "ansi-regex": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/stringify-package": { + "version": "1.0.1", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/strip-ansi": { + "version": "3.0.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "ansi-regex": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/strip-eof": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/strip-json-comments": { + "version": "2.0.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/supports-color": { + "version": "5.4.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/tar": { + "version": "4.4.13", + "inBundle": true, + "license": "ISC", + "dependencies": { + "chownr": "^1.1.1", + "fs-minipass": "^1.2.5", + "minipass": "^2.8.6", + "minizlib": "^1.2.1", + "mkdirp": "^0.5.0", + "safe-buffer": "^5.1.2", + "yallist": "^3.0.3" + }, + "engines": { + "node": ">=4.5" + } + }, + "node_modules/npm/node_modules/tar/node_modules/minipass": { + "version": "2.9.0", + "inBundle": true, + "license": "ISC", + "dependencies": { + "safe-buffer": "^5.1.2", + "yallist": "^3.0.0" + } + }, + "node_modules/npm/node_modules/term-size": { + "version": "1.2.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "execa": "^0.7.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/text-table": { + "version": "0.2.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/through": { + "version": "2.3.8", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/through2": { + "version": "2.0.3", + "inBundle": true, + "license": "MIT", + "dependencies": { + "readable-stream": "^2.1.5", + "xtend": "~4.0.1" + } + }, + "node_modules/npm/node_modules/through2/node_modules/readable-stream": { + "version": "2.3.6", + "inBundle": true, + "license": "MIT", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/npm/node_modules/through2/node_modules/string_decoder": { + "version": "1.1.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/npm/node_modules/timed-out": { + "version": "4.0.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/tiny-relative-date": { + "version": "1.3.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/tough-cookie": { + "version": "2.4.3", + "inBundle": true, + "license": "BSD-3-Clause", + "dependencies": { + "psl": "^1.1.24", + "punycode": "^1.4.1" + }, + "engines": { + "node": ">=0.8" + } + }, + "node_modules/npm/node_modules/tunnel-agent": { + "version": "0.6.0", + "inBundle": true, + "license": "Apache-2.0", + "dependencies": { + "safe-buffer": "^5.0.1" + }, + "engines": { + "node": "*" + } + }, + "node_modules/npm/node_modules/tweetnacl": { + "version": "0.14.5", + "inBundle": true, + "license": "Unlicense", + "optional": true + }, + "node_modules/npm/node_modules/typedarray": { + "version": "0.0.6", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/uid-number": { + "version": "0.0.6", + "inBundle": true, + "license": "ISC", + "engines": { + "node": "*" + } + }, + "node_modules/npm/node_modules/umask": { + "version": "1.1.0", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/unique-filename": { + "version": "1.1.1", + "inBundle": true, + "license": "ISC", + "dependencies": { + "unique-slug": "^2.0.0" + } + }, + "node_modules/npm/node_modules/unique-slug": { + "version": "2.0.0", + "inBundle": true, + "license": "ISC", + "dependencies": { + "imurmurhash": "^0.1.4" + } + }, + "node_modules/npm/node_modules/unique-string": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "crypto-random-string": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/unpipe": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/npm/node_modules/unzip-response": { + "version": "2.0.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/update-notifier": { + "version": "2.5.0", + "inBundle": true, + "license": "BSD-2-Clause", + "dependencies": { + "boxen": "^1.2.1", + "chalk": "^2.0.1", + "configstore": "^3.0.0", + "import-lazy": "^2.1.0", + "is-ci": "^1.0.10", + "is-installed-globally": "^0.1.0", + "is-npm": "^1.0.0", + "latest-version": "^3.0.0", + "semver-diff": "^2.0.0", + "xdg-basedir": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/url-parse-lax": { + "version": "1.0.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "prepend-http": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/util-deprecate": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/util-extend": { + "version": "1.0.3", + "inBundle": true, + "license": "MIT" + }, + "node_modules/npm/node_modules/util-promisify": { + "version": "2.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "object.getownpropertydescriptors": "^2.0.3" + } + }, + "node_modules/npm/node_modules/uuid": { + "version": "3.3.3", + "inBundle": true, + "license": "MIT", + "bin": { + "uuid": "bin/uuid" + } + }, + "node_modules/npm/node_modules/validate-npm-package-license": { + "version": "3.0.4", + "inBundle": true, + "license": "Apache-2.0", + "dependencies": { + "spdx-correct": "^3.0.0", + "spdx-expression-parse": "^3.0.0" + } + }, + "node_modules/npm/node_modules/validate-npm-package-name": { + "version": "3.0.0", + "inBundle": true, + "license": "ISC", + "dependencies": { + "builtins": "^1.0.3" + } + }, + "node_modules/npm/node_modules/verror": { + "version": "1.10.0", + "engines": [ + "node >=0.6.0" + ], + "inBundle": true, + "license": "MIT", + "dependencies": { + "assert-plus": "^1.0.0", + "core-util-is": "1.0.2", + "extsprintf": "^1.2.0" + } + }, + "node_modules/npm/node_modules/wcwidth": { + "version": "1.0.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "defaults": "^1.0.3" + } + }, + "node_modules/npm/node_modules/which": { + "version": "1.3.1", + "inBundle": true, + "license": "ISC", + "dependencies": { + "isexe": "^2.0.0" + }, + "bin": { + "which": "bin/which" + } + }, + "node_modules/npm/node_modules/which-module": { + "version": "2.0.0", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/wide-align": { + "version": "1.1.2", + "inBundle": true, + "license": "ISC", + "dependencies": { + "string-width": "^1.0.2" + } + }, + "node_modules/npm/node_modules/wide-align/node_modules/string-width": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "code-point-at": "^1.0.0", + "is-fullwidth-code-point": "^1.0.0", + "strip-ansi": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/widest-line": { + "version": "2.0.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "string-width": "^2.1.1" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/worker-farm": { + "version": "1.7.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "errno": "~0.1.7" + } + }, + "node_modules/npm/node_modules/wrap-ansi": { + "version": "2.1.0", + "inBundle": true, + "license": "MIT", + "dependencies": { + "string-width": "^1.0.1", + "strip-ansi": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/wrap-ansi/node_modules/string-width": { + "version": "1.0.2", + "inBundle": true, + "license": "MIT", + "dependencies": { + "code-point-at": "^1.0.0", + "is-fullwidth-code-point": "^1.0.0", + "strip-ansi": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/npm/node_modules/wrappy": { + "version": "1.0.2", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/write-file-atomic": { + "version": "2.4.3", + "inBundle": true, + "license": "ISC", + "dependencies": { + "graceful-fs": "^4.1.11", + "imurmurhash": "^0.1.4", + "signal-exit": "^3.0.2" + } + }, + "node_modules/npm/node_modules/xdg-basedir": { + "version": "3.0.0", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=4" + } + }, + "node_modules/npm/node_modules/xtend": { + "version": "4.0.1", + "inBundle": true, + "license": "MIT", + "engines": { + "node": ">=0.4" + } + }, + "node_modules/npm/node_modules/y18n": { + "version": "4.0.0", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/yallist": { + "version": "3.0.3", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npm/node_modules/yargs": { + "version": "11.1.1", + "inBundle": true, + "license": "MIT", + "dependencies": { + "cliui": "^4.0.0", + "decamelize": "^1.1.1", + "find-up": "^2.1.0", + "get-caller-file": "^1.0.1", + "os-locale": "^3.1.0", + "require-directory": "^2.1.1", + "require-main-filename": "^1.0.1", + "set-blocking": "^2.0.0", + "string-width": "^2.0.0", + "which-module": "^2.0.0", + "y18n": "^3.2.1", + "yargs-parser": "^9.0.2" + } + }, + "node_modules/npm/node_modules/yargs-parser": { + "version": "9.0.2", + "inBundle": true, + "license": "ISC", + "dependencies": { + "camelcase": "^4.1.0" + } + }, + "node_modules/npm/node_modules/yargs/node_modules/y18n": { + "version": "3.2.1", + "inBundle": true, + "license": "ISC" + }, + "node_modules/npmlog": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/npmlog/-/npmlog-4.1.2.tgz", + "integrity": "sha512-2uUqazuKlTaSI/dC8AzicUck7+IrEaOnN/e0jd3Xtt1KcGpwx30v50mL7oPyr/h9bL3E4aZccVwpwP+5W9Vjkg==", + "dependencies": { + "are-we-there-yet": "~1.1.2", + "console-control-strings": "~1.1.0", + "gauge": "~2.7.3", + "set-blocking": "~2.0.0" + } + }, + "node_modules/nth-check": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/nth-check/-/nth-check-1.0.2.tgz", + "integrity": "sha512-WeBOdju8SnzPN5vTUJYxYUxLeXpCaVP5i5e0LF8fg7WORF2Wd7wFX/pk0tYZk7s8T+J7VLy0Da6J1+wCT0AtHg==", + "dependencies": { + "boolbase": "~1.0.0" + } + }, + "node_modules/number-is-nan": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/number-is-nan/-/number-is-nan-1.0.1.tgz", + "integrity": "sha1-CXtgK1NCKlIsGvuHkDGDNpQaAR0=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/nwsapi": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/nwsapi/-/nwsapi-2.2.0.tgz", + "integrity": "sha512-h2AatdwYH+JHiZpv7pt/gSX1XoRGb7L/qSIeuqA6GwYoF9w1vP1cw42TO0aI2pNyshRK5893hNSl+1//vHK7hQ==", + "dev": true + }, + "node_modules/oauth": { + "version": "0.9.15", + "resolved": "https://registry.npmjs.org/oauth/-/oauth-0.9.15.tgz", + "integrity": "sha1-vR/vr2hslrdUda7VGWQS/2DPucE=" + }, + "node_modules/oauth-sign": { + "version": "0.9.0", + "resolved": "https://registry.npmjs.org/oauth-sign/-/oauth-sign-0.9.0.tgz", + "integrity": "sha512-fexhUFFPTGV8ybAtSIGbV6gOkSv8UtRbDBnAyLQw4QPKkgNlsH2ByPGtMUqdWkos6YCRmAqViwgZrJc/mRDzZQ==", + "engines": { + "node": "*" + } + }, + "node_modules/object-assign": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", + "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-component": { + "version": "0.0.3", + "resolved": "https://registry.npmjs.org/object-component/-/object-component-0.0.3.tgz", + "integrity": "sha1-8MaapQ78lbhmwYb0AKM3acsvEpE=" + }, + "node_modules/object-copy": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/object-copy/-/object-copy-0.1.0.tgz", + "integrity": "sha1-fn2Fi3gb18mRpBupde04EnVOmYw=", + "dependencies": { + "copy-descriptor": "^0.1.0", + "define-property": "^0.2.5", + "kind-of": "^3.0.3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-copy/node_modules/define-property": { + "version": "0.2.5", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", + "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", + "dependencies": { + "is-descriptor": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-copy/node_modules/is-buffer": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz", + "integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==" + }, + "node_modules/object-copy/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-inspect": { + "version": "1.7.0", + "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.7.0.tgz", + "integrity": "sha512-a7pEHdh1xKIAgTySUGgLMx/xwDZskN1Ud6egYYN3EdRW4ZMPNEDUTF+hwy2LUC+Bl+SyLXANnwz/jyh/qutKUw==" + }, + "node_modules/object-is": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/object-is/-/object-is-1.1.2.tgz", + "integrity": "sha512-5lHCz+0uufF6wZ7CRFWJN3hp8Jqblpgve06U5CMQ3f//6iDjPr2PEo9MWCjEssDsa+UZEL4PkFpr+BMop6aKzQ==", + "dependencies": { + "define-properties": "^1.1.3", + "es-abstract": "^1.17.5" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/object-keys": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.1.1.tgz", + "integrity": "sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/object-to-arguments": { + "version": "0.0.8", + "resolved": "https://registry.npmjs.org/object-to-arguments/-/object-to-arguments-0.0.8.tgz", + "integrity": "sha512-BfWfuAwuhdH1bhMG5EG90WE/eckkBhBvnke8eSEkCDXoLE9Jk5JwYGTbCx1ehGwV48HvBkn62VukPBdlMUOY9w==", + "dependencies": { + "inspect-parameters-declaration": "0.0.10", + "magicli": "0.0.5", + "split-skip": "0.0.2", + "stringify-parameters": "0.0.4", + "unpack-string": "0.0.2" + }, + "bin": { + "object-to-arguments": "bin/cli.js" + } + }, + "node_modules/object-to-arguments/node_modules/inspect-parameters-declaration": { + "version": "0.0.10", + "resolved": "https://registry.npmjs.org/inspect-parameters-declaration/-/inspect-parameters-declaration-0.0.10.tgz", + "integrity": "sha512-L8/Bvt9iDXQTZ63xY5/MAyvzz+FagR/qGh1kIXvUpsno3AAE0Z95d6QO51zrcMGaEGpwh/57idfMxTxbvRmytg==", + "dependencies": { + "magicli": "0.0.5", + "split-skip": "0.0.2", + "stringify-parameters": "0.0.4", + "unpack-string": "0.0.2" + }, + "bin": { + "inspect-parameters-declaration": "bin/cli.js" + } + }, + "node_modules/object-to-arguments/node_modules/magicli": { + "version": "0.0.5", + "resolved": "https://registry.npmjs.org/magicli/-/magicli-0.0.5.tgz", + "integrity": "sha1-zufQ+7THBRiqyxHsPrfiX/SaSSE=", + "dependencies": { + "commander": "^2.9.0", + "get-stdin": "^5.0.1", + "inspect-function": "^0.2.1", + "pipe-functions": "^1.2.0" + } + }, + "node_modules/object-visit": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/object-visit/-/object-visit-1.0.1.tgz", + "integrity": "sha1-95xEk68MU3e1n+OdOV5BBC3QRbs=", + "dependencies": { + "isobject": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object.assign": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.0.tgz", + "integrity": "sha512-exHJeq6kBKj58mqGyTQ9DFvrZC/eR6OwxzoM9YRoGBqrXYonaFyGiFMuc9VZrXf7DarreEwMpurG3dd+CNyW5w==", + "dependencies": { + "define-properties": "^1.1.2", + "function-bind": "^1.1.1", + "has-symbols": "^1.0.0", + "object-keys": "^1.0.11" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/object.getownpropertydescriptors": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/object.getownpropertydescriptors/-/object.getownpropertydescriptors-2.1.0.tgz", + "integrity": "sha512-Z53Oah9A3TdLoblT7VKJaTDdXdT+lQO+cNpKVnya5JDe9uLvzu1YyY1yFDFrcxrlRgWrEFH0jJtD/IbuwjcEVg==", + "dependencies": { + "define-properties": "^1.1.3", + "es-abstract": "^1.17.0-next.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/object.pick": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/object.pick/-/object.pick-1.3.0.tgz", + "integrity": "sha1-h6EKxMFpS9Lhy/U1kaZhQftd10c=", + "dependencies": { + "isobject": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/obuf": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/obuf/-/obuf-1.1.2.tgz", + "integrity": "sha512-PX1wu0AmAdPqOL1mWhqmlOd8kOIZQwGZw6rh7uby9fTc5lhaOWFLX3I6R1hrF9k3zUY40e6igsLGkDXK92LJNg==", + "dev": true + }, + "node_modules/on-finished": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz", + "integrity": "sha1-IPEzZIGwg811M3mSoWlxqi2QaUc=", + "dependencies": { + "ee-first": "1.1.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/on-headers": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/on-headers/-/on-headers-1.0.2.tgz", + "integrity": "sha512-pZAE+FJLoyITytdqK0U5s+FIpjN0JP3OzFi/u8Rx+EV5/W+JTWGXG8xFzevE7AjBfDqHv/8vL8qQsIhHnqRkrA==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/once": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", + "integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=", + "dependencies": { + "wrappy": "1" + } + }, + "node_modules/opentype.js": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/opentype.js/-/opentype.js-1.3.3.tgz", + "integrity": "sha512-/qIY/+WnKGlPIIPhbeNjynfD2PO15G9lA/xqlX2bDH+4lc3Xz5GCQ68mqxj3DdUv6AJqCeaPvuAoH8mVL0zcuA==", + "dependencies": { + "string.prototype.codepointat": "^0.2.1", + "tiny-inflate": "^1.0.3" + }, + "bin": { + "ot": "bin/ot" + }, + "engines": { + "node": ">= 8.0.0" + } + }, + "node_modules/opn": { + "version": "5.5.0", + "resolved": "https://registry.npmjs.org/opn/-/opn-5.5.0.tgz", + "integrity": "sha512-PqHpggC9bLV0VeWcdKhkpxY+3JTzetLSqTCWL/z/tFIbI6G8JCjondXklT1JinczLz2Xib62sSp0T/gKT4KksA==", + "dev": true, + "dependencies": { + "is-wsl": "^1.1.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/optionator": { + "version": "0.8.3", + "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.8.3.tgz", + "integrity": "sha512-+IW9pACdk3XWmmTXG8m3upGUJst5XRGzxMRjXzAuJ1XnIFNvfhjjIuYkDvysnPQ7qzqVzLt78BCruntqRhWQbA==", + "dev": true, + "dependencies": { + "deep-is": "~0.1.3", + "fast-levenshtein": "~2.0.6", + "levn": "~0.3.0", + "prelude-ls": "~1.1.2", + "type-check": "~0.3.2", + "word-wrap": "~1.2.3" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/orderedmap": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/orderedmap/-/orderedmap-1.1.1.tgz", + "integrity": "sha512-3Ux8um0zXbVacKUkcytc0u3HgC0b0bBLT+I60r2J/En72cI0nZffqrA7Xtf2Hqs27j1g82llR5Mhbd0Z1XW4AQ==" + }, + "node_modules/original": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/original/-/original-1.0.2.tgz", + "integrity": "sha512-hyBVl6iqqUOJ8FqRe+l/gS8H+kKYjrEndd5Pm1MfBtsEKA038HkkdbAl/72EAXGyonD/PFsvmVG+EvcIpliMBg==", + "dev": true, + "dependencies": { + "url-parse": "^1.4.3" + } + }, + "node_modules/os-browserify": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/os-browserify/-/os-browserify-0.3.0.tgz", + "integrity": "sha1-hUNzx/XCMVkU/Jv8a9gjj92h7Cc=", + "dev": true + }, + "node_modules/os-homedir": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz", + "integrity": "sha1-/7xJiDNuDoM94MFox+8VISGqf7M=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/os-tmpdir": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz", + "integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/osenv": { + "version": "0.1.5", + "resolved": "https://registry.npmjs.org/osenv/-/osenv-0.1.5.tgz", + "integrity": "sha512-0CWcCECdMVc2Rw3U5w9ZjqX6ga6ubk1xDVKxtBQPK7wis/0F2r9T6k4ydGYhecl7YUBxBVxhL5oisPsNxAPe2g==", + "dependencies": { + "os-homedir": "^1.0.0", + "os-tmpdir": "^1.0.0" + } + }, + "node_modules/p-debounce": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/p-debounce/-/p-debounce-1.0.0.tgz", + "integrity": "sha1-y38svu/YegnrqGHhErZ1J+Yh4v0=", + "engines": { + "node": ">=4" + } + }, + "node_modules/p-finally": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/p-finally/-/p-finally-1.0.0.tgz", + "integrity": "sha1-P7z7FbiZpEEjs0ttzBi3JDNqLK4=", + "engines": { + "node": ">=4" + } + }, + "node_modules/p-limit": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.3.0.tgz", + "integrity": "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==", + "dependencies": { + "p-try": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/p-locate": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz", + "integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==", + "dependencies": { + "p-limit": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/p-map": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/p-map/-/p-map-2.1.0.tgz", + "integrity": "sha512-y3b8Kpd8OAN444hxfBbFfj1FY/RjtTd8tzYwhUqNYXx0fXx2iX4maP4Qr6qhIKbQXI02wTLAda4fYUbDagTUFw==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/p-retry": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/p-retry/-/p-retry-3.0.1.tgz", + "integrity": "sha512-XE6G4+YTTkT2a0UWb2kjZe8xNwf8bIbnqpc/IS/idOBVhyves0mK5OJgeocjx7q5pvX/6m23xuzVPYT1uGM73w==", + "dev": true, + "dependencies": { + "retry": "^0.12.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/p-try": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", + "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", + "engines": { + "node": ">=6" + } + }, + "node_modules/package-json": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/package-json/-/package-json-4.0.1.tgz", + "integrity": "sha1-iGmgQBJTZhxMTKPabCEh7VVfXu0=", + "dependencies": { + "got": "^6.7.1", + "registry-auth-token": "^3.0.1", + "registry-url": "^3.0.3", + "semver": "^5.1.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/pako": { + "version": "1.0.11", + "resolved": "https://registry.npmjs.org/pako/-/pako-1.0.11.tgz", + "integrity": "sha512-4hLB8Py4zZce5s4yd9XzopqwVv/yGNhV1Bl8NTmCq1763HeK2+EwVTv+leGeL13Dnh2wfbqowVPXCIO0z4taYw==" + }, + "node_modules/parallel-transform": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/parallel-transform/-/parallel-transform-1.2.0.tgz", + "integrity": "sha512-P2vSmIu38uIlvdcU7fDkyrxj33gTUy/ABO5ZUbGowxNCopBq/OoD42bP4UmMrJoPyk4Uqf0mu3mtWBhHCZD8yg==", + "dev": true, + "dependencies": { + "cyclist": "^1.0.1", + "inherits": "^2.0.3", + "readable-stream": "^2.1.5" + } + }, + "node_modules/parallel-transform/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/parent-module": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/parent-module/-/parent-module-1.0.1.tgz", + "integrity": "sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==", + "dependencies": { + "callsites": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/parse-asn1": { + "version": "5.1.6", + "resolved": "https://registry.npmjs.org/parse-asn1/-/parse-asn1-5.1.6.tgz", + "integrity": "sha512-RnZRo1EPU6JBnra2vGHj0yhp6ebyjBZpmUCLHWiFhxlzvBCCpAuZ7elsBp1PVAbQN0/04VD/19rfzlBSwLstMw==", + "dev": true, + "dependencies": { + "asn1.js": "^5.2.0", + "browserify-aes": "^1.0.0", + "evp_bytestokey": "^1.0.0", + "pbkdf2": "^3.0.3", + "safe-buffer": "^5.1.1" + } + }, + "node_modules/parse-json": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-5.0.0.tgz", + "integrity": "sha512-OOY5b7PAEFV0E2Fir1KOkxchnZNCdowAJgQ5NuxjpBKTRP3pQhwkrkxqQjeoKJ+fO7bCpmIZaogI4eZGDMEGOw==", + "dependencies": { + "@babel/code-frame": "^7.0.0", + "error-ex": "^1.3.1", + "json-parse-better-errors": "^1.0.1", + "lines-and-columns": "^1.1.6" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/parse-passwd": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/parse-passwd/-/parse-passwd-1.0.0.tgz", + "integrity": "sha1-bVuTSkVpk7I9N/QKOC1vFmao5cY=", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/parse5": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/parse5/-/parse5-3.0.3.tgz", + "integrity": "sha512-rgO9Zg5LLLkfJF9E6CCmXlSE4UVceloys8JrFqCcHloC3usd/kJCyPDwH2SOlzix2j3xaP9sUX3e8+kvkuleAA==", + "dependencies": { + "@types/node": "*" + } + }, + "node_modules/parseqs": { + "version": "0.0.5", + "resolved": "https://registry.npmjs.org/parseqs/-/parseqs-0.0.5.tgz", + "integrity": "sha1-1SCKNzjkZ2bikbouoXNoSSGouJ0=", + "dependencies": { + "better-assert": "~1.0.0" + } + }, + "node_modules/parseuri": { + "version": "0.0.5", + "resolved": "https://registry.npmjs.org/parseuri/-/parseuri-0.0.5.tgz", + "integrity": "sha1-gCBKUNTbt3m/3G6+J3jZDkvOMgo=", + "dependencies": { + "better-assert": "~1.0.0" + } + }, + "node_modules/parseurl": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz", + "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/pascalcase": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/pascalcase/-/pascalcase-0.1.1.tgz", + "integrity": "sha1-s2PlXoAGym/iF4TS2yK9FdeRfxQ=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/passport": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/passport/-/passport-0.4.1.tgz", + "integrity": "sha512-IxXgZZs8d7uFSt3eqNjM9NQ3g3uQCW5avD8mRNoXV99Yig50vjuaez6dQK2qC0kVWPRTujxY0dWgGfT09adjYg==", + "dependencies": { + "passport-strategy": "1.x.x", + "pause": "0.0.1" + }, + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/passport-google-oauth20": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/passport-google-oauth20/-/passport-google-oauth20-2.0.0.tgz", + "integrity": "sha512-KSk6IJ15RoxuGq7D1UKK/8qKhNfzbLeLrG3gkLZ7p4A6DBCcv7xpyQwuXtWdpyR0+E0mwkpjY1VfPOhxQrKzdQ==", + "dependencies": { + "passport-oauth2": "1.x.x" + }, + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/passport-local": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/passport-local/-/passport-local-1.0.0.tgz", + "integrity": "sha1-H+YyaMkudWBmJkN+O5BmYsFbpu4=", + "dependencies": { + "passport-strategy": "1.x.x" + }, + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/passport-oauth2": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/passport-oauth2/-/passport-oauth2-1.5.0.tgz", + "integrity": "sha512-kqBt6vR/5VlCK8iCx1/KpY42kQ+NEHZwsSyt4Y6STiNjU+wWICG1i8ucc1FapXDGO15C5O5VZz7+7vRzrDPXXQ==", + "dependencies": { + "base64url": "3.x.x", + "oauth": "0.9.x", + "passport-strategy": "1.x.x", + "uid2": "0.0.x", + "utils-merge": "1.x.x" + }, + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/passport-strategy": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/passport-strategy/-/passport-strategy-1.0.0.tgz", + "integrity": "sha1-tVOaqPwiWj0a0XlHbd8ja0QPUuQ=", + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/path-browserify": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/path-browserify/-/path-browserify-0.0.1.tgz", + "integrity": "sha512-BapA40NHICOS+USX9SN4tyhq+A2RrN/Ws5F0Z5aMHDp98Fl86lX8Oti8B7uN93L4Ifv4fHOEA+pQw87gmMO/lQ==", + "dev": true + }, + "node_modules/path-dirname": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/path-dirname/-/path-dirname-1.0.2.tgz", + "integrity": "sha1-zDPSTVJeCZpTiMAzbG4yuRYGCeA=" + }, + "node_modules/path-exists": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz", + "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=", + "engines": { + "node": ">=4" + } + }, + "node_modules/path-is-absolute": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", + "integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/path-is-inside": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/path-is-inside/-/path-is-inside-1.0.2.tgz", + "integrity": "sha1-NlQX3t5EQw0cEa9hAn+s8HS9/FM=" + }, + "node_modules/path-key": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/path-key/-/path-key-2.0.1.tgz", + "integrity": "sha1-QRyttXTFoUDTpLGRDUDYDMn0C0A=", + "engines": { + "node": ">=4" + } + }, + "node_modules/path-parse": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.6.tgz", + "integrity": "sha512-GSmOT2EbHrINBf9SR7CDELwlJ8AENk3Qn7OikK4nFYAu3Ote2+JYNVvkpAEQm3/TLNEJFD/xZJjzyxg3KBWOzw==" + }, + "node_modules/path-to-regexp": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz", + "integrity": "sha1-32BBeABfUi8V60SQ5yR6G/qmf4w=" + }, + "node_modules/path-type": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-type/-/path-type-4.0.0.tgz", + "integrity": "sha512-gDKb8aZMDeD/tZWs9P6+q0J9Mwkdl6xMV8TjnGP3qJVJ06bdMgkbBlLU8IdfOsIsFz2BW1rNVT3XuNEl8zPAvw==", + "engines": { + "node": ">=8" + } + }, + "node_modules/pathval": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/pathval/-/pathval-1.1.0.tgz", + "integrity": "sha1-uULm1L3mUwBe9rcTYd74cn0GReA=", + "engines": { + "node": "*" + } + }, + "node_modules/pause": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/pause/-/pause-0.0.1.tgz", + "integrity": "sha1-HUCLP9t2kjuVQ9lvtMnf1TXZy10=" + }, + "node_modules/pbkdf2": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.1.2.tgz", + "integrity": "sha512-iuh7L6jA7JEGu2WxDwtQP1ddOpaJNC4KlDEFfdQajSGgGPNi4OyDc2R7QnbY2bR9QjBVGwgvTdNJZoE7RaxUMA==", + "dev": true, + "dependencies": { + "create-hash": "^1.1.2", + "create-hmac": "^1.1.4", + "ripemd160": "^2.0.1", + "safe-buffer": "^5.0.1", + "sha.js": "^2.4.8" + }, + "engines": { + "node": ">=0.12" + } + }, + "node_modules/pdf-parse": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/pdf-parse/-/pdf-parse-1.1.1.tgz", + "integrity": "sha512-v6ZJ/efsBpGrGGknjtq9J/oC8tZWq0KWL5vQrk2GlzLEQPUDB1ex+13Rmidl1neNN358Jn9EHZw5y07FFtaC7A==", + "dependencies": { + "debug": "^3.1.0", + "node-ensure": "^0.0.0" + }, + "engines": { + "node": ">=6.8.1" + } + }, + "node_modules/pdfjs": { + "version": "2.3.9", + "resolved": "https://registry.npmjs.org/pdfjs/-/pdfjs-2.3.9.tgz", + "integrity": "sha512-SK4xI0UbtNo9Ub1BMVgxphdL0Cy1iN9p2SxWG98JLnVe569WF8IO60K03UxlnmSV2s5P0MV1DEuZOlUslRlinA==", + "dependencies": { + "@rkusa/linebreak": "^1.0.0", + "opentype.js": "^1.3.3", + "pako": "^1.0.11", + "readable-stream": "^3.6.0", + "unorm": "^1.6.0", + "uuid": "^7.0.3" + }, + "engines": { + "node": ">=7" + } + }, + "node_modules/pdfjs-dist": { + "version": "2.4.456", + "resolved": "https://registry.npmjs.org/pdfjs-dist/-/pdfjs-dist-2.4.456.tgz", + "integrity": "sha512-yckJEHq3F48hcp6wStEpbN9McOj328Ib09UrBlGAKxvN2k+qYPN5iq6TH6jD1C0pso7zTep+g/CKsYgdrQd5QA==" + }, + "node_modules/pdfjs/node_modules/uuid": { + "version": "7.0.3", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-7.0.3.tgz", + "integrity": "sha512-DPSke0pXhTZgoF/d+WSt2QaKMCFSfx7QegxEWT+JOuHF5aWrKEn0G+ztjuJg/gG8/ItK+rbPCD/yNv8yyih6Cg==", + "bin": { + "uuid": "dist/bin/uuid" + } + }, + "node_modules/pend": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/pend/-/pend-1.2.0.tgz", + "integrity": "sha1-elfrVQpng/kRUzH89GY9XI4AelA=" + }, + "node_modules/performance-now": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/performance-now/-/performance-now-2.1.0.tgz", + "integrity": "sha1-Ywn04OX6kT7BxpMHrjZLSzd8nns=" + }, + "node_modules/picomatch": { + "version": "2.2.2", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.2.2.tgz", + "integrity": "sha512-q0M/9eZHzmr0AulXyPwNfZjtwZ/RBZlbN3K3CErVrk50T2ASYI7Bye0EvekFY3IP1Nt2DHu0re+V2ZHIpMkuWg==", + "dev": true, + "engines": { + "node": ">=8.6" + } + }, + "node_modules/pify": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/pify/-/pify-4.0.1.tgz", + "integrity": "sha512-uB80kBFb/tfd68bVleG9T5GGsGPjJrLAUpR5PZIrhBnIaRTQRjqdJSsIKkOP6OAIFbj7GOrcudc5pNjZ+geV2g==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/pinkie": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/pinkie/-/pinkie-2.0.4.tgz", + "integrity": "sha1-clVrgM+g1IqXToDnckjoDtT3+HA=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/pinkie-promise": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/pinkie-promise/-/pinkie-promise-2.0.1.tgz", + "integrity": "sha1-ITXW36ejWMBprJsXh3YogihFD/o=", + "dependencies": { + "pinkie": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/pipe-functions": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/pipe-functions/-/pipe-functions-1.3.0.tgz", + "integrity": "sha512-6Rtbp7criZRwedlvWbUYxqlqJoAlMvYHo2UcRWq79xZ54vZcaNHpVBOcWkX3ErT2aUA69tv+uiv4zKJbhD/Wgg==" + }, + "node_modules/pkg-dir": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-2.0.0.tgz", + "integrity": "sha1-9tXREJ4Z1j7fQo4L1X4Sd3YVM0s=", + "dev": true, + "dependencies": { + "find-up": "^2.1.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/pkg-dir/node_modules/find-up": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-2.1.0.tgz", + "integrity": "sha1-RdG35QbHF93UgndaK3eSCjwMV6c=", + "dev": true, + "dependencies": { + "locate-path": "^2.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/pkg-dir/node_modules/locate-path": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-2.0.0.tgz", + "integrity": "sha1-K1aLJl7slExtnA3pw9u7ygNUzY4=", + "dev": true, + "dependencies": { + "p-locate": "^2.0.0", + "path-exists": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/pkg-dir/node_modules/p-limit": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-1.3.0.tgz", + "integrity": "sha512-vvcXsLAJ9Dr5rQOPk7toZQZJApBl2K4J6dANSsEuh6QI41JYcsS/qhTGa9ErIUUgK3WNQoJYvylxvjqmiqEA9Q==", + "dev": true, + "dependencies": { + "p-try": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/pkg-dir/node_modules/p-locate": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-2.0.0.tgz", + "integrity": "sha1-IKAQOyIqcMj9OcwuWAaA893l7EM=", + "dev": true, + "dependencies": { + "p-limit": "^1.1.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/pkg-dir/node_modules/p-try": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/p-try/-/p-try-1.0.0.tgz", + "integrity": "sha1-y8ec26+P1CKOE/Yh8rGiN8GyB7M=", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/please-upgrade-node": { + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/please-upgrade-node/-/please-upgrade-node-3.2.0.tgz", + "integrity": "sha512-gQR3WpIgNIKwBMVLkpMUeR3e1/E1y42bqDQZfql+kDeXd8COYfM8PQA4X6y7a8u9Ua9FHmsrrmirW2vHs45hWg==", + "dependencies": { + "semver-compare": "^1.0.0" + } + }, + "node_modules/plist": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/plist/-/plist-1.2.0.tgz", + "integrity": "sha1-CEtQk93JJQbiWfh0uNmxr7jHlZM=", + "dependencies": { + "base64-js": "0.0.8", + "util-deprecate": "1.0.2", + "xmlbuilder": "4.0.0", + "xmldom": "0.1.x" + } + }, + "node_modules/plist/node_modules/base64-js": { + "version": "0.0.8", + "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-0.0.8.tgz", + "integrity": "sha1-EQHpVE9KdrG8OybUUsqW16NeeXg=", + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/pn": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/pn/-/pn-1.1.0.tgz", + "integrity": "sha512-2qHaIQr2VLRFoxe2nASzsV6ef4yOOH+Fi9FBOVH6cqeSgUnoyySPZkxzLuzd+RYOQTRpROA0ztTMqxROKSb/nA==", + "dev": true + }, + "node_modules/popper.js": { + "version": "1.16.1", + "resolved": "https://registry.npmjs.org/popper.js/-/popper.js-1.16.1.tgz", + "integrity": "sha512-Wb4p1J4zyFTbM+u6WuO4XstYx4Ky9Cewe4DWrel7B0w6VVICvPwdOpotjzcf6eD8TsckVnIMNONQyPIUFOUbCQ==" + }, + "node_modules/portfinder": { + "version": "1.0.26", + "resolved": "https://registry.npmjs.org/portfinder/-/portfinder-1.0.26.tgz", + "integrity": "sha512-Xi7mKxJHHMI3rIUrnm/jjUgwhbYMkp/XKEcZX3aG4BrumLpq3nmoQMX+ClYnDZnZ/New7IatC1no5RX0zo1vXQ==", + "dev": true, + "dependencies": { + "async": "^2.6.2", + "debug": "^3.1.1", + "mkdirp": "^0.5.1" + }, + "engines": { + "node": ">= 0.12.0" + } + }, + "node_modules/posix-character-classes": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/posix-character-classes/-/posix-character-classes-0.1.1.tgz", + "integrity": "sha1-AerA/jta9xoqbAL+q7jB/vfgDqs=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/postcss": { + "version": "7.0.27", + "resolved": "https://registry.npmjs.org/postcss/-/postcss-7.0.27.tgz", + "integrity": "sha512-WuQETPMcW9Uf1/22HWUWP9lgsIC+KEHg2kozMflKjbeUtw9ujvFX6QmIfozaErDkmLWS9WEnEdEe6Uo9/BNTdQ==", + "dev": true, + "dependencies": { + "chalk": "^2.4.2", + "source-map": "^0.6.1", + "supports-color": "^6.1.0" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/postcss-modules-extract-imports": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/postcss-modules-extract-imports/-/postcss-modules-extract-imports-2.0.0.tgz", + "integrity": "sha512-LaYLDNS4SG8Q5WAWqIJgdHPJrDDr/Lv775rMBFUbgjTz6j34lUznACHcdRWroPvXANP2Vj7yNK57vp9eFqzLWQ==", + "dev": true, + "dependencies": { + "postcss": "^7.0.5" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/postcss-modules-local-by-default": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/postcss-modules-local-by-default/-/postcss-modules-local-by-default-2.0.6.tgz", + "integrity": "sha512-oLUV5YNkeIBa0yQl7EYnxMgy4N6noxmiwZStaEJUSe2xPMcdNc8WmBQuQCx18H5psYbVxz8zoHk0RAAYZXP9gA==", + "dev": true, + "dependencies": { + "postcss": "^7.0.6", + "postcss-selector-parser": "^6.0.0", + "postcss-value-parser": "^3.3.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/postcss-modules-scope": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/postcss-modules-scope/-/postcss-modules-scope-2.2.0.tgz", + "integrity": "sha512-YyEgsTMRpNd+HmyC7H/mh3y+MeFWevy7V1evVhJWewmMbjDHIbZbOXICC2y+m1xI1UVfIT1HMW/O04Hxyu9oXQ==", + "dev": true, + "dependencies": { + "postcss": "^7.0.6", + "postcss-selector-parser": "^6.0.0" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/postcss-modules-values": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/postcss-modules-values/-/postcss-modules-values-2.0.0.tgz", + "integrity": "sha512-Ki7JZa7ff1N3EIMlPnGTZfUMe69FFwiQPnVSXC9mnn3jozCRBYIxiZd44yJOV2AmabOo4qFf8s0dC/+lweG7+w==", + "dev": true, + "dependencies": { + "icss-replace-symbols": "^1.1.0", + "postcss": "^7.0.6" + } + }, + "node_modules/postcss-selector-parser": { + "version": "6.0.2", + "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-6.0.2.tgz", + "integrity": "sha512-36P2QR59jDTOAiIkqEprfJDsoNrvwFei3eCqKd1Y0tUsBimsq39BLp7RD+JWny3WgB1zGhJX8XVePwm9k4wdBg==", + "dev": true, + "dependencies": { + "cssesc": "^3.0.0", + "indexes-of": "^1.0.1", + "uniq": "^1.0.1" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/postcss-value-parser": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz", + "integrity": "sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ==" + }, + "node_modules/postcss/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/postcss/node_modules/supports-color": { + "version": "6.1.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-6.1.0.tgz", + "integrity": "sha512-qe1jfm1Mg7Nq/NSh6XE24gPXROEVsWHxC1LIx//XNlD9iw7YZQGjZNjYN7xGaEG6iKdA8EtNFW6R0gjnVXp+wQ==", + "dev": true, + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/prebuild-install": { + "version": "5.3.3", + "resolved": "https://registry.npmjs.org/prebuild-install/-/prebuild-install-5.3.3.tgz", + "integrity": "sha512-GV+nsUXuPW2p8Zy7SarF/2W/oiK8bFQgJcncoJ0d7kRpekEA0ftChjfEaF9/Y+QJEc/wFR7RAEa8lYByuUIe2g==", + "dependencies": { + "detect-libc": "^1.0.3", + "expand-template": "^2.0.3", + "github-from-package": "0.0.0", + "minimist": "^1.2.0", + "mkdirp": "^0.5.1", + "napi-build-utils": "^1.0.1", + "node-abi": "^2.7.0", + "noop-logger": "^0.1.1", + "npmlog": "^4.0.1", + "pump": "^3.0.0", + "rc": "^1.2.7", + "simple-get": "^3.0.3", + "tar-fs": "^2.0.0", + "tunnel-agent": "^0.6.0", + "which-pm-runs": "^1.0.0" + }, + "bin": { + "prebuild-install": "bin.js" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/prelude-ls": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/prelude-ls/-/prelude-ls-1.1.2.tgz", + "integrity": "sha1-IZMqVJ9eUv/ZqCf1cOBL5iqX2lQ=", + "dev": true, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/prepend-http": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/prepend-http/-/prepend-http-1.0.4.tgz", + "integrity": "sha1-1PRWKwzjaW5BrFLQ4ALlemNdxtw=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/probe-image-size": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/probe-image-size/-/probe-image-size-4.1.1.tgz", + "integrity": "sha512-42LqKZqTLxH/UvAZ2/cKhAsR4G/Y6B7i7fI2qtQu9hRBK4YjS6gqO+QRtwTjvojUx4+/+JuOMzLoFyRecT9qRw==", + "dependencies": { + "any-promise": "^1.3.0", + "deepmerge": "^4.0.0", + "inherits": "^2.0.3", + "next-tick": "^1.0.0", + "request": "^2.83.0", + "stream-parser": "~0.3.1" + } + }, + "node_modules/probe-image-size/node_modules/deepmerge": { + "version": "4.2.2", + "resolved": "https://registry.npmjs.org/deepmerge/-/deepmerge-4.2.2.tgz", + "integrity": "sha512-FJ3UgI4gIl+PHZm53knsuSFpE+nESMr7M4v9QcgB7S63Kj/6WqMiFQJpBBYz1Pt+66bZpP3Q7Lye0Oo9MPKEdg==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/process": { + "version": "0.11.10", + "resolved": "https://registry.npmjs.org/process/-/process-0.11.10.tgz", + "integrity": "sha1-czIwDoQBYb2j5podHZGn1LwW8YI=", + "dev": true, + "engines": { + "node": ">= 0.6.0" + } + }, + "node_modules/process-nextick-args": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz", + "integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==" + }, + "node_modules/progress": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/progress/-/progress-2.0.3.tgz", + "integrity": "sha512-7PiHtLll5LdnKIMw100I+8xJXR5gW2QwWYkT6iJva0bXitZKa/XMrSbdmg3r2Xnaidz9Qumd0VPaMrZlF9V9sA==", + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/promise": { + "version": "7.3.1", + "resolved": "https://registry.npmjs.org/promise/-/promise-7.3.1.tgz", + "integrity": "sha512-nolQXZ/4L+bP/UGlkfaIujX9BKxGwmQ9OT4mOt5yvy8iK1h3wqTEJCijzGANTCCl9nWjY41juyAn2K3Q1hLLTg==", + "dependencies": { + "asap": "~2.0.3" + } + }, + "node_modules/promise-inflight": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/promise-inflight/-/promise-inflight-1.0.1.tgz", + "integrity": "sha1-mEcocL8igTL8vdhoEputEsPAKeM=", + "dev": true + }, + "node_modules/prop-types": { + "version": "15.7.2", + "resolved": "https://registry.npmjs.org/prop-types/-/prop-types-15.7.2.tgz", + "integrity": "sha512-8QQikdH7//R2vurIJSutZ1smHYTcLpRWEOlHnzcWHmBYrOGUysKwSsrC89BCiFj3CbrfJ/nXFdJepOVrY1GCHQ==", + "dependencies": { + "loose-envify": "^1.4.0", + "object-assign": "^4.1.1", + "react-is": "^16.8.1" + } + }, + "node_modules/prosemirror-commands": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/prosemirror-commands/-/prosemirror-commands-1.1.4.tgz", + "integrity": "sha512-kj4Qi+8h3EpJtZuuEDwZ9h2/QNGWDsIX/CzjmClxi9GhxWyBUMVUvIFk0mgdqHyX20lLeGmOpc0TLA5aPzgpWg==", + "dependencies": { + "prosemirror-model": "^1.0.0", + "prosemirror-state": "^1.0.0", + "prosemirror-transform": "^1.0.0" + } + }, + "node_modules/prosemirror-dev-tools": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/prosemirror-dev-tools/-/prosemirror-dev-tools-3.0.1.tgz", + "integrity": "sha512-ZLMqrdIpDstBG6kP6Pt62FB7sAiLKqtW/oWvoBqlHw1p2ovNErR1/5aR1Uxrs6dgb4nPDxbu2uMKf/yI7ok7zQ==", + "dependencies": { + "@babel/runtime": "^7.0.0", + "@emotion/core": "^10.0.28", + "@emotion/styled": "^10.0.27", + "emotion": "^10.0.27", + "html": "^1.0.0", + "jsondiffpatch": "^0.4.1", + "nanoid": "^3.1.6", + "prop-types": "^15.7.2", + "prosemirror-model": ">=1.0.0", + "prosemirror-state": ">=1.0.0", + "react-dock": "^0.2.4", + "react-json-tree": "^0.11.2", + "unstated": "^2.1.1" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/prosemirror-find-replace": { + "version": "0.9.0", + "resolved": "https://registry.npmjs.org/prosemirror-find-replace/-/prosemirror-find-replace-0.9.0.tgz", + "integrity": "sha1-QgsENNF5xdBJD44hSNhVGpVJY4I=" + }, + "node_modules/prosemirror-history": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/prosemirror-history/-/prosemirror-history-1.1.3.tgz", + "integrity": "sha512-zGDotijea+vnfnyyUGyiy1wfOQhf0B/b6zYcCouBV8yo6JmrE9X23M5q7Nf/nATywEZbgRLG70R4DmfSTC+gfg==", + "dependencies": { + "prosemirror-state": "^1.2.2", + "prosemirror-transform": "^1.0.0", + "rope-sequence": "^1.3.0" + } + }, + "node_modules/prosemirror-inputrules": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/prosemirror-inputrules/-/prosemirror-inputrules-1.1.2.tgz", + "integrity": "sha512-Ja5Z3BWestlHYGvtSGqyvxMeB8QEuBjlHM8YnKtLGUXMDp965qdDV4goV8lJb17kIWHk7e7JNj6Catuoa3302g==", + "dependencies": { + "prosemirror-state": "^1.0.0", + "prosemirror-transform": "^1.0.0" + } + }, + "node_modules/prosemirror-keymap": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/prosemirror-keymap/-/prosemirror-keymap-1.1.4.tgz", + "integrity": "sha512-Al8cVUOnDFL4gcI5IDlG6xbZ0aOD/i3B17VT+1JbHWDguCgt/lBHVTHUBcKvvbSg6+q/W4Nj1Fu6bwZSca3xjg==", + "dependencies": { + "prosemirror-state": "^1.0.0", + "w3c-keyname": "^2.2.0" + } + }, + "node_modules/prosemirror-model": { + "version": "1.10.0", + "resolved": "https://registry.npmjs.org/prosemirror-model/-/prosemirror-model-1.10.0.tgz", + "integrity": "sha512-xTMbbO2q4abs5lJdeRvk/SrftNfZlMdvChKziTiK+OKtP8LkQI8uw39u4S5zqyflrmW3Or6+qnyFPf1p4v2u1g==", + "dependencies": { + "orderedmap": "^1.1.0" + } + }, + "node_modules/prosemirror-schema-list": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/prosemirror-schema-list/-/prosemirror-schema-list-1.1.2.tgz", + "integrity": "sha512-dgM9PwtM4twa5WsgSYMB+J8bwjnR43DAD3L9MsR9rKm/nZR5Y85xcjB7gusVMSsbQ2NomMZF03RE6No6mTnclQ==", + "dependencies": { + "prosemirror-model": "^1.0.0", + "prosemirror-transform": "^1.0.0" + } + }, + "node_modules/prosemirror-state": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/prosemirror-state/-/prosemirror-state-1.3.3.tgz", + "integrity": "sha512-PLXh2VJsIgvlgSTH6I2Yg6vk1CzPDp21DFreVpQtDMY2S6WaMmrQgDTLRcsrD8X38v8Yc873H7+ogdGzyIPn+w==", + "dependencies": { + "prosemirror-model": "^1.0.0", + "prosemirror-transform": "^1.0.0" + } + }, + "node_modules/prosemirror-transform": { + "version": "1.2.6", + "resolved": "https://registry.npmjs.org/prosemirror-transform/-/prosemirror-transform-1.2.6.tgz", + "integrity": "sha512-DyV6cRip8//GIHTrqBe2B7I8VjPFQZYuBuB4clpguq1SrS9lLponoBt/0XRWxETkCVsxYSvwE76X0zo6AZhwaw==", + "dependencies": { + "prosemirror-model": "^1.0.0" + } + }, + "node_modules/prosemirror-view": { + "version": "1.15.0", + "resolved": "https://registry.npmjs.org/prosemirror-view/-/prosemirror-view-1.15.0.tgz", + "integrity": "sha512-a7Q76sO/DCZr2UX2Rv1Rbw52cr9kVIz8iJOf/rq4mPN1NA3lugq2BKJgUMwlB3U4utyw3olLigqouRHM48NJyg==", + "dependencies": { + "prosemirror-model": "^1.1.0", + "prosemirror-state": "^1.0.0", + "prosemirror-transform": "^1.1.0" + } + }, + "node_modules/proxy-addr": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.6.tgz", + "integrity": "sha512-dh/frvCBVmSsDYzw6n926jv974gddhkFPfiN8hPOi30Wax25QZyZEGveluCgliBnqmuM+UJmBErbAUFIoDbjOw==", + "dependencies": { + "forwarded": "~0.1.2", + "ipaddr.js": "1.9.1" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/proxy-from-env": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/proxy-from-env/-/proxy-from-env-1.1.0.tgz", + "integrity": "sha512-D+zkORCbA9f1tdWRK0RaCR3GPv50cMxcrz4X8k5LTSUD1Dkw47mKJEZQNunItRTkWwgtaUSo1RVFRIG9ZXiFYg==" + }, + "node_modules/prr": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/prr/-/prr-1.0.1.tgz", + "integrity": "sha1-0/wRS6BplaRexok/SEzrHXj19HY=", + "dev": true + }, + "node_modules/pseudomap": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/pseudomap/-/pseudomap-1.0.2.tgz", + "integrity": "sha1-8FKijacOYYkX7wqKw0wa5aaChrM=" + }, + "node_modules/psl": { + "version": "1.8.0", + "resolved": "https://registry.npmjs.org/psl/-/psl-1.8.0.tgz", + "integrity": "sha512-RIdOzyoavK+hA18OGGWDqUTsCLhtA7IcZ/6NCs4fFJaHBDab+pDDmDIByWFRQJq2Cd7r1OoQxBGKOaztq+hjIQ==" + }, + "node_modules/pstree.remy": { + "version": "1.1.7", + "resolved": "https://registry.npmjs.org/pstree.remy/-/pstree.remy-1.1.7.tgz", + "integrity": "sha512-xsMgrUwRpuGskEzBFkH8NmTimbZ5PcPup0LA8JJkHIm2IMUbQcpo3yeLNWVrufEYjh8YwtSVh0xz6UeWc5Oh5A==" + }, + "node_modules/public-encrypt": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/public-encrypt/-/public-encrypt-4.0.3.tgz", + "integrity": "sha512-zVpa8oKZSz5bTMTFClc1fQOnyyEzpl5ozpi1B5YcvBrdohMjH2rfsBtyXcuNuwjsDIXmBYlF2N5FlJYhR29t8Q==", + "dev": true, + "dependencies": { + "bn.js": "^4.1.0", + "browserify-rsa": "^4.0.0", + "create-hash": "^1.1.0", + "parse-asn1": "^5.0.0", + "randombytes": "^2.0.1", + "safe-buffer": "^5.1.2" + } + }, + "node_modules/public-encrypt/node_modules/bn.js": { + "version": "4.12.0", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", + "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==", + "dev": true + }, + "node_modules/pug": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/pug/-/pug-2.0.4.tgz", + "integrity": "sha512-XhoaDlvi6NIzL49nu094R2NA6P37ijtgMDuWE+ofekDChvfKnzFal60bhSdiy8y2PBO6fmz3oMEIcfpBVRUdvw==", + "dependencies": { + "pug-code-gen": "^2.0.2", + "pug-filters": "^3.1.1", + "pug-lexer": "^4.1.0", + "pug-linker": "^3.0.6", + "pug-load": "^2.0.12", + "pug-parser": "^5.0.1", + "pug-runtime": "^2.0.5", + "pug-strip-comments": "^1.0.4" + } + }, + "node_modules/pug-attrs": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/pug-attrs/-/pug-attrs-2.0.4.tgz", + "integrity": "sha512-TaZ4Z2TWUPDJcV3wjU3RtUXMrd3kM4Wzjbe3EWnSsZPsJ3LDI0F3yCnf2/W7PPFF+edUFQ0HgDL1IoxSz5K8EQ==", + "dependencies": { + "constantinople": "^3.0.1", + "js-stringify": "^1.0.1", + "pug-runtime": "^2.0.5" + } + }, + "node_modules/pug-code-gen": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/pug-code-gen/-/pug-code-gen-2.0.2.tgz", + "integrity": "sha512-kROFWv/AHx/9CRgoGJeRSm+4mLWchbgpRzTEn8XCiwwOy6Vh0gAClS8Vh5TEJ9DBjaP8wCjS3J6HKsEsYdvaCw==", + "dependencies": { + "constantinople": "^3.1.2", + "doctypes": "^1.1.0", + "js-stringify": "^1.0.1", + "pug-attrs": "^2.0.4", + "pug-error": "^1.3.3", + "pug-runtime": "^2.0.5", + "void-elements": "^2.0.1", + "with": "^5.0.0" + } + }, + "node_modules/pug-error": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/pug-error/-/pug-error-1.3.3.tgz", + "integrity": "sha512-qE3YhESP2mRAWMFJgKdtT5D7ckThRScXRwkfo+Erqga7dyJdY3ZquspprMCj/9sJ2ijm5hXFWQE/A3l4poMWiQ==" + }, + "node_modules/pug-filters": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/pug-filters/-/pug-filters-3.1.1.tgz", + "integrity": "sha512-lFfjNyGEyVWC4BwX0WyvkoWLapI5xHSM3xZJFUhx4JM4XyyRdO8Aucc6pCygnqV2uSgJFaJWW3Ft1wCWSoQkQg==", + "dependencies": { + "clean-css": "^4.1.11", + "constantinople": "^3.0.1", + "jstransformer": "1.0.0", + "pug-error": "^1.3.3", + "pug-walk": "^1.1.8", + "resolve": "^1.1.6", + "uglify-js": "^2.6.1" + } + }, + "node_modules/pug-lexer": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/pug-lexer/-/pug-lexer-4.1.0.tgz", + "integrity": "sha512-i55yzEBtjm0mlplW4LoANq7k3S8gDdfC6+LThGEvsK4FuobcKfDAwt6V4jKPH9RtiE3a2Akfg5UpafZ1OksaPA==", + "dependencies": { + "character-parser": "^2.1.1", + "is-expression": "^3.0.0", + "pug-error": "^1.3.3" + } + }, + "node_modules/pug-linker": { + "version": "3.0.6", + "resolved": "https://registry.npmjs.org/pug-linker/-/pug-linker-3.0.6.tgz", + "integrity": "sha512-bagfuHttfQOpANGy1Y6NJ+0mNb7dD2MswFG2ZKj22s8g0wVsojpRlqveEQHmgXXcfROB2RT6oqbPYr9EN2ZWzg==", + "dependencies": { + "pug-error": "^1.3.3", + "pug-walk": "^1.1.8" + } + }, + "node_modules/pug-load": { + "version": "2.0.12", + "resolved": "https://registry.npmjs.org/pug-load/-/pug-load-2.0.12.tgz", + "integrity": "sha512-UqpgGpyyXRYgJs/X60sE6SIf8UBsmcHYKNaOccyVLEuT6OPBIMo6xMPhoJnqtB3Q3BbO4Z3Bjz5qDsUWh4rXsg==", + "dependencies": { + "object-assign": "^4.1.0", + "pug-walk": "^1.1.8" + } + }, + "node_modules/pug-parser": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/pug-parser/-/pug-parser-5.0.1.tgz", + "integrity": "sha512-nGHqK+w07p5/PsPIyzkTQfzlYfuqoiGjaoqHv1LjOv2ZLXmGX1O+4Vcvps+P4LhxZ3drYSljjq4b+Naid126wA==", + "dependencies": { + "pug-error": "^1.3.3", + "token-stream": "0.0.1" + } + }, + "node_modules/pug-runtime": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/pug-runtime/-/pug-runtime-2.0.5.tgz", + "integrity": "sha512-P+rXKn9un4fQY77wtpcuFyvFaBww7/91f3jHa154qU26qFAnOe6SW1CbIDcxiG5lLK9HazYrMCCuDvNgDQNptw==" + }, + "node_modules/pug-strip-comments": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/pug-strip-comments/-/pug-strip-comments-1.0.4.tgz", + "integrity": "sha512-i5j/9CS4yFhSxHp5iKPHwigaig/VV9g+FgReLJWWHEHbvKsbqL0oP/K5ubuLco6Wu3Kan5p7u7qk8A4oLLh6vw==", + "dependencies": { + "pug-error": "^1.3.3" + } + }, + "node_modules/pug-walk": { + "version": "1.1.8", + "resolved": "https://registry.npmjs.org/pug-walk/-/pug-walk-1.1.8.tgz", + "integrity": "sha512-GMu3M5nUL3fju4/egXwZO0XLi6fW/K3T3VTgFQ14GxNi8btlxgT5qZL//JwZFm/2Fa64J/PNS8AZeys3wiMkVA==" + }, + "node_modules/pump": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz", + "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", + "dependencies": { + "end-of-stream": "^1.1.0", + "once": "^1.3.1" + } + }, + "node_modules/pumpify": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/pumpify/-/pumpify-1.5.1.tgz", + "integrity": "sha512-oClZI37HvuUJJxSKKrC17bZ9Cu0ZYhEAGPsPUy9KlMUmv9dKX2o77RUmq7f3XjIxbwyGwYzbzQ1L2Ks8sIradQ==", + "dev": true, + "dependencies": { + "duplexify": "^3.6.0", + "inherits": "^2.0.3", + "pump": "^2.0.0" + } + }, + "node_modules/pumpify/node_modules/pump": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/pump/-/pump-2.0.1.tgz", + "integrity": "sha512-ruPMNRkN3MHP1cWJc9OWr+T/xDP0jhXYCLfJcBuX54hhfIBnaQmAUMfDcG4DM5UMWByBbJY69QSphm3jtDKIkA==", + "dev": true, + "dependencies": { + "end-of-stream": "^1.1.0", + "once": "^1.3.1" + } + }, + "node_modules/punycode": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.1.1.tgz", + "integrity": "sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==", + "engines": { + "node": ">=6" + } + }, + "node_modules/puppeteer": { + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/puppeteer/-/puppeteer-3.3.0.tgz", + "integrity": "sha512-23zNqRltZ1PPoK28uRefWJ/zKb5Jhnzbbwbpcna2o5+QMn17F0khq5s1bdH3vPlyj+J36pubccR8wiNA/VE0Vw==", + "hasInstallScript": true, + "dependencies": { + "debug": "^4.1.0", + "extract-zip": "^2.0.0", + "https-proxy-agent": "^4.0.0", + "mime": "^2.0.3", + "progress": "^2.0.1", + "proxy-from-env": "^1.0.0", + "rimraf": "^3.0.2", + "tar-fs": "^2.0.0", + "unbzip2-stream": "^1.3.3", + "ws": "^7.2.3" + }, + "engines": { + "node": ">=10.18.1" + } + }, + "node_modules/puppeteer/node_modules/agent-base": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/agent-base/-/agent-base-5.1.1.tgz", + "integrity": "sha512-TMeqbNl2fMW0nMjTEPOwe3J/PRFP4vqeoNuQMG0HlMrtm5QxKqdvAkZ1pRBQ/ulIyDD5Yq0nJ7YbdD8ey0TO3g==", + "engines": { + "node": ">= 6.0.0" + } + }, + "node_modules/puppeteer/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/puppeteer/node_modules/https-proxy-agent": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/https-proxy-agent/-/https-proxy-agent-4.0.0.tgz", + "integrity": "sha512-zoDhWrkR3of1l9QAL8/scJZyLu8j/gBkcwcaQOZh7Gyh/+uJQzGVETdgT30akuwkpL8HTRfssqI3BZuV18teDg==", + "dependencies": { + "agent-base": "5", + "debug": "4" + }, + "engines": { + "node": ">= 6.0.0" + } + }, + "node_modules/puppeteer/node_modules/mime": { + "version": "2.4.6", + "resolved": "https://registry.npmjs.org/mime/-/mime-2.4.6.tgz", + "integrity": "sha512-RZKhC3EmpBchfTGBVb8fb+RL2cWyw/32lshnsETttkBAyAUXSGHxbEJWWRXc751DrIxG1q04b8QwMbAwkRPpUA==", + "bin": { + "mime": "cli.js" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/pure-color": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/pure-color/-/pure-color-1.3.0.tgz", + "integrity": "sha1-H+Bk+wrIUfDeYTIKi/eWg2Qi8z4=" + }, + "node_modules/q": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/q/-/q-1.5.1.tgz", + "integrity": "sha1-fjL3W0E4EpHQRhHxvxQQmsAGUdc=", + "engines": { + "node": ">=0.6.0", + "teleport": ">=0.2.0" + } + }, + "node_modules/qs": { + "version": "6.5.2", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.5.2.tgz", + "integrity": "sha512-N5ZAX4/LxJmF+7wN74pUD6qAh9/wnvdQcjq9TZjevvXzSUo7bfmw91saqMjzGS2xq91/odN2dW/WOl7qQHNDGA==", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/query-string": { + "version": "6.13.1", + "resolved": "https://registry.npmjs.org/query-string/-/query-string-6.13.1.tgz", + "integrity": "sha512-RfoButmcK+yCta1+FuU8REvisx1oEzhMKwhLUNcepQTPGcNMp1sIqjnfCtfnvGSQZQEhaBHvccujtWoUV3TTbA==", + "dependencies": { + "decode-uri-component": "^0.2.0", + "split-on-first": "^1.0.0", + "strict-uri-encode": "^2.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/querystring": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/querystring/-/querystring-0.2.0.tgz", + "integrity": "sha1-sgmEkgO7Jd+CDadW50cAWHhSFiA=", + "dev": true, + "engines": { + "node": ">=0.4.x" + } + }, + "node_modules/querystring-es3": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/querystring-es3/-/querystring-es3-0.2.1.tgz", + "integrity": "sha1-nsYfeQSYdXB9aUFFlv2Qek1xHnM=", + "dev": true, + "engines": { + "node": ">=0.4.x" + } + }, + "node_modules/querystringify": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/querystringify/-/querystringify-2.1.1.tgz", + "integrity": "sha512-w7fLxIRCRT7U8Qu53jQnJyPkYZIaR4n5151KMfcJlO/A9397Wxb1amJvROTK6TOnp7PfoAmg/qXiNHI+08jRfA==", + "dev": true + }, + "node_modules/raf-schd": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/raf-schd/-/raf-schd-4.0.2.tgz", + "integrity": "sha512-VhlMZmGy6A6hrkJWHLNTGl5gtgMUm+xfGza6wbwnE914yeQ5Ybm18vgM734RZhMgfw4tacUrWseGZlpUrrakEQ==" + }, + "node_modules/random-bytes": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/random-bytes/-/random-bytes-1.0.0.tgz", + "integrity": "sha1-T2ih3Arli9P7lYSMMDJNt11kNgs=", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/randombytes": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/randombytes/-/randombytes-2.1.0.tgz", + "integrity": "sha512-vYl3iOX+4CKUWuxGi9Ukhie6fsqXqS9FE2Zaic4tNFD2N2QQaXOMFbuKK4QmDHC0JO6B1Zp41J0LpT0oR68amQ==", + "dev": true, + "dependencies": { + "safe-buffer": "^5.1.0" + } + }, + "node_modules/randomfill": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/randomfill/-/randomfill-1.0.4.tgz", + "integrity": "sha512-87lcbR8+MhcWcUiQ+9e+Rwx8MyR2P7qnt15ynUlbm3TU/fjbgz4GsvfSUDTemtCCtVCqb4ZcEFlyPNTh9bBTLw==", + "dev": true, + "dependencies": { + "randombytes": "^2.0.5", + "safe-buffer": "^5.1.0" + } + }, + "node_modules/range-parser": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", + "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/raw-body": { + "version": "2.4.0", + "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.4.0.tgz", + "integrity": "sha512-4Oz8DUIwdvoa5qMJelxipzi/iJIi40O5cGV1wNYp5hvZP8ZN0T+jiNkL0QepXs+EsQ9XJ8ipEDoiH70ySUJP3Q==", + "dependencies": { + "bytes": "3.1.0", + "http-errors": "1.7.2", + "iconv-lite": "0.4.24", + "unpipe": "1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/raw-loader": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/raw-loader/-/raw-loader-1.0.0.tgz", + "integrity": "sha512-Uqy5AqELpytJTRxYT4fhltcKPj0TyaEpzJDcGz7DFJi+pQOOi3GjR/DOdxTkTsF+NzhnldIoG6TORaBlInUuqA==", + "dependencies": { + "loader-utils": "^1.1.0", + "schema-utils": "^1.0.0" + }, + "engines": { + "node": ">= 6.9.0" + } + }, + "node_modules/raw-loader/node_modules/schema-utils": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", + "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", + "dependencies": { + "ajv": "^6.1.0", + "ajv-errors": "^1.0.0", + "ajv-keywords": "^3.1.0" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/rc": { + "version": "1.2.8", + "resolved": "https://registry.npmjs.org/rc/-/rc-1.2.8.tgz", + "integrity": "sha512-y3bGgqKj3QBdxLbLkomlohkvsA8gdAiUQlSBJnBhfn+BPxg4bc62d8TcBW15wavDfgexCgccckhcZvywyQYPOw==", + "dependencies": { + "deep-extend": "^0.6.0", + "ini": "~1.3.0", + "minimist": "^1.2.0", + "strip-json-comments": "~2.0.1" + }, + "bin": { + "rc": "cli.js" + } + }, + "node_modules/rc-switch": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/rc-switch/-/rc-switch-1.9.0.tgz", + "integrity": "sha512-Isas+egaK6qSk64jaEw4GgPStY4umYDbT7ZY93bZF1Af+b/JEsKsJdNOU2qG3WI0Z6tXo2DDq0kJCv8Yhu0zww==", + "dependencies": { + "classnames": "^2.2.1", + "prop-types": "^15.5.6", + "react-lifecycles-compat": "^3.0.4" + } + }, + "node_modules/react": { + "version": "16.13.1", + "resolved": "https://registry.npmjs.org/react/-/react-16.13.1.tgz", + "integrity": "sha512-YMZQQq32xHLX0bz5Mnibv1/LHb3Sqzngu7xstSM+vrkE5Kzr9xE0yMByK5kMoTK30YVJE61WfbxIFFvfeDKT1w==", + "dependencies": { + "loose-envify": "^1.1.0", + "object-assign": "^4.1.1", + "prop-types": "^15.6.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/react-audio-waveform": { + "version": "0.0.5", + "resolved": "https://registry.npmjs.org/react-audio-waveform/-/react-audio-waveform-0.0.5.tgz", + "integrity": "sha512-4dJwhl+LQRuywzmmjuhWT5GueT3Ai2ZhB+loVxg0sRdhplyDp96xAu10/V/+J25Cl7YqNtl2DWSxvSoI/i6l6w==" + }, + "node_modules/react-autosuggest": { + "version": "9.4.3", + "resolved": "https://registry.npmjs.org/react-autosuggest/-/react-autosuggest-9.4.3.tgz", + "integrity": "sha512-wFbp5QpgFQRfw9cwKvcgLR8theikOUkv8PFsuLYqI2PUgVlx186Cz8MYt5bLxculi+jxGGUUVt+h0esaBZZouw==", + "dependencies": { + "prop-types": "^15.5.10", + "react-autowhatever": "^10.1.2", + "shallow-equal": "^1.0.0" + } + }, + "node_modules/react-autowhatever": { + "version": "10.2.1", + "resolved": "https://registry.npmjs.org/react-autowhatever/-/react-autowhatever-10.2.1.tgz", + "integrity": "sha512-5gQyoETyBH6GmuW1N1J81CuoAV+Djeg66DEo03xiZOl3WOwJHBP5LisKUvCGOakjrXU4M3hcIvCIqMBYGUmqOA==", + "dependencies": { + "prop-types": "^15.5.8", + "react-themeable": "^1.1.0", + "section-iterator": "^2.0.0" + } + }, + "node_modules/react-base16-styling": { + "version": "0.5.3", + "resolved": "https://registry.npmjs.org/react-base16-styling/-/react-base16-styling-0.5.3.tgz", + "integrity": "sha1-OFjyTpxN2MvT9wLz901YHKKRcmk=", + "dependencies": { + "base16": "^1.0.0", + "lodash.curry": "^4.0.1", + "lodash.flow": "^3.3.0", + "pure-color": "^1.2.0" + } + }, + "node_modules/react-beautiful-dnd": { + "version": "13.0.0", + "resolved": "https://registry.npmjs.org/react-beautiful-dnd/-/react-beautiful-dnd-13.0.0.tgz", + "integrity": "sha512-87It8sN0ineoC3nBW0SbQuTFXM6bUqM62uJGY4BtTf0yzPl8/3+bHMWkgIe0Z6m8e+gJgjWxefGRVfpE3VcdEg==", + "dependencies": { + "@babel/runtime": "^7.8.4", + "css-box-model": "^1.2.0", + "memoize-one": "^5.1.1", + "raf-schd": "^4.0.2", + "react-redux": "^7.1.1", + "redux": "^4.0.4", + "use-memo-one": "^1.1.1" + } + }, + "node_modules/react-color": { + "version": "2.18.1", + "resolved": "https://registry.npmjs.org/react-color/-/react-color-2.18.1.tgz", + "integrity": "sha512-X5XpyJS6ncplZs74ak0JJoqPi+33Nzpv5RYWWxn17bslih+X7OlgmfpmGC1fNvdkK7/SGWYf1JJdn7D2n5gSuQ==", + "dependencies": { + "@icons/material": "^0.2.4", + "lodash": "^4.17.11", + "material-colors": "^1.2.1", + "prop-types": "^15.5.10", + "reactcss": "^1.2.0", + "tinycolor2": "^1.4.1" + } + }, + "node_modules/react-compound-slider": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/react-compound-slider/-/react-compound-slider-2.5.0.tgz", + "integrity": "sha512-T84FtSI0bkQPmH5GaaHbL+2McOyIR6M5sqS80dqw/bHc5r2UKLYY64BWTbsL+XO0jlx7REuJJnZUBqo4eSRl7g==", + "dependencies": { + "@babel/runtime": "^7.7.7", + "d3-array": "^1.2.4", + "prop-types": "^15.7.2", + "warning": "^3.0.0" + } + }, + "node_modules/react-datepicker": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/react-datepicker/-/react-datepicker-3.0.0.tgz", + "integrity": "sha512-Yrxan1tERAiWS0EzitpiaiXOIz0APTUtV75uWbaS+jSaKoGCR6wUN2FDwr1ACGlnEoGhR9QQ2Vq3odnWtgJsOA==", + "dependencies": { + "classnames": "^2.2.6", + "date-fns": "^2.0.1", + "prop-types": "^15.7.2", + "react-onclickoutside": "^6.9.0", + "react-popper": "^1.3.4" + } + }, + "node_modules/react-dock": { + "version": "0.2.4", + "resolved": "https://registry.npmjs.org/react-dock/-/react-dock-0.2.4.tgz", + "integrity": "sha1-5yfcdVCztzEWY13LnA4E0Lev4Xw=", + "dependencies": { + "lodash.debounce": "^3.1.1", + "prop-types": "^15.5.8" + } + }, + "node_modules/react-dom": { + "version": "16.13.1", + "resolved": "https://registry.npmjs.org/react-dom/-/react-dom-16.13.1.tgz", + "integrity": "sha512-81PIMmVLnCNLO/fFOQxdQkvEq/+Hfpv24XNJfpyZhTRfO0QcmQIF/PgCa1zCOj2w1hrn12MFLyaJ/G0+Mxtfag==", + "dependencies": { + "loose-envify": "^1.1.0", + "object-assign": "^4.1.1", + "prop-types": "^15.6.2", + "scheduler": "^0.19.1" + } + }, + "node_modules/react-draggable": { + "version": "4.4.3", + "resolved": "https://registry.npmjs.org/react-draggable/-/react-draggable-4.4.3.tgz", + "integrity": "sha512-jV4TE59MBuWm7gb6Ns3Q1mxX8Azffb7oTtDtBgFkxRvhDp38YAARmRplrj0+XGkhOJB5XziArX+4HUUABtyZ0w==", + "dependencies": { + "classnames": "^2.2.5", + "prop-types": "^15.6.0" + } + }, + "node_modules/react-event-listener": { + "version": "0.6.6", + "resolved": "https://registry.npmjs.org/react-event-listener/-/react-event-listener-0.6.6.tgz", + "integrity": "sha512-+hCNqfy7o9wvO6UgjqFmBzARJS7qrNoda0VqzvOuioEpoEXKutiKuv92dSz6kP7rYLmyHPyYNLesi5t/aH1gfw==", + "dependencies": { + "@babel/runtime": "^7.2.0", + "prop-types": "^15.6.0", + "warning": "^4.0.1" + } + }, + "node_modules/react-event-listener/node_modules/warning": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/warning/-/warning-4.0.3.tgz", + "integrity": "sha512-rpJyN222KWIvHJ/F53XSZv0Zl/accqHR8et1kpaMTD/fLCRxtV8iX8czMzY7sVZupTI3zcUTg8eycS2kNF9l6w==", + "dependencies": { + "loose-envify": "^1.0.0" + } + }, + "node_modules/react-grid-layout": { + "version": "0.18.3", + "resolved": "https://registry.npmjs.org/react-grid-layout/-/react-grid-layout-0.18.3.tgz", + "integrity": "sha512-lHkrk941Tk5nTwZPa9uj6ttHBT0VehSHwEhWbINBJKvM1GRaFNOefvjcuxSyuCI5JWjVUP+Qm3ARt2470AlxMA==", + "dependencies": { + "classnames": "2.x", + "lodash.isequal": "^4.0.0", + "prop-types": "^15.0.0", + "react-draggable": "^4.0.0", + "react-resizable": "^1.9.0" + } + }, + "node_modules/react-image-lightbox-with-rotate": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/react-image-lightbox-with-rotate/-/react-image-lightbox-with-rotate-5.1.1.tgz", + "integrity": "sha512-5ZubUQefKSDGIiAwK4lkfmGr/bgIfNDHXqC+Fm6nbNwTVYuYOZ1RJjULOniEB4fxb3Vm0z/x0oNhi1lbP1aMtg==", + "dependencies": { + "blueimp-load-image": "^2.19.0", + "prop-types": "^15.6.1", + "react-modal": "^3.4.4" + } + }, + "node_modules/react-input-autosize": { + "version": "2.2.2", + "resolved": "https://registry.npmjs.org/react-input-autosize/-/react-input-autosize-2.2.2.tgz", + "integrity": "sha512-jQJgYCA3S0j+cuOwzuCd1OjmBmnZLdqQdiLKRYrsMMzbjUrVDS5RvJUDwJqA7sKuksDuzFtm6hZGKFu7Mjk5aw==", + "dependencies": { + "prop-types": "^15.5.8" + } + }, + "node_modules/react-is": { + "version": "16.13.1", + "resolved": "https://registry.npmjs.org/react-is/-/react-is-16.13.1.tgz", + "integrity": "sha512-24e6ynE2H+OKt4kqsOvNd8kBpV65zoxbA4BVsEOB3ARVWQki/DHzaUoC5KuON/BiccDaCCTZBuOcfZs70kR8bQ==" + }, + "node_modules/react-json-tree": { + "version": "0.11.2", + "resolved": "https://registry.npmjs.org/react-json-tree/-/react-json-tree-0.11.2.tgz", + "integrity": "sha512-aYhUPj1y5jR3ZQ+G3N7aL8FbTyO03iLwnVvvEikLcNFqNTyabdljo9xDftZndUBFyyyL0aK3qGO9+8EilILHUw==", + "dependencies": { + "babel-runtime": "^6.6.1", + "prop-types": "^15.5.8", + "react-base16-styling": "^0.5.1" + } + }, + "node_modules/react-jsx-parser": { + "version": "1.25.1", + "resolved": "https://registry.npmjs.org/react-jsx-parser/-/react-jsx-parser-1.25.1.tgz", + "integrity": "sha512-lCHAw7iOocnPSpjfsHXZQGLyPpr9wlk3qtkVN44hZs0PwQuxcH8MWbLY+j6pqB9QSijM7qtulDLgFIYbAcqSmQ==", + "dependencies": { + "acorn": "^7.2.0", + "acorn-jsx": "^5.2.0", + "core-js": "^3.6.5" + } + }, + "node_modules/react-jsx-parser/node_modules/acorn": { + "version": "7.3.1", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-7.3.1.tgz", + "integrity": "sha512-tLc0wSnatxAQHVHUapaHdz72pi9KUyHjq5KyHjGg9Y8Ifdc79pTh2XvI6I1/chZbnM7QtNKzh66ooDogPZSleA==", + "bin": { + "acorn": "bin/acorn" + }, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/react-jsx-parser/node_modules/core-js": { + "version": "3.6.5", + "resolved": "https://registry.npmjs.org/core-js/-/core-js-3.6.5.tgz", + "integrity": "sha512-vZVEEwZoIsI+vPEuoF9Iqf5H7/M3eeQqWlQnYa8FSKKePuYTf5MWnxb5SDAzCa60b3JBRS5g9b+Dq7b1y/RCrA==", + "hasInstallScript": true + }, + "node_modules/react-lifecycles-compat": { + "version": "3.0.4", + "resolved": "https://registry.npmjs.org/react-lifecycles-compat/-/react-lifecycles-compat-3.0.4.tgz", + "integrity": "sha512-fBASbA6LnOU9dOU2eW7aQ8xmYBSXUIWr+UmF9b1efZBazGNO+rcXT/icdKnYm2pTwcRylVUYwW7H1PHfLekVzA==" + }, + "node_modules/react-loading": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/react-loading/-/react-loading-2.0.3.tgz", + "integrity": "sha512-Vdqy79zq+bpeWJqC+xjltUjuGApyoItPgL0vgVfcJHhqwU7bAMKzysfGW/ADu6i0z0JiOCRJjo+IkFNkRNbA3A==" + }, + "node_modules/react-measure": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/react-measure/-/react-measure-2.3.0.tgz", + "integrity": "sha512-dwAvmiOeblj5Dvpnk8Jm7Q8B4THF/f1l1HtKVi0XDecsG6LXwGvzV5R1H32kq3TW6RW64OAf5aoQxpIgLa4z8A==", + "dependencies": { + "@babel/runtime": "^7.2.0", + "get-node-dimensions": "^1.2.1", + "prop-types": "^15.6.2", + "resize-observer-polyfill": "^1.5.0" + } + }, + "node_modules/react-merge-refs": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/react-merge-refs/-/react-merge-refs-1.1.0.tgz", + "integrity": "sha512-alTKsjEL0dKH/ru1Iyn7vliS2QRcBp9zZPGoWxUOvRGWPUYgjo+V01is7p04It6KhgrzhJGnIj9GgX8W4bZoCQ==" + }, + "node_modules/react-modal": { + "version": "3.11.2", + "resolved": "https://registry.npmjs.org/react-modal/-/react-modal-3.11.2.tgz", + "integrity": "sha512-o8gvvCOFaG1T7W6JUvsYjRjMVToLZgLIsi5kdhFIQCtHxDkA47LznX62j+l6YQkpXDbvQegsDyxe/+JJsFQN7w==", + "dependencies": { + "exenv": "^1.2.0", + "prop-types": "^15.5.10", + "react-lifecycles-compat": "^3.0.0", + "warning": "^4.0.3" + } + }, + "node_modules/react-modal/node_modules/warning": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/warning/-/warning-4.0.3.tgz", + "integrity": "sha512-rpJyN222KWIvHJ/F53XSZv0Zl/accqHR8et1kpaMTD/fLCRxtV8iX8czMzY7sVZupTI3zcUTg8eycS2kNF9l6w==", + "dependencies": { + "loose-envify": "^1.0.0" + } + }, + "node_modules/react-onclickoutside": { + "version": "6.9.0", + "resolved": "https://registry.npmjs.org/react-onclickoutside/-/react-onclickoutside-6.9.0.tgz", + "integrity": "sha512-8ltIY3bC7oGhj2nPAvWOGi+xGFybPNhJM0V1H8hY/whNcXgmDeaeoCMPPd8VatrpTsUWjb/vGzrmu6SrXVty3A==" + }, + "node_modules/react-popper": { + "version": "1.3.7", + "resolved": "https://registry.npmjs.org/react-popper/-/react-popper-1.3.7.tgz", + "integrity": "sha512-nmqYTx7QVjCm3WUZLeuOomna138R1luC4EqkW3hxJUrAe+3eNz3oFCLYdnPwILfn0mX1Ew2c3wctrjlUMYYUww==", + "dependencies": { + "@babel/runtime": "^7.1.2", + "create-react-context": "^0.3.0", + "deep-equal": "^1.1.1", + "popper.js": "^1.14.4", + "prop-types": "^15.6.1", + "typed-styles": "^0.0.7", + "warning": "^4.0.2" + } + }, + "node_modules/react-popper/node_modules/create-react-context": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/create-react-context/-/create-react-context-0.3.0.tgz", + "integrity": "sha512-dNldIoSuNSvlTJ7slIKC/ZFGKexBMBrrcc+TTe1NdmROnaASuLPvqpwj9v4XS4uXZ8+YPu0sNmShX2rXI5LNsw==", + "dependencies": { + "gud": "^1.0.0", + "warning": "^4.0.3" + } + }, + "node_modules/react-popper/node_modules/warning": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/warning/-/warning-4.0.3.tgz", + "integrity": "sha512-rpJyN222KWIvHJ/F53XSZv0Zl/accqHR8et1kpaMTD/fLCRxtV8iX8czMzY7sVZupTI3zcUTg8eycS2kNF9l6w==", + "dependencies": { + "loose-envify": "^1.0.0" + } + }, + "node_modules/react-reconciler": { + "version": "0.26.2", + "resolved": "https://registry.npmjs.org/react-reconciler/-/react-reconciler-0.26.2.tgz", + "integrity": "sha512-nK6kgY28HwrMNwDnMui3dvm3rCFjZrcGiuwLc5COUipBK5hWHLOxMJhSnSomirqWwjPBJKV1QcbkI0VJr7Gl1Q==", + "dependencies": { + "loose-envify": "^1.1.0", + "object-assign": "^4.1.1", + "scheduler": "^0.20.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/react-reconciler/node_modules/scheduler": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/scheduler/-/scheduler-0.20.2.tgz", + "integrity": "sha512-2eWfGgAqqWFGqtdMmcL5zCMK1U8KlXv8SQFGglL3CEtd0aDVDWgeF/YoCmvln55m5zSk3J/20hTaSBeSObsQDQ==", + "dependencies": { + "loose-envify": "^1.1.0", + "object-assign": "^4.1.1" + } + }, + "node_modules/react-redux": { + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/react-redux/-/react-redux-7.2.0.tgz", + "integrity": "sha512-EvCAZYGfOLqwV7gh849xy9/pt55rJXPwmYvI4lilPM5rUT/1NxuuN59ipdBksRVSvz0KInbPnp4IfoXJXCqiDA==", + "dependencies": { + "@babel/runtime": "^7.5.5", + "hoist-non-react-statics": "^3.3.0", + "loose-envify": "^1.4.0", + "prop-types": "^15.7.2", + "react-is": "^16.9.0" + } + }, + "node_modules/react-resizable": { + "version": "1.10.1", + "resolved": "https://registry.npmjs.org/react-resizable/-/react-resizable-1.10.1.tgz", + "integrity": "sha512-Jd/bKOKx6+19NwC4/aMLRu/J9/krfxlDnElP41Oc+oLiUWs/zwV1S9yBfBZRnqAwQb6vQ/HRSk3bsSWGSgVbpw==", + "dependencies": { + "prop-types": "15.x", + "react-draggable": "^4.0.3" + } + }, + "node_modules/react-resizable-rotatable-draggable": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/react-resizable-rotatable-draggable/-/react-resizable-rotatable-draggable-0.2.0.tgz", + "integrity": "sha512-F8TPx3z7/AcmRViySbYV3LpUWXFpHlGAmKmNcYMgPlS+h1eYFazRG3xYS8Z6e48hWY1EcCny/YNrwRNUrap8CQ==", + "engines": { + "node": ">=8", + "npm": ">=6" + } + }, + "node_modules/react-reveal": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/react-reveal/-/react-reveal-1.2.2.tgz", + "integrity": "sha512-JCv3fAoU6Z+Lcd8U48bwzm4pMZ79qsedSXYwpwt6lJNtj/v5nKJYZZbw3yhaQPPgYePo3Y0NOCoYOq/jcsisuw==", + "dependencies": { + "prop-types": "^15.5.10" + } + }, + "node_modules/react-select": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/react-select/-/react-select-3.1.0.tgz", + "integrity": "sha512-wBFVblBH1iuCBprtpyGtd1dGMadsG36W5/t2Aj8OE6WbByDg5jIFyT7X5gT+l0qmT5TqWhxX+VsKJvCEl2uL9g==", + "dependencies": { + "@babel/runtime": "^7.4.4", + "@emotion/cache": "^10.0.9", + "@emotion/core": "^10.0.9", + "@emotion/css": "^10.0.9", + "memoize-one": "^5.0.0", + "prop-types": "^15.6.0", + "react-input-autosize": "^2.2.2", + "react-transition-group": "^4.3.0" + } + }, + "node_modules/react-select/node_modules/dom-helpers": { + "version": "5.1.4", + "resolved": "https://registry.npmjs.org/dom-helpers/-/dom-helpers-5.1.4.tgz", + "integrity": "sha512-TjMyeVUvNEnOnhzs6uAn9Ya47GmMo3qq7m+Lr/3ON0Rs5kHvb8I+SQYjLUSYn7qhEm0QjW0yrBkvz9yOrwwz1A==", + "dependencies": { + "@babel/runtime": "^7.8.7", + "csstype": "^2.6.7" + } + }, + "node_modules/react-select/node_modules/react-transition-group": { + "version": "4.4.1", + "resolved": "https://registry.npmjs.org/react-transition-group/-/react-transition-group-4.4.1.tgz", + "integrity": "sha512-Djqr7OQ2aPUiYurhPalTrVy9ddmFCCzwhqQmtN+J3+3DzLO209Fdr70QrN8Z3DsglWql6iY1lDWAfpFiBtuKGw==", + "dependencies": { + "@babel/runtime": "^7.5.5", + "dom-helpers": "^5.0.1", + "loose-envify": "^1.4.0", + "prop-types": "^15.6.2" + } + }, + "node_modules/react-table": { + "version": "6.11.5", + "resolved": "https://registry.npmjs.org/react-table/-/react-table-6.11.5.tgz", + "integrity": "sha512-LM+AS9v//7Y7lAlgTWW/cW6Sn5VOb3EsSkKQfQTzOW8FngB1FUskLLNEVkAYsTX9LjOWR3QlGjykJqCE6eXT/g==", + "dependencies": { + "@types/react-table": "^6.8.5", + "classnames": "^2.2.5", + "react-is": "^16.8.1" + } + }, + "node_modules/react-themeable": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/react-themeable/-/react-themeable-1.1.0.tgz", + "integrity": "sha1-fURm3ZsrX6dQWHJ4JenxUro3mg4=", + "dependencies": { + "object-assign": "^3.0.0" + } + }, + "node_modules/react-themeable/node_modules/object-assign": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-3.0.0.tgz", + "integrity": "sha1-m+3VygiXlJvKR+f/QIBi1Un1h/I=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/react-three-fiber": { + "version": "0.0.0-deprecated", + "resolved": "https://registry.npmjs.org/react-three-fiber/-/react-three-fiber-0.0.0-deprecated.tgz", + "integrity": "sha512-EblIqTAsIpkYeM8bZtC4lcpTE0A2zCEGipFB52RgcQq/q+0oryrk7Sxt+sqhIjUu6xMNEVywV8dr74lz5yWO6A==" + }, + "node_modules/react-transition-group": { + "version": "2.9.0", + "resolved": "https://registry.npmjs.org/react-transition-group/-/react-transition-group-2.9.0.tgz", + "integrity": "sha512-+HzNTCHpeQyl4MJ/bdE0u6XRMe9+XG/+aL4mCxVN4DnPBQ0/5bfHWPDuOZUzYdMj94daZaZdCCc1Dzt9R/xSSg==", + "dependencies": { + "dom-helpers": "^3.4.0", + "loose-envify": "^1.4.0", + "prop-types": "^15.6.2", + "react-lifecycles-compat": "^3.0.4" + } + }, + "node_modules/react-use-measure": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/react-use-measure/-/react-use-measure-2.0.4.tgz", + "integrity": "sha512-7K2HIGaPMl3Q9ZQiEVjen3tRXl4UDda8LiTPy/QxP8dP2rl5gPBhf7mMH6MVjjRNv3loU7sNzey/ycPNnHVTxQ==", + "dependencies": { + "debounce": "^1.2.0" + } + }, + "node_modules/reactcss": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/reactcss/-/reactcss-1.2.3.tgz", + "integrity": "sha512-KiwVUcFu1RErkI97ywr8nvx8dNOpT03rbnma0SSalTYjkrPYaEajR4a/MRt6DZ46K6arDRbWMNHF+xH7G7n/8A==", + "dependencies": { + "lodash": "^4.0.1" + } + }, + "node_modules/read-pkg": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-1.1.0.tgz", + "integrity": "sha1-9f+qXs0pyzHAR0vKfXVra7KePyg=", + "dependencies": { + "load-json-file": "^1.0.0", + "normalize-package-data": "^2.3.2", + "path-type": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/read-pkg-up": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-1.0.1.tgz", + "integrity": "sha1-nWPBMnbAZZGNV/ACpX9AobZD+wI=", + "dependencies": { + "find-up": "^1.0.0", + "read-pkg": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/read-pkg-up/node_modules/find-up": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-1.1.2.tgz", + "integrity": "sha1-ay6YIrGizgpgq2TWEOzK1TyyTQ8=", + "dependencies": { + "path-exists": "^2.0.0", + "pinkie-promise": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/read-pkg-up/node_modules/path-exists": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-2.1.0.tgz", + "integrity": "sha1-D+tsZPD8UY2adU3V77YscCJ2H0s=", + "dependencies": { + "pinkie-promise": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/read-pkg/node_modules/path-type": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/path-type/-/path-type-1.1.0.tgz", + "integrity": "sha1-WcRPfuSR2nBNpBXaWkBwuk+P5EE=", + "dependencies": { + "graceful-fs": "^4.1.2", + "pify": "^2.0.0", + "pinkie-promise": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/read-pkg/node_modules/pify": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz", + "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "dependencies": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/readdirp": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-2.2.1.tgz", + "integrity": "sha512-1JU/8q+VgFZyxwrJ+SVIOsh+KywWGpds3NTqikiKpDMZWScmAYyKIgqkO+ARvNWJfXeXR1zxz7aHF4u4CyH6vQ==", + "dependencies": { + "graceful-fs": "^4.1.11", + "micromatch": "^3.1.10", + "readable-stream": "^2.0.2" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/readdirp/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/readline": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/readline/-/readline-1.3.0.tgz", + "integrity": "sha1-xYDXfvLPyHUrEySYBg3JeTp6wBw=" + }, + "node_modules/rechoir": { + "version": "0.6.2", + "resolved": "https://registry.npmjs.org/rechoir/-/rechoir-0.6.2.tgz", + "integrity": "sha1-hSBLVNuoLVdC4oyWdW70OvUOM4Q=", + "dependencies": { + "resolve": "^1.1.6" + }, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/recompose": { + "version": "0.26.0", + "resolved": "https://registry.npmjs.org/recompose/-/recompose-0.26.0.tgz", + "integrity": "sha512-KwOu6ztO0mN5vy3+zDcc45lgnaUoaQse/a5yLVqtzTK13czSWnFGmXbQVmnoMgDkI5POd1EwIKSbjU1V7xdZog==", + "dependencies": { + "change-emitter": "^0.1.2", + "fbjs": "^0.8.1", + "hoist-non-react-statics": "^2.3.1", + "symbol-observable": "^1.0.4" + } + }, + "node_modules/recompose/node_modules/hoist-non-react-statics": { + "version": "2.5.5", + "resolved": "https://registry.npmjs.org/hoist-non-react-statics/-/hoist-non-react-statics-2.5.5.tgz", + "integrity": "sha512-rqcy4pJo55FTTLWt+bU8ukscqHeE/e9KWvsOW2b/a3afxQZhwkQdT1rPPCJ0rYXdj4vNcasY8zHTH+jF/qStxw==" + }, + "node_modules/redent": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/redent/-/redent-1.0.0.tgz", + "integrity": "sha1-z5Fqsf1fHxbfsggi3W7H9zDCr94=", + "dependencies": { + "indent-string": "^2.1.0", + "strip-indent": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/reduce-flatten": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/reduce-flatten/-/reduce-flatten-1.0.1.tgz", + "integrity": "sha1-JYx479FT3fk8tWEjf2EYTzaW4yc=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/redux": { + "version": "4.0.5", + "resolved": "https://registry.npmjs.org/redux/-/redux-4.0.5.tgz", + "integrity": "sha512-VSz1uMAH24DM6MF72vcojpYPtrTUu3ByVWfPL1nPfVRb5mZVTve5GnNCUV53QM/BZ66xfWrm0CTWoM+Xlz8V1w==", + "dependencies": { + "loose-envify": "^1.4.0", + "symbol-observable": "^1.2.0" + } + }, + "node_modules/regenerator-runtime": { + "version": "0.13.5", + "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.13.5.tgz", + "integrity": "sha512-ZS5w8CpKFinUzOwW3c83oPeVXoNsrLsaCoLtJvAClH135j/R77RuymhiSErhm2lKcwSCIpmvIWSbDkIfAqKQlA==" + }, + "node_modules/regex-not": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/regex-not/-/regex-not-1.0.2.tgz", + "integrity": "sha512-J6SDjUgDxQj5NusnOtdFxDwN/+HWykR8GELwctJ7mdqhcyy1xEc4SRFHUXvxTp661YaVKAjfRLZ9cCqS6tn32A==", + "dependencies": { + "extend-shallow": "^3.0.2", + "safe-regex": "^1.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/regexp-clone": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/regexp-clone/-/regexp-clone-1.0.0.tgz", + "integrity": "sha512-TuAasHQNamyyJ2hb97IuBEif4qBHGjPHBS64sZwytpLEqtBQ1gPJTnOaQ6qmpET16cK14kkjbazl6+p0RRv0yw==" + }, + "node_modules/regexp.prototype.flags": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/regexp.prototype.flags/-/regexp.prototype.flags-1.3.0.tgz", + "integrity": "sha512-2+Q0C5g951OlYlJz6yu5/M33IcsESLlLfsyIaLJaG4FA2r4yP8MvVMJUUP/fVBkSpbbbZlS5gynbEWLipiiXiQ==", + "dependencies": { + "define-properties": "^1.1.3", + "es-abstract": "^1.17.0-next.1" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/registry-auth-token": { + "version": "3.4.0", + "resolved": "https://registry.npmjs.org/registry-auth-token/-/registry-auth-token-3.4.0.tgz", + "integrity": "sha512-4LM6Fw8eBQdwMYcES4yTnn2TqIasbXuwDx3um+QRs7S55aMKCBKBxvPXl2RiUjHwuJLTyYfxSpmfSAjQpcuP+A==", + "dependencies": { + "rc": "^1.1.6", + "safe-buffer": "^5.0.1" + } + }, + "node_modules/registry-url": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/registry-url/-/registry-url-3.1.0.tgz", + "integrity": "sha1-PU74cPc93h138M+aOBQyRE4XSUI=", + "dependencies": { + "rc": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/remove-trailing-separator": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz", + "integrity": "sha1-wkvOKig62tW8P1jg1IJJuSN52O8=" + }, + "node_modules/repeat-element": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/repeat-element/-/repeat-element-1.1.3.tgz", + "integrity": "sha512-ahGq0ZnV5m5XtZLMb+vP76kcAM5nkLqk0lpqAuojSKGgQtn4eRi4ZZGm2olo2zKFH+sMsWaqOCW1dqAnOru72g==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/repeat-string": { + "version": "1.6.1", + "resolved": "https://registry.npmjs.org/repeat-string/-/repeat-string-1.6.1.tgz", + "integrity": "sha1-jcrkcOHIirwtYA//Sndihtp15jc=", + "engines": { + "node": ">=0.10" + } + }, + "node_modules/repeating": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/repeating/-/repeating-2.0.1.tgz", + "integrity": "sha1-UhTFOpJtNVJwdSf7q0FdvAjQbdo=", + "dependencies": { + "is-finite": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/request": { + "version": "2.88.2", + "resolved": "https://registry.npmjs.org/request/-/request-2.88.2.tgz", + "integrity": "sha512-MsvtOrfG9ZcrOwAW+Qi+F6HbD0CWXEh9ou77uOb7FM2WPhwT7smM833PzanhJLsgXjN89Ir6V2PczXNnMpwKhw==", + "dependencies": { + "aws-sign2": "~0.7.0", + "aws4": "^1.8.0", + "caseless": "~0.12.0", + "combined-stream": "~1.0.6", + "extend": "~3.0.2", + "forever-agent": "~0.6.1", + "form-data": "~2.3.2", + "har-validator": "~5.1.3", + "http-signature": "~1.2.0", + "is-typedarray": "~1.0.0", + "isstream": "~0.1.2", + "json-stringify-safe": "~5.0.1", + "mime-types": "~2.1.19", + "oauth-sign": "~0.9.0", + "performance-now": "^2.1.0", + "qs": "~6.5.2", + "safe-buffer": "^5.1.2", + "tough-cookie": "~2.5.0", + "tunnel-agent": "^0.6.0", + "uuid": "^3.3.2" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/request-promise": { + "version": "4.2.5", + "resolved": "https://registry.npmjs.org/request-promise/-/request-promise-4.2.5.tgz", + "integrity": "sha512-ZgnepCykFdmpq86fKGwqntyTiUrHycALuGggpyCZwMvGaZWgxW6yagT0FHkgo5LzYvOaCNvxYwWYIjevSH1EDg==", + "dependencies": { + "bluebird": "^3.5.0", + "request-promise-core": "1.1.3", + "stealthy-require": "^1.1.1", + "tough-cookie": "^2.3.3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/request-promise-core": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/request-promise-core/-/request-promise-core-1.1.3.tgz", + "integrity": "sha512-QIs2+ArIGQVp5ZYbWD5ZLCY29D5CfWizP8eWnm8FoGD1TX61veauETVQbrV60662V0oFBkrDOuaBI8XgtuyYAQ==", + "dependencies": { + "lodash": "^4.17.15" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/request-promise-native": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/request-promise-native/-/request-promise-native-1.0.8.tgz", + "integrity": "sha512-dapwLGqkHtwL5AEbfenuzjTYg35Jd6KPytsC2/TLkVMz8rm+tNt72MGUWT1RP/aYawMpN6HqbNGBQaRcBtjQMQ==", + "dev": true, + "dependencies": { + "request-promise-core": "1.1.3", + "stealthy-require": "^1.1.1", + "tough-cookie": "^2.3.3" + }, + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/request/node_modules/form-data": { + "version": "2.3.3", + "resolved": "https://registry.npmjs.org/form-data/-/form-data-2.3.3.tgz", + "integrity": "sha512-1lLKB2Mu3aGP1Q/2eCOx0fNbRMe7XdwktwOruhfqqd0rIJWwN4Dh+E3hrPSlDCXnSR7UtZ1N38rVXm+6+MEhJQ==", + "dependencies": { + "asynckit": "^0.4.0", + "combined-stream": "^1.0.6", + "mime-types": "^2.1.12" + }, + "engines": { + "node": ">= 0.12" + } + }, + "node_modules/require_optional": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/require_optional/-/require_optional-1.0.1.tgz", + "integrity": "sha512-qhM/y57enGWHAe3v/NcwML6a3/vfESLe/sGM2dII+gEO0BpKRUkWZow/tyloNqJyN6kXSl3RyyM8Ll5D/sJP8g==", + "dependencies": { + "resolve-from": "^2.0.0", + "semver": "^5.1.0" + } + }, + "node_modules/require_optional/node_modules/resolve-from": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-2.0.0.tgz", + "integrity": "sha1-lICrIOlP+h2egKgEx+oUdhGWa1c=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/require-directory": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz", + "integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/require-main-filename": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", + "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==" + }, + "node_modules/require-package-name": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/require-package-name/-/require-package-name-2.0.1.tgz", + "integrity": "sha1-wR6XJ2tluOKSP3Xav1+y7ww4Qbk=" + }, + "node_modules/requires-port": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/requires-port/-/requires-port-1.0.0.tgz", + "integrity": "sha1-kl0mAdOaxIXgkc8NpcbmlNw9yv8=", + "dev": true + }, + "node_modules/resize-observer-polyfill": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/resize-observer-polyfill/-/resize-observer-polyfill-1.5.1.tgz", + "integrity": "sha512-LwZrotdHOo12nQuZlHEmtuXdqGoOD0OhaxopaNFxWzInpEgaLWoVuAMbTzixuosCx2nEG58ngzW3vxdWoxIgdg==" + }, + "node_modules/resolve": { + "version": "1.17.0", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.17.0.tgz", + "integrity": "sha512-ic+7JYiV8Vi2yzQGFWOkiZD5Z9z7O2Zhm9XMaTxdJExKasieFCr+yXZ/WmXsckHiKl12ar0y6XiXDx3m4RHn1w==", + "dependencies": { + "path-parse": "^1.0.6" + } + }, + "node_modules/resolve-cwd": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/resolve-cwd/-/resolve-cwd-2.0.0.tgz", + "integrity": "sha1-AKn3OHVW4nA46uIyyqNypqWbZlo=", + "dev": true, + "dependencies": { + "resolve-from": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/resolve-cwd/node_modules/resolve-from": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-3.0.0.tgz", + "integrity": "sha1-six699nWiBvItuZTM17rywoYh0g=", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/resolve-dir": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/resolve-dir/-/resolve-dir-1.0.1.tgz", + "integrity": "sha1-eaQGRMNivoLybv/nOcm7U4IEb0M=", + "dev": true, + "dependencies": { + "expand-tilde": "^2.0.0", + "global-modules": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/resolve-dir/node_modules/global-modules": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/global-modules/-/global-modules-1.0.0.tgz", + "integrity": "sha512-sKzpEkf11GpOFuw0Zzjzmt4B4UZwjOcG757PPvrfhxcLFbq0wpsgpOqxpxtxFiCG4DtG93M6XRVbF2oGdev7bg==", + "dev": true, + "dependencies": { + "global-prefix": "^1.0.1", + "is-windows": "^1.0.1", + "resolve-dir": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/resolve-from": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-4.0.0.tgz", + "integrity": "sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==", + "engines": { + "node": ">=4" + } + }, + "node_modules/resolve-url": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/resolve-url/-/resolve-url-0.2.1.tgz", + "integrity": "sha1-LGN/53yJOv0qZj/iGqkIAGjiBSo=" + }, + "node_modules/ret": { + "version": "0.1.15", + "resolved": "https://registry.npmjs.org/ret/-/ret-0.1.15.tgz", + "integrity": "sha512-TTlYpa+OL+vMMNG24xSlQGEJ3B/RzEfUlLct7b5G/ytav+wPrplCpVMFuwzXbkecJrb6IYo1iFb0S9v37754mg==", + "engines": { + "node": ">=0.12" + } + }, + "node_modules/retry": { + "version": "0.12.0", + "resolved": "https://registry.npmjs.org/retry/-/retry-0.12.0.tgz", + "integrity": "sha1-G0KmJmoh8HQh0bC1S33BZ7AcATs=", + "dev": true, + "engines": { + "node": ">= 4" + } + }, + "node_modules/reveal.js": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/reveal.js/-/reveal.js-4.0.2.tgz", + "integrity": "sha512-LWZSUenufF1gpD7npxJ7KfoQQFKgc1D6XrLTFgKlwWNP1BQ74hT48KONFWMAw+8R/QUeaScCLCLrBVHDfFIEiw==", + "engines": { + "node": ">=10.0.0" + } + }, + "node_modules/right-align": { + "version": "0.1.3", + "resolved": "https://registry.npmjs.org/right-align/-/right-align-0.1.3.tgz", + "integrity": "sha1-YTObci/mo1FWiSENJOFMlhSGE+8=", + "dependencies": { + "align-text": "^0.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/rimraf": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz", + "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==", + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/ripemd160": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/ripemd160/-/ripemd160-2.0.2.tgz", + "integrity": "sha512-ii4iagi25WusVoiC4B4lq7pbXfAp3D9v5CwfkY33vffw2+pkDjY1D8GaN7spsxvCSx8dkPqOZCEZyfxcmJG2IA==", + "dev": true, + "dependencies": { + "hash-base": "^3.0.0", + "inherits": "^2.0.1" + } + }, + "node_modules/rope-sequence": { + "version": "1.3.2", + "resolved": "https://registry.npmjs.org/rope-sequence/-/rope-sequence-1.3.2.tgz", + "integrity": "sha512-ku6MFrwEVSVmXLvy3dYph3LAMNS0890K7fabn+0YIRQ2T96T9F4gkFf0vf0WW0JUraNWwGRtInEpH7yO4tbQZg==" + }, + "node_modules/rtcpeerconnection-shim": { + "version": "1.2.15", + "resolved": "https://registry.npmjs.org/rtcpeerconnection-shim/-/rtcpeerconnection-shim-1.2.15.tgz", + "integrity": "sha512-C6DxhXt7bssQ1nHb154lqeL0SXz5Dx4RczXZu2Aa/L1NJFnEVDxFwCBo3fqtuljhHIGceg5JKBV4XJ0gW5JKyw==", + "dependencies": { + "sdp": "^2.6.0" + }, + "engines": { + "node": ">=6.0.0", + "npm": ">=3.10.0" + } + }, + "node_modules/run-queue": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/run-queue/-/run-queue-1.0.3.tgz", + "integrity": "sha1-6Eg5bwV9Ij8kOGkkYY4laUFh7Ec=", + "dev": true, + "dependencies": { + "aproba": "^1.1.1" + } + }, + "node_modules/safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==" + }, + "node_modules/safe-regex": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/safe-regex/-/safe-regex-1.1.0.tgz", + "integrity": "sha1-QKNmnzsHfR6UPURinhV91IAjvy4=", + "dependencies": { + "ret": "~0.1.10" + } + }, + "node_modules/safer-buffer": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", + "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==" + }, + "node_modules/saslprep": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/saslprep/-/saslprep-1.0.3.tgz", + "integrity": "sha512-/MY/PEMbk2SuY5sScONwhUDsV2p77Znkb/q3nSVstq/yQzYJOH/Azh29p9oJLsl3LnQwSvZDKagDGBsBwSooag==", + "optional": true, + "dependencies": { + "sparse-bitfield": "^3.0.3" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/sass-graph": { + "version": "2.2.5", + "resolved": "https://registry.npmjs.org/sass-graph/-/sass-graph-2.2.5.tgz", + "integrity": "sha512-VFWDAHOe6mRuT4mZRd4eKE+d8Uedrk6Xnh7Sh9b4NGufQLQjOrvf/MQoOdx+0s92L89FeyUUNfU597j/3uNpag==", + "dependencies": { + "glob": "^7.0.0", + "lodash": "^4.0.0", + "scss-tokenizer": "^0.2.3", + "yargs": "^13.3.2" + } + }, + "node_modules/sass-loader": { + "version": "7.3.1", + "resolved": "https://registry.npmjs.org/sass-loader/-/sass-loader-7.3.1.tgz", + "integrity": "sha512-tuU7+zm0pTCynKYHpdqaPpe+MMTQ76I9TPZ7i4/5dZsigE350shQWe5EZNl5dBidM49TPET75tNqRbcsUZWeNA==", + "dev": true, + "dependencies": { + "clone-deep": "^4.0.1", + "loader-utils": "^1.0.1", + "neo-async": "^2.5.0", + "pify": "^4.0.1", + "semver": "^6.3.0" + }, + "engines": { + "node": ">= 6.9.0" + } + }, + "node_modules/sass-loader/node_modules/semver": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", + "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", + "dev": true, + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/sax": { + "version": "1.2.4", + "resolved": "https://registry.npmjs.org/sax/-/sax-1.2.4.tgz", + "integrity": "sha512-NqVDv9TpANUjFm0N8uM5GxL36UgKi9/atZw+x7YFnQ8ckwFGKrl4xX4yWtrey3UJm5nP1kUbnYgLopqWNSRhWw==" + }, + "node_modules/saxes": { + "version": "3.1.11", + "resolved": "https://registry.npmjs.org/saxes/-/saxes-3.1.11.tgz", + "integrity": "sha512-Ydydq3zC+WYDJK1+gRxRapLIED9PWeSuuS41wqyoRmzvhhh9nc+QQrVMKJYzJFULazeGhzSV0QleN2wD3boh2g==", + "dev": true, + "dependencies": { + "xmlchars": "^2.1.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/scheduler": { + "version": "0.19.1", + "resolved": "https://registry.npmjs.org/scheduler/-/scheduler-0.19.1.tgz", + "integrity": "sha512-n/zwRWRYSUj0/3g/otKDRPMh6qv2SYMWNq85IEa8iZyAv8od9zDYpGSnpBEjNgcMNq6Scbu5KfIPxNF72R/2EA==", + "dependencies": { + "loose-envify": "^1.1.0", + "object-assign": "^4.1.1" + } + }, + "node_modules/schema-utils": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", + "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", + "dev": true, + "dependencies": { + "ajv": "^6.1.0", + "ajv-errors": "^1.0.0", + "ajv-keywords": "^3.1.0" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/scss-loader": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/scss-loader/-/scss-loader-0.0.1.tgz", + "integrity": "sha1-6uAXueDzjBKlMtslwiC5Avs05nE=", + "dev": true + }, + "node_modules/scss-tokenizer": { + "version": "0.2.3", + "resolved": "https://registry.npmjs.org/scss-tokenizer/-/scss-tokenizer-0.2.3.tgz", + "integrity": "sha1-jrBtualyMzOCTT9VMGQRSYR85dE=", + "dependencies": { + "js-base64": "^2.1.8", + "source-map": "^0.4.2" + } + }, + "node_modules/scss-tokenizer/node_modules/source-map": { + "version": "0.4.4", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.4.4.tgz", + "integrity": "sha1-66T12pwNyZneaAMti092FzZSA2s=", + "dependencies": { + "amdefine": ">=0.0.4" + }, + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/sdp": { + "version": "2.12.0", + "resolved": "https://registry.npmjs.org/sdp/-/sdp-2.12.0.tgz", + "integrity": "sha512-jhXqQAQVM+8Xj5EjJGVweuEzgtGWb3tmEEpl3CLP3cStInSbVHSg0QWOGQzNq8pSID4JkpeV2mPqlMDLrm0/Vw==" + }, + "node_modules/section-iterator": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/section-iterator/-/section-iterator-2.0.0.tgz", + "integrity": "sha1-v0RNev7rlK1Dw5rS+yYVFifMuio=" + }, + "node_modules/select-hose": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/select-hose/-/select-hose-2.0.0.tgz", + "integrity": "sha1-Yl2GWPhlr0Psliv8N2o3NZpJlMo=", + "dev": true + }, + "node_modules/selfsigned": { + "version": "1.10.7", + "resolved": "https://registry.npmjs.org/selfsigned/-/selfsigned-1.10.7.tgz", + "integrity": "sha512-8M3wBCzeWIJnQfl43IKwOmC4H/RAp50S8DF60znzjW5GVqTcSe2vWclt7hmYVPkKPlHWOu5EaWOMZ2Y6W8ZXTA==", + "dev": true, + "dependencies": { + "node-forge": "0.9.0" + } + }, + "node_modules/selfsigned/node_modules/node-forge": { + "version": "0.9.0", + "resolved": "https://registry.npmjs.org/node-forge/-/node-forge-0.9.0.tgz", + "integrity": "sha512-7ASaDa3pD+lJ3WvXFsxekJQelBKRpne+GOVbLbtHYdd7pFspyeuJHnWfLplGf3SwKGbfs/aYl5V/JCIaHVUKKQ==", + "dev": true, + "engines": { + "node": ">= 4.5.0" + } + }, + "node_modules/semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "bin": { + "semver": "bin/semver" + } + }, + "node_modules/semver-compare": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/semver-compare/-/semver-compare-1.0.0.tgz", + "integrity": "sha1-De4hahyUGrN+nvsXiPavxf9VN/w=" + }, + "node_modules/semver-diff": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/semver-diff/-/semver-diff-2.1.0.tgz", + "integrity": "sha1-S7uEN8jTfksM8aaP1ybsbWRdbTY=", + "dependencies": { + "semver": "^5.0.3" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/send": { + "version": "0.17.1", + "resolved": "https://registry.npmjs.org/send/-/send-0.17.1.tgz", + "integrity": "sha512-BsVKsiGcQMFwT8UxypobUKyv7irCNRHk1T0G680vk88yf6LBByGcZJOTJCrTP2xVN6yI+XjPJcNuE3V4fT9sAg==", + "dependencies": { + "debug": "2.6.9", + "depd": "~1.1.2", + "destroy": "~1.0.4", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "fresh": "0.5.2", + "http-errors": "~1.7.2", + "mime": "1.6.0", + "ms": "2.1.1", + "on-finished": "~2.3.0", + "range-parser": "~1.2.1", + "statuses": "~1.5.0" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/send/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/send/node_modules/debug/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/serialize-javascript": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/serialize-javascript/-/serialize-javascript-1.9.1.tgz", + "integrity": "sha512-0Vb/54WJ6k5v8sSWN09S0ora+Hnr+cX40r9F170nT+mSkaxltoE/7R3OrIdBSUv1OoiobH1QoWQbCnAO+e8J1A==", + "dev": true + }, + "node_modules/serializr": { + "version": "1.5.4", + "resolved": "https://registry.npmjs.org/serializr/-/serializr-1.5.4.tgz", + "integrity": "sha512-ImLlkNfNSSv9d7Ah1j/yrPk1FHbRC1zkD7URcgx/8M1eYHGUxGf/Ig/d8ML04ifqN7QesyYKsfLYA4xjAVAR/g==" + }, + "node_modules/serve-index": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/serve-index/-/serve-index-1.9.1.tgz", + "integrity": "sha1-03aNabHn2C5c4FD/9bRTvqEqkjk=", + "dev": true, + "dependencies": { + "accepts": "~1.3.4", + "batch": "0.6.1", + "debug": "2.6.9", + "escape-html": "~1.0.3", + "http-errors": "~1.6.2", + "mime-types": "~2.1.17", + "parseurl": "~1.3.2" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/serve-index/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dev": true, + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/serve-index/node_modules/http-errors": { + "version": "1.6.3", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.6.3.tgz", + "integrity": "sha1-i1VoC7S+KDoLW/TqLjhYC+HZMg0=", + "dev": true, + "dependencies": { + "depd": "~1.1.2", + "inherits": "2.0.3", + "setprototypeof": "1.1.0", + "statuses": ">= 1.4.0 < 2" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/serve-index/node_modules/inherits": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", + "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=", + "dev": true + }, + "node_modules/serve-index/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=", + "dev": true + }, + "node_modules/serve-index/node_modules/setprototypeof": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.1.0.tgz", + "integrity": "sha512-BvE/TwpZX4FXExxOxZyRGQQv651MSwmWKZGqvmPcRIjDqWub67kTKuIMx43cZZrS/cBBzwBcNDWoFxt2XEFIpQ==", + "dev": true + }, + "node_modules/serve-static": { + "version": "1.14.1", + "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.14.1.tgz", + "integrity": "sha512-JMrvUwE54emCYWlTI+hGrGv5I8dEwmco/00EvkzIIsR7MqrHonbD9pO2MOfFnpFntl7ecpZs+3mW+XbQZu9QCg==", + "dependencies": { + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "parseurl": "~1.3.3", + "send": "0.17.1" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/set-blocking": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz", + "integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc=" + }, + "node_modules/set-immediate-shim": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/set-immediate-shim/-/set-immediate-shim-1.0.1.tgz", + "integrity": "sha1-SysbJ+uAip+NzEgaWOXlb1mfP2E=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/set-value": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/set-value/-/set-value-2.0.1.tgz", + "integrity": "sha512-JxHc1weCN68wRY0fhCoXpyK55m/XPHafOmK4UWD7m2CI14GMcFypt4w/0+NV5f/ZMby2F6S2wwA7fgynh9gWSw==", + "dependencies": { + "extend-shallow": "^2.0.1", + "is-extendable": "^0.1.1", + "is-plain-object": "^2.0.3", + "split-string": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/set-value/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/set-value/node_modules/is-extendable": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz", + "integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/setimmediate": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/setimmediate/-/setimmediate-1.0.5.tgz", + "integrity": "sha1-KQy7Iy4waULX1+qbg3Mqt4VvgoU=" + }, + "node_modules/setprototypeof": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.1.1.tgz", + "integrity": "sha512-JvdAWfbXeIGaZ9cILp38HntZSFSo3mWg6xGcJJsd+d4aRMOqauag1C63dJfDw7OaMYwEbHMOxEZ1lqVRYP2OAw==" + }, + "node_modules/sha.js": { + "version": "2.4.11", + "resolved": "https://registry.npmjs.org/sha.js/-/sha.js-2.4.11.tgz", + "integrity": "sha512-QMEp5B7cftE7APOjk5Y6xgrbWu+WkLVQwk8JNjZ8nKRciZaByEW6MubieAiToS7+dwvrjGhH8jRXz3MVd0AYqQ==", + "dev": true, + "dependencies": { + "inherits": "^2.0.1", + "safe-buffer": "^5.0.1" + }, + "bin": { + "sha.js": "bin.js" + } + }, + "node_modules/shallow-clone": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/shallow-clone/-/shallow-clone-3.0.1.tgz", + "integrity": "sha512-/6KqX+GVUdqPuPPd2LxDDxzX6CAbjJehAAOKlNpqqUpAqPM6HeL8f+o3a+JsyGjn2lv0WY8UsTgUJjU9Ok55NA==", + "dev": true, + "dependencies": { + "kind-of": "^6.0.2" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/shallow-equal": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/shallow-equal/-/shallow-equal-1.2.1.tgz", + "integrity": "sha512-S4vJDjHHMBaiZuT9NPb616CSmLf618jawtv3sufLl6ivK8WocjAo58cXwbRV1cgqxH0Qbv+iUt6m05eqEa2IRA==" + }, + "node_modules/sharp": { + "version": "0.23.4", + "resolved": "https://registry.npmjs.org/sharp/-/sharp-0.23.4.tgz", + "integrity": "sha512-fJMagt6cT0UDy9XCsgyLi0eiwWWhQRxbwGmqQT6sY8Av4s0SVsT/deg8fobBQCTDU5iXRgz0rAeXoE2LBZ8g+Q==", + "hasInstallScript": true, + "dependencies": { + "color": "^3.1.2", + "detect-libc": "^1.0.3", + "nan": "^2.14.0", + "npmlog": "^4.1.2", + "prebuild-install": "^5.3.3", + "semver": "^6.3.0", + "simple-get": "^3.1.0", + "tar": "^5.0.5", + "tunnel-agent": "^0.6.0" + }, + "engines": { + "node": ">=8.5.0" + } + }, + "node_modules/sharp/node_modules/fs-minipass": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/fs-minipass/-/fs-minipass-2.1.0.tgz", + "integrity": "sha512-V/JgOLFCS+R6Vcq0slCuaeWEdNC3ouDlJMNIsacH2VtALiu9mV4LPrHc5cDl8k5aw6J8jwgWWpiTo5RYhmIzvg==", + "dependencies": { + "minipass": "^3.0.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/sharp/node_modules/minipass": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/minipass/-/minipass-3.1.1.tgz", + "integrity": "sha512-UFqVihv6PQgwj8/yTGvl9kPz7xIAY+R5z6XYjRInD3Gk3qx6QGSD6zEcpeG4Dy/lQnv1J6zv8ejV90hyYIKf3w==", + "dependencies": { + "yallist": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/sharp/node_modules/minizlib": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/minizlib/-/minizlib-2.1.0.tgz", + "integrity": "sha512-EzTZN/fjSvifSX0SlqUERCN39o6T40AMarPbv0MrarSFtIITCBh7bi+dU8nxGFHuqs9jdIAeoYoKuQAAASsPPA==", + "dependencies": { + "minipass": "^3.0.0", + "yallist": "^4.0.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/sharp/node_modules/semver": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", + "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/sharp/node_modules/tar": { + "version": "5.0.5", + "resolved": "https://registry.npmjs.org/tar/-/tar-5.0.5.tgz", + "integrity": "sha512-MNIgJddrV2TkuwChwcSNds/5E9VijOiw7kAc1y5hTNJoLDSuIyid2QtLYiCYNnICebpuvjhPQZsXwUL0O3l7OQ==", + "dependencies": { + "chownr": "^1.1.3", + "fs-minipass": "^2.0.0", + "minipass": "^3.0.0", + "minizlib": "^2.1.0", + "mkdirp": "^0.5.0", + "yallist": "^4.0.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/sharp/node_modules/yallist": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-4.0.0.tgz", + "integrity": "sha512-3wdGidZyq5PB084XLES5TpOSRA3wjXAlIWMhum2kRcv/41Sn2emQ0dycQW4uZXLejwKvg6EsvbdlVL+FYEct7A==" + }, + "node_modules/shebang-command": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-1.2.0.tgz", + "integrity": "sha1-RKrGW2lbAzmJaMOfNj/uXer98eo=", + "dependencies": { + "shebang-regex": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/shebang-regex": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-1.0.0.tgz", + "integrity": "sha1-2kL0l0DAtC2yypcoVxyxkMmO/qM=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/shelljs": { + "version": "0.8.4", + "resolved": "https://registry.npmjs.org/shelljs/-/shelljs-0.8.4.tgz", + "integrity": "sha512-7gk3UZ9kOfPLIAbslLzyWeGiEqx9e3rxwZM0KE6EL8GlGwjym9Mrlx5/p33bWTu9YG6vcS4MBxYZDHYr5lr8BQ==", + "dependencies": { + "glob": "^7.0.0", + "interpret": "^1.0.0", + "rechoir": "^0.6.2" + }, + "bin": { + "shjs": "bin/shjs" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/shellwords": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/shellwords/-/shellwords-0.1.1.tgz", + "integrity": "sha512-vFwSUfQvqybiICwZY5+DAWIPLKsWO31Q91JSKl3UYv+K5c2QRPzn0qzec6QPu1Qc9eHYItiP3NdJqNVqetYAww==", + "dev": true + }, + "node_modules/sift": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/sift/-/sift-7.0.1.tgz", + "integrity": "sha512-oqD7PMJ+uO6jV9EQCl0LrRw1OwsiPsiFQR5AR30heR+4Dl7jBBbDLnNvWiak20tzZlSE1H7RB30SX/1j/YYT7g==" + }, + "node_modules/signal-exit": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.3.tgz", + "integrity": "sha512-VUJ49FC8U1OxwZLxIbTTrDvLnf/6TDgxZcK8wxR8zs13xpx7xbG60ndBlhNrFi2EMuFRoeDoJO7wthSLq42EjA==" + }, + "node_modules/simple-assign": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/simple-assign/-/simple-assign-0.1.0.tgz", + "integrity": "sha1-F/0wZqXz13OPUDIbsPFMooHMS6o=" + }, + "node_modules/simple-concat": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/simple-concat/-/simple-concat-1.0.0.tgz", + "integrity": "sha1-c0TLuLbib7J9ZrL8hvn21Zl1IcY=" + }, + "node_modules/simple-get": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/simple-get/-/simple-get-3.1.0.tgz", + "integrity": "sha512-bCR6cP+aTdScaQCnQKbPKtJOKDp/hj9EDLJo3Nw4y1QksqaovlW/bnptB6/c1e+qmNIDHRK+oXFDdEqBT8WzUA==", + "dependencies": { + "decompress-response": "^4.2.0", + "once": "^1.3.1", + "simple-concat": "^1.0.0" + } + }, + "node_modules/simple-swizzle": { + "version": "0.2.2", + "resolved": "https://registry.npmjs.org/simple-swizzle/-/simple-swizzle-0.2.2.tgz", + "integrity": "sha1-pNprY1/8zMoz9w0Xy5JZLeleVXo=", + "dependencies": { + "is-arrayish": "^0.3.1" + } + }, + "node_modules/simple-swizzle/node_modules/is-arrayish": { + "version": "0.3.2", + "resolved": "https://registry.npmjs.org/is-arrayish/-/is-arrayish-0.3.2.tgz", + "integrity": "sha512-eVRqCvVlZbuw3GrM63ovNSNAeA1K16kaR/LRY/92w0zxQ5/1YzwblUX652i4Xs9RwAGjW9d9y6X88t8OaAJfWQ==" + }, + "node_modules/slash": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/slash/-/slash-1.0.0.tgz", + "integrity": "sha1-xB8vbDn8FtHNF61LXYlhFK5HDVU=", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/sliced": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/sliced/-/sliced-1.0.1.tgz", + "integrity": "sha1-CzpmK10Ewxd7GSa+qCsD+Dei70E=" + }, + "node_modules/snapdragon": { + "version": "0.8.2", + "resolved": "https://registry.npmjs.org/snapdragon/-/snapdragon-0.8.2.tgz", + "integrity": "sha512-FtyOnWN/wCHTVXOMwvSv26d+ko5vWlIDD6zoUJ7LW8vh+ZBC8QdljveRP+crNrtBwioEUWy/4dMtbBjA4ioNlg==", + "dependencies": { + "base": "^0.11.1", + "debug": "^2.2.0", + "define-property": "^0.2.5", + "extend-shallow": "^2.0.1", + "map-cache": "^0.2.2", + "source-map": "^0.5.6", + "source-map-resolve": "^0.5.0", + "use": "^3.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-node": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/snapdragon-node/-/snapdragon-node-2.1.1.tgz", + "integrity": "sha512-O27l4xaMYt/RSQ5TR3vpWCAB5Kb/czIcqUFOM/C4fYcLnbZUc1PkjTAMjof2pBWaSTwOUd6qUHcFGVGj7aIwnw==", + "dependencies": { + "define-property": "^1.0.0", + "isobject": "^3.0.0", + "snapdragon-util": "^3.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-node/node_modules/define-property": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz", + "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=", + "dependencies": { + "is-descriptor": "^1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-node/node_modules/is-accessor-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz", + "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-node/node_modules/is-data-descriptor": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz", + "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==", + "dependencies": { + "kind-of": "^6.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-node/node_modules/is-descriptor": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz", + "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==", + "dependencies": { + "is-accessor-descriptor": "^1.0.0", + "is-data-descriptor": "^1.0.0", + "kind-of": "^6.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-util": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/snapdragon-util/-/snapdragon-util-3.0.1.tgz", + "integrity": "sha512-mbKkMdQKsjX4BAL4bRYTj21edOf8cN7XHdYUJEe+Zn99hVEYcMvKPct1IqNe7+AZPirn8BCDOQBHQZknqmKlZQ==", + "dependencies": { + "kind-of": "^3.2.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon-util/node_modules/is-buffer": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz", + "integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==" + }, + "node_modules/snapdragon-util/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/snapdragon/node_modules/define-property": { + "version": "0.2.5", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", + "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", + "dependencies": { + "is-descriptor": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon/node_modules/extend-shallow": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz", + "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=", + "dependencies": { + "is-extendable": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon/node_modules/is-extendable": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz", + "integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/snapdragon/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/socket.io": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/socket.io/-/socket.io-2.3.0.tgz", + "integrity": "sha512-2A892lrj0GcgR/9Qk81EaY2gYhCBxurV0PfmmESO6p27QPrUK1J3zdns+5QPqvUYK2q657nSj0guoIil9+7eFg==", + "dependencies": { + "debug": "~4.1.0", + "engine.io": "~3.4.0", + "has-binary2": "~1.0.2", + "socket.io-adapter": "~1.1.0", + "socket.io-client": "2.3.0", + "socket.io-parser": "~3.4.0" + } + }, + "node_modules/socket.io-adapter": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/socket.io-adapter/-/socket.io-adapter-1.1.2.tgz", + "integrity": "sha512-WzZRUj1kUjrTIrUKpZLEzFZ1OLj5FwLlAFQs9kuZJzJi5DKdU7FsWc36SNmA8iDOtwBQyT8FkrriRM8vXLYz8g==" + }, + "node_modules/socket.io-client": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/socket.io-client/-/socket.io-client-2.3.0.tgz", + "integrity": "sha512-cEQQf24gET3rfhxZ2jJ5xzAOo/xhZwK+mOqtGRg5IowZsMgwvHwnf/mCRapAAkadhM26y+iydgwsXGObBB5ZdA==", + "dependencies": { + "backo2": "1.0.2", + "base64-arraybuffer": "0.1.5", + "component-bind": "1.0.0", + "component-emitter": "1.2.1", + "debug": "~4.1.0", + "engine.io-client": "~3.4.0", + "has-binary2": "~1.0.2", + "has-cors": "1.1.0", + "indexof": "0.0.1", + "object-component": "0.0.3", + "parseqs": "0.0.5", + "parseuri": "0.0.5", + "socket.io-parser": "~3.3.0", + "to-array": "0.1.4" + } + }, + "node_modules/socket.io-client/node_modules/component-emitter": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.2.1.tgz", + "integrity": "sha1-E3kY1teCg/ffemt8WmPhQOaUJeY=" + }, + "node_modules/socket.io-client/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/socket.io-client/node_modules/isarray": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/isarray/-/isarray-2.0.1.tgz", + "integrity": "sha1-o32U7ZzaLVmGXJ92/llu4fM4dB4=" + }, + "node_modules/socket.io-client/node_modules/socket.io-parser": { + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/socket.io-parser/-/socket.io-parser-3.3.0.tgz", + "integrity": "sha512-hczmV6bDgdaEbVqhAeVMM/jfUfzuEZHsQg6eOmLgJht6G3mPKMxYm75w2+qhAQZ+4X+1+ATZ+QFKeOZD5riHng==", + "dependencies": { + "component-emitter": "1.2.1", + "debug": "~3.1.0", + "isarray": "2.0.1" + } + }, + "node_modules/socket.io-client/node_modules/socket.io-parser/node_modules/debug": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz", + "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/socket.io-client/node_modules/socket.io-parser/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/socket.io-parser": { + "version": "3.4.0", + "resolved": "https://registry.npmjs.org/socket.io-parser/-/socket.io-parser-3.4.0.tgz", + "integrity": "sha512-/G/VOI+3DBp0+DJKW4KesGnQkQPFmUCbA/oO2QGT6CWxU7hLGWqU3tyuzeSK/dqcyeHsQg1vTe9jiZI8GU9SCQ==", + "dependencies": { + "component-emitter": "1.2.1", + "debug": "~4.1.0", + "isarray": "2.0.1" + } + }, + "node_modules/socket.io-parser/node_modules/component-emitter": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.2.1.tgz", + "integrity": "sha1-E3kY1teCg/ffemt8WmPhQOaUJeY=" + }, + "node_modules/socket.io-parser/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/socket.io-parser/node_modules/isarray": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/isarray/-/isarray-2.0.1.tgz", + "integrity": "sha1-o32U7ZzaLVmGXJ92/llu4fM4dB4=" + }, + "node_modules/socket.io/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/sockjs": { + "version": "0.3.20", + "resolved": "https://registry.npmjs.org/sockjs/-/sockjs-0.3.20.tgz", + "integrity": "sha512-SpmVOVpdq0DJc0qArhF3E5xsxvaiqGNb73XfgBpK1y3UD5gs8DSo8aCTsuT5pX8rssdc2NDIzANwP9eCAiSdTA==", + "dev": true, + "dependencies": { + "faye-websocket": "^0.10.0", + "uuid": "^3.4.0", + "websocket-driver": "0.6.5" + } + }, + "node_modules/sockjs-client": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/sockjs-client/-/sockjs-client-1.4.0.tgz", + "integrity": "sha512-5zaLyO8/nri5cua0VtOrFXBPK1jbL4+1cebT/mmKA1E1ZXOvJrII75bPu0l0k843G/+iAbhEqzyKr0w/eCCj7g==", + "dev": true, + "dependencies": { + "debug": "^3.2.5", + "eventsource": "^1.0.7", + "faye-websocket": "~0.11.1", + "inherits": "^2.0.3", + "json3": "^3.3.2", + "url-parse": "^1.4.3" + } + }, + "node_modules/sockjs-client/node_modules/faye-websocket": { + "version": "0.11.3", + "resolved": "https://registry.npmjs.org/faye-websocket/-/faye-websocket-0.11.3.tgz", + "integrity": "sha512-D2y4bovYpzziGgbHYtGCMjlJM36vAl/y+xUyn1C+FVx8szd1E+86KwVw6XvYSzOP8iMpm1X0I4xJD+QtUb36OA==", + "dev": true, + "dependencies": { + "websocket-driver": ">=0.5.1" + }, + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/solr-node": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/solr-node/-/solr-node-1.2.1.tgz", + "integrity": "sha512-DN3+FSBgpJEgGTNddzS8tNb+ILSn5MLcsWf15G9rGxi/sROHbpcevdRSVx6s5/nz56c/5AnBTBZWak7IXWX97A==", + "dependencies": { + "@log4js-node/log4js-api": "^1.0.2", + "node-fetch": "^2.3.0", + "underscore": "^1.8.3" + }, + "engines": { + "node": ">= 0.12.0" + } + }, + "node_modules/solr-node/node_modules/node-fetch": { + "version": "2.6.0", + "resolved": "https://registry.npmjs.org/node-fetch/-/node-fetch-2.6.0.tgz", + "integrity": "sha512-8dG4H5ujfvFiqDmVu9fQ5bOHUC15JMjMY/Zumv26oOvvVJjM67KF8koCWIabKQ1GJIa9r2mMZscBq/TbdOcmNA==", + "engines": { + "node": "4.x || >=6.0.0" + } + }, + "node_modules/source-list-map": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/source-list-map/-/source-list-map-2.0.1.tgz", + "integrity": "sha512-qnQ7gVMxGNxsiL4lEuJwe/To8UnK7fAnmbGEEH8RpLouuKbeEm0lhbQVFIrNSuB+G7tVrAlVsZgETT5nljf+Iw==", + "dev": true + }, + "node_modules/source-map": { + "version": "0.5.7", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz", + "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/source-map-resolve": { + "version": "0.5.3", + "resolved": "https://registry.npmjs.org/source-map-resolve/-/source-map-resolve-0.5.3.tgz", + "integrity": "sha512-Htz+RnsXWk5+P2slx5Jh3Q66vhQj1Cllm0zvnaY98+NFx+Dv2CF/f5O/t8x+KaNdrdIAsruNzoh/KpialbqAnw==", + "dependencies": { + "atob": "^2.1.2", + "decode-uri-component": "^0.2.0", + "resolve-url": "^0.2.1", + "source-map-url": "^0.4.0", + "urix": "^0.1.0" + } + }, + "node_modules/source-map-support": { + "version": "0.5.19", + "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.19.tgz", + "integrity": "sha512-Wonm7zOCIJzBGQdB+thsPar0kYuCIzYvxZwlBa87yi/Mdjv7Tip2cyVbLj5o0cFPN4EVkuTwb3GDDyUx2DGnGw==", + "dev": true, + "dependencies": { + "buffer-from": "^1.0.0", + "source-map": "^0.6.0" + } + }, + "node_modules/source-map-support/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/source-map-url": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/source-map-url/-/source-map-url-0.4.0.tgz", + "integrity": "sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM=" + }, + "node_modules/sparse-bitfield": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/sparse-bitfield/-/sparse-bitfield-3.0.3.tgz", + "integrity": "sha1-/0rm5oZWBWuks+eSqzM004JzyhE=", + "optional": true, + "dependencies": { + "memory-pager": "^1.0.2" + } + }, + "node_modules/spdx-correct": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/spdx-correct/-/spdx-correct-3.1.0.tgz", + "integrity": "sha512-lr2EZCctC2BNR7j7WzJ2FpDznxky1sjfxvvYEyzxNyb6lZXHODmEoJeFu4JupYlkfha1KZpJyoqiJ7pgA1qq8Q==", + "dependencies": { + "spdx-expression-parse": "^3.0.0", + "spdx-license-ids": "^3.0.0" + } + }, + "node_modules/spdx-exceptions": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/spdx-exceptions/-/spdx-exceptions-2.3.0.tgz", + "integrity": "sha512-/tTrYOC7PPI1nUAgx34hUpqXuyJG+DTHJTnIULG4rDygi4xu/tfgmq1e1cIRwRzwZgo4NLySi+ricLkZkw4i5A==" + }, + "node_modules/spdx-expression-parse": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/spdx-expression-parse/-/spdx-expression-parse-3.0.0.tgz", + "integrity": "sha512-Yg6D3XpRD4kkOmTpdgbUiEJFKghJH03fiC1OPll5h/0sO6neh2jqRDVHOQ4o/LMea0tgCkbMgea5ip/e+MkWyg==", + "dependencies": { + "spdx-exceptions": "^2.1.0", + "spdx-license-ids": "^3.0.0" + } + }, + "node_modules/spdx-license-ids": { + "version": "3.0.5", + "resolved": "https://registry.npmjs.org/spdx-license-ids/-/spdx-license-ids-3.0.5.tgz", + "integrity": "sha512-J+FWzZoynJEXGphVIS+XEh3kFSjZX/1i9gFBaWQcB+/tmpe2qUsSBABpcxqxnAxFdiUFEgAX1bjYGQvIZmoz9Q==" + }, + "node_modules/spdy": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/spdy/-/spdy-4.0.2.tgz", + "integrity": "sha512-r46gZQZQV+Kl9oItvl1JZZqJKGr+oEkB08A6BzkiR7593/7IbtuncXHd2YoYeTsG4157ZssMu9KYvUHLcjcDoA==", + "dev": true, + "dependencies": { + "debug": "^4.1.0", + "handle-thing": "^2.0.0", + "http-deceiver": "^1.2.7", + "select-hose": "^2.0.0", + "spdy-transport": "^3.0.0" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/spdy-transport": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/spdy-transport/-/spdy-transport-3.0.0.tgz", + "integrity": "sha512-hsLVFE5SjA6TCisWeJXFKniGGOpBgMLmerfO2aCyCU5s7nJ/rpAepqmFifv/GCbSbueEeAJJnmSQ2rKC/g8Fcw==", + "dev": true, + "dependencies": { + "debug": "^4.1.0", + "detect-node": "^2.0.4", + "hpack.js": "^2.1.6", + "obuf": "^1.1.2", + "readable-stream": "^3.0.6", + "wbuf": "^1.7.3" + } + }, + "node_modules/spdy-transport/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dev": true, + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/spdy/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dev": true, + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/split-on-first": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/split-on-first/-/split-on-first-1.1.0.tgz", + "integrity": "sha512-43ZssAJaMusuKWL8sKUBQXHWOpq8d6CfN/u1p4gUzfJkM05C8rxTmYrkIPTXapZpORA6LkkzcUulJ8FqA7Uudw==", + "engines": { + "node": ">=6" + } + }, + "node_modules/split-skip": { + "version": "0.0.2", + "resolved": "https://registry.npmjs.org/split-skip/-/split-skip-0.0.2.tgz", + "integrity": "sha1-2J2Iu9L3Pka1FYqjcKVhIk6A1GE=" + }, + "node_modules/split-string": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/split-string/-/split-string-3.1.0.tgz", + "integrity": "sha512-NzNVhJDYpwceVVii8/Hu6DKfD2G+NrQHlS/V/qgv763EYudVwEcMQNxd2lh+0VrUByXN/oJkl5grOhYWvQUYiw==", + "dependencies": { + "extend-shallow": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/sprintf-js": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/sprintf-js/-/sprintf-js-1.0.3.tgz", + "integrity": "sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=" + }, + "node_modules/sshpk": { + "version": "1.16.1", + "resolved": "https://registry.npmjs.org/sshpk/-/sshpk-1.16.1.tgz", + "integrity": "sha512-HXXqVUq7+pcKeLqqZj6mHFUMvXtOJt1uoUx09pFW6011inTMxqI8BA8PM95myrIyyKwdnzjdFjLiE6KBPVtJIg==", + "dependencies": { + "asn1": "~0.2.3", + "assert-plus": "^1.0.0", + "bcrypt-pbkdf": "^1.0.0", + "dashdash": "^1.12.0", + "ecc-jsbn": "~0.1.1", + "getpass": "^0.1.1", + "jsbn": "~0.1.0", + "safer-buffer": "^2.0.2", + "tweetnacl": "~0.14.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/ssri": { + "version": "5.3.0", + "resolved": "https://registry.npmjs.org/ssri/-/ssri-5.3.0.tgz", + "integrity": "sha512-XRSIPqLij52MtgoQavH/x/dU1qVKtWUAAZeOHsR9c2Ddi4XerFy3mc1alf+dLJKl9EUIm/Ht+EowFkTUOA6GAQ==", + "dev": true, + "dependencies": { + "safe-buffer": "^5.1.1" + } + }, + "node_modules/standard-error": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/standard-error/-/standard-error-1.1.0.tgz", + "integrity": "sha1-I+UWj6HAggGJ5YEnAaeQWFENDTQ=" + }, + "node_modules/standard-http-error": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/standard-http-error/-/standard-http-error-2.0.1.tgz", + "integrity": "sha1-+K6RcuPO+cs40ucIShkl9Xp8NL0=", + "dependencies": { + "standard-error": ">= 1.1.0 < 2" + } + }, + "node_modules/static-extend": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/static-extend/-/static-extend-0.1.2.tgz", + "integrity": "sha1-YICcOcv/VTNyJv1eC1IPNB8ftcY=", + "dependencies": { + "define-property": "^0.2.5", + "object-copy": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/static-extend/node_modules/define-property": { + "version": "0.2.5", + "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz", + "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=", + "dependencies": { + "is-descriptor": "^0.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/statuses": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.5.0.tgz", + "integrity": "sha1-Fhx9rBd2Wf2YEfQ3cfqZOBR4Yow=", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/stdout-stream": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/stdout-stream/-/stdout-stream-1.4.1.tgz", + "integrity": "sha512-j4emi03KXqJWcIeF8eIXkjMFN1Cmb8gUlDYGeBALLPo5qdyTfA9bOtl8m33lRoC+vFMkP3gl0WsDr6+gzxbbTA==", + "dependencies": { + "readable-stream": "^2.0.1" + } + }, + "node_modules/stdout-stream/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/stealthy-require": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/stealthy-require/-/stealthy-require-1.1.1.tgz", + "integrity": "sha1-NbCYdbT/SfJqd35QmzCQoyJr8ks=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/stream-browserify": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/stream-browserify/-/stream-browserify-2.0.2.tgz", + "integrity": "sha512-nX6hmklHs/gr2FuxYDltq8fJA1GDlxKQCz8O/IM4atRqBH8OORmBNgfvW5gG10GT/qQ9u0CzIvr2X5Pkt6ntqg==", + "dev": true, + "dependencies": { + "inherits": "~2.0.1", + "readable-stream": "^2.0.2" + } + }, + "node_modules/stream-browserify/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/stream-each": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/stream-each/-/stream-each-1.2.3.tgz", + "integrity": "sha512-vlMC2f8I2u/bZGqkdfLQW/13Zihpej/7PmSiMQsbYddxuTsJp8vRe2x2FvVExZg7FaOds43ROAuFJwPR4MTZLw==", + "dev": true, + "dependencies": { + "end-of-stream": "^1.1.0", + "stream-shift": "^1.0.0" + } + }, + "node_modules/stream-http": { + "version": "2.8.3", + "resolved": "https://registry.npmjs.org/stream-http/-/stream-http-2.8.3.tgz", + "integrity": "sha512-+TSkfINHDo4J+ZobQLWiMouQYB+UVYFttRA94FpEzzJ7ZdqcL4uUUQ7WkdkI4DSozGmgBUE/a47L+38PenXhUw==", + "dev": true, + "dependencies": { + "builtin-status-codes": "^3.0.0", + "inherits": "^2.0.1", + "readable-stream": "^2.3.6", + "to-arraybuffer": "^1.0.0", + "xtend": "^4.0.0" + } + }, + "node_modules/stream-http/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/stream-parser": { + "version": "0.3.1", + "resolved": "https://registry.npmjs.org/stream-parser/-/stream-parser-0.3.1.tgz", + "integrity": "sha1-FhhUhpRCACGhGC/wrxkRwSl2F3M=", + "dependencies": { + "debug": "2" + } + }, + "node_modules/stream-parser/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/stream-parser/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/stream-shift": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/stream-shift/-/stream-shift-1.0.1.tgz", + "integrity": "sha512-AiisoFqQ0vbGcZgQPY1cdP2I76glaVA/RauYR4G4thNFgkTqr90yXTo4LYX60Jl+sIlPNHHdGSwo01AvbKUSVQ==", + "dev": true + }, + "node_modules/strict-uri-encode": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/strict-uri-encode/-/strict-uri-encode-2.0.0.tgz", + "integrity": "sha1-ucczDHBChi9rFC3CdLvMWGbONUY=", + "engines": { + "node": ">=4" + } + }, + "node_modules/string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "dependencies": { + "safe-buffer": "~5.1.0" + } + }, + "node_modules/string-width": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz", + "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==", + "dependencies": { + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^4.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/string.prototype.codepointat": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/string.prototype.codepointat/-/string.prototype.codepointat-0.2.1.tgz", + "integrity": "sha512-2cBVCj6I4IOvEnjgO/hWqXjqBGsY+zwPmHl12Srk9IXSZ56Jwwmy+66XO5Iut/oQVR7t5ihYdLB0GMa4alEUcg==" + }, + "node_modules/string.prototype.trimend": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/string.prototype.trimend/-/string.prototype.trimend-1.0.1.tgz", + "integrity": "sha512-LRPxFUaTtpqYsTeNKaFOw3R4bxIzWOnbQ837QfBylo8jIxtcbK/A/sMV7Q+OAV/vWo+7s25pOE10KYSjaSO06g==", + "dependencies": { + "define-properties": "^1.1.3", + "es-abstract": "^1.17.5" + } + }, + "node_modules/string.prototype.trimleft": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/string.prototype.trimleft/-/string.prototype.trimleft-2.1.2.tgz", + "integrity": "sha512-gCA0tza1JBvqr3bfAIFJGqfdRTyPae82+KTnm3coDXkZN9wnuW3HjGgN386D7hfv5CHQYCI022/rJPVlqXyHSw==", + "dependencies": { + "define-properties": "^1.1.3", + "es-abstract": "^1.17.5", + "string.prototype.trimstart": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/string.prototype.trimright": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/string.prototype.trimright/-/string.prototype.trimright-2.1.2.tgz", + "integrity": "sha512-ZNRQ7sY3KroTaYjRS6EbNiiHrOkjihL9aQE/8gfQ4DtAC/aEBRHFJa44OmoWxGGqXuJlfKkZW4WcXErGr+9ZFg==", + "dependencies": { + "define-properties": "^1.1.3", + "es-abstract": "^1.17.5", + "string.prototype.trimend": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/string.prototype.trimstart": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/string.prototype.trimstart/-/string.prototype.trimstart-1.0.1.tgz", + "integrity": "sha512-XxZn+QpvrBI1FOcg6dIpxUPgWCPuNXvMD72aaRaUQv1eD4e/Qy8i/hFTe0BUmD60p/QA6bh1avmuPTfNjqVWRw==", + "dependencies": { + "define-properties": "^1.1.3", + "es-abstract": "^1.17.5" + } + }, + "node_modules/stringify-parameters": { + "version": "0.0.4", + "resolved": "https://registry.npmjs.org/stringify-parameters/-/stringify-parameters-0.0.4.tgz", + "integrity": "sha512-H3L90ERn5UPtkpO8eugnKcLgpIVlvTyUTrcLGm607AV5JDH6z0GymtNLr3gjGlP6I6NB/mxNX9QpY6jEQGLPdQ==", + "dependencies": { + "magicli": "0.0.5", + "unpack-string": "0.0.2" + }, + "bin": { + "stringify-parameters": "bin/cli.js" + } + }, + "node_modules/stringify-parameters/node_modules/magicli": { + "version": "0.0.5", + "resolved": "https://registry.npmjs.org/magicli/-/magicli-0.0.5.tgz", + "integrity": "sha1-zufQ+7THBRiqyxHsPrfiX/SaSSE=", + "dependencies": { + "commander": "^2.9.0", + "get-stdin": "^5.0.1", + "inspect-function": "^0.2.1", + "pipe-functions": "^1.2.0" + } + }, + "node_modules/strip-ansi": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz", + "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=", + "dependencies": { + "ansi-regex": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/strip-bom": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-2.0.0.tgz", + "integrity": "sha1-YhmoVhZSBJHzV4i9vxRHqZx+aw4=", + "dependencies": { + "is-utf8": "^0.2.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/strip-eof": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/strip-eof/-/strip-eof-1.0.0.tgz", + "integrity": "sha1-u0P/VZim6wXYm1n80SnJgzE2Br8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/strip-indent": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-1.0.1.tgz", + "integrity": "sha1-DHlipq3vp7vUrDZkYKY4VSrhoKI=", + "dependencies": { + "get-stdin": "^4.0.1" + }, + "bin": { + "strip-indent": "cli.js" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/strip-indent/node_modules/get-stdin": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/get-stdin/-/get-stdin-4.0.1.tgz", + "integrity": "sha1-uWjGsKBDhDJJAui/Gl3zJXmkUP4=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/strip-json-comments": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-2.0.1.tgz", + "integrity": "sha1-PFMZQukIwml8DsNEhYwobHygpgo=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/style-loader": { + "version": "0.23.1", + "resolved": "https://registry.npmjs.org/style-loader/-/style-loader-0.23.1.tgz", + "integrity": "sha512-XK+uv9kWwhZMZ1y7mysB+zoihsEj4wneFWAS5qoiLwzW0WzSqMrrsIy+a3zkQJq0ipFtBpX5W3MqyRIBF/WFGg==", + "dev": true, + "dependencies": { + "loader-utils": "^1.1.0", + "schema-utils": "^1.0.0" + }, + "engines": { + "node": ">= 0.12.0" + } + }, + "node_modules/style-loader/node_modules/schema-utils": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", + "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", + "dev": true, + "dependencies": { + "ajv": "^6.1.0", + "ajv-errors": "^1.0.0", + "ajv-keywords": "^3.1.0" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/styled-components": { + "version": "4.4.1", + "resolved": "https://registry.npmjs.org/styled-components/-/styled-components-4.4.1.tgz", + "integrity": "sha512-RNqj14kYzw++6Sr38n7197xG33ipEOktGElty4I70IKzQF1jzaD1U4xQ+Ny/i03UUhHlC5NWEO+d8olRCDji6g==", + "hasInstallScript": true, + "dependencies": { + "@babel/helper-module-imports": "^7.0.0", + "@babel/traverse": "^7.0.0", + "@emotion/is-prop-valid": "^0.8.1", + "@emotion/unitless": "^0.7.0", + "babel-plugin-styled-components": ">= 1", + "css-to-react-native": "^2.2.2", + "memoize-one": "^5.0.0", + "merge-anything": "^2.2.4", + "prop-types": "^15.5.4", + "react-is": "^16.6.0", + "stylis": "^3.5.0", + "stylis-rule-sheet": "^0.0.10", + "supports-color": "^5.5.0" + } + }, + "node_modules/stylis": { + "version": "3.5.4", + "resolved": "https://registry.npmjs.org/stylis/-/stylis-3.5.4.tgz", + "integrity": "sha512-8/3pSmthWM7lsPBKv7NXkzn2Uc9W7NotcwGNpJaa3k7WMM1XDCA4MgT5k/8BIexd5ydZdboXtU90XH9Ec4Bv/Q==" + }, + "node_modules/stylis-rule-sheet": { + "version": "0.0.10", + "resolved": "https://registry.npmjs.org/stylis-rule-sheet/-/stylis-rule-sheet-0.0.10.tgz", + "integrity": "sha512-nTbZoaqoBnmK+ptANthb10ZRZOGC+EmTLLUxeYIuHNkEKcmKgXX1XWKkUBT2Ac4es3NybooPe0SmvKdhKJZAuw==" + }, + "node_modules/supports-color": { + "version": "5.5.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", + "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/symbol-observable": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/symbol-observable/-/symbol-observable-1.2.0.tgz", + "integrity": "sha512-e900nM8RRtGhlV36KGEU9k65K3mPb1WV70OdjfxlG2EAuM1noi/E/BaW/uMhL7bPEssK8QV57vN3esixjUvcXQ==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/symbol-tree": { + "version": "3.2.4", + "resolved": "https://registry.npmjs.org/symbol-tree/-/symbol-tree-3.2.4.tgz", + "integrity": "sha512-9QNk5KwDF+Bvz+PyObkmSYjI5ksVUYtjW7AU22r2NKcfLJcXp96hkDWU3+XndOsUb+AQ9QhfzfCT2O+CNWT5Tw==", + "dev": true + }, + "node_modules/table-layout": { + "version": "0.4.5", + "resolved": "https://registry.npmjs.org/table-layout/-/table-layout-0.4.5.tgz", + "integrity": "sha512-zTvf0mcggrGeTe/2jJ6ECkJHAQPIYEwDoqsiqBjI24mvRmQbInK5jq33fyypaCBxX08hMkfmdOqj6haT33EqWw==", + "dependencies": { + "array-back": "^2.0.0", + "deep-extend": "~0.6.0", + "lodash.padend": "^4.6.1", + "typical": "^2.6.1", + "wordwrapjs": "^3.0.0" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/tapable": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/tapable/-/tapable-1.1.3.tgz", + "integrity": "sha512-4WK/bYZmj8xLr+HUCODHGF1ZFzsYffasLUgEiMBY4fgtltdO6B4WJtlSbPaDTLpYTcGVwM2qLnFTICEcNxs3kA==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/tar": { + "version": "4.4.13", + "resolved": "https://registry.npmjs.org/tar/-/tar-4.4.13.tgz", + "integrity": "sha512-w2VwSrBoHa5BsSyH+KxEqeQBAllHhccyMFVHtGtdMpF4W7IRWfZjFiQceJPChOeTsSDVUpER2T8FA93pr0L+QA==", + "dependencies": { + "chownr": "^1.1.1", + "fs-minipass": "^1.2.5", + "minipass": "^2.8.6", + "minizlib": "^1.2.1", + "mkdirp": "^0.5.0", + "safe-buffer": "^5.1.2", + "yallist": "^3.0.3" + }, + "engines": { + "node": ">=4.5" + } + }, + "node_modules/tar-fs": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/tar-fs/-/tar-fs-2.0.1.tgz", + "integrity": "sha512-6tzWDMeroL87uF/+lin46k+Q+46rAJ0SyPGz7OW7wTgblI273hsBqk2C1j0/xNadNLKDTUL9BukSjB7cwgmlPA==", + "dependencies": { + "chownr": "^1.1.1", + "mkdirp-classic": "^0.5.2", + "pump": "^3.0.0", + "tar-stream": "^2.0.0" + } + }, + "node_modules/tar-stream": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/tar-stream/-/tar-stream-2.1.2.tgz", + "integrity": "sha512-UaF6FoJ32WqALZGOIAApXx+OdxhekNMChu6axLJR85zMMjXKWFGjbIRe+J6P4UnRGg9rAwWvbTT0oI7hD/Un7Q==", + "dependencies": { + "bl": "^4.0.1", + "end-of-stream": "^1.4.1", + "fs-constants": "^1.0.0", + "inherits": "^2.0.3", + "readable-stream": "^3.1.1" + } + }, + "node_modules/temp-dir": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/temp-dir/-/temp-dir-1.0.0.tgz", + "integrity": "sha1-CnwOom06Oa+n4OvqnB/AvE2qAR0=", + "engines": { + "node": ">=4" + } + }, + "node_modules/tempy": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/tempy/-/tempy-0.2.1.tgz", + "integrity": "sha512-LB83o9bfZGrntdqPuRdanIVCPReam9SOZKW0fOy5I9X3A854GGWi0tjCqoXEk84XIEYBc/x9Hq3EFop/H5wJaw==", + "dependencies": { + "temp-dir": "^1.0.0", + "unique-string": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/term-size": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/term-size/-/term-size-1.2.0.tgz", + "integrity": "sha1-RYuDiH8oj8Vtb/+/rSYuJmOO+mk=", + "dependencies": { + "execa": "^0.7.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/terser": { + "version": "4.8.0", + "resolved": "https://registry.npmjs.org/terser/-/terser-4.8.0.tgz", + "integrity": "sha512-EAPipTNeWsb/3wLPeup1tVPaXfIaU68xMnVdPafIL1TV05OhASArYyIfFvnvJCNrR2NIOvDVNNTFRa+Re2MWyw==", + "dev": true, + "dependencies": { + "commander": "^2.20.0", + "source-map": "~0.6.1", + "source-map-support": "~0.5.12" + }, + "bin": { + "terser": "bin/terser" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/terser-webpack-plugin": { + "version": "1.4.5", + "resolved": "https://registry.npmjs.org/terser-webpack-plugin/-/terser-webpack-plugin-1.4.5.tgz", + "integrity": "sha512-04Rfe496lN8EYruwi6oPQkG0vo8C+HT49X687FZnpPF0qMAIHONI6HEXYPKDOE8e5HjXTyKfqRd/agHtH0kOtw==", + "dev": true, + "dependencies": { + "cacache": "^12.0.2", + "find-cache-dir": "^2.1.0", + "is-wsl": "^1.1.0", + "schema-utils": "^1.0.0", + "serialize-javascript": "^4.0.0", + "source-map": "^0.6.1", + "terser": "^4.1.2", + "webpack-sources": "^1.4.0", + "worker-farm": "^1.7.0" + }, + "engines": { + "node": ">= 6.9.0" + } + }, + "node_modules/terser-webpack-plugin/node_modules/cacache": { + "version": "12.0.4", + "resolved": "https://registry.npmjs.org/cacache/-/cacache-12.0.4.tgz", + "integrity": "sha512-a0tMB40oefvuInr4Cwb3GerbL9xTj1D5yg0T5xrjGCGyfvbxseIXX7BAO/u/hIXdafzOI5JC3wDwHyf24buOAQ==", + "dev": true, + "dependencies": { + "bluebird": "^3.5.5", + "chownr": "^1.1.1", + "figgy-pudding": "^3.5.1", + "glob": "^7.1.4", + "graceful-fs": "^4.1.15", + "infer-owner": "^1.0.3", + "lru-cache": "^5.1.1", + "mississippi": "^3.0.0", + "mkdirp": "^0.5.1", + "move-concurrently": "^1.0.1", + "promise-inflight": "^1.0.1", + "rimraf": "^2.6.3", + "ssri": "^6.0.1", + "unique-filename": "^1.1.1", + "y18n": "^4.0.0" + } + }, + "node_modules/terser-webpack-plugin/node_modules/find-cache-dir": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-2.1.0.tgz", + "integrity": "sha512-Tq6PixE0w/VMFfCgbONnkiQIVol/JJL7nRMi20fqzA4NRs9AfeqMGeRdPi3wIhYkxjeBaWh2rxwapn5Tu3IqOQ==", + "dev": true, + "dependencies": { + "commondir": "^1.0.1", + "make-dir": "^2.0.0", + "pkg-dir": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/terser-webpack-plugin/node_modules/make-dir": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-2.1.0.tgz", + "integrity": "sha512-LS9X+dc8KLxXCb8dni79fLIIUA5VyZoyjSMCwTluaXA0o27cCK0bhXkpgw+sTXVpPy/lSO57ilRixqk0vDmtRA==", + "dev": true, + "dependencies": { + "pify": "^4.0.1", + "semver": "^5.6.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/terser-webpack-plugin/node_modules/mississippi": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/mississippi/-/mississippi-3.0.0.tgz", + "integrity": "sha512-x471SsVjUtBRtcvd4BzKE9kFC+/2TeWgKCgw0bZcw1b9l2X3QX5vCWgF+KaZaYm87Ss//rHnWryupDrgLvmSkA==", + "dev": true, + "dependencies": { + "concat-stream": "^1.5.0", + "duplexify": "^3.4.2", + "end-of-stream": "^1.1.0", + "flush-write-stream": "^1.0.0", + "from2": "^2.1.0", + "parallel-transform": "^1.1.0", + "pump": "^3.0.0", + "pumpify": "^1.3.3", + "stream-each": "^1.1.0", + "through2": "^2.0.0" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/terser-webpack-plugin/node_modules/pkg-dir": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-3.0.0.tgz", + "integrity": "sha512-/E57AYkoeQ25qkxMj5PBOVgF8Kiu/h7cYS30Z5+R7WaiCCBfLq58ZI/dSeaEKb9WVJV5n/03QwrN3IeWIFllvw==", + "dev": true, + "dependencies": { + "find-up": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/terser-webpack-plugin/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dev": true, + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/terser-webpack-plugin/node_modules/serialize-javascript": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/serialize-javascript/-/serialize-javascript-4.0.0.tgz", + "integrity": "sha512-GaNA54380uFefWghODBWEGisLZFj00nS5ACs6yHa9nLqlLpVLO8ChDGeKRjZnV4Nh4n0Qi7nhYZD/9fCPzEqkw==", + "dev": true, + "dependencies": { + "randombytes": "^2.1.0" + } + }, + "node_modules/terser-webpack-plugin/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/terser-webpack-plugin/node_modules/ssri": { + "version": "6.0.2", + "resolved": "https://registry.npmjs.org/ssri/-/ssri-6.0.2.tgz", + "integrity": "sha512-cepbSq/neFK7xB6A50KHN0xHDotYzq58wWCa5LeWqnPrHG8GzfEjO/4O8kpmcGW+oaxkvhEJCWgbgNk4/ZV93Q==", + "dev": true, + "dependencies": { + "figgy-pudding": "^3.5.1" + } + }, + "node_modules/terser/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/textarea-caret": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/textarea-caret/-/textarea-caret-3.1.0.tgz", + "integrity": "sha512-cXAvzO9pP5CGa6NKx0WYHl+8CHKZs8byMkt3PCJBCmq2a34YA9pO1NrQET5pzeqnBjBdToF5No4rrmkDUgQC2Q==" + }, + "node_modules/three": { + "version": "0.127.0", + "resolved": "https://registry.npmjs.org/three/-/three-0.127.0.tgz", + "integrity": "sha512-wtgrn+mhYUbobxT7QN3GPdu3SRpSBQvwY6uOzLChWS7QE//f7paDU/+wlzbg+ngeIvBBqjBHSRuywTh8A99Jng==" + }, + "node_modules/through": { + "version": "2.3.8", + "resolved": "https://registry.npmjs.org/through/-/through-2.3.8.tgz", + "integrity": "sha1-DdTJ/6q8NXlgsbckEV1+Doai4fU=" + }, + "node_modules/through2": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/through2/-/through2-2.0.5.tgz", + "integrity": "sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ==", + "dev": true, + "dependencies": { + "readable-stream": "~2.3.6", + "xtend": "~4.0.1" + } + }, + "node_modules/through2/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/thunky": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/thunky/-/thunky-1.1.0.tgz", + "integrity": "sha512-eHY7nBftgThBqOyHGVN+l8gF0BucP09fMo0oO/Lb0w1OF80dJv+lDVpXG60WMQvkcxAkNybKsrEIE3ZtKGmPrA==", + "dev": true + }, + "node_modules/timed-out": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/timed-out/-/timed-out-4.0.1.tgz", + "integrity": "sha1-8y6srFoXW+ol1/q1Zas+2HQe9W8=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/timers-browserify": { + "version": "2.0.12", + "resolved": "https://registry.npmjs.org/timers-browserify/-/timers-browserify-2.0.12.tgz", + "integrity": "sha512-9phl76Cqm6FhSX9Xe1ZUAMLtm1BLkKj2Qd5ApyWkXzsMRaA7dgr81kf4wJmQf/hAvg8EEyJxDo3du/0KlhPiKQ==", + "dev": true, + "dependencies": { + "setimmediate": "^1.0.4" + }, + "engines": { + "node": ">=0.6.0" + } + }, + "node_modules/tiny-inflate": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/tiny-inflate/-/tiny-inflate-1.0.3.tgz", + "integrity": "sha512-pkY1fj1cKHb2seWDy0B16HeWyczlJA9/WW3u3c4z/NiWDsO3DOU5D7nhTLE9CF0yXv/QZFY7sEJmj24dK+Rrqw==" + }, + "node_modules/tiny-invariant": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/tiny-invariant/-/tiny-invariant-1.1.0.tgz", + "integrity": "sha512-ytxQvrb1cPc9WBEI/HSeYYoGD0kWnGEOR8RY6KomWLBVhqz0RgTwVO9dLrGz7dC+nN9llyI7OKAgRq8Vq4ZBSw==" + }, + "node_modules/tiny-warning": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/tiny-warning/-/tiny-warning-1.0.3.tgz", + "integrity": "sha512-lBN9zLN/oAf68o3zNXYrdCt1kP8WsiGW8Oo2ka41b2IM5JL/S1CTyX1rW0mb/zSuJun0ZUrDxx4sqvYS2FWzPA==" + }, + "node_modules/tinycolor2": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/tinycolor2/-/tinycolor2-1.4.1.tgz", + "integrity": "sha1-9PrTM0R7wLB9TcjpIJ2POaisd+g=", + "engines": { + "node": "*" + } + }, + "node_modules/to-array": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/to-array/-/to-array-0.1.4.tgz", + "integrity": "sha1-F+bBH3PdTz10zaek/zI46a2b+JA=" + }, + "node_modules/to-arraybuffer": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz", + "integrity": "sha1-fSKbH8xjfkZsoIEYCDanqr/4P0M=", + "dev": true + }, + "node_modules/to-fast-properties": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", + "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", + "engines": { + "node": ">=4" + } + }, + "node_modules/to-object-path": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/to-object-path/-/to-object-path-0.3.0.tgz", + "integrity": "sha1-KXWIt7Dn4KwI4E5nL4XB9JmeF68=", + "dependencies": { + "kind-of": "^3.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/to-object-path/node_modules/is-buffer": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz", + "integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==" + }, + "node_modules/to-object-path/node_modules/kind-of": { + "version": "3.2.2", + "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", + "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", + "dependencies": { + "is-buffer": "^1.1.5" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/to-regex": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/to-regex/-/to-regex-3.0.2.tgz", + "integrity": "sha512-FWtleNAtZ/Ki2qtqej2CXTOayOH9bHDQF+Q48VpWyDXjbYxA4Yz8iDB31zXOBUlOHHKidDbqGVrTUvQMPmBGBw==", + "dependencies": { + "define-property": "^2.0.2", + "extend-shallow": "^3.0.2", + "regex-not": "^1.0.2", + "safe-regex": "^1.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/to-regex-range": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz", + "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=", + "dependencies": { + "is-number": "^3.0.0", + "repeat-string": "^1.6.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/toidentifier": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.0.tgz", + "integrity": "sha512-yaOH/Pk/VEhBWWTlhI+qXxDFXlejDGcQipMlyxda9nthulaxLZUNcUqFxokp0vcYnvteJln5FNQDRrxj3YcbVw==", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/token-stream": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/token-stream/-/token-stream-0.0.1.tgz", + "integrity": "sha1-zu78cXp2xDFvEm0LnbqlXX598Bo=" + }, + "node_modules/touch": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/touch/-/touch-3.1.0.tgz", + "integrity": "sha512-WBx8Uy5TLtOSRtIq+M03/sKDrXCLHxwDcquSP2c43Le03/9serjQBIztjRz6FkJez9D/hleyAXTBGLwwZUw9lA==", + "dependencies": { + "nopt": "~1.0.10" + }, + "bin": { + "nodetouch": "bin/nodetouch.js" + } + }, + "node_modules/touch/node_modules/nopt": { + "version": "1.0.10", + "resolved": "https://registry.npmjs.org/nopt/-/nopt-1.0.10.tgz", + "integrity": "sha1-bd0hvSoxQXuScn3Vhfim83YI6+4=", + "dependencies": { + "abbrev": "1" + }, + "bin": { + "nopt": "bin/nopt.js" + } + }, + "node_modules/tough-cookie": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/tough-cookie/-/tough-cookie-2.5.0.tgz", + "integrity": "sha512-nlLsUzgm1kfLXSXfRZMc1KLAugd4hqJHDTvc2hDIwS3mZAfMEuMbc03SujMF+GEcpaX/qboeycw6iO8JwVv2+g==", + "dependencies": { + "psl": "^1.1.28", + "punycode": "^2.1.1" + }, + "engines": { + "node": ">=0.8" + } + }, + "node_modules/tr46": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/tr46/-/tr46-1.0.1.tgz", + "integrity": "sha1-qLE/1r/SSJUZZ0zN5VujaTtwbQk=", + "dev": true, + "dependencies": { + "punycode": "^2.1.0" + } + }, + "node_modules/translate-google-api": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/translate-google-api/-/translate-google-api-1.0.4.tgz", + "integrity": "sha512-KVXmo4+64/H1vIbnzf2zNiJ2JLeEB3jrEnNRP2EFNAGNqna/5bmw/Cps3pCHu0n3BzTOoWh9u6wFvrRYdzQ6Iw==", + "dependencies": { + "axios": "^0.20.0" + } + }, + "node_modules/translate-google-api/node_modules/axios": { + "version": "0.20.0", + "resolved": "https://registry.npmjs.org/axios/-/axios-0.20.0.tgz", + "integrity": "sha512-ANA4rr2BDcmmAQLOKft2fufrtuvlqR+cXNNinUmvfeSNCOF98PZL+7M/v1zIdGo7OLjEA9J2gXJL+j4zGsl0bA==", + "dependencies": { + "follow-redirects": "^1.10.0" + } + }, + "node_modules/traverse-chain": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/traverse-chain/-/traverse-chain-0.1.0.tgz", + "integrity": "sha1-YdvC1Ttp/2CRoSoWj9fUMxB+QPE=" + }, + "node_modules/tree-kill": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/tree-kill/-/tree-kill-1.2.2.tgz", + "integrity": "sha512-L0Orpi8qGpRG//Nd+H90vFB+3iHnue1zSSGmNOOCh1GLJ7rUKVwV2HvijphGQS2UmhUZewS9VgvxYIdgr+fG1A==", + "dev": true, + "bin": { + "tree-kill": "cli.js" + } + }, + "node_modules/trim-newlines": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-1.0.0.tgz", + "integrity": "sha1-WIeWa7WCpFA6QetST301ARgVphM=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/true-case-path": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/true-case-path/-/true-case-path-1.0.3.tgz", + "integrity": "sha512-m6s2OdQe5wgpFMC+pAJ+q9djG82O2jcHPOI6RNg1yy9rCYR+WD6Nbpl32fDpfC56nirdRy+opFa/Vk7HYhqaew==", + "dependencies": { + "glob": "^7.1.2" + } + }, + "node_modules/tryit": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/tryit/-/tryit-1.0.3.tgz", + "integrity": "sha1-OTvnMKlEb9Hq1tpZoBQwjzbCics=" + }, + "node_modules/ts-loader": { + "version": "5.4.5", + "resolved": "https://registry.npmjs.org/ts-loader/-/ts-loader-5.4.5.tgz", + "integrity": "sha512-XYsjfnRQCBum9AMRZpk2rTYSVpdZBpZK+kDh0TeT3kxmQNBDVIeUjdPjY5RZry4eIAb8XHc4gYSUiUWPYvzSRw==", + "dev": true, + "dependencies": { + "chalk": "^2.3.0", + "enhanced-resolve": "^4.0.0", + "loader-utils": "^1.0.2", + "micromatch": "^3.1.4", + "semver": "^5.0.1" + }, + "engines": { + "node": ">=6.11.5" + } + }, + "node_modules/ts-node": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/ts-node/-/ts-node-7.0.1.tgz", + "integrity": "sha512-BVwVbPJRspzNh2yfslyT1PSbl5uIk03EZlb493RKHN4qej/D06n1cEhjlOJG69oFsE7OT8XjpTUcYf6pKTLMhw==", + "dev": true, + "dependencies": { + "arrify": "^1.0.0", + "buffer-from": "^1.1.0", + "diff": "^3.1.0", + "make-error": "^1.1.1", + "minimist": "^1.2.0", + "mkdirp": "^0.5.1", + "source-map-support": "^0.5.6", + "yn": "^2.0.0" + }, + "bin": { + "ts-node": "dist/bin.js" + }, + "engines": { + "node": ">=4.2.0" + } + }, + "node_modules/ts-node-dev": { + "version": "1.0.0-pre.49", + "resolved": "https://registry.npmjs.org/ts-node-dev/-/ts-node-dev-1.0.0-pre.49.tgz", + "integrity": "sha512-iJd4QPPOaCAByl/WuEdmDX8xDR2GmoWYu6aKvGudGUcfP1sJRjpaHb7oFDuvBspQF1xhxUdbjfHuvEtZPwKZFQ==", + "dev": true, + "dependencies": { + "chokidar": "^3.4.0", + "dateformat": "~1.0.4-1.2.3", + "dynamic-dedupe": "^0.3.0", + "minimist": "^1.2.5", + "mkdirp": "^1.0.4", + "node-notifier": "^5.4.0", + "resolve": "^1.0.0", + "rimraf": "^2.6.1", + "source-map-support": "^0.5.12", + "tree-kill": "^1.2.2", + "ts-node": "^8.10.2", + "tsconfig": "^7.0.0" + }, + "bin": { + "ts-node-dev": "bin/ts-node-dev", + "tsnd": "bin/ts-node-dev" + }, + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/ts-node-dev/node_modules/anymatch": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.1.tgz", + "integrity": "sha512-mM8522psRCqzV+6LhomX5wgp25YVibjh8Wj23I5RPkPppSVSjyKD2A2mBJmWGa+KN7f2D6LNh9jkBCeyLktzjg==", + "dev": true, + "dependencies": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/ts-node-dev/node_modules/binary-extensions": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.0.0.tgz", + "integrity": "sha512-Phlt0plgpIIBOGTT/ehfFnbNlfsDEiqmzE2KRXoX1bLIlir4X/MR+zSyBEkL05ffWgnRSf/DXv+WrUAVr93/ow==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/ts-node-dev/node_modules/braces": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", + "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", + "dev": true, + "dependencies": { + "fill-range": "^7.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/ts-node-dev/node_modules/chokidar": { + "version": "3.4.0", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.4.0.tgz", + "integrity": "sha512-aXAaho2VJtisB/1fg1+3nlLJqGOuewTzQpd/Tz0yTg2R0e4IGtshYvtjowyEumcBv2z+y4+kc75Mz7j5xJskcQ==", + "dev": true, + "dependencies": { + "anymatch": "~3.1.1", + "braces": "~3.0.2", + "glob-parent": "~5.1.0", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.4.0" + }, + "engines": { + "node": ">= 8.10.0" + }, + "optionalDependencies": { + "fsevents": "~2.1.2" + } + }, + "node_modules/ts-node-dev/node_modules/diff": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/diff/-/diff-4.0.2.tgz", + "integrity": "sha512-58lmxKSA4BNyLz+HHMUzlOEpg09FV+ev6ZMe3vJihgdxzgcwZ8VoEEPmALCZG9LmqfVoNMMKpttIYTVG6uDY7A==", + "dev": true, + "engines": { + "node": ">=0.3.1" + } + }, + "node_modules/ts-node-dev/node_modules/fill-range": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", + "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", + "dev": true, + "dependencies": { + "to-regex-range": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/ts-node-dev/node_modules/glob-parent": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.1.tgz", + "integrity": "sha512-FnI+VGOpnlGHWZxthPGR+QhR78fuiK0sNLkHQv+bL9fQi57lNNdquIbna/WrfROrolq8GK5Ek6BiMwqL/voRYQ==", + "dev": true, + "dependencies": { + "is-glob": "^4.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/ts-node-dev/node_modules/is-binary-path": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", + "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", + "dev": true, + "dependencies": { + "binary-extensions": "^2.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/ts-node-dev/node_modules/is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", + "dev": true, + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/ts-node-dev/node_modules/mkdirp": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-1.0.4.tgz", + "integrity": "sha512-vVqVZQyf3WLx2Shd0qJ9xuvqgAyKPLAiqITEtqW0oIUjzo3PePDd6fW9iFz30ef7Ysp/oiWqbhszeGWW2T6Gzw==", + "dev": true, + "bin": { + "mkdirp": "bin/cmd.js" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/ts-node-dev/node_modules/readdirp": { + "version": "3.4.0", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.4.0.tgz", + "integrity": "sha512-0xe001vZBnJEK+uKcj8qOhyAKPzIT+gStxWr3LCB0DwcXR5NZJ3IaC+yGnHCYzB/S7ov3m3EEbZI2zeNvX+hGQ==", + "dev": true, + "dependencies": { + "picomatch": "^2.2.1" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/ts-node-dev/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dev": true, + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/ts-node-dev/node_modules/to-regex-range": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", + "dev": true, + "dependencies": { + "is-number": "^7.0.0" + }, + "engines": { + "node": ">=8.0" + } + }, + "node_modules/ts-node-dev/node_modules/ts-node": { + "version": "8.10.2", + "resolved": "https://registry.npmjs.org/ts-node/-/ts-node-8.10.2.tgz", + "integrity": "sha512-ISJJGgkIpDdBhWVu3jufsWpK3Rzo7bdiIXJjQc0ynKxVOVcg2oIrf2H2cejminGrptVc6q6/uynAHNCuWGbpVA==", + "dev": true, + "dependencies": { + "arg": "^4.1.0", + "diff": "^4.0.1", + "make-error": "^1.1.1", + "source-map-support": "^0.5.17", + "yn": "3.1.1" + }, + "bin": { + "ts-node": "dist/bin.js", + "ts-node-script": "dist/bin-script.js", + "ts-node-transpile-only": "dist/bin-transpile.js", + "ts-script": "dist/bin-script-deprecated.js" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/ts-node-dev/node_modules/yn": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/yn/-/yn-3.1.1.tgz", + "integrity": "sha512-Ux4ygGWsu2c7isFWe8Yu1YluJmqVhxqK2cLXNQA5AcC3QfbGNpM7fu0Y8b/z16pXLnFxZYvWhd3fhBY9DLmC6Q==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/ts-node/node_modules/arrify": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/arrify/-/arrify-1.0.1.tgz", + "integrity": "sha1-iYUI2iIm84DfkEcoRWhJwVAaSw0=", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/tsconfig": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/tsconfig/-/tsconfig-7.0.0.tgz", + "integrity": "sha512-vZXmzPrL+EmC4T/4rVlT2jNVMWCi/O4DIiSj3UHg1OE5kCKbk4mfrXc6dZksLgRM/TZlKnousKH9bbTazUWRRw==", + "dev": true, + "dependencies": { + "@types/strip-bom": "^3.0.0", + "@types/strip-json-comments": "0.0.30", + "strip-bom": "^3.0.0", + "strip-json-comments": "^2.0.0" + } + }, + "node_modules/tsconfig/node_modules/strip-bom": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-3.0.0.tgz", + "integrity": "sha1-IzTBjpx1n3vdVv3vfprj1YjmjtM=", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/tslib": { + "version": "1.11.1", + "resolved": "https://registry.npmjs.org/tslib/-/tslib-1.11.1.tgz", + "integrity": "sha512-aZW88SY8kQbU7gpV19lN24LtXh/yD4ZZg6qieAJDDg+YBsJcSmLGK9QpnUjAKVG/xefmvJGd1WUmfpT/g6AJGA==", + "dev": true + }, + "node_modules/tslint": { + "version": "5.20.1", + "resolved": "https://registry.npmjs.org/tslint/-/tslint-5.20.1.tgz", + "integrity": "sha512-EcMxhzCFt8k+/UP5r8waCf/lzmeSyVlqxqMEDQE7rWYiQky8KpIBz1JAoYXfROHrPZ1XXd43q8yQnULOLiBRQg==", + "dev": true, + "dependencies": { + "@babel/code-frame": "^7.0.0", + "builtin-modules": "^1.1.1", + "chalk": "^2.3.0", + "commander": "^2.12.1", + "diff": "^4.0.1", + "glob": "^7.1.1", + "js-yaml": "^3.13.1", + "minimatch": "^3.0.4", + "mkdirp": "^0.5.1", + "resolve": "^1.3.2", + "semver": "^5.3.0", + "tslib": "^1.8.0", + "tsutils": "^2.29.0" + }, + "bin": { + "tslint": "bin/tslint" + }, + "engines": { + "node": ">=4.8.0" + } + }, + "node_modules/tslint-loader": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/tslint-loader/-/tslint-loader-3.6.0.tgz", + "integrity": "sha512-Me9Qf/87BOfCY8uJJw+J7VMF4U8WiMXKLhKKKugMydF0xMhMOt9wo2mjYTNhwbF9H7SHh8PAIwRG8roisTNekQ==", + "dev": true, + "dependencies": { + "loader-utils": "^1.0.2", + "mkdirp": "^0.5.1", + "object-assign": "^4.1.1", + "rimraf": "^2.4.4", + "semver": "^5.3.0" + } + }, + "node_modules/tslint-loader/node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dev": true, + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/tslint/node_modules/diff": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/diff/-/diff-4.0.2.tgz", + "integrity": "sha512-58lmxKSA4BNyLz+HHMUzlOEpg09FV+ev6ZMe3vJihgdxzgcwZ8VoEEPmALCZG9LmqfVoNMMKpttIYTVG6uDY7A==", + "dev": true, + "engines": { + "node": ">=0.3.1" + } + }, + "node_modules/tsscmp": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/tsscmp/-/tsscmp-1.0.6.tgz", + "integrity": "sha512-LxhtAkPDTkVCMQjt2h6eBVY28KCjikZqZfMcC15YBeNjkgUpdCfBu5HoiOTDu86v6smE8yOjyEktJ8hlbANHQA==", + "engines": { + "node": ">=0.6.x" + } + }, + "node_modules/tsutils": { + "version": "2.29.0", + "resolved": "https://registry.npmjs.org/tsutils/-/tsutils-2.29.0.tgz", + "integrity": "sha512-g5JVHCIJwzfISaXpXE1qvNalca5Jwob6FjI4AoPlqMusJ6ftFE7IkkFoMhVLRgK+4Kx3gkzb8UZK5t5yTTvEmA==", + "dev": true, + "dependencies": { + "tslib": "^1.8.1" + } + }, + "node_modules/tty-browserify": { + "version": "0.0.0", + "resolved": "https://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.0.tgz", + "integrity": "sha1-oVe6QC2iTpv5V/mqadUk7tQpAaY=", + "dev": true + }, + "node_modules/tunnel-agent": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/tunnel-agent/-/tunnel-agent-0.6.0.tgz", + "integrity": "sha1-J6XeoGs2sEoKmWZ3SykIaPD8QP0=", + "dependencies": { + "safe-buffer": "^5.0.1" + }, + "engines": { + "node": "*" + } + }, + "node_modules/tweetnacl": { + "version": "0.14.5", + "resolved": "https://registry.npmjs.org/tweetnacl/-/tweetnacl-0.14.5.tgz", + "integrity": "sha1-WuaBd/GS1EViadEIr6k/+HQ/T2Q=" + }, + "node_modules/type": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/type/-/type-1.2.0.tgz", + "integrity": "sha512-+5nt5AAniqsCnu2cEQQdpzCAh33kVx8n0VoFidKpB1dVVLAN/F+bgVOqOJqOnEnrhp222clB5p3vUlD+1QAnfg==", + "dev": true + }, + "node_modules/type-check": { + "version": "0.3.2", + "resolved": "https://registry.npmjs.org/type-check/-/type-check-0.3.2.tgz", + "integrity": "sha1-WITKtRLPHTVeP7eE8wgEsrUg23I=", + "dev": true, + "dependencies": { + "prelude-ls": "~1.1.2" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/type-detect": { + "version": "4.0.8", + "resolved": "https://registry.npmjs.org/type-detect/-/type-detect-4.0.8.tgz", + "integrity": "sha512-0fr/mIH1dlO+x7TlcMy+bIDqKPsw/70tVyeHW787goQjhmqaZe10uwLujubK9q9Lg6Fiho1KUKDYz0Z7k7g5/g==", + "engines": { + "node": ">=4" + } + }, + "node_modules/type-is": { + "version": "1.6.18", + "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz", + "integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==", + "dependencies": { + "media-typer": "0.3.0", + "mime-types": "~2.1.24" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/typed-styles": { + "version": "0.0.7", + "resolved": "https://registry.npmjs.org/typed-styles/-/typed-styles-0.0.7.tgz", + "integrity": "sha512-pzP0PWoZUhsECYjABgCGQlRGL1n7tOHsgwYv3oIiEpJwGhFTuty/YNeduxQYzXXa3Ge5BdT6sHYIQYpl4uJ+5Q==" + }, + "node_modules/typedarray": { + "version": "0.0.6", + "resolved": "https://registry.npmjs.org/typedarray/-/typedarray-0.0.6.tgz", + "integrity": "sha1-hnrHTjhkGHsdPUfZlqeOxciDB3c=" + }, + "node_modules/typescript": { + "version": "3.9.9", + "resolved": "https://registry.npmjs.org/typescript/-/typescript-3.9.9.tgz", + "integrity": "sha512-kdMjTiekY+z/ubJCATUPlRDl39vXYiMV9iyeMuEuXZh2we6zz80uovNN2WlAxmmdE/Z/YQe+EbOEXB5RHEED3w==", + "dev": true, + "bin": { + "tsc": "bin/tsc", + "tsserver": "bin/tsserver" + }, + "engines": { + "node": ">=4.2.0" + } + }, + "node_modules/typescript-collections": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/typescript-collections/-/typescript-collections-1.3.3.tgz", + "integrity": "sha512-7sI4e/bZijOzyURng88oOFZCISQPTHozfE2sUu5AviFYk5QV7fYGb6YiDl+vKjF/pICA354JImBImL9XJWUvdQ==" + }, + "node_modules/typescript-language-server": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/typescript-language-server/-/typescript-language-server-0.4.0.tgz", + "integrity": "sha512-K8jNOmDFn+QfrCh8ujby2pGDs5rpjYZQn+zvQnf42rxG4IHbfw5CHoMvbGkWPK/J5Gw8/l5K3i03kVZC2IBElg==", + "dependencies": { + "command-exists": "1.2.6", + "commander": "^2.11.0", + "fs-extra": "^7.0.0", + "p-debounce": "^1.0.0", + "tempy": "^0.2.1", + "vscode-languageserver": "^5.3.0-next", + "vscode-uri": "^1.0.5" + }, + "bin": { + "typescript-language-server": "lib/cli.js" + } + }, + "node_modules/typescript-language-server/node_modules/fs-extra": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-7.0.1.tgz", + "integrity": "sha512-YJDaCJZEnBmcbw13fvdAM9AwNOJwOzrE4pqMqBq5nFiEqXUqHwlK4B+3pUw6JNvfSPtX05xFHtYy/1ni01eGCw==", + "dependencies": { + "graceful-fs": "^4.1.2", + "jsonfile": "^4.0.0", + "universalify": "^0.1.0" + }, + "engines": { + "node": ">=6 <7 || >=8" + } + }, + "node_modules/typescript-language-server/node_modules/jsonfile": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/jsonfile/-/jsonfile-4.0.0.tgz", + "integrity": "sha1-h3Gq4HmbZAdrdmQPygWPnBDjPss=", + "dependencies": { + "graceful-fs": "^4.1.6" + } + }, + "node_modules/typical": { + "version": "2.6.1", + "resolved": "https://registry.npmjs.org/typical/-/typical-2.6.1.tgz", + "integrity": "sha1-XAgOXWYcu+OCWdLnCjxyU+hziB0=" + }, + "node_modules/ua-parser-js": { + "version": "0.7.21", + "resolved": "https://registry.npmjs.org/ua-parser-js/-/ua-parser-js-0.7.21.tgz", + "integrity": "sha512-+O8/qh/Qj8CgC6eYBVBykMrNtp5Gebn4dlGD/kKXVkJNDwyrAwSIqwz8CDf+tsAIWVycKcku6gIXJ0qwx/ZXaQ==", + "engines": { + "node": "*" + } + }, + "node_modules/uglify-js": { + "version": "2.8.29", + "resolved": "https://registry.npmjs.org/uglify-js/-/uglify-js-2.8.29.tgz", + "integrity": "sha1-KcVzMUgFe7Th913zW3qcty5qWd0=", + "dependencies": { + "source-map": "~0.5.1", + "yargs": "~3.10.0" + }, + "bin": { + "uglifyjs": "bin/uglifyjs" + }, + "engines": { + "node": ">=0.8.0" + }, + "optionalDependencies": { + "uglify-to-browserify": "~1.0.0" + } + }, + "node_modules/uglify-js/node_modules/camelcase": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-1.2.1.tgz", + "integrity": "sha1-m7UwTS4LVmmLLHWLCKPqqdqlijk=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/uglify-js/node_modules/cliui": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/cliui/-/cliui-2.1.0.tgz", + "integrity": "sha1-S0dXYP+AJkx2LDoXGQMukcf+oNE=", + "dependencies": { + "center-align": "^0.1.1", + "right-align": "^0.1.1", + "wordwrap": "0.0.2" + } + }, + "node_modules/uglify-js/node_modules/yargs": { + "version": "3.10.0", + "resolved": "https://registry.npmjs.org/yargs/-/yargs-3.10.0.tgz", + "integrity": "sha1-9+572FfdfB0tOMDnTvvWgdFDH9E=", + "dependencies": { + "camelcase": "^1.0.2", + "cliui": "^2.1.0", + "decamelize": "^1.0.0", + "window-size": "0.1.0" + } + }, + "node_modules/uglify-to-browserify": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/uglify-to-browserify/-/uglify-to-browserify-1.0.2.tgz", + "integrity": "sha1-bgkk1r2mta/jSeOabWMoUKD4grc=", + "optional": true + }, + "node_modules/uid-safe": { + "version": "2.1.5", + "resolved": "https://registry.npmjs.org/uid-safe/-/uid-safe-2.1.5.tgz", + "integrity": "sha512-KPHm4VL5dDXKz01UuEd88Df+KzynaohSL9fBh096KWAxSKZQDI2uBrVqtvRM4rwrIrRRKsdLNML/lnaaVSRioA==", + "dependencies": { + "random-bytes": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/uid2": { + "version": "0.0.3", + "resolved": "https://registry.npmjs.org/uid2/-/uid2-0.0.3.tgz", + "integrity": "sha1-SDEm4Rd03y9xuLY53NeZw3YWK4I=" + }, + "node_modules/unbzip2-stream": { + "version": "1.4.3", + "resolved": "https://registry.npmjs.org/unbzip2-stream/-/unbzip2-stream-1.4.3.tgz", + "integrity": "sha512-mlExGW4w71ebDJviH16lQLtZS32VKqsSfk80GCfUlwT/4/hNRFsoscrF/c++9xinkMzECL1uL9DDwXqFWkruPg==", + "dependencies": { + "buffer": "^5.2.1", + "through": "^2.3.8" + } + }, + "node_modules/undefsafe": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/undefsafe/-/undefsafe-2.0.3.tgz", + "integrity": "sha512-nrXZwwXrD/T/JXeygJqdCO6NZZ1L66HrxM/Z7mIq2oPanoN0F1nLx3lwJMu6AwJY69hdixaFQOuoYsMjE5/C2A==", + "dependencies": { + "debug": "^2.2.0" + } + }, + "node_modules/undefsafe/node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/undefsafe/node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "node_modules/underscore": { + "version": "1.10.2", + "resolved": "https://registry.npmjs.org/underscore/-/underscore-1.10.2.tgz", + "integrity": "sha512-N4P+Q/BuyuEKFJ43B9gYuOj4TQUHXX+j2FqguVOpjkssLUUrnJofCcBccJSCoeturDoZU6GorDTHSvUDlSQbTg==" + }, + "node_modules/unicode-trie": { + "version": "0.3.1", + "resolved": "https://registry.npmjs.org/unicode-trie/-/unicode-trie-0.3.1.tgz", + "integrity": "sha1-1nHd3YkQGgi6w3tqUWEBBgIFIIU=", + "dependencies": { + "pako": "^0.2.5", + "tiny-inflate": "^1.0.0" + } + }, + "node_modules/unicode-trie/node_modules/pako": { + "version": "0.2.9", + "resolved": "https://registry.npmjs.org/pako/-/pako-0.2.9.tgz", + "integrity": "sha1-8/dSL073gjSNqBYbrZ7P1Rv4OnU=" + }, + "node_modules/union-value": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/union-value/-/union-value-1.0.1.tgz", + "integrity": "sha512-tJfXmxMeWYnczCVs7XAEvIV7ieppALdyepWMkHkwciRpZraG/xwT+s2JN8+pr1+8jCRf80FFzvr+MpQeeoF4Xg==", + "dependencies": { + "arr-union": "^3.1.0", + "get-value": "^2.0.6", + "is-extendable": "^0.1.1", + "set-value": "^2.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/union-value/node_modules/is-extendable": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz", + "integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/uniq": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/uniq/-/uniq-1.0.1.tgz", + "integrity": "sha1-sxxa6CVIRKOoKBVBzisEuGWnNP8=", + "dev": true + }, + "node_modules/unique-filename": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/unique-filename/-/unique-filename-1.1.1.tgz", + "integrity": "sha512-Vmp0jIp2ln35UTXuryvjzkjGdRyf9b2lTXuSYUiPmzRcl3FDtYqAwOnTJkAngD9SWhnoJzDbTKwaOrZ+STtxNQ==", + "dev": true, + "dependencies": { + "unique-slug": "^2.0.0" + } + }, + "node_modules/unique-slug": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/unique-slug/-/unique-slug-2.0.2.tgz", + "integrity": "sha512-zoWr9ObaxALD3DOPfjPSqxt4fnZiWblxHIgeWqW8x7UqDzEtHEQLzji2cuJYQFCU6KmoJikOYAZlrTHHebjx2w==", + "dev": true, + "dependencies": { + "imurmurhash": "^0.1.4" + } + }, + "node_modules/unique-string": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unique-string/-/unique-string-1.0.0.tgz", + "integrity": "sha1-nhBXzKhRq7kzmPizOuGHuZyuwRo=", + "dependencies": { + "crypto-random-string": "^1.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/universalify": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/universalify/-/universalify-0.1.2.tgz", + "integrity": "sha512-rBJeI5CXAlmy1pV+617WB9J63U6XcazHHF2f2dbJix4XzpUF0RS3Zbj0FGIOCAva5P/d/GBOYaACQ1w+0azUkg==", + "engines": { + "node": ">= 4.0.0" + } + }, + "node_modules/unorm": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/unorm/-/unorm-1.6.0.tgz", + "integrity": "sha512-b2/KCUlYZUeA7JFUuRJZPUtr4gZvBh7tavtv4fvk4+KV9pfGiR6CQAQAWl49ZpR3ts2dk4FYkP7EIgDJoiOLDA==", + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/unpack-string": { + "version": "0.0.2", + "resolved": "https://registry.npmjs.org/unpack-string/-/unpack-string-0.0.2.tgz", + "integrity": "sha1-MC7PCCOLATm9Q0pNf9Z83zPKJ10=" + }, + "node_modules/unpipe": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/unset-value": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unset-value/-/unset-value-1.0.0.tgz", + "integrity": "sha1-g3aHP30jNRef+x5vw6jtDfyKtVk=", + "dependencies": { + "has-value": "^0.3.1", + "isobject": "^3.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/unset-value/node_modules/has-value": { + "version": "0.3.1", + "resolved": "https://registry.npmjs.org/has-value/-/has-value-0.3.1.tgz", + "integrity": "sha1-ex9YutpiyoJ+wKIHgCVlSEWZXh8=", + "dependencies": { + "get-value": "^2.0.3", + "has-values": "^0.1.4", + "isobject": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/unset-value/node_modules/has-value/node_modules/isobject": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/isobject/-/isobject-2.1.0.tgz", + "integrity": "sha1-8GVWEJaj8dou9GJy+BXIQNh+DIk=", + "dependencies": { + "isarray": "1.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/unset-value/node_modules/has-values": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/has-values/-/has-values-0.1.4.tgz", + "integrity": "sha1-bWHeldkd/Km5oCCJrThL/49it3E=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/unstated": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/unstated/-/unstated-2.1.1.tgz", + "integrity": "sha512-fORlTWMZxq7NuMJDxyIrrYIZKN7wEWYQ9SiaJfIRcSpsowr6Ph/JIfK2tgtXLW614JfPG/t5q9eEIhXRCf55xg==", + "dependencies": { + "create-react-context": "^0.1.5" + } + }, + "node_modules/unstated/node_modules/create-react-context": { + "version": "0.1.6", + "resolved": "https://registry.npmjs.org/create-react-context/-/create-react-context-0.1.6.tgz", + "integrity": "sha512-eCnYYEUEc5i32LHwpE/W7NlddOB9oHwsPaWtWzYtflNkkwa3IfindIcoXdVWs12zCbwaMCavKNu84EXogVIWHw==" + }, + "node_modules/unzip-response": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/unzip-response/-/unzip-response-2.0.1.tgz", + "integrity": "sha1-0vD3N9FrBhXnKmk17QQhRXLVb5c=", + "engines": { + "node": ">=4" + } + }, + "node_modules/upath": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/upath/-/upath-1.2.0.tgz", + "integrity": "sha512-aZwGpamFO61g3OlfT7OQCHqhGnW43ieH9WZeP7QxN/G/jS4jfqUkZxoryvJgVPEcrl5NL/ggHsSmLMHuH64Lhg==", + "engines": { + "node": ">=4", + "yarn": "*" + } + }, + "node_modules/update-notifier": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/update-notifier/-/update-notifier-2.5.0.tgz", + "integrity": "sha512-gwMdhgJHGuj/+wHJJs9e6PcCszpxR1b236igrOkUofGhqJuG+amlIKwApH1IW1WWl7ovZxsX49lMBWLxSdm5Dw==", + "dependencies": { + "boxen": "^1.2.1", + "chalk": "^2.0.1", + "configstore": "^3.0.0", + "import-lazy": "^2.1.0", + "is-ci": "^1.0.10", + "is-installed-globally": "^0.1.0", + "is-npm": "^1.0.0", + "latest-version": "^3.0.0", + "semver-diff": "^2.0.0", + "xdg-basedir": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/uri-js": { + "version": "4.2.2", + "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.2.2.tgz", + "integrity": "sha512-KY9Frmirql91X2Qgjry0Wd4Y+YTdrdZheS8TFwvkbLWf/G5KNJDCh6pKL5OZctEW4+0Baa5idK2ZQuELRwPznQ==", + "dependencies": { + "punycode": "^2.1.0" + } + }, + "node_modules/urix": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/urix/-/urix-0.1.0.tgz", + "integrity": "sha1-2pN/emLiH+wf0Y1Js1wpNQZ6bHI=" + }, + "node_modules/url": { + "version": "0.11.0", + "resolved": "https://registry.npmjs.org/url/-/url-0.11.0.tgz", + "integrity": "sha1-ODjpfPxgUh63PFJajlW/3Z4uKPE=", + "dev": true, + "dependencies": { + "punycode": "1.3.2", + "querystring": "0.2.0" + } + }, + "node_modules/url-loader": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/url-loader/-/url-loader-1.1.2.tgz", + "integrity": "sha512-dXHkKmw8FhPqu8asTc1puBfe3TehOCo2+RmOOev5suNCIYBcT626kxiWg1NBVkwc4rO8BGa7gP70W7VXuqHrjg==", + "dependencies": { + "loader-utils": "^1.1.0", + "mime": "^2.0.3", + "schema-utils": "^1.0.0" + }, + "engines": { + "node": ">= 6.9.0" + } + }, + "node_modules/url-loader/node_modules/mime": { + "version": "2.4.4", + "resolved": "https://registry.npmjs.org/mime/-/mime-2.4.4.tgz", + "integrity": "sha512-LRxmNwziLPT828z+4YkNzloCFC2YM4wrB99k+AV5ZbEyfGNWfG8SO1FUXLmLDBSo89NrJZ4DIWeLjy1CHGhMGA==", + "bin": { + "mime": "cli.js" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/url-loader/node_modules/schema-utils": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz", + "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==", + "dependencies": { + "ajv": "^6.1.0", + "ajv-errors": "^1.0.0", + "ajv-keywords": "^3.1.0" + }, + "engines": { + "node": ">= 4" + } + }, + "node_modules/url-parse": { + "version": "1.4.7", + "resolved": "https://registry.npmjs.org/url-parse/-/url-parse-1.4.7.tgz", + "integrity": "sha512-d3uaVyzDB9tQoSXFvuSUNFibTd9zxd2bkVrDRvF5TmvWWQwqE4lgYJ5m+x1DbecWkw+LK4RNl2CU1hHuOKPVlg==", + "dev": true, + "dependencies": { + "querystringify": "^2.1.1", + "requires-port": "^1.0.0" + } + }, + "node_modules/url-parse-lax": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/url-parse-lax/-/url-parse-lax-1.0.0.tgz", + "integrity": "sha1-evjzA2Rem9eaJy56FKxovAYJ2nM=", + "dependencies": { + "prepend-http": "^1.0.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/url-template": { + "version": "2.0.8", + "resolved": "https://registry.npmjs.org/url-template/-/url-template-2.0.8.tgz", + "integrity": "sha1-/FZaPMy/93MMd19WQflVV5FDnyE=" + }, + "node_modules/url/node_modules/punycode": { + "version": "1.3.2", + "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.3.2.tgz", + "integrity": "sha1-llOgNvt8HuQjQvIyXM7v6jkmxI0=", + "dev": true + }, + "node_modules/use": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/use/-/use-3.1.1.tgz", + "integrity": "sha512-cwESVXlO3url9YWlFW/TA9cshCEhtu7IKJ/p5soJ/gGpj7vbvFrAY/eIioQ6Dw23KjZhYgiIo8HOs1nQ2vr/oQ==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/use-asset": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/use-asset/-/use-asset-1.0.4.tgz", + "integrity": "sha512-7/hqDrWa0iMnCoET9W1T07EmD4Eg/Wmoj/X8TGBc++ECRK4m5yTsjP4O6s0yagbxfqIOuUkIxe2/sA+VR2GxZA==", + "dependencies": { + "fast-deep-equal": "^3.1.3" + } + }, + "node_modules/use-asset/node_modules/fast-deep-equal": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz", + "integrity": "sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==" + }, + "node_modules/use-memo-one": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/use-memo-one/-/use-memo-one-1.1.1.tgz", + "integrity": "sha512-oFfsyun+bP7RX8X2AskHNTxu+R3QdE/RC5IefMbqptmACAA/gfol1KDD5KRzPsGMa62sWxGZw+Ui43u6x4ddoQ==" + }, + "node_modules/util": { + "version": "0.11.1", + "resolved": "https://registry.npmjs.org/util/-/util-0.11.1.tgz", + "integrity": "sha512-HShAsny+zS2TZfaXxD9tYj4HQGlBezXZMZuM/S5PKLLoZkShZiGk9o5CzukI1LVHZvjdvZ2Sj1aW/Ndn2NB/HQ==", + "dev": true, + "dependencies": { + "inherits": "2.0.3" + } + }, + "node_modules/util-deprecate": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", + "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=" + }, + "node_modules/util/node_modules/inherits": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", + "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=", + "dev": true + }, + "node_modules/utility-types": { + "version": "3.10.0", + "resolved": "https://registry.npmjs.org/utility-types/-/utility-types-3.10.0.tgz", + "integrity": "sha512-O11mqxmi7wMKCo6HKFt5AhO4BwY3VV68YU07tgxfz8zJTIxr4BpsezN49Ffwy9j3ZpwwJp4fkRwjRzq3uWE6Rg==", + "engines": { + "node": ">= 4" + } + }, + "node_modules/utils-merge": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", + "integrity": "sha1-n5VxD1CiZ5R7LMwSR0HBAoQn5xM=", + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/uuid": { + "version": "3.4.0", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-3.4.0.tgz", + "integrity": "sha512-HjSDRw6gZE5JMggctHBcjVak08+KEVhSIiDzFnT9S9aegmp85S/bReBVTb4QTFaRNptJ9kuYaNhnbNEOkbKb/A==", + "bin": { + "uuid": "bin/uuid" + } + }, + "node_modules/v8-compile-cache": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/v8-compile-cache/-/v8-compile-cache-2.1.1.tgz", + "integrity": "sha512-8OQ9CL+VWyt3JStj7HX7/ciTL2V3Rl1Wf5OL+SNTm0yK1KvtReVulksyeRnCANHHuUxHlQig+JJDlUhBt1NQDQ==", + "dev": true + }, + "node_modules/valid-url": { + "version": "1.0.9", + "resolved": "https://registry.npmjs.org/valid-url/-/valid-url-1.0.9.tgz", + "integrity": "sha1-HBRHm0DxOXp1eC8RXkCGRHQzogA=" + }, + "node_modules/validate-npm-package-license": { + "version": "3.0.4", + "resolved": "https://registry.npmjs.org/validate-npm-package-license/-/validate-npm-package-license-3.0.4.tgz", + "integrity": "sha512-DpKm2Ui/xN7/HQKCtpZxoRWBhZ9Z0kqtygG8XCgNQ8ZlDnxuQmWhj566j8fN4Cu3/JmbhsDo7fcAJq4s9h27Ew==", + "dependencies": { + "spdx-correct": "^3.0.0", + "spdx-expression-parse": "^3.0.0" + } + }, + "node_modules/validator": { + "version": "10.11.0", + "resolved": "https://registry.npmjs.org/validator/-/validator-10.11.0.tgz", + "integrity": "sha512-X/p3UZerAIsbBfN/IwahhYaBbY68EN/UQBWHtsbXGT5bfrH/p4NQzUCG1kF/rtKaNpnJ7jAu6NGTdSNtyNIXMw==", + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/vary": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz", + "integrity": "sha1-IpnwLG3tMNSllhsLn3RSShj2NPw=", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/verror": { + "version": "1.10.0", + "resolved": "https://registry.npmjs.org/verror/-/verror-1.10.0.tgz", + "integrity": "sha1-OhBcoXBTr1XW4nDB+CiGguGNpAA=", + "engines": [ + "node >=0.6.0" + ], + "dependencies": { + "assert-plus": "^1.0.0", + "core-util-is": "1.0.2", + "extsprintf": "^1.2.0" + } + }, + "node_modules/vm-browserify": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/vm-browserify/-/vm-browserify-1.1.2.tgz", + "integrity": "sha512-2ham8XPWTONajOR0ohOKOHXkm3+gaBmGut3SRuu75xLd/RRaY6vqgh8NBYYk7+RW3u5AtzPQZG8F10LHkl0lAQ==", + "dev": true + }, + "node_modules/void-elements": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/void-elements/-/void-elements-2.0.1.tgz", + "integrity": "sha1-wGavtYK7HLQSjWDqkjkulNXp2+w=", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/vscode-jsonrpc": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/vscode-jsonrpc/-/vscode-jsonrpc-5.0.1.tgz", + "integrity": "sha512-JvONPptw3GAQGXlVV2utDcHx0BiY34FupW/kI6mZ5x06ER5DdPG/tXWMVHjTNULF5uKPOUUD0SaXg5QaubJL0A==", + "engines": { + "node": ">=8.0.0 || >=10.0.0" + } + }, + "node_modules/vscode-languageserver": { + "version": "5.3.0-next.10", + "resolved": "https://registry.npmjs.org/vscode-languageserver/-/vscode-languageserver-5.3.0-next.10.tgz", + "integrity": "sha512-QL7Fe1FT6PdLtVzwJeZ78pTic4eZbzLRy7yAQgPb9xalqqgZESR0+yDZPwJrM3E7PzOmwHBceYcJR54eQZ7Kng==", + "dependencies": { + "vscode-languageserver-protocol": "^3.15.0-next.8", + "vscode-textbuffer": "^1.0.0" + }, + "bin": { + "installServerIntoExtension": "bin/installServerIntoExtension" + } + }, + "node_modules/vscode-languageserver-protocol": { + "version": "3.15.3", + "resolved": "https://registry.npmjs.org/vscode-languageserver-protocol/-/vscode-languageserver-protocol-3.15.3.tgz", + "integrity": "sha512-zrMuwHOAQRhjDSnflWdJG+O2ztMWss8GqUUB8dXLR/FPenwkiBNkMIJJYfSN6sgskvsF0rHAoBowNQfbyZnnvw==", + "dependencies": { + "vscode-jsonrpc": "^5.0.1", + "vscode-languageserver-types": "3.15.1" + } + }, + "node_modules/vscode-languageserver-types": { + "version": "3.15.1", + "resolved": "https://registry.npmjs.org/vscode-languageserver-types/-/vscode-languageserver-types-3.15.1.tgz", + "integrity": "sha512-+a9MPUQrNGRrGU630OGbYVQ+11iOIovjCkqxajPa9w57Sd5ruK8WQNsslzpa0x/QJqC8kRc2DUxWjIFwoNm4ZQ==" + }, + "node_modules/vscode-textbuffer": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/vscode-textbuffer/-/vscode-textbuffer-1.0.0.tgz", + "integrity": "sha512-zPaHo4urgpwsm+PrJWfNakolRpryNja18SUip/qIIsfhuEqEIPEXMxHOlFPjvDC4JgTaimkncNW7UMXRJTY6ow==" + }, + "node_modules/vscode-uri": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/vscode-uri/-/vscode-uri-1.0.8.tgz", + "integrity": "sha512-obtSWTlbJ+a+TFRYGaUumtVwb+InIUVI0Lu0VBUAPmj2cU5JutEXg3xUE0c2J5Tcy7h2DEKVJBFi+Y9ZSFzzPQ==" + }, + "node_modules/vue-template-compiler": { + "version": "2.6.11", + "resolved": "https://registry.npmjs.org/vue-template-compiler/-/vue-template-compiler-2.6.11.tgz", + "integrity": "sha512-KIq15bvQDrcCjpGjrAhx4mUlyyHfdmTaoNfeoATHLAiWB+MU3cx4lOzMwrnUh9cCxy0Lt1T11hAFY6TQgroUAA==", + "dependencies": { + "de-indent": "^1.0.2", + "he": "^1.1.0" + } + }, + "node_modules/w3c-hr-time": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/w3c-hr-time/-/w3c-hr-time-1.0.2.tgz", + "integrity": "sha512-z8P5DvDNjKDoFIHK7q8r8lackT6l+jo/Ye3HOle7l9nICP9lf1Ci25fy9vHd0JOWewkIFzXIEig3TdKT7JQ5fQ==", + "dev": true, + "dependencies": { + "browser-process-hrtime": "^1.0.0" + } + }, + "node_modules/w3c-keyname": { + "version": "2.2.4", + "resolved": "https://registry.npmjs.org/w3c-keyname/-/w3c-keyname-2.2.4.tgz", + "integrity": "sha512-tOhfEwEzFLJzf6d1ZPkYfGj+FWhIpBux9ppoP3rlclw3Z0BZv3N7b7030Z1kYth+6rDuAsXUFr+d0VE6Ed1ikw==" + }, + "node_modules/w3c-xmlserializer": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/w3c-xmlserializer/-/w3c-xmlserializer-1.1.2.tgz", + "integrity": "sha512-p10l/ayESzrBMYWRID6xbuCKh2Fp77+sA0doRuGn4tTIMrrZVeqfpKjXHY+oDh3K4nLdPgNwMTVP6Vp4pvqbNg==", + "dev": true, + "dependencies": { + "domexception": "^1.0.1", + "webidl-conversions": "^4.0.2", + "xml-name-validator": "^3.0.0" + } + }, + "node_modules/walkdir": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/walkdir/-/walkdir-0.4.1.tgz", + "integrity": "sha512-3eBwRyEln6E1MSzcxcVpQIhRG8Q1jLvEqRmCZqS3dsfXEDR/AhOF4d+jHg1qvDCpYaVRZjENPQyrVxAkQqxPgQ==", + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/warning": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/warning/-/warning-3.0.0.tgz", + "integrity": "sha1-MuU3fLVy3kqwR1O9+IIcAe1gW3w=", + "dependencies": { + "loose-envify": "^1.0.0" + } + }, + "node_modules/watchpack": { + "version": "1.7.5", + "resolved": "https://registry.npmjs.org/watchpack/-/watchpack-1.7.5.tgz", + "integrity": "sha512-9P3MWk6SrKjHsGkLT2KHXdQ/9SNkyoJbabxnKOoJepsvJjJG8uYTR3yTPxPQvNDI3w4Nz1xnE0TLHK4RIVe/MQ==", + "dev": true, + "dependencies": { + "graceful-fs": "^4.1.2", + "neo-async": "^2.5.0" + }, + "optionalDependencies": { + "chokidar": "^3.4.1", + "watchpack-chokidar2": "^2.0.1" + } + }, + "node_modules/watchpack-chokidar2": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/watchpack-chokidar2/-/watchpack-chokidar2-2.0.1.tgz", + "integrity": "sha512-nCFfBIPKr5Sh61s4LPpy1Wtfi0HE8isJ3d2Yb5/Ppw2P2B/3eVSEBjKfN0fmHJSK14+31KwMKmcrzs2GM4P0Ww==", + "dev": true, + "optional": true, + "dependencies": { + "chokidar": "^2.1.8" + } + }, + "node_modules/watchpack/node_modules/anymatch": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.2.tgz", + "integrity": "sha512-P43ePfOAIupkguHUycrc4qJ9kz8ZiuOUijaETwX7THt0Y/GNK7v0aa8rY816xWjZ7rJdA5XdMcpVFTKMq+RvWg==", + "dev": true, + "optional": true, + "dependencies": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/watchpack/node_modules/binary-extensions": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.2.0.tgz", + "integrity": "sha512-jDctJ/IVQbZoJykoeHbhXpOlNBqGNcwXJKJog42E5HDPUwQTSdjCHdihjj0DlnheQ7blbT6dHOafNAiS8ooQKA==", + "dev": true, + "optional": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/watchpack/node_modules/braces": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", + "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", + "dev": true, + "optional": true, + "dependencies": { + "fill-range": "^7.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/watchpack/node_modules/chokidar": { + "version": "3.5.1", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.5.1.tgz", + "integrity": "sha512-9+s+Od+W0VJJzawDma/gvBNQqkTiqYTWLuZoyAsivsI4AaWTCzHG06/TMjsf1cYe9Cb97UCEhjz7HvnPk2p/tw==", + "dev": true, + "optional": true, + "dependencies": { + "anymatch": "~3.1.1", + "braces": "~3.0.2", + "fsevents": "~2.3.1", + "glob-parent": "~5.1.0", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.5.0" + }, + "engines": { + "node": ">= 8.10.0" + } + }, + "node_modules/watchpack/node_modules/fill-range": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", + "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", + "dev": true, + "optional": true, + "dependencies": { + "to-regex-range": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/watchpack/node_modules/fsevents": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.2.tgz", + "integrity": "sha512-xiqMQR4xAeHTuB9uWm+fFRcIOgKBMiOBP+eXiyT7jsgVCq1bkVygt00oASowB7EdtpOHaaPgKt812P9ab+DDKA==", + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": "^8.16.0 || ^10.6.0 || >=11.0.0" + } + }, + "node_modules/watchpack/node_modules/glob-parent": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", + "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", + "dev": true, + "optional": true, + "dependencies": { + "is-glob": "^4.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/watchpack/node_modules/is-binary-path": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", + "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", + "dev": true, + "optional": true, + "dependencies": { + "binary-extensions": "^2.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/watchpack/node_modules/is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", + "dev": true, + "optional": true, + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/watchpack/node_modules/readdirp": { + "version": "3.5.0", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.5.0.tgz", + "integrity": "sha512-cMhu7c/8rdhkHXWsY+osBhfSy0JikwpHK/5+imo+LpeasTF8ouErHrlYkwT0++njiyuDvc7OFY5T3ukvZ8qmFQ==", + "dev": true, + "optional": true, + "dependencies": { + "picomatch": "^2.2.1" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/watchpack/node_modules/to-regex-range": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", + "dev": true, + "optional": true, + "dependencies": { + "is-number": "^7.0.0" + }, + "engines": { + "node": ">=8.0" + } + }, + "node_modules/wbuf": { + "version": "1.7.3", + "resolved": "https://registry.npmjs.org/wbuf/-/wbuf-1.7.3.tgz", + "integrity": "sha512-O84QOnr0icsbFGLS0O3bI5FswxzRr8/gHwWkDlQFskhSPryQXvrTMxjxGP4+iWYoauLoBvfDpkrOauZ+0iZpDA==", + "dev": true, + "dependencies": { + "minimalistic-assert": "^1.0.0" + } + }, + "node_modules/web-request": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/web-request/-/web-request-1.0.7.tgz", + "integrity": "sha1-twxCs81FV3noLbaIYlOySR8r1Wk=", + "dependencies": { + "request": "^2.69.0" + } + }, + "node_modules/webidl-conversions": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/webidl-conversions/-/webidl-conversions-4.0.2.tgz", + "integrity": "sha512-YQ+BmxuTgd6UXZW3+ICGfyqRyHXVlD5GtQr5+qjiNW7bF0cqrzX500HVXPBOvgXb5YnzDd+h0zqyv61KUD7+Sg==", + "dev": true + }, + "node_modules/webpack": { + "version": "4.46.0", + "resolved": "https://registry.npmjs.org/webpack/-/webpack-4.46.0.tgz", + "integrity": "sha512-6jJuJjg8znb/xRItk7bkT0+Q7AHCYjjFnvKIWQPkNIOyRqoCGvkOs0ipeQzrqz4l5FtN5ZI/ukEHroeX/o1/5Q==", + "dev": true, + "dependencies": { + "@webassemblyjs/ast": "1.9.0", + "@webassemblyjs/helper-module-context": "1.9.0", + "@webassemblyjs/wasm-edit": "1.9.0", + "@webassemblyjs/wasm-parser": "1.9.0", + "acorn": "^6.4.1", + "ajv": "^6.10.2", + "ajv-keywords": "^3.4.1", + "chrome-trace-event": "^1.0.2", + "enhanced-resolve": "^4.5.0", + "eslint-scope": "^4.0.3", + "json-parse-better-errors": "^1.0.2", + "loader-runner": "^2.4.0", + "loader-utils": "^1.2.3", + "memory-fs": "^0.4.1", + "micromatch": "^3.1.10", + "mkdirp": "^0.5.3", + "neo-async": "^2.6.1", + "node-libs-browser": "^2.2.1", + "schema-utils": "^1.0.0", + "tapable": "^1.1.3", + "terser-webpack-plugin": "^1.4.3", + "watchpack": "^1.7.4", + "webpack-sources": "^1.4.1" + }, + "bin": { + "webpack": "bin/webpack.js" + }, + "engines": { + "node": ">=6.11.5" + } + }, + "node_modules/webpack-cli": { + "version": "3.3.12", + "resolved": "https://registry.npmjs.org/webpack-cli/-/webpack-cli-3.3.12.tgz", + "integrity": "sha512-NVWBaz9k839ZH/sinurM+HcDvJOTXwSjYp1ku+5XKeOC03z8v5QitnK/x+lAxGXFyhdayoIf/GOpv85z3/xPag==", + "dev": true, + "dependencies": { + "chalk": "^2.4.2", + "cross-spawn": "^6.0.5", + "enhanced-resolve": "^4.1.1", + "findup-sync": "^3.0.0", + "global-modules": "^2.0.0", + "import-local": "^2.0.0", + "interpret": "^1.4.0", + "loader-utils": "^1.4.0", + "supports-color": "^6.1.0", + "v8-compile-cache": "^2.1.1", + "yargs": "^13.3.2" + }, + "bin": { + "webpack-cli": "bin/cli.js" + }, + "engines": { + "node": ">=6.11.5" + } + }, + "node_modules/webpack-cli/node_modules/cross-spawn": { + "version": "6.0.5", + "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-6.0.5.tgz", + "integrity": "sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==", + "dev": true, + "dependencies": { + "nice-try": "^1.0.4", + "path-key": "^2.0.1", + "semver": "^5.5.0", + "shebang-command": "^1.2.0", + "which": "^1.2.9" + }, + "engines": { + "node": ">=4.8" + } + }, + "node_modules/webpack-cli/node_modules/interpret": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/interpret/-/interpret-1.4.0.tgz", + "integrity": "sha512-agE4QfB2Lkp9uICn7BAqoscw4SZP9kTE2hxiFI3jBPmXJfdqiahTbUuKGsMoN2GtqL9AxhYioAcVvgsb1HvRbA==", + "dev": true, + "engines": { + "node": ">= 0.10" + } + }, + "node_modules/webpack-cli/node_modules/supports-color": { + "version": "6.1.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-6.1.0.tgz", + "integrity": "sha512-qe1jfm1Mg7Nq/NSh6XE24gPXROEVsWHxC1LIx//XNlD9iw7YZQGjZNjYN7xGaEG6iKdA8EtNFW6R0gjnVXp+wQ==", + "dev": true, + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/webpack-dev-middleware": { + "version": "3.7.3", + "resolved": "https://registry.npmjs.org/webpack-dev-middleware/-/webpack-dev-middleware-3.7.3.tgz", + "integrity": "sha512-djelc/zGiz9nZj/U7PTBi2ViorGJXEWo/3ltkPbDyxCXhhEXkW0ce99falaok4TPj+AsxLiXJR0EBOb0zh9fKQ==", + "dev": true, + "dependencies": { + "memory-fs": "^0.4.1", + "mime": "^2.4.4", + "mkdirp": "^0.5.1", + "range-parser": "^1.2.1", + "webpack-log": "^2.0.0" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/webpack-dev-middleware/node_modules/memory-fs": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.4.1.tgz", + "integrity": "sha1-OpoguEYlI+RHz7x+i7gO1me/xVI=", + "dev": true, + "dependencies": { + "errno": "^0.1.3", + "readable-stream": "^2.0.1" + } + }, + "node_modules/webpack-dev-middleware/node_modules/mime": { + "version": "2.5.2", + "resolved": "https://registry.npmjs.org/mime/-/mime-2.5.2.tgz", + "integrity": "sha512-tqkh47FzKeCPD2PUiPB6pkbMzsCasjxAfC62/Wap5qrUWcb+sFasXUC5I3gYM5iBM8v/Qpn4UK0x+j0iHyFPDg==", + "dev": true, + "bin": { + "mime": "cli.js" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/webpack-dev-middleware/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/webpack-dev-middleware/node_modules/webpack-log": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/webpack-log/-/webpack-log-2.0.0.tgz", + "integrity": "sha512-cX8G2vR/85UYG59FgkoMamwHUIkSSlV3bBMRsbxVXVUk2j6NleCKjQ/WE9eYg9WY4w25O9w8wKP4rzNZFmUcUg==", + "dev": true, + "dependencies": { + "ansi-colors": "^3.0.0", + "uuid": "^3.3.2" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/webpack-dev-server": { + "version": "3.11.0", + "resolved": "https://registry.npmjs.org/webpack-dev-server/-/webpack-dev-server-3.11.0.tgz", + "integrity": "sha512-PUxZ+oSTxogFQgkTtFndEtJIPNmml7ExwufBZ9L2/Xyyd5PnOL5UreWe5ZT7IU25DSdykL9p1MLQzmLh2ljSeg==", + "dev": true, + "dependencies": { + "ansi-html": "0.0.7", + "bonjour": "^3.5.0", + "chokidar": "^2.1.8", + "compression": "^1.7.4", + "connect-history-api-fallback": "^1.6.0", + "debug": "^4.1.1", + "del": "^4.1.1", + "express": "^4.17.1", + "html-entities": "^1.3.1", + "http-proxy-middleware": "0.19.1", + "import-local": "^2.0.0", + "internal-ip": "^4.3.0", + "ip": "^1.1.5", + "is-absolute-url": "^3.0.3", + "killable": "^1.0.1", + "loglevel": "^1.6.8", + "opn": "^5.5.0", + "p-retry": "^3.0.1", + "portfinder": "^1.0.26", + "schema-utils": "^1.0.0", + "selfsigned": "^1.10.7", + "semver": "^6.3.0", + "serve-index": "^1.9.1", + "sockjs": "0.3.20", + "sockjs-client": "1.4.0", + "spdy": "^4.0.2", + "strip-ansi": "^3.0.1", + "supports-color": "^6.1.0", + "url": "^0.11.0", + "webpack-dev-middleware": "^3.7.2", + "webpack-log": "^2.0.0", + "ws": "^6.2.1", + "yargs": "^13.3.2" + }, + "bin": { + "webpack-dev-server": "bin/webpack-dev-server.js" + }, + "engines": { + "node": ">= 6.11.5" + } + }, + "node_modules/webpack-dev-server/node_modules/ansi-regex": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", + "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-dev-server/node_modules/debug": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.1.1.tgz", + "integrity": "sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==", + "dev": true, + "dependencies": { + "ms": "^2.1.1" + } + }, + "node_modules/webpack-dev-server/node_modules/semver": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", + "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", + "dev": true, + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/webpack-dev-server/node_modules/strip-ansi": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", + "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", + "dev": true, + "dependencies": { + "ansi-regex": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-dev-server/node_modules/supports-color": { + "version": "6.1.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-6.1.0.tgz", + "integrity": "sha512-qe1jfm1Mg7Nq/NSh6XE24gPXROEVsWHxC1LIx//XNlD9iw7YZQGjZNjYN7xGaEG6iKdA8EtNFW6R0gjnVXp+wQ==", + "dev": true, + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/webpack-dev-server/node_modules/webpack-log": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/webpack-log/-/webpack-log-2.0.0.tgz", + "integrity": "sha512-cX8G2vR/85UYG59FgkoMamwHUIkSSlV3bBMRsbxVXVUk2j6NleCKjQ/WE9eYg9WY4w25O9w8wKP4rzNZFmUcUg==", + "dev": true, + "dependencies": { + "ansi-colors": "^3.0.0", + "uuid": "^3.3.2" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/webpack-dev-server/node_modules/ws": { + "version": "6.2.1", + "resolved": "https://registry.npmjs.org/ws/-/ws-6.2.1.tgz", + "integrity": "sha512-GIyAXC2cB7LjvpgMt9EKS2ldqr0MTrORaleiOno6TweZ6r3TKtoFQWay/2PceJ3RuBasOHzXNn5Lrw1X0bEjqA==", + "dev": true, + "dependencies": { + "async-limiter": "~1.0.0" + } + }, + "node_modules/webpack-hot-middleware": { + "version": "2.25.0", + "resolved": "https://registry.npmjs.org/webpack-hot-middleware/-/webpack-hot-middleware-2.25.0.tgz", + "integrity": "sha512-xs5dPOrGPCzuRXNi8F6rwhawWvQQkeli5Ro48PRuQh8pYPCPmNnltP9itiUPT4xI8oW+y0m59lyyeQk54s5VgA==", + "dev": true, + "dependencies": { + "ansi-html": "0.0.7", + "html-entities": "^1.2.0", + "querystring": "^0.2.0", + "strip-ansi": "^3.0.0" + } + }, + "node_modules/webpack-hot-middleware/node_modules/ansi-regex": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", + "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-hot-middleware/node_modules/strip-ansi": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", + "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", + "dev": true, + "dependencies": { + "ansi-regex": "^2.0.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack-log": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/webpack-log/-/webpack-log-1.2.0.tgz", + "integrity": "sha512-U9AnICnu50HXtiqiDxuli5gLB5PGBo7VvcHx36jRZHwK4vzOYLbImqT4lwWwoMHdQWwEKw736fCHEekokTEKHA==", + "dev": true, + "dependencies": { + "chalk": "^2.1.0", + "log-symbols": "^2.1.0", + "loglevelnext": "^1.0.1", + "uuid": "^3.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/webpack-sources": { + "version": "1.4.3", + "resolved": "https://registry.npmjs.org/webpack-sources/-/webpack-sources-1.4.3.tgz", + "integrity": "sha512-lgTS3Xhv1lCOKo7SA5TjKXMjpSM4sBjNV5+q2bqesbSPs5FjGmU6jjtBSkX9b4qW87vDIsCIlUPOEhbZrMdjeQ==", + "dev": true, + "dependencies": { + "source-list-map": "^2.0.0", + "source-map": "~0.6.1" + } + }, + "node_modules/webpack-sources/node_modules/source-map": { + "version": "0.6.1", + "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", + "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/webpack/node_modules/acorn": { + "version": "6.4.2", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-6.4.2.tgz", + "integrity": "sha512-XtGIhXwF8YM8bJhGxG5kXgjkEuNGLTkoYqVE+KMR+aspr4KGYmKYg7yUe3KghyQ9yheNwLnjmzh/7+gfDBmHCQ==", + "dev": true, + "bin": { + "acorn": "bin/acorn" + }, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/webpack/node_modules/enhanced-resolve": { + "version": "4.5.0", + "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.5.0.tgz", + "integrity": "sha512-Nv9m36S/vxpsI+Hc4/ZGRs0n9mXqSWGGq49zxb/cJfPAQMbUtttJAlNPS4AQzaBdw/pKskw5bMbekT/Y7W/Wlg==", + "dev": true, + "dependencies": { + "graceful-fs": "^4.1.2", + "memory-fs": "^0.5.0", + "tapable": "^1.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/webpack/node_modules/enhanced-resolve/node_modules/memory-fs": { + "version": "0.5.0", + "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.5.0.tgz", + "integrity": "sha512-jA0rdU5KoQMC0e6ppoNRtpp6vjFq6+NY7r8hywnC7V+1Xj/MtHwGIbB1QaK/dunyjWteJzmkpd7ooeWg10T7GA==", + "dev": true, + "dependencies": { + "errno": "^0.1.3", + "readable-stream": "^2.0.1" + }, + "engines": { + "node": ">=4.3.0 <5.0.0 || >=5.10" + } + }, + "node_modules/webpack/node_modules/memory-fs": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.4.1.tgz", + "integrity": "sha1-OpoguEYlI+RHz7x+i7gO1me/xVI=", + "dev": true, + "dependencies": { + "errno": "^0.1.3", + "readable-stream": "^2.0.1" + } + }, + "node_modules/webpack/node_modules/readable-stream": { + "version": "2.3.7", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", + "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", + "dev": true, + "dependencies": { + "core-util-is": "~1.0.0", + "inherits": "~2.0.3", + "isarray": "~1.0.0", + "process-nextick-args": "~2.0.0", + "safe-buffer": "~5.1.1", + "string_decoder": "~1.1.1", + "util-deprecate": "~1.0.1" + } + }, + "node_modules/webrtc-adapter": { + "version": "7.6.3", + "resolved": "https://registry.npmjs.org/webrtc-adapter/-/webrtc-adapter-7.6.3.tgz", + "integrity": "sha512-DCMiS6cy29PknSuBz779twM6/VsPdoQNAU/I/q4VCEVSlCQ88xiwqGD5/osVO6UMyXCnTBiOl8kd+1cJi6Pkig==", + "dependencies": { + "rtcpeerconnection-shim": "^1.2.15", + "sdp": "^2.12.0" + }, + "engines": { + "node": ">=6.0.0", + "npm": ">=3.10.0" + } + }, + "node_modules/websocket-driver": { + "version": "0.6.5", + "resolved": "https://registry.npmjs.org/websocket-driver/-/websocket-driver-0.6.5.tgz", + "integrity": "sha1-XLJVbOuF9Dc8bYI4qmkchFThOjY=", + "dev": true, + "dependencies": { + "websocket-extensions": ">=0.1.1" + }, + "engines": { + "node": ">=0.6.0" + } + }, + "node_modules/websocket-extensions": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/websocket-extensions/-/websocket-extensions-0.1.4.tgz", + "integrity": "sha512-OqedPIGOfsDlo31UNwYbCFMSaO9m9G/0faIHj5/dZFDMFqPTcx6UwqyOy3COEaEOg/9VsGIpdqn62W5KhoKSpg==", + "dev": true, + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/whatwg-encoding": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/whatwg-encoding/-/whatwg-encoding-1.0.5.tgz", + "integrity": "sha512-b5lim54JOPN9HtzvK9HFXvBma/rnfFeqsic0hSpjtDbVxR3dJKLc+KB4V6GgiGOvl7CY/KNh8rxSo9DKQrnUEw==", + "dev": true, + "dependencies": { + "iconv-lite": "0.4.24" + } + }, + "node_modules/whatwg-fetch": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/whatwg-fetch/-/whatwg-fetch-3.0.0.tgz", + "integrity": "sha512-9GSJUgz1D4MfyKU7KRqwOjXCXTqWdFNvEr7eUBYchQiVc744mqK/MzXPNR2WsPkmkOa4ywfg8C2n8h+13Bey1Q==" + }, + "node_modules/whatwg-mimetype": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/whatwg-mimetype/-/whatwg-mimetype-2.3.0.tgz", + "integrity": "sha512-M4yMwr6mAnQz76TbJm914+gPpB/nCwvZbJU28cUD6dR004SAxDLOOSUaB1JDRqLtaOV/vi0IC5lEAGFgrjGv/g==", + "dev": true + }, + "node_modules/whatwg-url": { + "version": "7.1.0", + "resolved": "https://registry.npmjs.org/whatwg-url/-/whatwg-url-7.1.0.tgz", + "integrity": "sha512-WUu7Rg1DroM7oQvGWfOiAK21n74Gg+T4elXEQYkOhtyLeWiJFoOGLXPKI/9gzIie9CtwVLm8wtw6YJdKyxSjeg==", + "dev": true, + "dependencies": { + "lodash.sortby": "^4.7.0", + "tr46": "^1.0.1", + "webidl-conversions": "^4.0.2" + } + }, + "node_modules/which": { + "version": "1.3.1", + "resolved": "https://registry.npmjs.org/which/-/which-1.3.1.tgz", + "integrity": "sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ==", + "dependencies": { + "isexe": "^2.0.0" + }, + "bin": { + "which": "bin/which" + } + }, + "node_modules/which-module": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz", + "integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=" + }, + "node_modules/which-pm-runs": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/which-pm-runs/-/which-pm-runs-1.0.0.tgz", + "integrity": "sha1-Zws6+8VS4LVd9rd4DKdGFfI60cs=" + }, + "node_modules/wide-align": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/wide-align/-/wide-align-1.1.3.tgz", + "integrity": "sha512-QGkOQc8XL6Bt5PwnsExKBPuMKBxnGxWWW3fU55Xt4feHozMUhdUMaBCk290qpm/wG5u/RSKzwdAC4i51YigihA==", + "dependencies": { + "string-width": "^1.0.2 || 2" + } + }, + "node_modules/widest-line": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/widest-line/-/widest-line-2.0.1.tgz", + "integrity": "sha512-Ba5m9/Fa4Xt9eb2ELXt77JxVDV8w7qQrH0zS/TWSJdLyAwQjWoOzpzj5lwVftDz6n/EOu3tNACS84v509qwnJA==", + "dependencies": { + "string-width": "^2.1.1" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/wikijs": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/wikijs/-/wikijs-6.0.1.tgz", + "integrity": "sha512-67ZtXyVPspYM5/B5ci0NIwvPJyG23HPk33QQLgLbCcORQ6N0I3Mhxd/KsPRh3xyly87KDs/bh1xuIG6PVTCKGw==", + "dependencies": { + "cheerio": "^1.0.0-rc.3", + "cross-fetch": "^3.0.2", + "infobox-parser": "3.3.1" + }, + "engines": { + "node": ">=0.10.4" + } + }, + "node_modules/window-size": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/window-size/-/window-size-0.1.0.tgz", + "integrity": "sha1-VDjNLqk7IC76Ohn+iIeu58lPnJ0=", + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/with": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/with/-/with-5.1.1.tgz", + "integrity": "sha1-+k2qktrzLE6pTtRTyB8EaGtXXf4=", + "dependencies": { + "acorn": "^3.1.0", + "acorn-globals": "^3.0.0" + } + }, + "node_modules/word-wrap": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/word-wrap/-/word-wrap-1.2.3.tgz", + "integrity": "sha512-Hz/mrNwitNRh/HUAtM/VT/5VH+ygD6DV7mYKZAtHOrbs8U7lvPS6xf7EJKMF0uW1KJCl0H701g3ZGus+muE5vQ==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/words-to-numbers": { + "version": "1.5.1", + "resolved": "https://registry.npmjs.org/words-to-numbers/-/words-to-numbers-1.5.1.tgz", + "integrity": "sha512-uvz7zSCKmmA7o5f5zp4Z5l24RQhy6HSNu10URhNxQWv1I82RsFaZX3qD07RLFUMJsCV38oAuaca13AvhO+9yGw==", + "dependencies": { + "babel-runtime": "6.x.x", + "clj-fuzzy": "^0.3.2", + "its-set": "^1.1.5" + } + }, + "node_modules/wordwrap": { + "version": "0.0.2", + "resolved": "https://registry.npmjs.org/wordwrap/-/wordwrap-0.0.2.tgz", + "integrity": "sha1-t5Zpu0LstAn4PVg8rVLKF+qhZD8=", + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/wordwrapjs": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/wordwrapjs/-/wordwrapjs-3.0.0.tgz", + "integrity": "sha512-mO8XtqyPvykVCsrwj5MlOVWvSnCdT+C+QVbm6blradR7JExAhbkZ7hZ9A+9NUtwzSqrlUo9a67ws0EiILrvRpw==", + "dependencies": { + "reduce-flatten": "^1.0.1", + "typical": "^2.6.1" + }, + "engines": { + "node": ">=4.0.0" + } + }, + "node_modules/worker-farm": { + "version": "1.7.0", + "resolved": "https://registry.npmjs.org/worker-farm/-/worker-farm-1.7.0.tgz", + "integrity": "sha512-rvw3QTZc8lAxyVrqcSGVm5yP/IJ2UcB3U0graE3LCFoZ0Yn2x4EoVSqJKdB/T5M+FLcRPjz4TDacRf3OCfNUzw==", + "dev": true, + "dependencies": { + "errno": "~0.1.7" + } + }, + "node_modules/worker-rpc": { + "version": "0.1.1", + "resolved": "https://registry.npmjs.org/worker-rpc/-/worker-rpc-0.1.1.tgz", + "integrity": "sha512-P1WjMrUB3qgJNI9jfmpZ/htmBEjFh//6l/5y8SD9hg1Ef5zTTVVoRjTrTEzPrNBQvmhMxkoTsjOXN10GWU7aCg==", + "dev": true, + "dependencies": { + "microevent.ts": "~0.1.1" + } + }, + "node_modules/wrap-ansi": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-5.1.0.tgz", + "integrity": "sha512-QC1/iN/2/RPVJ5jYK8BGttj5z83LmSKmvbvrXPNCLZSEb32KKVDJDl/MOt2N01qU2H/FkzEa9PKto1BqDjtd7Q==", + "dependencies": { + "ansi-styles": "^3.2.0", + "string-width": "^3.0.0", + "strip-ansi": "^5.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/wrap-ansi/node_modules/ansi-regex": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", + "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==", + "engines": { + "node": ">=6" + } + }, + "node_modules/wrap-ansi/node_modules/string-width": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz", + "integrity": "sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==", + "dependencies": { + "emoji-regex": "^7.0.1", + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^5.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/wrap-ansi/node_modules/strip-ansi": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", + "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", + "dependencies": { + "ansi-regex": "^4.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/wrappy": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", + "integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=" + }, + "node_modules/write-file-atomic": { + "version": "2.4.3", + "resolved": "https://registry.npmjs.org/write-file-atomic/-/write-file-atomic-2.4.3.tgz", + "integrity": "sha512-GaETH5wwsX+GcnzhPgKcKjJ6M2Cq3/iZp1WyY/X1CSqrW+jVNM9Y7D8EC2sM4ZG/V8wZlSniJnCKWPmBYAucRQ==", + "dependencies": { + "graceful-fs": "^4.1.11", + "imurmurhash": "^0.1.4", + "signal-exit": "^3.0.2" + } + }, + "node_modules/ws": { + "version": "7.2.5", + "resolved": "https://registry.npmjs.org/ws/-/ws-7.2.5.tgz", + "integrity": "sha512-C34cIU4+DB2vMyAbmEKossWq2ZQDr6QEyuuCzWrM9zfw1sGc0mYiJ0UnG9zzNykt49C2Fi34hvr2vssFQRS6EA==", + "engines": { + "node": ">=8.3.0" + } + }, + "node_modules/xdg-basedir": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/xdg-basedir/-/xdg-basedir-3.0.0.tgz", + "integrity": "sha1-SWsswQnsqNus/i3HK2A8F8WHCtQ=", + "engines": { + "node": ">=4" + } + }, + "node_modules/xml-name-validator": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/xml-name-validator/-/xml-name-validator-3.0.0.tgz", + "integrity": "sha512-A5CUptxDsvxKJEU3yO6DuWBSJz/qizqzJKOMIfUJHETbBw/sFaDxgd6fxm1ewUaM0jZ444Fc5vC5ROYurg/4Pw==", + "dev": true + }, + "node_modules/xmlbuilder": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/xmlbuilder/-/xmlbuilder-4.0.0.tgz", + "integrity": "sha1-mLj2UcowqmJANvEn0RzGbce5B6M=", + "dependencies": { + "lodash": "^3.5.0" + }, + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/xmlbuilder/node_modules/lodash": { + "version": "3.10.1", + "resolved": "https://registry.npmjs.org/lodash/-/lodash-3.10.1.tgz", + "integrity": "sha1-W/Rejkm6QYnhfUgnid/RW9FAt7Y=" + }, + "node_modules/xmlchars": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/xmlchars/-/xmlchars-2.2.0.tgz", + "integrity": "sha512-JZnDKK8B0RCDw84FNdDAIpZK+JuJw+s7Lz8nksI7SIuU3UXJJslUthsi+uWBUYOwPFwW7W7PRLRfUKpxjtjFCw==", + "dev": true + }, + "node_modules/xmldom": { + "version": "0.1.31", + "resolved": "https://registry.npmjs.org/xmldom/-/xmldom-0.1.31.tgz", + "integrity": "sha512-yS2uJflVQs6n+CyjHoaBmVSqIDevTAWrzMmjG1Gc7h1qQ7uVozNhEPJAwZXWyGQ/Gafo3fCwrcaokezLPupVyQ==", + "engines": { + "node": ">=0.1" + } + }, + "node_modules/xmlhttprequest-ssl": { + "version": "1.5.5", + "resolved": "https://registry.npmjs.org/xmlhttprequest-ssl/-/xmlhttprequest-ssl-1.5.5.tgz", + "integrity": "sha1-wodrBhaKrcQOV9l+gRkayPQ5iz4=", + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/xoauth2": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/xoauth2/-/xoauth2-1.2.0.tgz", + "integrity": "sha1-8u76wRRyyXHqO8RuVU60sSMhRuU=" + }, + "node_modules/xregexp": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/xregexp/-/xregexp-4.3.0.tgz", + "integrity": "sha512-7jXDIFXh5yJ/orPn4SXjuVrWWoi4Cr8jfV1eHv9CixKSbU+jY4mxfrBwAuDvupPNKpMUY+FeIqsVw/JLT9+B8g==", + "dependencies": { + "@babel/runtime-corejs3": "^7.8.3" + } + }, + "node_modules/xtend": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/xtend/-/xtend-4.0.2.tgz", + "integrity": "sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ==", + "dev": true, + "engines": { + "node": ">=0.4" + } + }, + "node_modules/y18n": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz", + "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==" + }, + "node_modules/yallist": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", + "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==" + }, + "node_modules/yaml": { + "version": "1.10.0", + "resolved": "https://registry.npmjs.org/yaml/-/yaml-1.10.0.tgz", + "integrity": "sha512-yr2icI4glYaNG+KWONODapy2/jDdMSDnrONSjblABjD9B4Z5LgiircSt8m8sRZFNi08kG9Sm0uSHtEmP3zaEGg==", + "engines": { + "node": ">= 6" + } + }, + "node_modules/yargs": { + "version": "13.3.2", + "resolved": "https://registry.npmjs.org/yargs/-/yargs-13.3.2.tgz", + "integrity": "sha512-AX3Zw5iPruN5ie6xGRIDgqkT+ZhnRlZMLMHAs8tg7nRruy2Nb+i5o9bwghAogtM08q1dpr2LVoS8KSTMYpWXUw==", + "dependencies": { + "cliui": "^5.0.0", + "find-up": "^3.0.0", + "get-caller-file": "^2.0.1", + "require-directory": "^2.1.1", + "require-main-filename": "^2.0.0", + "set-blocking": "^2.0.0", + "string-width": "^3.0.0", + "which-module": "^2.0.0", + "y18n": "^4.0.0", + "yargs-parser": "^13.1.2" + } + }, + "node_modules/yargs-parser": { + "version": "13.1.2", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-13.1.2.tgz", + "integrity": "sha512-3lbsNRf/j+A4QuSZfDRA7HRSfWrzO0YjqTJd5kjAq37Zep1CEgaYmrH9Q3GwPiB9cHyd1Y1UwggGhJGoxipbzg==", + "dependencies": { + "camelcase": "^5.0.0", + "decamelize": "^1.2.0" + } + }, + "node_modules/yargs-unparser": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/yargs-unparser/-/yargs-unparser-1.6.0.tgz", + "integrity": "sha512-W9tKgmSn0DpSatfri0nx52Joq5hVXgeLiqR/5G0sZNDoLZFOr/xjBUDcShCOGNsBnEMNo1KAMBkTej1Hm62HTw==", + "dependencies": { + "flat": "^4.1.0", + "lodash": "^4.17.15", + "yargs": "^13.3.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/yargs/node_modules/ansi-regex": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-4.1.0.tgz", + "integrity": "sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==", + "engines": { + "node": ">=6" + } + }, + "node_modules/yargs/node_modules/string-width": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-3.1.0.tgz", + "integrity": "sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w==", + "dependencies": { + "emoji-regex": "^7.0.1", + "is-fullwidth-code-point": "^2.0.0", + "strip-ansi": "^5.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/yargs/node_modules/strip-ansi": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-5.2.0.tgz", + "integrity": "sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA==", + "dependencies": { + "ansi-regex": "^4.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/yauzl": { + "version": "2.10.0", + "resolved": "https://registry.npmjs.org/yauzl/-/yauzl-2.10.0.tgz", + "integrity": "sha1-x+sXyT4RLLEIb6bY5R+wZnt5pfk=", + "dependencies": { + "buffer-crc32": "~0.2.3", + "fd-slicer": "~1.1.0" + } + }, + "node_modules/yeast": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/yeast/-/yeast-0.1.2.tgz", + "integrity": "sha1-AI4G2AlDIMNy28L47XagymyKxBk=" + }, + "node_modules/yn": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/yn/-/yn-2.0.0.tgz", + "integrity": "sha1-5a2ryKz0CPY4X8dklWhMiOavaJo=", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/zip-stream": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/zip-stream/-/zip-stream-2.1.3.tgz", + "integrity": "sha512-EkXc2JGcKhO5N5aZ7TmuNo45budRaFGHOmz24wtJR7znbNqDPmdZtUauKX6et8KAVseAMBOyWJqEpXcHTBsh7Q==", + "dependencies": { + "archiver-utils": "^2.1.0", + "compress-commons": "^2.1.1", + "readable-stream": "^3.4.0" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/zustand": { + "version": "3.4.1", + "resolved": "https://registry.npmjs.org/zustand/-/zustand-3.4.1.tgz", + "integrity": "sha512-Kb91vSjy5vwBQ/PQ1a5GE6naS3gCxCgpkujT9zqZSO85+gnvmzgqraMW3ao1I0jR4PwHBXtLTf26r9j7EXoUiQ==" + } + }, "dependencies": { "@babel/code-frame": { "version": "7.8.3", @@ -3688,22 +26608,22 @@ "bundled": true, "optional": true }, - "string-width": { - "version": "1.0.2", + "string_decoder": { + "version": "1.1.1", "bundled": true, "optional": true, "requires": { - "code-point-at": "^1.0.0", - "is-fullwidth-code-point": "^1.0.0", - "strip-ansi": "^3.0.0" + "safe-buffer": "~5.1.0" } }, - "string_decoder": { - "version": "1.1.1", + "string-width": { + "version": "1.0.2", "bundled": true, "optional": true, "requires": { - "safe-buffer": "~5.1.0" + "code-point-at": "^1.0.0", + "is-fullwidth-code-point": "^1.0.0", + "strip-ansi": "^3.0.0" } }, "strip-ansi": { @@ -5800,8 +28720,8 @@ "integrity": "sha512-f2LZMYl1Fzu7YSBKg+RoROelpOaNrcGmE9AZubeDfrCEia483oW4MI4VyFd5VNHIgQ/7qm1I0wUHK1eJnn2y2w==" }, "equation-editor-react": { - "version": "github:bobzel/equation-editor-react#75915e852b4b36a6a4cd3e1cbc80598da6b65227", - "from": "github:bobzel/equation-editor-react#useLocally", + "version": "git+ssh://git@github.com/bobzel/equation-editor-react.git#75915e852b4b36a6a4cd3e1cbc80598da6b65227", + "from": "equation-editor-react@github:bobzel/equation-editor-react#useLocally", "requires": { "jquery": "^3.4.1", "mathquill": "^0.10.1-a" @@ -7700,8 +30620,8 @@ }, "dependencies": { "image-size": { - "version": "github:netroy/image-size#da2c863807a3e9602617bdd357b0de3ab4a064c1", - "from": "github:netroy/image-size#da2c863807a3e9602617bdd357b0de3ab4a064c1" + "version": "git+ssh://git@github.com/netroy/image-size.git#da2c863807a3e9602617bdd357b0de3ab4a064c1", + "from": "image-size@github:netroy/image-size#da2c863807a3e9602617bdd357b0de3ab4a064c1" }, "isarray": { "version": "0.0.1", @@ -10125,7 +33045,6 @@ "resolved": "https://registry.npmjs.org/npm/-/npm-6.14.5.tgz", "integrity": "sha512-CDwa3FJd0XJpKDbWCST484H+mCNjF26dPrU+xnREW+upR0UODjMEfXPl3bxWuAwZIX6c2ASg1plLO7jP8ehWeA==", "requires": { - "JSONStream": "^1.3.5", "abbrev": "~1.1.1", "ansicolors": "~0.3.2", "ansistyles": "~0.1.3", @@ -10166,6 +33085,7 @@ "init-package-json": "^1.10.3", "is-cidr": "^3.0.0", "json-parse-better-errors": "^1.0.2", + "JSONStream": "^1.3.5", "lazy-property": "~1.0.0", "libcipm": "^4.0.7", "libnpm": "^3.0.1", @@ -10250,14 +33170,6 @@ "write-file-atomic": "^2.4.3" }, "dependencies": { - "JSONStream": { - "version": "1.3.5", - "bundled": true, - "requires": { - "jsonparse": "^1.2.0", - "through": ">=2.2.7 <3" - } - }, "abbrev": { "version": "1.1.1", "bundled": true @@ -11504,6 +34416,14 @@ "version": "1.3.1", "bundled": true }, + "JSONStream": { + "version": "1.3.5", + "bundled": true, + "requires": { + "jsonparse": "^1.2.0", + "through": ">=2.2.7 <3" + } + }, "jsprim": { "version": "1.4.1", "bundled": true, @@ -12080,9 +35000,9 @@ "version": "4.0.4", "bundled": true, "requires": { - "JSONStream": "^1.3.4", "bluebird": "^3.5.1", "figgy-pudding": "^3.4.1", + "JSONStream": "^1.3.4", "lru-cache": "^5.1.1", "make-fetch-happen": "^5.0.0", "npm-package-arg": "^6.1.0", @@ -12828,6 +35748,19 @@ "version": "2.0.0", "bundled": true }, + "string_decoder": { + "version": "1.3.0", + "bundled": true, + "requires": { + "safe-buffer": "~5.2.0" + }, + "dependencies": { + "safe-buffer": { + "version": "5.2.0", + "bundled": true + } + } + }, "string-width": { "version": "2.1.1", "bundled": true, @@ -12853,19 +35786,6 @@ } } }, - "string_decoder": { - "version": "1.3.0", - "bundled": true, - "requires": { - "safe-buffer": "~5.2.0" - }, - "dependencies": { - "safe-buffer": { - "version": "5.2.0", - "bundled": true - } - } - }, "stringify-package": { "version": "1.0.1", "bundled": true @@ -15379,21 +38299,6 @@ "tough-cookie": "^2.3.3" } }, - "require-directory": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz", - "integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I=" - }, - "require-main-filename": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", - "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==" - }, - "require-package-name": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/require-package-name/-/require-package-name-2.0.1.tgz", - "integrity": "sha1-wR6XJ2tluOKSP3Xav1+y7ww4Qbk=" - }, "require_optional": { "version": "1.0.1", "resolved": "https://registry.npmjs.org/require_optional/-/require_optional-1.0.1.tgz", @@ -15410,6 +38315,21 @@ } } }, + "require-directory": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz", + "integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I=" + }, + "require-main-filename": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", + "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==" + }, + "require-package-name": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/require-package-name/-/require-package-name-2.0.1.tgz", + "integrity": "sha1-wR6XJ2tluOKSP3Xav1+y7ww4Qbk=" + }, "requires-port": { "version": "1.0.0", "resolved": "https://registry.npmjs.org/requires-port/-/requires-port-1.0.0.tgz", @@ -16692,6 +39612,14 @@ "resolved": "https://registry.npmjs.org/strict-uri-encode/-/strict-uri-encode-2.0.0.tgz", "integrity": "sha1-ucczDHBChi9rFC3CdLvMWGbONUY=" }, + "string_decoder": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", + "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", + "requires": { + "safe-buffer": "~5.1.0" + } + }, "string-width": { "version": "2.1.1", "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz", @@ -16744,14 +39672,6 @@ "es-abstract": "^1.17.5" } }, - "string_decoder": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", - "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", - "requires": { - "safe-buffer": "~5.1.0" - } - }, "stringify-parameters": { "version": "0.0.4", "resolved": "https://registry.npmjs.org/stringify-parameters/-/stringify-parameters-0.0.4.tgz", diff --git a/src/client/ClientRecommender.scss b/src/client/ClientRecommender.scss index 3f9102f15..178c7fdab 100644 --- a/src/client/ClientRecommender.scss +++ b/src/client/ClientRecommender.scss @@ -1,4 +1,4 @@ -// @import "/views/globalCssVariables.scss"; +// @import "/views/global/globalCssVariables.scss"; .space{ border: 1px dashed blue; diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 24682cbd0..0c4d266d4 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -30,7 +30,7 @@ import { CollectionDockingView } from "../views/collections/CollectionDockingVie import { CollectionView, CollectionViewType } from "../views/collections/CollectionView"; import { ContextMenu } from "../views/ContextMenu"; import { ContextMenuProps } from "../views/ContextMenuItem"; -import { DFLT_IMAGE_NATIVE_DIM } from "../views/globalCssVariables.scss"; +import { DFLT_IMAGE_NATIVE_DIM } from "../views/global/globalCssVariables.scss"; import { ActiveArrowEnd, ActiveArrowStart, ActiveDash, ActiveFillColor, ActiveInkBezierApprox, ActiveInkColor, ActiveInkWidth, InkingStroke } from "../views/InkingStroke"; import { AudioBox } from "../views/nodes/AudioBox"; import { ColorBox } from "../views/nodes/ColorBox"; diff --git a/src/client/util/CaptureManager.scss b/src/client/util/CaptureManager.scss index 71539ee1e..a5024247e 100644 --- a/src/client/util/CaptureManager.scss +++ b/src/client/util/CaptureManager.scss @@ -1,4 +1,4 @@ -@import "../views/globalCssVariables"; +@import "../views/global/globalCssVariables"; .capture-interface { //background-color: whitesmoke !important; diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index d8c2f913e..e0e6024d2 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -9,7 +9,7 @@ import { ScriptField } from "../../fields/ScriptField"; import { Cast, NumCast, ScriptCast, StrCast } from "../../fields/Types"; import { emptyFunction, returnTrue } from "../../Utils"; import { Docs, DocUtils } from "../documents/Documents"; -import * as globalCssVariables from "../views/globalCssVariables.scss"; +import * as globalCssVariables from "../views/global/globalCssVariables.scss"; import { UndoManager } from "./UndoManager"; import { SnappingManager } from "./SnappingManager"; import { DocumentView } from "../views/nodes/DocumentView"; diff --git a/src/client/util/SettingsManager.scss b/src/client/util/SettingsManager.scss index d8342ea56..c9db94419 100644 --- a/src/client/util/SettingsManager.scss +++ b/src/client/util/SettingsManager.scss @@ -1,4 +1,4 @@ -@import "../views/globalCssVariables"; +@import "../views/global/globalCssVariables"; .settings-interface { //background-color: whitesmoke !important; @@ -264,7 +264,7 @@ //margin-top: 4px; &:hover { - background: $main-accent; + background: $medium-gray; } } diff --git a/src/client/views/AntimodeMenu.scss b/src/client/views/AntimodeMenu.scss index a275901be..8670b1747 100644 --- a/src/client/views/AntimodeMenu.scss +++ b/src/client/views/AntimodeMenu.scss @@ -1,4 +1,4 @@ -@import "./globalCssVariables"; +@import "./global/globalCssVariables"; .antimodeMenu-cont { diff --git a/src/client/views/ContextMenu.scss b/src/client/views/ContextMenu.scss index b514de5f2..2590e34c6 100644 --- a/src/client/views/ContextMenu.scss +++ b/src/client/views/ContextMenu.scss @@ -1,10 +1,10 @@ -@import "globalCssVariables"; +@import "global/globalCssVariables"; .contextMenu-cont { position: absolute; display: flex; z-index: $contextMenu-zindex; - box-shadow: $intermediate-color 0.2vw 0.2vw 0.4vw; + box-shadow: $medium-gray 0.2vw 0.2vw 0.4vw; flex-direction: column; background: whitesmoke; padding-top: 10px; @@ -14,17 +14,17 @@ } // .contextMenu-item:first-child { -// background: $intermediate-color; -// color: $light-color; +// background: $medium-gray; +// color: $white; // } // .contextMenu-item:first-child::placeholder { -// color: $light-color; +// color: $white; // } // .contextMenu-item:first-child:hover { -// background: $intermediate-color; -// color: $light-color; +// background: $medium-gray; +// color: $white; // } .contextMenu-subMenu-cont { @@ -94,7 +94,7 @@ .contextMenu-item:hover { border-width: .11px; border-style: none; - border-color: $intermediate-color; // rgb(187, 186, 186); + border-color: $medium-gray; // rgb(187, 186, 186); border-bottom-style: solid; border-top-style: solid; @@ -122,7 +122,7 @@ transition: all .1s; border-width: .11px; border-style: none; - border-color: $intermediate-color; // rgb(187, 186, 186); + border-color: $medium-gray; // rgb(187, 186, 186); // padding: 10px 0px 10px 0px; white-space: nowrap; font-size: 13px; diff --git a/src/client/views/DocumentButtonBar.scss b/src/client/views/DocumentButtonBar.scss index 09ae14016..e816c52a3 100644 --- a/src/client/views/DocumentButtonBar.scss +++ b/src/client/views/DocumentButtonBar.scss @@ -1,4 +1,4 @@ -@import "globalCssVariables"; +@import "global/globalCssVariables"; $linkGap : 3px; @@ -7,13 +7,13 @@ $linkGap : 3px; } .documentButtonBar-linkButton-empty:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); cursor: pointer; } .documentButtonBar-linkButton-nonempty:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); cursor: pointer; } @@ -26,7 +26,7 @@ $linkGap : 3px; opacity: 0.9; pointer-events: auto; background-color: $dark-color; - color: $light-color; + color: $white; text-transform: uppercase; letter-spacing: 2px; font-size: 75%; @@ -37,7 +37,7 @@ $linkGap : 3px; align-items: center; &:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); cursor: pointer; } @@ -69,7 +69,7 @@ $linkGap : 3px; transition: 0.2s ease all; &:hover { - background-color: $main-accent; + background-color: $medium-gray; } } diff --git a/src/client/views/DocumentDecorations.scss b/src/client/views/DocumentDecorations.scss index db2d56aa8..47a8326bb 100644 --- a/src/client/views/DocumentDecorations.scss +++ b/src/client/views/DocumentDecorations.scss @@ -1,4 +1,4 @@ -@import "globalCssVariables"; +@import "global/globalCssVariables"; $linkGap : 3px; @@ -49,7 +49,7 @@ $linkGap : 3px; .documentDecorations-bottomResizer, .documentDecorations-rightResizer { pointer-events: auto; - background: $alt-accent; + background: $medium-gray; opacity: 0.1; &:hover { opacity: 1; @@ -251,13 +251,13 @@ $linkGap : 3px; } .linkButton-empty:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); cursor: pointer; } .linkButton-nonempty:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); cursor: pointer; } @@ -271,7 +271,7 @@ $linkGap : 3px; flex-direction: row; z-index: 998; position: absolute; - background: $alt-accent; + background: $medium-gray; } .linkButtonWrapper { @@ -303,7 +303,7 @@ $linkGap : 3px; opacity: 0.9; pointer-events: auto; background-color: $dark-color; - color: $light-color; + color: $white; text-transform: uppercase; letter-spacing: 2px; font-size: 75%; @@ -314,7 +314,7 @@ $linkGap : 3px; align-items: center; &:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); cursor: pointer; } @@ -344,12 +344,12 @@ $linkGap : 3px; opacity: 0.9; font-size: 14; background-color: $dark-color; - color: $light-color; + color: $white; text-align: center; cursor: pointer; &:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); } } @@ -365,7 +365,7 @@ $linkGap : 3px; width: max-content; font-family: $sans-serif; font-size: 12px; - background-color: $light-color-secondary; + background-color: $light-gray; padding: 2px 12px; list-style: none; diff --git a/src/client/views/Main.scss b/src/client/views/Main.scss index b1ad4868c..c8e64b5c4 100644 --- a/src/client/views/Main.scss +++ b/src/client/views/Main.scss @@ -1,4 +1,4 @@ -@import "globalCssVariables"; +@import "global/globalCssVariables"; @import "nodeModuleOverrides"; :root { @@ -54,7 +54,7 @@ button { background: black; outline: none; border: 0px; - color: $light-color; + color: $white; text-transform: uppercase; letter-spacing: 2px; font-size: 75%; @@ -63,7 +63,7 @@ button { } button:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); cursor: pointer; } diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss index 3f04a0f3a..d76458460 100644 --- a/src/client/views/MainView.scss +++ b/src/client/views/MainView.scss @@ -1,4 +1,4 @@ -@import "globalCssVariables"; +@import "global/globalCssVariables"; @import "nodeModuleOverrides"; diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index 4eeb1fc95..f34851b00 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -40,7 +40,7 @@ import { ContextMenu } from './ContextMenu'; import { DictationOverlay } from './DictationOverlay'; import { DocumentDecorations } from './DocumentDecorations'; import { GestureOverlay } from './GestureOverlay'; -import { MENU_PANEL_WIDTH, SEARCH_PANEL_HEIGHT } from './globalCssVariables.scss'; +import { MENU_PANEL_WIDTH, SEARCH_PANEL_HEIGHT } from './global/globalCssVariables.scss'; import { KeyManager } from './GlobalKeyHandler'; import { InkStrokeProperties } from './InkStrokeProperties'; import { LightboxView } from './LightboxView'; @@ -180,8 +180,8 @@ export class MainView extends React.Component { const targClass = targets[0].className.toString(); if (SearchBox.Instance._searchbarOpen || SearchBox.Instance.open) { const check = targets.some((thing) => - (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" || - thing.className === "collectionSchema-header-menuOptions")); + (thing.className === "collectionSchemaView-searchContainer" || (thing as any)?.dataset.icon === "filter" || + thing.className === "collectionSchema-header-menuOptions")); !check && SearchBox.Instance.resetSearch(true); } !targClass.includes("contextMenu") && ContextMenu.Instance.closeMenu(); diff --git a/src/client/views/PropertiesButtons.scss b/src/client/views/PropertiesButtons.scss index 29d2bfcb7..4ef7763be 100644 --- a/src/client/views/PropertiesButtons.scss +++ b/src/client/views/PropertiesButtons.scss @@ -1,4 +1,4 @@ -@import "globalCssVariables"; +@import "global/globalCssVariables"; $linkGap : 3px; @@ -7,13 +7,13 @@ $linkGap : 3px; } .propertiesButtons-linkButton-empty:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); cursor: pointer; } .propertiesButtons-linkButton-nonempty:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); cursor: pointer; } @@ -24,7 +24,7 @@ $linkGap : 3px; width: 29px; border-radius: 6px; pointer-events: auto; - background-color: #121721; + background-color: $dark-color; color: #fcfbf7; text-transform: uppercase; letter-spacing: 2px; @@ -38,18 +38,18 @@ $linkGap : 3px; margin-left: 4px; &:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); cursor: pointer; } } .propertiesButtons-linkButton-empty.toggle-on { background-color: white; - color: black; + color: $dark-color; } .propertiesButtons-linkButton-empty.toggle-hover { background-color: gray; - color: black; + color: $dark-color; } .propertiesButtons-linkButton-empty.toggle-off { color: white; @@ -111,7 +111,7 @@ $linkGap : 3px; margin-left: 4px; &:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); cursor: pointer; } diff --git a/src/client/views/TemplateMenu.scss b/src/client/views/TemplateMenu.scss index bbed8cd96..f81cbdaab 100644 --- a/src/client/views/TemplateMenu.scss +++ b/src/client/views/TemplateMenu.scss @@ -1,4 +1,4 @@ -@import "globalCssVariables"; +@import "global/globalCssVariables"; .templating-menu { position: absolute; pointer-events: auto; @@ -24,7 +24,7 @@ cursor: pointer; &:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); } } @@ -32,7 +32,7 @@ .template-list { font-family: $sans-serif; font-size: 12px; - background-color: $light-color-secondary; + background-color: $light-gray; padding: 2px 12px; list-style: none; position: relative; diff --git a/src/client/views/animationtimeline/Keyframe.scss b/src/client/views/animationtimeline/Keyframe.scss index 84c8de287..38eb103c6 100644 --- a/src/client/views/animationtimeline/Keyframe.scss +++ b/src/client/views/animationtimeline/Keyframe.scss @@ -1,4 +1,4 @@ -@import "./../globalCssVariables.scss"; +@import "./../global/globalCssVariables.scss"; $timelineColor: #9acedf; @@ -15,11 +15,11 @@ $timelineDark: #77a1aa; height: 200px; top: 50%; position: relative; - background-color: $light-color; + background-color: $white; .menutable { tr:nth-child(odd) { - background-color: $light-color-secondary; + background-color: $light-gray; } } } @@ -67,7 +67,7 @@ $timelineDark: #77a1aa; height: 100%; position: absolute; pointer-events: none; - background: linear-gradient(to left, $timelineColor 10%, $light-color); + background: linear-gradient(to left, $timelineColor 10%, $white); } .fadeRight { @@ -75,7 +75,7 @@ $timelineDark: #77a1aa; height: 100%; position: absolute; pointer-events: none; - background: linear-gradient(to right, $timelineColor 10%, $light-color); + background: linear-gradient(to right, $timelineColor 10%, $white); } .divider { diff --git a/src/client/views/animationtimeline/Keyframe.tsx b/src/client/views/animationtimeline/Keyframe.tsx index e84022366..82b0218bf 100644 --- a/src/client/views/animationtimeline/Keyframe.tsx +++ b/src/client/views/animationtimeline/Keyframe.tsx @@ -1,7 +1,7 @@ import * as React from "react"; import "./Keyframe.scss"; import "./Timeline.scss"; -import "../globalCssVariables.scss"; +import "../global/globalCssVariables.scss"; import { observer } from "mobx-react"; import { observable, reaction, action, IReactionDisposer, observe, computed, runInAction, trace } from "mobx"; import { Doc, DocListCast, DocListCastAsync, Opt } from "../../../fields/Doc"; diff --git a/src/client/views/animationtimeline/Timeline.scss b/src/client/views/animationtimeline/Timeline.scss index f90249771..d82eb85bf 100644 --- a/src/client/views/animationtimeline/Timeline.scss +++ b/src/client/views/animationtimeline/Timeline.scss @@ -1,4 +1,4 @@ -@import "./../globalCssVariables.scss"; +@import "./../global/globalCssVariables.scss"; $timelineColor: #9acedf; $timelineDark: #77a1aa; @@ -161,7 +161,7 @@ $timelineDark: #77a1aa; width: 100%; height: 300px; position: absolute; - background-color: $light-color-secondary; + background-color: $light-gray; border-bottom: 2px solid $timelineDark; transition: transform 500ms ease; diff --git a/src/client/views/animationtimeline/TimelineMenu.scss b/src/client/views/animationtimeline/TimelineMenu.scss index 7ee0a43d5..935f04aba 100644 --- a/src/client/views/animationtimeline/TimelineMenu.scss +++ b/src/client/views/animationtimeline/TimelineMenu.scss @@ -1,10 +1,10 @@ -@import "./../globalCssVariables.scss"; +@import "./../global/globalCssVariables.scss"; .timeline-menu-container{ position: absolute; display: flex; - box-shadow: $intermediate-color 0.2vw 0.2vw 0.4vw; + box-shadow: $medium-gray 0.2vw 0.2vw 0.4vw; flex-direction: column; background: whitesmoke; z-index: 10000; @@ -79,7 +79,7 @@ .timeline-menu-item:hover { border-width: .11px; border-style: none; - border-color: $intermediate-color; + border-color: $medium-gray; border-bottom-style: solid; border-top-style: solid; background: $darker-alt-accent; diff --git a/src/client/views/animationtimeline/TimelineOverview.scss b/src/client/views/animationtimeline/TimelineOverview.scss index 283163ea7..c8d96c399 100644 --- a/src/client/views/animationtimeline/TimelineOverview.scss +++ b/src/client/views/animationtimeline/TimelineOverview.scss @@ -1,4 +1,4 @@ -@import "./../globalCssVariables.scss"; +@import "./../global/globalCssVariables.scss"; $timelineColor: #9acedf; $timelineDark: #77a1aa; diff --git a/src/client/views/animationtimeline/Track.scss b/src/client/views/animationtimeline/Track.scss index aec587a79..6d6d1620f 100644 --- a/src/client/views/animationtimeline/Track.scss +++ b/src/client/views/animationtimeline/Track.scss @@ -1,4 +1,4 @@ -@import "./../globalCssVariables.scss"; +@import "./../global/globalCssVariables.scss"; .track-container { @@ -6,7 +6,7 @@ .inner { top: 0px; width: calc(100%); - background-color: $light-color; + background-color: $white; border: 1px solid $dark-color; position: relative; z-index: 100; diff --git a/src/client/views/collections/CollectionDockingView.scss b/src/client/views/collections/CollectionDockingView.scss index f4736eb29..6d5dc9b18 100644 --- a/src/client/views/collections/CollectionDockingView.scss +++ b/src/client/views/collections/CollectionDockingView.scss @@ -1,4 +1,4 @@ -@import "../../views/globalCssVariables.scss"; +@import "../../views/global/globalCssVariables.scss"; .lm_title { @@ -110,7 +110,7 @@ } .flexlayout__splitter { - background-color: black; + background-color: $dark-color; } .flexlayout__splitter:hover { @@ -179,7 +179,7 @@ position: absolute; box-sizing: border-box; background-color: #222; - color: black; + color: $dark-color; } .flexlayout__tab_button { @@ -268,7 +268,7 @@ } .flexlayout__tab_header_outer { - background-color: black; + background-color: $dark-color; position: absolute; left: 0; right: 0; @@ -332,28 +332,28 @@ } .flexlayout__border_top { - background-color: black; + background-color: $dark-color; border-bottom: 1px solid #ddd; box-sizing: border-box; overflow: hidden; } .flexlayout__border_bottom { - background-color: black; + background-color: $dark-color; border-top: 1px solid #333; box-sizing: border-box; overflow: hidden; } .flexlayout__border_left { - background-color: black; + background-color: $dark-color; border-right: 1px solid #333; box-sizing: border-box; overflow: hidden; } .flexlayout__border_right { - background-color: black; + background-color: $dark-color; border-left: 1px solid #333; box-sizing: border-box; overflow: hidden; diff --git a/src/client/views/collections/CollectionLinearView.scss b/src/client/views/collections/CollectionLinearView.scss index ca72b98a5..632ce4417 100644 --- a/src/client/views/collections/CollectionLinearView.scss +++ b/src/client/views/collections/CollectionLinearView.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; @import "../_nodeModuleOverrides"; .collectionLinearView-outer { @@ -13,7 +13,7 @@ >span { background: $dark-color; - color: $light-color; + color: $white; border-radius: 18px; margin-right: 6px; cursor: pointer; @@ -64,7 +64,7 @@ margin-top: "auto"; margin-bottom: "auto"; background: $dark-color; - color: $light-color; + color: $white; display: inline-block; border-radius: 18px; font-size: 12.5px; @@ -82,7 +82,7 @@ } label:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.15); } diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss index dc5231a3a..328d7c081 100644 --- a/src/client/views/collections/CollectionMenu.scss +++ b/src/client/views/collections/CollectionMenu.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .collectionMenu-cont { @@ -407,7 +407,7 @@ } .switchToText { - color: $main-accent; + color: $medium-gray; } .switchToText:hover { @@ -534,7 +534,7 @@ .collectionSchemaViewChrome-togglerButton { width: 47px; height: 30px; - background-color: $light-color-secondary; + background-color: $light-gray; // position: absolute; transition: all 0.5s ease; // top: 3px; diff --git a/src/client/views/collections/CollectionSchemaCells.tsx b/src/client/views/collections/CollectionSchemaCells.tsx index 2e6186680..ee6d446f8 100644 --- a/src/client/views/collections/CollectionSchemaCells.tsx +++ b/src/client/views/collections/CollectionSchemaCells.tsx @@ -26,7 +26,7 @@ import { SnappingManager } from "../../util/SnappingManager"; import { undoBatch } from "../../util/UndoManager"; import '../DocumentDecorations.scss'; import { EditableView } from "../EditableView"; -import { MAX_ROW_HEIGHT } from '../globalCssVariables.scss'; +import { MAX_ROW_HEIGHT } from '../global/globalCssVariables.scss'; import { DocumentIconContainer } from "../nodes/DocumentIcon"; import { OverlayView } from "../OverlayView"; import "./CollectionSchemaView.scss"; diff --git a/src/client/views/collections/CollectionSchemaView.scss b/src/client/views/collections/CollectionSchemaView.scss index 2bdd280ec..d529f097e 100644 --- a/src/client/views/collections/CollectionSchemaView.scss +++ b/src/client/views/collections/CollectionSchemaView.scss @@ -1,8 +1,8 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .collectionSchemaView-container { border-width: $COLLECTION_BORDER_WIDTH; - border-color: $intermediate-color; + border-color: $medium-gray; border-style: solid; border-radius: $border-radius; box-sizing: border-box; @@ -39,13 +39,13 @@ } // .documentView-node:first-child { - // background: $light-color; + // background: $white; // } } .collectionSchemaView-searchContainer { border-width: $COLLECTION_BORDER_WIDTH; - border-color: $intermediate-color; + border-color: $medium-gray; border-style: solid; border-radius: $border-radius; box-sizing: border-box; @@ -83,7 +83,7 @@ } // .documentView-node:first-child { - // background: $light-color; + // background: $white; // } } @@ -282,7 +282,7 @@ button.add-column { } label { - color: $main-accent; + color: $medium-gray; font-weight: normal; letter-spacing: 2px; text-transform: uppercase; @@ -300,12 +300,12 @@ button.add-column { transition: background-color 0.2s; &:hover { - background-color: $light-color-secondary; + background-color: $light-gray; } &.active { font-weight: bold; - border: 2px solid $light-color-secondary; + border: 2px solid $light-gray; } svg { @@ -321,7 +321,7 @@ button.add-column { background-color: white; input { - border: 2px solid $light-color-secondary; + border: 2px solid $light-gray; padding: 3px; height: 28px; font-weight: bold; @@ -352,7 +352,7 @@ button.add-column { } &:hover { - background-color: $light-color-secondary; + background-color: $light-gray; } } } @@ -382,7 +382,7 @@ button.add-column { background-color: white; &.row-focused .rt-td { - background-color: #bfffc0; //$light-color-secondary; + background-color: #bfffc0; //$light-gray; } &.row-wrapped { diff --git a/src/client/views/collections/CollectionSchemaView.tsx b/src/client/views/collections/CollectionSchemaView.tsx index b33c437a9..18926264d 100644 --- a/src/client/views/collections/CollectionSchemaView.tsx +++ b/src/client/views/collections/CollectionSchemaView.tsx @@ -16,7 +16,7 @@ import { SelectionManager } from "../../util/SelectionManager"; import { SnappingManager } from "../../util/SnappingManager"; import { Transform } from "../../util/Transform"; import { undoBatch } from "../../util/UndoManager"; -import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/globalCssVariables.scss'; +import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/global/globalCssVariables.scss'; import { ContextMenu } from "../ContextMenu"; import { ContextMenuProps } from "../ContextMenuItem"; import '../DocumentDecorations.scss'; @@ -147,43 +147,43 @@ export class CollectionSchemaView extends CollectionSubView(doc => doc) { const anyType =
this.setColumnType(col, ColumnType.Any)}> - Any -
; + Any +
; const numType =
this.setColumnType(col, ColumnType.Number)}> - Number -
; + Number +
; const textType =
this.setColumnType(col, ColumnType.String)}> Text -
; +
; const boolType =
this.setColumnType(col, ColumnType.Boolean)}> Checkbox -
; +
; const listType =
this.setColumnType(col, ColumnType.List)}> List -
; + ; const docType =
this.setColumnType(col, ColumnType.Doc)}> Document -
; + ; const imageType =
this.setColumnType(col, ColumnType.Image)}> Image -
; + ; const dateType =
this.setColumnType(col, ColumnType.Date)}> - Date -
; + Date + ; const allColumnTypes =
diff --git a/src/client/views/collections/CollectionStackingView.scss b/src/client/views/collections/CollectionStackingView.scss index 9f56a0c0e..f103d9581 100644 --- a/src/client/views/collections/CollectionStackingView.scss +++ b/src/client/views/collections/CollectionStackingView.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .collectionMasonryView { display: inline; @@ -97,7 +97,7 @@ width: 100%; font-family: $sans-serif; background: $dark-color; - color: $light-color; + color: $white; } .collectionStackingView-columnDragger { @@ -128,7 +128,7 @@ margin-left: 2px; margin-right: 2px; margin-top: 2px; - background: $main-accent; + background: $medium-gray; height: 5px; &.active { @@ -180,11 +180,11 @@ .collectionStackingView-sectionHeader { text-align: center; margin: auto; - background: $main-accent; + background: $medium-gray; // overflow: hidden; overflow is visible so the color menu isn't hidden -ftong .editableView-input { - color: black; + color: $dark-color; } .editableView-input:hover, @@ -205,7 +205,7 @@ display: flex; align-items: center; justify-content: center; - color: black; + color: $dark-color; .editableView-container-editing-oneLine, .editableView-container-editing { diff --git a/src/client/views/collections/CollectionTreeView.scss b/src/client/views/collections/CollectionTreeView.scss index 72ab51784..ec461ab94 100644 --- a/src/client/views/collections/CollectionTreeView.scss +++ b/src/client/views/collections/CollectionTreeView.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .collectionTreeView-dropTarget { border-width: $COLLECTION_BORDER_WIDTH; @@ -12,7 +12,7 @@ top: 0; padding-left: 10px; padding-right: 10px; - background: $light-color-secondary; + background: $light-gray; font-size: 13px; overflow: auto; user-select: none; @@ -40,7 +40,7 @@ } .delete-button { - color: $intermediate-color; + color: $medium-gray; // float: right; margin-left: 15px; // margin-top: 3px; @@ -71,7 +71,7 @@ .collectionTreeView-subtitle { font-style: italic; font-size: 8pt; - color: $intermediate-color; + color: $medium-gray; } .docContainer { diff --git a/src/client/views/collections/CollectionView.scss b/src/client/views/collections/CollectionView.scss index a5aef86de..5db489c0a 100644 --- a/src/client/views/collections/CollectionView.scss +++ b/src/client/views/collections/CollectionView.scss @@ -1,8 +1,8 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .collectionView { border-width: 0; - border-color: $light-color-secondary; + border-color: $light-gray; border-style: solid; border-radius: 0 0 $border-radius $border-radius; box-sizing: border-box; diff --git a/src/client/views/collections/SchemaTable.tsx b/src/client/views/collections/SchemaTable.tsx index 0c69ee030..84560cf26 100644 --- a/src/client/views/collections/SchemaTable.tsx +++ b/src/client/views/collections/SchemaTable.tsx @@ -21,7 +21,7 @@ import { DocumentType } from "../../documents/DocumentTypes"; import { CompileScript, Transformer, ts } from "../../util/Scripting"; import { Transform } from "../../util/Transform"; import { undoBatch } from "../../util/UndoManager"; -import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/globalCssVariables.scss'; +import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/global/globalCssVariables.scss'; import { ContextMenu } from "../ContextMenu"; import '../DocumentDecorations.scss'; import { DocumentView } from "../nodes/DocumentView"; diff --git a/src/client/views/collections/TreeView.scss b/src/client/views/collections/TreeView.scss index 3f6fc8b0c..1ebc5873e 100644 --- a/src/client/views/collections/TreeView.scss +++ b/src/client/views/collections/TreeView.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .treeView-label { max-height: 1.5em; @@ -14,7 +14,7 @@ .bullet-outline { position: relative; width: $TREE_BULLET_WIDTH; - color: $intermediate-color; + color: $medium-gray; transform: scale(0.5); display: inline-flex; align-items: center; @@ -45,7 +45,7 @@ .bullet { position: relative; width: $TREE_BULLET_WIDTH; - color: $intermediate-color; + color: $medium-gray; margin-top: 3px; transform: scale(1.3, 1.3); border: #80808030 1px solid; diff --git a/src/client/views/collections/TreeView.tsx b/src/client/views/collections/TreeView.tsx index 2e98fb508..4f9a966f2 100644 --- a/src/client/views/collections/TreeView.tsx +++ b/src/client/views/collections/TreeView.tsx @@ -20,7 +20,7 @@ import { SnappingManager } from '../../util/SnappingManager'; import { Transform } from '../../util/Transform'; import { undoBatch, UndoManager } from '../../util/UndoManager'; import { EditableView } from "../EditableView"; -import { TREE_BULLET_WIDTH } from '../globalCssVariables.scss'; +import { TREE_BULLET_WIDTH } from '../global/globalCssVariables.scss'; import { DocumentView, DocumentViewProps, StyleProviderFunc, DocumentViewInternal } from '../nodes/DocumentView'; import { FormattedTextBox } from '../nodes/formattedText/FormattedTextBox'; import { RichTextMenu } from '../nodes/formattedText/RichTextMenu'; diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss b/src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss index c5b8fc5e8..5fa01b102 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormRemoteCursors.scss @@ -1,4 +1,4 @@ -@import "globalCssVariables"; +@import "global/globalCssVariables"; .collectionFreeFormRemoteCursors-cont { diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss index eb0538c41..79e063f7f 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.scss @@ -1,4 +1,4 @@ -@import "../../globalCssVariables"; +@import "../../global/globalCssVariables"; .collectionfreeformview-none { position: inherit; @@ -226,7 +226,7 @@ // linear-gradient(to bottom, $light-color-secondary 1px, transparent 1px); // background-size: 30px 30px; // } - border: 0px solid $light-color-secondary; + border: 0px solid $light-gray; border-radius: inherit; box-sizing: border-box; position: absolute; diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index accb80c5a..a4e310e6c 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -28,7 +28,7 @@ import { SelectionManager } from "../../../util/SelectionManager"; import { SnappingManager } from "../../../util/SnappingManager"; import { Transform } from "../../../util/Transform"; import { undoBatch } from "../../../util/UndoManager"; -import { COLLECTION_BORDER_WIDTH } from "../../../views/globalCssVariables.scss"; +import { COLLECTION_BORDER_WIDTH } from "../../../views/global/globalCssVariables.scss"; import { Timeline } from "../../animationtimeline/Timeline"; import { ContextMenu } from "../../ContextMenu"; import { DocumentDecorations } from "../../DocumentDecorations"; @@ -834,10 +834,10 @@ export class CollectionFreeFormView extends CollectionSubView ({ ...this.childDataProvider(doc, ""), ...this.childSizeProvider(doc, "") })); if (measuredDocs.length) { const ranges = measuredDocs.reduce(({ xrange, yrange }, { x, y, width, height }) => // computes range of content - ({ - xrange: { min: Math.min(xrange.min, x), max: Math.max(xrange.max, x + width) }, - yrange: { min: Math.min(yrange.min, y), max: Math.max(yrange.max, y + height) } - }) + ({ + xrange: { min: Math.min(xrange.min, x), max: Math.max(xrange.max, x + width) }, + yrange: { min: Math.min(yrange.min, y), max: Math.max(yrange.max, y + height) } + }) , { xrange: { min: Number.MAX_VALUE, max: -Number.MAX_VALUE }, yrange: { min: Number.MAX_VALUE, max: -Number.MAX_VALUE } diff --git a/src/client/views/global/globalCssVariables.scss b/src/client/views/global/globalCssVariables.scss new file mode 100644 index 000000000..218bdbf3c --- /dev/null +++ b/src/client/views/global/globalCssVariables.scss @@ -0,0 +1,52 @@ +@import url("https://fonts.googleapis.com/css?family=Noto+Sans:400,700|Crimson+Text:400,400i,700"); +// colors +$white: #ffffff; +$light-gray:#dfdfdf; +$medium-gray: #9F9F9F; + +$lighter-alt-accent: rgb(207, 220, 240); +$darker-alt-accent: #b2cef8; + +$dark-color: #111111; +$link-color: #add8e6; +$antimodemenu-height: 35px; +// fonts +$sans-serif: "Noto Sans", +sans-serif; +// $sans-serif: "Roboto Slab", sans-serif; +$serif: "Crimson Text", +serif; +// misc values +$border-radius: 0.3em; +// +$search-thumnail-size: 130; + +// dragged items +$contextMenu-zindex: 100000; // context menu shows up over everything +$radialMenu-zindex: 100000; // context menu shows up over everything + +$searchpanel-height: 32px; +$mainTextInput-zindex: 999; // then text input overlay so that it's context menu will appear over decorations, etc +$docDecorations-zindex: 998; // then doc decorations appear over everything else +$remoteCursors-zindex: 997; // ... not sure what level the remote cursors should go -- is this right? +$COLLECTION_BORDER_WIDTH: 0; +$SCHEMA_DIVIDER_WIDTH: 4; +$MINIMIZED_ICON_SIZE:25; +$MAX_ROW_HEIGHT: 44px; +$DFLT_IMAGE_NATIVE_DIM: 900px; +$MENU_PANEL_WIDTH: 60px; +$TREE_BULLET_WIDTH: 20px; + +:export { + contextMenuZindex: $contextMenu-zindex; + SCHEMA_DIVIDER_WIDTH: $SCHEMA_DIVIDER_WIDTH; + COLLECTION_BORDER_WIDTH: $COLLECTION_BORDER_WIDTH; + MINIMIZED_ICON_SIZE: $MINIMIZED_ICON_SIZE; + MAX_ROW_HEIGHT: $MAX_ROW_HEIGHT; + SEARCH_THUMBNAIL_SIZE: $search-thumnail-size; + ANTIMODEMENU_HEIGHT: $antimodemenu-height; + SEARCH_PANEL_HEIGHT: $searchpanel-height; + DFLT_IMAGE_NATIVE_DIM: $DFLT_IMAGE_NATIVE_DIM; + MENU_PANEL_WIDTH: $MENU_PANEL_WIDTH; + TREE_BULLET_WIDTH: $TREE_BULLET_WIDTH; +} \ No newline at end of file diff --git a/src/client/views/global/globalCssVariables.scss.d.ts b/src/client/views/global/globalCssVariables.scss.d.ts new file mode 100644 index 000000000..11e62e1eb --- /dev/null +++ b/src/client/views/global/globalCssVariables.scss.d.ts @@ -0,0 +1,17 @@ + +interface IGlobalScss { + contextMenuZindex: string; // context menu shows up over everything + SCHEMA_DIVIDER_WIDTH: string; + COLLECTION_BORDER_WIDTH: string; + MINIMIZED_ICON_SIZE: string; + MAX_ROW_HEIGHT: string; + SEARCH_THUMBNAIL_SIZE: string; + ANTIMODEMENU_HEIGHT: string; + SEARCH_PANEL_HEIGHT: string; + DFLT_IMAGE_NATIVE_DIM: string; + MENU_PANEL_WIDTH: string; + TREE_BULLET_WIDTH: string; +} +declare const globalCssVariables: IGlobalScss; + +export = globalCssVariables; \ No newline at end of file diff --git a/src/client/views/global/globalEnums.tsx b/src/client/views/global/globalEnums.tsx new file mode 100644 index 000000000..9d182ee0f --- /dev/null +++ b/src/client/views/global/globalEnums.tsx @@ -0,0 +1,19 @@ +export enum Colors { + DarkGray = "#111111", + MediumGray = "#9F9F9F", + LightGray = "#DFDFDF", + White = "#FFFFFF", + MediumBlue = "#4476F7", + LightBlue = "#BDDDF5", + Pink = "#E0217D", + Yellow = "#F5D747" +} + +export enum FontSizes { + LargeHeader = "16px" + +} + +export enum Padding { + +} \ No newline at end of file diff --git a/src/client/views/globalCssVariables.scss b/src/client/views/globalCssVariables.scss deleted file mode 100644 index ccc9306c4..000000000 --- a/src/client/views/globalCssVariables.scss +++ /dev/null @@ -1,56 +0,0 @@ -@import url("https://fonts.googleapis.com/css?family=Noto+Sans:400,700|Crimson+Text:400,400i,700"); -// colors -$light-color: #fcfbf7; -$light-color-secondary:#f1efeb; -//$main-accent: #61aaa3; -$main-accent: #aaaaa3; -// $alt-accent: #cdd5ec; -// $alt-accent: #cdeceb; -//$alt-accent: #59dff7; -$alt-accent: #c2c2c5; -$lighter-alt-accent: rgb(207, 220, 240); -$darker-alt-accent: #b2cef8; -$intermediate-color: #9c9396; -$dark-color: #121721; -$link-color: #add8e6; -$antimodemenu-height: 35px; -// fonts -$sans-serif: "Noto Sans", -sans-serif; -// $sans-serif: "Roboto Slab", sans-serif; -$serif: "Crimson Text", -serif; -// misc values -$border-radius: 0.3em; -// -$search-thumnail-size: 130; - -// dragged items -$contextMenu-zindex: 100000; // context menu shows up over everything -$radialMenu-zindex: 100000; // context menu shows up over everything - -$searchpanel-height: 32px; -$mainTextInput-zindex: 999; // then text input overlay so that it's context menu will appear over decorations, etc -$docDecorations-zindex: 998; // then doc decorations appear over everything else -$remoteCursors-zindex: 997; // ... not sure what level the remote cursors should go -- is this right? -$COLLECTION_BORDER_WIDTH: 0; -$SCHEMA_DIVIDER_WIDTH: 4; -$MINIMIZED_ICON_SIZE:25; -$MAX_ROW_HEIGHT: 44px; -$DFLT_IMAGE_NATIVE_DIM: 900px; -$MENU_PANEL_WIDTH: 60px; -$TREE_BULLET_WIDTH: 20px; - -:export { - contextMenuZindex: $contextMenu-zindex; - SCHEMA_DIVIDER_WIDTH: $SCHEMA_DIVIDER_WIDTH; - COLLECTION_BORDER_WIDTH: $COLLECTION_BORDER_WIDTH; - MINIMIZED_ICON_SIZE: $MINIMIZED_ICON_SIZE; - MAX_ROW_HEIGHT: $MAX_ROW_HEIGHT; - SEARCH_THUMBNAIL_SIZE: $search-thumnail-size; - ANTIMODEMENU_HEIGHT: $antimodemenu-height; - SEARCH_PANEL_HEIGHT: $searchpanel-height; - DFLT_IMAGE_NATIVE_DIM: $DFLT_IMAGE_NATIVE_DIM; - MENU_PANEL_WIDTH: $MENU_PANEL_WIDTH; - TREE_BULLET_WIDTH: $TREE_BULLET_WIDTH; -} \ No newline at end of file diff --git a/src/client/views/globalCssVariables.scss.d.ts b/src/client/views/globalCssVariables.scss.d.ts deleted file mode 100644 index 11e62e1eb..000000000 --- a/src/client/views/globalCssVariables.scss.d.ts +++ /dev/null @@ -1,17 +0,0 @@ - -interface IGlobalScss { - contextMenuZindex: string; // context menu shows up over everything - SCHEMA_DIVIDER_WIDTH: string; - COLLECTION_BORDER_WIDTH: string; - MINIMIZED_ICON_SIZE: string; - MAX_ROW_HEIGHT: string; - SEARCH_THUMBNAIL_SIZE: string; - ANTIMODEMENU_HEIGHT: string; - SEARCH_PANEL_HEIGHT: string; - DFLT_IMAGE_NATIVE_DIM: string; - MENU_PANEL_WIDTH: string; - TREE_BULLET_WIDTH: string; -} -declare const globalCssVariables: IGlobalScss; - -export = globalCssVariables; \ No newline at end of file diff --git a/src/client/views/linking/LinkEditor.scss b/src/client/views/linking/LinkEditor.scss index 7e6999cdc..eee072ed5 100644 --- a/src/client/views/linking/LinkEditor.scss +++ b/src/client/views/linking/LinkEditor.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .linkEditor { width: 100%; @@ -20,7 +20,7 @@ } .linkEditor-info { - //border-bottom: 0.5px solid $light-color-secondary; + //border-bottom: 0.5px solid $light-gray; //padding-bottom: 1px; padding-top: 5px; padding-left: 5px; @@ -195,7 +195,7 @@ } .linkEditor-group { - background-color: $light-color-secondary; + background-color: $light-gray; padding: 6px; margin: 3px 0; border-radius: 3px; @@ -254,8 +254,8 @@ } .linkEditor-option { - background-color: $light-color-secondary; - border: 1px solid $intermediate-color; + background-color: $light-gray; + border: 1px solid $medium-gray; border-top: 0; padding: 3px; cursor: pointer; @@ -285,7 +285,7 @@ width: calc(100% - 40px); &:hover { - background-color: $light-color; + background-color: $white; } } diff --git a/src/client/views/linking/LinkMenu.scss b/src/client/views/linking/LinkMenu.scss index a90bf8b0a..a2ea42999 100644 --- a/src/client/views/linking/LinkMenu.scss +++ b/src/client/views/linking/LinkMenu.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .linkMenu { width: auto; diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss index 4e13ef8c8..a07e540ae 100644 --- a/src/client/views/linking/LinkMenuItem.scss +++ b/src/client/views/linking/LinkMenuItem.scss @@ -1,7 +1,7 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .linkMenu-item { - // border-top: 0.5px solid $main-accent; + // border-top: 0.5px solid $medium-gray; position: relative; display: flex; border-bottom: 0.5px solid black; @@ -102,7 +102,7 @@ .link-metadata { padding: 0 10px 0 16px; margin-bottom: 4px; - color: $main-accent; + color: $medium-gray; font-style: italic; font-size: 10.5px; } @@ -144,7 +144,7 @@ border-radius: 50%; pointer-events: auto; background-color: $dark-color; - color: $light-color; + color: $white; font-size: 65%; transition: transform 0.2s; text-align: center; @@ -162,7 +162,7 @@ } &:hover { - background: $main-accent; + background: $medium-gray; cursor: pointer; } } diff --git a/src/client/views/nodes/DocumentLinksButton.scss b/src/client/views/nodes/DocumentLinksButton.scss index 735aa669f..daffaf9e7 100644 --- a/src/client/views/nodes/DocumentLinksButton.scss +++ b/src/client/views/nodes/DocumentLinksButton.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables.scss"; +@import "../global/globalCssVariables.scss"; .documentLinksButton-cont { @@ -37,7 +37,7 @@ font-weight: bold; &:hover { - background: $main-accent; + background: $medium-gray; transform: scale(1.05); cursor: pointer; } diff --git a/src/client/views/nodes/DocumentView.scss b/src/client/views/nodes/DocumentView.scss index bdbece621..8f86417d6 100644 --- a/src/client/views/nodes/DocumentView.scss +++ b/src/client/views/nodes/DocumentView.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .documentView-effectsWrapper { border-radius: inherit; @@ -22,7 +22,7 @@ transition: outline .3s linear; cursor: grab; - // background: $light-color; //overflow: hidden; + // background: $white; //overflow: hidden; transform-origin: left top; &.minimized { @@ -218,6 +218,6 @@ .documentView-node:first-child { position: relative; - background: "#B59B66"; //$light-color; + background: "#B59B66"; //$white; } } \ No newline at end of file diff --git a/src/client/views/nodes/KeyValueBox.scss b/src/client/views/nodes/KeyValueBox.scss index eb7c2f32b..ffcba4981 100644 --- a/src/client/views/nodes/KeyValueBox.scss +++ b/src/client/views/nodes/KeyValueBox.scss @@ -1,10 +1,10 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .keyValueBox-cont { overflow-y: scroll; width:100%; height: 100%; - background-color: $light-color; - border: 1px solid $intermediate-color; + background-color: $white; + border: 1px solid $medium-gray; border-radius: $border-radius; box-sizing: border-box; display: inline-block; @@ -56,8 +56,8 @@ $header-height: 30px; width:100%; position: relative; display: inline-block; - background: $intermediate-color; - color: $light-color; + background: $medium-gray; + color: $white; text-transform: uppercase; letter-spacing: 2px; font-size: 12px; @@ -66,7 +66,7 @@ $header-height: 30px; th { font-weight: normal; &:first-child { - border-right: 1px solid $light-color; + border-right: 1px solid $white; } } } @@ -76,9 +76,9 @@ $header-height: 30px; display: flex; width:100%; height:$header-height; - background: $light-color; + background: $white; .formattedTextBox-cont { - background: $light-color; + background: $white; } } .keyValueBox-cont { @@ -116,8 +116,8 @@ $header-height: 30px; display: flex; width:100%; height:30px; - background: $light-color-secondary; + background: $light-gray; .formattedTextBox-cont { - background: $light-color-secondary; + background: $light-gray; } } \ No newline at end of file diff --git a/src/client/views/nodes/KeyValuePair.scss b/src/client/views/nodes/KeyValuePair.scss index f78767234..5b660e582 100644 --- a/src/client/views/nodes/KeyValuePair.scss +++ b/src/client/views/nodes/KeyValuePair.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .keyValuePair-td-key { diff --git a/src/client/views/nodes/RadialMenu.scss b/src/client/views/nodes/RadialMenu.scss index daa620d12..312b51013 100644 --- a/src/client/views/nodes/RadialMenu.scss +++ b/src/client/views/nodes/RadialMenu.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .radialMenu-cont { position: absolute; @@ -53,7 +53,7 @@ s transition: all .1s; border-width: .11px; border-style: none; - border-color: $intermediate-color; // rgb(187, 186, 186); + border-color: $medium-gray; // rgb(187, 186, 186); // padding: 10px 0px 10px 0px; white-space: nowrap; font-size: 13px; diff --git a/src/client/views/nodes/WebBox.scss b/src/client/views/nodes/WebBox.scss index ca82c049c..e206508d3 100644 --- a/src/client/views/nodes/WebBox.scss +++ b/src/client/views/nodes/WebBox.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables.scss"; +@import "../global/globalCssVariables.scss"; .webBox { diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.scss b/src/client/views/nodes/formattedText/FormattedTextBox.scss index 53aceb533..3cedab1a4 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBox.scss +++ b/src/client/views/nodes/formattedText/FormattedTextBox.scss @@ -1,4 +1,4 @@ -@import "../../globalCssVariables"; +@import "../../global/globalCssVariables"; .ProseMirror { width: 100%; @@ -31,7 +31,7 @@ audiotag:hover { padding: 0; border-width: 0px; border-radius: inherit; - border-color: $intermediate-color; + border-color: $medium-gray; box-sizing: border-box; background-color: inherit; border-style: solid; @@ -363,7 +363,7 @@ footnote::after { @media only screen and (max-width: 1000px) { - @import "../../globalCssVariables"; + @import "../../global/globalCssVariables"; .ProseMirror { width: 100%; @@ -381,7 +381,7 @@ footnote::after { padding: 0; border-width: 0px; border-radius: inherit; - border-color: $intermediate-color; + border-color: $medium-gray; box-sizing: border-box; background-color: inherit; border-style: solid; diff --git a/src/client/views/nodes/formattedText/RichTextMenu.scss b/src/client/views/nodes/formattedText/RichTextMenu.scss index 1d24d6833..c94e93541 100644 --- a/src/client/views/nodes/formattedText/RichTextMenu.scss +++ b/src/client/views/nodes/formattedText/RichTextMenu.scss @@ -1,4 +1,4 @@ -@import "../../globalCssVariables"; +@import "../../global/globalCssVariables"; .button-dropdown-wrapper { position: relative; @@ -24,7 +24,7 @@ top: 35px; left: 0; background-color: #323232; - color: $light-color-secondary; + color: $light-gray; border: 1px solid #4d4d4d; border-radius: 0 6px 6px 6px; box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25); diff --git a/src/client/views/nodes/formattedText/TooltipTextMenu.scss b/src/client/views/nodes/formattedText/TooltipTextMenu.scss index 0e4b752ac..8c4d77da9 100644 --- a/src/client/views/nodes/formattedText/TooltipTextMenu.scss +++ b/src/client/views/nodes/formattedText/TooltipTextMenu.scss @@ -1,4 +1,4 @@ -@import "../views/globalCssVariables"; +@import "../views/global/globalCssVariables"; .ProseMirror-menu-dropdown-wrap { display: inline-block; position: relative; @@ -50,7 +50,7 @@ padding: 3px; &:hover { - background-color: $light-color-secondary; + background-color: $light-gray; } } } @@ -294,9 +294,9 @@ top: 31px; background-color: #323232; border: 1px solid #4d4d4d; - color: $light-color-secondary; + color: $light-gray; // border: none; - // border: 1px solid $light-color-secondary; + // border: 1px solid $light-gray; border-radius: 0 6px 6px 6px; padding: 3px; box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25); @@ -323,7 +323,7 @@ } .separated-button { - border-top: 1px solid $light-color-secondary; + border-top: 1px solid $light-gray; padding-top: 6px; } diff --git a/src/client/views/search/CheckBox.scss b/src/client/views/search/CheckBox.scss index cc858bec6..c46b3eb20 100644 --- a/src/client/views/search/CheckBox.scss +++ b/src/client/views/search/CheckBox.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .checkboxfilter { display: flex; @@ -40,7 +40,7 @@ overflow: visible; background-color: transparent; border-style: solid; - border-color: $alt-accent; + border-color: $medium-gray; border-width: 2px; -webkit-transition: all 0.2s ease-in-out; -moz-transition: all 0.2s ease-in-out; diff --git a/src/client/views/search/CollectionFilters.scss b/src/client/views/search/CollectionFilters.scss index b54cdcbd1..845b16f67 100644 --- a/src/client/views/search/CollectionFilters.scss +++ b/src/client/views/search/CollectionFilters.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .collection-filters { display: flex; diff --git a/src/client/views/search/IconBar.scss b/src/client/views/search/IconBar.scss index 013dcd57e..6aaf7918d 100644 --- a/src/client/views/search/IconBar.scss +++ b/src/client/views/search/IconBar.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .icon-bar { display: flex; diff --git a/src/client/views/search/IconButton.scss b/src/client/views/search/IconButton.scss index 4ec03c7c9..d87b8bd5c 100644 --- a/src/client/views/search/IconButton.scss +++ b/src/client/views/search/IconButton.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .type-outer { display: flex; @@ -9,7 +9,7 @@ .type-icon { height: 30px; width: 30px; - color: $light-color; + color: $white; // background-color: rgb(194, 194, 197); background-color: gray; border-radius: 50%; diff --git a/src/client/views/search/IconButton.tsx b/src/client/views/search/IconButton.tsx index 349690b20..6fd91c9c1 100644 --- a/src/client/views/search/IconButton.tsx +++ b/src/client/views/search/IconButton.tsx @@ -4,7 +4,7 @@ import { action, IReactionDisposer, observable, reaction, runInAction } from 'mo import { observer } from 'mobx-react'; import * as React from 'react'; import { DocumentType } from "../../documents/DocumentTypes"; -import '../globalCssVariables.scss'; +import '../global/globalCssVariables.scss'; import { IconBar } from './IconBar'; import "./IconButton.scss"; import "./SearchBox.scss"; diff --git a/src/client/views/search/NaviconButton.scss b/src/client/views/search/NaviconButton.scss index c23bab461..8a70b29de 100644 --- a/src/client/views/search/NaviconButton.scss +++ b/src/client/views/search/NaviconButton.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; $height-icon: 15px; $width-line: 30px; @@ -20,7 +20,7 @@ $translateX: 0; .line { display: block; - background: $alt-accent; + background: $medium-gray; width: $width-line; height: $height-line; position: absolute; diff --git a/src/client/views/search/SearchBox.scss b/src/client/views/search/SearchBox.scss index 4f5b7e41a..8d6bc86cb 100644 --- a/src/client/views/search/SearchBox.scss +++ b/src/client/views/search/SearchBox.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; @import "./NaviconButton.scss"; .searchBox-container { @@ -20,7 +20,7 @@ display: flex; justify-content: center; align-items: center; - background-color: black; + background-color: $dark-color; .searchBox-lozenges { position: absolute; @@ -86,7 +86,7 @@ &.searchBox-input { margin:5px; border-radius:20px; - border:black; + border:$dark-color; display: block; width: 130px; -webkit-transition: width 0.4s; @@ -114,7 +114,7 @@ } &.searchBox-close { - color: $light-color; + color: $white; max-height: $searchpanel-height; } } @@ -132,7 +132,7 @@ .no-result { width: 500px; - background: $light-color-secondary; + background: $light-gray; padding: 10px; height: 50px; text-transform: uppercase; diff --git a/src/client/views/search/SelectorContextMenu.scss b/src/client/views/search/SelectorContextMenu.scss index 48cacc608..438b6a0c2 100644 --- a/src/client/views/search/SelectorContextMenu.scss +++ b/src/client/views/search/SelectorContextMenu.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .parents { background: $lighter-alt-accent; diff --git a/src/client/views/search/ToggleBar.scss b/src/client/views/search/ToggleBar.scss index 79f866acb..3a164f133 100644 --- a/src/client/views/search/ToggleBar.scss +++ b/src/client/views/search/ToggleBar.scss @@ -1,9 +1,9 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .toggle-title { display: flex; align-items: center; - color: $light-color; + color: $white; text-transform: uppercase; flex-direction: row; justify-content: space-around; @@ -25,7 +25,7 @@ // height: 50px; height: 30px; width: 100px; - background-color: $alt-accent; + background-color: $medium-gray; border-radius: 10px; padding: 5px; display: flex; @@ -36,6 +36,6 @@ width: 40px; height: 100%; border-radius: 10px; - background-color: $light-color; + background-color: $white; } } \ No newline at end of file diff --git a/src/client/views/webcam/DashWebRTCVideo.scss b/src/client/views/webcam/DashWebRTCVideo.scss index 41307a808..249aee9d6 100644 --- a/src/client/views/webcam/DashWebRTCVideo.scss +++ b/src/client/views/webcam/DashWebRTCVideo.scss @@ -1,4 +1,4 @@ -@import "../globalCssVariables"; +@import "../global/globalCssVariables"; .webcam-cont { background: whitesmoke; diff --git a/src/mobile/AudioUpload.scss b/src/mobile/AudioUpload.scss index 6e64d9e2e..dce0c724f 100644 --- a/src/mobile/AudioUpload.scss +++ b/src/mobile/AudioUpload.scss @@ -1,4 +1,4 @@ -@import "../client/views/globalCssVariables.scss"; +@import "../client/views/global/globalCssVariables.scss"; .audioUpload_cont { display: flex; diff --git a/src/mobile/ImageUpload.scss b/src/mobile/ImageUpload.scss index 890258918..6669a3d21 100644 --- a/src/mobile/ImageUpload.scss +++ b/src/mobile/ImageUpload.scss @@ -1,4 +1,4 @@ -@import "../client/views/globalCssVariables.scss"; +@import "../client/views/global/globalCssVariables.scss"; .imgupload_cont { display: flex; diff --git a/src/mobile/ImageUpload.tsx b/src/mobile/ImageUpload.tsx index 2183d2172..98696496f 100644 --- a/src/mobile/ImageUpload.tsx +++ b/src/mobile/ImageUpload.tsx @@ -5,7 +5,7 @@ import * as rp from 'request-promise'; import { DocServer } from '../client/DocServer'; import { Docs } from '../client/documents/Documents'; import { Networking } from '../client/Network'; -import { DFLT_IMAGE_NATIVE_DIM } from '../client/views/globalCssVariables.scss'; +import { DFLT_IMAGE_NATIVE_DIM } from '../client/views/global/globalCssVariables.scss'; import { MainViewModal } from '../client/views/MainViewModal'; import { Doc, Opt } from '../fields/Doc'; import { List } from '../fields/List'; -- cgit v1.2.3-70-g09d2 From dda6b85a142f5b47cb01e63777cc031aa556d491 Mon Sep 17 00:00:00 2001 From: 0x85FB9C51 <77808164+0x85FB9C51@users.noreply.github.com> Date: Sat, 10 Jul 2021 15:51:32 -0400 Subject: Seperated a file into two for organizaitonal purposes --- .../schemaView/CollectionSchemaMovableColumn.tsx | 261 +++++++++++++++++++++ .../schemaView/CollectionSchemaMovableRow.tsx | 147 ++++++++++++ .../schemaView/CollectionSchemaMovableTableHOC.tsx | 261 --------------------- .../views/collections/schemaView/SchemaTable.tsx | 3 +- 4 files changed, 410 insertions(+), 262 deletions(-) create mode 100644 src/client/views/collections/schemaView/CollectionSchemaMovableColumn.tsx create mode 100644 src/client/views/collections/schemaView/CollectionSchemaMovableRow.tsx delete mode 100644 src/client/views/collections/schemaView/CollectionSchemaMovableTableHOC.tsx (limited to 'src/client/views/collections') diff --git a/src/client/views/collections/schemaView/CollectionSchemaMovableColumn.tsx b/src/client/views/collections/schemaView/CollectionSchemaMovableColumn.tsx new file mode 100644 index 000000000..e1066caf4 --- /dev/null +++ b/src/client/views/collections/schemaView/CollectionSchemaMovableColumn.tsx @@ -0,0 +1,261 @@ +import React = require("react"); +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { action } from "mobx"; +import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table"; +import { Doc } from "../../../../fields/Doc"; +import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; +import { Cast, FieldValue, StrCast } from "../../../../fields/Types"; +import { DocumentManager } from "../../../util/DocumentManager"; +import { DragManager, dropActionType, SetupDrag } from "../../../util/DragManager"; +import { SnappingManager } from "../../../util/SnappingManager"; +import { Transform } from "../../../util/Transform"; +import { undoBatch } from "../../../util/UndoManager"; +import { ContextMenu } from "../../ContextMenu"; +import "./CollectionSchemaView.scss"; + +export interface MovableColumnProps { + columnRenderer: TableCellRenderer; + columnValue: SchemaHeaderField; + allColumns: SchemaHeaderField[]; + reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columns: SchemaHeaderField[]) => void; + ScreenToLocalTransform: () => Transform; +} +export class MovableColumn extends React.Component { + private _header?: React.RefObject = React.createRef(); + private _colDropDisposer?: DragManager.DragDropDisposer; + private _startDragPosition: { x: number, y: number } = { x: 0, y: 0 }; + private _sensitivity: number = 16; + private _dragRef: React.RefObject = React.createRef(); + + onPointerEnter = (e: React.PointerEvent): void => { + if (e.buttons === 1 && SnappingManager.GetIsDragging()) { + this._header!.current!.className = "collectionSchema-col-wrapper"; + document.addEventListener("pointermove", this.onDragMove, true); + } + } + onPointerLeave = (e: React.PointerEvent): void => { + this._header!.current!.className = "collectionSchema-col-wrapper"; + document.removeEventListener("pointermove", this.onDragMove, true); + !e.buttons && document.removeEventListener("pointermove", this.onPointerMove); + } + onDragMove = (e: PointerEvent): void => { + const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top); + const before = x[0] < bounds[0]; + this._header!.current!.className = "collectionSchema-col-wrapper"; + if (before) this._header!.current!.className += " col-before"; + if (!before) this._header!.current!.className += " col-after"; + e.stopPropagation(); + } + + createColDropTarget = (ele: HTMLDivElement) => { + this._colDropDisposer?.(); + if (ele) { + this._colDropDisposer = DragManager.MakeDropTarget(ele, this.colDrop.bind(this)); + } + } + + colDrop = (e: Event, de: DragManager.DropEvent) => { + document.removeEventListener("pointermove", this.onDragMove, true); + const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top); + const before = x[0] < bounds[0]; + const colDragData = de.complete.columnDragData; + if (colDragData) { + e.stopPropagation(); + this.props.reorderColumns(colDragData.colKey, this.props.columnValue, before, this.props.allColumns); + return true; + } + return false; + } + + onPointerMove = (e: PointerEvent) => { + const onRowMove = (e: PointerEvent) => { + e.stopPropagation(); + e.preventDefault(); + + document.removeEventListener("pointermove", onRowMove); + document.removeEventListener('pointerup', onRowUp); + const dragData = new DragManager.ColumnDragData(this.props.columnValue); + DragManager.StartColumnDrag(this._dragRef.current!, dragData, e.x, e.y); + }; + const onRowUp = (): void => { + document.removeEventListener("pointermove", onRowMove); + document.removeEventListener('pointerup', onRowUp); + }; + if (e.buttons === 1) { + const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX - this._startDragPosition.x, e.clientY - this._startDragPosition.y); + if (Math.abs(dx) + Math.abs(dy) > this._sensitivity) { + document.removeEventListener("pointermove", this.onPointerMove); + e.stopPropagation(); + + document.addEventListener("pointermove", onRowMove); + document.addEventListener("pointerup", onRowUp); + } + } + } + + onPointerUp = (e: React.PointerEvent) => { + document.removeEventListener("pointermove", this.onPointerMove); + } + + @action + onPointerDown = (e: React.PointerEvent, ref: React.RefObject) => { + this._dragRef = ref; + const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX, e.clientY); + if (!(e.target as any)?.tagName.includes("INPUT")) { + this._startDragPosition = { x: dx, y: dy }; + document.addEventListener("pointermove", this.onPointerMove); + } + } + + + render() { + const reference = React.createRef(); + + return ( +
+
+
this.onPointerDown(e, reference)} onPointerUp={this.onPointerUp}> + {this.props.columnRenderer} +
+
+
+ ); + } +} + +export interface MovableRowProps { + rowInfo: RowInfo; + ScreenToLocalTransform: () => Transform; + addDoc: (doc: Doc | Doc[], relativeTo?: Doc, before?: boolean) => boolean; + removeDoc: (doc: Doc | Doc[]) => boolean; + rowFocused: boolean; + textWrapRow: (doc: Doc) => void; + rowWrapped: boolean; + dropAction: string; + addDocTab: any; +} + +export class MovableRow extends React.Component { + private _header?: React.RefObject = React.createRef(); + private _rowDropDisposer?: DragManager.DragDropDisposer; + + // Event listeners are only necessary when the user is hovering over the table + // Create one when the mouse starts hovering... + onPointerEnter = (e: React.PointerEvent): void => { + if (e.buttons === 1 && SnappingManager.GetIsDragging()) { + this._header!.current!.className = "collectionSchema-row-wrapper"; + document.addEventListener("pointermove", this.onDragMove, true); + } + } + // ... and delete it when the mouse leaves + onPointerLeave = (e: React.PointerEvent): void => { + this._header!.current!.className = "collectionSchema-row-wrapper"; + document.removeEventListener("pointermove", this.onDragMove, true); + } + // The method for the event listener, reorders columns when dragged to their new locations. + onDragMove = (e: PointerEvent): void => { + const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); + const before = x[1] < bounds[1]; + this._header!.current!.className = "collectionSchema-row-wrapper"; + if (before) this._header!.current!.className += " row-above"; + if (!before) this._header!.current!.className += " row-below"; + e.stopPropagation(); + } + componentWillUnmount() { + + this._rowDropDisposer?.(); + } + // + createRowDropTarget = (ele: HTMLDivElement) => { + this._rowDropDisposer?.(); + if (ele) { + this._rowDropDisposer = DragManager.MakeDropTarget(ele, this.rowDrop.bind(this)); + } + } + // Controls what hppens when a row is dragged and dropped + rowDrop = (e: Event, de: DragManager.DropEvent) => { + this.onPointerLeave(e as any); + const rowDoc = FieldValue(Cast(this.props.rowInfo.original, Doc)); + if (!rowDoc) return false; + + const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); + const before = x[1] < bounds[1]; + + const docDragData = de.complete.docDragData; + if (docDragData) { + e.stopPropagation(); + if (docDragData.draggedDocuments[0] === rowDoc) return true; + const addDocument = (doc: Doc | Doc[]) => this.props.addDoc(doc, rowDoc, before); + const movedDocs = docDragData.draggedDocuments; + return (docDragData.dropAction || docDragData.userDropAction) ? + docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before) || added, false) + : (docDragData.moveDocument) ? + movedDocs.reduce((added: boolean, d) => docDragData.moveDocument?.(d, rowDoc, addDocument) || added, false) + : docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before), false); + } + return false; + } + + onRowContextMenu = (e: React.MouseEvent): void => { + const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row"; + ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" }); + } + + @undoBatch + @action + move: DragManager.MoveFunction = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc) => { + const targetView = targetCollection && DocumentManager.Instance.getDocumentView(targetCollection); + return doc !== targetCollection && doc !== targetView?.props.ContainingCollectionDoc && this.props.removeDoc(doc) && addDoc(doc); + } + + @action + onKeyDown = (e: React.KeyboardEvent) => { + console.log("yes"); + if (e.key === "Backspace" || e.key === "Delete") { + undoBatch(() => this.props.removeDoc(this.props.rowInfo.original)); + } + } + + render() { + const { children = null, rowInfo } = this.props; + + if (!rowInfo) { + return {children}; + } + + const { original } = rowInfo; + const doc = FieldValue(Cast(original, Doc)); + + if (!doc) return (null); + + const reference = React.createRef(); + const onItemDown = SetupDrag(reference, () => doc, this.move, StrCast(this.props.dropAction) as dropActionType); + + let className = "collectionSchema-row"; + if (this.props.rowFocused) className += " row-focused"; + if (this.props.rowWrapped) className += " row-wrapped"; + + return ( +
+
+ +
+
this.props.removeDoc(this.props.rowInfo.original))}>
+
+
this.props.addDocTab(this.props.rowInfo.original, "add:right")}>
+
+ {children} +
+
+
+ ); + } +} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/CollectionSchemaMovableRow.tsx b/src/client/views/collections/schemaView/CollectionSchemaMovableRow.tsx new file mode 100644 index 000000000..f48906ba5 --- /dev/null +++ b/src/client/views/collections/schemaView/CollectionSchemaMovableRow.tsx @@ -0,0 +1,147 @@ +import React = require("react"); +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { action } from "mobx"; +import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table"; +import { Doc } from "../../../../fields/Doc"; +import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; +import { Cast, FieldValue, StrCast } from "../../../../fields/Types"; +import { DocumentManager } from "../../../util/DocumentManager"; +import { DragManager, dropActionType, SetupDrag } from "../../../util/DragManager"; +import { SnappingManager } from "../../../util/SnappingManager"; +import { Transform } from "../../../util/Transform"; +import { undoBatch } from "../../../util/UndoManager"; +import { ContextMenu } from "../../ContextMenu"; +import "./CollectionSchemaView.scss"; + +export interface MovableRowProps { + rowInfo: RowInfo; + ScreenToLocalTransform: () => Transform; + addDoc: (doc: Doc | Doc[], relativeTo?: Doc, before?: boolean) => boolean; + removeDoc: (doc: Doc | Doc[]) => boolean; + rowFocused: boolean; + textWrapRow: (doc: Doc) => void; + rowWrapped: boolean; + dropAction: string; + addDocTab: any; +} + +export class MovableRow extends React.Component { + private _header?: React.RefObject = React.createRef(); + private _rowDropDisposer?: DragManager.DragDropDisposer; + + // Event listeners are only necessary when the user is hovering over the table + // Create one when the mouse starts hovering... + onPointerEnter = (e: React.PointerEvent): void => { + if (e.buttons === 1 && SnappingManager.GetIsDragging()) { + this._header!.current!.className = "collectionSchema-row-wrapper"; + document.addEventListener("pointermove", this.onDragMove, true); + } + } + // ... and delete it when the mouse leaves + onPointerLeave = (e: React.PointerEvent): void => { + this._header!.current!.className = "collectionSchema-row-wrapper"; + document.removeEventListener("pointermove", this.onDragMove, true); + } + // The method for the event listener, reorders columns when dragged to their new locations. + onDragMove = (e: PointerEvent): void => { + const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); + const before = x[1] < bounds[1]; + this._header!.current!.className = "collectionSchema-row-wrapper"; + if (before) this._header!.current!.className += " row-above"; + if (!before) this._header!.current!.className += " row-below"; + e.stopPropagation(); + } + componentWillUnmount() { + + this._rowDropDisposer?.(); + } + // + createRowDropTarget = (ele: HTMLDivElement) => { + this._rowDropDisposer?.(); + if (ele) { + this._rowDropDisposer = DragManager.MakeDropTarget(ele, this.rowDrop.bind(this)); + } + } + // Controls what hppens when a row is dragged and dropped + rowDrop = (e: Event, de: DragManager.DropEvent) => { + this.onPointerLeave(e as any); + const rowDoc = FieldValue(Cast(this.props.rowInfo.original, Doc)); + if (!rowDoc) return false; + + const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); + const before = x[1] < bounds[1]; + + const docDragData = de.complete.docDragData; + if (docDragData) { + e.stopPropagation(); + if (docDragData.draggedDocuments[0] === rowDoc) return true; + const addDocument = (doc: Doc | Doc[]) => this.props.addDoc(doc, rowDoc, before); + const movedDocs = docDragData.draggedDocuments; + return (docDragData.dropAction || docDragData.userDropAction) ? + docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before) || added, false) + : (docDragData.moveDocument) ? + movedDocs.reduce((added: boolean, d) => docDragData.moveDocument?.(d, rowDoc, addDocument) || added, false) + : docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before), false); + } + return false; + } + + onRowContextMenu = (e: React.MouseEvent): void => { + const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row"; + ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" }); + } + + @undoBatch + @action + move: DragManager.MoveFunction = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc) => { + const targetView = targetCollection && DocumentManager.Instance.getDocumentView(targetCollection); + return doc !== targetCollection && doc !== targetView?.props.ContainingCollectionDoc && this.props.removeDoc(doc) && addDoc(doc); + } + + @action + onKeyDown = (e: React.KeyboardEvent) => { + console.log("yes"); + if (e.key === "Backspace" || e.key === "Delete") { + undoBatch(() => this.props.removeDoc(this.props.rowInfo.original)); + } + } + + render() { + const { children = null, rowInfo } = this.props; + + if (!rowInfo) { + return {children}; + } + + const { original } = rowInfo; + const doc = FieldValue(Cast(original, Doc)); + + if (!doc) return (null); + + const reference = React.createRef(); + const onItemDown = SetupDrag(reference, () => doc, this.move, StrCast(this.props.dropAction) as dropActionType); + + let className = "collectionSchema-row"; + if (this.props.rowFocused) className += " row-focused"; + if (this.props.rowWrapped) className += " row-wrapped"; + + return ( +
+
+ +
+
this.props.removeDoc(this.props.rowInfo.original))}>
+
+
this.props.addDocTab(this.props.rowInfo.original, "add:right")}>
+
+ {children} +
+
+
+ ); + } +} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/CollectionSchemaMovableTableHOC.tsx b/src/client/views/collections/schemaView/CollectionSchemaMovableTableHOC.tsx deleted file mode 100644 index e1066caf4..000000000 --- a/src/client/views/collections/schemaView/CollectionSchemaMovableTableHOC.tsx +++ /dev/null @@ -1,261 +0,0 @@ -import React = require("react"); -import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { action } from "mobx"; -import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table"; -import { Doc } from "../../../../fields/Doc"; -import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; -import { Cast, FieldValue, StrCast } from "../../../../fields/Types"; -import { DocumentManager } from "../../../util/DocumentManager"; -import { DragManager, dropActionType, SetupDrag } from "../../../util/DragManager"; -import { SnappingManager } from "../../../util/SnappingManager"; -import { Transform } from "../../../util/Transform"; -import { undoBatch } from "../../../util/UndoManager"; -import { ContextMenu } from "../../ContextMenu"; -import "./CollectionSchemaView.scss"; - -export interface MovableColumnProps { - columnRenderer: TableCellRenderer; - columnValue: SchemaHeaderField; - allColumns: SchemaHeaderField[]; - reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columns: SchemaHeaderField[]) => void; - ScreenToLocalTransform: () => Transform; -} -export class MovableColumn extends React.Component { - private _header?: React.RefObject = React.createRef(); - private _colDropDisposer?: DragManager.DragDropDisposer; - private _startDragPosition: { x: number, y: number } = { x: 0, y: 0 }; - private _sensitivity: number = 16; - private _dragRef: React.RefObject = React.createRef(); - - onPointerEnter = (e: React.PointerEvent): void => { - if (e.buttons === 1 && SnappingManager.GetIsDragging()) { - this._header!.current!.className = "collectionSchema-col-wrapper"; - document.addEventListener("pointermove", this.onDragMove, true); - } - } - onPointerLeave = (e: React.PointerEvent): void => { - this._header!.current!.className = "collectionSchema-col-wrapper"; - document.removeEventListener("pointermove", this.onDragMove, true); - !e.buttons && document.removeEventListener("pointermove", this.onPointerMove); - } - onDragMove = (e: PointerEvent): void => { - const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top); - const before = x[0] < bounds[0]; - this._header!.current!.className = "collectionSchema-col-wrapper"; - if (before) this._header!.current!.className += " col-before"; - if (!before) this._header!.current!.className += " col-after"; - e.stopPropagation(); - } - - createColDropTarget = (ele: HTMLDivElement) => { - this._colDropDisposer?.(); - if (ele) { - this._colDropDisposer = DragManager.MakeDropTarget(ele, this.colDrop.bind(this)); - } - } - - colDrop = (e: Event, de: DragManager.DropEvent) => { - document.removeEventListener("pointermove", this.onDragMove, true); - const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top); - const before = x[0] < bounds[0]; - const colDragData = de.complete.columnDragData; - if (colDragData) { - e.stopPropagation(); - this.props.reorderColumns(colDragData.colKey, this.props.columnValue, before, this.props.allColumns); - return true; - } - return false; - } - - onPointerMove = (e: PointerEvent) => { - const onRowMove = (e: PointerEvent) => { - e.stopPropagation(); - e.preventDefault(); - - document.removeEventListener("pointermove", onRowMove); - document.removeEventListener('pointerup', onRowUp); - const dragData = new DragManager.ColumnDragData(this.props.columnValue); - DragManager.StartColumnDrag(this._dragRef.current!, dragData, e.x, e.y); - }; - const onRowUp = (): void => { - document.removeEventListener("pointermove", onRowMove); - document.removeEventListener('pointerup', onRowUp); - }; - if (e.buttons === 1) { - const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX - this._startDragPosition.x, e.clientY - this._startDragPosition.y); - if (Math.abs(dx) + Math.abs(dy) > this._sensitivity) { - document.removeEventListener("pointermove", this.onPointerMove); - e.stopPropagation(); - - document.addEventListener("pointermove", onRowMove); - document.addEventListener("pointerup", onRowUp); - } - } - } - - onPointerUp = (e: React.PointerEvent) => { - document.removeEventListener("pointermove", this.onPointerMove); - } - - @action - onPointerDown = (e: React.PointerEvent, ref: React.RefObject) => { - this._dragRef = ref; - const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX, e.clientY); - if (!(e.target as any)?.tagName.includes("INPUT")) { - this._startDragPosition = { x: dx, y: dy }; - document.addEventListener("pointermove", this.onPointerMove); - } - } - - - render() { - const reference = React.createRef(); - - return ( -
-
-
this.onPointerDown(e, reference)} onPointerUp={this.onPointerUp}> - {this.props.columnRenderer} -
-
-
- ); - } -} - -export interface MovableRowProps { - rowInfo: RowInfo; - ScreenToLocalTransform: () => Transform; - addDoc: (doc: Doc | Doc[], relativeTo?: Doc, before?: boolean) => boolean; - removeDoc: (doc: Doc | Doc[]) => boolean; - rowFocused: boolean; - textWrapRow: (doc: Doc) => void; - rowWrapped: boolean; - dropAction: string; - addDocTab: any; -} - -export class MovableRow extends React.Component { - private _header?: React.RefObject = React.createRef(); - private _rowDropDisposer?: DragManager.DragDropDisposer; - - // Event listeners are only necessary when the user is hovering over the table - // Create one when the mouse starts hovering... - onPointerEnter = (e: React.PointerEvent): void => { - if (e.buttons === 1 && SnappingManager.GetIsDragging()) { - this._header!.current!.className = "collectionSchema-row-wrapper"; - document.addEventListener("pointermove", this.onDragMove, true); - } - } - // ... and delete it when the mouse leaves - onPointerLeave = (e: React.PointerEvent): void => { - this._header!.current!.className = "collectionSchema-row-wrapper"; - document.removeEventListener("pointermove", this.onDragMove, true); - } - // The method for the event listener, reorders columns when dragged to their new locations. - onDragMove = (e: PointerEvent): void => { - const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); - const before = x[1] < bounds[1]; - this._header!.current!.className = "collectionSchema-row-wrapper"; - if (before) this._header!.current!.className += " row-above"; - if (!before) this._header!.current!.className += " row-below"; - e.stopPropagation(); - } - componentWillUnmount() { - - this._rowDropDisposer?.(); - } - // - createRowDropTarget = (ele: HTMLDivElement) => { - this._rowDropDisposer?.(); - if (ele) { - this._rowDropDisposer = DragManager.MakeDropTarget(ele, this.rowDrop.bind(this)); - } - } - // Controls what hppens when a row is dragged and dropped - rowDrop = (e: Event, de: DragManager.DropEvent) => { - this.onPointerLeave(e as any); - const rowDoc = FieldValue(Cast(this.props.rowInfo.original, Doc)); - if (!rowDoc) return false; - - const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); - const before = x[1] < bounds[1]; - - const docDragData = de.complete.docDragData; - if (docDragData) { - e.stopPropagation(); - if (docDragData.draggedDocuments[0] === rowDoc) return true; - const addDocument = (doc: Doc | Doc[]) => this.props.addDoc(doc, rowDoc, before); - const movedDocs = docDragData.draggedDocuments; - return (docDragData.dropAction || docDragData.userDropAction) ? - docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before) || added, false) - : (docDragData.moveDocument) ? - movedDocs.reduce((added: boolean, d) => docDragData.moveDocument?.(d, rowDoc, addDocument) || added, false) - : docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before), false); - } - return false; - } - - onRowContextMenu = (e: React.MouseEvent): void => { - const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row"; - ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" }); - } - - @undoBatch - @action - move: DragManager.MoveFunction = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc) => { - const targetView = targetCollection && DocumentManager.Instance.getDocumentView(targetCollection); - return doc !== targetCollection && doc !== targetView?.props.ContainingCollectionDoc && this.props.removeDoc(doc) && addDoc(doc); - } - - @action - onKeyDown = (e: React.KeyboardEvent) => { - console.log("yes"); - if (e.key === "Backspace" || e.key === "Delete") { - undoBatch(() => this.props.removeDoc(this.props.rowInfo.original)); - } - } - - render() { - const { children = null, rowInfo } = this.props; - - if (!rowInfo) { - return {children}; - } - - const { original } = rowInfo; - const doc = FieldValue(Cast(original, Doc)); - - if (!doc) return (null); - - const reference = React.createRef(); - const onItemDown = SetupDrag(reference, () => doc, this.move, StrCast(this.props.dropAction) as dropActionType); - - let className = "collectionSchema-row"; - if (this.props.rowFocused) className += " row-focused"; - if (this.props.rowWrapped) className += " row-wrapped"; - - return ( -
-
- -
-
this.props.removeDoc(this.props.rowInfo.original))}>
-
-
this.props.addDocTab(this.props.rowInfo.original, "add:right")}>
-
- {children} -
-
-
- ); - } -} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/SchemaTable.tsx b/src/client/views/collections/schemaView/SchemaTable.tsx index 05d77a739..a735d4257 100644 --- a/src/client/views/collections/schemaView/SchemaTable.tsx +++ b/src/client/views/collections/schemaView/SchemaTable.tsx @@ -28,7 +28,8 @@ import { DocumentView } from "../../nodes/DocumentView"; import { DefaultStyleProvider } from "../../StyleProvider"; import { CellProps, CollectionSchemaButtons, CollectionSchemaCell, CollectionSchemaCheckboxCell, CollectionSchemaDateCell, CollectionSchemaDocCell, CollectionSchemaImageCell, CollectionSchemaListCell, CollectionSchemaNumberCell, CollectionSchemaStringCell } from "./CollectionSchemaCells"; import { CollectionSchemaAddColumnHeader, KeysDropdown } from "./CollectionSchemaHeaders"; -import { MovableColumn, MovableRow } from "./CollectionSchemaMovableTableHOC"; +import { MovableColumn } from "./CollectionSchemaMovableColumn"; +import { MovableRow } from "./CollectionSchemaMovableRow"; import "./CollectionSchemaView.scss"; import { CollectionView } from "../CollectionView"; -- cgit v1.2.3-70-g09d2 From a5c099cb5ae455064f65989dc977870ce2c3f7fc Mon Sep 17 00:00:00 2001 From: 0x85FB9C51 <77808164+0x85FB9C51@users.noreply.github.com> Date: Sat, 10 Jul 2021 16:57:45 -0400 Subject: added indentation for visibility of hierarchy --- src/client/util/SelectionManager.ts | 2 +- .../schemaView/CollectionSchemaHeaders.tsx | 1 - .../schemaView/CollectionSchemaMovableColumn.tsx | 133 --------------------- .../views/collections/schemaView/SchemaTable.tsx | 3 +- src/fields/SchemaHeaderField.ts | 2 +- 5 files changed, 4 insertions(+), 137 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts index ca5ef75d2..a624d5b7c 100644 --- a/src/client/util/SelectionManager.ts +++ b/src/client/util/SelectionManager.ts @@ -1,7 +1,7 @@ import { action, observable, ObservableMap } from "mobx"; import { computedFn } from "mobx-utils"; import { Doc, Opt } from "../../fields/Doc"; -import { CollectionSchemaView } from "../views/collections/CollectionSchemaView"; +import { CollectionSchemaView } from "../views/collections/schemaView/CollectionSchemaView"; import { CollectionViewType } from "../views/collections/CollectionView"; import { DocumentView } from "../views/nodes/DocumentView"; diff --git a/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx b/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx index ab3076224..b2115b22e 100644 --- a/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx +++ b/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx @@ -11,7 +11,6 @@ import { Cast, StrCast } from "../../../../fields/Types"; import { undoBatch } from "../../../util/UndoManager"; import { SearchBox } from "../../search/SearchBox"; import { ColumnType } from "./CollectionSchemaView"; -import { ColumnType2 } from "../CollectionSchemaView"; import "./CollectionSchemaView.scss"; import { CollectionView } from "../CollectionView"; diff --git a/src/client/views/collections/schemaView/CollectionSchemaMovableColumn.tsx b/src/client/views/collections/schemaView/CollectionSchemaMovableColumn.tsx index e1066caf4..456c38c68 100644 --- a/src/client/views/collections/schemaView/CollectionSchemaMovableColumn.tsx +++ b/src/client/views/collections/schemaView/CollectionSchemaMovableColumn.tsx @@ -126,136 +126,3 @@ export class MovableColumn extends React.Component { ); } } - -export interface MovableRowProps { - rowInfo: RowInfo; - ScreenToLocalTransform: () => Transform; - addDoc: (doc: Doc | Doc[], relativeTo?: Doc, before?: boolean) => boolean; - removeDoc: (doc: Doc | Doc[]) => boolean; - rowFocused: boolean; - textWrapRow: (doc: Doc) => void; - rowWrapped: boolean; - dropAction: string; - addDocTab: any; -} - -export class MovableRow extends React.Component { - private _header?: React.RefObject = React.createRef(); - private _rowDropDisposer?: DragManager.DragDropDisposer; - - // Event listeners are only necessary when the user is hovering over the table - // Create one when the mouse starts hovering... - onPointerEnter = (e: React.PointerEvent): void => { - if (e.buttons === 1 && SnappingManager.GetIsDragging()) { - this._header!.current!.className = "collectionSchema-row-wrapper"; - document.addEventListener("pointermove", this.onDragMove, true); - } - } - // ... and delete it when the mouse leaves - onPointerLeave = (e: React.PointerEvent): void => { - this._header!.current!.className = "collectionSchema-row-wrapper"; - document.removeEventListener("pointermove", this.onDragMove, true); - } - // The method for the event listener, reorders columns when dragged to their new locations. - onDragMove = (e: PointerEvent): void => { - const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); - const before = x[1] < bounds[1]; - this._header!.current!.className = "collectionSchema-row-wrapper"; - if (before) this._header!.current!.className += " row-above"; - if (!before) this._header!.current!.className += " row-below"; - e.stopPropagation(); - } - componentWillUnmount() { - - this._rowDropDisposer?.(); - } - // - createRowDropTarget = (ele: HTMLDivElement) => { - this._rowDropDisposer?.(); - if (ele) { - this._rowDropDisposer = DragManager.MakeDropTarget(ele, this.rowDrop.bind(this)); - } - } - // Controls what hppens when a row is dragged and dropped - rowDrop = (e: Event, de: DragManager.DropEvent) => { - this.onPointerLeave(e as any); - const rowDoc = FieldValue(Cast(this.props.rowInfo.original, Doc)); - if (!rowDoc) return false; - - const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); - const before = x[1] < bounds[1]; - - const docDragData = de.complete.docDragData; - if (docDragData) { - e.stopPropagation(); - if (docDragData.draggedDocuments[0] === rowDoc) return true; - const addDocument = (doc: Doc | Doc[]) => this.props.addDoc(doc, rowDoc, before); - const movedDocs = docDragData.draggedDocuments; - return (docDragData.dropAction || docDragData.userDropAction) ? - docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before) || added, false) - : (docDragData.moveDocument) ? - movedDocs.reduce((added: boolean, d) => docDragData.moveDocument?.(d, rowDoc, addDocument) || added, false) - : docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before), false); - } - return false; - } - - onRowContextMenu = (e: React.MouseEvent): void => { - const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row"; - ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" }); - } - - @undoBatch - @action - move: DragManager.MoveFunction = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc) => { - const targetView = targetCollection && DocumentManager.Instance.getDocumentView(targetCollection); - return doc !== targetCollection && doc !== targetView?.props.ContainingCollectionDoc && this.props.removeDoc(doc) && addDoc(doc); - } - - @action - onKeyDown = (e: React.KeyboardEvent) => { - console.log("yes"); - if (e.key === "Backspace" || e.key === "Delete") { - undoBatch(() => this.props.removeDoc(this.props.rowInfo.original)); - } - } - - render() { - const { children = null, rowInfo } = this.props; - - if (!rowInfo) { - return {children}; - } - - const { original } = rowInfo; - const doc = FieldValue(Cast(original, Doc)); - - if (!doc) return (null); - - const reference = React.createRef(); - const onItemDown = SetupDrag(reference, () => doc, this.move, StrCast(this.props.dropAction) as dropActionType); - - let className = "collectionSchema-row"; - if (this.props.rowFocused) className += " row-focused"; - if (this.props.rowWrapped) className += " row-wrapped"; - - return ( -
-
- -
-
this.props.removeDoc(this.props.rowInfo.original))}>
-
-
this.props.addDocTab(this.props.rowInfo.original, "add:right")}>
-
- {children} -
-
-
- ); - } -} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/SchemaTable.tsx b/src/client/views/collections/schemaView/SchemaTable.tsx index a735d4257..0d5c9e077 100644 --- a/src/client/views/collections/schemaView/SchemaTable.tsx +++ b/src/client/views/collections/schemaView/SchemaTable.tsx @@ -458,8 +458,9 @@ export class SchemaTable extends React.Component { expanded={expanded} resized={this.resized} onResizedChange={this.props.onResizedChange} + // if it has a child, render another table with the children SubComponent={!hasCollectionChild ? undefined : row => (row.original.type !== DocumentType.COL) ? (null) : -
} +
} />; } diff --git a/src/fields/SchemaHeaderField.ts b/src/fields/SchemaHeaderField.ts index 88de3a19f..74cf934f2 100644 --- a/src/fields/SchemaHeaderField.ts +++ b/src/fields/SchemaHeaderField.ts @@ -3,7 +3,7 @@ import { serializable, primitive } from "serializr"; import { ObjectField } from "./ObjectField"; import { Copy, ToScriptString, ToString, OnUpdate } from "./FieldSymbols"; import { scriptingGlobal } from "../client/util/Scripting"; -import { ColumnType } from "../client/views/collections/CollectionSchemaView"; +import { ColumnType } from "../client/views/collections/schemaView/CollectionSchemaView"; export const PastelSchemaPalette = new Map([ // ["pink1", "#FFB4E8"], -- cgit v1.2.3-70-g09d2 From e48f447f66f7f50f39be385e0eb09df552f5f503 Mon Sep 17 00:00:00 2001 From: geireann Date: Mon, 12 Jul 2021 13:54:23 -0400 Subject: Changed "schemaView" :arrow_right: "collectionSchema" So style is consistent with other folders --- src/client/util/SelectionManager.ts | 2 +- .../views/collections/CollectionSchemaView.tsx | 575 ++++++++++++++++++++ src/client/views/collections/CollectionView.tsx | 2 +- .../collectionSchema/CollectionSchemaCells.tsx | 585 ++++++++++++++++++++ .../collectionSchema/CollectionSchemaHeaders.tsx | 518 ++++++++++++++++++ .../CollectionSchemaMovableColumn.tsx | 128 +++++ .../CollectionSchemaMovableRow.tsx | 147 +++++ .../collectionSchema/CollectionSchemaView.scss | 552 +++++++++++++++++++ .../collectionSchema/CollectionSchemaView.tsx | 575 ++++++++++++++++++++ .../collections/collectionSchema/SchemaTable.tsx | 601 +++++++++++++++++++++ .../schemaView/CollectionSchemaCells.tsx | 585 -------------------- .../schemaView/CollectionSchemaHeaders.tsx | 518 ------------------ .../schemaView/CollectionSchemaMovableColumn.tsx | 128 ----- .../schemaView/CollectionSchemaMovableRow.tsx | 147 ----- .../schemaView/CollectionSchemaView.scss | 552 ------------------- .../schemaView/CollectionSchemaView.tsx | 575 -------------------- .../views/collections/schemaView/SchemaTable.tsx | 601 --------------------- src/client/views/nodes/DocumentContentsView.tsx | 2 +- src/client/views/search/SearchBox.tsx | 8 +- src/fields/SchemaHeaderField.ts | 2 +- 20 files changed, 3689 insertions(+), 3114 deletions(-) create mode 100644 src/client/views/collections/CollectionSchemaView.tsx create mode 100644 src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx create mode 100644 src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx create mode 100644 src/client/views/collections/collectionSchema/CollectionSchemaMovableColumn.tsx create mode 100644 src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx create mode 100644 src/client/views/collections/collectionSchema/CollectionSchemaView.scss create mode 100644 src/client/views/collections/collectionSchema/CollectionSchemaView.tsx create mode 100644 src/client/views/collections/collectionSchema/SchemaTable.tsx delete mode 100644 src/client/views/collections/schemaView/CollectionSchemaCells.tsx delete mode 100644 src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx delete mode 100644 src/client/views/collections/schemaView/CollectionSchemaMovableColumn.tsx delete mode 100644 src/client/views/collections/schemaView/CollectionSchemaMovableRow.tsx delete mode 100644 src/client/views/collections/schemaView/CollectionSchemaView.scss delete mode 100644 src/client/views/collections/schemaView/CollectionSchemaView.tsx delete mode 100644 src/client/views/collections/schemaView/SchemaTable.tsx (limited to 'src/client/views/collections') diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts index a624d5b7c..00f0894c7 100644 --- a/src/client/util/SelectionManager.ts +++ b/src/client/util/SelectionManager.ts @@ -1,7 +1,7 @@ import { action, observable, ObservableMap } from "mobx"; import { computedFn } from "mobx-utils"; import { Doc, Opt } from "../../fields/Doc"; -import { CollectionSchemaView } from "../views/collections/schemaView/CollectionSchemaView"; +import { CollectionSchemaView } from "../views/collections/collectionSchema/CollectionSchemaView"; import { CollectionViewType } from "../views/collections/CollectionView"; import { DocumentView } from "../views/nodes/DocumentView"; diff --git a/src/client/views/collections/CollectionSchemaView.tsx b/src/client/views/collections/CollectionSchemaView.tsx new file mode 100644 index 000000000..8f2847139 --- /dev/null +++ b/src/client/views/collections/CollectionSchemaView.tsx @@ -0,0 +1,575 @@ +import React = require("react"); +import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; +import { action, computed, observable, untracked } from "mobx"; +import { observer } from "mobx-react"; +import Measure from "react-measure"; +import { Resize } from "react-table"; +import "react-table/react-table.css"; +import { Doc, Opt } from "../../../fields/Doc"; +import { List } from "../../../fields/List"; +import { listSpec } from "../../../fields/Schema"; +import { PastelSchemaPalette, SchemaHeaderField } from "../../../fields/SchemaHeaderField"; +import { Cast, NumCast } from "../../../fields/Types"; +import { TraceMobx } from "../../../fields/util"; +import { emptyFunction, emptyPath, returnFalse, setupMoveUpEvents, returnEmptyDoclist, returnTrue } from "../../../Utils"; +import { SelectionManager } from "../../util/SelectionManager"; +import { SnappingManager } from "../../util/SnappingManager"; +import { Transform } from "../../util/Transform"; +import { undoBatch } from "../../util/UndoManager"; +import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../views/globalCssVariables.scss'; +import { ContextMenu } from "../ContextMenu"; +import { ContextMenuProps } from "../ContextMenuItem"; +import '../DocumentDecorations.scss'; +import { DocumentView } from "../nodes/DocumentView"; +import { DefaultStyleProvider } from "../StyleProvider"; +import "./CollectionSchemaView.scss"; +import { CollectionSubView } from "./CollectionSubView"; +import { SchemaTable } from "./SchemaTable"; +import { DocUtils } from "../../documents/Documents"; +// bcz: need to add drag and drop of rows and columns. This seems like it might work for rows: https://codesandbox.io/s/l94mn1q657 + +export enum ColumnType { + Any, + Number, + String, + Boolean, + Doc, + Image, + List, + Date +} +// this map should be used for keys that should have a const type of value +const columnTypes: Map = new Map([ + ["title", ColumnType.String], + ["x", ColumnType.Number], ["y", ColumnType.Number], ["_width", ColumnType.Number], ["_height", ColumnType.Number], + ["_nativeWidth", ColumnType.Number], ["_nativeHeight", ColumnType.Number], ["isPrototype", ColumnType.Boolean], + ["_curPage", ColumnType.Number], ["_currentTimecode", ColumnType.Number], ["zIndex", ColumnType.Number] +]); + +@observer +export class CollectionSchemaView extends CollectionSubView(doc => doc) { + private _previewCont?: HTMLDivElement; + + @observable _previewDoc: Doc | undefined = undefined; + @observable _focusedTable: Doc = this.props.Document; + @observable _col: any = ""; + @observable _menuWidth = 0; + @observable _headerOpen = false; + @observable _headerIsEditing = false; + @observable _menuHeight = 0; + @observable _pointerX = 0; + @observable _pointerY = 0; + @observable _openTypes: boolean = false; + + @computed get previewWidth() { return () => NumCast(this.props.Document.schemaPreviewWidth); } + @computed get previewHeight() { return () => this.props.PanelHeight() - 2 * this.borderWidth; } + @computed get tableWidth() { return this.props.PanelWidth() - 2 * this.borderWidth - Number(SCHEMA_DIVIDER_WIDTH) - this.previewWidth(); } + @computed get borderWidth() { return Number(COLLECTION_BORDER_WIDTH); } + @computed get scale() { return this.props.ScreenToLocalTransform().Scale; } + @computed get columns() { return Cast(this.props.Document._schemaHeaders, listSpec(SchemaHeaderField), []); } + set columns(columns: SchemaHeaderField[]) { this.props.Document._schemaHeaders = new List(columns); } + + @computed get menuCoordinates() { + let searchx = 0; + let searchy = 0; + if (this.props.Document._searchDoc) { + const el = document.getElementsByClassName("collectionSchemaView-searchContainer")[0]; + if (el !== undefined) { + const rect = el.getBoundingClientRect(); + searchx = rect.x; + searchy = rect.y; + } + } + const x = Math.max(0, Math.min(document.body.clientWidth - this._menuWidth, this._pointerX)) - searchx; + const y = Math.max(0, Math.min(document.body.clientHeight - this._menuHeight, this._pointerY)) - searchy; + return this.props.ScreenToLocalTransform().transformPoint(x, y); + } + + get documentKeys() { + const docs = this.childDocs; + const keys: { [key: string]: boolean } = {}; + // bcz: ugh. this is untracked since otherwise a large collection of documents will blast the server for all their fields. + // then as each document's fields come back, we update the documents _proxies. Each time we do this, the whole schema will be + // invalidated and re-rendered. This workaround will inquire all of the document fields before the options button is clicked. + // then by the time the options button is clicked, all of the fields should be in place. If a new field is added while this menu + // is displayed (unlikely) it won't show up until something else changes. + //TODO Types + untracked(() => docs.map(doc => Doc.GetAllPrototypes(doc).map(proto => Object.keys(proto).forEach(key => keys[key] = false)))); + + this.columns.forEach(key => keys[key.heading] = true); + return Array.from(Object.keys(keys)); + } + + @action setHeaderIsEditing = (isEditing: boolean) => this._headerIsEditing = isEditing; + + @undoBatch + setColumnType = action((columnField: SchemaHeaderField, type: ColumnType): void => { + this._openTypes = false; + if (columnTypes.get(columnField.heading)) return; + + const columns = this.columns; + const index = columns.indexOf(columnField); + if (index > -1) { + columnField.setType(NumCast(type)); + columns[index] = columnField; + this.columns = columns; + } + }); + + @undoBatch + setColumnColor = (columnField: SchemaHeaderField, color: string): void => { + const columns = this.columns; + const index = columns.indexOf(columnField); + if (index > -1) { + columnField.setColor(color); + columns[index] = columnField; + this.columns = columns; // need to set the columns to trigger rerender + } + } + + @undoBatch + @action + setColumnSort = (columnField: SchemaHeaderField, descending: boolean | undefined) => { + const columns = this.columns; + columns.forEach(col => col.setDesc(undefined)); + + const index = columns.findIndex(c => c.heading === columnField.heading); + const column = columns[index]; + column.setDesc(descending); + columns[index] = column; + this.columns = columns; + } + + renderTypes = (col: any) => { + if (columnTypes.get(col.heading)) return (null); + + const type = col.type; + + const anyType =
this.setColumnType(col, ColumnType.Any)}> + + Any +
; + + const numType =
this.setColumnType(col, ColumnType.Number)}> + + Number +
; + + const textType =
this.setColumnType(col, ColumnType.String)}> + + Text +
; + + const boolType =
this.setColumnType(col, ColumnType.Boolean)}> + + Checkbox +
; + + const listType =
this.setColumnType(col, ColumnType.List)}> + + List +
; + + const docType =
this.setColumnType(col, ColumnType.Doc)}> + + Document +
; + + const imageType =
this.setColumnType(col, ColumnType.Image)}> + + Image +
; + + const dateType =
this.setColumnType(col, ColumnType.Date)}> + + Date +
; + + + const allColumnTypes =
+ {anyType} + {numType} + {textType} + {boolType} + {listType} + {docType} + {imageType} + {dateType} +
; + + const justColType = type === ColumnType.Any ? anyType : type === ColumnType.Number ? numType : + type === ColumnType.String ? textType : type === ColumnType.Boolean ? boolType : + type === ColumnType.List ? listType : type === ColumnType.Doc ? docType : + type === ColumnType.Date ? dateType : imageType; + + return ( +
this._openTypes = !this._openTypes)}> +
+ + +
+ {this._openTypes ? allColumnTypes : justColType} +
+ ); + } + + renderSorting = (col: any) => { + const sort = col.desc; + return ( +
+ +
+
this.setColumnSort(col, true)}> + + Sort descending +
+
this.setColumnSort(col, false)}> + + Sort ascending +
+
this.setColumnSort(col, undefined)}> + + Clear sorting +
+
+
+ ); + } + + renderColors = (col: any) => { + const selected = col.color; + + const pink = PastelSchemaPalette.get("pink2"); + const purple = PastelSchemaPalette.get("purple2"); + const blue = PastelSchemaPalette.get("bluegreen1"); + const yellow = PastelSchemaPalette.get("yellow4"); + const red = PastelSchemaPalette.get("red2"); + const gray = "#f1efeb"; + + return ( +
+ +
+
this.setColumnColor(col, pink!)}>
+
this.setColumnColor(col, purple!)}>
+
this.setColumnColor(col, blue!)}>
+
this.setColumnColor(col, yellow!)}>
+
this.setColumnColor(col, red!)}>
+
this.setColumnColor(col, gray)}>
+
+
+ ); + } + + @undoBatch + @action + changeColumns = (oldKey: string, newKey: string, addNew: boolean, filter?: string) => { + const columns = this.columns; + if (columns === undefined) { + this.columns = new List([new SchemaHeaderField(newKey, "f1efeb")]); + } else { + if (addNew) { + columns.push(new SchemaHeaderField(newKey, "f1efeb")); + this.columns = columns; + } else { + const index = columns.map(c => c.heading).indexOf(oldKey); + if (index > -1) { + const column = columns[index]; + column.setHeading(newKey); + columns[index] = column; + this.columns = columns; + if (filter) { + Doc.setDocFilter(this.props.Document, newKey, filter, "match"); + } + else { + this.props.Document._docFilters = undefined; + } + } + } + } + } + + @action + openHeader = (col: any, screenx: number, screeny: number) => { + this._col = col; + this._headerOpen = true; + this._pointerX = screenx; + this._pointerY = screeny; + } + + @action + closeHeader = () => { this._headerOpen = false; } + + @undoBatch + @action + deleteColumn = (key: string) => { + const columns = this.columns; + if (columns === undefined) { + this.columns = new List([]); + } else { + const index = columns.map(c => c.heading).indexOf(key); + if (index > -1) { + columns.splice(index, 1); + this.columns = columns; + } + } + this.closeHeader(); + } + + getPreviewTransform = (): Transform => { + return this.props.ScreenToLocalTransform().translate(- this.borderWidth - NumCast(COLLECTION_BORDER_WIDTH) - this.tableWidth, - this.borderWidth); + } + + @action + onHeaderClick = (e: React.PointerEvent) => { + e.stopPropagation(); + } + + @action + onWheel(e: React.WheelEvent) { + const scale = this.props.ScreenToLocalTransform().Scale; + this.props.isContentActive(true) && e.stopPropagation(); + } + + @computed get renderMenuContent() { + TraceMobx(); + return
+ {this.renderTypes(this._col)} + {this.renderColors(this._col)} +
+ +
+
; + } + + private createTarget = (ele: HTMLDivElement) => { + this._previewCont = ele; + super.CreateDropTarget(ele); + } + + isFocused = (doc: Doc, outsideReaction: boolean): boolean => this.props.isSelected(outsideReaction) && doc === this._focusedTable; + + @action setFocused = (doc: Doc) => this._focusedTable = doc; + + @action setPreviewDoc = (doc: Opt) => { + SelectionManager.SelectSchemaView(this, doc); + this._previewDoc = doc; + } + + //toggles preview side-panel of schema + @action + toggleExpander = () => { + this.props.Document.schemaPreviewWidth = this.previewWidth() === 0 ? Math.min(this.tableWidth / 3, 200) : 0; + } + + onDividerDown = (e: React.PointerEvent) => { + setupMoveUpEvents(this, e, this.onDividerMove, emptyFunction, this.toggleExpander); + } + @action + onDividerMove = (e: PointerEvent, down: number[], delta: number[]) => { + const nativeWidth = this._previewCont!.getBoundingClientRect(); + const minWidth = 40; + const maxWidth = 1000; + const movedWidth = this.props.ScreenToLocalTransform().transformDirection(nativeWidth.right - e.clientX, 0)[0]; + const width = movedWidth < minWidth ? minWidth : movedWidth > maxWidth ? maxWidth : movedWidth; + this.props.Document.schemaPreviewWidth = width; + return false; + } + + onPointerDown = (e: React.PointerEvent): void => { + if (e.button === 0 && !e.altKey && !e.ctrlKey && !e.metaKey) { + if (this.props.isSelected(true)) e.stopPropagation(); + else this.props.select(false); + } + } + + @computed + get previewDocument(): Doc | undefined { return this._previewDoc; } + + @computed + get dividerDragger() { + return this.previewWidth() === 0 ? (null) : +
+
+
; + } + + @computed + get previewPanel() { + return
+ {!this.previewDocument ? (null) : + } +
; + } + + @computed + get schemaTable() { + return ; + } + + @computed + public get schemaToolbar() { + return
+
+
+ + Show Preview +
+
+
; + } + + onSpecificMenu = (e: React.MouseEvent) => { + if ((e.target as any)?.className?.includes?.("collectionSchemaView-cell") || (e.target instanceof HTMLSpanElement)) { + const cm = ContextMenu.Instance; + const options = cm.findByDescription("Options..."); + const optionItems: ContextMenuProps[] = options && "subitems" in options ? options.subitems : []; + optionItems.push({ description: "remove", event: () => this._previewDoc && this.props.removeDocument?.(this._previewDoc), icon: "trash" }); + !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "compass" }); + cm.displayMenu(e.clientX, e.clientY); + (e.nativeEvent as any).SchemaHandled = true; // not sure why this is needed, but if you right-click quickly on a cell, the Document/Collection contextMenu handlers still fire without this. + e.stopPropagation(); + } + } + + @action + onTableClick = (e: React.MouseEvent): void => { + if (!(e.target as any)?.className?.includes?.("collectionSchemaView-cell") && !(e.target instanceof HTMLSpanElement)) { + this.setPreviewDoc(undefined); + } else { + e.stopPropagation(); + } + this.setFocused(this.props.Document); + this.closeHeader(); + } + + onResizedChange = (newResized: Resize[], event: any) => { + const columns = this.columns; + newResized.forEach(resized => { + const index = columns.findIndex(c => c.heading === resized.id); + const column = columns[index]; + column.setWidth(resized.value); + columns[index] = column; + }); + this.columns = columns; + } + + @action + setColumns = (columns: SchemaHeaderField[]) => this.columns = columns + + @undoBatch + reorderColumns = (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columnsValues: SchemaHeaderField[]) => { + const columns = [...columnsValues]; + const oldIndex = columns.indexOf(toMove); + const relIndex = columns.indexOf(relativeTo); + const newIndex = (oldIndex > relIndex && !before) ? relIndex + 1 : (oldIndex < relIndex && before) ? relIndex - 1 : relIndex; + + if (oldIndex === newIndex) return; + + columns.splice(newIndex, 0, columns.splice(oldIndex, 1)[0]); + this.columns = columns; + } + + onZoomMenu = (e: React.WheelEvent) => this.props.isContentActive(true) && e.stopPropagation(); + + render() { + TraceMobx(); + if (!this.props.isContentActive()) setTimeout(() => this.closeHeader(), 0); + const menuContent = this.renderMenuContent; + const menu =
this.onZoomMenu(e)} + onPointerDown={e => this.onHeaderClick(e)} + style={{ transform: `translate(${(this.menuCoordinates[0])}px, ${(this.menuCoordinates[1])}px)` }}> + { + const dim = this.props.ScreenToLocalTransform().inverse().transformDirection(r.offset.width, r.offset.height); + this._menuWidth = dim[0]; this._menuHeight = dim[1]; + })}> + {({ measureRef }) =>
{menuContent}
} +
+
; + return
+
this.props.isContentActive(true) && e.stopPropagation()} + onDrop={e => this.onExternalDrop(e, {})} + ref={this.createTarget}> + {this.schemaTable} +
+ {this.dividerDragger} + {!this.previewWidth() ? (null) : this.previewPanel} + {this._headerOpen && this.props.isContentActive() ? menu : null} +
; + } +} \ No newline at end of file diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index e5b1721f9..e225c4a11 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -29,7 +29,7 @@ import CollectionMapView from './CollectionMapView'; import { CollectionMulticolumnView } from './collectionMulticolumn/CollectionMulticolumnView'; import { CollectionMultirowView } from './collectionMulticolumn/CollectionMultirowView'; import { CollectionPileView } from './CollectionPileView'; -import { CollectionSchemaView } from "./schemaView/CollectionSchemaView"; +import { CollectionSchemaView } from "./collectionSchema/CollectionSchemaView"; import { CollectionStackingView } from './CollectionStackingView'; import { SubCollectionViewProps } from './CollectionSubView'; import { CollectionTimeView } from './CollectionTimeView'; diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx new file mode 100644 index 000000000..f75179cea --- /dev/null +++ b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx @@ -0,0 +1,585 @@ +import React = require("react"); +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { action, computed, observable } from "mobx"; +import { observer } from "mobx-react"; +import DatePicker from "react-datepicker"; +import "react-datepicker/dist/react-datepicker.css"; +import { CellInfo } from "react-table"; +import "react-table/react-table.css"; +import { DateField } from "../../../../fields/DateField"; +import { Doc, DocListCast, Field, Opt } from "../../../../fields/Doc"; +import { Id } from "../../../../fields/FieldSymbols"; +import { List } from "../../../../fields/List"; +import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; +import { ComputedField } from "../../../../fields/ScriptField"; +import { BoolCast, Cast, DateCast, FieldValue, NumCast, StrCast } from "../../../../fields/Types"; +import { ImageField } from "../../../../fields/URLField"; +import { Utils, emptyFunction } from "../../../../Utils"; +import { Docs } from "../../../documents/Documents"; +import { DocumentType } from "../../../documents/DocumentTypes"; +import { DocumentManager } from "../../../util/DocumentManager"; +import { DragManager } from "../../../util/DragManager"; +import { KeyCodes } from "../../../util/KeyCodes"; +import { CompileScript } from "../../../util/Scripting"; +import { SearchUtil } from "../../../util/SearchUtil"; +import { SnappingManager } from "../../../util/SnappingManager"; +import { undoBatch } from "../../../util/UndoManager"; +import '../../../views/DocumentDecorations.scss'; +import { EditableView } from "../../EditableView"; +import { MAX_ROW_HEIGHT } from '../../globalCssVariables.scss'; +import { DocumentIconContainer } from "../../nodes/DocumentIcon"; +import { OverlayView } from "../../OverlayView"; +import "./CollectionSchemaView.scss"; +import { CollectionView } from "../CollectionView"; +const path = require('path'); + +// intialize cell properties +export interface CellProps { + row: number; + col: number; + rowProps: CellInfo; + CollectionView: Opt; + ContainingCollection: Opt; + Document: Doc; + fieldKey: string; + renderDepth: number; + addDocTab: (document: Doc, where: string) => boolean; + pinToPres: (document: Doc) => void; + moveDocument?: (document: Doc | Doc[], targetCollection: Doc | undefined, + addDocument: (document: Doc | Doc[]) => boolean) => boolean; + isFocused: boolean; + changeFocusedCellByIndex: (row: number, col: number) => void; + setIsEditing: (isEditing: boolean) => void; + isEditable: boolean; + setPreviewDoc: (doc: Doc) => void; + setComputed: (script: string, doc: Doc, field: string, row: number, col: number) => boolean; + getField: (row: number, col?: number) => void; + showDoc: (doc: Doc | undefined, dataDoc?: any, screenX?: number, screenY?: number) => void; +} + +@observer +export class CollectionSchemaCell extends React.Component { + public static resolvedFieldKey(column: string, rowDoc: Doc) { + const fieldKey = column; + if (fieldKey.startsWith("*")) { + const rootKey = fieldKey.substring(1); + const allKeys = [...Array.from(Object.keys(rowDoc)), ...Array.from(Object.keys(Doc.GetProto(rowDoc)))]; + const matchedKeys = allKeys.filter(key => key.includes(rootKey)); + if (matchedKeys.length) return matchedKeys[0]; + } + return fieldKey; + } + @observable protected _isEditing: boolean = false; + protected _focusRef = React.createRef(); + protected _rowDoc = this.props.rowProps.original; + protected _rowDataDoc = Doc.GetProto(this.props.rowProps.original); + protected _dropDisposer?: DragManager.DragDropDisposer; + @observable contents: string = ""; + + componentDidMount() { document.addEventListener("keydown", this.onKeyDown); } + componentWillUnmount() { document.removeEventListener("keydown", this.onKeyDown); } + + @action + onKeyDown = (e: KeyboardEvent): void => { + if (this.props.isFocused && this.props.isEditable && e.keyCode === KeyCodes.ENTER) { + document.removeEventListener("keydown", this.onKeyDown); + this._isEditing = true; + this.props.setIsEditing(true); + } + } + + @action + isEditingCallback = (isEditing: boolean): void => { + document.removeEventListener("keydown", this.onKeyDown); + isEditing && document.addEventListener("keydown", this.onKeyDown); + this._isEditing = isEditing; + this.props.setIsEditing(isEditing); + this.props.changeFocusedCellByIndex(this.props.row, this.props.col); + } + + @action + onPointerDown = async (e: React.PointerEvent): Promise => { + this.onItemDown(e); + this.props.changeFocusedCellByIndex(this.props.row, this.props.col); + this.props.setPreviewDoc(this.props.rowProps.original); + + let url: string; + if (url = StrCast(this.props.rowProps.row.href)) { + try { + new URL(url); + const temp = window.open(url)!; + temp.blur(); + window.focus(); + } catch { } + } + + const doc = Cast(this._rowDoc[this.renderFieldKey], Doc, null); + doc && this.props.setPreviewDoc(doc); + } + + @undoBatch + applyToDoc = (doc: Doc, row: number, col: number, run: (args?: { [name: string]: any }) => any) => { + const res = run({ this: doc, $r: row, $c: col, $: (r: number = 0, c: number = 0) => this.props.getField(r + row, c + col) }); + if (!res.success) return false; + doc[this.renderFieldKey] = res.result; + return true; + } + + private drop = (e: Event, de: DragManager.DropEvent) => { + if (de.complete.docDragData) { + if (de.complete.docDragData.draggedDocuments.length === 1) { + this._rowDataDoc[this.renderFieldKey] = de.complete.docDragData.draggedDocuments[0]; + } + else { + const coll = Docs.Create.SchemaDocument([new SchemaHeaderField("title", "#f1efeb")], de.complete.docDragData.draggedDocuments, {}); + this._rowDataDoc[this.renderFieldKey] = coll; + } + e.stopPropagation(); + } + } + + protected dropRef = (ele: HTMLElement | null) => { + this._dropDisposer?.(); + ele && (this._dropDisposer = DragManager.MakeDropTarget(ele, this.drop.bind(this))); + } + + returnHighlights(contents: string, positions?: number[]) { + if (positions) { + const results = []; + StrCast(this.props.Document._searchString); + const length = StrCast(this.props.Document._searchString).length; + const color = contents ? "black" : "grey"; + + results.push({contents?.slice(0, positions[0])}); + positions.forEach((num, cur) => { + results.push({contents?.slice(num, num + length)}); + let end = 0; + cur === positions.length - 1 ? end = contents.length : end = positions[cur + 1]; + results.push({contents?.slice(num + length, end)}); + } + ); + return results; + } + return {contents ? contents?.valueOf() : "undefined"}; + } + + @computed get renderFieldKey() { return CollectionSchemaCell.resolvedFieldKey(this.props.rowProps.column.id!, this.props.rowProps.original); } + onItemDown = async (e: React.PointerEvent) => { + if (this.props.Document._searchDoc) { + const aliasdoc = await SearchUtil.GetAliasesOfDocument(this._rowDataDoc); + const targetContext = aliasdoc.length <= 0 ? undefined : Cast(aliasdoc[0].context, Doc, null); + DocumentManager.Instance.jumpToDocument(this._rowDoc, false, emptyFunction, targetContext, + undefined, undefined, undefined, () => this.props.setPreviewDoc(this._rowDoc)); + } + } + renderCellWithType(type: string | undefined) { + const dragRef: React.RefObject = React.createRef(); + + const fieldKey = this.renderFieldKey; + const field = this._rowDoc[fieldKey]; + + const onPointerEnter = (e: React.PointerEvent): void => { + if (e.buttons === 1 && SnappingManager.GetIsDragging() && (type === "document" || type === undefined)) { + dragRef.current!.className = "collectionSchemaView-cellContainer doc-drag-over"; + } + }; + const onPointerLeave = (e: React.PointerEvent): void => { + dragRef.current!.className = "collectionSchemaView-cellContainer"; + }; + + let contents = Field.toString(field as Field); + contents = contents === "" ? "--" : contents; + + let className = "collectionSchemaView-cellWrapper"; + if (this._isEditing) className += " editing"; + if (this.props.isFocused && this.props.isEditable) className += " focused"; + if (this.props.isFocused && !this.props.isEditable) className += " inactive"; + + const positions = []; + if (StrCast(this.props.Document._searchString).toLowerCase() !== "") { + let term = (field instanceof Promise) ? "...promise pending..." : contents.toLowerCase(); + const search = StrCast(this.props.Document._searchString).toLowerCase(); + let start = term.indexOf(search); + let tally = 0; + if (start !== -1) { + positions.push(start); + } + while (start < contents?.length && start !== -1) { + term = term.slice(start + search.length + 1); + tally += start + search.length + 1; + start = term.indexOf(search); + positions.push(tally + start); + } + if (positions.length > 1) { + positions.pop(); + } + } + const placeholder = type === "number" ? "0" : contents === "" ? "--" : "undefined"; + return ( +
this._isEditing = true)} onPointerEnter={onPointerEnter} onPointerLeave={onPointerLeave}> +
+
+ {!this.props.Document._searchDoc ? + { + const cfield = ComputedField.WithoutComputed(() => FieldValue(field)); + const cscript = cfield instanceof ComputedField ? cfield.script.originalScript : undefined; + const cfinalScript = cscript?.split("return")[cscript.split("return").length - 1]; + return cscript ? (cfinalScript?.endsWith(";") ? `:=${cfinalScript?.substring(0, cfinalScript.length - 2)}` : cfinalScript) : + Field.IsField(cfield) ? Field.toScriptString(cfield) : ""; + }} + SetValue={action((value: string) => { + // sets what is displayed after the user makes an input + let retVal = false; + if (value.startsWith(":=") || value.startsWith("=:=")) { + // decides how to compute a value when given either of the above strings + const script = value.substring(value.startsWith("=:=") ? 3 : 2); + retVal = this.props.setComputed(script, value.startsWith(":=") ? this._rowDataDoc : this._rowDoc, this.renderFieldKey, this.props.row, this.props.col); + } else { + // check if the input is a number + let inputIsNum = true; + for (let s of value) { + if (isNaN(parseInt(s)) && !(s == ".") && !(s == ",")) { + inputIsNum = false; + } + } + // check if the input is a boolean + let inputIsBool: boolean = value == "false" || value == "true"; + // what to do in the case + if (!inputIsNum && !inputIsBool && !value.startsWith("=")) { + // if it's not a number, it's a string, and should be processed as such + // strips the string of quotes when it is edited to prevent quotes form being added to the text automatically + // after each edit + let valueSansQuotes = value; + if (this._isEditing) { + const vsqLength = valueSansQuotes.length; + // get rid of outer quotes + valueSansQuotes = valueSansQuotes.substring(value.startsWith("\"") ? 1 : 0, + valueSansQuotes.charAt(vsqLength - 1) == "\"" ? vsqLength - 1 : vsqLength); + } + let inputAsString = '"'; + // escape any quotes in the string + for (const i of valueSansQuotes) { + if (i == '"') { + inputAsString += '\\"'; + } else { + inputAsString += i; + } + } + // add a closing quote + inputAsString += '"'; + //two options here: we can strip off outer quotes or we can figure out what's going on with the script + const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); + const changeMade = inputAsString.length !== value.length || inputAsString.length - 2 !== value.length + script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + // handle numbers and expressions + } else if (inputIsNum || value.startsWith("=")) { + //TODO: make accept numbers + const inputscript = value.substring(value.startsWith("=") ? 1 : 0); + // if commas are not stripped, the parser only considers the numbers after the last comma + let inputSansCommas = ""; + for (let s of inputscript) { + if (!(s == ",")) { + inputSansCommas += s; + } + } + const script = CompileScript(inputSansCommas, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); + const changeMade = value.length !== value.length || value.length - 2 !== value.length + script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + // handle booleans + } else if (inputIsBool) { + const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); + const changeMade = value.length !== value.length || value.length - 2 !== value.length + script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); + } + } + if (retVal) { + this._isEditing = false; // need to set this here. otherwise, the assignment of the field will invalidate & cause render() to be called with the wrong value for 'editing' + this.props.setIsEditing(false); + } + return retVal; + })} + OnFillDown={async (value: string) => { + const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); + script.compiled && DocListCast(this.props.Document[this.props.fieldKey]). + forEach((doc, i) => value.startsWith(":=") ? + this.props.setComputed(value.substring(2), Doc.GetProto(doc), this.renderFieldKey, i, this.props.col) : + this.applyToDoc(Doc.GetProto(doc), i, this.props.col, script.run)); + }} + /> + : + this.returnHighlights(contents, positions) + } +
+
+
+ ); + } + + render() { return this.renderCellWithType(undefined); } +} + +@observer +export class CollectionSchemaNumberCell extends CollectionSchemaCell { render() { return this.renderCellWithType("number"); } } + +@observer +export class CollectionSchemaBooleanCell extends CollectionSchemaCell { render() { return this.renderCellWithType("boolean"); } } + +@observer +export class CollectionSchemaStringCell extends CollectionSchemaCell { render() { return this.renderCellWithType("string"); } } + +@observer +export class CollectionSchemaDateCell extends CollectionSchemaCell { + @computed get _date(): Opt { return this._rowDoc[this.renderFieldKey] instanceof DateField ? DateCast(this._rowDoc[this.renderFieldKey]) : undefined; } + + @action + handleChange = (date: any) => { + // const script = CompileScript(date.toString(), { requiredType: "Date", addReturn: true, params: { this: Doc.name } }); + // if (script.compiled) { + // this.applyToDoc(this._document, this.props.row, this.props.col, script.run); + // } else { + // ^ DateCast is always undefined for some reason, but that is what the field should be set to + this._rowDoc[this.renderFieldKey] = new DateField(date as Date); + //} + } + + render() { + return !this.props.isFocused ? {this._date ? Field.toString(this._date as Field) : "--"} : + this.handleChange(date)} + onChange={date => this.handleChange(date)} + />; + } +} + +@observer +export class CollectionSchemaDocCell extends CollectionSchemaCell { + + _overlayDisposer?: () => void; + + @computed get _doc() { return FieldValue(Cast(this._rowDoc[this.renderFieldKey], Doc)); } + + @action + onSetValue = (value: string) => { + this._doc && (Doc.GetProto(this._doc).title = value); + + const script = CompileScript(value, { + addReturn: true, + typecheck: true, + transformer: DocumentIconContainer.getTransformer() + }); + + const results = script.compiled && script.run(); + if (results && results.success) { + this._rowDoc[this.renderFieldKey] = results.result; + return true; + } + return false; + } + + componentWillUnmount() { this.onBlur(); } + + onBlur = () => { this._overlayDisposer?.(); }; + onFocus = () => { + this.onBlur(); + this._overlayDisposer = OverlayView.Instance.addElement(, { x: 0, y: 0 }); + } + + @action + isEditingCallback = (isEditing: boolean): void => { + document.removeEventListener("keydown", this.onKeyDown); + isEditing && document.addEventListener("keydown", this.onKeyDown); + this._isEditing = isEditing; + this.props.setIsEditing(isEditing); + this.props.changeFocusedCellByIndex(this.props.row, this.props.col); + } + + render() { + return !this._doc ? this.renderCellWithType("document") : +
+
+ StrCast(this._doc?.title)} + SetValue={action((value: string) => { + this.onSetValue(value); + return true; + })} + /> +
+
this._doc && this.props.addDocTab(this._doc, "add:right")} className="collectionSchemaView-cellContents-docButton"> + +
+
; + } +} + +@observer +export class CollectionSchemaImageCell extends CollectionSchemaCell { + + choosePath(url: URL) { + if (url.protocol === "data") return url.href; + if (url.href.indexOf(window.location.origin) === -1) return Utils.CorsProxy(url.href); + if (!/\.(png|jpg|jpeg|gif|webp)$/.test(url.href.toLowerCase())) return url.href;//Why is this here + + const ext = path.extname(url.href); + return url.href.replace(ext, "_o" + path.extname(url.href)); + } + + render() { + const field = Cast(this._rowDoc[this.renderFieldKey], ImageField, null); // retrieve the primary image URL that is being rendered from the data doc + const alts = DocListCast(this._rowDoc[this.renderFieldKey + "-alternates"]); // retrieve alternate documents that may be rendered as alternate images + const altpaths = alts.map(doc => Cast(doc[Doc.LayoutFieldKey(doc)], ImageField, null)?.url).filter(url => url).map(url => this.choosePath(url)); // access the primary layout data of the alternate documents + const paths = field ? [this.choosePath(field.url), ...altpaths] : altpaths; + const url = paths.length ? paths : [Utils.CorsProxy("http://www.cs.brown.edu/~bcz/noImage.png")]; + + const aspect = Doc.NativeAspect(this._rowDoc); + let width = Math.min(75, this.props.rowProps.width); + const height = Math.min(75, width / aspect); + width = height * aspect; + + const reference = React.createRef(); + return
+
+ +
+
; + } +} + + +@observer +export class CollectionSchemaListCell extends CollectionSchemaCell { + _overlayDisposer?: () => void; + + @computed get _field() { return this._rowDoc[this.renderFieldKey]; } + @computed get _optionsList() { return this._field as List; } + @observable private _opened = false; + @observable private _text = "select an item"; + @observable private _selectedNum = 0; + + @action + onSetValue = (value: string) => { + // change if its a document + this._optionsList[this._selectedNum] = this._text = value; + + (this._field as List).splice(this._selectedNum, 1, value); + } + + @action + onSelected = (element: string, index: number) => { + this._text = element; + this._selectedNum = index; + } + + onFocus = () => { + this._overlayDisposer?.(); + this._overlayDisposer = OverlayView.Instance.addElement(, { x: 0, y: 0 }); + } + + render() { + const link = false; + const reference = React.createRef(); + + if (this._optionsList?.length) { + const options = !this._opened ? (null) : +
+ {this._optionsList.map((element, index) => { + const val = Field.toString(element); + return
this.onSelected(StrCast(element), index)} > + {val} +
; + })} +
; + + const plainText =
{this._text}
; + const textarea =
+ this._text} + SetValue={action((value: string) => { + // add special for params + this.onSetValue(value); + return true; + })} + /> +
; + + //☰ + return ( +
+
+
+ +
{link ? plainText : textarea}
+
+ {options} +
+
+ ); + } + return this.renderCellWithType("list"); + } +} + + +@observer +export class CollectionSchemaCheckboxCell extends CollectionSchemaCell { + @computed get _isChecked() { return BoolCast(this._rowDoc[this.renderFieldKey]); } + + render() { + const reference = React.createRef(); + return ( +
+ this._rowDoc[this.renderFieldKey] = e.target.checked} /> +
+ ); + } +} + + +@observer +export class CollectionSchemaButtons extends CollectionSchemaCell { + render() { + return !this.props.Document._searchDoc || ![DocumentType.PDF, DocumentType.RTF].includes(StrCast(this._rowDoc.type) as DocumentType) ? <> : +
+ + +
; + } +} \ No newline at end of file diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx new file mode 100644 index 000000000..b2115b22e --- /dev/null +++ b/src/client/views/collections/collectionSchema/CollectionSchemaHeaders.tsx @@ -0,0 +1,518 @@ +import React = require("react"); +import { IconProp, library } from "@fortawesome/fontawesome-svg-core"; +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { action, computed, observable, runInAction } from "mobx"; +import { observer } from "mobx-react"; +import { Doc, DocListCast, Opt } from "../../../../fields/Doc"; +import { listSpec } from "../../../../fields/Schema"; +import { PastelSchemaPalette, SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; +import { ScriptField } from "../../../../fields/ScriptField"; +import { Cast, StrCast } from "../../../../fields/Types"; +import { undoBatch } from "../../../util/UndoManager"; +import { SearchBox } from "../../search/SearchBox"; +import { ColumnType } from "./CollectionSchemaView"; +import "./CollectionSchemaView.scss"; +import { CollectionView } from "../CollectionView"; + +const higflyout = require("@hig/flyout"); +export const { anchorPoints } = higflyout; +export const Flyout = higflyout.default; + + +export interface AddColumnHeaderProps { + createColumn: () => void; +} + +@observer +export class CollectionSchemaAddColumnHeader extends React.Component { + render() { + return ( + + ); + } +} + + +export interface ColumnMenuProps { + columnField: SchemaHeaderField; + // keyValue: string; + possibleKeys: string[]; + existingKeys: string[]; + // keyType: ColumnType; + typeConst: boolean; + menuButtonContent: JSX.Element; + addNew: boolean; + onSelect: (oldKey: string, newKey: string, addnew: boolean) => void; + setIsEditing: (isEditing: boolean) => void; + deleteColumn: (column: string) => void; + onlyShowOptions: boolean; + setColumnType: (column: SchemaHeaderField, type: ColumnType) => void; + setColumnSort: (column: SchemaHeaderField, desc: boolean | undefined) => void; + anchorPoint?: any; + setColumnColor: (column: SchemaHeaderField, color: string) => void; +} +@observer +export class CollectionSchemaColumnMenu extends React.Component { + @observable private _isOpen: boolean = false; + @observable private _node: HTMLDivElement | null = null; + + componentDidMount() { document.addEventListener("pointerdown", this.detectClick); } + + componentWillUnmount() { document.removeEventListener("pointerdown", this.detectClick); } + + @action + detectClick = (e: PointerEvent) => { + !this._node?.contains(e.target as Node) && this.props.setIsEditing(this._isOpen = false); + } + + @action + toggleIsOpen = (): void => { + this.props.setIsEditing(this._isOpen = !this._isOpen); + } + + changeColumnType = (type: ColumnType) => { + this.props.setColumnType(this.props.columnField, type); + } + + changeColumnSort = (desc: boolean | undefined) => { + this.props.setColumnSort(this.props.columnField, desc); + } + + changeColumnColor = (color: string) => { + this.props.setColumnColor(this.props.columnField, color); + } + + @action + setNode = (node: HTMLDivElement): void => { + if (node) { + this._node = node; + } + } + + renderTypes = () => { + if (this.props.typeConst) return (null); + + const type = this.props.columnField.type; + return ( +
+ +
+
this.changeColumnType(ColumnType.Any)}> + + Any +
+
this.changeColumnType(ColumnType.Number)}> + + Number +
+
this.changeColumnType(ColumnType.String)}> + + Text +
+
this.changeColumnType(ColumnType.Boolean)}> + + Checkbox +
+
this.changeColumnType(ColumnType.List)}> + + List +
+
this.changeColumnType(ColumnType.Doc)}> + + Document +
+
this.changeColumnType(ColumnType.Image)}> + + Image +
+
this.changeColumnType(ColumnType.Date)}> + + Date +
+
+
+ ); + } + + renderSorting = () => { + const sort = this.props.columnField.desc; + return ( +
+ +
+
this.changeColumnSort(true)}> + + Sort descending +
+
this.changeColumnSort(false)}> + + Sort ascending +
+
this.changeColumnSort(undefined)}> + + Clear sorting +
+
+
+ ); + } + + renderColors = () => { + const selected = this.props.columnField.color; + + const pink = PastelSchemaPalette.get("pink2"); + const purple = PastelSchemaPalette.get("purple2"); + const blue = PastelSchemaPalette.get("bluegreen1"); + const yellow = PastelSchemaPalette.get("yellow4"); + const red = PastelSchemaPalette.get("red2"); + const gray = "#f1efeb"; + + return ( +
+ +
+
this.changeColumnColor(pink!)}>
+
this.changeColumnColor(purple!)}>
+
this.changeColumnColor(blue!)}>
+
this.changeColumnColor(yellow!)}>
+
this.changeColumnColor(red!)}>
+
this.changeColumnColor(gray)}>
+
+
+ ); + } + + renderContent = () => { + return ( +
+ {this.props.onlyShowOptions ? <> : + <> + {this.renderTypes()} + {this.renderSorting()} + {this.renderColors()} +
+ +
+ + } +
+ ); + } + + render() { + return ( +
+ +
this.toggleIsOpen()}>{this.props.menuButtonContent}
+ +
+ ); + } +} + + +export interface KeysDropdownProps { + keyValue: string; + possibleKeys: string[]; + existingKeys: string[]; + canAddNew: boolean; + addNew: boolean; + onSelect: (oldKey: string, newKey: string, addnew: boolean, filter?: string) => void; + setIsEditing: (isEditing: boolean) => void; + width?: string; + docs?: Doc[]; + Document: Doc; + dataDoc: Doc | undefined; + fieldKey: string; + ContainingCollectionDoc: Doc | undefined; + ContainingCollectionView: Opt; + active?: (outsideReaction?: boolean) => boolean; + openHeader: (column: any, screenx: number, screeny: number) => void; + col: SchemaHeaderField; + icon: IconProp; +} +@observer +export class KeysDropdown extends React.Component { + @observable private _key: string = this.props.keyValue; + @observable private _searchTerm: string = this.props.keyValue; + @observable private _isOpen: boolean = false; + @observable private _node: HTMLDivElement | null = null; + @observable private _inputRef: React.RefObject = React.createRef(); + + @action setSearchTerm = (value: string): void => { this._searchTerm = value; }; + @action setKey = (key: string): void => { this._key = key; }; + @action setIsOpen = (isOpen: boolean): void => { this._isOpen = isOpen; }; + + @action + onSelect = (key: string): void => { + this.props.onSelect(this._key, key, this.props.addNew); + this.setKey(key); + this._isOpen = false; + this.props.setIsEditing(false); + } + + @action + setNode = (node: HTMLDivElement): void => { + if (node) { + this._node = node; + } + } + + componentDidMount() { + document.addEventListener("pointerdown", this.detectClick); + const filters = Cast(this.props.Document._docFilters, listSpec("string")); + if (filters?.some(filter => filter.split(":")[0] === this._key)) { + runInAction(() => this.closeResultsVisibility = "contents"); + } + } + + @action + detectClick = (e: PointerEvent): void => { + if (this._node && this._node.contains(e.target as Node)) { + } else { + this._isOpen = false; + this.props.setIsEditing(false); + } + } + + private tempfilter: string = ""; + @undoBatch + onKeyDown = (e: React.KeyboardEvent): void => { + if (e.key === "Enter") { + if (this._searchTerm.includes(":")) { + const colpos = this._searchTerm.indexOf(":"); + const temp = this._searchTerm.slice(colpos + 1, this._searchTerm.length); + if (temp === "") { + Doc.setDocFilter(this.props.Document, this._key, this.tempfilter, "remove"); + this.updateFilter(); + } + else { + Doc.setDocFilter(this.props.Document, this._key, this.tempfilter, "remove"); + this.tempfilter = temp; + Doc.setDocFilter(this.props.Document, this._key, temp, "check"); + this.props.col.setColor("green"); + this.closeResultsVisibility = "contents"; + } + } + else { + Doc.setDocFilter(this.props.Document, this._key, this.tempfilter, "remove"); + this.updateFilter(); + if (this.showKeys.length) { + this.onSelect(this.showKeys[0]); + } else if (this._searchTerm !== "" && this.props.canAddNew) { + this.setSearchTerm(this._searchTerm || this._key); + this.onSelect(this._searchTerm); + } + } + } + } + + onChange = (val: string): void => { + this.setSearchTerm(val); + } + + @action + onFocus = (e: React.FocusEvent): void => { + this._isOpen = true; + this.props.setIsEditing(true); + } + + @computed get showKeys() { + const whitelistKeys = ["context", "author", "*lastModified", "text", "data", "tags", "creationDate"]; + const keyOptions = this._searchTerm === "" ? this.props.possibleKeys : this.props.possibleKeys.filter(key => key.toUpperCase().indexOf(this._searchTerm.toUpperCase()) > -1); + const showKeys = new Set(); + [...keyOptions, ...whitelistKeys].forEach(key => (!Doc.UserDoc().noviceMode || + whitelistKeys.includes(key) + || ((!key.startsWith("_") && key[0] === key[0].toUpperCase()) || key[0] === "#")) ? showKeys.add(key) : null); + return Array.from(showKeys.keys()).filter(key => !this._searchTerm || key.includes(this._searchTerm)); + } + @action + renderOptions = (): JSX.Element[] | JSX.Element => { + if (!this._isOpen) { + this.defaultMenuHeight = 0; + return <>; + } + const options = this.showKeys.map(key => { + return
{ + e.stopPropagation(); + }} + onClick={() => { + this.onSelect(key); + this.setSearchTerm(""); + }}>{key}
; + }); + + // if search term does not already exist as a group type, give option to create new group type + + if (this._key !== this._searchTerm.slice(0, this._key.length)) { + if (this._searchTerm !== "" && this.props.canAddNew) { + options.push(
{ this.onSelect(this._searchTerm); this.setSearchTerm(""); }}> + Create "{this._searchTerm}" key
); + } + } + + if (options.length === 0) { + this.defaultMenuHeight = 0; + } + else { + if (this.props.docs) { + const panesize = this.props.docs.length * 30; + options.length * 20 + 8 - 10 > panesize ? this.defaultMenuHeight = panesize : this.defaultMenuHeight = options.length * 20 + 8; + } + else { + options.length > 5 ? this.defaultMenuHeight = 108 : this.defaultMenuHeight = options.length * 20 + 8; + } + } + return options; + } + + docSafe: Doc[] = []; + + @action + renderFilterOptions = (): JSX.Element[] | JSX.Element => { + if (!this._isOpen || !this.props.dataDoc) { + this.defaultMenuHeight = 0; + return <>; + } + const keyOptions: string[] = []; + const colpos = this._searchTerm.indexOf(":"); + const temp = this._searchTerm.slice(colpos + 1, this._searchTerm.length); + if (this.docSafe.length === 0) { + this.docSafe = DocListCast(this.props.dataDoc[this.props.fieldKey]); + } + const docs = this.docSafe; + docs.forEach((doc) => { + const key = StrCast(doc[this._key]); + if (keyOptions.includes(key) === false && key.includes(temp) && key !== "") { + keyOptions.push(key); + } + }); + + const filters = Cast(this.props.Document._docFilters, listSpec("string")); + if (filters === undefined || filters.length === 0 || filters.some(filter => filter.split(":")[0] === this._key) === false) { + this.props.col.setColor("rgb(241, 239, 235)"); + this.closeResultsVisibility = "none"; + } + for (let i = 0; i < (filters?.length ?? 0) - 1; i++) { + if (filters![i] === this.props.col.heading && keyOptions.includes(filters![i].split(":")[1]) === false) { + keyOptions.push(filters![i + 1]); + } + } + const options = keyOptions.map(key => { + let bool = false; + if (filters !== undefined) { + const ind = filters.findIndex(filter => filter.split(":")[0] === key); + const fields = ind === -1 ? undefined : filters[ind].split(":"); + bool = fields ? fields[1] === "check" : false; + } + return
+ e.stopPropagation()} + onClick={e => e.stopPropagation()} + onChange={(e) => { + e.target.checked === true ? Doc.setDocFilter(this.props.Document, this._key, key, "check") : Doc.setDocFilter(this.props.Document, this._key, key, "remove"); + e.target.checked === true ? this.closeResultsVisibility = "contents" : console.log(""); + e.target.checked === true ? this.props.col.setColor("green") : this.updateFilter(); + e.target.checked === true && SearchBox.Instance.filter === true ? Doc.setDocFilter(docs[0], this._key, key, "check") : Doc.setDocFilter(docs[0], this._key, key, "remove"); + }} + checked={bool} + /> + + {key} + + +
; + }); + if (options.length === 0) { + this.defaultMenuHeight = 0; + } + else { + if (this.props.docs) { + const panesize = this.props.docs.length * 30; + options.length * 20 + 8 - 10 > panesize ? this.defaultMenuHeight = panesize : this.defaultMenuHeight = options.length * 20 + 8; + } + else { + options.length > 5 ? this.defaultMenuHeight = 108 : this.defaultMenuHeight = options.length * 20 + 8; + } + + } + return options; + } + + @observable defaultMenuHeight = 0; + + + updateFilter() { + const filters = Cast(this.props.Document._docFilters, listSpec("string")); + if (filters === undefined || filters.length === 0 || filters.some(filter => filter.split(":")[0] === this._key) === false) { + this.props.col.setColor("rgb(241, 239, 235)"); + this.closeResultsVisibility = "none"; + } + } + + @computed get scriptField() { + const scriptText = "setDocFilter(containingTreeView, heading, this.title, checked)"; + const script = ScriptField.MakeScript(scriptText, { this: Doc.name, heading: "string", checked: "string", containingTreeView: Doc.name }); + return script ? () => script : undefined; + } + filterBackground = () => "rgba(105, 105, 105, 0.432)"; + @observable filterOpen: boolean | undefined = undefined; + closeResultsVisibility: string = "none"; + + removeFilters = (e: React.PointerEvent): void => { + const keyOptions: string[] = []; + if (this.docSafe.length === 0 && this.props.dataDoc) { + this.docSafe = DocListCast(this.props.dataDoc[this.props.fieldKey]); + } + const docs = this.docSafe; + docs.forEach((doc) => { + const key = StrCast(doc[this._key]); + if (keyOptions.includes(key) === false) { + keyOptions.push(key); + } + }); + + Doc.setDocFilter(this.props.Document, this._key, "", "remove"); + this.props.col.setColor("rgb(241, 239, 235)"); + this.closeResultsVisibility = "none"; + } + render() { + return ( +
+ { this.props.openHeader(this.props.col, e.clientX, e.clientY); e.stopPropagation(); }} icon={this.props.icon} size="lg" style={{ display: "inline", paddingBottom: "1px", paddingTop: "4px", cursor: "hand" }} /> + + {/* { + runInAction(() => { this._isOpen === undefined ? this._isOpen = true : this._isOpen = !this._isOpen }) + }} /> */} + +
+ this.onChange(e.target.value)} + onClick={(e) => { e.stopPropagation(); this._inputRef.current?.focus(); }} + onFocus={this.onFocus} > +
+ +
+ {!this._isOpen ? (null) :
+ {this._searchTerm.includes(":") ? this.renderFilterOptions() : this.renderOptions()} +
} +
+
+ ); + } +} diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaMovableColumn.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaMovableColumn.tsx new file mode 100644 index 000000000..456c38c68 --- /dev/null +++ b/src/client/views/collections/collectionSchema/CollectionSchemaMovableColumn.tsx @@ -0,0 +1,128 @@ +import React = require("react"); +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { action } from "mobx"; +import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table"; +import { Doc } from "../../../../fields/Doc"; +import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; +import { Cast, FieldValue, StrCast } from "../../../../fields/Types"; +import { DocumentManager } from "../../../util/DocumentManager"; +import { DragManager, dropActionType, SetupDrag } from "../../../util/DragManager"; +import { SnappingManager } from "../../../util/SnappingManager"; +import { Transform } from "../../../util/Transform"; +import { undoBatch } from "../../../util/UndoManager"; +import { ContextMenu } from "../../ContextMenu"; +import "./CollectionSchemaView.scss"; + +export interface MovableColumnProps { + columnRenderer: TableCellRenderer; + columnValue: SchemaHeaderField; + allColumns: SchemaHeaderField[]; + reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columns: SchemaHeaderField[]) => void; + ScreenToLocalTransform: () => Transform; +} +export class MovableColumn extends React.Component { + private _header?: React.RefObject = React.createRef(); + private _colDropDisposer?: DragManager.DragDropDisposer; + private _startDragPosition: { x: number, y: number } = { x: 0, y: 0 }; + private _sensitivity: number = 16; + private _dragRef: React.RefObject = React.createRef(); + + onPointerEnter = (e: React.PointerEvent): void => { + if (e.buttons === 1 && SnappingManager.GetIsDragging()) { + this._header!.current!.className = "collectionSchema-col-wrapper"; + document.addEventListener("pointermove", this.onDragMove, true); + } + } + onPointerLeave = (e: React.PointerEvent): void => { + this._header!.current!.className = "collectionSchema-col-wrapper"; + document.removeEventListener("pointermove", this.onDragMove, true); + !e.buttons && document.removeEventListener("pointermove", this.onPointerMove); + } + onDragMove = (e: PointerEvent): void => { + const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top); + const before = x[0] < bounds[0]; + this._header!.current!.className = "collectionSchema-col-wrapper"; + if (before) this._header!.current!.className += " col-before"; + if (!before) this._header!.current!.className += " col-after"; + e.stopPropagation(); + } + + createColDropTarget = (ele: HTMLDivElement) => { + this._colDropDisposer?.(); + if (ele) { + this._colDropDisposer = DragManager.MakeDropTarget(ele, this.colDrop.bind(this)); + } + } + + colDrop = (e: Event, de: DragManager.DropEvent) => { + document.removeEventListener("pointermove", this.onDragMove, true); + const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top); + const before = x[0] < bounds[0]; + const colDragData = de.complete.columnDragData; + if (colDragData) { + e.stopPropagation(); + this.props.reorderColumns(colDragData.colKey, this.props.columnValue, before, this.props.allColumns); + return true; + } + return false; + } + + onPointerMove = (e: PointerEvent) => { + const onRowMove = (e: PointerEvent) => { + e.stopPropagation(); + e.preventDefault(); + + document.removeEventListener("pointermove", onRowMove); + document.removeEventListener('pointerup', onRowUp); + const dragData = new DragManager.ColumnDragData(this.props.columnValue); + DragManager.StartColumnDrag(this._dragRef.current!, dragData, e.x, e.y); + }; + const onRowUp = (): void => { + document.removeEventListener("pointermove", onRowMove); + document.removeEventListener('pointerup', onRowUp); + }; + if (e.buttons === 1) { + const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX - this._startDragPosition.x, e.clientY - this._startDragPosition.y); + if (Math.abs(dx) + Math.abs(dy) > this._sensitivity) { + document.removeEventListener("pointermove", this.onPointerMove); + e.stopPropagation(); + + document.addEventListener("pointermove", onRowMove); + document.addEventListener("pointerup", onRowUp); + } + } + } + + onPointerUp = (e: React.PointerEvent) => { + document.removeEventListener("pointermove", this.onPointerMove); + } + + @action + onPointerDown = (e: React.PointerEvent, ref: React.RefObject) => { + this._dragRef = ref; + const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX, e.clientY); + if (!(e.target as any)?.tagName.includes("INPUT")) { + this._startDragPosition = { x: dx, y: dy }; + document.addEventListener("pointermove", this.onPointerMove); + } + } + + + render() { + const reference = React.createRef(); + + return ( +
+
+
this.onPointerDown(e, reference)} onPointerUp={this.onPointerUp}> + {this.props.columnRenderer} +
+
+
+ ); + } +} diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx new file mode 100644 index 000000000..f48906ba5 --- /dev/null +++ b/src/client/views/collections/collectionSchema/CollectionSchemaMovableRow.tsx @@ -0,0 +1,147 @@ +import React = require("react"); +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { action } from "mobx"; +import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table"; +import { Doc } from "../../../../fields/Doc"; +import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; +import { Cast, FieldValue, StrCast } from "../../../../fields/Types"; +import { DocumentManager } from "../../../util/DocumentManager"; +import { DragManager, dropActionType, SetupDrag } from "../../../util/DragManager"; +import { SnappingManager } from "../../../util/SnappingManager"; +import { Transform } from "../../../util/Transform"; +import { undoBatch } from "../../../util/UndoManager"; +import { ContextMenu } from "../../ContextMenu"; +import "./CollectionSchemaView.scss"; + +export interface MovableRowProps { + rowInfo: RowInfo; + ScreenToLocalTransform: () => Transform; + addDoc: (doc: Doc | Doc[], relativeTo?: Doc, before?: boolean) => boolean; + removeDoc: (doc: Doc | Doc[]) => boolean; + rowFocused: boolean; + textWrapRow: (doc: Doc) => void; + rowWrapped: boolean; + dropAction: string; + addDocTab: any; +} + +export class MovableRow extends React.Component { + private _header?: React.RefObject = React.createRef(); + private _rowDropDisposer?: DragManager.DragDropDisposer; + + // Event listeners are only necessary when the user is hovering over the table + // Create one when the mouse starts hovering... + onPointerEnter = (e: React.PointerEvent): void => { + if (e.buttons === 1 && SnappingManager.GetIsDragging()) { + this._header!.current!.className = "collectionSchema-row-wrapper"; + document.addEventListener("pointermove", this.onDragMove, true); + } + } + // ... and delete it when the mouse leaves + onPointerLeave = (e: React.PointerEvent): void => { + this._header!.current!.className = "collectionSchema-row-wrapper"; + document.removeEventListener("pointermove", this.onDragMove, true); + } + // The method for the event listener, reorders columns when dragged to their new locations. + onDragMove = (e: PointerEvent): void => { + const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); + const before = x[1] < bounds[1]; + this._header!.current!.className = "collectionSchema-row-wrapper"; + if (before) this._header!.current!.className += " row-above"; + if (!before) this._header!.current!.className += " row-below"; + e.stopPropagation(); + } + componentWillUnmount() { + + this._rowDropDisposer?.(); + } + // + createRowDropTarget = (ele: HTMLDivElement) => { + this._rowDropDisposer?.(); + if (ele) { + this._rowDropDisposer = DragManager.MakeDropTarget(ele, this.rowDrop.bind(this)); + } + } + // Controls what hppens when a row is dragged and dropped + rowDrop = (e: Event, de: DragManager.DropEvent) => { + this.onPointerLeave(e as any); + const rowDoc = FieldValue(Cast(this.props.rowInfo.original, Doc)); + if (!rowDoc) return false; + + const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); + const rect = this._header!.current!.getBoundingClientRect(); + const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); + const before = x[1] < bounds[1]; + + const docDragData = de.complete.docDragData; + if (docDragData) { + e.stopPropagation(); + if (docDragData.draggedDocuments[0] === rowDoc) return true; + const addDocument = (doc: Doc | Doc[]) => this.props.addDoc(doc, rowDoc, before); + const movedDocs = docDragData.draggedDocuments; + return (docDragData.dropAction || docDragData.userDropAction) ? + docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before) || added, false) + : (docDragData.moveDocument) ? + movedDocs.reduce((added: boolean, d) => docDragData.moveDocument?.(d, rowDoc, addDocument) || added, false) + : docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before), false); + } + return false; + } + + onRowContextMenu = (e: React.MouseEvent): void => { + const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row"; + ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" }); + } + + @undoBatch + @action + move: DragManager.MoveFunction = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc) => { + const targetView = targetCollection && DocumentManager.Instance.getDocumentView(targetCollection); + return doc !== targetCollection && doc !== targetView?.props.ContainingCollectionDoc && this.props.removeDoc(doc) && addDoc(doc); + } + + @action + onKeyDown = (e: React.KeyboardEvent) => { + console.log("yes"); + if (e.key === "Backspace" || e.key === "Delete") { + undoBatch(() => this.props.removeDoc(this.props.rowInfo.original)); + } + } + + render() { + const { children = null, rowInfo } = this.props; + + if (!rowInfo) { + return {children}; + } + + const { original } = rowInfo; + const doc = FieldValue(Cast(original, Doc)); + + if (!doc) return (null); + + const reference = React.createRef(); + const onItemDown = SetupDrag(reference, () => doc, this.move, StrCast(this.props.dropAction) as dropActionType); + + let className = "collectionSchema-row"; + if (this.props.rowFocused) className += " row-focused"; + if (this.props.rowWrapped) className += " row-wrapped"; + + return ( +
+
+ +
+
this.props.removeDoc(this.props.rowInfo.original))}>
+
+
this.props.addDocTab(this.props.rowInfo.original, "add:right")}>
+
+ {children} +
+
+
+ ); + } +} \ No newline at end of file diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaView.scss b/src/client/views/collections/collectionSchema/CollectionSchemaView.scss new file mode 100644 index 000000000..b57fee0e4 --- /dev/null +++ b/src/client/views/collections/collectionSchema/CollectionSchemaView.scss @@ -0,0 +1,552 @@ +@import "../../globalCssVariables"; +.collectionSchemaView-container { + border-width: $COLLECTION_BORDER_WIDTH; + border-color: $intermediate-color; + border-style: solid; + border-radius: $border-radius; + box-sizing: border-box; + position: relative; + top: 0; + width: 100%; + height: 100%; + margin-top: 0; + transition: top 0.5s; + display: flex; + justify-content: space-between; + flex-wrap: nowrap; + touch-action: none; + div { + touch-action: none; + } + .collectionSchemaView-tableContainer { + width: 100%; + height: 100%; + } + .collectionSchemaView-dividerDragger { + position: relative; + height: 100%; + width: $SCHEMA_DIVIDER_WIDTH; + z-index: 20; + right: 0; + top: 0; + background: gray; + cursor: col-resize; + } + // .documentView-node:first-child { + // background: $light-color; + // } +} + +.collectionSchemaView-searchContainer { + border-width: $COLLECTION_BORDER_WIDTH; + border-color: $intermediate-color; + border-style: solid; + border-radius: $border-radius; + box-sizing: border-box; + position: relative; + top: 0; + width: 100%; + height: 100%; + margin-top: 0; + transition: top 0.5s; + display: flex; + justify-content: space-between; + flex-wrap: nowrap; + touch-action: none; + padding: 2px; + div { + touch-action: none; + } + .collectionSchemaView-tableContainer { + width: 100%; + height: 100%; + } + .collectionSchemaView-dividerDragger { + position: relative; + height: 100%; + width: 20px; + z-index: 20; + right: 0; + top: 0; + background: gray; + cursor: col-resize; + } + // .documentView-node:first-child { + // background: $light-color; + // } +} + +.ReactTable { + width: 100%; + background: white; + box-sizing: border-box; + border: none !important; + float: none !important; + .rt-table { + height: 100%; + display: -webkit-inline-box; + direction: ltr; + overflow: visible; + } + .rt-noData { + display: none; + } + .rt-thead { + width: 100%; + z-index: 100; + overflow-y: visible; + &.-header { + font-size: 12px; + height: 30px; + box-shadow: none; + z-index: 100; + overflow-y: visible; + } + .rt-resizable-header-content { + height: 100%; + overflow: visible; + } + .rt-th { + padding: 0; + border: solid lightgray; + border-width: 0 1px; + border-bottom: 2px solid lightgray; + } + } + .rt-th { + font-size: 13px; + text-align: center; + &:last-child { + overflow: visible; + } + } + .rt-tbody { + width: 100%; + direction: rtl; + overflow: visible; + .rt-td { + border-right: 1px solid rgba(0, 0, 0, 0.2); + } + } + .rt-tr-group { + direction: ltr; + flex: 0 1 auto; + min-height: 30px; + border: 0 !important; + } + .rt-tr { + width: 100%; + min-height: 30px; + } + .rt-td { + padding: 0; + font-size: 13px; + text-align: center; + white-space: nowrap; + display: flex; + align-items: center; + .imageBox-cont { + position: relative; + max-height: 100%; + } + .imageBox-cont img { + object-fit: contain; + max-width: 100%; + height: 100%; + } + .videoBox-cont { + object-fit: contain; + width: auto; + height: 100%; + } + } + .rt-td.rt-expandable { + display: flex; + align-items: center; + height: inherit; + } + .rt-resizer { + width: 8px; + right: -4px; + } + .rt-resizable-header { + padding: 0; + height: 30px; + } + .rt-resizable-header:last-child { + overflow: visible; + .rt-resizer { + width: 5px !important; + } + } +} + +.documentView-node-topmost { + text-align: left; + transform-origin: center top; + display: inline-block; +} + +.collectionSchema-col { + height: 100%; +} + +.collectionSchema-header-menu { + height: auto; + z-index: 100; + position: absolute; + background: white; + padding: 5px; + position: fixed; + background: white; + border: black 1px solid; + .collectionSchema-header-toggler { + z-index: 100; + width: 100%; + height: 100%; + padding: 4px; + letter-spacing: 2px; + text-transform: uppercase; + svg { + margin-right: 4px; + } + } +} + +.collectionSchemaView-header { + height: 100%; + color: gray; + z-index: 100; + overflow-y: visible; + display: flex; + justify-content: space-between; + flex-wrap: wrap; +} + +button.add-column { + width: 28px; +} + +.collectionSchema-header-menuOptions { + color: black; + width: 180px; + text-align: left; + .collectionSchema-headerMenu-group { + padding: 7px 0; + border-bottom: 1px solid lightgray; + cursor: pointer; + &:first-child { + padding-top: 0; + } + &:last-child { + border: none; + text-align: center; + padding: 12px 0 0 0; + } + } + label { + color: $main-accent; + font-weight: normal; + letter-spacing: 2px; + text-transform: uppercase; + } + input { + color: black; + width: 100%; + } + .columnMenu-option { + cursor: pointer; + padding: 3px; + background-color: white; + transition: background-color 0.2s; + &:hover { + background-color: $light-color-secondary; + } + &.active { + font-weight: bold; + border: 2px solid $light-color-secondary; + } + svg { + color: gray; + margin-right: 5px; + width: 10px; + } + } + .keys-dropdown { + position: relative; + //width: 100%; + background-color: white; + input { + border: 2px solid $light-color-secondary; + padding: 3px; + height: 28px; + font-weight: bold; + letter-spacing: "2px"; + text-transform: "uppercase"; + &:focus { + font-weight: normal; + } + } + .keys-options-wrapper { + width: 100%; + max-height: 150px; + overflow-y: scroll; + position: absolute; + top: 28px; + box-shadow: 0 10px 16px rgba(0, 0, 0, 0.1); + background-color: white; + .key-option { + background-color: white; + border: 1px solid lightgray; + padding: 2px 3px; + &:not(:first-child) { + border-top: 0; + } + &:hover { + background-color: $light-color-secondary; + } + } + } + } + .columnMenu-colors { + display: flex; + justify-content: space-between; + flex-wrap: wrap; + .columnMenu-colorPicker { + cursor: pointer; + width: 20px; + height: 20px; + border-radius: 10px; + &.active { + border: 2px solid white; + box-shadow: 0 0 0 2px lightgray; + } + } + } +} + +.collectionSchema-row { + height: 100%; + background-color: white; + &.row-focused .rt-td { + background-color: #bfffc0; //$light-color-secondary; + } + &.row-wrapped { + .rt-td { + white-space: normal; + } + } + .row-dragger { + display: flex; + justify-content: space-around; + //flex: 50 0 auto; + width: 0; + max-width: 50px; + //height: 100%; + min-height: 30px; + align-items: center; + color: lightgray; + background-color: white; + transition: color 0.1s ease; + .row-option { + // padding: 5px; + cursor: pointer; + position: absolute; + transition: color 0.1s ease; + display: flex; + flex-direction: column; + justify-content: center; + z-index: 2; + &:hover { + color: gray; + } + } + } + .collectionSchema-row-wrapper { + &.row-above { + border-top: 1px solid red; + } + &.row-below { + border-bottom: 1px solid red; + } + &.row-inside { + border: 1px solid red; + } + .row-dragging { + background-color: blue; + } + } +} + +.collectionSchemaView-cellContainer { + width: 100%; + height: unset; +} + +.collectionSchemaView-cellWrapper { + height: 100%; + padding: 4px; + text-align: left; + padding-left: 19px; + position: relative; + &:focus { + outline: none; + } + &.editing { + padding: 0; + input { + outline: 0; + border: none; + background-color: rgb(255, 217, 217); + width: 100%; + height: 100%; + padding: 2px 3px; + min-height: 26px; + } + } + &.focused { + &.inactive { + border: none; + } + } + p { + width: 100%; + height: 100%; + } + &:hover .collectionSchemaView-cellContents-docExpander { + display: block; + } + .collectionSchemaView-cellContents-document { + display: inline-block; + } + .collectionSchemaView-cellContents-docButton { + float: right; + width: "15px"; + height: "15px"; + } + .collectionSchemaView-dropdownWrapper { + border: grey; + border-style: solid; + border-width: 1px; + height: 30px; + .collectionSchemaView-dropdownButton { + //display: inline-block; + float: left; + height: 100%; + } + .collectionSchemaView-dropdownText { + display: inline-block; + //float: right; + height: 100%; + display: "flex"; + font-size: 13; + justify-content: "center"; + align-items: "center"; + } + } + .collectionSchemaView-dropdownContainer { + position: absolute; + border: 1px solid rgba(0, 0, 0, 0.04); + box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14); + .collectionSchemaView-dropdownOption:hover { + background-color: rgba(0, 0, 0, 0.14); + cursor: pointer; + } + } +} + +.collectionSchemaView-cellContents-docExpander { + height: 30px; + width: 30px; + display: none; + position: absolute; + top: 0; + right: 0; + background-color: lightgray; +} + +.doc-drag-over { + background-color: red; +} + +.collectionSchemaView-toolbar { + z-index: 100; +} + +.collectionSchemaView-toolbar { + height: 30px; + display: flex; + justify-content: flex-end; + padding: 0 10px; + border-bottom: 2px solid gray; + .collectionSchemaView-toolbar-item { + display: flex; + flex-direction: column; + justify-content: center; + } +} + +#preview-schema-checkbox-div { + margin-left: 20px; + font-size: 12px; +} + +.collectionSchemaView-table { + width: 100%; + height: 100%; + overflow: auto; + padding: 3px; +} + +.rt-td.rt-expandable { + overflow: visible; + position: relative; + height: 100%; + z-index: 1; +} + +.reactTable-sub { + background-color: rgb(252, 252, 252); + width: 100%; + .rt-thead { + display: none; + } + .row-dragger { + background-color: rgb(252, 252, 252); + } + .rt-table { + background-color: rgb(252, 252, 252); + } + .collectionSchemaView-table { + width: 100%; + border: solid 1px; + overflow: visible; + padding: 0px; + } +} + +.collectionSchemaView-expander { + height: 100%; + min-height: 30px; + position: absolute; + color: gray; + width: 20; + height: auto; + left: 55; + svg { + position: absolute; + top: 50%; + left: 10; + transform: translate(-50%, -50%); + } +} + +.collectionSchemaView-addRow { + color: gray; + letter-spacing: 2px; + text-transform: uppercase; + cursor: pointer; + font-size: 10.5px; + margin-left: 50px; + margin-top: 10px; +} \ No newline at end of file diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx new file mode 100644 index 000000000..ef28f75c8 --- /dev/null +++ b/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx @@ -0,0 +1,575 @@ +import React = require("react"); +import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; +import { action, computed, observable, untracked } from "mobx"; +import { observer } from "mobx-react"; +import Measure from "react-measure"; +import { Resize } from "react-table"; +import "react-table/react-table.css"; +import { Doc, Opt } from "../../../../fields/Doc"; +import { List } from "../../../../fields/List"; +import { listSpec } from "../../../../fields/Schema"; +import { PastelSchemaPalette, SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; +import { Cast, NumCast } from "../../../../fields/Types"; +import { TraceMobx } from "../../../../fields/util"; +import { emptyFunction, emptyPath, returnFalse, setupMoveUpEvents, returnEmptyDoclist, returnTrue } from "../../../../Utils"; +import { SelectionManager } from "../../../util/SelectionManager"; +import { SnappingManager } from "../../../util/SnappingManager"; +import { Transform } from "../../../util/Transform"; +import { undoBatch } from "../../../util/UndoManager"; +import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../globalCssVariables.scss'; +import { ContextMenu } from "../../ContextMenu"; +import { ContextMenuProps } from "../../ContextMenuItem"; +import '../../../views/DocumentDecorations.scss'; +import { DocumentView } from "../../nodes/DocumentView"; +import { DefaultStyleProvider } from "../../StyleProvider"; +import "./CollectionSchemaView.scss"; +import { CollectionSubView } from "../CollectionSubView"; +import { SchemaTable } from "./SchemaTable"; +import { DocUtils } from "../../../documents/Documents"; +// bcz: need to add drag and drop of rows and columns. This seems like it might work for rows: https://codesandbox.io/s/l94mn1q657 + +export enum ColumnType { + Any, + Number, + String, + Boolean, + Doc, + Image, + List, + Date +} +// this map should be used for keys that should have a const type of value +const columnTypes: Map = new Map([ + ["title", ColumnType.String], + ["x", ColumnType.Number], ["y", ColumnType.Number], ["_width", ColumnType.Number], ["_height", ColumnType.Number], + ["_nativeWidth", ColumnType.Number], ["_nativeHeight", ColumnType.Number], ["isPrototype", ColumnType.Boolean], + ["_curPage", ColumnType.Number], ["_currentTimecode", ColumnType.Number], ["zIndex", ColumnType.Number] +]); + +@observer +export class CollectionSchemaView extends CollectionSubView(doc => doc) { + private _previewCont?: HTMLDivElement; + + @observable _previewDoc: Doc | undefined = undefined; + @observable _focusedTable: Doc = this.props.Document; + @observable _col: any = ""; + @observable _menuWidth = 0; + @observable _headerOpen = false; + @observable _headerIsEditing = false; + @observable _menuHeight = 0; + @observable _pointerX = 0; + @observable _pointerY = 0; + @observable _openTypes: boolean = false; + + @computed get previewWidth() { return () => NumCast(this.props.Document.schemaPreviewWidth); } + @computed get previewHeight() { return () => this.props.PanelHeight() - 2 * this.borderWidth; } + @computed get tableWidth() { return this.props.PanelWidth() - 2 * this.borderWidth - Number(SCHEMA_DIVIDER_WIDTH) - this.previewWidth(); } + @computed get borderWidth() { return Number(COLLECTION_BORDER_WIDTH); } + @computed get scale() { return this.props.ScreenToLocalTransform().Scale; } + @computed get columns() { return Cast(this.props.Document._schemaHeaders, listSpec(SchemaHeaderField), []); } + set columns(columns: SchemaHeaderField[]) { this.props.Document._schemaHeaders = new List(columns); } + + @computed get menuCoordinates() { + let searchx = 0; + let searchy = 0; + if (this.props.Document._searchDoc) { + const el = document.getElementsByClassName("collectionSchemaView-searchContainer")[0]; + if (el !== undefined) { + const rect = el.getBoundingClientRect(); + searchx = rect.x; + searchy = rect.y; + } + } + const x = Math.max(0, Math.min(document.body.clientWidth - this._menuWidth, this._pointerX)) - searchx; + const y = Math.max(0, Math.min(document.body.clientHeight - this._menuHeight, this._pointerY)) - searchy; + return this.props.ScreenToLocalTransform().transformPoint(x, y); + } + + get documentKeys() { + const docs = this.childDocs; + const keys: { [key: string]: boolean } = {}; + // bcz: ugh. this is untracked since otherwise a large collection of documents will blast the server for all their fields. + // then as each document's fields come back, we update the documents _proxies. Each time we do this, the whole schema will be + // invalidated and re-rendered. This workaround will inquire all of the document fields before the options button is clicked. + // then by the time the options button is clicked, all of the fields should be in place. If a new field is added while this menu + // is displayed (unlikely) it won't show up until something else changes. + //TODO Types + untracked(() => docs.map(doc => Doc.GetAllPrototypes(doc).map(proto => Object.keys(proto).forEach(key => keys[key] = false)))); + + this.columns.forEach(key => keys[key.heading] = true); + return Array.from(Object.keys(keys)); + } + + @action setHeaderIsEditing = (isEditing: boolean) => this._headerIsEditing = isEditing; + + @undoBatch + setColumnType = action((columnField: SchemaHeaderField, type: ColumnType): void => { + this._openTypes = false; + if (columnTypes.get(columnField.heading)) return; + + const columns = this.columns; + const index = columns.indexOf(columnField); + if (index > -1) { + columnField.setType(NumCast(type)); + columns[index] = columnField; + this.columns = columns; + } + }); + + @undoBatch + setColumnColor = (columnField: SchemaHeaderField, color: string): void => { + const columns = this.columns; + const index = columns.indexOf(columnField); + if (index > -1) { + columnField.setColor(color); + columns[index] = columnField; + this.columns = columns; // need to set the columns to trigger rerender + } + } + + @undoBatch + @action + setColumnSort = (columnField: SchemaHeaderField, descending: boolean | undefined) => { + const columns = this.columns; + columns.forEach(col => col.setDesc(undefined)); + + const index = columns.findIndex(c => c.heading === columnField.heading); + const column = columns[index]; + column.setDesc(descending); + columns[index] = column; + this.columns = columns; + } + + renderTypes = (col: any) => { + if (columnTypes.get(col.heading)) return (null); + + const type = col.type; + + const anyType =
this.setColumnType(col, ColumnType.Any)}> + + Any +
; + + const numType =
this.setColumnType(col, ColumnType.Number)}> + + Number +
; + + const textType =
this.setColumnType(col, ColumnType.String)}> + + Text +
; + + const boolType =
this.setColumnType(col, ColumnType.Boolean)}> + + Checkbox +
; + + const listType =
this.setColumnType(col, ColumnType.List)}> + + List +
; + + const docType =
this.setColumnType(col, ColumnType.Doc)}> + + Document +
; + + const imageType =
this.setColumnType(col, ColumnType.Image)}> + + Image +
; + + const dateType =
this.setColumnType(col, ColumnType.Date)}> + + Date +
; + + + const allColumnTypes =
+ {anyType} + {numType} + {textType} + {boolType} + {listType} + {docType} + {imageType} + {dateType} +
; + + const justColType = type === ColumnType.Any ? anyType : type === ColumnType.Number ? numType : + type === ColumnType.String ? textType : type === ColumnType.Boolean ? boolType : + type === ColumnType.List ? listType : type === ColumnType.Doc ? docType : + type === ColumnType.Date ? dateType : imageType; + + return ( +
this._openTypes = !this._openTypes)}> +
+ + +
+ {this._openTypes ? allColumnTypes : justColType} +
+ ); + } + + renderSorting = (col: any) => { + const sort = col.desc; + return ( +
+ +
+
this.setColumnSort(col, true)}> + + Sort descending +
+
this.setColumnSort(col, false)}> + + Sort ascending +
+
this.setColumnSort(col, undefined)}> + + Clear sorting +
+
+
+ ); + } + + renderColors = (col: any) => { + const selected = col.color; + + const pink = PastelSchemaPalette.get("pink2"); + const purple = PastelSchemaPalette.get("purple2"); + const blue = PastelSchemaPalette.get("bluegreen1"); + const yellow = PastelSchemaPalette.get("yellow4"); + const red = PastelSchemaPalette.get("red2"); + const gray = "#f1efeb"; + + return ( +
+ +
+
this.setColumnColor(col, pink!)}>
+
this.setColumnColor(col, purple!)}>
+
this.setColumnColor(col, blue!)}>
+
this.setColumnColor(col, yellow!)}>
+
this.setColumnColor(col, red!)}>
+
this.setColumnColor(col, gray)}>
+
+
+ ); + } + + @undoBatch + @action + changeColumns = (oldKey: string, newKey: string, addNew: boolean, filter?: string) => { + const columns = this.columns; + if (columns === undefined) { + this.columns = new List([new SchemaHeaderField(newKey, "f1efeb")]); + } else { + if (addNew) { + columns.push(new SchemaHeaderField(newKey, "f1efeb")); + this.columns = columns; + } else { + const index = columns.map(c => c.heading).indexOf(oldKey); + if (index > -1) { + const column = columns[index]; + column.setHeading(newKey); + columns[index] = column; + this.columns = columns; + if (filter) { + Doc.setDocFilter(this.props.Document, newKey, filter, "match"); + } + else { + this.props.Document._docFilters = undefined; + } + } + } + } + } + + @action + openHeader = (col: any, screenx: number, screeny: number) => { + this._col = col; + this._headerOpen = true; + this._pointerX = screenx; + this._pointerY = screeny; + } + + @action + closeHeader = () => { this._headerOpen = false; } + + @undoBatch + @action + deleteColumn = (key: string) => { + const columns = this.columns; + if (columns === undefined) { + this.columns = new List([]); + } else { + const index = columns.map(c => c.heading).indexOf(key); + if (index > -1) { + columns.splice(index, 1); + this.columns = columns; + } + } + this.closeHeader(); + } + + getPreviewTransform = (): Transform => { + return this.props.ScreenToLocalTransform().translate(- this.borderWidth - NumCast(COLLECTION_BORDER_WIDTH) - this.tableWidth, - this.borderWidth); + } + + @action + onHeaderClick = (e: React.PointerEvent) => { + e.stopPropagation(); + } + + @action + onWheel(e: React.WheelEvent) { + const scale = this.props.ScreenToLocalTransform().Scale; + this.props.isContentActive(true) && e.stopPropagation(); + } + + @computed get renderMenuContent() { + TraceMobx(); + return
+ {this.renderTypes(this._col)} + {this.renderColors(this._col)} +
+ +
+
; + } + + private createTarget = (ele: HTMLDivElement) => { + this._previewCont = ele; + super.CreateDropTarget(ele); + } + + isFocused = (doc: Doc, outsideReaction: boolean): boolean => this.props.isSelected(outsideReaction) && doc === this._focusedTable; + + @action setFocused = (doc: Doc) => this._focusedTable = doc; + + @action setPreviewDoc = (doc: Opt) => { + SelectionManager.SelectSchemaView(this, doc); + this._previewDoc = doc; + } + + //toggles preview side-panel of schema + @action + toggleExpander = () => { + this.props.Document.schemaPreviewWidth = this.previewWidth() === 0 ? Math.min(this.tableWidth / 3, 200) : 0; + } + + onDividerDown = (e: React.PointerEvent) => { + setupMoveUpEvents(this, e, this.onDividerMove, emptyFunction, this.toggleExpander); + } + @action + onDividerMove = (e: PointerEvent, down: number[], delta: number[]) => { + const nativeWidth = this._previewCont!.getBoundingClientRect(); + const minWidth = 40; + const maxWidth = 1000; + const movedWidth = this.props.ScreenToLocalTransform().transformDirection(nativeWidth.right - e.clientX, 0)[0]; + const width = movedWidth < minWidth ? minWidth : movedWidth > maxWidth ? maxWidth : movedWidth; + this.props.Document.schemaPreviewWidth = width; + return false; + } + + onPointerDown = (e: React.PointerEvent): void => { + if (e.button === 0 && !e.altKey && !e.ctrlKey && !e.metaKey) { + if (this.props.isSelected(true)) e.stopPropagation(); + else this.props.select(false); + } + } + + @computed + get previewDocument(): Doc | undefined { return this._previewDoc; } + + @computed + get dividerDragger() { + return this.previewWidth() === 0 ? (null) : +
+
+
; + } + + @computed + get previewPanel() { + return
+ {!this.previewDocument ? (null) : + } +
; + } + + @computed + get schemaTable() { + return ; + } + + @computed + public get schemaToolbar() { + return
+
+
+ + Show Preview +
+
+
; + } + + onSpecificMenu = (e: React.MouseEvent) => { + if ((e.target as any)?.className?.includes?.("collectionSchemaView-cell") || (e.target instanceof HTMLSpanElement)) { + const cm = ContextMenu.Instance; + const options = cm.findByDescription("Options..."); + const optionItems: ContextMenuProps[] = options && "subitems" in options ? options.subitems : []; + optionItems.push({ description: "remove", event: () => this._previewDoc && this.props.removeDocument?.(this._previewDoc), icon: "trash" }); + !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "compass" }); + cm.displayMenu(e.clientX, e.clientY); + (e.nativeEvent as any).SchemaHandled = true; // not sure why this is needed, but if you right-click quickly on a cell, the Document/Collection contextMenu handlers still fire without this. + e.stopPropagation(); + } + } + + @action + onTableClick = (e: React.MouseEvent): void => { + if (!(e.target as any)?.className?.includes?.("collectionSchemaView-cell") && !(e.target instanceof HTMLSpanElement)) { + this.setPreviewDoc(undefined); + } else { + e.stopPropagation(); + } + this.setFocused(this.props.Document); + this.closeHeader(); + } + + onResizedChange = (newResized: Resize[], event: any) => { + const columns = this.columns; + newResized.forEach(resized => { + const index = columns.findIndex(c => c.heading === resized.id); + const column = columns[index]; + column.setWidth(resized.value); + columns[index] = column; + }); + this.columns = columns; + } + + @action + setColumns = (columns: SchemaHeaderField[]) => this.columns = columns + + @undoBatch + reorderColumns = (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columnsValues: SchemaHeaderField[]) => { + const columns = [...columnsValues]; + const oldIndex = columns.indexOf(toMove); + const relIndex = columns.indexOf(relativeTo); + const newIndex = (oldIndex > relIndex && !before) ? relIndex + 1 : (oldIndex < relIndex && before) ? relIndex - 1 : relIndex; + + if (oldIndex === newIndex) return; + + columns.splice(newIndex, 0, columns.splice(oldIndex, 1)[0]); + this.columns = columns; + } + + onZoomMenu = (e: React.WheelEvent) => this.props.isContentActive(true) && e.stopPropagation(); + + render() { + TraceMobx(); + if (!this.props.isContentActive()) setTimeout(() => this.closeHeader(), 0); + const menuContent = this.renderMenuContent; + const menu =
this.onZoomMenu(e)} + onPointerDown={e => this.onHeaderClick(e)} + style={{ transform: `translate(${(this.menuCoordinates[0])}px, ${(this.menuCoordinates[1])}px)` }}> + { + const dim = this.props.ScreenToLocalTransform().inverse().transformDirection(r.offset.width, r.offset.height); + this._menuWidth = dim[0]; this._menuHeight = dim[1]; + })}> + {({ measureRef }) =>
{menuContent}
} +
+
; + return
+
this.props.isContentActive(true) && e.stopPropagation()} + onDrop={e => this.onExternalDrop(e, {})} + ref={this.createTarget}> + {this.schemaTable} +
+ {this.dividerDragger} + {!this.previewWidth() ? (null) : this.previewPanel} + {this._headerOpen && this.props.isContentActive() ? menu : null} +
; + } +} \ No newline at end of file diff --git a/src/client/views/collections/collectionSchema/SchemaTable.tsx b/src/client/views/collections/collectionSchema/SchemaTable.tsx new file mode 100644 index 000000000..0d5c9e077 --- /dev/null +++ b/src/client/views/collections/collectionSchema/SchemaTable.tsx @@ -0,0 +1,601 @@ +import React = require("react"); +import { IconProp } from '@fortawesome/fontawesome-svg-core'; +import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; +import { action, computed, observable } from "mobx"; +import { observer } from "mobx-react"; +import ReactTable, { CellInfo, Column, ComponentPropsGetterR, Resize, SortingRule } from "react-table"; +import "react-table/react-table.css"; +import { DateField } from "../../../../fields/DateField"; +import { AclPrivate, AclReadonly, DataSym, Doc, DocListCast, Field, Opt } from "../../../../fields/Doc"; +import { Id } from "../../../../fields/FieldSymbols"; +import { List } from "../../../../fields/List"; +import { listSpec } from "../../../../fields/Schema"; +import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; +import { ComputedField } from "../../../../fields/ScriptField"; +import { Cast, FieldValue, NumCast, StrCast } from "../../../../fields/Types"; +import { ImageField } from "../../../../fields/URLField"; +import { GetEffectiveAcl } from "../../../../fields/util"; +import { emptyFunction, emptyPath, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from "../../../../Utils"; +import { Docs, DocumentOptions, DocUtils } from "../../../documents/Documents"; +import { DocumentType } from "../../../documents/DocumentTypes"; +import { CompileScript, Transformer, ts } from "../../../util/Scripting"; +import { Transform } from "../../../util/Transform"; +import { undoBatch } from "../../../util/UndoManager"; +import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../globalCssVariables.scss'; +import { ContextMenu } from "../../ContextMenu"; +import '../../../views/DocumentDecorations.scss'; +import { DocumentView } from "../../nodes/DocumentView"; +import { DefaultStyleProvider } from "../../StyleProvider"; +import { CellProps, CollectionSchemaButtons, CollectionSchemaCell, CollectionSchemaCheckboxCell, CollectionSchemaDateCell, CollectionSchemaDocCell, CollectionSchemaImageCell, CollectionSchemaListCell, CollectionSchemaNumberCell, CollectionSchemaStringCell } from "./CollectionSchemaCells"; +import { CollectionSchemaAddColumnHeader, KeysDropdown } from "./CollectionSchemaHeaders"; +import { MovableColumn } from "./CollectionSchemaMovableColumn"; +import { MovableRow } from "./CollectionSchemaMovableRow"; +import "./CollectionSchemaView.scss"; +import { CollectionView } from "../CollectionView"; + + +enum ColumnType { + Any, + Number, + String, + Boolean, + Doc, + Image, + List, + Date +} + +// this map should be used for keys that should have a const type of value +const columnTypes: Map = new Map([ + ["title", ColumnType.String], + ["x", ColumnType.Number], ["y", ColumnType.Number], ["_width", ColumnType.Number], ["_height", ColumnType.Number], + ["_nativeWidth", ColumnType.Number], ["_nativeHeight", ColumnType.Number], ["isPrototype", ColumnType.Boolean], + ["_curPage", ColumnType.Number], ["_currentTimecode", ColumnType.Number], ["zIndex", ColumnType.Number] +]); + +export interface SchemaTableProps { + Document: Doc; // child doc + dataDoc?: Doc; + PanelHeight: () => number; + PanelWidth: () => number; + childDocs?: Doc[]; + CollectionView: Opt; + ContainingCollectionView: Opt; + ContainingCollectionDoc: Opt; + fieldKey: string; + renderDepth: number; + deleteDocument?: (document: Doc | Doc[]) => boolean; + addDocument?: (document: Doc | Doc[]) => boolean; + moveDocument?: (document: Doc | Doc[], targetCollection: Doc | undefined, addDocument: (document: Doc | Doc[]) => boolean) => boolean; + ScreenToLocalTransform: () => Transform; + active: (outsideReaction: boolean | undefined) => boolean; + onDrop: (e: React.DragEvent, options: DocumentOptions, completed?: (() => void) | undefined) => void; + addDocTab: (document: Doc, where: string) => boolean; + pinToPres: (document: Doc) => void; + isSelected: (outsideReaction?: boolean) => boolean; + isFocused: (document: Doc, outsideReaction: boolean) => boolean; + setFocused: (document: Doc) => void; + setPreviewDoc: (document: Opt) => void; + columns: SchemaHeaderField[]; + documentKeys: any[]; + headerIsEditing: boolean; + openHeader: (column: any, screenx: number, screeny: number) => void; + onClick: (e: React.MouseEvent) => void; + onPointerDown: (e: React.PointerEvent) => void; + onResizedChange: (newResized: Resize[], event: any) => void; + setColumns: (columns: SchemaHeaderField[]) => void; + reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columnsValues: SchemaHeaderField[]) => void; + changeColumns: (oldKey: string, newKey: string, addNew: boolean) => void; + setHeaderIsEditing: (isEditing: boolean) => void; + changeColumnSort: (columnField: SchemaHeaderField, descending: boolean | undefined) => void; +} + +@observer +export class SchemaTable extends React.Component { + @observable _cellIsEditing: boolean = false; + @observable _focusedCell: { row: number, col: number } = { row: 0, col: 0 }; + @observable _openCollections: Set = new Set; + + @observable _showDoc: Doc | undefined; + @observable _showDataDoc: any = ""; + @observable _showDocPos: number[] = []; + + @observable _showTitleDropdown: boolean = false; + + @computed get previewWidth() { return () => NumCast(this.props.Document.schemaPreviewWidth); } + @computed get previewHeight() { return () => this.props.PanelHeight() - 2 * this.borderWidth; } + @computed get tableWidth() { return this.props.PanelWidth() - 2 * this.borderWidth - Number(SCHEMA_DIVIDER_WIDTH) - this.previewWidth(); } + + @computed get childDocs() { + if (this.props.childDocs) return this.props.childDocs; + + const doc = this.props.dataDoc ? this.props.dataDoc : this.props.Document; + return DocListCast(doc[this.props.fieldKey]); + } + set childDocs(docs: Doc[]) { + const doc = this.props.dataDoc ? this.props.dataDoc : this.props.Document; + doc[this.props.fieldKey] = new List(docs); + } + + @computed get textWrappedRows() { + return Cast(this.props.Document.textwrappedSchemaRows, listSpec("string"), []); + } + set textWrappedRows(textWrappedRows: string[]) { + this.props.Document.textwrappedSchemaRows = new List(textWrappedRows); + } + + @computed get resized(): { id: string, value: number }[] { + return this.props.columns.reduce((resized, shf) => { + (shf.width > -1) && resized.push({ id: shf.heading, value: shf.width }); + return resized; + }, [] as { id: string, value: number }[]); + } + @computed get sorted(): SortingRule[] { + return this.props.columns.reduce((sorted, shf) => { + shf.desc !== undefined && sorted.push({ id: shf.heading, desc: shf.desc }); + return sorted; + }, [] as SortingRule[]); + } + + @action + changeSorting = (col: any) => { + this.props.changeColumnSort(col, col.desc === true ? false : col.desc === false ? undefined : true); + } + + @action + changeTitleMode = () => this._showTitleDropdown = !this._showTitleDropdown + + @computed get borderWidth() { return Number(COLLECTION_BORDER_WIDTH); } + @computed get tableColumns(): Column[] { + const possibleKeys = this.props.documentKeys.filter(key => this.props.columns.findIndex(existingKey => existingKey.heading.toUpperCase() === key.toUpperCase()) === -1); + const columns: Column[] = []; + const tableIsFocused = this.props.isFocused(this.props.Document, false); + const focusedRow = this._focusedCell.row; + const focusedCol = this._focusedCell.col; + const isEditable = !this.props.headerIsEditing; + + columns.push({ + expander: true, Header: "", width: 58, + Expander: (rowInfo) => { + return rowInfo.original.type !== DocumentType.COL ? (null) : +
(this._openCollections[rowInfo.isExpanded ? "delete" : "add"])(rowInfo.viewIndex))}> + +
; + } + }); + columns.push(...this.props.columns.map(col => { + const icon: IconProp = this.getColumnType(col) === ColumnType.Number ? "hashtag" : this.getColumnType(col) === ColumnType.String ? "font" : + this.getColumnType(col) === ColumnType.Boolean ? "check-square" : this.getColumnType(col) === ColumnType.Doc ? "file" : + this.getColumnType(col) === ColumnType.Image ? "image" : this.getColumnType(col) === ColumnType.List ? "list-ul" : + this.getColumnType(col) === ColumnType.Date ? "calendar" : "align-justify"; + + const keysDropdown = c.heading)} + canAddNew={true} + addNew={false} + onSelect={this.props.changeColumns} + setIsEditing={this.props.setHeaderIsEditing} + docs={this.props.childDocs} + Document={this.props.Document} + dataDoc={this.props.dataDoc} + fieldKey={this.props.fieldKey} + ContainingCollectionDoc={this.props.ContainingCollectionDoc} + ContainingCollectionView={this.props.ContainingCollectionView} + active={this.props.active} + openHeader={this.props.openHeader} + icon={icon} + col={col} + // try commenting this out + width={"100%"} + />; + + const sortIcon = col.desc === undefined ? "caret-right" : col.desc === true ? "caret-down" : "caret-up"; + const header =
+ {keysDropdown} +
this.changeSorting(col)} style={{ width: 21, padding: 1, display: "inline", zIndex: 1, background: "inherit", cursor: "hand" }}> + +
+
; + + return { + Header: , + accessor: (doc: Doc) => doc ? Field.toString(doc[col.heading] as Field) : 0, + id: col.heading, + Cell: (rowProps: CellInfo) => { + const rowIndex = rowProps.index; + const columnIndex = this.props.columns.map(c => c.heading).indexOf(rowProps.column.id!); + const isFocused = focusedRow === rowIndex && focusedCol === columnIndex && tableIsFocused; + + const props: CellProps = { + row: rowIndex, + col: columnIndex, + rowProps: rowProps, + isFocused: isFocused, + changeFocusedCellByIndex: this.changeFocusedCellByIndex, + CollectionView: this.props.CollectionView, + ContainingCollection: this.props.ContainingCollectionView, + Document: this.props.Document, + fieldKey: this.props.fieldKey, + renderDepth: this.props.renderDepth, + addDocTab: this.props.addDocTab, + pinToPres: this.props.pinToPres, + moveDocument: this.props.moveDocument, + setIsEditing: this.setCellIsEditing, + isEditable: isEditable, + setPreviewDoc: this.props.setPreviewDoc, + setComputed: this.setComputed, + getField: this.getField, + showDoc: this.showDoc, + }; + + + switch (this.getColumnType(col, rowProps.original, rowProps.column.id)) { + case ColumnType.Number: return ; + case ColumnType.String: return ; + case ColumnType.Boolean: return ; + case ColumnType.Doc: return ; + case ColumnType.Image: return ; + case ColumnType.List: return ; + case ColumnType.Date: return ; + default: + return ; + } + }, + minWidth: 200, + }; + })); + columns.push({ + Header: , + accessor: (doc: Doc) => 0, + id: "add", + Cell: (rowProps: CellInfo) => { + const rowIndex = rowProps.index; + const columnIndex = this.props.columns.map(c => c.heading).indexOf(rowProps.column.id!); + const isFocused = focusedRow === rowIndex && focusedCol === columnIndex && tableIsFocused; + return ; + }, + width: 28, + resizable: false + }); + return columns; + } + + + constructor(props: SchemaTableProps) { + super(props); + if (this.props.Document._schemaHeaders === undefined) { + this.props.Document._schemaHeaders = new List([new SchemaHeaderField("title", "#f1efeb"), new SchemaHeaderField("author", "#f1efeb"), new SchemaHeaderField("*lastModified", "#f1efeb", ColumnType.Date), + new SchemaHeaderField("text", "#f1efeb", ColumnType.String), new SchemaHeaderField("type", "#f1efeb"), new SchemaHeaderField("context", "#f1efeb", ColumnType.Doc)]); + } + } + + componentDidMount() { + document.addEventListener("keydown", this.onKeyDown); + } + + componentWillUnmount() { + document.removeEventListener("keydown", this.onKeyDown); + } + + tableAddDoc = (doc: Doc, relativeTo?: Doc, before?: boolean) => { + const tableDoc = this.props.Document[DataSym]; + const effectiveAcl = GetEffectiveAcl(tableDoc); + + if (effectiveAcl !== AclPrivate && effectiveAcl !== AclReadonly) { + doc.context = this.props.Document; + tableDoc[this.props.fieldKey + "-lastModified"] = new DateField(new Date(Date.now())); + return Doc.AddDocToList(this.props.Document, this.props.fieldKey, doc, relativeTo, before); + } + return false; + } + + private getTrProps: ComponentPropsGetterR = (state, rowInfo) => { + return !rowInfo ? {} : { + ScreenToLocalTransform: this.props.ScreenToLocalTransform, + addDoc: this.tableAddDoc, + removeDoc: this.props.deleteDocument, + rowInfo, + rowFocused: !this.props.headerIsEditing && rowInfo.index === this._focusedCell.row && this.props.isFocused(this.props.Document, true), + textWrapRow: this.toggleTextWrapRow, + rowWrapped: this.textWrappedRows.findIndex(id => rowInfo.original[Id] === id) > -1, + dropAction: StrCast(this.props.Document.childDropAction), + addDocTab: this.props.addDocTab + }; + } + + private getTdProps: ComponentPropsGetterR = (state, rowInfo, column, instance) => { + if (!rowInfo || column) return {}; + + const row = rowInfo.index; + //@ts-ignore + const col = this.columns.map(c => c.heading).indexOf(column!.id); + const isFocused = this._focusedCell.row === row && this._focusedCell.col === col && this.props.isFocused(this.props.Document, true); + // TODO: editing border doesn't work :( + return { + style: { border: !this.props.headerIsEditing && isFocused ? "2px solid rgb(255, 160, 160)" : "1px solid #f1efeb" } + }; + } + + @action setCellIsEditing = (isEditing: boolean) => this._cellIsEditing = isEditing; + + @action + onKeyDown = (e: KeyboardEvent): void => { + if (!this._cellIsEditing && !this.props.headerIsEditing && this.props.isFocused(this.props.Document, true)) {// && this.props.isSelected(true)) { + const direction = e.key === "Tab" ? "tab" : e.which === 39 ? "right" : e.which === 37 ? "left" : e.which === 38 ? "up" : e.which === 40 ? "down" : ""; + this._focusedCell = this.changeFocusedCellByDirection(direction, this._focusedCell.row, this._focusedCell.col); + + if (direction) { + const pdoc = FieldValue(this.childDocs[this._focusedCell.row]); + pdoc && this.props.setPreviewDoc(pdoc); + e.stopPropagation(); + } + } else if (e.keyCode === 27) { + this.props.setPreviewDoc(undefined); + e.stopPropagation(); // stopPropagation for left/right arrows + } + } + + changeFocusedCellByDirection = (direction: string, curRow: number, curCol: number) => { + switch (direction) { + case "tab": return { row: (curRow + 1 === this.childDocs.length ? 0 : curRow + 1), col: curCol + 1 === this.props.columns.length ? 0 : curCol + 1 }; + case "right": return { row: curRow, col: curCol + 1 === this.props.columns.length ? curCol : curCol + 1 }; + case "left": return { row: curRow, col: curCol === 0 ? curCol : curCol - 1 }; + case "up": return { row: curRow === 0 ? curRow : curRow - 1, col: curCol }; + case "down": return { row: curRow + 1 === this.childDocs.length ? curRow : curRow + 1, col: curCol }; + } + return this._focusedCell; + } + + @action + changeFocusedCellByIndex = (row: number, col: number): void => { + if (this._focusedCell.row !== row || this._focusedCell.col !== col) { + this._focusedCell = { row: row, col: col }; + } + this.props.setFocused(this.props.Document); + } + + @undoBatch + createRow = action(() => { + this.props.addDocument?.(Docs.Create.TextDocument("", { title: "", _width: 100, _height: 30 })); + this._focusedCell = { row: this.childDocs.length, col: this._focusedCell.col }; + }); + + @undoBatch + @action + createColumn = () => { + let index = 0; + let found = this.props.columns.findIndex(col => col.heading.toUpperCase() === "New field".toUpperCase()) > -1; + while (found) { + index++; + found = this.props.columns.findIndex(col => col.heading.toUpperCase() === ("New field (" + index + ")").toUpperCase()) > -1; + } + this.props.columns.push(new SchemaHeaderField(`New field ${index ? "(" + index + ")" : ""}`, "#f1efeb")); + } + + @action + getColumnType = (column: SchemaHeaderField, doc?: Doc, field?: string): ColumnType => { + if (doc && field && column.type === ColumnType.Any) { + const val = doc[CollectionSchemaCell.resolvedFieldKey(field, doc)]; + if (val instanceof ImageField) return ColumnType.Image; + if (val instanceof Doc) return ColumnType.Doc; + if (val instanceof DateField) return ColumnType.Date; + if (val instanceof List) return ColumnType.List; + } + if (column.type && column.type !== 0) { + return column.type; + } + if (columnTypes.get(column.heading)) { + return column.type = columnTypes.get(column.heading)!; + } + return column.type = ColumnType.Any; + } + + @undoBatch + @action + toggleTextwrap = async () => { + const textwrappedRows = Cast(this.props.Document.textwrappedSchemaRows, listSpec("string"), []); + if (textwrappedRows.length) { + this.props.Document.textwrappedSchemaRows = new List([]); + } else { + const docs = DocListCast(this.props.Document[this.props.fieldKey]); + const allRows = docs instanceof Doc ? [docs[Id]] : docs.map(doc => doc[Id]); + this.props.Document.textwrappedSchemaRows = new List(allRows); + } + } + + @action + toggleTextWrapRow = (doc: Doc): void => { + const textWrapped = this.textWrappedRows; + const index = textWrapped.findIndex(id => doc[Id] === id); + + index > -1 ? textWrapped.splice(index, 1) : textWrapped.push(doc[Id]); + + this.textWrappedRows = textWrapped; + } + + @computed + get reactTable() { + const children = this.childDocs; + const hasCollectionChild = children.reduce((found, doc) => found || doc.type === DocumentType.COL, false); + const expanded: { [name: string]: any } = {}; + Array.from(this._openCollections.keys()).map(col => expanded[col.toString()] = true); + const rerender = [...this.textWrappedRows]; // TODO: get component to rerender on text wrap change without needign to console.log :(((( + + return (row.original.type !== DocumentType.COL) ? (null) : +
} + + />; + } + + onContextMenu = (e: React.MouseEvent): void => { + ContextMenu.Instance.addItem({ description: "Toggle text wrapping", event: this.toggleTextwrap, icon: "table" }); + } + + getField = (row: number, col?: number) => { + const docs = this.childDocs; + + row = row % docs.length; + while (row < 0) row += docs.length; + const columns = this.props.columns; + const doc = docs[row]; + if (col === undefined) { + return doc; + } + if (col >= 0 && col < columns.length) { + const column = this.props.columns[col].heading; + return doc[column]; + } + return undefined; + } + + createTransformer = (row: number, col: number): Transformer => { + const self = this; + const captures: { [name: string]: Field } = {}; + + const transformer: ts.TransformerFactory = context => { + return root => { + function visit(node: ts.Node) { + node = ts.visitEachChild(node, visit, context); + if (ts.isIdentifier(node)) { + const isntPropAccess = !ts.isPropertyAccessExpression(node.parent) || node.parent.expression === node; + const isntPropAssign = !ts.isPropertyAssignment(node.parent) || node.parent.name !== node; + if (isntPropAccess && isntPropAssign) { + if (node.text === "$r") { + return ts.createNumericLiteral(row.toString()); + } else if (node.text === "$c") { + return ts.createNumericLiteral(col.toString()); + } else if (node.text === "$") { + if (ts.isCallExpression(node.parent)) { + // captures.doc = self.props.Document; + // captures.key = self.props.fieldKey; + } + } + } + } + + return node; + } + return ts.visitNode(root, visit); + }; + }; + + // const getVars = () => { + // return { capturedVariables: captures }; + // }; + + return { transformer, /*getVars*/ }; + } + + setComputed = (script: string, doc: Doc, field: string, row: number, col: number): boolean => { + script = + `const $ = (row:number, col?:number) => { + const rval = (doc as any)[key][row + ${row}]; + return col === undefined ? rval : rval[(doc as any)._schemaHeaders[col + ${col}].heading]; + } + return ${script}`; + const compiled = CompileScript(script, { params: { this: Doc.name }, capturedVariables: { doc: this.props.Document, key: this.props.fieldKey }, typecheck: false, transformer: this.createTransformer(row, col) }); + if (compiled.compiled) { + doc[field] = new ComputedField(compiled); + return true; + } + return false; + } + + @action + showDoc = (doc: Doc | undefined, dataDoc?: Doc, screenX?: number, screenY?: number) => { + this._showDoc = doc; + if (dataDoc && screenX && screenY) { + this._showDocPos = this.props.ScreenToLocalTransform().transformPoint(screenX, screenY); + } + } + + onOpenClick = () => { + this._showDoc && this.props.addDocTab(this._showDoc, "add:right"); + } + + getPreviewTransform = (): Transform => { + return this.props.ScreenToLocalTransform().translate(- this.borderWidth - 4 - this.tableWidth, - this.borderWidth); + } + + render() { + const preview = ""; + return
this.props.active(true) && e.stopPropagation()} + onDrop={e => this.props.onDrop(e, {})} onContextMenu={this.onContextMenu} > + {this.reactTable} + {this.props.Document._chromeHidden ? undefined :
+ new
} + {!this._showDoc ? (null) : +
+ 150} + PanelHeight={() => 150} + ScreenToLocalTransform={this.getPreviewTransform} + docFilters={returnEmptyFilter} + docRangeFilters={returnEmptyFilter} + searchFilterDocs={returnEmptyDoclist} + ContainingCollectionDoc={this.props.CollectionView?.props.Document} + ContainingCollectionView={this.props.CollectionView} + moveDocument={this.props.moveDocument} + whenChildContentsActiveChanged={emptyFunction} + addDocTab={this.props.addDocTab} + pinToPres={this.props.pinToPres} + bringToFront={returnFalse}> + +
} +
; + } +} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/CollectionSchemaCells.tsx b/src/client/views/collections/schemaView/CollectionSchemaCells.tsx deleted file mode 100644 index f75179cea..000000000 --- a/src/client/views/collections/schemaView/CollectionSchemaCells.tsx +++ /dev/null @@ -1,585 +0,0 @@ -import React = require("react"); -import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { action, computed, observable } from "mobx"; -import { observer } from "mobx-react"; -import DatePicker from "react-datepicker"; -import "react-datepicker/dist/react-datepicker.css"; -import { CellInfo } from "react-table"; -import "react-table/react-table.css"; -import { DateField } from "../../../../fields/DateField"; -import { Doc, DocListCast, Field, Opt } from "../../../../fields/Doc"; -import { Id } from "../../../../fields/FieldSymbols"; -import { List } from "../../../../fields/List"; -import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; -import { ComputedField } from "../../../../fields/ScriptField"; -import { BoolCast, Cast, DateCast, FieldValue, NumCast, StrCast } from "../../../../fields/Types"; -import { ImageField } from "../../../../fields/URLField"; -import { Utils, emptyFunction } from "../../../../Utils"; -import { Docs } from "../../../documents/Documents"; -import { DocumentType } from "../../../documents/DocumentTypes"; -import { DocumentManager } from "../../../util/DocumentManager"; -import { DragManager } from "../../../util/DragManager"; -import { KeyCodes } from "../../../util/KeyCodes"; -import { CompileScript } from "../../../util/Scripting"; -import { SearchUtil } from "../../../util/SearchUtil"; -import { SnappingManager } from "../../../util/SnappingManager"; -import { undoBatch } from "../../../util/UndoManager"; -import '../../../views/DocumentDecorations.scss'; -import { EditableView } from "../../EditableView"; -import { MAX_ROW_HEIGHT } from '../../globalCssVariables.scss'; -import { DocumentIconContainer } from "../../nodes/DocumentIcon"; -import { OverlayView } from "../../OverlayView"; -import "./CollectionSchemaView.scss"; -import { CollectionView } from "../CollectionView"; -const path = require('path'); - -// intialize cell properties -export interface CellProps { - row: number; - col: number; - rowProps: CellInfo; - CollectionView: Opt; - ContainingCollection: Opt; - Document: Doc; - fieldKey: string; - renderDepth: number; - addDocTab: (document: Doc, where: string) => boolean; - pinToPres: (document: Doc) => void; - moveDocument?: (document: Doc | Doc[], targetCollection: Doc | undefined, - addDocument: (document: Doc | Doc[]) => boolean) => boolean; - isFocused: boolean; - changeFocusedCellByIndex: (row: number, col: number) => void; - setIsEditing: (isEditing: boolean) => void; - isEditable: boolean; - setPreviewDoc: (doc: Doc) => void; - setComputed: (script: string, doc: Doc, field: string, row: number, col: number) => boolean; - getField: (row: number, col?: number) => void; - showDoc: (doc: Doc | undefined, dataDoc?: any, screenX?: number, screenY?: number) => void; -} - -@observer -export class CollectionSchemaCell extends React.Component { - public static resolvedFieldKey(column: string, rowDoc: Doc) { - const fieldKey = column; - if (fieldKey.startsWith("*")) { - const rootKey = fieldKey.substring(1); - const allKeys = [...Array.from(Object.keys(rowDoc)), ...Array.from(Object.keys(Doc.GetProto(rowDoc)))]; - const matchedKeys = allKeys.filter(key => key.includes(rootKey)); - if (matchedKeys.length) return matchedKeys[0]; - } - return fieldKey; - } - @observable protected _isEditing: boolean = false; - protected _focusRef = React.createRef(); - protected _rowDoc = this.props.rowProps.original; - protected _rowDataDoc = Doc.GetProto(this.props.rowProps.original); - protected _dropDisposer?: DragManager.DragDropDisposer; - @observable contents: string = ""; - - componentDidMount() { document.addEventListener("keydown", this.onKeyDown); } - componentWillUnmount() { document.removeEventListener("keydown", this.onKeyDown); } - - @action - onKeyDown = (e: KeyboardEvent): void => { - if (this.props.isFocused && this.props.isEditable && e.keyCode === KeyCodes.ENTER) { - document.removeEventListener("keydown", this.onKeyDown); - this._isEditing = true; - this.props.setIsEditing(true); - } - } - - @action - isEditingCallback = (isEditing: boolean): void => { - document.removeEventListener("keydown", this.onKeyDown); - isEditing && document.addEventListener("keydown", this.onKeyDown); - this._isEditing = isEditing; - this.props.setIsEditing(isEditing); - this.props.changeFocusedCellByIndex(this.props.row, this.props.col); - } - - @action - onPointerDown = async (e: React.PointerEvent): Promise => { - this.onItemDown(e); - this.props.changeFocusedCellByIndex(this.props.row, this.props.col); - this.props.setPreviewDoc(this.props.rowProps.original); - - let url: string; - if (url = StrCast(this.props.rowProps.row.href)) { - try { - new URL(url); - const temp = window.open(url)!; - temp.blur(); - window.focus(); - } catch { } - } - - const doc = Cast(this._rowDoc[this.renderFieldKey], Doc, null); - doc && this.props.setPreviewDoc(doc); - } - - @undoBatch - applyToDoc = (doc: Doc, row: number, col: number, run: (args?: { [name: string]: any }) => any) => { - const res = run({ this: doc, $r: row, $c: col, $: (r: number = 0, c: number = 0) => this.props.getField(r + row, c + col) }); - if (!res.success) return false; - doc[this.renderFieldKey] = res.result; - return true; - } - - private drop = (e: Event, de: DragManager.DropEvent) => { - if (de.complete.docDragData) { - if (de.complete.docDragData.draggedDocuments.length === 1) { - this._rowDataDoc[this.renderFieldKey] = de.complete.docDragData.draggedDocuments[0]; - } - else { - const coll = Docs.Create.SchemaDocument([new SchemaHeaderField("title", "#f1efeb")], de.complete.docDragData.draggedDocuments, {}); - this._rowDataDoc[this.renderFieldKey] = coll; - } - e.stopPropagation(); - } - } - - protected dropRef = (ele: HTMLElement | null) => { - this._dropDisposer?.(); - ele && (this._dropDisposer = DragManager.MakeDropTarget(ele, this.drop.bind(this))); - } - - returnHighlights(contents: string, positions?: number[]) { - if (positions) { - const results = []; - StrCast(this.props.Document._searchString); - const length = StrCast(this.props.Document._searchString).length; - const color = contents ? "black" : "grey"; - - results.push({contents?.slice(0, positions[0])}); - positions.forEach((num, cur) => { - results.push({contents?.slice(num, num + length)}); - let end = 0; - cur === positions.length - 1 ? end = contents.length : end = positions[cur + 1]; - results.push({contents?.slice(num + length, end)}); - } - ); - return results; - } - return {contents ? contents?.valueOf() : "undefined"}; - } - - @computed get renderFieldKey() { return CollectionSchemaCell.resolvedFieldKey(this.props.rowProps.column.id!, this.props.rowProps.original); } - onItemDown = async (e: React.PointerEvent) => { - if (this.props.Document._searchDoc) { - const aliasdoc = await SearchUtil.GetAliasesOfDocument(this._rowDataDoc); - const targetContext = aliasdoc.length <= 0 ? undefined : Cast(aliasdoc[0].context, Doc, null); - DocumentManager.Instance.jumpToDocument(this._rowDoc, false, emptyFunction, targetContext, - undefined, undefined, undefined, () => this.props.setPreviewDoc(this._rowDoc)); - } - } - renderCellWithType(type: string | undefined) { - const dragRef: React.RefObject = React.createRef(); - - const fieldKey = this.renderFieldKey; - const field = this._rowDoc[fieldKey]; - - const onPointerEnter = (e: React.PointerEvent): void => { - if (e.buttons === 1 && SnappingManager.GetIsDragging() && (type === "document" || type === undefined)) { - dragRef.current!.className = "collectionSchemaView-cellContainer doc-drag-over"; - } - }; - const onPointerLeave = (e: React.PointerEvent): void => { - dragRef.current!.className = "collectionSchemaView-cellContainer"; - }; - - let contents = Field.toString(field as Field); - contents = contents === "" ? "--" : contents; - - let className = "collectionSchemaView-cellWrapper"; - if (this._isEditing) className += " editing"; - if (this.props.isFocused && this.props.isEditable) className += " focused"; - if (this.props.isFocused && !this.props.isEditable) className += " inactive"; - - const positions = []; - if (StrCast(this.props.Document._searchString).toLowerCase() !== "") { - let term = (field instanceof Promise) ? "...promise pending..." : contents.toLowerCase(); - const search = StrCast(this.props.Document._searchString).toLowerCase(); - let start = term.indexOf(search); - let tally = 0; - if (start !== -1) { - positions.push(start); - } - while (start < contents?.length && start !== -1) { - term = term.slice(start + search.length + 1); - tally += start + search.length + 1; - start = term.indexOf(search); - positions.push(tally + start); - } - if (positions.length > 1) { - positions.pop(); - } - } - const placeholder = type === "number" ? "0" : contents === "" ? "--" : "undefined"; - return ( -
this._isEditing = true)} onPointerEnter={onPointerEnter} onPointerLeave={onPointerLeave}> -
-
- {!this.props.Document._searchDoc ? - { - const cfield = ComputedField.WithoutComputed(() => FieldValue(field)); - const cscript = cfield instanceof ComputedField ? cfield.script.originalScript : undefined; - const cfinalScript = cscript?.split("return")[cscript.split("return").length - 1]; - return cscript ? (cfinalScript?.endsWith(";") ? `:=${cfinalScript?.substring(0, cfinalScript.length - 2)}` : cfinalScript) : - Field.IsField(cfield) ? Field.toScriptString(cfield) : ""; - }} - SetValue={action((value: string) => { - // sets what is displayed after the user makes an input - let retVal = false; - if (value.startsWith(":=") || value.startsWith("=:=")) { - // decides how to compute a value when given either of the above strings - const script = value.substring(value.startsWith("=:=") ? 3 : 2); - retVal = this.props.setComputed(script, value.startsWith(":=") ? this._rowDataDoc : this._rowDoc, this.renderFieldKey, this.props.row, this.props.col); - } else { - // check if the input is a number - let inputIsNum = true; - for (let s of value) { - if (isNaN(parseInt(s)) && !(s == ".") && !(s == ",")) { - inputIsNum = false; - } - } - // check if the input is a boolean - let inputIsBool: boolean = value == "false" || value == "true"; - // what to do in the case - if (!inputIsNum && !inputIsBool && !value.startsWith("=")) { - // if it's not a number, it's a string, and should be processed as such - // strips the string of quotes when it is edited to prevent quotes form being added to the text automatically - // after each edit - let valueSansQuotes = value; - if (this._isEditing) { - const vsqLength = valueSansQuotes.length; - // get rid of outer quotes - valueSansQuotes = valueSansQuotes.substring(value.startsWith("\"") ? 1 : 0, - valueSansQuotes.charAt(vsqLength - 1) == "\"" ? vsqLength - 1 : vsqLength); - } - let inputAsString = '"'; - // escape any quotes in the string - for (const i of valueSansQuotes) { - if (i == '"') { - inputAsString += '\\"'; - } else { - inputAsString += i; - } - } - // add a closing quote - inputAsString += '"'; - //two options here: we can strip off outer quotes or we can figure out what's going on with the script - const script = CompileScript(inputAsString, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - const changeMade = inputAsString.length !== value.length || inputAsString.length - 2 !== value.length - script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); - // handle numbers and expressions - } else if (inputIsNum || value.startsWith("=")) { - //TODO: make accept numbers - const inputscript = value.substring(value.startsWith("=") ? 1 : 0); - // if commas are not stripped, the parser only considers the numbers after the last comma - let inputSansCommas = ""; - for (let s of inputscript) { - if (!(s == ",")) { - inputSansCommas += s; - } - } - const script = CompileScript(inputSansCommas, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - const changeMade = value.length !== value.length || value.length - 2 !== value.length - script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); - // handle booleans - } else if (inputIsBool) { - const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - const changeMade = value.length !== value.length || value.length - 2 !== value.length - script.compiled && (retVal = this.applyToDoc(changeMade ? this._rowDoc : this._rowDataDoc, this.props.row, this.props.col, script.run)); - } - } - if (retVal) { - this._isEditing = false; // need to set this here. otherwise, the assignment of the field will invalidate & cause render() to be called with the wrong value for 'editing' - this.props.setIsEditing(false); - } - return retVal; - })} - OnFillDown={async (value: string) => { - const script = CompileScript(value, { requiredType: type, typecheck: false, editable: true, addReturn: true, params: { this: Doc.name, $r: "number", $c: "number", $: "any" } }); - script.compiled && DocListCast(this.props.Document[this.props.fieldKey]). - forEach((doc, i) => value.startsWith(":=") ? - this.props.setComputed(value.substring(2), Doc.GetProto(doc), this.renderFieldKey, i, this.props.col) : - this.applyToDoc(Doc.GetProto(doc), i, this.props.col, script.run)); - }} - /> - : - this.returnHighlights(contents, positions) - } -
-
-
- ); - } - - render() { return this.renderCellWithType(undefined); } -} - -@observer -export class CollectionSchemaNumberCell extends CollectionSchemaCell { render() { return this.renderCellWithType("number"); } } - -@observer -export class CollectionSchemaBooleanCell extends CollectionSchemaCell { render() { return this.renderCellWithType("boolean"); } } - -@observer -export class CollectionSchemaStringCell extends CollectionSchemaCell { render() { return this.renderCellWithType("string"); } } - -@observer -export class CollectionSchemaDateCell extends CollectionSchemaCell { - @computed get _date(): Opt { return this._rowDoc[this.renderFieldKey] instanceof DateField ? DateCast(this._rowDoc[this.renderFieldKey]) : undefined; } - - @action - handleChange = (date: any) => { - // const script = CompileScript(date.toString(), { requiredType: "Date", addReturn: true, params: { this: Doc.name } }); - // if (script.compiled) { - // this.applyToDoc(this._document, this.props.row, this.props.col, script.run); - // } else { - // ^ DateCast is always undefined for some reason, but that is what the field should be set to - this._rowDoc[this.renderFieldKey] = new DateField(date as Date); - //} - } - - render() { - return !this.props.isFocused ? {this._date ? Field.toString(this._date as Field) : "--"} : - this.handleChange(date)} - onChange={date => this.handleChange(date)} - />; - } -} - -@observer -export class CollectionSchemaDocCell extends CollectionSchemaCell { - - _overlayDisposer?: () => void; - - @computed get _doc() { return FieldValue(Cast(this._rowDoc[this.renderFieldKey], Doc)); } - - @action - onSetValue = (value: string) => { - this._doc && (Doc.GetProto(this._doc).title = value); - - const script = CompileScript(value, { - addReturn: true, - typecheck: true, - transformer: DocumentIconContainer.getTransformer() - }); - - const results = script.compiled && script.run(); - if (results && results.success) { - this._rowDoc[this.renderFieldKey] = results.result; - return true; - } - return false; - } - - componentWillUnmount() { this.onBlur(); } - - onBlur = () => { this._overlayDisposer?.(); }; - onFocus = () => { - this.onBlur(); - this._overlayDisposer = OverlayView.Instance.addElement(, { x: 0, y: 0 }); - } - - @action - isEditingCallback = (isEditing: boolean): void => { - document.removeEventListener("keydown", this.onKeyDown); - isEditing && document.addEventListener("keydown", this.onKeyDown); - this._isEditing = isEditing; - this.props.setIsEditing(isEditing); - this.props.changeFocusedCellByIndex(this.props.row, this.props.col); - } - - render() { - return !this._doc ? this.renderCellWithType("document") : -
-
- StrCast(this._doc?.title)} - SetValue={action((value: string) => { - this.onSetValue(value); - return true; - })} - /> -
-
this._doc && this.props.addDocTab(this._doc, "add:right")} className="collectionSchemaView-cellContents-docButton"> - -
-
; - } -} - -@observer -export class CollectionSchemaImageCell extends CollectionSchemaCell { - - choosePath(url: URL) { - if (url.protocol === "data") return url.href; - if (url.href.indexOf(window.location.origin) === -1) return Utils.CorsProxy(url.href); - if (!/\.(png|jpg|jpeg|gif|webp)$/.test(url.href.toLowerCase())) return url.href;//Why is this here - - const ext = path.extname(url.href); - return url.href.replace(ext, "_o" + path.extname(url.href)); - } - - render() { - const field = Cast(this._rowDoc[this.renderFieldKey], ImageField, null); // retrieve the primary image URL that is being rendered from the data doc - const alts = DocListCast(this._rowDoc[this.renderFieldKey + "-alternates"]); // retrieve alternate documents that may be rendered as alternate images - const altpaths = alts.map(doc => Cast(doc[Doc.LayoutFieldKey(doc)], ImageField, null)?.url).filter(url => url).map(url => this.choosePath(url)); // access the primary layout data of the alternate documents - const paths = field ? [this.choosePath(field.url), ...altpaths] : altpaths; - const url = paths.length ? paths : [Utils.CorsProxy("http://www.cs.brown.edu/~bcz/noImage.png")]; - - const aspect = Doc.NativeAspect(this._rowDoc); - let width = Math.min(75, this.props.rowProps.width); - const height = Math.min(75, width / aspect); - width = height * aspect; - - const reference = React.createRef(); - return
-
- -
-
; - } -} - - -@observer -export class CollectionSchemaListCell extends CollectionSchemaCell { - _overlayDisposer?: () => void; - - @computed get _field() { return this._rowDoc[this.renderFieldKey]; } - @computed get _optionsList() { return this._field as List; } - @observable private _opened = false; - @observable private _text = "select an item"; - @observable private _selectedNum = 0; - - @action - onSetValue = (value: string) => { - // change if its a document - this._optionsList[this._selectedNum] = this._text = value; - - (this._field as List).splice(this._selectedNum, 1, value); - } - - @action - onSelected = (element: string, index: number) => { - this._text = element; - this._selectedNum = index; - } - - onFocus = () => { - this._overlayDisposer?.(); - this._overlayDisposer = OverlayView.Instance.addElement(, { x: 0, y: 0 }); - } - - render() { - const link = false; - const reference = React.createRef(); - - if (this._optionsList?.length) { - const options = !this._opened ? (null) : -
- {this._optionsList.map((element, index) => { - const val = Field.toString(element); - return
this.onSelected(StrCast(element), index)} > - {val} -
; - })} -
; - - const plainText =
{this._text}
; - const textarea =
- this._text} - SetValue={action((value: string) => { - // add special for params - this.onSetValue(value); - return true; - })} - /> -
; - - //☰ - return ( -
-
-
- -
{link ? plainText : textarea}
-
- {options} -
-
- ); - } - return this.renderCellWithType("list"); - } -} - - -@observer -export class CollectionSchemaCheckboxCell extends CollectionSchemaCell { - @computed get _isChecked() { return BoolCast(this._rowDoc[this.renderFieldKey]); } - - render() { - const reference = React.createRef(); - return ( -
- this._rowDoc[this.renderFieldKey] = e.target.checked} /> -
- ); - } -} - - -@observer -export class CollectionSchemaButtons extends CollectionSchemaCell { - render() { - return !this.props.Document._searchDoc || ![DocumentType.PDF, DocumentType.RTF].includes(StrCast(this._rowDoc.type) as DocumentType) ? <> : -
- - -
; - } -} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx b/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx deleted file mode 100644 index b2115b22e..000000000 --- a/src/client/views/collections/schemaView/CollectionSchemaHeaders.tsx +++ /dev/null @@ -1,518 +0,0 @@ -import React = require("react"); -import { IconProp, library } from "@fortawesome/fontawesome-svg-core"; -import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { action, computed, observable, runInAction } from "mobx"; -import { observer } from "mobx-react"; -import { Doc, DocListCast, Opt } from "../../../../fields/Doc"; -import { listSpec } from "../../../../fields/Schema"; -import { PastelSchemaPalette, SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; -import { ScriptField } from "../../../../fields/ScriptField"; -import { Cast, StrCast } from "../../../../fields/Types"; -import { undoBatch } from "../../../util/UndoManager"; -import { SearchBox } from "../../search/SearchBox"; -import { ColumnType } from "./CollectionSchemaView"; -import "./CollectionSchemaView.scss"; -import { CollectionView } from "../CollectionView"; - -const higflyout = require("@hig/flyout"); -export const { anchorPoints } = higflyout; -export const Flyout = higflyout.default; - - -export interface AddColumnHeaderProps { - createColumn: () => void; -} - -@observer -export class CollectionSchemaAddColumnHeader extends React.Component { - render() { - return ( - - ); - } -} - - -export interface ColumnMenuProps { - columnField: SchemaHeaderField; - // keyValue: string; - possibleKeys: string[]; - existingKeys: string[]; - // keyType: ColumnType; - typeConst: boolean; - menuButtonContent: JSX.Element; - addNew: boolean; - onSelect: (oldKey: string, newKey: string, addnew: boolean) => void; - setIsEditing: (isEditing: boolean) => void; - deleteColumn: (column: string) => void; - onlyShowOptions: boolean; - setColumnType: (column: SchemaHeaderField, type: ColumnType) => void; - setColumnSort: (column: SchemaHeaderField, desc: boolean | undefined) => void; - anchorPoint?: any; - setColumnColor: (column: SchemaHeaderField, color: string) => void; -} -@observer -export class CollectionSchemaColumnMenu extends React.Component { - @observable private _isOpen: boolean = false; - @observable private _node: HTMLDivElement | null = null; - - componentDidMount() { document.addEventListener("pointerdown", this.detectClick); } - - componentWillUnmount() { document.removeEventListener("pointerdown", this.detectClick); } - - @action - detectClick = (e: PointerEvent) => { - !this._node?.contains(e.target as Node) && this.props.setIsEditing(this._isOpen = false); - } - - @action - toggleIsOpen = (): void => { - this.props.setIsEditing(this._isOpen = !this._isOpen); - } - - changeColumnType = (type: ColumnType) => { - this.props.setColumnType(this.props.columnField, type); - } - - changeColumnSort = (desc: boolean | undefined) => { - this.props.setColumnSort(this.props.columnField, desc); - } - - changeColumnColor = (color: string) => { - this.props.setColumnColor(this.props.columnField, color); - } - - @action - setNode = (node: HTMLDivElement): void => { - if (node) { - this._node = node; - } - } - - renderTypes = () => { - if (this.props.typeConst) return (null); - - const type = this.props.columnField.type; - return ( -
- -
-
this.changeColumnType(ColumnType.Any)}> - - Any -
-
this.changeColumnType(ColumnType.Number)}> - - Number -
-
this.changeColumnType(ColumnType.String)}> - - Text -
-
this.changeColumnType(ColumnType.Boolean)}> - - Checkbox -
-
this.changeColumnType(ColumnType.List)}> - - List -
-
this.changeColumnType(ColumnType.Doc)}> - - Document -
-
this.changeColumnType(ColumnType.Image)}> - - Image -
-
this.changeColumnType(ColumnType.Date)}> - - Date -
-
-
- ); - } - - renderSorting = () => { - const sort = this.props.columnField.desc; - return ( -
- -
-
this.changeColumnSort(true)}> - - Sort descending -
-
this.changeColumnSort(false)}> - - Sort ascending -
-
this.changeColumnSort(undefined)}> - - Clear sorting -
-
-
- ); - } - - renderColors = () => { - const selected = this.props.columnField.color; - - const pink = PastelSchemaPalette.get("pink2"); - const purple = PastelSchemaPalette.get("purple2"); - const blue = PastelSchemaPalette.get("bluegreen1"); - const yellow = PastelSchemaPalette.get("yellow4"); - const red = PastelSchemaPalette.get("red2"); - const gray = "#f1efeb"; - - return ( -
- -
-
this.changeColumnColor(pink!)}>
-
this.changeColumnColor(purple!)}>
-
this.changeColumnColor(blue!)}>
-
this.changeColumnColor(yellow!)}>
-
this.changeColumnColor(red!)}>
-
this.changeColumnColor(gray)}>
-
-
- ); - } - - renderContent = () => { - return ( -
- {this.props.onlyShowOptions ? <> : - <> - {this.renderTypes()} - {this.renderSorting()} - {this.renderColors()} -
- -
- - } -
- ); - } - - render() { - return ( -
- -
this.toggleIsOpen()}>{this.props.menuButtonContent}
- -
- ); - } -} - - -export interface KeysDropdownProps { - keyValue: string; - possibleKeys: string[]; - existingKeys: string[]; - canAddNew: boolean; - addNew: boolean; - onSelect: (oldKey: string, newKey: string, addnew: boolean, filter?: string) => void; - setIsEditing: (isEditing: boolean) => void; - width?: string; - docs?: Doc[]; - Document: Doc; - dataDoc: Doc | undefined; - fieldKey: string; - ContainingCollectionDoc: Doc | undefined; - ContainingCollectionView: Opt; - active?: (outsideReaction?: boolean) => boolean; - openHeader: (column: any, screenx: number, screeny: number) => void; - col: SchemaHeaderField; - icon: IconProp; -} -@observer -export class KeysDropdown extends React.Component { - @observable private _key: string = this.props.keyValue; - @observable private _searchTerm: string = this.props.keyValue; - @observable private _isOpen: boolean = false; - @observable private _node: HTMLDivElement | null = null; - @observable private _inputRef: React.RefObject = React.createRef(); - - @action setSearchTerm = (value: string): void => { this._searchTerm = value; }; - @action setKey = (key: string): void => { this._key = key; }; - @action setIsOpen = (isOpen: boolean): void => { this._isOpen = isOpen; }; - - @action - onSelect = (key: string): void => { - this.props.onSelect(this._key, key, this.props.addNew); - this.setKey(key); - this._isOpen = false; - this.props.setIsEditing(false); - } - - @action - setNode = (node: HTMLDivElement): void => { - if (node) { - this._node = node; - } - } - - componentDidMount() { - document.addEventListener("pointerdown", this.detectClick); - const filters = Cast(this.props.Document._docFilters, listSpec("string")); - if (filters?.some(filter => filter.split(":")[0] === this._key)) { - runInAction(() => this.closeResultsVisibility = "contents"); - } - } - - @action - detectClick = (e: PointerEvent): void => { - if (this._node && this._node.contains(e.target as Node)) { - } else { - this._isOpen = false; - this.props.setIsEditing(false); - } - } - - private tempfilter: string = ""; - @undoBatch - onKeyDown = (e: React.KeyboardEvent): void => { - if (e.key === "Enter") { - if (this._searchTerm.includes(":")) { - const colpos = this._searchTerm.indexOf(":"); - const temp = this._searchTerm.slice(colpos + 1, this._searchTerm.length); - if (temp === "") { - Doc.setDocFilter(this.props.Document, this._key, this.tempfilter, "remove"); - this.updateFilter(); - } - else { - Doc.setDocFilter(this.props.Document, this._key, this.tempfilter, "remove"); - this.tempfilter = temp; - Doc.setDocFilter(this.props.Document, this._key, temp, "check"); - this.props.col.setColor("green"); - this.closeResultsVisibility = "contents"; - } - } - else { - Doc.setDocFilter(this.props.Document, this._key, this.tempfilter, "remove"); - this.updateFilter(); - if (this.showKeys.length) { - this.onSelect(this.showKeys[0]); - } else if (this._searchTerm !== "" && this.props.canAddNew) { - this.setSearchTerm(this._searchTerm || this._key); - this.onSelect(this._searchTerm); - } - } - } - } - - onChange = (val: string): void => { - this.setSearchTerm(val); - } - - @action - onFocus = (e: React.FocusEvent): void => { - this._isOpen = true; - this.props.setIsEditing(true); - } - - @computed get showKeys() { - const whitelistKeys = ["context", "author", "*lastModified", "text", "data", "tags", "creationDate"]; - const keyOptions = this._searchTerm === "" ? this.props.possibleKeys : this.props.possibleKeys.filter(key => key.toUpperCase().indexOf(this._searchTerm.toUpperCase()) > -1); - const showKeys = new Set(); - [...keyOptions, ...whitelistKeys].forEach(key => (!Doc.UserDoc().noviceMode || - whitelistKeys.includes(key) - || ((!key.startsWith("_") && key[0] === key[0].toUpperCase()) || key[0] === "#")) ? showKeys.add(key) : null); - return Array.from(showKeys.keys()).filter(key => !this._searchTerm || key.includes(this._searchTerm)); - } - @action - renderOptions = (): JSX.Element[] | JSX.Element => { - if (!this._isOpen) { - this.defaultMenuHeight = 0; - return <>; - } - const options = this.showKeys.map(key => { - return
{ - e.stopPropagation(); - }} - onClick={() => { - this.onSelect(key); - this.setSearchTerm(""); - }}>{key}
; - }); - - // if search term does not already exist as a group type, give option to create new group type - - if (this._key !== this._searchTerm.slice(0, this._key.length)) { - if (this._searchTerm !== "" && this.props.canAddNew) { - options.push(
{ this.onSelect(this._searchTerm); this.setSearchTerm(""); }}> - Create "{this._searchTerm}" key
); - } - } - - if (options.length === 0) { - this.defaultMenuHeight = 0; - } - else { - if (this.props.docs) { - const panesize = this.props.docs.length * 30; - options.length * 20 + 8 - 10 > panesize ? this.defaultMenuHeight = panesize : this.defaultMenuHeight = options.length * 20 + 8; - } - else { - options.length > 5 ? this.defaultMenuHeight = 108 : this.defaultMenuHeight = options.length * 20 + 8; - } - } - return options; - } - - docSafe: Doc[] = []; - - @action - renderFilterOptions = (): JSX.Element[] | JSX.Element => { - if (!this._isOpen || !this.props.dataDoc) { - this.defaultMenuHeight = 0; - return <>; - } - const keyOptions: string[] = []; - const colpos = this._searchTerm.indexOf(":"); - const temp = this._searchTerm.slice(colpos + 1, this._searchTerm.length); - if (this.docSafe.length === 0) { - this.docSafe = DocListCast(this.props.dataDoc[this.props.fieldKey]); - } - const docs = this.docSafe; - docs.forEach((doc) => { - const key = StrCast(doc[this._key]); - if (keyOptions.includes(key) === false && key.includes(temp) && key !== "") { - keyOptions.push(key); - } - }); - - const filters = Cast(this.props.Document._docFilters, listSpec("string")); - if (filters === undefined || filters.length === 0 || filters.some(filter => filter.split(":")[0] === this._key) === false) { - this.props.col.setColor("rgb(241, 239, 235)"); - this.closeResultsVisibility = "none"; - } - for (let i = 0; i < (filters?.length ?? 0) - 1; i++) { - if (filters![i] === this.props.col.heading && keyOptions.includes(filters![i].split(":")[1]) === false) { - keyOptions.push(filters![i + 1]); - } - } - const options = keyOptions.map(key => { - let bool = false; - if (filters !== undefined) { - const ind = filters.findIndex(filter => filter.split(":")[0] === key); - const fields = ind === -1 ? undefined : filters[ind].split(":"); - bool = fields ? fields[1] === "check" : false; - } - return
- e.stopPropagation()} - onClick={e => e.stopPropagation()} - onChange={(e) => { - e.target.checked === true ? Doc.setDocFilter(this.props.Document, this._key, key, "check") : Doc.setDocFilter(this.props.Document, this._key, key, "remove"); - e.target.checked === true ? this.closeResultsVisibility = "contents" : console.log(""); - e.target.checked === true ? this.props.col.setColor("green") : this.updateFilter(); - e.target.checked === true && SearchBox.Instance.filter === true ? Doc.setDocFilter(docs[0], this._key, key, "check") : Doc.setDocFilter(docs[0], this._key, key, "remove"); - }} - checked={bool} - /> - - {key} - - -
; - }); - if (options.length === 0) { - this.defaultMenuHeight = 0; - } - else { - if (this.props.docs) { - const panesize = this.props.docs.length * 30; - options.length * 20 + 8 - 10 > panesize ? this.defaultMenuHeight = panesize : this.defaultMenuHeight = options.length * 20 + 8; - } - else { - options.length > 5 ? this.defaultMenuHeight = 108 : this.defaultMenuHeight = options.length * 20 + 8; - } - - } - return options; - } - - @observable defaultMenuHeight = 0; - - - updateFilter() { - const filters = Cast(this.props.Document._docFilters, listSpec("string")); - if (filters === undefined || filters.length === 0 || filters.some(filter => filter.split(":")[0] === this._key) === false) { - this.props.col.setColor("rgb(241, 239, 235)"); - this.closeResultsVisibility = "none"; - } - } - - @computed get scriptField() { - const scriptText = "setDocFilter(containingTreeView, heading, this.title, checked)"; - const script = ScriptField.MakeScript(scriptText, { this: Doc.name, heading: "string", checked: "string", containingTreeView: Doc.name }); - return script ? () => script : undefined; - } - filterBackground = () => "rgba(105, 105, 105, 0.432)"; - @observable filterOpen: boolean | undefined = undefined; - closeResultsVisibility: string = "none"; - - removeFilters = (e: React.PointerEvent): void => { - const keyOptions: string[] = []; - if (this.docSafe.length === 0 && this.props.dataDoc) { - this.docSafe = DocListCast(this.props.dataDoc[this.props.fieldKey]); - } - const docs = this.docSafe; - docs.forEach((doc) => { - const key = StrCast(doc[this._key]); - if (keyOptions.includes(key) === false) { - keyOptions.push(key); - } - }); - - Doc.setDocFilter(this.props.Document, this._key, "", "remove"); - this.props.col.setColor("rgb(241, 239, 235)"); - this.closeResultsVisibility = "none"; - } - render() { - return ( -
- { this.props.openHeader(this.props.col, e.clientX, e.clientY); e.stopPropagation(); }} icon={this.props.icon} size="lg" style={{ display: "inline", paddingBottom: "1px", paddingTop: "4px", cursor: "hand" }} /> - - {/* { - runInAction(() => { this._isOpen === undefined ? this._isOpen = true : this._isOpen = !this._isOpen }) - }} /> */} - -
- this.onChange(e.target.value)} - onClick={(e) => { e.stopPropagation(); this._inputRef.current?.focus(); }} - onFocus={this.onFocus} > -
- -
- {!this._isOpen ? (null) :
- {this._searchTerm.includes(":") ? this.renderFilterOptions() : this.renderOptions()} -
} -
-
- ); - } -} diff --git a/src/client/views/collections/schemaView/CollectionSchemaMovableColumn.tsx b/src/client/views/collections/schemaView/CollectionSchemaMovableColumn.tsx deleted file mode 100644 index 456c38c68..000000000 --- a/src/client/views/collections/schemaView/CollectionSchemaMovableColumn.tsx +++ /dev/null @@ -1,128 +0,0 @@ -import React = require("react"); -import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { action } from "mobx"; -import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table"; -import { Doc } from "../../../../fields/Doc"; -import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; -import { Cast, FieldValue, StrCast } from "../../../../fields/Types"; -import { DocumentManager } from "../../../util/DocumentManager"; -import { DragManager, dropActionType, SetupDrag } from "../../../util/DragManager"; -import { SnappingManager } from "../../../util/SnappingManager"; -import { Transform } from "../../../util/Transform"; -import { undoBatch } from "../../../util/UndoManager"; -import { ContextMenu } from "../../ContextMenu"; -import "./CollectionSchemaView.scss"; - -export interface MovableColumnProps { - columnRenderer: TableCellRenderer; - columnValue: SchemaHeaderField; - allColumns: SchemaHeaderField[]; - reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columns: SchemaHeaderField[]) => void; - ScreenToLocalTransform: () => Transform; -} -export class MovableColumn extends React.Component { - private _header?: React.RefObject = React.createRef(); - private _colDropDisposer?: DragManager.DragDropDisposer; - private _startDragPosition: { x: number, y: number } = { x: 0, y: 0 }; - private _sensitivity: number = 16; - private _dragRef: React.RefObject = React.createRef(); - - onPointerEnter = (e: React.PointerEvent): void => { - if (e.buttons === 1 && SnappingManager.GetIsDragging()) { - this._header!.current!.className = "collectionSchema-col-wrapper"; - document.addEventListener("pointermove", this.onDragMove, true); - } - } - onPointerLeave = (e: React.PointerEvent): void => { - this._header!.current!.className = "collectionSchema-col-wrapper"; - document.removeEventListener("pointermove", this.onDragMove, true); - !e.buttons && document.removeEventListener("pointermove", this.onPointerMove); - } - onDragMove = (e: PointerEvent): void => { - const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top); - const before = x[0] < bounds[0]; - this._header!.current!.className = "collectionSchema-col-wrapper"; - if (before) this._header!.current!.className += " col-before"; - if (!before) this._header!.current!.className += " col-after"; - e.stopPropagation(); - } - - createColDropTarget = (ele: HTMLDivElement) => { - this._colDropDisposer?.(); - if (ele) { - this._colDropDisposer = DragManager.MakeDropTarget(ele, this.colDrop.bind(this)); - } - } - - colDrop = (e: Event, de: DragManager.DropEvent) => { - document.removeEventListener("pointermove", this.onDragMove, true); - const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left + ((rect.right - rect.left) / 2), rect.top); - const before = x[0] < bounds[0]; - const colDragData = de.complete.columnDragData; - if (colDragData) { - e.stopPropagation(); - this.props.reorderColumns(colDragData.colKey, this.props.columnValue, before, this.props.allColumns); - return true; - } - return false; - } - - onPointerMove = (e: PointerEvent) => { - const onRowMove = (e: PointerEvent) => { - e.stopPropagation(); - e.preventDefault(); - - document.removeEventListener("pointermove", onRowMove); - document.removeEventListener('pointerup', onRowUp); - const dragData = new DragManager.ColumnDragData(this.props.columnValue); - DragManager.StartColumnDrag(this._dragRef.current!, dragData, e.x, e.y); - }; - const onRowUp = (): void => { - document.removeEventListener("pointermove", onRowMove); - document.removeEventListener('pointerup', onRowUp); - }; - if (e.buttons === 1) { - const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX - this._startDragPosition.x, e.clientY - this._startDragPosition.y); - if (Math.abs(dx) + Math.abs(dy) > this._sensitivity) { - document.removeEventListener("pointermove", this.onPointerMove); - e.stopPropagation(); - - document.addEventListener("pointermove", onRowMove); - document.addEventListener("pointerup", onRowUp); - } - } - } - - onPointerUp = (e: React.PointerEvent) => { - document.removeEventListener("pointermove", this.onPointerMove); - } - - @action - onPointerDown = (e: React.PointerEvent, ref: React.RefObject) => { - this._dragRef = ref; - const [dx, dy] = this.props.ScreenToLocalTransform().transformDirection(e.clientX, e.clientY); - if (!(e.target as any)?.tagName.includes("INPUT")) { - this._startDragPosition = { x: dx, y: dy }; - document.addEventListener("pointermove", this.onPointerMove); - } - } - - - render() { - const reference = React.createRef(); - - return ( -
-
-
this.onPointerDown(e, reference)} onPointerUp={this.onPointerUp}> - {this.props.columnRenderer} -
-
-
- ); - } -} diff --git a/src/client/views/collections/schemaView/CollectionSchemaMovableRow.tsx b/src/client/views/collections/schemaView/CollectionSchemaMovableRow.tsx deleted file mode 100644 index f48906ba5..000000000 --- a/src/client/views/collections/schemaView/CollectionSchemaMovableRow.tsx +++ /dev/null @@ -1,147 +0,0 @@ -import React = require("react"); -import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { action } from "mobx"; -import { ReactTableDefaults, RowInfo, TableCellRenderer } from "react-table"; -import { Doc } from "../../../../fields/Doc"; -import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; -import { Cast, FieldValue, StrCast } from "../../../../fields/Types"; -import { DocumentManager } from "../../../util/DocumentManager"; -import { DragManager, dropActionType, SetupDrag } from "../../../util/DragManager"; -import { SnappingManager } from "../../../util/SnappingManager"; -import { Transform } from "../../../util/Transform"; -import { undoBatch } from "../../../util/UndoManager"; -import { ContextMenu } from "../../ContextMenu"; -import "./CollectionSchemaView.scss"; - -export interface MovableRowProps { - rowInfo: RowInfo; - ScreenToLocalTransform: () => Transform; - addDoc: (doc: Doc | Doc[], relativeTo?: Doc, before?: boolean) => boolean; - removeDoc: (doc: Doc | Doc[]) => boolean; - rowFocused: boolean; - textWrapRow: (doc: Doc) => void; - rowWrapped: boolean; - dropAction: string; - addDocTab: any; -} - -export class MovableRow extends React.Component { - private _header?: React.RefObject = React.createRef(); - private _rowDropDisposer?: DragManager.DragDropDisposer; - - // Event listeners are only necessary when the user is hovering over the table - // Create one when the mouse starts hovering... - onPointerEnter = (e: React.PointerEvent): void => { - if (e.buttons === 1 && SnappingManager.GetIsDragging()) { - this._header!.current!.className = "collectionSchema-row-wrapper"; - document.addEventListener("pointermove", this.onDragMove, true); - } - } - // ... and delete it when the mouse leaves - onPointerLeave = (e: React.PointerEvent): void => { - this._header!.current!.className = "collectionSchema-row-wrapper"; - document.removeEventListener("pointermove", this.onDragMove, true); - } - // The method for the event listener, reorders columns when dragged to their new locations. - onDragMove = (e: PointerEvent): void => { - const x = this.props.ScreenToLocalTransform().transformPoint(e.clientX, e.clientY); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); - const before = x[1] < bounds[1]; - this._header!.current!.className = "collectionSchema-row-wrapper"; - if (before) this._header!.current!.className += " row-above"; - if (!before) this._header!.current!.className += " row-below"; - e.stopPropagation(); - } - componentWillUnmount() { - - this._rowDropDisposer?.(); - } - // - createRowDropTarget = (ele: HTMLDivElement) => { - this._rowDropDisposer?.(); - if (ele) { - this._rowDropDisposer = DragManager.MakeDropTarget(ele, this.rowDrop.bind(this)); - } - } - // Controls what hppens when a row is dragged and dropped - rowDrop = (e: Event, de: DragManager.DropEvent) => { - this.onPointerLeave(e as any); - const rowDoc = FieldValue(Cast(this.props.rowInfo.original, Doc)); - if (!rowDoc) return false; - - const x = this.props.ScreenToLocalTransform().transformPoint(de.x, de.y); - const rect = this._header!.current!.getBoundingClientRect(); - const bounds = this.props.ScreenToLocalTransform().transformPoint(rect.left, rect.top + rect.height / 2); - const before = x[1] < bounds[1]; - - const docDragData = de.complete.docDragData; - if (docDragData) { - e.stopPropagation(); - if (docDragData.draggedDocuments[0] === rowDoc) return true; - const addDocument = (doc: Doc | Doc[]) => this.props.addDoc(doc, rowDoc, before); - const movedDocs = docDragData.draggedDocuments; - return (docDragData.dropAction || docDragData.userDropAction) ? - docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before) || added, false) - : (docDragData.moveDocument) ? - movedDocs.reduce((added: boolean, d) => docDragData.moveDocument?.(d, rowDoc, addDocument) || added, false) - : docDragData.droppedDocuments.reduce((added: boolean, d) => this.props.addDoc(d, rowDoc, before), false); - } - return false; - } - - onRowContextMenu = (e: React.MouseEvent): void => { - const description = this.props.rowWrapped ? "Unwrap text on row" : "Text wrap row"; - ContextMenu.Instance.addItem({ description: description, event: () => this.props.textWrapRow(this.props.rowInfo.original), icon: "file-pdf" }); - } - - @undoBatch - @action - move: DragManager.MoveFunction = (doc: Doc | Doc[], targetCollection: Doc | undefined, addDoc) => { - const targetView = targetCollection && DocumentManager.Instance.getDocumentView(targetCollection); - return doc !== targetCollection && doc !== targetView?.props.ContainingCollectionDoc && this.props.removeDoc(doc) && addDoc(doc); - } - - @action - onKeyDown = (e: React.KeyboardEvent) => { - console.log("yes"); - if (e.key === "Backspace" || e.key === "Delete") { - undoBatch(() => this.props.removeDoc(this.props.rowInfo.original)); - } - } - - render() { - const { children = null, rowInfo } = this.props; - - if (!rowInfo) { - return {children}; - } - - const { original } = rowInfo; - const doc = FieldValue(Cast(original, Doc)); - - if (!doc) return (null); - - const reference = React.createRef(); - const onItemDown = SetupDrag(reference, () => doc, this.move, StrCast(this.props.dropAction) as dropActionType); - - let className = "collectionSchema-row"; - if (this.props.rowFocused) className += " row-focused"; - if (this.props.rowWrapped) className += " row-wrapped"; - - return ( -
-
- -
-
this.props.removeDoc(this.props.rowInfo.original))}>
-
-
this.props.addDocTab(this.props.rowInfo.original, "add:right")}>
-
- {children} -
-
-
- ); - } -} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/CollectionSchemaView.scss b/src/client/views/collections/schemaView/CollectionSchemaView.scss deleted file mode 100644 index b57fee0e4..000000000 --- a/src/client/views/collections/schemaView/CollectionSchemaView.scss +++ /dev/null @@ -1,552 +0,0 @@ -@import "../../globalCssVariables"; -.collectionSchemaView-container { - border-width: $COLLECTION_BORDER_WIDTH; - border-color: $intermediate-color; - border-style: solid; - border-radius: $border-radius; - box-sizing: border-box; - position: relative; - top: 0; - width: 100%; - height: 100%; - margin-top: 0; - transition: top 0.5s; - display: flex; - justify-content: space-between; - flex-wrap: nowrap; - touch-action: none; - div { - touch-action: none; - } - .collectionSchemaView-tableContainer { - width: 100%; - height: 100%; - } - .collectionSchemaView-dividerDragger { - position: relative; - height: 100%; - width: $SCHEMA_DIVIDER_WIDTH; - z-index: 20; - right: 0; - top: 0; - background: gray; - cursor: col-resize; - } - // .documentView-node:first-child { - // background: $light-color; - // } -} - -.collectionSchemaView-searchContainer { - border-width: $COLLECTION_BORDER_WIDTH; - border-color: $intermediate-color; - border-style: solid; - border-radius: $border-radius; - box-sizing: border-box; - position: relative; - top: 0; - width: 100%; - height: 100%; - margin-top: 0; - transition: top 0.5s; - display: flex; - justify-content: space-between; - flex-wrap: nowrap; - touch-action: none; - padding: 2px; - div { - touch-action: none; - } - .collectionSchemaView-tableContainer { - width: 100%; - height: 100%; - } - .collectionSchemaView-dividerDragger { - position: relative; - height: 100%; - width: 20px; - z-index: 20; - right: 0; - top: 0; - background: gray; - cursor: col-resize; - } - // .documentView-node:first-child { - // background: $light-color; - // } -} - -.ReactTable { - width: 100%; - background: white; - box-sizing: border-box; - border: none !important; - float: none !important; - .rt-table { - height: 100%; - display: -webkit-inline-box; - direction: ltr; - overflow: visible; - } - .rt-noData { - display: none; - } - .rt-thead { - width: 100%; - z-index: 100; - overflow-y: visible; - &.-header { - font-size: 12px; - height: 30px; - box-shadow: none; - z-index: 100; - overflow-y: visible; - } - .rt-resizable-header-content { - height: 100%; - overflow: visible; - } - .rt-th { - padding: 0; - border: solid lightgray; - border-width: 0 1px; - border-bottom: 2px solid lightgray; - } - } - .rt-th { - font-size: 13px; - text-align: center; - &:last-child { - overflow: visible; - } - } - .rt-tbody { - width: 100%; - direction: rtl; - overflow: visible; - .rt-td { - border-right: 1px solid rgba(0, 0, 0, 0.2); - } - } - .rt-tr-group { - direction: ltr; - flex: 0 1 auto; - min-height: 30px; - border: 0 !important; - } - .rt-tr { - width: 100%; - min-height: 30px; - } - .rt-td { - padding: 0; - font-size: 13px; - text-align: center; - white-space: nowrap; - display: flex; - align-items: center; - .imageBox-cont { - position: relative; - max-height: 100%; - } - .imageBox-cont img { - object-fit: contain; - max-width: 100%; - height: 100%; - } - .videoBox-cont { - object-fit: contain; - width: auto; - height: 100%; - } - } - .rt-td.rt-expandable { - display: flex; - align-items: center; - height: inherit; - } - .rt-resizer { - width: 8px; - right: -4px; - } - .rt-resizable-header { - padding: 0; - height: 30px; - } - .rt-resizable-header:last-child { - overflow: visible; - .rt-resizer { - width: 5px !important; - } - } -} - -.documentView-node-topmost { - text-align: left; - transform-origin: center top; - display: inline-block; -} - -.collectionSchema-col { - height: 100%; -} - -.collectionSchema-header-menu { - height: auto; - z-index: 100; - position: absolute; - background: white; - padding: 5px; - position: fixed; - background: white; - border: black 1px solid; - .collectionSchema-header-toggler { - z-index: 100; - width: 100%; - height: 100%; - padding: 4px; - letter-spacing: 2px; - text-transform: uppercase; - svg { - margin-right: 4px; - } - } -} - -.collectionSchemaView-header { - height: 100%; - color: gray; - z-index: 100; - overflow-y: visible; - display: flex; - justify-content: space-between; - flex-wrap: wrap; -} - -button.add-column { - width: 28px; -} - -.collectionSchema-header-menuOptions { - color: black; - width: 180px; - text-align: left; - .collectionSchema-headerMenu-group { - padding: 7px 0; - border-bottom: 1px solid lightgray; - cursor: pointer; - &:first-child { - padding-top: 0; - } - &:last-child { - border: none; - text-align: center; - padding: 12px 0 0 0; - } - } - label { - color: $main-accent; - font-weight: normal; - letter-spacing: 2px; - text-transform: uppercase; - } - input { - color: black; - width: 100%; - } - .columnMenu-option { - cursor: pointer; - padding: 3px; - background-color: white; - transition: background-color 0.2s; - &:hover { - background-color: $light-color-secondary; - } - &.active { - font-weight: bold; - border: 2px solid $light-color-secondary; - } - svg { - color: gray; - margin-right: 5px; - width: 10px; - } - } - .keys-dropdown { - position: relative; - //width: 100%; - background-color: white; - input { - border: 2px solid $light-color-secondary; - padding: 3px; - height: 28px; - font-weight: bold; - letter-spacing: "2px"; - text-transform: "uppercase"; - &:focus { - font-weight: normal; - } - } - .keys-options-wrapper { - width: 100%; - max-height: 150px; - overflow-y: scroll; - position: absolute; - top: 28px; - box-shadow: 0 10px 16px rgba(0, 0, 0, 0.1); - background-color: white; - .key-option { - background-color: white; - border: 1px solid lightgray; - padding: 2px 3px; - &:not(:first-child) { - border-top: 0; - } - &:hover { - background-color: $light-color-secondary; - } - } - } - } - .columnMenu-colors { - display: flex; - justify-content: space-between; - flex-wrap: wrap; - .columnMenu-colorPicker { - cursor: pointer; - width: 20px; - height: 20px; - border-radius: 10px; - &.active { - border: 2px solid white; - box-shadow: 0 0 0 2px lightgray; - } - } - } -} - -.collectionSchema-row { - height: 100%; - background-color: white; - &.row-focused .rt-td { - background-color: #bfffc0; //$light-color-secondary; - } - &.row-wrapped { - .rt-td { - white-space: normal; - } - } - .row-dragger { - display: flex; - justify-content: space-around; - //flex: 50 0 auto; - width: 0; - max-width: 50px; - //height: 100%; - min-height: 30px; - align-items: center; - color: lightgray; - background-color: white; - transition: color 0.1s ease; - .row-option { - // padding: 5px; - cursor: pointer; - position: absolute; - transition: color 0.1s ease; - display: flex; - flex-direction: column; - justify-content: center; - z-index: 2; - &:hover { - color: gray; - } - } - } - .collectionSchema-row-wrapper { - &.row-above { - border-top: 1px solid red; - } - &.row-below { - border-bottom: 1px solid red; - } - &.row-inside { - border: 1px solid red; - } - .row-dragging { - background-color: blue; - } - } -} - -.collectionSchemaView-cellContainer { - width: 100%; - height: unset; -} - -.collectionSchemaView-cellWrapper { - height: 100%; - padding: 4px; - text-align: left; - padding-left: 19px; - position: relative; - &:focus { - outline: none; - } - &.editing { - padding: 0; - input { - outline: 0; - border: none; - background-color: rgb(255, 217, 217); - width: 100%; - height: 100%; - padding: 2px 3px; - min-height: 26px; - } - } - &.focused { - &.inactive { - border: none; - } - } - p { - width: 100%; - height: 100%; - } - &:hover .collectionSchemaView-cellContents-docExpander { - display: block; - } - .collectionSchemaView-cellContents-document { - display: inline-block; - } - .collectionSchemaView-cellContents-docButton { - float: right; - width: "15px"; - height: "15px"; - } - .collectionSchemaView-dropdownWrapper { - border: grey; - border-style: solid; - border-width: 1px; - height: 30px; - .collectionSchemaView-dropdownButton { - //display: inline-block; - float: left; - height: 100%; - } - .collectionSchemaView-dropdownText { - display: inline-block; - //float: right; - height: 100%; - display: "flex"; - font-size: 13; - justify-content: "center"; - align-items: "center"; - } - } - .collectionSchemaView-dropdownContainer { - position: absolute; - border: 1px solid rgba(0, 0, 0, 0.04); - box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14); - .collectionSchemaView-dropdownOption:hover { - background-color: rgba(0, 0, 0, 0.14); - cursor: pointer; - } - } -} - -.collectionSchemaView-cellContents-docExpander { - height: 30px; - width: 30px; - display: none; - position: absolute; - top: 0; - right: 0; - background-color: lightgray; -} - -.doc-drag-over { - background-color: red; -} - -.collectionSchemaView-toolbar { - z-index: 100; -} - -.collectionSchemaView-toolbar { - height: 30px; - display: flex; - justify-content: flex-end; - padding: 0 10px; - border-bottom: 2px solid gray; - .collectionSchemaView-toolbar-item { - display: flex; - flex-direction: column; - justify-content: center; - } -} - -#preview-schema-checkbox-div { - margin-left: 20px; - font-size: 12px; -} - -.collectionSchemaView-table { - width: 100%; - height: 100%; - overflow: auto; - padding: 3px; -} - -.rt-td.rt-expandable { - overflow: visible; - position: relative; - height: 100%; - z-index: 1; -} - -.reactTable-sub { - background-color: rgb(252, 252, 252); - width: 100%; - .rt-thead { - display: none; - } - .row-dragger { - background-color: rgb(252, 252, 252); - } - .rt-table { - background-color: rgb(252, 252, 252); - } - .collectionSchemaView-table { - width: 100%; - border: solid 1px; - overflow: visible; - padding: 0px; - } -} - -.collectionSchemaView-expander { - height: 100%; - min-height: 30px; - position: absolute; - color: gray; - width: 20; - height: auto; - left: 55; - svg { - position: absolute; - top: 50%; - left: 10; - transform: translate(-50%, -50%); - } -} - -.collectionSchemaView-addRow { - color: gray; - letter-spacing: 2px; - text-transform: uppercase; - cursor: pointer; - font-size: 10.5px; - margin-left: 50px; - margin-top: 10px; -} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/CollectionSchemaView.tsx b/src/client/views/collections/schemaView/CollectionSchemaView.tsx deleted file mode 100644 index ef28f75c8..000000000 --- a/src/client/views/collections/schemaView/CollectionSchemaView.tsx +++ /dev/null @@ -1,575 +0,0 @@ -import React = require("react"); -import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; -import { action, computed, observable, untracked } from "mobx"; -import { observer } from "mobx-react"; -import Measure from "react-measure"; -import { Resize } from "react-table"; -import "react-table/react-table.css"; -import { Doc, Opt } from "../../../../fields/Doc"; -import { List } from "../../../../fields/List"; -import { listSpec } from "../../../../fields/Schema"; -import { PastelSchemaPalette, SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; -import { Cast, NumCast } from "../../../../fields/Types"; -import { TraceMobx } from "../../../../fields/util"; -import { emptyFunction, emptyPath, returnFalse, setupMoveUpEvents, returnEmptyDoclist, returnTrue } from "../../../../Utils"; -import { SelectionManager } from "../../../util/SelectionManager"; -import { SnappingManager } from "../../../util/SnappingManager"; -import { Transform } from "../../../util/Transform"; -import { undoBatch } from "../../../util/UndoManager"; -import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../globalCssVariables.scss'; -import { ContextMenu } from "../../ContextMenu"; -import { ContextMenuProps } from "../../ContextMenuItem"; -import '../../../views/DocumentDecorations.scss'; -import { DocumentView } from "../../nodes/DocumentView"; -import { DefaultStyleProvider } from "../../StyleProvider"; -import "./CollectionSchemaView.scss"; -import { CollectionSubView } from "../CollectionSubView"; -import { SchemaTable } from "./SchemaTable"; -import { DocUtils } from "../../../documents/Documents"; -// bcz: need to add drag and drop of rows and columns. This seems like it might work for rows: https://codesandbox.io/s/l94mn1q657 - -export enum ColumnType { - Any, - Number, - String, - Boolean, - Doc, - Image, - List, - Date -} -// this map should be used for keys that should have a const type of value -const columnTypes: Map = new Map([ - ["title", ColumnType.String], - ["x", ColumnType.Number], ["y", ColumnType.Number], ["_width", ColumnType.Number], ["_height", ColumnType.Number], - ["_nativeWidth", ColumnType.Number], ["_nativeHeight", ColumnType.Number], ["isPrototype", ColumnType.Boolean], - ["_curPage", ColumnType.Number], ["_currentTimecode", ColumnType.Number], ["zIndex", ColumnType.Number] -]); - -@observer -export class CollectionSchemaView extends CollectionSubView(doc => doc) { - private _previewCont?: HTMLDivElement; - - @observable _previewDoc: Doc | undefined = undefined; - @observable _focusedTable: Doc = this.props.Document; - @observable _col: any = ""; - @observable _menuWidth = 0; - @observable _headerOpen = false; - @observable _headerIsEditing = false; - @observable _menuHeight = 0; - @observable _pointerX = 0; - @observable _pointerY = 0; - @observable _openTypes: boolean = false; - - @computed get previewWidth() { return () => NumCast(this.props.Document.schemaPreviewWidth); } - @computed get previewHeight() { return () => this.props.PanelHeight() - 2 * this.borderWidth; } - @computed get tableWidth() { return this.props.PanelWidth() - 2 * this.borderWidth - Number(SCHEMA_DIVIDER_WIDTH) - this.previewWidth(); } - @computed get borderWidth() { return Number(COLLECTION_BORDER_WIDTH); } - @computed get scale() { return this.props.ScreenToLocalTransform().Scale; } - @computed get columns() { return Cast(this.props.Document._schemaHeaders, listSpec(SchemaHeaderField), []); } - set columns(columns: SchemaHeaderField[]) { this.props.Document._schemaHeaders = new List(columns); } - - @computed get menuCoordinates() { - let searchx = 0; - let searchy = 0; - if (this.props.Document._searchDoc) { - const el = document.getElementsByClassName("collectionSchemaView-searchContainer")[0]; - if (el !== undefined) { - const rect = el.getBoundingClientRect(); - searchx = rect.x; - searchy = rect.y; - } - } - const x = Math.max(0, Math.min(document.body.clientWidth - this._menuWidth, this._pointerX)) - searchx; - const y = Math.max(0, Math.min(document.body.clientHeight - this._menuHeight, this._pointerY)) - searchy; - return this.props.ScreenToLocalTransform().transformPoint(x, y); - } - - get documentKeys() { - const docs = this.childDocs; - const keys: { [key: string]: boolean } = {}; - // bcz: ugh. this is untracked since otherwise a large collection of documents will blast the server for all their fields. - // then as each document's fields come back, we update the documents _proxies. Each time we do this, the whole schema will be - // invalidated and re-rendered. This workaround will inquire all of the document fields before the options button is clicked. - // then by the time the options button is clicked, all of the fields should be in place. If a new field is added while this menu - // is displayed (unlikely) it won't show up until something else changes. - //TODO Types - untracked(() => docs.map(doc => Doc.GetAllPrototypes(doc).map(proto => Object.keys(proto).forEach(key => keys[key] = false)))); - - this.columns.forEach(key => keys[key.heading] = true); - return Array.from(Object.keys(keys)); - } - - @action setHeaderIsEditing = (isEditing: boolean) => this._headerIsEditing = isEditing; - - @undoBatch - setColumnType = action((columnField: SchemaHeaderField, type: ColumnType): void => { - this._openTypes = false; - if (columnTypes.get(columnField.heading)) return; - - const columns = this.columns; - const index = columns.indexOf(columnField); - if (index > -1) { - columnField.setType(NumCast(type)); - columns[index] = columnField; - this.columns = columns; - } - }); - - @undoBatch - setColumnColor = (columnField: SchemaHeaderField, color: string): void => { - const columns = this.columns; - const index = columns.indexOf(columnField); - if (index > -1) { - columnField.setColor(color); - columns[index] = columnField; - this.columns = columns; // need to set the columns to trigger rerender - } - } - - @undoBatch - @action - setColumnSort = (columnField: SchemaHeaderField, descending: boolean | undefined) => { - const columns = this.columns; - columns.forEach(col => col.setDesc(undefined)); - - const index = columns.findIndex(c => c.heading === columnField.heading); - const column = columns[index]; - column.setDesc(descending); - columns[index] = column; - this.columns = columns; - } - - renderTypes = (col: any) => { - if (columnTypes.get(col.heading)) return (null); - - const type = col.type; - - const anyType =
this.setColumnType(col, ColumnType.Any)}> - - Any -
; - - const numType =
this.setColumnType(col, ColumnType.Number)}> - - Number -
; - - const textType =
this.setColumnType(col, ColumnType.String)}> - - Text -
; - - const boolType =
this.setColumnType(col, ColumnType.Boolean)}> - - Checkbox -
; - - const listType =
this.setColumnType(col, ColumnType.List)}> - - List -
; - - const docType =
this.setColumnType(col, ColumnType.Doc)}> - - Document -
; - - const imageType =
this.setColumnType(col, ColumnType.Image)}> - - Image -
; - - const dateType =
this.setColumnType(col, ColumnType.Date)}> - - Date -
; - - - const allColumnTypes =
- {anyType} - {numType} - {textType} - {boolType} - {listType} - {docType} - {imageType} - {dateType} -
; - - const justColType = type === ColumnType.Any ? anyType : type === ColumnType.Number ? numType : - type === ColumnType.String ? textType : type === ColumnType.Boolean ? boolType : - type === ColumnType.List ? listType : type === ColumnType.Doc ? docType : - type === ColumnType.Date ? dateType : imageType; - - return ( -
this._openTypes = !this._openTypes)}> -
- - -
- {this._openTypes ? allColumnTypes : justColType} -
- ); - } - - renderSorting = (col: any) => { - const sort = col.desc; - return ( -
- -
-
this.setColumnSort(col, true)}> - - Sort descending -
-
this.setColumnSort(col, false)}> - - Sort ascending -
-
this.setColumnSort(col, undefined)}> - - Clear sorting -
-
-
- ); - } - - renderColors = (col: any) => { - const selected = col.color; - - const pink = PastelSchemaPalette.get("pink2"); - const purple = PastelSchemaPalette.get("purple2"); - const blue = PastelSchemaPalette.get("bluegreen1"); - const yellow = PastelSchemaPalette.get("yellow4"); - const red = PastelSchemaPalette.get("red2"); - const gray = "#f1efeb"; - - return ( -
- -
-
this.setColumnColor(col, pink!)}>
-
this.setColumnColor(col, purple!)}>
-
this.setColumnColor(col, blue!)}>
-
this.setColumnColor(col, yellow!)}>
-
this.setColumnColor(col, red!)}>
-
this.setColumnColor(col, gray)}>
-
-
- ); - } - - @undoBatch - @action - changeColumns = (oldKey: string, newKey: string, addNew: boolean, filter?: string) => { - const columns = this.columns; - if (columns === undefined) { - this.columns = new List([new SchemaHeaderField(newKey, "f1efeb")]); - } else { - if (addNew) { - columns.push(new SchemaHeaderField(newKey, "f1efeb")); - this.columns = columns; - } else { - const index = columns.map(c => c.heading).indexOf(oldKey); - if (index > -1) { - const column = columns[index]; - column.setHeading(newKey); - columns[index] = column; - this.columns = columns; - if (filter) { - Doc.setDocFilter(this.props.Document, newKey, filter, "match"); - } - else { - this.props.Document._docFilters = undefined; - } - } - } - } - } - - @action - openHeader = (col: any, screenx: number, screeny: number) => { - this._col = col; - this._headerOpen = true; - this._pointerX = screenx; - this._pointerY = screeny; - } - - @action - closeHeader = () => { this._headerOpen = false; } - - @undoBatch - @action - deleteColumn = (key: string) => { - const columns = this.columns; - if (columns === undefined) { - this.columns = new List([]); - } else { - const index = columns.map(c => c.heading).indexOf(key); - if (index > -1) { - columns.splice(index, 1); - this.columns = columns; - } - } - this.closeHeader(); - } - - getPreviewTransform = (): Transform => { - return this.props.ScreenToLocalTransform().translate(- this.borderWidth - NumCast(COLLECTION_BORDER_WIDTH) - this.tableWidth, - this.borderWidth); - } - - @action - onHeaderClick = (e: React.PointerEvent) => { - e.stopPropagation(); - } - - @action - onWheel(e: React.WheelEvent) { - const scale = this.props.ScreenToLocalTransform().Scale; - this.props.isContentActive(true) && e.stopPropagation(); - } - - @computed get renderMenuContent() { - TraceMobx(); - return
- {this.renderTypes(this._col)} - {this.renderColors(this._col)} -
- -
-
; - } - - private createTarget = (ele: HTMLDivElement) => { - this._previewCont = ele; - super.CreateDropTarget(ele); - } - - isFocused = (doc: Doc, outsideReaction: boolean): boolean => this.props.isSelected(outsideReaction) && doc === this._focusedTable; - - @action setFocused = (doc: Doc) => this._focusedTable = doc; - - @action setPreviewDoc = (doc: Opt) => { - SelectionManager.SelectSchemaView(this, doc); - this._previewDoc = doc; - } - - //toggles preview side-panel of schema - @action - toggleExpander = () => { - this.props.Document.schemaPreviewWidth = this.previewWidth() === 0 ? Math.min(this.tableWidth / 3, 200) : 0; - } - - onDividerDown = (e: React.PointerEvent) => { - setupMoveUpEvents(this, e, this.onDividerMove, emptyFunction, this.toggleExpander); - } - @action - onDividerMove = (e: PointerEvent, down: number[], delta: number[]) => { - const nativeWidth = this._previewCont!.getBoundingClientRect(); - const minWidth = 40; - const maxWidth = 1000; - const movedWidth = this.props.ScreenToLocalTransform().transformDirection(nativeWidth.right - e.clientX, 0)[0]; - const width = movedWidth < minWidth ? minWidth : movedWidth > maxWidth ? maxWidth : movedWidth; - this.props.Document.schemaPreviewWidth = width; - return false; - } - - onPointerDown = (e: React.PointerEvent): void => { - if (e.button === 0 && !e.altKey && !e.ctrlKey && !e.metaKey) { - if (this.props.isSelected(true)) e.stopPropagation(); - else this.props.select(false); - } - } - - @computed - get previewDocument(): Doc | undefined { return this._previewDoc; } - - @computed - get dividerDragger() { - return this.previewWidth() === 0 ? (null) : -
-
-
; - } - - @computed - get previewPanel() { - return
- {!this.previewDocument ? (null) : - } -
; - } - - @computed - get schemaTable() { - return ; - } - - @computed - public get schemaToolbar() { - return
-
-
- - Show Preview -
-
-
; - } - - onSpecificMenu = (e: React.MouseEvent) => { - if ((e.target as any)?.className?.includes?.("collectionSchemaView-cell") || (e.target instanceof HTMLSpanElement)) { - const cm = ContextMenu.Instance; - const options = cm.findByDescription("Options..."); - const optionItems: ContextMenuProps[] = options && "subitems" in options ? options.subitems : []; - optionItems.push({ description: "remove", event: () => this._previewDoc && this.props.removeDocument?.(this._previewDoc), icon: "trash" }); - !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "compass" }); - cm.displayMenu(e.clientX, e.clientY); - (e.nativeEvent as any).SchemaHandled = true; // not sure why this is needed, but if you right-click quickly on a cell, the Document/Collection contextMenu handlers still fire without this. - e.stopPropagation(); - } - } - - @action - onTableClick = (e: React.MouseEvent): void => { - if (!(e.target as any)?.className?.includes?.("collectionSchemaView-cell") && !(e.target instanceof HTMLSpanElement)) { - this.setPreviewDoc(undefined); - } else { - e.stopPropagation(); - } - this.setFocused(this.props.Document); - this.closeHeader(); - } - - onResizedChange = (newResized: Resize[], event: any) => { - const columns = this.columns; - newResized.forEach(resized => { - const index = columns.findIndex(c => c.heading === resized.id); - const column = columns[index]; - column.setWidth(resized.value); - columns[index] = column; - }); - this.columns = columns; - } - - @action - setColumns = (columns: SchemaHeaderField[]) => this.columns = columns - - @undoBatch - reorderColumns = (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columnsValues: SchemaHeaderField[]) => { - const columns = [...columnsValues]; - const oldIndex = columns.indexOf(toMove); - const relIndex = columns.indexOf(relativeTo); - const newIndex = (oldIndex > relIndex && !before) ? relIndex + 1 : (oldIndex < relIndex && before) ? relIndex - 1 : relIndex; - - if (oldIndex === newIndex) return; - - columns.splice(newIndex, 0, columns.splice(oldIndex, 1)[0]); - this.columns = columns; - } - - onZoomMenu = (e: React.WheelEvent) => this.props.isContentActive(true) && e.stopPropagation(); - - render() { - TraceMobx(); - if (!this.props.isContentActive()) setTimeout(() => this.closeHeader(), 0); - const menuContent = this.renderMenuContent; - const menu =
this.onZoomMenu(e)} - onPointerDown={e => this.onHeaderClick(e)} - style={{ transform: `translate(${(this.menuCoordinates[0])}px, ${(this.menuCoordinates[1])}px)` }}> - { - const dim = this.props.ScreenToLocalTransform().inverse().transformDirection(r.offset.width, r.offset.height); - this._menuWidth = dim[0]; this._menuHeight = dim[1]; - })}> - {({ measureRef }) =>
{menuContent}
} -
-
; - return
-
this.props.isContentActive(true) && e.stopPropagation()} - onDrop={e => this.onExternalDrop(e, {})} - ref={this.createTarget}> - {this.schemaTable} -
- {this.dividerDragger} - {!this.previewWidth() ? (null) : this.previewPanel} - {this._headerOpen && this.props.isContentActive() ? menu : null} -
; - } -} \ No newline at end of file diff --git a/src/client/views/collections/schemaView/SchemaTable.tsx b/src/client/views/collections/schemaView/SchemaTable.tsx deleted file mode 100644 index 0d5c9e077..000000000 --- a/src/client/views/collections/schemaView/SchemaTable.tsx +++ /dev/null @@ -1,601 +0,0 @@ -import React = require("react"); -import { IconProp } from '@fortawesome/fontawesome-svg-core'; -import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; -import { action, computed, observable } from "mobx"; -import { observer } from "mobx-react"; -import ReactTable, { CellInfo, Column, ComponentPropsGetterR, Resize, SortingRule } from "react-table"; -import "react-table/react-table.css"; -import { DateField } from "../../../../fields/DateField"; -import { AclPrivate, AclReadonly, DataSym, Doc, DocListCast, Field, Opt } from "../../../../fields/Doc"; -import { Id } from "../../../../fields/FieldSymbols"; -import { List } from "../../../../fields/List"; -import { listSpec } from "../../../../fields/Schema"; -import { SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; -import { ComputedField } from "../../../../fields/ScriptField"; -import { Cast, FieldValue, NumCast, StrCast } from "../../../../fields/Types"; -import { ImageField } from "../../../../fields/URLField"; -import { GetEffectiveAcl } from "../../../../fields/util"; -import { emptyFunction, emptyPath, returnEmptyDoclist, returnEmptyFilter, returnFalse, returnTrue } from "../../../../Utils"; -import { Docs, DocumentOptions, DocUtils } from "../../../documents/Documents"; -import { DocumentType } from "../../../documents/DocumentTypes"; -import { CompileScript, Transformer, ts } from "../../../util/Scripting"; -import { Transform } from "../../../util/Transform"; -import { undoBatch } from "../../../util/UndoManager"; -import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../globalCssVariables.scss'; -import { ContextMenu } from "../../ContextMenu"; -import '../../../views/DocumentDecorations.scss'; -import { DocumentView } from "../../nodes/DocumentView"; -import { DefaultStyleProvider } from "../../StyleProvider"; -import { CellProps, CollectionSchemaButtons, CollectionSchemaCell, CollectionSchemaCheckboxCell, CollectionSchemaDateCell, CollectionSchemaDocCell, CollectionSchemaImageCell, CollectionSchemaListCell, CollectionSchemaNumberCell, CollectionSchemaStringCell } from "./CollectionSchemaCells"; -import { CollectionSchemaAddColumnHeader, KeysDropdown } from "./CollectionSchemaHeaders"; -import { MovableColumn } from "./CollectionSchemaMovableColumn"; -import { MovableRow } from "./CollectionSchemaMovableRow"; -import "./CollectionSchemaView.scss"; -import { CollectionView } from "../CollectionView"; - - -enum ColumnType { - Any, - Number, - String, - Boolean, - Doc, - Image, - List, - Date -} - -// this map should be used for keys that should have a const type of value -const columnTypes: Map = new Map([ - ["title", ColumnType.String], - ["x", ColumnType.Number], ["y", ColumnType.Number], ["_width", ColumnType.Number], ["_height", ColumnType.Number], - ["_nativeWidth", ColumnType.Number], ["_nativeHeight", ColumnType.Number], ["isPrototype", ColumnType.Boolean], - ["_curPage", ColumnType.Number], ["_currentTimecode", ColumnType.Number], ["zIndex", ColumnType.Number] -]); - -export interface SchemaTableProps { - Document: Doc; // child doc - dataDoc?: Doc; - PanelHeight: () => number; - PanelWidth: () => number; - childDocs?: Doc[]; - CollectionView: Opt; - ContainingCollectionView: Opt; - ContainingCollectionDoc: Opt; - fieldKey: string; - renderDepth: number; - deleteDocument?: (document: Doc | Doc[]) => boolean; - addDocument?: (document: Doc | Doc[]) => boolean; - moveDocument?: (document: Doc | Doc[], targetCollection: Doc | undefined, addDocument: (document: Doc | Doc[]) => boolean) => boolean; - ScreenToLocalTransform: () => Transform; - active: (outsideReaction: boolean | undefined) => boolean; - onDrop: (e: React.DragEvent, options: DocumentOptions, completed?: (() => void) | undefined) => void; - addDocTab: (document: Doc, where: string) => boolean; - pinToPres: (document: Doc) => void; - isSelected: (outsideReaction?: boolean) => boolean; - isFocused: (document: Doc, outsideReaction: boolean) => boolean; - setFocused: (document: Doc) => void; - setPreviewDoc: (document: Opt) => void; - columns: SchemaHeaderField[]; - documentKeys: any[]; - headerIsEditing: boolean; - openHeader: (column: any, screenx: number, screeny: number) => void; - onClick: (e: React.MouseEvent) => void; - onPointerDown: (e: React.PointerEvent) => void; - onResizedChange: (newResized: Resize[], event: any) => void; - setColumns: (columns: SchemaHeaderField[]) => void; - reorderColumns: (toMove: SchemaHeaderField, relativeTo: SchemaHeaderField, before: boolean, columnsValues: SchemaHeaderField[]) => void; - changeColumns: (oldKey: string, newKey: string, addNew: boolean) => void; - setHeaderIsEditing: (isEditing: boolean) => void; - changeColumnSort: (columnField: SchemaHeaderField, descending: boolean | undefined) => void; -} - -@observer -export class SchemaTable extends React.Component { - @observable _cellIsEditing: boolean = false; - @observable _focusedCell: { row: number, col: number } = { row: 0, col: 0 }; - @observable _openCollections: Set = new Set; - - @observable _showDoc: Doc | undefined; - @observable _showDataDoc: any = ""; - @observable _showDocPos: number[] = []; - - @observable _showTitleDropdown: boolean = false; - - @computed get previewWidth() { return () => NumCast(this.props.Document.schemaPreviewWidth); } - @computed get previewHeight() { return () => this.props.PanelHeight() - 2 * this.borderWidth; } - @computed get tableWidth() { return this.props.PanelWidth() - 2 * this.borderWidth - Number(SCHEMA_DIVIDER_WIDTH) - this.previewWidth(); } - - @computed get childDocs() { - if (this.props.childDocs) return this.props.childDocs; - - const doc = this.props.dataDoc ? this.props.dataDoc : this.props.Document; - return DocListCast(doc[this.props.fieldKey]); - } - set childDocs(docs: Doc[]) { - const doc = this.props.dataDoc ? this.props.dataDoc : this.props.Document; - doc[this.props.fieldKey] = new List(docs); - } - - @computed get textWrappedRows() { - return Cast(this.props.Document.textwrappedSchemaRows, listSpec("string"), []); - } - set textWrappedRows(textWrappedRows: string[]) { - this.props.Document.textwrappedSchemaRows = new List(textWrappedRows); - } - - @computed get resized(): { id: string, value: number }[] { - return this.props.columns.reduce((resized, shf) => { - (shf.width > -1) && resized.push({ id: shf.heading, value: shf.width }); - return resized; - }, [] as { id: string, value: number }[]); - } - @computed get sorted(): SortingRule[] { - return this.props.columns.reduce((sorted, shf) => { - shf.desc !== undefined && sorted.push({ id: shf.heading, desc: shf.desc }); - return sorted; - }, [] as SortingRule[]); - } - - @action - changeSorting = (col: any) => { - this.props.changeColumnSort(col, col.desc === true ? false : col.desc === false ? undefined : true); - } - - @action - changeTitleMode = () => this._showTitleDropdown = !this._showTitleDropdown - - @computed get borderWidth() { return Number(COLLECTION_BORDER_WIDTH); } - @computed get tableColumns(): Column[] { - const possibleKeys = this.props.documentKeys.filter(key => this.props.columns.findIndex(existingKey => existingKey.heading.toUpperCase() === key.toUpperCase()) === -1); - const columns: Column[] = []; - const tableIsFocused = this.props.isFocused(this.props.Document, false); - const focusedRow = this._focusedCell.row; - const focusedCol = this._focusedCell.col; - const isEditable = !this.props.headerIsEditing; - - columns.push({ - expander: true, Header: "", width: 58, - Expander: (rowInfo) => { - return rowInfo.original.type !== DocumentType.COL ? (null) : -
(this._openCollections[rowInfo.isExpanded ? "delete" : "add"])(rowInfo.viewIndex))}> - -
; - } - }); - columns.push(...this.props.columns.map(col => { - const icon: IconProp = this.getColumnType(col) === ColumnType.Number ? "hashtag" : this.getColumnType(col) === ColumnType.String ? "font" : - this.getColumnType(col) === ColumnType.Boolean ? "check-square" : this.getColumnType(col) === ColumnType.Doc ? "file" : - this.getColumnType(col) === ColumnType.Image ? "image" : this.getColumnType(col) === ColumnType.List ? "list-ul" : - this.getColumnType(col) === ColumnType.Date ? "calendar" : "align-justify"; - - const keysDropdown = c.heading)} - canAddNew={true} - addNew={false} - onSelect={this.props.changeColumns} - setIsEditing={this.props.setHeaderIsEditing} - docs={this.props.childDocs} - Document={this.props.Document} - dataDoc={this.props.dataDoc} - fieldKey={this.props.fieldKey} - ContainingCollectionDoc={this.props.ContainingCollectionDoc} - ContainingCollectionView={this.props.ContainingCollectionView} - active={this.props.active} - openHeader={this.props.openHeader} - icon={icon} - col={col} - // try commenting this out - width={"100%"} - />; - - const sortIcon = col.desc === undefined ? "caret-right" : col.desc === true ? "caret-down" : "caret-up"; - const header =
- {keysDropdown} -
this.changeSorting(col)} style={{ width: 21, padding: 1, display: "inline", zIndex: 1, background: "inherit", cursor: "hand" }}> - -
-
; - - return { - Header: , - accessor: (doc: Doc) => doc ? Field.toString(doc[col.heading] as Field) : 0, - id: col.heading, - Cell: (rowProps: CellInfo) => { - const rowIndex = rowProps.index; - const columnIndex = this.props.columns.map(c => c.heading).indexOf(rowProps.column.id!); - const isFocused = focusedRow === rowIndex && focusedCol === columnIndex && tableIsFocused; - - const props: CellProps = { - row: rowIndex, - col: columnIndex, - rowProps: rowProps, - isFocused: isFocused, - changeFocusedCellByIndex: this.changeFocusedCellByIndex, - CollectionView: this.props.CollectionView, - ContainingCollection: this.props.ContainingCollectionView, - Document: this.props.Document, - fieldKey: this.props.fieldKey, - renderDepth: this.props.renderDepth, - addDocTab: this.props.addDocTab, - pinToPres: this.props.pinToPres, - moveDocument: this.props.moveDocument, - setIsEditing: this.setCellIsEditing, - isEditable: isEditable, - setPreviewDoc: this.props.setPreviewDoc, - setComputed: this.setComputed, - getField: this.getField, - showDoc: this.showDoc, - }; - - - switch (this.getColumnType(col, rowProps.original, rowProps.column.id)) { - case ColumnType.Number: return ; - case ColumnType.String: return ; - case ColumnType.Boolean: return ; - case ColumnType.Doc: return ; - case ColumnType.Image: return ; - case ColumnType.List: return ; - case ColumnType.Date: return ; - default: - return ; - } - }, - minWidth: 200, - }; - })); - columns.push({ - Header: , - accessor: (doc: Doc) => 0, - id: "add", - Cell: (rowProps: CellInfo) => { - const rowIndex = rowProps.index; - const columnIndex = this.props.columns.map(c => c.heading).indexOf(rowProps.column.id!); - const isFocused = focusedRow === rowIndex && focusedCol === columnIndex && tableIsFocused; - return ; - }, - width: 28, - resizable: false - }); - return columns; - } - - - constructor(props: SchemaTableProps) { - super(props); - if (this.props.Document._schemaHeaders === undefined) { - this.props.Document._schemaHeaders = new List([new SchemaHeaderField("title", "#f1efeb"), new SchemaHeaderField("author", "#f1efeb"), new SchemaHeaderField("*lastModified", "#f1efeb", ColumnType.Date), - new SchemaHeaderField("text", "#f1efeb", ColumnType.String), new SchemaHeaderField("type", "#f1efeb"), new SchemaHeaderField("context", "#f1efeb", ColumnType.Doc)]); - } - } - - componentDidMount() { - document.addEventListener("keydown", this.onKeyDown); - } - - componentWillUnmount() { - document.removeEventListener("keydown", this.onKeyDown); - } - - tableAddDoc = (doc: Doc, relativeTo?: Doc, before?: boolean) => { - const tableDoc = this.props.Document[DataSym]; - const effectiveAcl = GetEffectiveAcl(tableDoc); - - if (effectiveAcl !== AclPrivate && effectiveAcl !== AclReadonly) { - doc.context = this.props.Document; - tableDoc[this.props.fieldKey + "-lastModified"] = new DateField(new Date(Date.now())); - return Doc.AddDocToList(this.props.Document, this.props.fieldKey, doc, relativeTo, before); - } - return false; - } - - private getTrProps: ComponentPropsGetterR = (state, rowInfo) => { - return !rowInfo ? {} : { - ScreenToLocalTransform: this.props.ScreenToLocalTransform, - addDoc: this.tableAddDoc, - removeDoc: this.props.deleteDocument, - rowInfo, - rowFocused: !this.props.headerIsEditing && rowInfo.index === this._focusedCell.row && this.props.isFocused(this.props.Document, true), - textWrapRow: this.toggleTextWrapRow, - rowWrapped: this.textWrappedRows.findIndex(id => rowInfo.original[Id] === id) > -1, - dropAction: StrCast(this.props.Document.childDropAction), - addDocTab: this.props.addDocTab - }; - } - - private getTdProps: ComponentPropsGetterR = (state, rowInfo, column, instance) => { - if (!rowInfo || column) return {}; - - const row = rowInfo.index; - //@ts-ignore - const col = this.columns.map(c => c.heading).indexOf(column!.id); - const isFocused = this._focusedCell.row === row && this._focusedCell.col === col && this.props.isFocused(this.props.Document, true); - // TODO: editing border doesn't work :( - return { - style: { border: !this.props.headerIsEditing && isFocused ? "2px solid rgb(255, 160, 160)" : "1px solid #f1efeb" } - }; - } - - @action setCellIsEditing = (isEditing: boolean) => this._cellIsEditing = isEditing; - - @action - onKeyDown = (e: KeyboardEvent): void => { - if (!this._cellIsEditing && !this.props.headerIsEditing && this.props.isFocused(this.props.Document, true)) {// && this.props.isSelected(true)) { - const direction = e.key === "Tab" ? "tab" : e.which === 39 ? "right" : e.which === 37 ? "left" : e.which === 38 ? "up" : e.which === 40 ? "down" : ""; - this._focusedCell = this.changeFocusedCellByDirection(direction, this._focusedCell.row, this._focusedCell.col); - - if (direction) { - const pdoc = FieldValue(this.childDocs[this._focusedCell.row]); - pdoc && this.props.setPreviewDoc(pdoc); - e.stopPropagation(); - } - } else if (e.keyCode === 27) { - this.props.setPreviewDoc(undefined); - e.stopPropagation(); // stopPropagation for left/right arrows - } - } - - changeFocusedCellByDirection = (direction: string, curRow: number, curCol: number) => { - switch (direction) { - case "tab": return { row: (curRow + 1 === this.childDocs.length ? 0 : curRow + 1), col: curCol + 1 === this.props.columns.length ? 0 : curCol + 1 }; - case "right": return { row: curRow, col: curCol + 1 === this.props.columns.length ? curCol : curCol + 1 }; - case "left": return { row: curRow, col: curCol === 0 ? curCol : curCol - 1 }; - case "up": return { row: curRow === 0 ? curRow : curRow - 1, col: curCol }; - case "down": return { row: curRow + 1 === this.childDocs.length ? curRow : curRow + 1, col: curCol }; - } - return this._focusedCell; - } - - @action - changeFocusedCellByIndex = (row: number, col: number): void => { - if (this._focusedCell.row !== row || this._focusedCell.col !== col) { - this._focusedCell = { row: row, col: col }; - } - this.props.setFocused(this.props.Document); - } - - @undoBatch - createRow = action(() => { - this.props.addDocument?.(Docs.Create.TextDocument("", { title: "", _width: 100, _height: 30 })); - this._focusedCell = { row: this.childDocs.length, col: this._focusedCell.col }; - }); - - @undoBatch - @action - createColumn = () => { - let index = 0; - let found = this.props.columns.findIndex(col => col.heading.toUpperCase() === "New field".toUpperCase()) > -1; - while (found) { - index++; - found = this.props.columns.findIndex(col => col.heading.toUpperCase() === ("New field (" + index + ")").toUpperCase()) > -1; - } - this.props.columns.push(new SchemaHeaderField(`New field ${index ? "(" + index + ")" : ""}`, "#f1efeb")); - } - - @action - getColumnType = (column: SchemaHeaderField, doc?: Doc, field?: string): ColumnType => { - if (doc && field && column.type === ColumnType.Any) { - const val = doc[CollectionSchemaCell.resolvedFieldKey(field, doc)]; - if (val instanceof ImageField) return ColumnType.Image; - if (val instanceof Doc) return ColumnType.Doc; - if (val instanceof DateField) return ColumnType.Date; - if (val instanceof List) return ColumnType.List; - } - if (column.type && column.type !== 0) { - return column.type; - } - if (columnTypes.get(column.heading)) { - return column.type = columnTypes.get(column.heading)!; - } - return column.type = ColumnType.Any; - } - - @undoBatch - @action - toggleTextwrap = async () => { - const textwrappedRows = Cast(this.props.Document.textwrappedSchemaRows, listSpec("string"), []); - if (textwrappedRows.length) { - this.props.Document.textwrappedSchemaRows = new List([]); - } else { - const docs = DocListCast(this.props.Document[this.props.fieldKey]); - const allRows = docs instanceof Doc ? [docs[Id]] : docs.map(doc => doc[Id]); - this.props.Document.textwrappedSchemaRows = new List(allRows); - } - } - - @action - toggleTextWrapRow = (doc: Doc): void => { - const textWrapped = this.textWrappedRows; - const index = textWrapped.findIndex(id => doc[Id] === id); - - index > -1 ? textWrapped.splice(index, 1) : textWrapped.push(doc[Id]); - - this.textWrappedRows = textWrapped; - } - - @computed - get reactTable() { - const children = this.childDocs; - const hasCollectionChild = children.reduce((found, doc) => found || doc.type === DocumentType.COL, false); - const expanded: { [name: string]: any } = {}; - Array.from(this._openCollections.keys()).map(col => expanded[col.toString()] = true); - const rerender = [...this.textWrappedRows]; // TODO: get component to rerender on text wrap change without needign to console.log :(((( - - return (row.original.type !== DocumentType.COL) ? (null) : -
} - - />; - } - - onContextMenu = (e: React.MouseEvent): void => { - ContextMenu.Instance.addItem({ description: "Toggle text wrapping", event: this.toggleTextwrap, icon: "table" }); - } - - getField = (row: number, col?: number) => { - const docs = this.childDocs; - - row = row % docs.length; - while (row < 0) row += docs.length; - const columns = this.props.columns; - const doc = docs[row]; - if (col === undefined) { - return doc; - } - if (col >= 0 && col < columns.length) { - const column = this.props.columns[col].heading; - return doc[column]; - } - return undefined; - } - - createTransformer = (row: number, col: number): Transformer => { - const self = this; - const captures: { [name: string]: Field } = {}; - - const transformer: ts.TransformerFactory = context => { - return root => { - function visit(node: ts.Node) { - node = ts.visitEachChild(node, visit, context); - if (ts.isIdentifier(node)) { - const isntPropAccess = !ts.isPropertyAccessExpression(node.parent) || node.parent.expression === node; - const isntPropAssign = !ts.isPropertyAssignment(node.parent) || node.parent.name !== node; - if (isntPropAccess && isntPropAssign) { - if (node.text === "$r") { - return ts.createNumericLiteral(row.toString()); - } else if (node.text === "$c") { - return ts.createNumericLiteral(col.toString()); - } else if (node.text === "$") { - if (ts.isCallExpression(node.parent)) { - // captures.doc = self.props.Document; - // captures.key = self.props.fieldKey; - } - } - } - } - - return node; - } - return ts.visitNode(root, visit); - }; - }; - - // const getVars = () => { - // return { capturedVariables: captures }; - // }; - - return { transformer, /*getVars*/ }; - } - - setComputed = (script: string, doc: Doc, field: string, row: number, col: number): boolean => { - script = - `const $ = (row:number, col?:number) => { - const rval = (doc as any)[key][row + ${row}]; - return col === undefined ? rval : rval[(doc as any)._schemaHeaders[col + ${col}].heading]; - } - return ${script}`; - const compiled = CompileScript(script, { params: { this: Doc.name }, capturedVariables: { doc: this.props.Document, key: this.props.fieldKey }, typecheck: false, transformer: this.createTransformer(row, col) }); - if (compiled.compiled) { - doc[field] = new ComputedField(compiled); - return true; - } - return false; - } - - @action - showDoc = (doc: Doc | undefined, dataDoc?: Doc, screenX?: number, screenY?: number) => { - this._showDoc = doc; - if (dataDoc && screenX && screenY) { - this._showDocPos = this.props.ScreenToLocalTransform().transformPoint(screenX, screenY); - } - } - - onOpenClick = () => { - this._showDoc && this.props.addDocTab(this._showDoc, "add:right"); - } - - getPreviewTransform = (): Transform => { - return this.props.ScreenToLocalTransform().translate(- this.borderWidth - 4 - this.tableWidth, - this.borderWidth); - } - - render() { - const preview = ""; - return
this.props.active(true) && e.stopPropagation()} - onDrop={e => this.props.onDrop(e, {})} onContextMenu={this.onContextMenu} > - {this.reactTable} - {this.props.Document._chromeHidden ? undefined :
+ new
} - {!this._showDoc ? (null) : -
- 150} - PanelHeight={() => 150} - ScreenToLocalTransform={this.getPreviewTransform} - docFilters={returnEmptyFilter} - docRangeFilters={returnEmptyFilter} - searchFilterDocs={returnEmptyDoclist} - ContainingCollectionDoc={this.props.CollectionView?.props.Document} - ContainingCollectionView={this.props.CollectionView} - moveDocument={this.props.moveDocument} - whenChildContentsActiveChanged={emptyFunction} - addDocTab={this.props.addDocTab} - pinToPres={this.props.pinToPres} - bringToFront={returnFalse}> - -
} -
; - } -} \ No newline at end of file diff --git a/src/client/views/nodes/DocumentContentsView.tsx b/src/client/views/nodes/DocumentContentsView.tsx index ecf4c0901..34488ffbe 100644 --- a/src/client/views/nodes/DocumentContentsView.tsx +++ b/src/client/views/nodes/DocumentContentsView.tsx @@ -8,7 +8,7 @@ import { emptyPath, OmitKeys, Without } from "../../../Utils"; import { DirectoryImportBox } from "../../util/Import & Export/DirectoryImportBox"; import { CollectionDockingView } from "../collections/CollectionDockingView"; import { CollectionFreeFormView } from "../collections/collectionFreeForm/CollectionFreeFormView"; -import { CollectionSchemaView } from "../collections/schemaView/CollectionSchemaView"; +import { CollectionSchemaView } from "../collections/collectionSchema/CollectionSchemaView"; import { CollectionView } from "../collections/CollectionView"; import { InkingStroke } from "../InkingStroke"; import { PresElementBox } from "../presentationview/PresElementBox"; diff --git a/src/client/views/search/SearchBox.tsx b/src/client/views/search/SearchBox.tsx index a671c955d..6a2325342 100644 --- a/src/client/views/search/SearchBox.tsx +++ b/src/client/views/search/SearchBox.tsx @@ -18,7 +18,7 @@ import { SetupDrag } from '../../util/DragManager'; import { SearchUtil } from '../../util/SearchUtil'; import { Transform } from '../../util/Transform'; import { CollectionDockingView } from "../collections/CollectionDockingView"; -import { CollectionSchemaView, ColumnType } from "../collections/schemaView/CollectionSchemaView"; +import { CollectionSchemaView, ColumnType } from "../collections/collectionSchema/CollectionSchemaView"; import { CollectionViewType } from '../collections/CollectionView'; import { ViewBoxBaseComponent } from "../DocComponent"; import { FieldView, FieldViewProps } from '../nodes/FieldView'; @@ -522,7 +522,7 @@ export class SearchBox extends ViewBoxBaseComponent window.location.assign(Utils.prepend("/logout"))}> Logoff -
+
DocServer.UPDATE_SERVER_CACHE()}> {`UI project`} @@ -534,10 +534,10 @@ export class SearchBox extends ViewBoxBaseComponent
CurrentUserUtils.createNewDashboard(Doc.UserDoc()))}> New -
+
CurrentUserUtils.snapshotDashboard(Doc.UserDoc()))}> Snapshot -
+
diff --git a/src/fields/SchemaHeaderField.ts b/src/fields/SchemaHeaderField.ts index 74cf934f2..a53fa542e 100644 --- a/src/fields/SchemaHeaderField.ts +++ b/src/fields/SchemaHeaderField.ts @@ -3,7 +3,7 @@ import { serializable, primitive } from "serializr"; import { ObjectField } from "./ObjectField"; import { Copy, ToScriptString, ToString, OnUpdate } from "./FieldSymbols"; import { scriptingGlobal } from "../client/util/Scripting"; -import { ColumnType } from "../client/views/collections/schemaView/CollectionSchemaView"; +import { ColumnType } from "../client/views/collections/collectionSchema/CollectionSchemaView"; export const PastelSchemaPalette = new Map([ // ["pink1", "#FFB4E8"], -- cgit v1.2.3-70-g09d2 From a9459901be6ed608fef28d4703072aa594748f84 Mon Sep 17 00:00:00 2001 From: bobzel Date: Wed, 14 Jul 2021 11:19:51 -0400 Subject: fixed dropping onto filesystem view to drop document into specific location/folder instead of hanging. --- src/client/documents/Documents.ts | 18 ++++++------ src/client/views/collections/CollectionSubView.tsx | 20 +++++++------ .../views/collections/CollectionTreeView.tsx | 2 +- src/client/views/collections/TreeView.tsx | 33 ++++++++++++++++------ 4 files changed, 45 insertions(+), 28 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 24682cbd0..040571b10 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -1329,16 +1329,14 @@ export namespace DocUtils { d._timecodeToShow = undefined; // bcz: this should be automatic somehow.. along with any other properties that were logically associated with the original collection }); }); - if (x !== undefined && y !== undefined) { - const newCollection = Docs.Create.PileDocument(docList, { title: "pileup", x: x - 55, y: y - 55, _width: 110, _height: 100, _overflow: "visible" }); - newCollection.x = NumCast(newCollection.x) + NumCast(newCollection._width) / 2 - 55; - newCollection.y = NumCast(newCollection.y) + NumCast(newCollection._height) / 2 - 55; - newCollection._width = newCollection._height = 110; - //newCollection.borderRounding = "40px"; - newCollection._jitterRotation = 10; - newCollection._backgroundColor = "gray"; - return newCollection; - } + const newCollection = Docs.Create.PileDocument(docList, { title: "pileup", x: (x || 0) - 55, y: (y || 0) - 55, _width: 110, _height: 100, _overflow: "visible" }); + newCollection.x = NumCast(newCollection.x) + NumCast(newCollection._width) / 2 - 55; + newCollection.y = NumCast(newCollection.y) + NumCast(newCollection._height) / 2 - 55; + newCollection._width = newCollection._height = 110; + //newCollection.borderRounding = "40px"; + newCollection._jitterRotation = 10; + newCollection._backgroundColor = "gray"; + return newCollection; } export function LeavePushpin(doc: Doc, annotationField: string) { diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index 8d549bd56..ca45536f4 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -241,7 +241,7 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: @undoBatch @action - protected async onExternalDrop(e: React.DragEvent, options: DocumentOptions, completed?: () => void) { + protected async onExternalDrop(e: React.DragEvent, options: DocumentOptions, completed?: (docs: Doc[]) => void) { if (e.ctrlKey) { e.stopPropagation(); // bcz: this is a hack to stop propagation when dropping an image on a text document with shift+ctrl return; @@ -439,7 +439,7 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: } this.slowLoadDocuments(files, options, generatedDocuments, text, completed, e.clientX, e.clientY, addDocument).then(batch.end); } - slowLoadDocuments = async (files: (File[] | string), options: DocumentOptions, generatedDocuments: Doc[], text: string, completed: (() => void) | undefined, clientX: number, clientY: number, addDocument: (doc: Doc | Doc[]) => boolean) => { + slowLoadDocuments = async (files: (File[] | string), options: DocumentOptions, generatedDocuments: Doc[], text: string, completed: ((doc: Doc[]) => void) | undefined, clientX: number, clientY: number, addDocument: (doc: Doc | Doc[]) => boolean) => { const disposer = OverlayView.Instance.addElement( , { x: clientX - 125, y: clientY - 125 }); if (typeof files === "string") { @@ -448,13 +448,17 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: generatedDocuments.push(...await DocUtils.uploadFilesToDocs(files, options)); } if (generatedDocuments.length) { - const set = generatedDocuments.length > 1 && generatedDocuments.map(d => DocUtils.iconify(d)); - if (set) { - addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!)!); - } else { - generatedDocuments.forEach(addDocument); + const isFreeformView = this.props.Document._viewType === CollectionViewType.Freeform; + const set = !isFreeformView ? generatedDocuments : + generatedDocuments.length > 1 ? generatedDocuments.map(d => { DocUtils.iconify(d); return d; }) : []; + if (completed) completed(set); + else { + if (isFreeformView) { + addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!)!); + } else { + generatedDocuments.forEach(addDocument); + } } - completed?.(); } else { if (text && !text.includes("https://")) { addDocument(Docs.Create.TextDocument(text, { ...options, title: text.substring(0, 20), _width: 400, _height: 315 })); diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx index 82c8a9114..3eece0086 100644 --- a/src/client/views/collections/CollectionTreeView.tsx +++ b/src/client/views/collections/CollectionTreeView.tsx @@ -154,7 +154,7 @@ export class CollectionTreeView extends CollectionSubView this.onExternalDrop(e, {}); + onTreeDrop = (e: React.DragEvent, addDocs?: (docs: Doc[]) => void) => this.onExternalDrop(e, {}, addDocs); @undoBatch makeTextCollection = (childDocs: Doc[]) => { diff --git a/src/client/views/collections/TreeView.tsx b/src/client/views/collections/TreeView.tsx index 2e98fb508..c1125c233 100644 --- a/src/client/views/collections/TreeView.tsx +++ b/src/client/views/collections/TreeView.tsx @@ -261,15 +261,19 @@ export class TreeView extends React.Component { if (docDragData) { e.stopPropagation(); if (docDragData.draggedDocuments[0] === this.doc) return true; - const parentAddDoc = (doc: Doc | Doc[]) => this.props.addDocument(doc, undefined, before); - const canAdd = !StrCast((inside ? this.props.document : this.props.containerCollection)?.freezeChildren).includes("add") || docDragData.treeViewDoc === this.props.treeView.props.Document; - const localAdd = (doc: Doc) => Doc.AddDocToList(this.dataDoc, this.fieldKey, doc) && ((doc.context = this.doc.context) || true) ? true : false; - const addDoc = !inside ? parentAddDoc : - (doc: Doc | Doc[]) => (doc instanceof Doc ? [doc] : doc).reduce((flg, doc) => flg && localAdd(doc), true as boolean); - const move = (!docDragData.dropAction || docDragData.dropAction === "proto" || docDragData.dropAction === "move" || docDragData.dropAction === "same") && docDragData.moveDocument; - if (canAdd) { - UndoManager.RunInTempBatch(() => docDragData.droppedDocuments.reduce((added, d) => (move ? move(d, undefined, addDoc) || (docDragData.dropAction === "proto" ? addDoc(d) : false) : addDoc(d)) || added, false)); - } + this.dropDocuments(docDragData.droppedDocuments, before, inside, docDragData.dropAction, docDragData.moveDocument, docDragData.treeViewDoc === this.props.treeView.props.Document); + } + } + + dropDocuments(droppedDocuments: Doc[], before: boolean, inside: number | boolean, dropAction: dropActionType, moveDocument: DragManager.MoveFunction | undefined, forceAdd: boolean) { + const parentAddDoc = (doc: Doc | Doc[]) => this.props.addDocument(doc, undefined, before); + const canAdd = !StrCast((inside ? this.props.document : this.props.containerCollection)?.freezeChildren).includes("add") || forceAdd; + const localAdd = (doc: Doc) => Doc.AddDocToList(this.dataDoc, this.fieldKey, doc) && ((doc.context = this.doc.context) || true) ? true : false; + const addDoc = !inside ? parentAddDoc : + (doc: Doc | Doc[]) => (doc instanceof Doc ? [doc] : doc).reduce((flg, doc) => flg && localAdd(doc), true as boolean); + const move = (!dropAction || dropAction === "proto" || dropAction === "move" || dropAction === "same") && moveDocument; + if (canAdd) { + UndoManager.RunInTempBatch(() => droppedDocuments.reduce((added, d) => (move ? move(d, undefined, addDoc) || (dropAction === "proto" ? addDoc(d) : false) : addDoc(d)) || added, false)); } } @@ -727,12 +731,23 @@ export class TreeView extends React.Component {
; } + onTreeDrop = (de: React.DragEvent) => { + const pt = [de.clientX, de.clientY]; + const rect = this._header.current!.getBoundingClientRect(); + const before = pt[1] < rect.top + rect.height / 2; + const inside = this.props.treeView.fileSysMode && !this.doc.isFolder ? false : pt[0] > Math.min(rect.left + 75, rect.left + rect.width * .75) || (!before && this.treeViewOpen && this.childDocList.length); + + const docs = this.props.treeView.onTreeDrop(de, (docs: Doc[]) => this.dropDocuments(docs, before, inside, "copy", undefined, false)); + } + render() { TraceMobx(); const hideTitle = this.doc.treeViewHideHeader || this.props.treeView.outlineMode; return this.props.renderedIds.indexOf(this.doc[Id]) !== -1 ? "<" + this.doc.title + ">" : // just print the title of documents we've previously rendered in this hierarchical path to avoid cycles
this.props.isContentActive(true) && SelectionManager.DeselectAll()} // bcz: this breaks entering a text filter in a filterBox since it deselects the filter's target document onKeyDown={this.onKeyDown}>
  • -- cgit v1.2.3-70-g09d2 From 1a1fc27a66c95c947dc8d2a812484f37586133cd Mon Sep 17 00:00:00 2001 From: Ashley Cai Date: Thu, 15 Jul 2021 12:37:31 -0700 Subject: Starting Color consistency --- src/client/views/AntimodeMenu.scss | 2 +- src/client/views/ContextMenu.scss | 2 +- src/client/views/DocumentButtonBar.scss | 4 +- src/client/views/DocumentDecorations.scss | 8 +-- src/client/views/MainView.scss | 58 +++++++++++----------- src/client/views/PropertiesButtons.scss | 6 +-- src/client/views/StyleProvider.tsx | 31 ++++++------ src/client/views/_nodeModuleOverrides.scss | 2 +- src/client/views/animationtimeline/Timeline.scss | 2 +- .../views/animationtimeline/TimelineMenu.scss | 4 +- src/client/views/animationtimeline/Track.scss | 2 +- .../views/collections/CollectionDockingView.scss | 14 +++--- .../views/collections/CollectionLinearView.scss | 4 +- src/client/views/collections/CollectionMenu.scss | 2 +- .../views/collections/CollectionStackingView.scss | 6 +-- .../views/collections/CollectionStackingView.tsx | 2 +- src/client/views/global/globalCssVariables.scss | 18 ++++--- src/client/views/global/globalEnums.tsx | 17 ++++--- src/client/views/linking/LinkEditor.scss | 2 +- src/client/views/linking/LinkMenuItem.scss | 2 +- src/client/views/nodes/FontIconBox.scss | 13 +++-- src/client/views/search/CheckBox.scss | 2 +- src/client/views/search/IconButton.scss | 2 +- src/client/views/search/IconButton.tsx | 2 +- src/client/views/search/SearchBox.scss | 4 +- src/client/views/search/SelectorContextMenu.scss | 4 +- 26 files changed, 111 insertions(+), 104 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/views/AntimodeMenu.scss b/src/client/views/AntimodeMenu.scss index 8670b1747..2bac03af4 100644 --- a/src/client/views/AntimodeMenu.scss +++ b/src/client/views/AntimodeMenu.scss @@ -5,7 +5,7 @@ position: absolute; z-index: 10001; height: $antimodemenu-height; - background: #323232; + background: $dark-gray; box-shadow: 3px 3px 3px rgba(0, 0, 0, 0.25); // border-radius: 0px 6px 6px 6px; z-index: 1001; diff --git a/src/client/views/ContextMenu.scss b/src/client/views/ContextMenu.scss index 2590e34c6..795529780 100644 --- a/src/client/views/ContextMenu.scss +++ b/src/client/views/ContextMenu.scss @@ -137,7 +137,7 @@ .contextMenu-item:hover { transition: all 0.1s ease; - background: $lighter-alt-accent; + background: $light-blue; } .contextMenu-description { diff --git a/src/client/views/DocumentButtonBar.scss b/src/client/views/DocumentButtonBar.scss index e816c52a3..2a0b494f5 100644 --- a/src/client/views/DocumentButtonBar.scss +++ b/src/client/views/DocumentButtonBar.scss @@ -25,7 +25,7 @@ $linkGap : 3px; border-radius: 50%; opacity: 0.9; pointer-events: auto; - background-color: $dark-color; + background-color: $dark-gray; color: $white; text-transform: uppercase; letter-spacing: 2px; @@ -64,7 +64,7 @@ $linkGap : 3px; text-align: center; border-radius: 50%; pointer-events: auto; - background-color: $dark-color; + background-color: $dark-gray; border: none; transition: 0.2s ease all; diff --git a/src/client/views/DocumentDecorations.scss b/src/client/views/DocumentDecorations.scss index 47a8326bb..1715f35e7 100644 --- a/src/client/views/DocumentDecorations.scss +++ b/src/client/views/DocumentDecorations.scss @@ -286,8 +286,8 @@ $linkGap : 3px; text-align: center; border-radius: 50%; pointer-events: auto; - color: $dark-color; - border: $dark-color 1px solid; + color: $dark-gray; + border: $dark-gray 1px solid; } .linkButton-linker:hover { @@ -302,7 +302,7 @@ $linkGap : 3px; border-radius: 50%; opacity: 0.9; pointer-events: auto; - background-color: $dark-color; + background-color: $dark-gray; color: $white; text-transform: uppercase; letter-spacing: 2px; @@ -343,7 +343,7 @@ $linkGap : 3px; border-radius: 50%; opacity: 0.9; font-size: 14; - background-color: $dark-color; + background-color: $dark-gray; color: $white; text-align: center; cursor: pointer; diff --git a/src/client/views/MainView.scss b/src/client/views/MainView.scss index d76458460..07ca0257c 100644 --- a/src/client/views/MainView.scss +++ b/src/client/views/MainView.scss @@ -56,50 +56,50 @@ touch-action: none; .searchBox-container { - background: lightgray; + background: $light-gray; } } .mainView-container { - color: black; + color: $dark-gray; .lm_title { - background: #cacaca; - color: black; + background: $light-gray; + color: $dark-gray; } } .mainView-container-dark { - color: lightgray; + color: $light-gray; .lm_goldenlayout { - background: dimgray; + background: $medium-gray; } .lm_title { - background: black; + background: $dark-gray; color: unset; } .marquee { - border-color: white; + border-color: $white; } #search-input { - background: lightgray; + background: $light-gray; } .searchBox-container { - background: rgb(45, 45, 45); + background: $dark-gray; } .contextMenu-cont, .contextMenu-item { - background: dimGray; + background: $medium-gray; } .contextMenu-item:hover { - background: gray; + background: $medium-gray; } } @@ -113,7 +113,7 @@ .mainView-propertiesDragger { //background-color: rgb(140, 139, 139); - background-color: lightgrey; + background-color: $light-gray; height: 55px; width: 17px; position: absolute; @@ -163,10 +163,10 @@ flex-direction: column; position: relative; height: 100%; - background: dimgray; + background: $medium-gray; .documentView-node-topmost { - background: lightgrey; + background: $light-gray; } } @@ -174,32 +174,32 @@ right: 0; position: absolute; z-index: 2; - background-color: rgb(159, 159, 159); + background-color: $medium-gray; .editable-title { - background-color: lightgrey; + background-color: $light-gray; } } } .mainView-libraryHandle { - background-color: lightgrey; + background-color: $light-gray; } .mainView-innerContent-dark { .propertiesView { background-color: #252525; input { - background-color: dimgrey; + background-color: $medium-gray; } .propertiesView-sharingTable { - background-color: dimgrey; + background-color: $medium-gray; } .editable-title { - background-color: dimgrey; + background-color: $medium-gray; } .propertiesView-field { - background-color: dimgrey; + background-color: $medium-gray; } } .mainView-propertiesDragger, @@ -209,17 +209,17 @@ } .mainView-container-dark { .contextMenu-cont { - background: dimgrey; - color: white; + background: $medium-gray; + color: $white; input::placeholder { - color:white; + color:$white; } } } .mainView-menuPanel { min-width: var(--menuPanelWidth); - background-color: #121721; + background-color: $dark-gray; .collectionStackingView { scrollbar-width: none; @@ -233,13 +233,13 @@ padding: 7px; padding-left: 7px; width: 100%; - background: black; + background: $dark-gray; .mainView-menuPanel-button-wrap { width: 45px; /* padding: 5px; */ touch-action: none; - background: black; + background: $dark-gray; transform-origin: top left; /* margin-bottom: 5px; */ margin-top: 5px; @@ -247,7 +247,7 @@ border-radius: 8px; &:hover { - background: rgb(61, 61, 61); + background: $black; cursor: pointer; } } diff --git a/src/client/views/PropertiesButtons.scss b/src/client/views/PropertiesButtons.scss index 4ef7763be..484522bc7 100644 --- a/src/client/views/PropertiesButtons.scss +++ b/src/client/views/PropertiesButtons.scss @@ -24,7 +24,7 @@ $linkGap : 3px; width: 29px; border-radius: 6px; pointer-events: auto; - background-color: $dark-color; + background-color: $dark-gray; color: #fcfbf7; text-transform: uppercase; letter-spacing: 2px; @@ -45,11 +45,11 @@ $linkGap : 3px; } .propertiesButtons-linkButton-empty.toggle-on { background-color: white; - color: $dark-color; + color: $dark-gray; } .propertiesButtons-linkButton-empty.toggle-hover { background-color: gray; - color: $dark-color; + color: $dark-gray; } .propertiesButtons-linkButton-empty.toggle-off { color: white; diff --git a/src/client/views/StyleProvider.tsx b/src/client/views/StyleProvider.tsx index 9e61351c4..1bf47f6ac 100644 --- a/src/client/views/StyleProvider.tsx +++ b/src/client/views/StyleProvider.tsx @@ -1,4 +1,5 @@ import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; +import { Colors } from './global/globalEnums'; import { IconProp } from '@fortawesome/fontawesome-svg-core'; import 'golden-layout/src/css/goldenlayout-base.css'; import 'golden-layout/src/css/goldenlayout-dark-theme.css'; @@ -97,14 +98,14 @@ export function DefaultStyleProvider(doc: Opt, props: Opt = StrCast(doc?.[fieldKey + "color"], StrCast(doc?._color)); if (docColor) return docColor; - const backColor = backgroundCol();// || (darkScheme() ? "black" : "white"); + const backColor = backgroundCol(); if (!backColor) return undefined; const nonAlphaColor = backColor.startsWith("#") ? (backColor as string).substring(0, 7) : backColor.startsWith("rgba") ? backColor.replace(/,.[^,]*\)/, ")").replace("rgba", "rgb") : backColor const col = Color(nonAlphaColor).rgb(); const colsum = (col.red() + col.green() + col.blue()); - if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return "black"; - return "white"; + if (colsum / col.alpha() > 400 || col.alpha() < 0.25) return Colors.DARK_GRAY; + return Colors.WHITE; case StyleProp.Hidden: return BoolCast(doc?._hidden); case StyleProp.BorderRounding: return StrCast(doc?.[fieldKey + "borderRounding"]); case StyleProp.TitleHeight: return 15; @@ -114,30 +115,30 @@ export function DefaultStyleProvider(doc: Opt, props: Opt = StrCast(doc?.[fieldKey + "backgroundColor"], StrCast(doc?._backgroundColor, isCaption ? "rgba(0,0,0,0.4)" : "")); - if (MainView.Instance.LastButton === doc) return darkScheme() ? "dimgrey" : "lightgrey"; + if (MainView.Instance.LastButton === doc) return darkScheme() ? Colors.MEDIUM_GRAY : Colors.LIGHT_GRAY; switch (doc?.type) { case DocumentType.PRESELEMENT: docColor = docColor || (darkScheme() ? "" : ""); break; - case DocumentType.PRES: docColor = docColor || (darkScheme() ? "#3e3e3e" : "white"); break; - case DocumentType.FONTICON: docColor = docColor || "black"; break; - case DocumentType.RTF: docColor = docColor || (darkScheme() ? "#2d2d2d" : "#f1efeb"); break; - case DocumentType.FILTER: docColor = docColor || (darkScheme() ? "#2d2d2d" : "rgba(105, 105, 105, 0.432)"); break; + case DocumentType.PRES: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.WHITE); break; + case DocumentType.FONTICON: docColor = docColor || Colors.DARK_GRAY; break; + case DocumentType.RTF: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY); break; + case DocumentType.FILTER: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : "rgba(105, 105, 105, 0.432)"); break; case DocumentType.INK: docColor = doc?.isInkMask ? "rgba(0,0,0,0.7)" : undefined; break; case DocumentType.SLIDER: break; case DocumentType.EQUATION: docColor = docColor || "transparent"; break; case DocumentType.LABEL: docColor = docColor || (doc.annotationOn !== undefined ? "rgba(128, 128, 128, 0.18)" : undefined); break; - case DocumentType.BUTTON: docColor = docColor || (darkScheme() ? "#2d2d2d" : "lightgray"); break; - case DocumentType.LINKANCHOR: docColor = isAnchor ? "lightblue" : "transparent"; break; + case DocumentType.BUTTON: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY); break; + case DocumentType.LINKANCHOR: docColor = isAnchor ? Colors.LIGHT_BLUE : "transparent"; break; case DocumentType.LINK: docColor = docColor || "transparent"; break; case DocumentType.IMG: case DocumentType.WEB: case DocumentType.PDF: case DocumentType.SCREENSHOT: - case DocumentType.VID: docColor = docColor || (darkScheme() ? "#2d2d2d" : "lightgray"); break; + case DocumentType.VID: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY); break; case DocumentType.COL: if (StrCast(Doc.LayoutField(doc)).includes("SliderBox")) break; - docColor = docColor ? docColor : + docColor = docColor ? Colors.DARK_GRAY : doc?._isGroup ? "#00000004" : // very faint highlight to show bounds of group - (Doc.IsSystem(doc) ? (darkScheme() ? "rgb(62,62,62)" : "lightgrey") : // system docs (seen in treeView) get a grayish background + (Doc.IsSystem(doc) ? (darkScheme() ? Colors.DARK_GRAY : Colors.LIGHT_GRAY) : // system docs (seen in treeView) get a grayish background isBackground() ? "cyan" : // ?? is there a good default for a background collection doc.annotationOn ? "#00000015" : // faint interior for collections on PDFs, images, etc StrCast((props?.renderDepth || 0) > 0 ? @@ -145,7 +146,7 @@ export function DefaultStyleProvider(doc: Opt, props: Opt, props: Optspan { - background: $dark-color; + background: $dark-gray; color: $white; border-radius: 18px; margin-right: 6px; @@ -63,7 +63,7 @@ >label { margin-top: "auto"; margin-bottom: "auto"; - background: $dark-color; + background: $dark-gray; color: $white; display: inline-block; border-radius: 18px; diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss index 328d7c081..7e507d6b5 100644 --- a/src/client/views/collections/CollectionMenu.scss +++ b/src/client/views/collections/CollectionMenu.scss @@ -411,7 +411,7 @@ } .switchToText:hover { - color: $dark-color; + color: $dark-gray; } } diff --git a/src/client/views/collections/CollectionStackingView.scss b/src/client/views/collections/CollectionStackingView.scss index f103d9581..4b123c8b6 100644 --- a/src/client/views/collections/CollectionStackingView.scss +++ b/src/client/views/collections/CollectionStackingView.scss @@ -96,7 +96,7 @@ height: 2vw; width: 100%; font-family: $sans-serif; - background: $dark-color; + background: $dark-gray; color: $white; } @@ -184,7 +184,7 @@ // overflow: hidden; overflow is visible so the color menu isn't hidden -ftong .editableView-input { - color: $dark-color; + color: $dark-gray; } .editableView-input:hover, @@ -205,7 +205,7 @@ display: flex; align-items: center; justify-content: center; - color: $dark-color; + color: $dark-gray; .editableView-container-editing-oneLine, .editableView-container-editing { diff --git a/src/client/views/collections/CollectionStackingView.tsx b/src/client/views/collections/CollectionStackingView.tsx index 30f8e0112..7aa8dfd56 100644 --- a/src/client/views/collections/CollectionStackingView.tsx +++ b/src/client/views/collections/CollectionStackingView.tsx @@ -480,7 +480,7 @@ export class CollectionStackingView extends CollectionSubView{ hoverStyle = { opacity: 1, backgroundColor: "rgb(128, 128, 128)" - //backgroundColor: "rgb(178, 206, 248)" //$darker-alt-accent + //backgroundColor: "rgb(178, 206, 248)" //$medium-blue }; render() { diff --git a/src/client/views/search/SearchBox.scss b/src/client/views/search/SearchBox.scss index 8d6bc86cb..6a2fe6f19 100644 --- a/src/client/views/search/SearchBox.scss +++ b/src/client/views/search/SearchBox.scss @@ -20,7 +20,7 @@ display: flex; justify-content: center; align-items: center; - background-color: $dark-color; + background-color: $dark-gray; .searchBox-lozenges { position: absolute; @@ -86,7 +86,7 @@ &.searchBox-input { margin:5px; border-radius:20px; - border:$dark-color; + border:$dark-gray; display: block; width: 130px; -webkit-transition: width 0.4s; diff --git a/src/client/views/search/SelectorContextMenu.scss b/src/client/views/search/SelectorContextMenu.scss index 438b6a0c2..a114f679c 100644 --- a/src/client/views/search/SelectorContextMenu.scss +++ b/src/client/views/search/SelectorContextMenu.scss @@ -1,7 +1,7 @@ @import "../global/globalCssVariables"; .parents { - background: $lighter-alt-accent; + background: $light-blue; padding: 10px; // width: 300px; @@ -10,7 +10,7 @@ } .collection { - border-color: $darker-alt-accent; + border-color: $medium-blue; border-bottom-style: solid; } } \ No newline at end of file -- cgit v1.2.3-70-g09d2 From 98893e0944f7e04455a30fa128b1c91954c8a16d Mon Sep 17 00:00:00 2001 From: Ashley Cai Date: Tue, 20 Jul 2021 15:12:24 -0700 Subject: Padding and font size --- src/client/views/collections/CollectionMenu.scss | 4 ++-- src/client/views/global/globalCssVariables.scss | 19 ++++++++++++++----- src/client/views/global/globalEnums.tsx | 18 ++++++++++++++++-- 3 files changed, 32 insertions(+), 9 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss index 7e507d6b5..1a9a6d5d9 100644 --- a/src/client/views/collections/CollectionMenu.scss +++ b/src/client/views/collections/CollectionMenu.scss @@ -425,7 +425,7 @@ padding: 12px 10px 11px 10px; border: 0px; color: black; - font-size: 10px; + font-size: 9px; letter-spacing: 2px; outline-color: black; background: rgb(238, 238, 238); @@ -508,7 +508,7 @@ .collectionSchemaViewChrome-cont { display: flex; - font-size: 10.5px; + font-size: 9px; .collectionSchemaViewChrome-toggle { display: flex; diff --git a/src/client/views/global/globalCssVariables.scss b/src/client/views/global/globalCssVariables.scss index 3a36377f7..ead5e166e 100644 --- a/src/client/views/global/globalCssVariables.scss +++ b/src/client/views/global/globalCssVariables.scss @@ -8,21 +8,30 @@ $black: #000000; $light-blue: #BDDDF5; $medium-blue: #4476F7; -$pink: "#E0217D"; -$yellow: "#F5D747"; +$pink: #E0217D; +$yellow: #F5D747; $drop-shadow: "#32323215"; +//padding +$minimum-padding: 4px; +$medium-padding: 16px; +$large-padding: 32px; + +//icon sizes +$icon-size: 28px; + $antimodemenu-height: 36px; // fonts -$sans-serif: "Noto Sans", -sans-serif; +$sans-serif: "Noto Sans", sans-serif; +$large-header: 16px; +$body-text: 12px; +$small-text: 9px; // $sans-serif: "Roboto Slab", sans-serif; // misc values $border-radius: 0.3em; -// $search-thumnail-size: 130; // dragged items diff --git a/src/client/views/global/globalEnums.tsx b/src/client/views/global/globalEnums.tsx index 80558e1c1..1e0381c33 100644 --- a/src/client/views/global/globalEnums.tsx +++ b/src/client/views/global/globalEnums.tsx @@ -7,14 +7,28 @@ export enum Colors { MEDIUM_BLUE = "#4476F7", LIGHT_BLUE = "#BDDDF5", PINK = "#E0217D", - YELLOW = "#F5D747" + YELLOW = "#F5D747", + DROP_SHADOW = "#32323215", } export enum FontSizes { - LargeHeader = "16px" + //Bolded + LARGE_HEADER = "16px", + //Bolded or unbolded + BODY_TEXT = "12px", + + //Bolded + SMALL_TEXT = "9px", } export enum Padding { + MINIMUM_PADDING = "4px", + SMALL_PADDING = "8px", + MEDIUM_PADDING = "16px", + LARGE_PADDING = "32px", +} +export enum IconSizes { + ICON_SIZE = "28px", } \ No newline at end of file -- cgit v1.2.3-70-g09d2 From af33c5a46f0680dad41532a86557193bf8af3b08 Mon Sep 17 00:00:00 2001 From: Ashley Cai Date: Tue, 20 Jul 2021 15:21:54 -0700 Subject: standardizing edits --- src/client/views/collections/CollectionMenu.scss | 135 +++++++++++------------ 1 file changed, 67 insertions(+), 68 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/views/collections/CollectionMenu.scss b/src/client/views/collections/CollectionMenu.scss index 1a9a6d5d9..c0fc774d3 100644 --- a/src/client/views/collections/CollectionMenu.scss +++ b/src/client/views/collections/CollectionMenu.scss @@ -1,6 +1,5 @@ @import "../global/globalCssVariables"; - .collectionMenu-cont { position: relative; display: inline-flex; @@ -8,8 +7,8 @@ opacity: 0.9; z-index: 901; transition: top .5s; - background: #323232; - color: white; + background: $dark-gray; + color: $white; transform-origin: top left; top: 0; width: 100%; @@ -18,7 +17,7 @@ border-radius: 100%; width: 18px; height: 18px; - border: solid 1px #f5f5f5; + border: solid 1px $white; display: flex; align-items: center; justify-content: center; @@ -28,7 +27,7 @@ border-radius: 100%; width: 70%; height: 70%; - background: white; + background: $white; } .collectionMenu { @@ -43,7 +42,7 @@ margin-left: 3px; margin-right: 3px; width: 1.5px; - background-color: #656060; + background-color: $medium-gray; } .collectionViewBaseChrome { @@ -51,11 +50,11 @@ align-items: center; .collectionViewBaseChrome-viewPicker { - font-size: 75%; - outline-color: black; - color: white; + font-size: $small-text; + outline-color: $black; + color: $white; border: none; - background: #323232; + background: $dark-gray; } .collectionViewBaseChrome-viewPicker:focus { @@ -64,16 +63,16 @@ } .collectionViewBaseChrome-viewPicker:active { - outline-color: black; + outline-color: $black; } .collectionViewBaseChrome-button { - font-size: 75%; + font-size: $small-text; text-transform: uppercase; letter-spacing: 2px; - background: rgb(238, 238, 238); - color: purple; - outline-color: black; + background: $white; + color: $pink; + outline-color: $black; border: none; padding: 12px 10px 11px 10px; margin-left: 10px; @@ -82,11 +81,11 @@ .collectionViewBaseChrome-cmdPicker { margin-left: 3px; margin-right: 0px; - font-size: 75%; + font-size: $small-text; text-transform: capitalize; - color: white; + color: $white; border: none; - background: #323232; + background: $dark-gray; } .collectionViewBaseChrome-cmdPicker:focus { @@ -105,7 +104,7 @@ overflow: hidden; .commandEntry-drop { - color: white; + color: $white; width: 30px; margin-top: auto; margin-bottom: auto; @@ -113,11 +112,11 @@ } .commandEntry-outerDiv:hover{ - background-color: rgba(0,0,0,0.2); + background-color: $drop-shadow; .collectionViewBaseChrome-viewPicker, .collectionViewBaseChrome-cmdPicker{ - background: rgb(41,41,41); + background: $dark-gray; } } @@ -142,7 +141,7 @@ height: 100%; display: flex; background: transparent; - color: grey; + color: $medium-gray; justify-content: center; } @@ -150,31 +149,31 @@ margin-left: 5px; display: grid; border: none; - border-right: solid gray 1px; + border-right: solid $medium-gray 1px; .collectionViewBaseChrome-filterIcon { position: relative; display: flex; margin: auto; - background: #323232; - color: white; + background: $dark-gray; + color: $white; width: 30px; height: 30px; align-items: center; justify-content: center; border: none; - border-right: solid gray 1px; + border-right: solid $medium-gray 1px; } .collectionViewBaseChrome-viewSpecsInput { padding: 12px 10px 11px 10px; border: 0px; - color: grey; + color: $medium-gray; text-align: center; letter-spacing: 2px; - outline-color: black; - font-size: 75%; - background: rgb(238, 238, 238); + outline-color: $black; + font-size: $small-text; + background: $white; height: 100%; width: 75px; } @@ -187,8 +186,8 @@ z-index: 100; display: flex; flex-direction: column; - background: rgb(238, 238, 238); - box-shadow: grey 2px 2px 4px; + background: $white; + box-shadow: $medium-gray 2px 2px 4px; .qs-datepicker { left: unset; @@ -204,13 +203,13 @@ .collectionViewBaseChrome-viewSpecsMenu-rowLeft, .collectionViewBaseChrome-viewSpecsMenu-rowMiddle, .collectionViewBaseChrome-viewSpecsMenu-rowRight { - font-size: 75%; + font-size: $small-text; letter-spacing: 2px; - color: grey; + color: $medium-gray; margin-left: 10px; padding: 5px; border: none; - outline-color: black; + outline-color: $black; } } @@ -236,19 +235,19 @@ margin-left: 10; .collectionGridViewChrome-viewPicker { - font-size: 75%; + font-size: $small-text; //text-transform: uppercase; //letter-spacing: 2px; - background: #121721; - color: white; - outline-color: black; - color: white; + background: $dark-gray; + color: $white; + outline-color: $black; + color: $white; border: none; - border-right: solid gray 1px; + border-right: solid $medium-gray 1px; } .collectionGridViewChrome-viewPicker:active { - outline-color: black; + outline-color: $black; } .grid-control { @@ -268,11 +267,11 @@ .collectionGridViewChrome-entryBox { width: 50%; - color: black; + color: $black; } .collectionGridViewChrome-columnButton { - color: black; + color: $black; } } } @@ -302,7 +301,7 @@ align-items: center; display: flex; grid-auto-columns: auto; - font-size: 75%; + font-size: $small-text; letter-spacing: 2px; .collectionStackingViewChrome-pivotField-label, @@ -311,7 +310,7 @@ grid-column: 1; margin-right: 7px; user-select: none; - font-family: 'Roboto'; + font-family: $sans-serif; letter-spacing: normal; } @@ -329,13 +328,13 @@ } .collectionStackingViewChrome-sortIcon:hover { - background-color: rgba(0,0,0,0.2); + background-color: $drop-shadow; } .collectionStackingViewChrome-pivotField, .collectionTreeViewChrome-pivotField, .collection3DCarouselViewChrome-scrollSpeed { - color: white; + color: $white; grid-column: 2; grid-row: 1; width: 90%; @@ -344,7 +343,7 @@ height: 80%; border-radius: 7px; align-items: center; - background: #eeeeee; + background: $white; .editable-view-input, input, @@ -352,16 +351,16 @@ .editableView-container-editing { margin: auto; border: 0px; - color: grey !important; + color: $light-gray !important; text-align: center; letter-spacing: 2px; - outline-color: black; + outline-color: $black; height: 100%; } .react-autosuggest__container { margin: 0; - color: grey; + color: $medium-gray; padding: 0px; } } @@ -424,11 +423,11 @@ .collectionMenu-urlInput { padding: 12px 10px 11px 10px; border: 0px; - color: black; - font-size: 9px; + color: $black; + font-size: $small-text; letter-spacing: 2px; - outline-color: black; - background: rgb(238, 238, 238); + outline-color: $black; + background: $white; width: 100%; min-width: 350px; margin-right: 10px; @@ -477,10 +476,10 @@ width: 20; height: 30; bottom: 0; - background: #323232; + background: $dark-gray; display: inline-flex; align-items: center; - color: white; + color: $white; } .backKeyframe { @@ -502,13 +501,13 @@ margin: auto; } - border-right: solid gray 1px; + border-right: solid $medium-gray 1px; } } .collectionSchemaViewChrome-cont { display: flex; - font-size: 9px; + font-size: $small-text; .collectionSchemaViewChrome-toggle { display: flex; @@ -527,7 +526,7 @@ .collectionSchemaViewChrome-toggler { width: 100px; height: 35px; - background-color: black; + background-color: $black; position: relative; } @@ -539,7 +538,7 @@ transition: all 0.5s ease; // top: 3px; margin-top: 3px; - color: gray; + color: $medium-gray; letter-spacing: 2px; text-transform: uppercase; display: flex; @@ -579,7 +578,7 @@ } .react-autosuggest__input { - border: 1px solid #aaa; + border: 1px solid $light-gray; border-radius: 4px; width: 100%; } @@ -603,11 +602,11 @@ overflow-y: auto; max-height: 400px; width: 180px; - border: 1px solid #aaa; - background-color: #fff; - font-family: Helvetica, sans-serif; + border: 1px solid $light-gray; + background-color: $white; + font-family: $sans-serif; font-weight: 300; - font-size: 16px; + font-size: $large-header; border-bottom-left-radius: 4px; border-bottom-right-radius: 4px; z-index: 2; @@ -625,5 +624,5 @@ } .react-autosuggest__suggestion--highlighted { - background-color: #ddd; + background-color: $light-gray; } \ No newline at end of file -- cgit v1.2.3-70-g09d2 From d358e6952effeb933ab57e4b343d8f0886077d55 Mon Sep 17 00:00:00 2001 From: 0x85FB9C51 <77808164+0x85FB9C51@users.noreply.github.com> Date: Wed, 21 Jul 2021 08:52:22 -0400 Subject: fixed date formatting --- .../collectionSchema/CollectionSchemaCells.tsx | 15 +++++++++------ 1 file changed, 9 insertions(+), 6 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx index f75179cea..a8d901f4d 100644 --- a/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx +++ b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx @@ -351,13 +351,16 @@ export class CollectionSchemaDateCell extends CollectionSchemaCell { //} } + // If the cell is not clicked on, render the date normally. Otherwise, render a date picker. render() { - return !this.props.isFocused ? {this._date ? Field.toString(this._date as Field) : "--"} : - this.handleChange(date)} - onChange={date => this.handleChange(date)} - />; + return !this.props.isFocused ? {this._date ? Field.toString(this._date as Field) : "--"} : +
    + this.handleChange(date)} + onChange={date => this.handleChange(date)} + /> +
    } } -- cgit v1.2.3-70-g09d2 From d5030554055d7f11caba3d95f3d082dbf066f55c Mon Sep 17 00:00:00 2001 From: 0x85FB9C51 <77808164+0x85FB9C51@users.noreply.github.com> Date: Wed, 21 Jul 2021 08:55:13 -0400 Subject: Revert "fixed date formatting" This reverts commit d358e6952effeb933ab57e4b343d8f0886077d55. --- .../collectionSchema/CollectionSchemaCells.tsx | 15 ++++++--------- 1 file changed, 6 insertions(+), 9 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx index a8d901f4d..f75179cea 100644 --- a/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx +++ b/src/client/views/collections/collectionSchema/CollectionSchemaCells.tsx @@ -351,16 +351,13 @@ export class CollectionSchemaDateCell extends CollectionSchemaCell { //} } - // If the cell is not clicked on, render the date normally. Otherwise, render a date picker. render() { - return !this.props.isFocused ? {this._date ? Field.toString(this._date as Field) : "--"} : -
    - this.handleChange(date)} - onChange={date => this.handleChange(date)} - /> -
    + return !this.props.isFocused ? {this._date ? Field.toString(this._date as Field) : "--"} : + this.handleChange(date)} + onChange={date => this.handleChange(date)} + />; } } -- cgit v1.2.3-70-g09d2 From 7a8865bbbe7b16219aa63058a159eb4facb06b0b Mon Sep 17 00:00:00 2001 From: bobzel Date: Fri, 23 Jul 2021 10:26:02 -0400 Subject: fixed compile errors --- src/client/views/collections/CollectionSchemaView.tsx | 6 +++--- .../collections/collectionSchema/CollectionSchemaView.scss | 2 +- .../collections/collectionSchema/CollectionSchemaView.tsx | 10 +++++----- 3 files changed, 9 insertions(+), 9 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/views/collections/CollectionSchemaView.tsx b/src/client/views/collections/CollectionSchemaView.tsx index 18926264d..e1e04915a 100644 --- a/src/client/views/collections/CollectionSchemaView.tsx +++ b/src/client/views/collections/CollectionSchemaView.tsx @@ -11,7 +11,8 @@ import { listSpec } from "../../../fields/Schema"; import { PastelSchemaPalette, SchemaHeaderField } from "../../../fields/SchemaHeaderField"; import { Cast, NumCast } from "../../../fields/Types"; import { TraceMobx } from "../../../fields/util"; -import { emptyFunction, emptyPath, returnFalse, setupMoveUpEvents, returnEmptyDoclist, returnTrue } from "../../../Utils"; +import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents } from "../../../Utils"; +import { DocUtils } from "../../documents/Documents"; import { SelectionManager } from "../../util/SelectionManager"; import { SnappingManager } from "../../util/SnappingManager"; import { Transform } from "../../util/Transform"; @@ -24,8 +25,7 @@ import { DocumentView } from "../nodes/DocumentView"; import { DefaultStyleProvider } from "../StyleProvider"; import "./CollectionSchemaView.scss"; import { CollectionSubView } from "./CollectionSubView"; -import { SchemaTable } from "./SchemaTable"; -import { DocUtils } from "../../documents/Documents"; +import { SchemaTable } from "../collections/collectionSchema/SchemaTable"; // bcz: need to add drag and drop of rows and columns. This seems like it might work for rows: https://codesandbox.io/s/l94mn1q657 export enum ColumnType { diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaView.scss b/src/client/views/collections/collectionSchema/CollectionSchemaView.scss index 4cc34cd32..40cdcd14b 100644 --- a/src/client/views/collections/collectionSchema/CollectionSchemaView.scss +++ b/src/client/views/collections/collectionSchema/CollectionSchemaView.scss @@ -1,4 +1,4 @@ -@import "../../globalCssVariables"; +@import "../../global/globalCssVariables.scss"; .collectionSchemaView-container { border-width: $COLLECTION_BORDER_WIDTH; border-color: $medium-gray; diff --git a/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx b/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx index ef28f75c8..585cda729 100644 --- a/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx +++ b/src/client/views/collections/collectionSchema/CollectionSchemaView.tsx @@ -11,21 +11,21 @@ import { listSpec } from "../../../../fields/Schema"; import { PastelSchemaPalette, SchemaHeaderField } from "../../../../fields/SchemaHeaderField"; import { Cast, NumCast } from "../../../../fields/Types"; import { TraceMobx } from "../../../../fields/util"; -import { emptyFunction, emptyPath, returnFalse, setupMoveUpEvents, returnEmptyDoclist, returnTrue } from "../../../../Utils"; +import { emptyFunction, returnEmptyDoclist, returnFalse, returnTrue, setupMoveUpEvents } from "../../../../Utils"; +import { DocUtils } from "../../../documents/Documents"; import { SelectionManager } from "../../../util/SelectionManager"; import { SnappingManager } from "../../../util/SnappingManager"; import { Transform } from "../../../util/Transform"; import { undoBatch } from "../../../util/UndoManager"; -import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../globalCssVariables.scss'; +import '../../../views/DocumentDecorations.scss'; import { ContextMenu } from "../../ContextMenu"; import { ContextMenuProps } from "../../ContextMenuItem"; -import '../../../views/DocumentDecorations.scss'; +import { COLLECTION_BORDER_WIDTH, SCHEMA_DIVIDER_WIDTH } from '../../global/globalCssVariables.scss'; import { DocumentView } from "../../nodes/DocumentView"; import { DefaultStyleProvider } from "../../StyleProvider"; -import "./CollectionSchemaView.scss"; import { CollectionSubView } from "../CollectionSubView"; +import "./CollectionSchemaView.scss"; import { SchemaTable } from "./SchemaTable"; -import { DocUtils } from "../../../documents/Documents"; // bcz: need to add drag and drop of rows and columns. This seems like it might work for rows: https://codesandbox.io/s/l94mn1q657 export enum ColumnType { -- cgit v1.2.3-70-g09d2 From 26e9e0a554ee5aff001e2bc10b6802a4e830b63c Mon Sep 17 00:00:00 2001 From: bobzel Date: Mon, 26 Jul 2021 12:35:25 -0400 Subject: cleaned up pile view a bit so that it doesn't scale up huge when there's one document. made the pile be round and drop-shadowed. made the pile go away immediately if there are no documents. made it work with undo. --- src/client/documents/Documents.ts | 2 -- src/client/views/StyleProvider.tsx | 15 ++++++++------- src/client/views/collections/CollectionPileView.tsx | 15 +++++++++------ src/client/views/collections/CollectionSubView.tsx | 2 +- .../CollectionFreeFormLayoutEngines.tsx | 5 +++-- 5 files changed, 21 insertions(+), 18 deletions(-) (limited to 'src/client/views/collections') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index c2cdf7f72..f1db3e32c 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -1333,9 +1333,7 @@ export namespace DocUtils { newCollection.x = NumCast(newCollection.x) + NumCast(newCollection._width) / 2 - 55; newCollection.y = NumCast(newCollection.y) + NumCast(newCollection._height) / 2 - 55; newCollection._width = newCollection._height = 110; - //newCollection.borderRounding = "40px"; newCollection._jitterRotation = 10; - newCollection._backgroundColor = "gray"; return newCollection; } diff --git a/src/client/views/StyleProvider.tsx b/src/client/views/StyleProvider.tsx index 55f6b8e3c..6b94539c9 100644 --- a/src/client/views/StyleProvider.tsx +++ b/src/client/views/StyleProvider.tsx @@ -107,7 +107,7 @@ export function DefaultStyleProvider(doc: Opt, props: Opt 400 || col.alpha() < 0.25) return Colors.DARK_GRAY; return Colors.WHITE; case StyleProp.Hidden: return BoolCast(doc?._hidden); - case StyleProp.BorderRounding: return StrCast(doc?.[fieldKey + "borderRounding"]); + case StyleProp.BorderRounding: return StrCast(doc?.[fieldKey + "borderRounding"], doc?._viewType === CollectionViewType.Pile ? "50%" : ""); case StyleProp.TitleHeight: return 15; case StyleProp.BorderPath: return comicStyle() && props?.renderDepth ? { path: wavyBorderPath(props?.PanelWidth?.() || 0, props?.PanelHeight?.() || 0), fill: wavyBorderPath(props?.PanelWidth?.() || 0, props?.PanelHeight?.() || 0, .08), width: 3 } : { path: undefined, width: 0 }; case StyleProp.JitterRotation: return comicStyle() ? random(-1, 1, NumCast(doc?.x), NumCast(doc?.y)) * ((props?.PanelWidth() || 0) > (props?.PanelHeight() || 0) ? 5 : 10) : 0; @@ -136,14 +136,14 @@ export function DefaultStyleProvider(doc: Opt, props: Opt 0 ? Doc.UserDoc().activeCollectionNestedBackground : - Doc.UserDoc().activeCollectionBackground)); + Doc.UserDoc().activeCollectionBackground))); break; //if (doc._viewType !== CollectionViewType.Freeform && doc._viewType !== CollectionViewType.Time) return "rgb(62,62,62)"; default: docColor = docColor || (darkScheme() ? Colors.DARK_GRAY : Colors.WHITE); break; @@ -159,8 +159,9 @@ export function DefaultStyleProvider(doc: Opt, props: Opt doc) { _originalChrome: any = ""; + _disposers: { [name: string]: IReactionDisposer } = {}; componentDidMount() { if (this.layoutEngine() !== "pass" && this.layoutEngine() !== "starburst") { @@ -22,9 +23,14 @@ export class CollectionPileView extends CollectionSubView(doc => doc) { } this._originalChrome = this.layoutDoc._chromeHidden; this.layoutDoc._chromeHidden = true; + + // pileups are designed to go away when they are empty. + this._disposers.selected = reaction(() => this.childDocs.length, + (num) => !num && this.props.ContainingCollectionView?.removeDocument(this.props.Document)); } componentWillUnmount() { this.layoutDoc._chromeHidden = this._originalChrome; + Object.values(this._disposers).forEach(disposer => disposer?.()); } layoutEngine = () => StrCast(this.Document._pileLayoutEngine); @@ -107,9 +113,6 @@ export class CollectionPileView extends CollectionSubView(doc => doc) { this._undoBatch?.end(); this._undoBatch = undefined; SnappingManager.SetIsDragging(false); - if (!this.childDocs.length) { - this.props.ContainingCollectionView?.removeDocument(this.props.Document); - } }, emptyFunction, e.shiftKey && this.layoutEngine() === "pass", this.layoutEngine() === "pass" && e.shiftKey); // this sets _doubleTap } diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index ca45536f4..f39443ae2 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -453,7 +453,7 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: generatedDocuments.length > 1 ? generatedDocuments.map(d => { DocUtils.iconify(d); return d; }) : []; if (completed) completed(set); else { - if (isFreeformView) { + if (isFreeformView && generatedDocuments.length > 1) { addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!)!); } else { generatedDocuments.forEach(addDocument); diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx index afc1babeb..37444a9dc 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLayoutEngines.tsx @@ -126,7 +126,8 @@ export function computerStarburstLayout( replica: "" }); }); - return normalizeResults(scaleDim, 12, docMap, poolData, viewDefsToJSX, [], 0, []); + const divider = { type: "div", color: "transparent", x: -burstRadius[0] / 3, y: 0, width: 15, height: 15, payload: undefined }; + return normalizeResults(scaleDim, 12, docMap, poolData, viewDefsToJSX, [], 0, [divider]); } @@ -399,7 +400,7 @@ function normalizeResults( ): ViewDefResult[] { const grpEles = groupNames.map(gn => ({ x: gn.x, y: gn.y, width: gn.width, height: gn.height }) as ViewDefBounds); const docEles = Array.from(docMap.entries()).map(ele => ele[1]); - const aggBounds = aggregateBounds(grpEles.concat(docEles.map(de => ({ ...de, type: "doc", payload: "" }))).filter(e => e.zIndex !== -99), 0, 0); + const aggBounds = aggregateBounds(extras.concat(grpEles.concat(docEles.map(de => ({ ...de, type: "doc", payload: "" })))).filter(e => e.zIndex !== -99), 0, 0); aggBounds.r = Math.max(minWidth, aggBounds.r - aggBounds.x); const wscale = panelDim[0] / (aggBounds.r - aggBounds.x); let scale = wscale * (aggBounds.b - aggBounds.y) > panelDim[1] ? (panelDim[1]) / (aggBounds.b - aggBounds.y) : wscale; -- cgit v1.2.3-70-g09d2