From 7c93a65535a278dd1381b27fbd4c3869eed19527 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Fri, 3 Jul 2020 20:22:52 +0900 Subject: pin and icon --- src/client/views/AntimodeMenu.tsx | 7 +- src/client/views/GestureOverlay.tsx | 10 +- src/client/views/MainView.tsx | 11 +- .../collectionFreeForm/InkOptionsMenu.scss | 5 + .../collectionFreeForm/InkOptionsMenu.tsx | 267 ++++++++++++++------- 5 files changed, 202 insertions(+), 98 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/AntimodeMenu.tsx b/src/client/views/AntimodeMenu.tsx index 3e4d20fea..d83ac434c 100644 --- a/src/client/views/AntimodeMenu.tsx +++ b/src/client/views/AntimodeMenu.tsx @@ -137,13 +137,18 @@ export default abstract class AntimodeMenu extends React.Component { protected getElement(buttons: JSX.Element[]) { return (
+ style={{ + left: this._left, top: this._top, opacity: this._opacity, transitionProperty: this._transitionProperty, transitionDuration: this._transitionDuration, transitionDelay: this._transitionDelay, + position: this.Pinned ? "unset" : undefined + }}>
{buttons}
); } + + protected getElementWithRows(rows: JSX.Element[], numRows: number, hasDragger: boolean = true) { return (
{ @@ -885,7 +891,9 @@ export default class GestureOverlay extends Touchable { render() { return ( -
+ +
{this.showMobileInkOverlay ? : <>} {this.elements} diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index 8f5a31b6c..afdff4ed8 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -453,10 +453,12 @@ export class MainView extends React.Component { @computed get mainContent() { const sidebar = this.userDoc?.["tabs-panelContainer"]; + console.log(InkOptionsMenu.Instance?.Pinned); return !this.userDoc || !(sidebar instanceof Doc) ? (null) : (
@@ -593,7 +595,10 @@ export class MainView extends React.Component { - + + + + {this.mainContent} @@ -606,7 +611,7 @@ export class MainView extends React.Component { - + {this.snapLines} diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss index a9fab4c1e..7329f4fc1 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss @@ -26,6 +26,11 @@ /* Make the buttons appear below each other */ } +.btn-draw { + display: inline; + /* Make the buttons appear below each other */ +} + .btn2-group { display: block; background: #323232; diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index f1032adaa..7de70b8cd 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -17,6 +17,7 @@ import { DocumentType } from "../../../documents/DocumentTypes"; import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; import { faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSubscript, faSuperscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faSleigh, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve, } from "@fortawesome/free-solid-svg-icons"; +import { Cast, StrCast, BoolCast } from "../../../../fields/Types"; library.add(faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSuperscript, faSubscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve); @@ -28,36 +29,67 @@ export default class InkOptionsMenu extends AntimodeMenu { private _width = ["1", "5", "10", "100"]; // private _buttons = ["circle", "triangle", "rectangle", "arrow", "line"]; // private _icons = ["O", "∆", "ロ", "➜", "-"]; - private _buttons = ["circle", "triangle", "rectangle", "line", "noRec", "",]; - private _icons = ["O", "∆", "ロ", "⎯", "✖︎", " "]; + // private _buttons = ["circle", "triangle", "rectangle", "line", "noRec", "",]; + // private _icons = ["O", "∆", "ロ", "⎯⎯⎯", "✖︎", " "]; //arrowStart and arrowEnd must match and defs must exist in Inking Stroke - private _arrowStart = ["arrowHead", "arrowHead", "dot", "dot", "none"]; - private _arrowEnd = ["none", "arrowEnd", "none", "dot", "none"]; - private _arrowIcons = ["→", "↔︎", "•", "••", " "]; + // private _arrowStart = ["arrowHead", "arrowHead", "dot", "dot", "none"]; + // private _arrowEnd = ["none", "arrowEnd", "none", "dot", "none"]; + // private _arrowIcons = ["→", "↔︎", "•", "••", " "]; + private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; + private _head = ["none", "arrowHead", "arrowHead", "none", "arrowHead", "arrowHead", "none", "none", "none"]; + private _end = ["none", "none", "arrowEnd", "none", "none", "arrowEnd", "none", "none", "none"]; + private _shape = ["", "", "", "", "", "", "rectangle", "circle", "triangle"]; + + @observable _shapesNum = this._shape.length; + @observable _selected = this._shapesNum; + + @observable private collapsed: boolean = false; @observable _colorBtn = false; @observable _widthBtn = false; @observable _fillBtn = false; - @observable _arrowBtn = false; - @observable _dashBtn = false; - @observable _shapeBtn = false; + // @observable _arrowBtn = false; + // @observable _dashBtn = false; + // @observable _shapeBtn = false; constructor(props: Readonly<{}>) { super(props); InkOptionsMenu.Instance = this; this._canFade = false; // don't let the inking menu fade away + this.Pinned = BoolCast(Doc.UserDoc()["inkOptionsMenu-pinned"]); + } - getColors = () => { - return this._palette; + @action + toggleMenuPin = (e: React.MouseEvent) => { + Doc.UserDoc()["inkOptionsMenu-pinned"] = this.Pinned = !this.Pinned; + if (!this.Pinned) { + // this.fadeOut(true); + } } @action - changeArrow = (arrowStart: string, arrowEnd: string) => { - SetActiveArrowStart(arrowStart); - SetActiveArrowEnd(arrowEnd); + protected toggleCollapse = (e: React.MouseEvent) => { + this.collapsed = !this.collapsed; + setTimeout(() => { + const x = Math.min(this._left, window.innerWidth - InkOptionsMenu.Instance.width); + InkOptionsMenu.Instance.jumpTo(x, this._top, true); + }, 0); + } + + + + + getColors = () => { + return this._palette; } + // @action + // changeArrow = (arrowStart: string, arrowEnd: string) => { + // SetActiveArrowStart(arrowStart); + // SetActiveArrowEnd(arrowEnd); + // } + @action changeColor = (color: string, type: string) => { const col: ColorState = { @@ -116,40 +148,77 @@ export default class InkOptionsMenu extends AntimodeMenu { this.editProperties(ActiveDash(), "dash"); } - @computed get arrowPicker() { - var currIcon; - for (var i = 0; i < this._arrowStart.length; i++) { - if (this._arrowStart[i] === ActiveArrowStart() && this._arrowEnd[i] === ActiveArrowEnd()) { - currIcon = this._arrowIcons[i]; - if (this._arrowIcons[i] === " ") { - currIcon = "➤"; - } - } - } - var arrowPicker = ; - if (this._arrowBtn) { - arrowPicker =
- {arrowPicker} - {this._arrowStart.map((arrowStart, i) => { - return ; - })} -
; - } - return arrowPicker; + @computed get drawButtons() { + const drawButtons =
+ {this._draw.map((icon, i) => { + return ; + })}
; + return drawButtons; } + // @computed get arrowPicker() { + // var currIcon; + // for (var i = 0; i < this._arrowStart.length; i++) { + // if (this._arrowStart[i] === ActiveArrowStart() && this._arrowEnd[i] === ActiveArrowEnd()) { + // currIcon = this._arrowIcons[i]; + // if (this._arrowIcons[i] === " ") { + // currIcon = "➤"; + // } + // } + // } + // var arrowPicker = ; + // if (this._arrowBtn) { + // arrowPicker =
+ // {arrowPicker} + // {this._arrowStart.map((arrowStart, i) => { + // return ; + // })} + //
; + // } + // return arrowPicker; + // } + @computed get widthPicker() { var widthPicker = ; - if (this._shapeBtn) { - shapePicker =
- {shapePicker} - {this._buttons.map((btn, i) => { - var ttl = btn; - if (btn === "") { - ttl = "no shape"; - } - if (btn === "noRec") { - ttl = "disable shape recognition"; - } - return ; - })} -
; - } - return shapePicker; - } + // @computed get shapePicker() { + // var currIcon; + // if (GestureOverlay.Instance.InkShape === "") { + // currIcon = ; + // } else { + // for (var i = 0; i < this._icons.length; i++) { + // if (GestureOverlay.Instance.InkShape === this._buttons[i]) { + // currIcon = this._icons[i]; + // } + // } + // } + // var shapePicker = ; + // if (this._shapeBtn) { + // shapePicker =
+ // {shapePicker} + // {this._buttons.map((btn, i) => { + // var ttl = btn; + // if (btn === "") { + // ttl = "no shape"; + // } + // if (btn === "noRec") { + // ttl = "disable shape recognition"; + // } + // return ; + // })} + //
; + // } + // return shapePicker; + // } @computed get bezierButton() { return , - this.shapePicker, - this.bezierButton, + // this.shapePicker, + // this.bezierButton, this.widthPicker, this.colorPicker, this.fillPicker, - this.arrowPicker, - this.dashButton, + this.drawButtons, + // this.arrowPicker, + // this.dashButton, + + ]; + + // return this.getElement(buttons); return this.getElement(buttons); } } Scripting.addGlobal(function activatePen(penBtn: any) { if (penBtn) { - Doc.SetSelectedTool(InkTool.Pen); + //no longer changes to inkmode + // Doc.SetSelectedTool(InkTool.Pen); InkOptionsMenu.Instance.jumpTo(300, 300); + InkOptionsMenu.Instance.Pinned = true; + } else { - Doc.SetSelectedTool(InkTool.None); + // Doc.SetSelectedTool(InkTool.None); + InkOptionsMenu.Instance.Pinned = false; InkOptionsMenu.Instance.fadeOut(true); + } }); \ No newline at end of file -- cgit v1.2.3-70-g09d2 From c3a147995564a10ae7650330aa11bbbb4fabdfda Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Tue, 7 Jul 2020 15:08:21 -0500 Subject: UI change to menu --- src/client/views/linking/LinkMenu.scss | 35 +++++++++++++++--------------- src/client/views/linking/LinkMenu.tsx | 11 +++++++++- src/client/views/linking/LinkMenuItem.scss | 10 ++++++++- 3 files changed, 36 insertions(+), 20 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/linking/LinkMenu.scss b/src/client/views/linking/LinkMenu.scss index 4b1a3f425..10a24c5ca 100644 --- a/src/client/views/linking/LinkMenu.scss +++ b/src/client/views/linking/LinkMenu.scss @@ -5,35 +5,34 @@ height: auto; //border: 1px solid black; - &:hover { - width: calc(auto + 26px); - } + // &:hover { + // width: calc(auto + 26px); + // } } .linkMenu-list { border: 1px solid black; - max-height: 200px; - overflow-y: scroll; + max-height: 170px; + //overflow-y: scroll; position: absolute; z-index: 10; background: white; min-width: 150px; - border-radius: 5px; - padding-top: 6.5px; - padding-bottom: 6.5px; - padding-left: 6.5px; - padding-right: 2px; - //width: calc(auto + 50px); -} - -.linkMenu-group { - //border-bottom: 0.5px solid lightgray; - //@extend: 5px 0; - + //border-radius: 5px; + //padding-top: 6.5px; + //padding-bottom: 6.5px; + //padding-left: 6.5px; + //padding-right: 2px; + width: calc(auto + 50px); &:last-child { border-bottom: none; } +} + +.linkMenu-group { + border-bottom: 0.5px solid lightgray; + //@extend: 5px 0; .linkMenu-group-name { display: flex; @@ -56,7 +55,7 @@ p { width: 100%; - padding: 4px 6px; + //padding: 4px 6px; line-height: 12px; border-radius: 5px; font-weight: bold; diff --git a/src/client/views/linking/LinkMenu.tsx b/src/client/views/linking/LinkMenu.tsx index 8a7b12f48..064c24f7a 100644 --- a/src/client/views/linking/LinkMenu.tsx +++ b/src/client/views/linking/LinkMenu.tsx @@ -29,6 +29,8 @@ export class LinkMenu extends React.Component { @observable private _linkMenuRef = React.createRef(); private _editorRef = React.createRef(); + @observable private _numLinks: number = 0; + @action onClick = (e: PointerEvent) => { @@ -69,6 +71,9 @@ export class LinkMenu extends React.Component { showEditor={action((linkDoc: Doc) => this._editingLink = linkDoc)} addDocTab={this.props.addDocTab} /> ); + group.forEach((item) => { + this._numLinks++; + }); }); // if source doc has no links push message @@ -77,12 +82,16 @@ export class LinkMenu extends React.Component { return linkItems; } + @action render() { const sourceDoc = this.props.docView.props.Document; const groups: Map = LinkManager.Instance.getRelatedGroupedLinks(sourceDoc); return
+ style={{ + left: this.props.location[0], top: this.props.location[1], + overflowY: this._numLinks > 4 ? "scroll" : "auto" + }}> {!this._editingLink ? this.renderAllGroups(groups) : Date: Tue, 7 Jul 2020 17:54:33 -0500 Subject: adding apply for descriptions, author, creation date --- package.json | 2 +- src/client/views/linking/LinkEditor.scss | 83 +++++++++++++++++++++++------- src/client/views/linking/LinkEditor.tsx | 68 +++++++++++++++++++----- src/client/views/linking/LinkMenu.scss | 13 ++++- src/client/views/linking/LinkMenu.tsx | 17 +++--- src/client/views/linking/LinkMenuItem.scss | 2 +- src/client/views/linking/LinkMenuItem.tsx | 3 ++ 7 files changed, 144 insertions(+), 44 deletions(-) (limited to 'src/client/views') diff --git a/package.json b/package.json index 62a554355..5a6c6f0b1 100644 --- a/package.json +++ b/package.json @@ -249,4 +249,4 @@ "xoauth2": "^1.2.0", "xregexp": "^4.3.0" } -} \ No newline at end of file +} diff --git a/src/client/views/linking/LinkEditor.scss b/src/client/views/linking/LinkEditor.scss index 406a38c26..937427e46 100644 --- a/src/client/views/linking/LinkEditor.scss +++ b/src/client/views/linking/LinkEditor.scss @@ -3,12 +3,12 @@ .linkEditor { width: 100%; height: auto; - font-size: 12px; // TODO + font-size: 13px; // TODO user-select: none; } .linkEditor-button-back { - margin-bottom: 6px; + //margin-bottom: 6px; border-radius: 10px; width: 18px; height: 18px; @@ -17,12 +17,13 @@ .linkEditor-info { //border-bottom: 0.5px solid $light-color-secondary; - padding-bottom: 4px; + //padding-bottom: 1px; padding-top: 5px; padding-left: 5px; //margin-bottom: 6px; display: flex; justify-content: space-between; + color: black; .linkEditor-linkedTo { width: calc(100% - 26px); @@ -31,30 +32,65 @@ } } +.linkEditor-moreInfo { + margin-left: 12px; + padding-left: 13px; + padding-right: 6.5px; + padding-bottom: 4px; + font-size: 9px; + //font-style: italic; + text-decoration-color: grey; +} + .linkEditor-description { padding-left: 6.5px; padding-right: 6.5px; padding-bottom: 3.5px; - .linkEditor-description-text { - text-decoration-color: grey; + .linkEditor-description-label { + text-decoration-color: black; + color: black; } .linkEditor-description-input { - border: 1px solid grey; - border-radius: 4px; - background-color: rgb(236, 236, 236); - padding-left: 2px; - padding-right: 2px; - color: grey; - text-decoration-color: grey; + display: flex; + + .linkEditor-description-editing { + min-width: 85%; + //border: 1px solid grey; + //border-radius: 4px; + padding-left: 2px; + padding-right: 2px; + margin-right: 4px; + color: black; + text-decoration-color: grey; + } + + .linkEditor-description-add-button { + display: inline; + /* float: right; */ + border-radius: 9px; + font-size: 9px; + background-color: black; + /* padding: 3px; */ + padding-top: 4px; + padding-left: 3px; + padding-bottom: 4px; + padding-right: 5px; + height: 80%; + color: white; + } } } .linkEditor-followingDropdown { padding-left: 6.5px; padding-right: 6.5px; - padding-bottom: 3.5px; + padding-bottom: 6px; + + .linkEditor-followingDropdown-label { + color: black; + } .linkEditor-followingDropdown-dropdown { @@ -62,11 +98,11 @@ border: 1px solid grey; border-radius: 4px; - background-color: rgb(236, 236, 236); + //background-color: rgb(236, 236, 236); padding-left: 2px; padding-right: 2px; - color: grey; - text-decoration-color: grey; + text-decoration-color: black; + color: black; .linkEditor-followingDropdown-icon { float: right; @@ -77,17 +113,22 @@ padding-left: 3px; padding-right: 3px; + &:last-child { + border-bottom: none; + } + .linkEditor-followingDropdown-option { - border: 0.25px dotted grey; - background-color: rgb(236, 236, 236); + border: 0.25px solid grey; + //background-color: rgb(236, 236, 236); padding-left: 2px; padding-right: 2px; color: grey; text-decoration-color: grey; font-size: 9px; + border-top: none; &:hover { - background-color: rgb(211, 210, 210); + background-color: rgb(187, 220, 231); } } @@ -98,6 +139,10 @@ } + + + + .linkEditor-button, .linkEditor-addbutton { width: 18px; diff --git a/src/client/views/linking/LinkEditor.tsx b/src/client/views/linking/LinkEditor.tsx index 014d57ed0..7af11bca1 100644 --- a/src/client/views/linking/LinkEditor.tsx +++ b/src/client/views/linking/LinkEditor.tsx @@ -1,10 +1,10 @@ import { library } from "@fortawesome/fontawesome-svg-core"; import { faArrowLeft, faCog, faEllipsisV, faExchangeAlt, faPlus, faTable, faTimes, faTrash } from '@fortawesome/free-solid-svg-icons'; import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { action, observable, computed } from "mobx"; +import { action, observable, computed, toJS } from "mobx"; import { observer } from "mobx-react"; import { Doc, Opt } from "../../../fields/Doc"; -import { StrCast } from "../../../fields/Types"; +import { StrCast, DateCast } from "../../../fields/Types"; import { Utils } from "../../../Utils"; import { LinkManager } from "../../util/LinkManager"; import './LinkEditor.scss'; @@ -291,6 +291,10 @@ export class LinkEditor extends React.Component { @observable followBehavior = this.props.linkDoc.follow ? this.props.linkDoc.follow : "Default"; + @observable showInfo: boolean = false; + + @computed get infoIcon() { if (this.showInfo) { return "chevron-up"; } return "chevron-down"; } + //@observable description = this.props.linkDoc.description ? StrCast(this.props.linkDoc.description) : "DESCRIPTION"; @@ -308,19 +312,44 @@ export class LinkEditor extends React.Component { } } + @action + onKey = (e: React.KeyboardEvent) => { + if (e.key === "Enter") { + this.setDescripValue(this.description); + document.getElementById('input')?.blur(); + } + } + + @action + onDown = () => { + this.setDescripValue(this.description); + } + + @action + handleChange = (e: React.ChangeEvent) => { + this.description = e.target.value; + } + + @computed get editDescription() { return
- Link Description:
+ Link Label:
- StrCast(LinkManager.currentLink?.description)} - SetValue={value => { this.setDescripValue(value); return false; }} - contents={LinkManager.currentLink?.description} - placeholder={"(optional) enter link description"} - color={"rgb(88, 88, 88)"} - >
; +
+ +
+
Add
+
; } @action @@ -346,7 +375,7 @@ export class LinkEditor extends React.Component { {this.followBehavior} + size={"lg"} />
@@ -367,6 +396,11 @@ export class LinkEditor extends React.Component {
; } + @action + changeInfo = () => { + this.showInfo = !this.showInfo; + } + render() { const destination = LinkManager.Instance.getOppositeAnchor(this.props.linkDoc, this.props.sourceDoc); @@ -382,11 +416,17 @@ export class LinkEditor extends React.Component { style={{ display: this.props.hideback ? "none" : "" }} onClick={this.props.showLinks}> -

editing link to: { +

Editing Link to: { destination.proto?.title ?? destination.title ?? "untitled"}

- + {/* */} +
+ {this.showInfo ?
+
{this.props.linkDoc.author ?
Author: {this.props.linkDoc.author}
: null}
+
{this.props.linkDoc.creationDate ?
Creation Date: + {DateCast(this.props.linkDoc.creationDate).toString()}
: null}
+
: null}
{this.editDescription}
{this.followingDropdown}
diff --git a/src/client/views/linking/LinkMenu.scss b/src/client/views/linking/LinkMenu.scss index 10a24c5ca..422ab0430 100644 --- a/src/client/views/linking/LinkMenu.scss +++ b/src/client/views/linking/LinkMenu.scss @@ -3,7 +3,8 @@ .linkMenu { width: 100%; height: auto; - //border: 1px solid black; + + border: 1px solid black; // &:hover { // width: calc(auto + 26px); @@ -11,9 +12,13 @@ } .linkMenu-list { + border: 1px solid black; + + box-shadow: 3px 3px 1.5px grey; + max-height: 170px; - //overflow-y: scroll; + overflow-y: scroll; position: absolute; z-index: 10; background: white; @@ -34,6 +39,10 @@ border-bottom: 0.5px solid lightgray; //@extend: 5px 0; + &:last-child { + border-bottom: none; + } + .linkMenu-group-name { display: flex; diff --git a/src/client/views/linking/LinkMenu.tsx b/src/client/views/linking/LinkMenu.tsx index 064c24f7a..478ac3fe6 100644 --- a/src/client/views/linking/LinkMenu.tsx +++ b/src/client/views/linking/LinkMenu.tsx @@ -1,4 +1,4 @@ -import { action, observable } from "mobx"; +import { action, observable, computed } from "mobx"; import { observer } from "mobx-react"; import { DocumentView } from "../nodes/DocumentView"; import { LinkEditor } from "./LinkEditor"; @@ -29,7 +29,14 @@ export class LinkMenu extends React.Component { @observable private _linkMenuRef = React.createRef(); private _editorRef = React.createRef(); - @observable private _numLinks: number = 0; + //@observable private _numLinks: number = 0; + + // @computed get overflow() { + // if (this._numLinks) { + // return "scroll"; + // } + // return "auto"; + // } @action onClick = (e: PointerEvent) => { @@ -71,9 +78,6 @@ export class LinkMenu extends React.Component { showEditor={action((linkDoc: Doc) => this._editingLink = linkDoc)} addDocTab={this.props.addDocTab} /> ); - group.forEach((item) => { - this._numLinks++; - }); }); // if source doc has no links push message @@ -82,7 +86,6 @@ export class LinkMenu extends React.Component { return linkItems; } - @action render() { const sourceDoc = this.props.docView.props.Document; const groups: Map = LinkManager.Instance.getRelatedGroupedLinks(sourceDoc); @@ -90,7 +93,7 @@ export class LinkMenu extends React.Component {
4 ? "scroll" : "auto" + //overflowY: "scroll", }}> {!this._editingLink ? this.renderAllGroups(groups) : diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss index df8a3cadb..8578d0b75 100644 --- a/src/client/views/linking/LinkMenuItem.scss +++ b/src/client/views/linking/LinkMenuItem.scss @@ -103,7 +103,7 @@ width: 20px; height: 20px; margin: 0; - //margin-right: 6px; + margin-right: 4px; padding-right: 6px; border-radius: 50%; pointer-events: auto; diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index 6af474513..59a88a1d9 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -78,7 +78,10 @@ export class LinkMenuItem extends React.Component { @action toggleShowMore(e: React.PointerEvent) { e.stopPropagation(); this._showMore = !this._showMore; } onEdit = (e: React.PointerEvent): void => { + + console.log("Edit"); LinkManager.currentLink = this.props.linkDoc; + console.log(this.props.linkDoc); setupMoveUpEvents(this, e, this.editMoved, emptyFunction, () => this.props.showEditor(this.props.linkDoc)); } -- cgit v1.2.3-70-g09d2 From 2b1af3fab4cc51f8cbb577ed51842cec1774a355 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Wed, 8 Jul 2020 13:22:49 -0500 Subject: restructured textbox comment, cleaned menu UI --- src/client/views/linking/LinkEditor.scss | 15 ++-- src/client/views/linking/LinkEditor.tsx | 3 +- src/client/views/linking/LinkMenu.scss | 71 ++++++++++------ src/client/views/linking/LinkMenu.tsx | 18 ++-- src/client/views/linking/LinkMenuItem.scss | 29 ++++--- src/client/views/linking/LinkMenuItem.tsx | 10 ++- .../formattedText/FormattedTextBoxComment.scss | 99 +++++++++------------- .../formattedText/FormattedTextBoxComment.tsx | 53 +++--------- 8 files changed, 143 insertions(+), 155 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/linking/LinkEditor.scss b/src/client/views/linking/LinkEditor.scss index 937427e46..87afc99eb 100644 --- a/src/client/views/linking/LinkEditor.scss +++ b/src/client/views/linking/LinkEditor.scss @@ -40,6 +40,10 @@ font-size: 9px; //font-style: italic; text-decoration-color: grey; + + .button { + color: black; + } } .linkEditor-description { @@ -61,7 +65,7 @@ //border-radius: 4px; padding-left: 2px; padding-right: 2px; - margin-right: 4px; + //margin-right: 4px; color: black; text-decoration-color: grey; } @@ -69,14 +73,14 @@ .linkEditor-description-add-button { display: inline; /* float: right; */ - border-radius: 9px; + border-radius: 7px; font-size: 9px; background-color: black; /* padding: 3px; */ padding-top: 4px; - padding-left: 3px; + padding-left: 7px; padding-bottom: 4px; - padding-right: 5px; + padding-right: 8px; height: 80%; color: white; } @@ -102,10 +106,11 @@ padding-left: 2px; padding-right: 2px; text-decoration-color: black; - color: black; + color: rgb(94, 94, 94); .linkEditor-followingDropdown-icon { float: right; + color: black; } } diff --git a/src/client/views/linking/LinkEditor.tsx b/src/client/views/linking/LinkEditor.tsx index 7af11bca1..a26685318 100644 --- a/src/client/views/linking/LinkEditor.tsx +++ b/src/client/views/linking/LinkEditor.tsx @@ -339,6 +339,7 @@ export class LinkEditor extends React.Component {
{ destination.proto?.title ?? destination.title ?? "untitled"}

{/* */} - +
{this.showInfo ?
{this.props.linkDoc.author ?
Author: {this.props.linkDoc.author}
: null}
diff --git a/src/client/views/linking/LinkMenu.scss b/src/client/views/linking/LinkMenu.scss index 422ab0430..4f7ac3275 100644 --- a/src/client/views/linking/LinkMenu.scss +++ b/src/client/views/linking/LinkMenu.scss @@ -1,37 +1,59 @@ @import "../globalCssVariables"; .linkMenu { - width: 100%; + width: auto; height: auto; - border: 1px solid black; - // &:hover { - // width: calc(auto + 26px); - // } -} + .linkMenu-list { -.linkMenu-list { + display: inline-block; - border: 1px solid black; + border: 1px solid black; - box-shadow: 3px 3px 1.5px grey; + box-shadow: 3px 3px 1.5px grey; - max-height: 170px; - overflow-y: scroll; - position: absolute; - z-index: 10; - background: white; - min-width: 150px; - //border-radius: 5px; - //padding-top: 6.5px; - //padding-bottom: 6.5px; - //padding-left: 6.5px; - //padding-right: 2px; - width: calc(auto + 50px); + max-height: 170px; + overflow-y: scroll; + position: relative; + z-index: 10; + background: white; + min-width: 170px; + //border-radius: 5px; + //padding-top: 6.5px; + //padding-bottom: 6.5px; + //padding-left: 6.5px; + //padding-right: 2px; + //width: calc(auto + 50px); - &:last-child { - border-bottom: none; + white-space: nowrap; + + overflow-x: hidden; + + &:last-child { + border-bottom: none; + } + + &:hover { + padding-right: 65px; + display: inline-block; + } + } + + .linkMenu-listEditor { + + display: inline-block; + + border: 1px solid black; + + box-shadow: 3px 3px 1.5px grey; + + max-height: 170px; + overflow-y: scroll; + position: relative; + z-index: 10; + background: white; + min-width: 170px; } } @@ -39,6 +61,7 @@ border-bottom: 0.5px solid lightgray; //@extend: 5px 0; + &:last-child { border-bottom: none; } @@ -54,7 +77,7 @@ } p.expand-one { - width: calc(100% + 26px); + width: calc(100% + 20px); } .linkEditor-tableButton { diff --git a/src/client/views/linking/LinkMenu.tsx b/src/client/views/linking/LinkMenu.tsx index 478ac3fe6..234cd5e07 100644 --- a/src/client/views/linking/LinkMenu.tsx +++ b/src/client/views/linking/LinkMenu.tsx @@ -90,16 +90,16 @@ export class LinkMenu extends React.Component { const sourceDoc = this.props.docView.props.Document; const groups: Map = LinkManager.Instance.getRelatedGroupedLinks(sourceDoc); return
-
- {!this._editingLink ? - this.renderAllGroups(groups) : + {!this._editingLink ?
+ {this.renderAllGroups(groups)} +
:
this._editingLink = undefined)} /> - } -
; +
+ } + +
; } } \ No newline at end of file diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss index 8578d0b75..9f1f82ce2 100644 --- a/src/client/views/linking/LinkMenuItem.scss +++ b/src/client/views/linking/LinkMenuItem.scss @@ -26,6 +26,8 @@ color: rgb(85, 120, 196); font-size: 14px; padding-bottom: 2px; + padding-right: 4px; + margin-right: 4px; } .linkMenu-description { @@ -36,12 +38,16 @@ } p { - //padding: 4px 2px; + padding-right: 4px; line-height: 12px; border-radius: 5px; - overflow-wrap: break-word; + //overflow-wrap: break-word; user-select: none; } + + &:hover { + padding-right: 8px; + } } } @@ -60,6 +66,7 @@ &:hover { + width: calc(100% + 58px); .linkMenu-item-buttons { display: flex; @@ -74,19 +81,13 @@ text-overflow: break; } - &.expand-two p { - width: calc(100% - 52px); - //text-decoration: underline; - //color: rgb(15, 57, 148); - //background-color: lightgray; - } + // &.expand-two p { + // width: calc(100% - 63px); + // } - &.expand-three p { - width: calc(100% - 84px); - //text-decoration: underline; - //color: rgb(15, 57, 148); - //background-color: lightgray; - } + // &.expand-three p { + // width: calc(100% - 93px); + // } } } } diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index 59a88a1d9..57993d240 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -1,5 +1,5 @@ import { library } from '@fortawesome/fontawesome-svg-core'; -import { faArrowRight, faChevronDown, faChevronUp, faEdit, faEye, faTimes, faPencilAlt } from '@fortawesome/free-solid-svg-icons'; +import { faArrowRight, faChevronDown, faChevronUp, faEdit, faEye, faTimes, faPencilAlt, faEyeSlash } from '@fortawesome/free-solid-svg-icons'; import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; import { action, observable } from 'mobx'; import { observer } from "mobx-react"; @@ -15,7 +15,7 @@ import { setupMoveUpEvents, emptyFunction } from '../../../Utils'; import { DocumentView } from '../nodes/DocumentView'; import { DocumentLinksButton } from '../nodes/DocumentLinksButton'; import { LinkDocPreview } from '../nodes/LinkDocPreview'; -library.add(faEye, faEdit, faTimes, faArrowRight, faChevronDown, faChevronUp, faPencilAlt); +library.add(faEye, faEdit, faTimes, faArrowRight, faChevronDown, faChevronUp, faPencilAlt, faEyeSlash); interface LinkMenuItemProps { @@ -179,6 +179,8 @@ export class LinkMenuItem extends React.Component { const keys = LinkManager.Instance.getMetadataKeysInGroup(this.props.groupType);//groupMetadataKeys.get(this.props.groupType); const canExpand = keys ? keys.length > 0 : false; + const eyeIcon = this.props.linkDoc.shown ? "eye-slash" : "eye"; + return (
@@ -203,6 +205,10 @@ export class LinkMenuItem extends React.Component { {canExpand ?
this.toggleShowMore(e)}>
: <>} +
+
+ +
diff --git a/src/client/views/nodes/formattedText/FormattedTextBoxComment.scss b/src/client/views/nodes/formattedText/FormattedTextBoxComment.scss index 9089e7039..286ccf22d 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBoxComment.scss +++ b/src/client/views/nodes/formattedText/FormattedTextBoxComment.scss @@ -8,6 +8,45 @@ margin-bottom: 7px; -webkit-transform: translateX(-50%); transform: translateX(-50%); + box-shadow: 3px 3px 1.5px grey; + + .FormattedTextBoxComment-title { + background-color: white; + border: 8px solid white; + + .FormattedTextBoxComment-button { + display: inline; + padding-left: 6px; + padding-right: 6px; + padding-top: 2.5px; + padding-bottom: 2.5px; + width: 20px; + height: 20px; + margin: 0; + margin-right: 6px; + border-radius: 50%; + pointer-events: auto; + background-color: rgb(0, 0, 0); + color: rgb(255, 255, 255); + transition: transform 0.2s; + text-align: center; + position: relative; + font: 10px; + + &:hover { + background-color: rgb(77, 77, 77); + cursor: grab; + } + } + + .FormattedTextBoxComment-preview-wrapper { + max-width: 180px; + max-height: 168px; + overflow: hidden; + overflow-y: hidden; + padding-top: 5px; + } + } } .FormattedTextBox-tooltip:before { @@ -42,64 +81,4 @@ top: 50%; right: 0; transform: translateY(-50%); - - .FormattedTextBoxComment-button { - width: 20px; - height: 20px; - margin: 0; - margin-right: 6px; - border-radius: 50%; - pointer-events: auto; - background-color: rgb(38, 40, 41); - color: rgb(178, 181, 184); - font-size: 65%; - transition: transform 0.2s; - text-align: center; - position: relative; - - // margin-top: "auto"; - // margin-bottom: "auto"; - // background: black; - // color: white; - // display: inline-block; - // border-radius: 18px; - // font-size: 12.5px; - // width: 18px; - // height: 18px; - // margin-top: auto; - // margin-bottom: auto; - // margin-right: 3px; - // cursor: pointer; - // transition: transform 0.2s; - - .FormattedTextBoxComment-fa-icon { - margin-top: "auto"; - margin-bottom: "auto"; - background: black; - color: white; - display: inline-block; - border-radius: 18px; - font-size: 12.5px; - width: 18px; - height: 18px; - margin-top: auto; - margin-bottom: auto; - margin-right: 3px; - cursor: pointer; - transition: transform 0.2s; - // position: absolute; - // top: 50%; - // left: 50%; - // transform: translate(-50%, -50%); - } - - &:last-child { - margin-right: 0; - } - - &:hover { - background: rgb(53, 146, 199); - ; - } - } } \ No newline at end of file diff --git a/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx b/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx index 56826e5c7..79b09b374 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx +++ b/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx @@ -241,52 +241,22 @@ export class FormattedTextBoxComment { } if (target?.author) { FormattedTextBoxComment.showCommentbox("", view, nbef); - const docPreview =
+ + + const docPreview =
{target.title}
-
this._deleteRef = r}> - this._deleteRef = r}> +
-
this._followRef = r}> - this._followRef = r}> +
-
@@ -318,6 +288,9 @@ export class FormattedTextBoxComment { />
; + + + FormattedTextBoxComment.showCommentbox("", view, nbef); ReactDOM.render(docPreview, FormattedTextBoxComment.tooltipText); -- cgit v1.2.3-70-g09d2 From 3beca8e7d268dc7b67b20b2c8760ea5e4b6fdb88 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Wed, 8 Jul 2020 18:59:37 -0500 Subject: added dashDragging event --- src/client/util/DragManager.ts | 48 ++++++++++++++++++++++ .../collectionFreeForm/CollectionFreeFormView.tsx | 15 +++++++ src/client/views/nodes/DocumentLinksButton.tsx | 2 +- 3 files changed, 64 insertions(+), 1 deletion(-) (limited to 'src/client/views') diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index 2ceafff30..64c3d8458 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -427,6 +427,54 @@ export namespace DragManager { }, dragData.droppedDocuments); } + const target = document.elementFromPoint(e.x, e.y); + + const complete = new DragCompleteEvent(false, dragData); + + if (target) { + target.dispatchEvent( + new CustomEvent("dashDragging", { + bubbles: true, + detail: { + shiftKey: e.shiftKey, + altKey: e.altKey, + metaKey: e.metaKey, + ctrlKey: e.ctrlKey, + clientX: e.clientX, + clientY: e.clientY, + dataTransfer: new DataTransfer, + button: e.button, + buttons: e.buttons, + getModifierState: e.getModifierState, + movementX: e.movementX, + movementY: e.movementY, + pageX: e.pageX, + pageY: e.pageY, + relatedTarget: e.relatedTarget, + screenX: e.screenX, + screenY: e.screenY, + detail: e.detail, + view: e.view ? e.view : new Window, + nativeEvent: new DragEvent("dashDragging"), + currentTarget: target, + target: target, + bubbles: true, + cancelable: true, + defaultPrevented: true, + eventPhase: e.eventPhase, + isTrusted: true, + preventDefault: e.preventDefault, + isDefaultPrevented: () => true, + stopPropagation: e.stopPropagation, + isPropagationStopped: () => true, + persist: emptyFunction, + timeStamp: e.timeStamp, + type: "dashDragging" + } + }) + ); + } + const { thisX, thisY } = snapDrag(e, xFromLeft, yFromTop, xFromRight, yFromBottom); const moveX = thisX - lastX; diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 9bf425db2..5a762a85c 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1143,10 +1143,19 @@ export class CollectionFreeFormView extends CollectionSubView this.doLayoutComputation, (elements) => this._layoutElements = elements || [], { fireImmediately: true, name: "doLayout" }); + + const handler = (e: Event) => this.handleDragging(e, (e as CustomEvent).detail); + + document.addEventListener("dashDragging", handler); } + componentWillUnmount() { this._layoutComputeReaction?.(); + + const handler = (e: Event) => this.handleDragging(e, (e as CustomEvent).detail); + document.removeEventListener("dashDragging", handler); } + @computed get views() { return this._layoutElements.filter(ele => ele.bounds && !ele.bounds.z).map(ele => ele.ele); } elementFunc = () => this._layoutElements; @@ -1155,6 +1164,12 @@ export class CollectionFreeFormView extends CollectionSubView { + console.log(de.clientX); + console.log(de.clientX); + } + promoteCollection = undoBatch(action(() => { const childDocs = this.childDocs.slice(); childDocs.forEach(doc => { diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 7fb447cab..44e72215d 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -152,7 +152,7 @@ export class DocumentLinksButton extends React.Component
Date: Thu, 9 Jul 2020 01:54:29 -0500 Subject: started dragging pans screen (needs cleaning) --- src/client/util/LinkManager.ts | 2 + .../collectionFreeForm/CollectionFreeFormView.tsx | 105 ++++++++++++++++++--- 2 files changed, 96 insertions(+), 11 deletions(-) (limited to 'src/client/views') diff --git a/src/client/util/LinkManager.ts b/src/client/util/LinkManager.ts index 6da581f35..50f3fc1d6 100644 --- a/src/client/util/LinkManager.ts +++ b/src/client/util/LinkManager.ts @@ -3,6 +3,7 @@ import { List } from "../../fields/List"; import { listSpec } from "../../fields/Schema"; import { Cast, StrCast } from "../../fields/Types"; import { Scripting } from "./Scripting"; +import { undoBatch } from "./UndoManager"; /* * link doc: @@ -52,6 +53,7 @@ export class LinkManager { return false; } + @undoBatch public deleteLink(linkDoc: Doc): boolean { if (LinkManager.Instance.LinkManagerDoc && linkDoc instanceof Doc) { Doc.RemoveDocFromList(LinkManager.Instance.LinkManagerDoc, "data", linkDoc); diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 5a762a85c..a3d3a210d 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -101,6 +101,10 @@ export class CollectionFreeFormView extends CollectionSubView(); + @observable _marqueeRef = React.createRef(); + @observable canPanX: boolean = true; + @observable canPanY: boolean = true; + @computed get fitToContentScaling() { return this.fitToContent ? NumCast(this.layoutDoc.fitToContentScaling, 1) : 1; } @computed get fitToContent() { return (this.props.fitToBox || this.Document._fitToBox) && !this.isAnnotationOverlay; } @computed get parentScaling() { return this.props.ContentScaling && this.fitToContent && !this.isAnnotationOverlay ? this.props.ContentScaling() : 1; } @@ -1164,10 +1168,87 @@ export class CollectionFreeFormView extends CollectionSubView + @action handleDragging = (e: Event, de: DragEvent) => { - console.log(de.clientX); - console.log(de.clientX); + + const nw = NumCast(this.Document._nativeWidth, this.props.NativeWidth()); + const nh = NumCast(this.Document._nativeHeight, this.props.NativeHeight()); + const hscale = nh ? this.props.PanelHeight() / nh : 1; + const wscale = nw ? this.props.PanelWidth() / nw : 1; + + if (this._marqueeRef) { + if (this._marqueeRef.current) { + + // console.log("left: " + this._marqueeRef.current.clientLeft); + // console.log("width: " + this._marqueeRef.current.clientWidth); + // console.log("client x: " + de.clientX); + + // console.log("top: " + this._marqueeRef.current.clientTop); + // console.log("height: " + this._marqueeRef.current.clientHeight); + // console.log("client y: " + de.clientY); + + + if (this._marqueeRef.current.clientWidth > 0) { + if (de.clientX - 315 - this._marqueeRef.current.clientLeft < 25) { + console.log("PAN left "); + if (this.canPanX) { + this.Document._panX = de.clientX - 20 - this._marqueeRef.current.clientLeft; + setTimeout(action(() => { + this.canPanX = true; + this.panX(); + }), 2500); + this.canPanX = false; + } + } else if (de.clientX - 315 - this._marqueeRef.current.clientLeft - + this._marqueeRef.current.clientWidth < 25) { + console.log("PAN right "); + if (this.canPanX) { + this.Document._panX = de.clientX - 315 - this._marqueeRef.current.clientLeft - + this._marqueeRef.current.clientWidth; + + setTimeout(action(() => { + this.panX(); + this.canPanX = true; + }), 2500); + this.canPanX = false; + } + + } + } + + if (this._marqueeRef.current.clientHeight > 0) { + if (de.clientY - 120 - this._marqueeRef.current.clientTop < 25) { + console.log("PAN top "); + if (this.canPanY) { + this.Document._panY = de.clientY - 20 - this._marqueeRef.current.clientTop; + setTimeout(action(() => { + this.canPanY = true; + this.panY(); + }), 2500); + this.canPanY = false; + } + } else if (de.clientY - 120 - this._marqueeRef.current.clientTop - + this._marqueeRef.current.clientHeight < 25) { + console.log("PAN bottom "); + if (this.canPanY) { + this.Document._panY = de.clientY - 120 - this._marqueeRef.current.clientTop - + this._marqueeRef.current.clientHeight; + + setTimeout(action(() => { + this.panY(); + this.canPanY = true; + }), 2500); + this.canPanY = false; + } + + } + + } + } + } } promoteCollection = undoBatch(action(() => { @@ -1351,7 +1432,8 @@ export class CollectionFreeFormView extends CollectionSubView - - {this.children} - +
+ + {this.children} +
{this.showTimeline ? : (null)} ; } -- cgit v1.2.3-70-g09d2 From 27b0f32460245539d77bcd435627a68364e0bc0d Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Thu, 9 Jul 2020 12:15:42 -0500 Subject: fixed linking undo issues --- .../collectionFreeForm/CollectionFreeFormView.tsx | 96 ++++++++++++---------- src/client/views/nodes/DocumentLinksButton.tsx | 6 +- .../views/nodes/formattedText/FormattedTextBox.tsx | 2 + 3 files changed, 57 insertions(+), 47 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index a3d3a210d..ffa4be4b9 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1174,47 +1174,55 @@ export class CollectionFreeFormView extends CollectionSubView { - const nw = NumCast(this.Document._nativeWidth, this.props.NativeWidth()); - const nh = NumCast(this.Document._nativeHeight, this.props.NativeHeight()); - const hscale = nh ? this.props.PanelHeight() / nh : 1; - const wscale = nw ? this.props.PanelWidth() / nw : 1; + const top = this.panX(); + const left = this.panY(); + + const size = this.getTransform().transformDirection(this.props.PanelWidth(), this.props.PanelHeight()); + + const scale = this.getLocalTransform().inverse().Scale; if (this._marqueeRef) { + if (this._marqueeRef.current) { + // console.log("top: " + this._marqueeRef.current.clientTop); // console.log("left: " + this._marqueeRef.current.clientLeft); // console.log("width: " + this._marqueeRef.current.clientWidth); - // console.log("client x: " + de.clientX); - - // console.log("top: " + this._marqueeRef.current.clientTop); // console.log("height: " + this._marqueeRef.current.clientHeight); - // console.log("client y: " + de.clientY); + + console.log("width: " + this._marqueeRef.current.getBoundingClientRect().width); + console.log("height: " + this._marqueeRef.current.getBoundingClientRect().width); + console.log("x: " + this._marqueeRef.current.getBoundingClientRect().x); + console.log("y: " + this._marqueeRef.current.getBoundingClientRect().y); + + // console.log("mouse x: " + de.screenX); + // console.log("mouse y: " + de.screenY); if (this._marqueeRef.current.clientWidth > 0) { if (de.clientX - 315 - this._marqueeRef.current.clientLeft < 25) { console.log("PAN left "); - if (this.canPanX) { - this.Document._panX = de.clientX - 20 - this._marqueeRef.current.clientLeft; - setTimeout(action(() => { - this.canPanX = true; - this.panX(); - }), 2500); - this.canPanX = false; - } + + // if (this.canPanX) { + // this.Document._panX = left - 5; + // setTimeout(action(() => { + // this.canPanX = true; + // this.panX(); + // }), 250); + // this.canPanX = false; + // } } else if (de.clientX - 315 - this._marqueeRef.current.clientLeft - this._marqueeRef.current.clientWidth < 25) { console.log("PAN right "); - if (this.canPanX) { - this.Document._panX = de.clientX - 315 - this._marqueeRef.current.clientLeft - - this._marqueeRef.current.clientWidth; - - setTimeout(action(() => { - this.panX(); - this.canPanX = true; - }), 2500); - this.canPanX = false; - } + + // if (this.canPanX) { + // this.Document._panX = left + 5; + // setTimeout(action(() => { + // this.panX(); + // this.canPanX = true; + // }), 250); + // this.canPanX = false; + // } } } @@ -1222,27 +1230,27 @@ export class CollectionFreeFormView extends CollectionSubView 0) { if (de.clientY - 120 - this._marqueeRef.current.clientTop < 25) { console.log("PAN top "); - if (this.canPanY) { - this.Document._panY = de.clientY - 20 - this._marqueeRef.current.clientTop; - setTimeout(action(() => { - this.canPanY = true; - this.panY(); - }), 2500); - this.canPanY = false; - } + + // if (this.canPanY) { + // this.Document._panY = top - 5; + // setTimeout(action(() => { + // this.canPanY = true; + // this.panY(); + // }), 250); + // this.canPanY = false; + // } } else if (de.clientY - 120 - this._marqueeRef.current.clientTop - this._marqueeRef.current.clientHeight < 25) { console.log("PAN bottom "); - if (this.canPanY) { - this.Document._panY = de.clientY - 120 - this._marqueeRef.current.clientTop - - this._marqueeRef.current.clientHeight; - - setTimeout(action(() => { - this.panY(); - this.canPanY = true; - }), 2500); - this.canPanY = false; - } + + // if (this.canPanY) { + // this.Document._panY = top + 5; + // setTimeout(action(() => { + // this.panY(); + // this.canPanY = true; + // }), 250); + // this.canPanY = false; + // } } diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 44e72215d..ce96eddfe 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -3,7 +3,7 @@ import { observer } from "mobx-react"; import { Doc, DocListCast } from "../../../fields/Doc"; import { emptyFunction, setupMoveUpEvents, returnFalse } from "../../../Utils"; import { DragManager } from "../../util/DragManager"; -import { UndoManager } from "../../util/UndoManager"; +import { UndoManager, undoBatch } from "../../util/UndoManager"; import './DocumentLinksButton.scss'; import { DocumentView } from "./DocumentView"; import React = require("react"); @@ -29,7 +29,7 @@ export class DocumentLinksButton extends React.Component { if (this._linkButton.current !== null) { const linkDrag = UndoManager.StartBatch("Drag Link"); @@ -56,7 +56,7 @@ export class DocumentLinksButton extends React.Component { setupMoveUpEvents(this, e, this.onLinkButtonMoved, emptyFunction, action((e, doubleTap) => { if (doubleTap && this.props.InMenu) { diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx index fc63dfbf5..30e0738bf 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx +++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx @@ -944,6 +944,8 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp frag.forEach(node => nodes.push(marker(node))); return Fragment.fromArray(nodes); } + + function addLinkMark(node: Node, title: string, linkId: string) { if (!node.isText) { const content = addMarkToFrag(node.content, (node: Node) => addLinkMark(node, title, linkId)); -- cgit v1.2.3-70-g09d2 From e0a3e3bb169812bdb742459cd8a26e7a92ecdf63 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Thu, 9 Jul 2020 12:18:35 -0500 Subject: last linking undo fix --- src/client/views/nodes/DocumentLinksButton.tsx | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index ce96eddfe..1af3318cb 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -69,7 +69,7 @@ export class DocumentLinksButton extends React.Component { if (this.props.InMenu) { DocumentLinksButton.StartLink = this.props.View; @@ -80,7 +80,7 @@ export class DocumentLinksButton extends React.Component { setupMoveUpEvents(this, e, returnFalse, emptyFunction, action((e, doubleTap) => { if (doubleTap) { @@ -111,7 +111,7 @@ export class DocumentLinksButton extends React.Component { if (DocumentLinksButton.StartLink === this.props.View) { DocumentLinksButton.StartLink = undefined; -- cgit v1.2.3-70-g09d2 From 1d7fb12118db997ed411fa967e832c2a5f741584 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Thu, 9 Jul 2020 12:56:57 -0500 Subject: trying to add linked text in menu --- src/client/documents/Documents.ts | 6 +++++- src/client/views/linking/LinkMenuGroup.tsx | 2 ++ src/client/views/linking/LinkMenuItem.scss | 8 ++++++++ src/client/views/linking/LinkMenuItem.tsx | 3 ++- src/client/views/nodes/formattedText/FormattedTextBox.tsx | 6 +++++- 5 files changed, 22 insertions(+), 3 deletions(-) (limited to 'src/client/views') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index fa85d58f0..565e7c25d 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -909,7 +909,7 @@ export namespace DocUtils { DocUtils.ActiveRecordings.map(d => DocUtils.MakeLink({ doc: doc }, { doc: d }, "audio link", "audio timeline")); } - export function MakeLink(source: { doc: Doc }, target: { doc: Doc }, linkRelationship: string = "", description: string = "", id?: string) { + export function MakeLink(source: { doc: Doc }, target: { doc: Doc }, linkRelationship: string = "", description: string = "", id?: string, linkedText?: string) { const sv = DocumentManager.Instance.getDocumentView(source.doc); if (sv && sv.props.ContainingCollectionDoc === target.doc) return; if (target.doc === Doc.UserDoc()) return undefined; @@ -921,6 +921,10 @@ export namespace DocUtils { Doc.GetProto(source.doc).links = ComputedField.MakeFunction("links(self)"); Doc.GetProto(target.doc).links = ComputedField.MakeFunction("links(self)"); + if (linkedText) { + Doc.GetProto(linkDoc).linkedText = linkedText; + } + return linkDoc; } diff --git a/src/client/views/linking/LinkMenuGroup.tsx b/src/client/views/linking/LinkMenuGroup.tsx index ec17776e3..2f6b75437 100644 --- a/src/client/views/linking/LinkMenuGroup.tsx +++ b/src/client/views/linking/LinkMenuGroup.tsx @@ -82,11 +82,13 @@ export class LinkMenuGroup extends React.Component { return (
+ {/*

{this.props.groupType}:

{this.props.groupType === "*" || this.props.groupType === "" ? <> : this.viewGroupAsTable(this.props.groupType)}
*/} +
{groupItems}
diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss index 9f1f82ce2..6a6ea7fa0 100644 --- a/src/client/views/linking/LinkMenuItem.scss +++ b/src/client/views/linking/LinkMenuItem.scss @@ -21,6 +21,14 @@ padding: 4px 2px; //display: inline; + .linkMenu-source-title { + text-decoration: none; + color: rgb(43, 43, 43); + font-size: 7px; + padding-bottom: 0.75px; + } + + .linkMenu-destination-title { text-decoration: none; color: rgb(85, 120, 196); diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index 57993d240..b7cd50b7e 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -195,6 +195,8 @@ export class LinkMenuItem extends React.Component { onPointerDown={this.onLinkButtonDown}>
+ {this.props.linkDoc.linkedText ?

+ Source: {StrCast(this.props.linkDoc.linkedText)}

: null}

{StrCast(this.props.destinationDoc.title)}

@@ -208,7 +210,6 @@ export class LinkMenuItem extends React.Component {
-
diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx index 30e0738bf..7fd0d89a1 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx +++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx @@ -174,6 +174,8 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp linkOnDeselect: Map = new Map(); doLinkOnDeselect() { + + console.log("link on deselect"); Array.from(this.linkOnDeselect.entries()).map(entry => { const key = entry[0]; const value = entry[1]; @@ -183,7 +185,9 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp this.dataDoc[key] = doc || Docs.Create.FreeformDocument([], { title: value, _width: 500, _height: 500 }, value); DocUtils.Publish(this.dataDoc[key] as Doc, value, this.props.addDocument, this.props.removeDocument); if (linkDoc) { (linkDoc as Doc).anchor2 = this.dataDoc[key] as Doc; } - else DocUtils.MakeLink({ doc: this.rootDoc }, { doc: this.dataDoc[key] as Doc }, "link to named target", id); + else { + const linkDoc = DocUtils.MakeLink({ doc: this.rootDoc }, { doc: this.dataDoc[key] as Doc }, "link to named target", id); + } }); }); }); -- cgit v1.2.3-70-g09d2 From f774d6953d23dda9b8b20ed24b64e28607d3d88c Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Thu, 9 Jul 2020 14:53:52 -0400 Subject: fixed auto panning in collectionview. --- .../collectionFreeForm/CollectionFreeFormView.tsx | 124 +++++++++------------ 1 file changed, 51 insertions(+), 73 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index ffa4be4b9..7a7505319 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1172,89 +1172,67 @@ export class CollectionFreeFormView extends CollectionSubView @action - handleDragging = (e: Event, de: DragEvent) => { + handleDragging = (e: CustomEvent, de: DragEvent) => { const top = this.panX(); const left = this.panY(); const size = this.getTransform().transformDirection(this.props.PanelWidth(), this.props.PanelHeight()); - const scale = this.getLocalTransform().inverse().Scale; - if (this._marqueeRef) { - - if (this._marqueeRef.current) { - - // console.log("top: " + this._marqueeRef.current.clientTop); - // console.log("left: " + this._marqueeRef.current.clientLeft); - // console.log("width: " + this._marqueeRef.current.clientWidth); - // console.log("height: " + this._marqueeRef.current.clientHeight); - - console.log("width: " + this._marqueeRef.current.getBoundingClientRect().width); - console.log("height: " + this._marqueeRef.current.getBoundingClientRect().width); - console.log("x: " + this._marqueeRef.current.getBoundingClientRect().x); - console.log("y: " + this._marqueeRef.current.getBoundingClientRect().y); - - // console.log("mouse x: " + de.screenX); - // console.log("mouse y: " + de.screenY); - - - if (this._marqueeRef.current.clientWidth > 0) { - if (de.clientX - 315 - this._marqueeRef.current.clientLeft < 25) { - console.log("PAN left "); - - // if (this.canPanX) { - // this.Document._panX = left - 5; - // setTimeout(action(() => { - // this.canPanX = true; - // this.panX(); - // }), 250); - // this.canPanX = false; - // } - } else if (de.clientX - 315 - this._marqueeRef.current.clientLeft - - this._marqueeRef.current.clientWidth < 25) { - console.log("PAN right "); - - // if (this.canPanX) { - // this.Document._panX = left + 5; - // setTimeout(action(() => { - // this.panX(); - // this.canPanX = true; - // }), 250); - // this.canPanX = false; - // } - - } - } + if (this._marqueeRef?.current) { + const dragX = e.detail.clientX; + const dragY = e.detail.clientY; + const bounds = this._marqueeRef.current?.getBoundingClientRect()!; + + if (dragX - bounds.left < 25) { + console.log("PAN left "); + + // if (this.canPanX) { + // this.Document._panX = left - 5; + // setTimeout(action(() => { + // this.canPanX = true; + // this.panX(); + // }), 250); + // this.canPanX = false; + // } + } else if (bounds.right - dragX < 25) { + console.log("PAN right "); + + // if (this.canPanX) { + // this.Document._panX = left + 5; + // setTimeout(action(() => { + // this.panX(); + // this.canPanX = true; + // }), 250); + // this.canPanX = false; + // } - if (this._marqueeRef.current.clientHeight > 0) { - if (de.clientY - 120 - this._marqueeRef.current.clientTop < 25) { - console.log("PAN top "); - - // if (this.canPanY) { - // this.Document._panY = top - 5; - // setTimeout(action(() => { - // this.canPanY = true; - // this.panY(); - // }), 250); - // this.canPanY = false; - // } - } else if (de.clientY - 120 - this._marqueeRef.current.clientTop - - this._marqueeRef.current.clientHeight < 25) { - console.log("PAN bottom "); - - // if (this.canPanY) { - // this.Document._panY = top + 5; - // setTimeout(action(() => { - // this.panY(); - // this.canPanY = true; - // }), 250); - // this.canPanY = false; - // } + } - } + if (dragY - bounds.top < 25) { + console.log("PAN top "); + + // if (this.canPanY) { + // this.Document._panY = top - 5; + // setTimeout(action(() => { + // this.canPanY = true; + // this.panY(); + // }), 250); + // this.canPanY = false; + // } + } else if (bounds.bottom - dragY < 25) { + console.log("PAN bottom "); + + // if (this.canPanY) { + // this.Document._panY = top + 5; + // setTimeout(action(() => { + // this.panY(); + // this.canPanY = true; + // }), 250); + // this.canPanY = false; + // } - } } } } -- cgit v1.2.3-70-g09d2 From 372a37033358d9b9e5a2daf19ad590ca06107901 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Thu, 9 Jul 2020 14:01:43 -0500 Subject: added types display --- src/client/views/linking/LinkMenuItem.scss | 28 +++++++++++++++++++++------- src/client/views/linking/LinkMenuItem.tsx | 26 +++++++++++++++++++++++--- 2 files changed, 44 insertions(+), 10 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss index 6a6ea7fa0..e444b832b 100644 --- a/src/client/views/linking/LinkMenuItem.scss +++ b/src/client/views/linking/LinkMenuItem.scss @@ -29,13 +29,27 @@ } - .linkMenu-destination-title { - text-decoration: none; - color: rgb(85, 120, 196); - font-size: 14px; - padding-bottom: 2px; - padding-right: 4px; - margin-right: 4px; + .linkMenu-title-wrapper { + + display: flex; + + .destination-icon { + float: left; + width: 12px; + height: 12px; + padding-right: 3px; + margin-right: 3px; + } + + .linkMenu-destination-title { + text-decoration: none; + color: rgb(85, 120, 196); + font-size: 14px; + padding-bottom: 2px; + padding-right: 4px; + margin-right: 4px; + float: right; + } } .linkMenu-description { diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index b7cd50b7e..d2363c7d3 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -181,9 +181,26 @@ export class LinkMenuItem extends React.Component { const eyeIcon = this.props.linkDoc.shown ? "eye-slash" : "eye"; + const destinationIcon = this.props.destinationDoc.type === "image" ? "image" : + this.props.destinationDoc.type === "comparison" ? "columns" : + this.props.destinationDoc.type === "rtf" ? "font" : + this.props.destinationDoc.type === "collection" ? "folder" : + this.props.destinationDoc.type === "web" ? "globe-asia" : + this.props.destinationDoc.type === "screenshot" ? "photo-video" : + this.props.destinationDoc.type === "webcam" ? "video" : + this.props.destinationDoc.type === "audio" ? "microphone" : + this.props.destinationDoc.type === "button" ? "lightning" : + this.props.destinationDoc.type === "presentation" ? "tv" : + this.props.destinationDoc.type === "query" ? "search" : + this.props.destinationDoc.type === "script" ? "terminal" : + this.props.destinationDoc.type === "import" ? "cloud-upload-alt" : + this.props.destinationDoc.type === "docholder" ? "expand" : "question"; + + return (
+
LinkDocPreview.LinkInfo = undefined)} onPointerEnter={action(e => this.props.linkDoc && (LinkDocPreview.LinkInfo = { @@ -197,9 +214,12 @@ export class LinkMenuItem extends React.Component {
{this.props.linkDoc.linkedText ?

Source: {StrCast(this.props.linkDoc.linkedText)}

: null} -

- {StrCast(this.props.destinationDoc.title)}

+
+ +

+ {StrCast(this.props.destinationDoc.title)}

+
{this.props.linkDoc.description !== "" ?

{StrCast(this.props.linkDoc.description)}

: null}
-- cgit v1.2.3-70-g09d2 From 065a29e87c771b5cd9301b0468fb036e070cad17 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Fri, 10 Jul 2020 05:08:53 +0900 Subject: added format shape --- src/client/documents/Documents.ts | 3 +- src/client/util/InteractionUtils.tsx | 8 + src/client/util/SelectionManager.ts | 5 + src/client/views/AntimodeMenu.tsx | 18 + src/client/views/ContextMenu.tsx | 1 + src/client/views/DocumentDecorations.tsx | 2 + src/client/views/GestureOverlay.tsx | 17 +- src/client/views/InkingStroke.tsx | 15 +- src/client/views/MainView.tsx | 13 +- .../collectionFreeForm/FormatShapePane.scss | 53 ++ .../collectionFreeForm/FormatShapePane.tsx | 996 +++++++++++++++++++++ .../collectionFreeForm/InkOptionsMenu.scss | 2 +- .../collectionFreeForm/InkOptionsMenu.tsx | 40 +- 13 files changed, 1152 insertions(+), 21 deletions(-) create mode 100644 src/client/views/collections/collectionFreeForm/FormatShapePane.scss create mode 100644 src/client/views/collections/collectionFreeForm/FormatShapePane.tsx (limited to 'src/client/views') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index b70971c2d..eb8e04317 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -653,7 +653,7 @@ export namespace Docs { I.type = DocumentType.INK; I.layout = InkingStroke.LayoutString("data"); I.color = color; - I.strokeWidth = strokeWidth; + I.strokeWidth = Number(strokeWidth); I.strokeBezier = strokeBezier; I.fillColor = fillColor; I.arrowStart = arrowStart; @@ -667,6 +667,7 @@ export namespace Docs { I._width = options._width; I._height = options._height; I.author = Doc.CurrentUserEmail; + I.rotation = 0; I.data = new InkField(points); return I; // return I; diff --git a/src/client/util/InteractionUtils.tsx b/src/client/util/InteractionUtils.tsx index edeb461e0..2883e2056 100644 --- a/src/client/util/InteractionUtils.tsx +++ b/src/client/util/InteractionUtils.tsx @@ -3,6 +3,7 @@ import * as beziercurve from 'bezier-curve'; import * as fitCurve from 'fit-curve'; import "./InteractionUtils.scss"; import { Utils } from "../../Utils"; +import InkOptionsMenu from "../views/collections/collectionFreeForm/InkOptionsMenu"; export namespace InteractionUtils { export const MOUSETYPE = "mouse"; @@ -94,6 +95,13 @@ export namespace InteractionUtils { export function CreatePolyline(points: { X: number, Y: number }[], left: number, top: number, color: string, width: number, strokeWidth: number, bezier: string, fill: string, arrowStart: string, arrowEnd: string, dash: string, scalex: number, scaley: number, shape: string, pevents: string, drawHalo: boolean, nodefs: boolean) { + + // if (InkOptionsMenu.Instance.Pinned) { + // for (var i = 0; i < points.length; i++) { + // points[i].Y -= 35; + // } + // } + let pts: { X: number; Y: number; }[] = []; if (shape) { //if any of the shape are true pts = makePolygon(shape, points); diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts index 024532f90..aea2c542b 100644 --- a/src/client/util/SelectionManager.ts +++ b/src/client/util/SelectionManager.ts @@ -5,6 +5,7 @@ import { computedFn } from "mobx-utils"; import { List } from "../../fields/List"; import { Scripting } from "./Scripting"; import { DocumentManager } from "./DocumentManager"; +import FormatShapePane from "../views/collections/collectionFreeForm/FormatShapePane"; export namespace SelectionManager { @@ -14,6 +15,8 @@ export namespace SelectionManager { SelectedDocuments: ObservableMap = new ObservableMap(); @action SelectDoc(docView: DocumentView, ctrlPressed: boolean): void { + console.log("select" + ); // if doc is not in SelectedDocuments, add it if (!manager.SelectedDocuments.get(docView)) { if (!ctrlPressed) { @@ -29,6 +32,8 @@ export namespace SelectionManager { manager.SelectedDocuments.set(docView, true); } Doc.UserDoc().activeSelection = new List(SelectionManager.SelectedDocuments().map(dv => dv.props.Document)); + FormatShapePane.Instance.selected(); + } @action DeselectDoc(docView: DocumentView): void { diff --git a/src/client/views/AntimodeMenu.tsx b/src/client/views/AntimodeMenu.tsx index d83ac434c..cb6de1785 100644 --- a/src/client/views/AntimodeMenu.tsx +++ b/src/client/views/AntimodeMenu.tsx @@ -1,6 +1,7 @@ import React = require("react"); import { observable, action } from "mobx"; import "./AntimodeMenu.scss"; +import { inherits } from "util"; /** * This is an abstract class that serves as the base for a PDF-style or Marquee-style @@ -147,6 +148,23 @@ export default abstract class AntimodeMenu extends React.Component { ); } + protected getElementVert(buttons: JSX.Element[]) { + return ( +
+ {buttons} +
+ ); + } + protected getElementWithRows(rows: JSX.Element[], numRows: number, hasDragger: boolean = true) { diff --git a/src/client/views/ContextMenu.tsx b/src/client/views/ContextMenu.tsx index 941d7b44a..1a6b7ab90 100644 --- a/src/client/views/ContextMenu.tsx +++ b/src/client/views/ContextMenu.tsx @@ -224,6 +224,7 @@ export class ContextMenu extends React.Component { } render() { + console.log("context"); if (!this._display) { return null; } diff --git a/src/client/views/DocumentDecorations.tsx b/src/client/views/DocumentDecorations.tsx index 4fda10926..8edd4c4a9 100644 --- a/src/client/views/DocumentDecorations.tsx +++ b/src/client/views/DocumentDecorations.tsx @@ -293,6 +293,8 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { const doc = Document(element.rootDoc); if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { + doc.rotation = Number(doc.rotation) + Number(angle); + console.log(doc.rotation); const ink = Cast(doc.data, InkField)?.inkData; if (ink) { diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index bfd659207..26a06090b 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -633,7 +633,8 @@ export default class GestureOverlay extends Touchable { this.makePolygon(this.InkShape, false); this.dispatchGesture(GestureUtils.Gestures.Stroke); this._points = []; - if (this.InkShape !== "noRec") { + if (InkOptionsMenu.Instance._double === "") { + this.InkShape = ""; } } @@ -687,12 +688,14 @@ export default class GestureOverlay extends Touchable { } //get out of ink mode after each stroke= console.log("now"); - Doc.SetSelectedTool(InkTool.None); - InkOptionsMenu.Instance._selected = InkOptionsMenu.Instance._shapesNum; - SetActiveArrowStart("none"); - GestureOverlay.Instance.SavedArrowStart = ActiveArrowStart(); - SetActiveArrowEnd("none"); - GestureOverlay.Instance.SavedArrowEnd = ActiveArrowEnd(); + if (InkOptionsMenu.Instance._double === "") { + Doc.SetSelectedTool(InkTool.None); + InkOptionsMenu.Instance._selected = InkOptionsMenu.Instance._shapesNum; + SetActiveArrowStart("none"); + GestureOverlay.Instance.SavedArrowStart = ActiveArrowStart(); + SetActiveArrowEnd("none"); + GestureOverlay.Instance.SavedArrowEnd = ActiveArrowEnd(); + } document.removeEventListener("pointermove", this.onPointerMove); document.removeEventListener("pointerup", this.onPointerUp); diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index c32e76cec..4a7ec40be 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -15,6 +15,8 @@ import { FieldView, FieldViewProps } from "./nodes/FieldView"; import React = require("react"); import { Scripting } from "../util/Scripting"; import { Doc } from "../../fields/Doc"; +import FormatShapePane from "./collections/collectionFreeForm/FormatShapePane"; +import { action } from "mobx"; library.add(faPaintBrush); @@ -38,10 +40,19 @@ export class InkingStroke extends ViewBoxBaseComponent { + console.log("Clicked"); + FormatShapePane.Instance.Pinned = true; + FormatShapePane.Instance.selected(); + + } + render() { TraceMobx(); const data: InkData = Cast(this.dataDoc[this.fieldKey], InkField)?.inkData ?? []; - const strokeWidth = Number(StrCast(this.layoutDoc.strokeWidth, ActiveInkWidth())); + // const strokeWidth = Number(StrCast(this.layoutDoc.strokeWidth, ActiveInkWidth())); + const strokeWidth = Number(this.layoutDoc.strokeWidth); const xs = data.map(p => p.X); const ys = data.map(p => p.Y); const left = Math.min(...xs) - strokeWidth / 2; @@ -74,6 +85,8 @@ export class InkingStroke extends ViewBoxBaseComponent { ContextMenu.Instance.addItem({ description: "Analyze Stroke", event: this.analyzeStrokes, icon: "paint-brush" }); ContextMenu.Instance.addItem({ description: "Make Mask", event: this.makeMask, icon: "paint-brush" }); + ContextMenu.Instance.addItem({ description: "Format Shape", event: this.formatShape, icon: "paint-brush" }); + }} > diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index afdff4ed8..3eed44654 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -58,7 +58,7 @@ import { DocumentManager } from '../util/DocumentManager'; import { DocumentLinksButton } from './nodes/DocumentLinksButton'; import { LinkMenu } from './linking/LinkMenu'; import { LinkDocPreview } from './nodes/LinkDocPreview'; - +import FormatShapePane from "./collections/collectionFreeForm/FormatShapePane"; @observer export class MainView extends React.Component { public static Instance: MainView; @@ -453,12 +453,13 @@ export class MainView extends React.Component { @computed get mainContent() { const sidebar = this.userDoc?.["tabs-panelContainer"]; - console.log(InkOptionsMenu.Instance?.Pinned); + console.log('${ ANTIMODEMENU_HEIGHT }'); return !this.userDoc || !(sidebar instanceof Doc) ? (null) : (
@@ -597,7 +598,10 @@ export class MainView extends React.Component { + + + {this.mainContent} @@ -608,6 +612,7 @@ export class MainView extends React.Component { linkDoc={LinkDocPreview.LinkInfo.linkDoc} linkSrc={LinkDocPreview.LinkInfo.linkSrc} href={LinkDocPreview.LinkInfo.href} addDocTab={LinkDocPreview.LinkInfo.addDocTab} /> : (null)} + diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss new file mode 100644 index 000000000..5789c6c75 --- /dev/null +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss @@ -0,0 +1,53 @@ +.antimodeMenu-button { + width: 200px; + + .color-previewI { + width: 100%; + height: 40%; + } + + .color-previewII { + width: 100%; + height: 100%; + } + + +} + +.sketch-picker { + background: #323232; + + .flexbox-fit { + background: #323232; + } +} + +.btn-group { + display: grid; + grid-template-columns: auto auto auto auto; + /* Make the buttons appear below each other */ +} + +.btn-group-palette { + display: block; + /* Make the buttons appear below each other */ +} + +.btn-draw { + display: inline; + /* Make the buttons appear below each other */ +} + +.btn2-group { + display: block; + background: #323232; + grid-template-columns: auto; + + /* Make the buttons appear below each other */ + .antimodeMenu-button { + background: #323232; + display: block; + + + } +} \ No newline at end of file diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx new file mode 100644 index 000000000..7b47b7ca4 --- /dev/null +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -0,0 +1,996 @@ +import React = require("react"); +import AntimodeMenu from "../../AntimodeMenu"; +import { observer } from "mobx-react"; +import { observable, action, computed } from "mobx"; +import "./FormatShapePane.scss"; +import { ActiveInkColor, ActiveInkBezierApprox, ActiveFillColor, ActiveArrowStart, ActiveArrowEnd, SetActiveInkWidth, SetActiveInkColor, SetActiveBezierApprox, SetActiveFillColor, SetActiveArrowStart, SetActiveArrowEnd, ActiveDash, SetActiveDash } from "../../InkingStroke"; +import { Scripting } from "../../../util/Scripting"; +import { InkTool, InkField } from "../../../../fields/InkField"; +import { ColorState } from "react-color"; +import { Utils } from "../../../../Utils"; +import GestureOverlay from "../../GestureOverlay"; +import { Doc } from "../../../../fields/Doc"; +import { SelectionManager } from "../../../util/SelectionManager"; +import { DocumentView } from "../../../views/nodes/DocumentView"; +import { Document } from "../../../../fields/documentSchemas"; +import { DocumentType } from "../../../documents/DocumentTypes"; +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; +import { faRulerCombined, faFillDrip, faPenNib } from "@fortawesome/free-solid-svg-icons"; +import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; +import e = require("express"); +import { ChangeEvent } from "mongodb"; +import { black } from "colors"; + + +library.add(faRulerCombined, faFillDrip, faPenNib); + +@observer +export default class FormatShapePane extends AntimodeMenu { + static Instance: FormatShapePane; + + private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF"]; + private _width = ["1", "5", "10", "100"]; + private _mode = ["fill-drip", "ruler-combined"]; + private _subMenu = ["fill", "line", "size", "position"]; + private _headIcon = ["⎯", "←"]; + private _endIcon = ["⎯", "→"]; + private _head = ["none", "arrowHead"]; + private _end = ["none", "arrowEnd"]; + + @observable private _subOpen = [false, false, false, false]; + + @observable private collapsed: boolean = false; + @observable private currMode: string = "fill-drip"; + @observable _fillBtn = false; + @observable _lineBtn = false; + + @observable _selectDoc: DocumentView[] = []; + + @observable _noFill = false; + @observable _solidFill = false; + @observable _noLine = false; + @observable _solidLine = false; + @observable _dashLine = false; + @observable _lock = false; + + @observable _multiple = false; + + @observable _widthBtn = false; + + @observable _currWidth = "10"; + + @observable _single = false; + @observable _currFill = "#D0021B"; + @observable _currColor = "#D0021B"; + + @observable _arrowHead = false; + @observable _arrowEnd = false; + + + @observable _currSizeHeight = "10"; + @observable _currSizeWidth = "10"; + @observable _currRotation = "10"; + + @observable _currPositionHorizontal = "10"; + @observable _currPositionVertical = "10"; + + + constructor(props: Readonly<{}>) { + super(props); + FormatShapePane.Instance = this; + this._canFade = false; // don't let the inking menu fade away + this.Pinned = BoolCast(Doc.UserDoc()["formatShapePane-pinned"]); + + } + + @action + toggleMenuPin = (e: React.MouseEvent) => { + Doc.UserDoc()["formatShapePane-pinned"] = this.Pinned = !this.Pinned; + if (!this.Pinned) { + // this.fadeOut(true); + } + } + + @action + protected toggleCollapse = (e: React.MouseEvent) => { + this.collapsed = !this.collapsed; + setTimeout(() => { + const x = Math.min(this._left, window.innerWidth - FormatShapePane.Instance.width); + FormatShapePane.Instance.jumpTo(x, this._top, true); + }, 0); + } + + @action + closePane = () => { + this.jumpTo(-300, -300); + this.Pinned = false; + + } + + @action + checkSame = () => { + const docs = SelectionManager.SelectedDocuments(); + const inks: DocumentView[] = []; + for (var i = 0; i < docs.length; i++) { + if (Document(docs[i].rootDoc).type === DocumentType.INK) { + inks.push(docs[i]); + } + } + const firstWidth = Document(inks[0].rootDoc).strokeWidth; + const firstColor = Document(inks[0].rootDoc).color; + const firstFill = Document(inks[0].rootDoc).fillColor; + // const firstBezier + const firstRotation = Document(inks[0].rootDoc).rotation; + const firstArrowStart = Document(inks[0].rootDoc).arrowStart; + const firstArrowEnd = Document(inks[0].rootDoc).arrowEnd; + const firstDash = Document(inks[0].rootDoc).dash; + const firstWidthSize = Document(inks[0].rootDoc)._width; + const firstHeightSize = Document(inks[0].rootDoc)._height; + const firstHorizontal = Document(inks[0].rootDoc).x; + const firstVertical = Document(inks[0].rootDoc).y; + this._noFill = Document(inks[0].rootDoc).fillColor === "none" ? true : false; + this._solidFill = Document(inks[0].rootDoc).fillColor === "none" ? false : true; + this._noLine = Document(inks[0].rootDoc).color === "none" ? true : false; + if (Document(inks[0].rootDoc).color !== "none") { + this._solidLine = true; + this._dashLine = true; + if (Document(inks[0].rootDoc).dash === "0") { + this._dashLine = false; + } else { + this._solidLine = false; + + } + } + // this._solidLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash === 0 ? true : false; + // this._dashLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash !== 0 ? true : false; + // // this._widthBtn = false; + this._currWidth = String(Document(inks[0].rootDoc).strokeWidth); + // this._single = false; + this._currFill = String(Document(inks[0].rootDoc).fillColor); + this._currColor = String(Document(inks[0].rootDoc).color); + this._arrowHead = Document(inks[0].rootDoc).arrowStart === "none" ? false : true; + this._arrowEnd = Document(inks[0].rootDoc).arrowEnd === "none" ? false : true; + this._currSizeHeight = String(Document(inks[0].rootDoc)._height); + this._currSizeWidth = String(Document(inks[0].rootDoc)._width); + this._currRotation = String(Document(inks[0].rootDoc).rotation); + this._currPositionHorizontal = String(Document(inks[0].rootDoc).x); + this._currPositionVertical = String(Document(inks[0].rootDoc).y); + for (var i = 0; i < inks.length; i++) { + if (Document(inks[i].rootDoc).strokeWidth !== firstWidth) { + this._currWidth = ""; + } + if (Document(inks[i].rootDoc).color !== firstColor) { + this._noLine = false; + this._solidLine = false; + this._dashLine = false; + } + if (Document(inks[i].rootDoc).fillColor !== firstFill) { + this._solidFill = false; + this._noFill = false; + } + if (Document(inks[i].rootDoc).arrowStart !== firstArrowStart) { + this._arrowHead = false; + } + if (Document(inks[i].rootDoc).arrowEnd !== firstArrowEnd) { + this._arrowEnd = false; + } + if (Document(inks[i].rootDoc).x !== firstHorizontal) { + this._currPositionHorizontal = ""; + } + if (Document(inks[i].rootDoc).y !== firstVertical) { + this._currPositionVertical = ""; + } + if (Document(inks[i].rootDoc)._width !== firstWidthSize) { + this._currSizeWidth = ""; + } + if (Document(inks[i].rootDoc)._height !== firstHeightSize) { + this._currSizeHeight = ""; + } + if (Document(inks[i].rootDoc).rotation !== firstRotation) { + this._currRotation = ""; + } + } + + + + } + + @action + upDownButtons = (dirs: string, field: string) => { + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK) { + switch (field) { + case "width": + if (doc.strokeWidth) { + doc.strokeWidth = dirs === "up" ? doc.strokeWidth + 1 : doc.strokeWidth - 1; + SetActiveInkWidth(String(doc.strokeWidth)); + + } + break; + case "sizeWidth": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + + doc._width = dirs === "up" ? doc._width + 10 : doc._width - 10; + if (this._lock) { + doc._height = (doc._width * oldHeight) / oldWidth; + } + } + break; + case "sizeHeight": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + doc._height = dirs === "up" ? doc._height + 10 : doc._height - 10; + if (this._lock) { + doc._width = (doc._height * oldWidth) / oldHeight; + } + } + break; + case "horizontal": + if (doc.x) { + doc.x = dirs === "up" ? doc.x + 10 : doc.x - 10; + } + break; + case "vertical": + if (doc.y) { + doc.y = dirs === "up" ? doc.y + 10 : doc.y - 10; + } + case "rotation": + + this.rotate(dirs === "up" ? Number(doc.rotation) + Number(0.1) : Number(doc.rotation) - Number(0.1)); + + break; + default: + break; + } + this.selected(); + + } + })); + } + + @action + editProperties = (value: any, field: string) => { + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK) { + switch (field) { + case "width": + SetActiveInkWidth(value); + doc.strokeWidth = Number(value); + break; + case "color": + doc.color = String(value); + break; + case "fill": + doc.fillColor = String(value); + break; + case "bezier": + // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; + break; + case "arrowStart": + doc.arrowStart = String(value); + break; + case "arrowEnd": + doc.arrowEnd = String(value); + break; + case "dash": + doc.dash = String(value); + break; + case "widthSize": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + + doc._width = Number(value); + if (this._lock) { + doc._height = (doc._width * oldHeight) / oldWidth; + } + } + break; + case "heightSize": + if (doc._width && doc._height) { + const oldWidth = doc._width; + const oldHeight = doc._height; + + doc._height = Number(value); + if (this._lock) { + doc._width = (doc._height * oldWidth) / oldHeight; + } + } + break; + case "horizontal": + doc.x = Number(value); + break; + case "vertical": + doc.y = Number(value); + + break; + default: + break; + } + } + this.selected(); + })); + this.checkSame(); + + } + + @computed get close() { + const close = ; + return close; + } + + @computed get modes() { + const modes =
+ {this._mode.map(mode => { + return ; + }) + }
; + return modes; + } + + @action + selected = () => { + this._selectDoc = SelectionManager.SelectedDocuments(); + if (this._selectDoc.length === 1 && Document(this._selectDoc[0].rootDoc).type === DocumentType.INK) { + this._single = true; + const doc = Document(this._selectDoc[0].rootDoc); + if (doc.type === DocumentType.INK) { + console.log(doc.fillColor); + if (doc.fillColor === "none") { + this._noFill = true; + this._solidFill = false; + } else { + this._solidFill = true; + this._noFill = false; + this._currFill = String(doc.fillColor); + } + if (doc.color === "none") { + this._noLine = true; + this._solidLine = false; + this._dashLine = false; + } else { + console.log(doc.strokeWidth); + this._currWidth = String(doc.strokeWidth); + this._currColor = String(doc.color); + if (doc.dash === "0") { + this._solidLine = true; + this._noLine = false; + this._dashLine = false; + } else { + this._dashLine = true; + this._noLine = false; + this._solidLine = false; + } + + this._arrowHead = doc.arrowStart === "none" ? false : true; + this._arrowEnd = doc.arrowEnd === "none" ? false : true; + + + this._currPositionHorizontal = String(doc.x); + this._currPositionVertical = String(doc.y); + console.log(doc.rotation); + this._currRotation = String(doc.rotation); + this._currSizeHeight = String(doc._height); + this._currSizeWidth = String(doc._width); + } + + } + } else { + this._noFill = false; + this._solidFill = false; + this._single = false; + this._currFill = "#D0021B"; + this._noLine = false; + this._solidLine = false; + this._dashLine = false; + this._currColor = "#D0021B"; + this._arrowHead = false; + this._arrowEnd = false; + this._currPositionHorizontal = ""; + this._currPositionVertical = ""; + this._currRotation = ""; + this._currSizeHeight = ""; + this._currSizeWidth = ""; + } + this.checkSame(); + } + + @action + rotate = (degrees: number) => { + SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { + const doc = Document(element.rootDoc); + if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { + // doc.rotation = (Number(doc.rotation) + (Number(angle) * 180 / Math.PI)); + // console.log(doc.rotation); + const angle = Number(degrees) - Number(doc.rotation); + doc.rotation = Number(degrees); + const ink = Cast(doc.data, InkField)?.inkData; + if (ink) { + const xs = ink.map(p => p.X); + const ys = ink.map(p => p.Y); + const left = Math.min(...xs); + const top = Math.min(...ys); + const right = Math.max(...xs); + const bottom = Math.max(...ys); + const _centerPoints: { X: number, Y: number }[] = []; + _centerPoints.push({ X: left, Y: top }); + + const newPoints: { X: number, Y: number }[] = []; + for (var i = 0; i < ink.length; i++) { + const newX = Math.cos(angle) * (ink[i].X - _centerPoints[0].X) - Math.sin(angle) * (ink[i].Y - _centerPoints[0].Y) + _centerPoints[0].X; + const newY = Math.sin(angle) * (ink[i].X - _centerPoints[0].X) + Math.cos(angle) * (ink[i].Y - _centerPoints[0].Y) + _centerPoints[0].Y; + newPoints.push({ X: newX, Y: newY }); + } + doc.data = new InkField(newPoints); + const xs2 = newPoints.map(p => p.X); + const ys2 = newPoints.map(p => p.Y); + const left2 = Math.min(...xs2); + const top2 = Math.min(...ys2); + const right2 = Math.max(...xs2); + const bottom2 = Math.max(...ys2); + + doc._height = (bottom2 - top2) * element.props.ScreenToLocalTransform().Scale; + doc._width = (right2 - left2) * element.props.ScreenToLocalTransform().Scale; + + } + } + })); + } + + @action + toggle = (check: string) => { + switch (check) { + case "noFill": + if (!this._noFill) { + this._noFill = true; + this._solidFill = false; + } + break; + case "solidFill": + if (!this._solidFill) { + this._solidFill = true; + this._noFill = false; + if (this._currFill === "none") { + this._currFill = "#D0021B"; + } + } + break; + case "noLine": + if (!this._noLine) { + this._noLine = true; + this._solidLine = false; + this._dashLine = false; + } + break; + case "solidLine": + if (!this._solidLine) { + this._solidLine = true; + this._noLine = false; + this._dashLine = false; + if (this._currColor === "none") { + this._currColor = "#D0021B"; + } + } + break; + case "dashLine": + if (!this._dashLine) { + this._dashLine = true; + this._solidLine = false; + this._noLine = false; + if (this._currColor === "none") { + this._currColor = "#D0021B"; + } + } + break; + case "lock": + if (this._lock) { + this._lock = false; + } else { + this._lock = true; + } + break; + case "arrowHead": + this._arrowHead = this._arrowHead ? false : true; + break; + case "arrowEnd": + this._arrowEnd = this._arrowEnd ? false : true; + break; + default: + break; + } + } + + @computed get subMenu() { + const fillCheck =
+ { this.toggle("noFill"); this.editProperties("none", "fill"); })} /> + No Fill +

+ { this.toggle("solidFill"); this.editProperties(this._currFill, "fill"); })} /> + Solid Fill +

+

+ {this._solidFill ? "Color" : ""} + {this._solidFill ? this.fillButton : ""} + {this._fillBtn && this._solidFill ? this.fillPicker : ""} + +
; + const arrows = <> { this.toggle("arrowHead"); this.editProperties(this._arrowHead ? "arrowHead" : "none", "arrowStart"); })} /> + Arrow Head +

+ + { this.toggle("arrowEnd"); this.editProperties(this._arrowEnd ? "arrowEnd" : "none", "arrowEnd"); })} /> + Arrow End +

; + const lineCheck =
+ { this.toggle("noLine"); this.editProperties("none", "color"); })} /> + No Line +

+ { this.toggle("solidLine"); this.editProperties(this._currColor, "color"); this.editProperties("0", "dash"); })} /> + Solid Line +

+ { this.toggle("dashLine"); this.editProperties(this._currColor, "color"); this.editProperties("2", "dash"); })} /> + Dash Line +

+

+ {(this._solidLine || this._dashLine) ? "Color" : ""} + {(this._solidLine || this._dashLine) ? this.lineButton : ""} + {this._lineBtn && (this._solidLine || this._dashLine) ? this.linePicker : ""} +

+ {(this._solidLine || this._dashLine) ? "Width" : ""} + {(this._solidLine || this._dashLine) ? this.widthInput : ""} +

+

+ {(this._solidLine || this._dashLine) ? arrows : ""} + +
; + + const sizeCheck =
+ Height {this.sizeHeightInput} +

+

+ + + Width {this.sizeWidthInput} +

+

+ + { this.toggle("lock"); })} /> + Lock Ratio +

+

+ + + Rotation {this.rotationInput} +

+

+ + +
; + const positionCheck =
+ Horizontal {this.positionHorizontalInput} +

+

+ + Vertical {this.positionVerticalInput} +

+

+ + +
; + + const subMenu =
+ {this._subMenu.map((subMenu, i) => { + if (subMenu === "fill" || subMenu === "line") { + return
+ {this.currMode === "fill-drip" && subMenu === "fill" && this._subOpen[0] ? fillCheck : ""} + {this.currMode === "fill-drip" && subMenu === "line" && this._subOpen[1] ? lineCheck : ""} + +
; + } + else if (subMenu === "size" || subMenu === "position") { + return
+ {this.currMode === "ruler-combined" && subMenu === "size" && this._subOpen[2] ? sizeCheck : ""} + {this.currMode === "ruler-combined" && subMenu === "position" && this._subOpen[3] ? positionCheck : ""} + +
+ ; + + } + }) + }
; + return subMenu; + } + + @computed get fillButton() { + const fillButton = <> +

+

; + return fillButton; + } + @computed get fillPicker() { + const fillPicker =
+ {this._palette.map(color => { + return ; + })} + +
; + return fillPicker; + } + + @computed get lineButton() { + const lineButton = <> +

+

; + return lineButton; + } + @computed get linePicker() { + const linePicker =
+ {this._palette.map(color => { + return ; + })} + +
; + return linePicker; + } + @computed get widthInput() { + const widthInput = <> + this.onChange(e.target.value, "width")} + autoFocus> +
+ ; + return widthInput; + } + @computed get sizeHeightInput() { + const sizeHeightInput = <> + this.onChange(e.target.value, "sizeHeight")} + autoFocus> + +
+ + ; + return sizeHeightInput; + } + + @computed get sizeWidthInput() { + const sizeWidthInput = <> + this.onChange(e.target.value, "sizeWidth")} + autoFocus> + +

+ ; + return sizeWidthInput; + } + + @computed get rotationInput() { + const rotationInput = + <> + this.onChange(e.target.value, "rotation")} + autoFocus> + +

+ ; + return rotationInput; + } + + @computed get positionHorizontalInput() { + const positionHorizontalInput = + <> this.onChange(e.target.value, "positionHorizontal")} + autoFocus> + +

+ ; + return positionHorizontalInput; + } + + @computed get positionVerticalInput() { + const positionVerticalInput = + <> this.onChange(e.target.value, "positionVertical")} + autoFocus> + +

+ ; + return positionVerticalInput; + } + + + @action + onChange = (val: string, property: string): void => { + if (!Number.isNaN(Number(val)) && Number(val) !== null && val !== " ") { + + // if (val === "") { + // val = "0"; + // } + switch (property) { + case "width": + this._currWidth = val; + if (val !== "") { + this.editProperties(this._currWidth, "width"); + } + break; + case "sizeHeight": + this._currSizeHeight = val; + if (val !== "") { + this.editProperties(this._currSizeHeight, "heightSize"); + } + break; + case "sizeWidth": + this._currSizeWidth = val; + if (val !== "") { + + this.editProperties(this._currSizeWidth, "widthSize"); + } + break; + case "rotation": + + this._currRotation = val; + if (val !== "") { + + this.rotate(Number(val)); + } + break; + case "positionHorizontal": + this._currPositionHorizontal = val; if (val !== "") { + + this.editProperties(this._currPositionHorizontal, "horizontal"); + } + + break; + case "positionVertical": + this._currPositionVertical = val; + if (val !== "") { + + this.editProperties(this._currPositionVertical, "vertical"); + } + + break; + default: + break; + } + } + } + + + + + // @action + // changeWidth = (event: React.ChangeEvent) => { + // console.log(event.target.value); + // this._currWidth = NumCast(event.target.value); + + // } + + @computed get upDown() { + const upDown =
+ +

+ +
; + return upDown; + } + + + @computed get widthPicker() { + var widthPicker = ; + if (this._widthBtn) { + widthPicker =
+ {widthPicker} + {this._width.map(wid => { + return ; + })} +
; + } + return widthPicker; + } + + + + render() { + const buttons = [ + + this.close, + this.modes, + this.subMenu + + ]; + + return this.getElementVert(buttons); + } +} +Scripting.addGlobal(function activatePen2(penBtn: any) { + if (penBtn) { + //no longer changes to inkmode + // Doc.SetSelectedTool(InkTool.Pen); + FormatShapePane.Instance.jumpTo(300, 300); + FormatShapePane.Instance.Pinned = true; + + } else { + // Doc.SetSelectedTool(InkTool.None); + FormatShapePane.Instance.Pinned = false; + FormatShapePane.Instance.fadeOut(true); + + } +}); \ No newline at end of file diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss index 7329f4fc1..f739fcc8c 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.scss @@ -32,7 +32,7 @@ } .btn2-group { - display: block; + display: grid; background: #323232; grid-template-columns: auto; diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index 7de70b8cd..e4f3248d0 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -36,14 +36,15 @@ export default class InkOptionsMenu extends AntimodeMenu { // private _arrowEnd = ["none", "arrowEnd", "none", "dot", "none"]; // private _arrowIcons = ["→", "↔︎", "•", "••", " "]; private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; - private _head = ["none", "arrowHead", "arrowHead", "none", "arrowHead", "arrowHead", "none", "none", "none"]; - private _end = ["none", "none", "arrowEnd", "none", "none", "arrowEnd", "none", "none", "none"]; + private _head = ["none", "none", "arrowHead", "none", "none", "arrowHead", "none", "none", "none"]; + private _end = ["none", "arrowEnd", "arrowEnd", "none", "arrowEnd", "arrowEnd", "none", "none", "none"]; private _shape = ["", "", "", "", "", "", "rectangle", "circle", "triangle"]; @observable _shapesNum = this._shape.length; @observable _selected = this._shapesNum; @observable private collapsed: boolean = false; + @observable _double = ""; @observable _colorBtn = false; @observable _widthBtn = false; @@ -155,7 +156,7 @@ export default class InkOptionsMenu extends AntimodeMenu { className="antimodeMenu-button" key={icon} onPointerDown={action(() => { - console.log(this._selected); + this._double = ""; if (this._selected !== i) { this._selected = i; @@ -177,6 +178,31 @@ export default class InkOptionsMenu extends AntimodeMenu { } console.log(this._selected); + })} + onDoubleClick={action(() => { + console.log("double"); + this._double = this._draw[i]; + if (this._selected !== i) { + this._selected = i; + Doc.SetSelectedTool(InkTool.Pen); + SetActiveArrowStart(this._head[i]); + SetActiveArrowEnd(this._end[i]); + SetActiveBezierApprox("300"); + + // this.editProperties(this._head[i], "arrowStart"), this.editProperties(this._end[i], "arrowEnd"); + GestureOverlay.Instance.InkShape = this._shape[i]; + } else { + this._selected = this._shapesNum; + Doc.SetSelectedTool(InkTool.None); + SetActiveArrowStart("none"); + SetActiveArrowEnd("none"); + GestureOverlay.Instance.InkShape = ""; + SetActiveBezierApprox("0"); + + } + + + })} style={{ backgroundColor: i === this._selected ? "121212" : "", fontSize: "20" }}> {this._draw[i]} @@ -235,7 +261,7 @@ export default class InkOptionsMenu extends AntimodeMenu { className="antimodeMenu-button" key={wid} onPointerDown={action(() => { SetActiveInkWidth(wid); this._widthBtn = false; this.editProperties(wid, "width"); })} - style={{ backgroundColor: this._widthBtn ? "121212" : "" }}> + style={{ backgroundColor: this._widthBtn ? "121212" : "", zIndex: 1001 }}> {wid} ; })} @@ -265,7 +291,7 @@ export default class InkOptionsMenu extends AntimodeMenu { className="antimodeMenu-button" key={color} onPointerDown={action(() => { this.changeColor(color, "color"); this._colorBtn = false; this.editProperties(color, "color"); })} - style={{ backgroundColor: this._colorBtn ? "121212" : "" }}> + style={{ backgroundColor: this._colorBtn ? "121212" : "", zIndex: 1001 }}> {/* */}
; @@ -286,14 +312,14 @@ export default class InkOptionsMenu extends AntimodeMenu {
; if (this._fillBtn) { - fillPicker =
+ fillPicker =
{fillPicker} {this._palette.map(color => { return ; })} -- cgit v1.2.3-70-g09d2 From c8454d675a3081a83c56cf598b1b3637479b0459 Mon Sep 17 00:00:00 2001 From: yunahi <60233430+yunahi@users.noreply.github.com> Date: Fri, 10 Jul 2020 05:22:06 +0900 Subject: added format shape --- src/client/util/SelectionManager.ts | 3 +- .../collectionFreeForm/FormatShapePane.tsx | 137 ++++----------------- 2 files changed, 24 insertions(+), 116 deletions(-) (limited to 'src/client/views') diff --git a/src/client/util/SelectionManager.ts b/src/client/util/SelectionManager.ts index aea2c542b..af2f320d3 100644 --- a/src/client/util/SelectionManager.ts +++ b/src/client/util/SelectionManager.ts @@ -15,8 +15,7 @@ export namespace SelectionManager { SelectedDocuments: ObservableMap = new ObservableMap(); @action SelectDoc(docView: DocumentView, ctrlPressed: boolean): void { - console.log("select" - ); + // if doc is not in SelectedDocuments, add it if (!manager.SelectedDocuments.get(docView)) { if (!ctrlPressed) { diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 7b47b7ca4..37ba805b6 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -3,12 +3,9 @@ import AntimodeMenu from "../../AntimodeMenu"; import { observer } from "mobx-react"; import { observable, action, computed } from "mobx"; import "./FormatShapePane.scss"; -import { ActiveInkColor, ActiveInkBezierApprox, ActiveFillColor, ActiveArrowStart, ActiveArrowEnd, SetActiveInkWidth, SetActiveInkColor, SetActiveBezierApprox, SetActiveFillColor, SetActiveArrowStart, SetActiveArrowEnd, ActiveDash, SetActiveDash } from "../../InkingStroke"; +import { SetActiveInkWidth } from "../../InkingStroke"; import { Scripting } from "../../../util/Scripting"; -import { InkTool, InkField } from "../../../../fields/InkField"; -import { ColorState } from "react-color"; -import { Utils } from "../../../../Utils"; -import GestureOverlay from "../../GestureOverlay"; +import { InkField } from "../../../../fields/InkField"; import { Doc } from "../../../../fields/Doc"; import { SelectionManager } from "../../../util/SelectionManager"; import { DocumentView } from "../../../views/nodes/DocumentView"; @@ -19,9 +16,6 @@ import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; import { faRulerCombined, faFillDrip, faPenNib } from "@fortawesome/free-solid-svg-icons"; import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; import e = require("express"); -import { ChangeEvent } from "mongodb"; -import { black } from "colors"; - library.add(faRulerCombined, faFillDrip, faPenNib); @@ -33,63 +27,42 @@ export default class FormatShapePane extends AntimodeMenu { private _width = ["1", "5", "10", "100"]; private _mode = ["fill-drip", "ruler-combined"]; private _subMenu = ["fill", "line", "size", "position"]; - private _headIcon = ["⎯", "←"]; - private _endIcon = ["⎯", "→"]; - private _head = ["none", "arrowHead"]; - private _end = ["none", "arrowEnd"]; - @observable private _subOpen = [false, false, false, false]; - @observable private collapsed: boolean = false; @observable private currMode: string = "fill-drip"; @observable _fillBtn = false; @observable _lineBtn = false; - @observable _selectDoc: DocumentView[] = []; - @observable _noFill = false; @observable _solidFill = false; @observable _noLine = false; @observable _solidLine = false; @observable _dashLine = false; @observable _lock = false; - @observable _multiple = false; - @observable _widthBtn = false; - - @observable _currWidth = "10"; - @observable _single = false; - @observable _currFill = "#D0021B"; - @observable _currColor = "#D0021B"; - @observable _arrowHead = false; @observable _arrowEnd = false; - - @observable _currSizeHeight = "10"; @observable _currSizeWidth = "10"; @observable _currRotation = "10"; - @observable _currPositionHorizontal = "10"; @observable _currPositionVertical = "10"; - + @observable _currWidth = "10"; + @observable _currFill = "#D0021B"; + @observable _currColor = "#D0021B"; constructor(props: Readonly<{}>) { super(props); FormatShapePane.Instance = this; - this._canFade = false; // don't let the inking menu fade away + this._canFade = false; this.Pinned = BoolCast(Doc.UserDoc()["formatShapePane-pinned"]); - } @action toggleMenuPin = (e: React.MouseEvent) => { Doc.UserDoc()["formatShapePane-pinned"] = this.Pinned = !this.Pinned; - if (!this.Pinned) { - // this.fadeOut(true); - } } @action @@ -105,9 +78,9 @@ export default class FormatShapePane extends AntimodeMenu { closePane = () => { this.jumpTo(-300, -300); this.Pinned = false; - } + //if multiple inks are selected and do not share the same prop, leave blank @action checkSame = () => { const docs = SelectionManager.SelectedDocuments(); @@ -117,18 +90,6 @@ export default class FormatShapePane extends AntimodeMenu { inks.push(docs[i]); } } - const firstWidth = Document(inks[0].rootDoc).strokeWidth; - const firstColor = Document(inks[0].rootDoc).color; - const firstFill = Document(inks[0].rootDoc).fillColor; - // const firstBezier - const firstRotation = Document(inks[0].rootDoc).rotation; - const firstArrowStart = Document(inks[0].rootDoc).arrowStart; - const firstArrowEnd = Document(inks[0].rootDoc).arrowEnd; - const firstDash = Document(inks[0].rootDoc).dash; - const firstWidthSize = Document(inks[0].rootDoc)._width; - const firstHeightSize = Document(inks[0].rootDoc)._height; - const firstHorizontal = Document(inks[0].rootDoc).x; - const firstVertical = Document(inks[0].rootDoc).y; this._noFill = Document(inks[0].rootDoc).fillColor === "none" ? true : false; this._solidFill = Document(inks[0].rootDoc).fillColor === "none" ? false : true; this._noLine = Document(inks[0].rootDoc).color === "none" ? true : false; @@ -142,11 +103,7 @@ export default class FormatShapePane extends AntimodeMenu { } } - // this._solidLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash === 0 ? true : false; - // this._dashLine = (Document(inks[0].rootDoc).color === "none") ? false : Document(inks[0].rootDoc).dash !== 0 ? true : false; - // // this._widthBtn = false; this._currWidth = String(Document(inks[0].rootDoc).strokeWidth); - // this._single = false; this._currFill = String(Document(inks[0].rootDoc).fillColor); this._currColor = String(Document(inks[0].rootDoc).color); this._arrowHead = Document(inks[0].rootDoc).arrowStart === "none" ? false : true; @@ -157,45 +114,43 @@ export default class FormatShapePane extends AntimodeMenu { this._currPositionHorizontal = String(Document(inks[0].rootDoc).x); this._currPositionVertical = String(Document(inks[0].rootDoc).y); for (var i = 0; i < inks.length; i++) { - if (Document(inks[i].rootDoc).strokeWidth !== firstWidth) { + if (Document(inks[i].rootDoc).strokeWidth !== Document(inks[0].rootDoc).strokeWidth) { this._currWidth = ""; } - if (Document(inks[i].rootDoc).color !== firstColor) { + if (Document(inks[i].rootDoc).color !== Document(inks[0].rootDoc).color) { this._noLine = false; this._solidLine = false; this._dashLine = false; } - if (Document(inks[i].rootDoc).fillColor !== firstFill) { + if (Document(inks[i].rootDoc).fillColor !== Document(inks[0].rootDoc).fillColor) { this._solidFill = false; this._noFill = false; } - if (Document(inks[i].rootDoc).arrowStart !== firstArrowStart) { + if (Document(inks[i].rootDoc).arrowStart !== Document(inks[0].rootDoc).arrowStart) { this._arrowHead = false; } - if (Document(inks[i].rootDoc).arrowEnd !== firstArrowEnd) { + if (Document(inks[i].rootDoc).arrowEnd !== Document(inks[0].rootDoc).arrowEnd) { this._arrowEnd = false; } - if (Document(inks[i].rootDoc).x !== firstHorizontal) { + if (Document(inks[i].rootDoc).x !== Document(inks[0].rootDoc).x) { this._currPositionHorizontal = ""; } - if (Document(inks[i].rootDoc).y !== firstVertical) { + if (Document(inks[i].rootDoc).y !== Document(inks[0].rootDoc).y) { this._currPositionVertical = ""; } - if (Document(inks[i].rootDoc)._width !== firstWidthSize) { + if (Document(inks[i].rootDoc)._width !== Document(inks[0].rootDoc)._width) { this._currSizeWidth = ""; } - if (Document(inks[i].rootDoc)._height !== firstHeightSize) { + if (Document(inks[i].rootDoc)._height !== Document(inks[0].rootDoc)._height) { this._currSizeHeight = ""; } - if (Document(inks[i].rootDoc).rotation !== firstRotation) { + if (Document(inks[i].rootDoc).rotation !== Document(inks[0].rootDoc).rotation) { this._currRotation = ""; } } - - - } + @action upDownButtons = (dirs: string, field: string) => { SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { @@ -206,14 +161,12 @@ export default class FormatShapePane extends AntimodeMenu { if (doc.strokeWidth) { doc.strokeWidth = dirs === "up" ? doc.strokeWidth + 1 : doc.strokeWidth - 1; SetActiveInkWidth(String(doc.strokeWidth)); - } break; case "sizeWidth": if (doc._width && doc._height) { const oldWidth = doc._width; const oldHeight = doc._height; - doc._width = dirs === "up" ? doc._width + 10 : doc._width - 10; if (this._lock) { doc._height = (doc._width * oldHeight) / oldWidth; @@ -240,19 +193,17 @@ export default class FormatShapePane extends AntimodeMenu { doc.y = dirs === "up" ? doc.y + 10 : doc.y - 10; } case "rotation": - this.rotate(dirs === "up" ? Number(doc.rotation) + Number(0.1) : Number(doc.rotation) - Number(0.1)); - break; default: break; } this.selected(); - } })); } + @action editProperties = (value: any, field: string) => { SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { @@ -270,7 +221,6 @@ export default class FormatShapePane extends AntimodeMenu { doc.fillColor = String(value); break; case "bezier": - // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; break; case "arrowStart": doc.arrowStart = String(value); @@ -285,7 +235,6 @@ export default class FormatShapePane extends AntimodeMenu { if (doc._width && doc._height) { const oldWidth = doc._width; const oldHeight = doc._height; - doc._width = Number(value); if (this._lock) { doc._height = (doc._width * oldHeight) / oldWidth; @@ -296,7 +245,6 @@ export default class FormatShapePane extends AntimodeMenu { if (doc._width && doc._height) { const oldWidth = doc._width; const oldHeight = doc._height; - doc._height = Number(value); if (this._lock) { doc._width = (doc._height * oldWidth) / oldHeight; @@ -308,7 +256,6 @@ export default class FormatShapePane extends AntimodeMenu { break; case "vertical": doc.y = Number(value); - break; default: break; @@ -331,13 +278,14 @@ export default class FormatShapePane extends AntimodeMenu { return close; } + //select either coor&fill or size&position @computed get modes() { const modes =
{this._mode.map(mode => { return ; @@ -346,6 +294,7 @@ export default class FormatShapePane extends AntimodeMenu { return modes; } + //detects currently selected document and change value in pane @action selected = () => { this._selectDoc = SelectionManager.SelectedDocuments(); @@ -353,7 +302,6 @@ export default class FormatShapePane extends AntimodeMenu { this._single = true; const doc = Document(this._selectDoc[0].rootDoc); if (doc.type === DocumentType.INK) { - console.log(doc.fillColor); if (doc.fillColor === "none") { this._noFill = true; this._solidFill = false; @@ -382,11 +330,8 @@ export default class FormatShapePane extends AntimodeMenu { this._arrowHead = doc.arrowStart === "none" ? false : true; this._arrowEnd = doc.arrowEnd === "none" ? false : true; - - this._currPositionHorizontal = String(doc.x); this._currPositionVertical = String(doc.y); - console.log(doc.rotation); this._currRotation = String(doc.rotation); this._currSizeHeight = String(doc._height); this._currSizeWidth = String(doc._width); @@ -418,8 +363,6 @@ export default class FormatShapePane extends AntimodeMenu { SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { const doc = Document(element.rootDoc); if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { - // doc.rotation = (Number(doc.rotation) + (Number(angle) * 180 / Math.PI)); - // console.log(doc.rotation); const angle = Number(degrees) - Number(doc.rotation); doc.rotation = Number(degrees); const ink = Cast(doc.data, InkField)?.inkData; @@ -446,10 +389,8 @@ export default class FormatShapePane extends AntimodeMenu { const top2 = Math.min(...ys2); const right2 = Math.max(...xs2); const bottom2 = Math.max(...ys2); - doc._height = (bottom2 - top2) * element.props.ScreenToLocalTransform().Scale; doc._width = (right2 - left2) * element.props.ScreenToLocalTransform().Scale; - } } })); @@ -854,14 +795,11 @@ export default class FormatShapePane extends AntimodeMenu { return positionVerticalInput; } - + //change inputs @action onChange = (val: string, property: string): void => { if (!Number.isNaN(Number(val)) && Number(val) !== null && val !== " ") { - // if (val === "") { - // val = "0"; - // } switch (property) { case "width": this._currWidth = val; @@ -912,35 +850,6 @@ export default class FormatShapePane extends AntimodeMenu { } - - - // @action - // changeWidth = (event: React.ChangeEvent) => { - // console.log(event.target.value); - // this._currWidth = NumCast(event.target.value); - - // } - - @computed get upDown() { - const upDown =
- -

- -
; - return upDown; - } - - @computed get widthPicker() { var widthPicker =
-
+
Math.min(350, NumCast(target._width, 350))} - PanelHeight={() => Math.min(250, NumCast(target._height, 250))} + PanelWidth={() => 170} //Math.min(350, NumCast(target._width, 350))} + PanelHeight={() => 170} //Math.min(250, NumCast(target._height, 250))} focus={emptyFunction} whenActiveChanged={returnFalse} bringToFront={returnFalse} ContentScaling={returnOne} - NativeWidth={returnZero} - NativeHeight={returnZero} + NativeWidth={() => target._nativeWidth ? NumCast(target._nativeWidth) : 0} + NativeHeight={() => target._nativeHeight ? NumCast(target._nativeHeight) : 0} />
; -- cgit v1.2.3-70-g09d2 From 3d0c64cf9979f739177b0efd9970ad0e0a9fa3d0 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Thu, 9 Jul 2020 17:00:12 -0500 Subject: small changes --- src/client/documents/Documents.ts | 6 +----- .../collections/collectionFreeForm/CollectionFreeFormView.tsx | 8 +++++--- src/client/views/linking/LinkMenuItem.tsx | 2 +- src/client/views/nodes/formattedText/FormattedTextBox.tsx | 2 ++ 4 files changed, 9 insertions(+), 9 deletions(-) (limited to 'src/client/views') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 565e7c25d..fa85d58f0 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -909,7 +909,7 @@ export namespace DocUtils { DocUtils.ActiveRecordings.map(d => DocUtils.MakeLink({ doc: doc }, { doc: d }, "audio link", "audio timeline")); } - export function MakeLink(source: { doc: Doc }, target: { doc: Doc }, linkRelationship: string = "", description: string = "", id?: string, linkedText?: string) { + export function MakeLink(source: { doc: Doc }, target: { doc: Doc }, linkRelationship: string = "", description: string = "", id?: string) { const sv = DocumentManager.Instance.getDocumentView(source.doc); if (sv && sv.props.ContainingCollectionDoc === target.doc) return; if (target.doc === Doc.UserDoc()) return undefined; @@ -921,10 +921,6 @@ export namespace DocUtils { Doc.GetProto(source.doc).links = ComputedField.MakeFunction("links(self)"); Doc.GetProto(target.doc).links = ComputedField.MakeFunction("links(self)"); - if (linkedText) { - Doc.GetProto(linkDoc).linkedText = linkedText; - } - return linkDoc; } diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 965bfdf24..9d79c0c89 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1181,17 +1181,19 @@ export class CollectionFreeFormView extends CollectionSubView { this.props.destinationDoc.type === "screenshot" ? "photo-video" : this.props.destinationDoc.type === "webcam" ? "video" : this.props.destinationDoc.type === "audio" ? "microphone" : - this.props.destinationDoc.type === "button" ? "lightning" : + this.props.destinationDoc.type === "button" ? "bolt" : this.props.destinationDoc.type === "presentation" ? "tv" : this.props.destinationDoc.type === "query" ? "search" : this.props.destinationDoc.type === "script" ? "terminal" : diff --git a/src/client/views/nodes/formattedText/FormattedTextBox.tsx b/src/client/views/nodes/formattedText/FormattedTextBox.tsx index bff6f1c8c..4f6927d3d 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBox.tsx +++ b/src/client/views/nodes/formattedText/FormattedTextBox.tsx @@ -176,9 +176,11 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp doLinkOnDeselect() { console.log("link on deselect"); + Array.from(this.linkOnDeselect.entries()).map(entry => { const key = entry[0]; const value = entry[1]; + const id = Utils.GenerateDeterministicGuid(this.dataDoc[Id] + key); DocServer.GetRefField(value).then(doc => { DocServer.GetRefField(id).then(linkDoc => { -- cgit v1.2.3-70-g09d2 From 756a2d4e680bcdcc339e8f2493f699bb01e3fbb0 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Thu, 9 Jul 2020 18:37:03 -0400 Subject: fixed type errors. --- .../views/collections/collectionFreeForm/CollectionFreeFormView.tsx | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 9d79c0c89..f2a39b240 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1172,7 +1172,7 @@ export class CollectionFreeFormView extends CollectionSubView - _lastClientY = 0; + _lastClientY: number | undefined = 0; @action handleDragging = (e: CustomEvent, de: DragEvent) => { if ((e as any).handlePan) return; @@ -1233,7 +1233,7 @@ export class CollectionFreeFormView extends CollectionSubView { setTimeout(() => { const dragY = this._lastClientY; - if (this._lastClientY !== undefined && this._marqueeRef.current) { + if (dragY !== undefined && this._marqueeRef.current) { const bounds = this._marqueeRef.current.getBoundingClientRect()!; this.Document._panY = NumCast(this.Document._panY) + delta; (dragY - bounds.top < 25 || bounds.bottom - dragY < 25) && this.continueYPan(delta); -- cgit v1.2.3-70-g09d2 From 968efe63083326af1689004b1c6fb41980e40566 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Thu, 9 Jul 2020 18:44:59 -0500 Subject: menu UI fixes --- src/client/views/linking/LinkMenu.scss | 8 ++---- src/client/views/linking/LinkMenuItem.scss | 43 +++++++++++++++++------------- src/client/views/linking/LinkMenuItem.tsx | 6 ++++- 3 files changed, 31 insertions(+), 26 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/linking/LinkMenu.scss b/src/client/views/linking/LinkMenu.scss index 4f7ac3275..1fa185150 100644 --- a/src/client/views/linking/LinkMenu.scss +++ b/src/client/views/linking/LinkMenu.scss @@ -30,14 +30,11 @@ overflow-x: hidden; + width: 240px; + &:last-child { border-bottom: none; } - - &:hover { - padding-right: 65px; - display: inline-block; - } } .linkMenu-listEditor { @@ -67,7 +64,6 @@ } .linkMenu-group-name { - display: flex; &:hover { diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss index e444b832b..a3cce8e3c 100644 --- a/src/client/views/linking/LinkMenuItem.scss +++ b/src/client/views/linking/LinkMenuItem.scss @@ -15,6 +15,7 @@ .linkMenu-name { position: relative; + width: auto; .linkMenu-text { @@ -26,6 +27,8 @@ color: rgb(43, 43, 43); font-size: 7px; padding-bottom: 0.75px; + + margin-left: 20px; } @@ -33,12 +36,19 @@ display: flex; - .destination-icon { - float: left; - width: 12px; - height: 12px; - padding-right: 3px; - margin-right: 3px; + .destination-icon-wrapper { + //border: 0.5px solid rgb(161, 161, 161); + margin-right: 2px; + padding-right: 2px; + + .destination-icon { + float: left; + width: 12px; + height: 12px; + padding: 1px; + margin-right: 3px; + color: rgb(161, 161, 161); + } } .linkMenu-destination-title { @@ -49,6 +59,13 @@ padding-right: 4px; margin-right: 4px; float: right; + + &:hover { + text-decoration: underline; + color: rgb(60, 90, 156); + //display: inline; + text-overflow: break; + } } } @@ -57,6 +74,7 @@ font-style: italic; color: rgb(95, 97, 102); font-size: 10px; + margin-left: 20px; } p { @@ -67,9 +85,6 @@ user-select: none; } - &:hover { - padding-right: 8px; - } } } @@ -88,8 +103,6 @@ &:hover { - width: calc(100% + 58px); - .linkMenu-item-buttons { display: flex; } @@ -102,14 +115,6 @@ //display: inline; text-overflow: break; } - - // &.expand-two p { - // width: calc(100% - 63px); - // } - - // &.expand-three p { - // width: calc(100% - 93px); - // } } } } diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index f601432fe..a07266023 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -214,8 +214,12 @@ export class LinkMenuItem extends React.Component {
{this.props.linkDoc.linkedText ?

Source: {StrCast(this.props.linkDoc.linkedText)}

: null} + +

+ Source: sample text

- +
+

{StrCast(this.props.destinationDoc.title)}

-- cgit v1.2.3-70-g09d2 From 95cb352eae8188e01dbed9fce19a27481cda667c Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Thu, 9 Jul 2020 22:06:19 -0500 Subject: change doc preiew layout --- src/client/views/linking/LinkMenuItem.scss | 4 ++++ src/client/views/linking/LinkMenuItem.tsx | 5 +--- .../views/nodes/ContentFittingDocumentView.tsx | 4 ++-- src/client/views/nodes/LinkDocPreview.tsx | 27 +++++++--------------- 4 files changed, 15 insertions(+), 25 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss index a3cce8e3c..f759aef5e 100644 --- a/src/client/views/linking/LinkMenuItem.scss +++ b/src/client/views/linking/LinkMenuItem.scss @@ -12,6 +12,8 @@ padding-top: 6.5px; padding-bottom: 6.5px; + background-color: white; + .linkMenu-name { position: relative; @@ -103,6 +105,8 @@ &:hover { + background-color: rgb(201, 239, 252); + .linkMenu-item-buttons { display: flex; } diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index a07266023..05ec10f71 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -213,10 +213,7 @@ export class LinkMenuItem extends React.Component {
{this.props.linkDoc.linkedText ?

- Source: {StrCast(this.props.linkDoc.linkedText)}

: null} - -

- Source: sample text

+ Source: {StrCast(this.props.linkDoc.linkedText)}

: null}
diff --git a/src/client/views/nodes/ContentFittingDocumentView.tsx b/src/client/views/nodes/ContentFittingDocumentView.tsx index ba075886b..be72bf60c 100644 --- a/src/client/views/nodes/ContentFittingDocumentView.tsx +++ b/src/client/views/nodes/ContentFittingDocumentView.tsx @@ -2,7 +2,7 @@ import React = require("react"); import { computed } from "mobx"; import { observer } from "mobx-react"; import { Transform } from "nodemailer/lib/xoauth2"; -import "react-table/react-table.css"; +//import "react-table/react-table.css"; import { Doc, HeightSym, Opt, WidthSym } from "../../../fields/Doc"; import { ScriptField } from "../../../fields/ScriptField"; import { Cast, NumCast, StrCast } from "../../../fields/Types"; @@ -10,7 +10,7 @@ import { TraceMobx } from "../../../fields/util"; import { emptyFunction } from "../../../Utils"; import { dropActionType } from "../../util/DragManager"; import { CollectionView } from "../collections/CollectionView"; -import '../DocumentDecorations.scss'; + import { DocumentView, DocumentViewProps } from "../nodes/DocumentView"; import "./ContentFittingDocumentView.scss"; diff --git a/src/client/views/nodes/LinkDocPreview.tsx b/src/client/views/nodes/LinkDocPreview.tsx index 197dc8df4..079920f56 100644 --- a/src/client/views/nodes/LinkDocPreview.tsx +++ b/src/client/views/nodes/LinkDocPreview.tsx @@ -98,23 +98,11 @@ export class LinkDocPreview extends React.Component { {this._toolTipText}
: - //
- //
{this._targetDoc.title} - //
- //
- //
- //
- // - //
- //
- //
+ { ContainingCollectionDoc={undefined} ContainingCollectionView={undefined} renderDepth={0} - PanelWidth={this.width} - PanelHeight={this.height} + PanelWidth={() => this.width() - 16} //Math.min(350, NumCast(target._width, 350))} + PanelHeight={() => this.height() - 16} //Math.min(250, NumCast(target._height, 250))} focus={emptyFunction} whenActiveChanged={returnFalse} bringToFront={returnFalse} ContentScaling={returnOne} NativeWidth={returnZero} - NativeHeight={returnZero} - />; - //
; + NativeHeight={returnZero} />; } render() { @@ -145,7 +131,10 @@ export class LinkDocPreview extends React.Component { style={{ position: "absolute", left: this.props.location[0], top: this.props.location[1], width: this.width(), height: this.height(), - boxShadow: "black 2px 2px 1em", zIndex: 1000 + zIndex: 1000, + border: "8px solid white", borderRadius: "7px", + boxShadow: "3px 3px 1.5px grey", + borderBottom: "8px solid white", borderRight: "8px solid white" }}> {this.targetDocView}
; -- cgit v1.2.3-70-g09d2 From 5e120375015d916a883232bf1235b1b133d7f9f0 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Fri, 10 Jul 2020 00:07:18 -0500 Subject: added tooltips and textboxcomment cleanup and descriptions --- src/client/views/linking/LinkMenuItem.tsx | 21 ++++--- src/client/views/nodes/DocumentLinksButton.tsx | 50 +++++++++-------- .../formattedText/FormattedTextBoxComment.scss | 65 ++++++++++++++-------- .../formattedText/FormattedTextBoxComment.tsx | 60 ++++++++++++++------ 4 files changed, 127 insertions(+), 69 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index 05ec10f71..07630c3ff 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -15,6 +15,7 @@ import { setupMoveUpEvents, emptyFunction } from '../../../Utils'; import { DocumentView } from '../nodes/DocumentView'; import { DocumentLinksButton } from '../nodes/DocumentLinksButton'; import { LinkDocPreview } from '../nodes/LinkDocPreview'; +import Tooltip from '@material-ui/core/Tooltip'; library.add(faEye, faEdit, faTimes, faArrowRight, faChevronDown, faChevronUp, faPencilAlt, faEyeSlash); @@ -228,13 +229,19 @@ export class LinkMenuItem extends React.Component { {canExpand ?
this.toggleShowMore(e)}>
: <>} -
-
- -
-
-
-
+ +
+
+
+ + +
+
+
+ +
+
+
{/*
*/}
diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 1af3318cb..f61ae2dd0 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -13,6 +13,7 @@ import { LinkDocPreview } from "./LinkDocPreview"; import { LinkCreatedBox } from "./LinkCreatedBox"; import { LinkDescriptionPopup } from "./LinkDescriptionPopup"; import { LinkManager } from "../../util/LinkManager"; +import { Tooltip } from "@material-ui/core"; const higflyout = require("@hig/flyout"); export const { anchorPoints } = higflyout; export const Flyout = higflyout.default; @@ -149,30 +150,33 @@ export class DocumentLinksButton extends React.Component +
LinkDocPreview.LinkInfo = undefined)} + // onPointerEnter={action(e => links.length && (LinkDocPreview.LinkInfo = { + // addDocTab: this.props.View.props.addDocTab, + // linkSrc: this.props.View.props.Document, + // linkDoc: links[0], + // Location: [e.clientX, e.clientY + 20] + // }))} + > + {links.length && !!!this.props.InMenu ? links.length : } +
+ {DocumentLinksButton.StartLink && DocumentLinksButton.StartLink !== this.props.View ?
this.finishLinkClick(e)} /> : (null)} + {DocumentLinksButton.StartLink === this.props.View ?
: (null)} +
; return (!links.length || links[0].hidden) && !this.props.AlwaysOn ? (null) : -
-
LinkDocPreview.LinkInfo = undefined)} - // onPointerEnter={action(e => links.length && (LinkDocPreview.LinkInfo = { - // addDocTab: this.props.View.props.addDocTab, - // linkSrc: this.props.View.props.Document, - // linkDoc: links[0], - // Location: [e.clientX, e.clientY + 20] - // }))} - > - {links.length && !!!this.props.InMenu ? links.length : } -
- {DocumentLinksButton.StartLink && DocumentLinksButton.StartLink !== this.props.View ?
this.finishLinkClick(e)} /> : (null)} - {DocumentLinksButton.StartLink === this.props.View ?
: (null)} -
; + + {linkButton} + ; } render() { return this.linkButton; diff --git a/src/client/views/nodes/formattedText/FormattedTextBoxComment.scss b/src/client/views/nodes/formattedText/FormattedTextBoxComment.scss index 7af209842..83f99122a 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBoxComment.scss +++ b/src/client/views/nodes/formattedText/FormattedTextBoxComment.scss @@ -10,32 +10,53 @@ transform: translateX(-50%); box-shadow: 3px 3px 1.5px grey; - .FormattedTextBoxComment-title { + .FormattedTextBoxComment { background-color: white; border: 8px solid white; - .FormattedTextBoxComment-button { - display: inline; - padding-left: 6px; - padding-right: 6px; - padding-top: 2.5px; - padding-bottom: 2.5px; - width: 20px; - height: 20px; - margin: 0; - margin-right: 6px; - border-radius: 50%; - pointer-events: auto; - background-color: rgb(0, 0, 0); - color: rgb(255, 255, 255); - transition: transform 0.2s; - text-align: center; - position: relative; - font: 10px; + //display: flex; + .FormattedTextBoxComment-info { - &:hover { - background-color: rgb(77, 77, 77); - cursor: grab; + margin-bottom: 9px; + + .FormattedTextBoxComment-title { + padding-right: 4px; + float: left; + + .FormattedTextBoxComment-description { + text-decoration: none; + font-style: italic; + color: rgb(95, 97, 102); + font-size: 10px; + padding-bottom: 4px; + margin-bottom: 5px; + + } + } + + .FormattedTextBoxComment-button { + display: inline; + padding-left: 6px; + padding-right: 6px; + padding-top: 2.5px; + padding-bottom: 2.5px; + width: 17px; + height: 17px; + margin: 0; + margin-right: 3px; + border-radius: 50%; + pointer-events: auto; + background-color: rgb(0, 0, 0); + color: rgb(255, 255, 255); + transition: transform 0.2s; + text-align: center; + position: relative; + font-size: 12px; + + &:hover { + background-color: rgb(77, 77, 77); + cursor: grab; + } } } diff --git a/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx b/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx index a9185be21..acdc7c56b 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx +++ b/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx @@ -3,7 +3,7 @@ import { EditorState, Plugin } from "prosemirror-state"; import { EditorView } from "prosemirror-view"; import * as ReactDOM from 'react-dom'; import { Doc, DocCastAsync, Opt } from "../../../../fields/Doc"; -import { Cast, FieldValue, NumCast } from "../../../../fields/Types"; +import { Cast, FieldValue, NumCast, StrCast } from "../../../../fields/Types"; import { emptyFunction, returnEmptyString, returnFalse, Utils, emptyPath, returnZero, returnOne, returnEmptyFilter } from "../../../../Utils"; import { DocServer } from "../../../DocServer"; import { DocumentManager } from "../../../util/DocumentManager"; @@ -21,6 +21,7 @@ import { action } from "mobx"; import { LinkManager } from "../../../util/LinkManager"; import { LinkDocPreview } from "../LinkDocPreview"; import { DocumentLinksButton } from "../DocumentLinksButton"; +import Tooltip from "@material-ui/core/Tooltip"; export let formattedTextBoxCommentPlugin = new Plugin({ view(editorView) { return new FormattedTextBoxComment(editorView); } @@ -85,13 +86,13 @@ export class FormattedTextBoxComment { FormattedTextBoxComment.tooltip.className = "FormattedTextBox-tooltip"; FormattedTextBoxComment.tooltip.style.pointerEvents = "all"; FormattedTextBoxComment.tooltip.style.maxWidth = "190px"; - FormattedTextBoxComment.tooltip.style.maxHeight = "220px"; + FormattedTextBoxComment.tooltip.style.maxHeight = "235px"; FormattedTextBoxComment.tooltip.style.width = "100%"; FormattedTextBoxComment.tooltip.style.height = "100%"; FormattedTextBoxComment.tooltip.style.overflow = "hidden"; FormattedTextBoxComment.tooltip.style.display = "none"; FormattedTextBoxComment.tooltip.appendChild(FormattedTextBoxComment.tooltipInput); - FormattedTextBoxComment.tooltip.onpointerdown = (e: PointerEvent) => { + FormattedTextBoxComment.tooltip.onpointerdown = async (e: PointerEvent) => { const keep = e.target && (e.target as any).type === "checkbox" ? true : false; const textBox = FormattedTextBoxComment.textBox; if (FormattedTextBoxComment.linkDoc && !keep && textBox) { @@ -103,8 +104,22 @@ export class FormattedTextBoxComment { if (FormattedTextBoxComment.linkDoc.type !== DocumentType.LINK) { textBox.props.addDocTab(FormattedTextBoxComment.linkDoc, e.ctrlKey ? "inTab" : "onRight"); } else { - DocumentManager.Instance.FollowLink(FormattedTextBoxComment.linkDoc, textBox.props.Document, - (doc: Doc, followLinkLocation: string) => textBox.props.addDocTab(doc, e.ctrlKey ? "inTab" : followLinkLocation)); + const anchor = FieldValue(Doc.AreProtosEqual(FieldValue(Cast(FormattedTextBoxComment.linkDoc.anchor1, Doc)), textBox.dataDoc) ? + Cast(FormattedTextBoxComment.linkDoc.anchor2, Doc) : (Cast(FormattedTextBoxComment.linkDoc.anchor1, Doc)) + || FormattedTextBoxComment.linkDoc); + const target = anchor?.annotationOn ? await DocCastAsync(anchor.annotationOn) : anchor; + + if (FormattedTextBoxComment.linkDoc.follow) { + if (FormattedTextBoxComment.linkDoc.follow === "Default") { + DocumentManager.Instance.FollowLink(FormattedTextBoxComment.linkDoc, textBox.props.Document, doc => textBox.props.addDocTab(doc, "onRight"), false); + } else if (FormattedTextBoxComment.linkDoc.follow === "Always open in right tab") { + if (target) { textBox.props.addDocTab(target, "onRight"); } + } else if (FormattedTextBoxComment.linkDoc.follow === "Always open in new tab") { + if (target) { textBox.props.addDocTab(target, "inTab"); } + } + } else { + DocumentManager.Instance.FollowLink(FormattedTextBoxComment.linkDoc, textBox.props.Document, doc => textBox.props.addDocTab(doc, "onRight"), false); + } } } else { if (FormattedTextBoxComment.linkDoc.type !== DocumentType.LINK) { @@ -243,19 +258,30 @@ export class FormattedTextBoxComment { FormattedTextBoxComment.showCommentbox("", view, nbef); - const docPreview =
- {target.title} -
-
this._deleteRef = r}> -
-
this._followRef = r}> - + const docPreview =
+
+
+ {target.title} + {FormattedTextBoxComment.linkDoc.description !== "" ?

+ {StrCast(FormattedTextBoxComment.linkDoc.description)}

: null}
-
+
+ + +
this._deleteRef = r}> +
+
+ + +
this._followRef = r}> + +
+
+
Date: Fri, 10 Jul 2020 00:43:05 -0500 Subject: adding ... --- src/client/views/collections/CollectionLinearView.tsx | 17 ++++++++++++----- src/client/views/linking/LinkMenuItem.tsx | 8 +++++++- .../nodes/formattedText/FormattedTextBoxComment.tsx | 11 +++++++---- 3 files changed, 26 insertions(+), 10 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/collections/CollectionLinearView.tsx b/src/client/views/collections/CollectionLinearView.tsx index c370415be..2dd48aa27 100644 --- a/src/client/views/collections/CollectionLinearView.tsx +++ b/src/client/views/collections/CollectionLinearView.tsx @@ -16,6 +16,7 @@ import { Id } from '../../../fields/FieldSymbols'; import { DocumentLinksButton } from '../nodes/DocumentLinksButton'; import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; import { LinkDescriptionPopup } from '../nodes/LinkDescriptionPopup'; +import { Tooltip } from '@material-ui/core'; type LinearDocument = makeInterface<[typeof documentSchema,]>; @@ -171,11 +172,17 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) { onPointerDown={e => e.stopPropagation()} > Creating link from: {DocumentLinksButton.StartLink.title} - Labels: {LinkDescriptionPopup.showDescriptions ? LinkDescriptionPopup.showDescriptions : "ON"} - - Exit + + Labels: {LinkDescriptionPopup.showDescriptions ? LinkDescriptionPopup.showDescriptions : "ON"} + + + + + Exit + {/* */} diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index 07630c3ff..f1a744ff2 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -197,6 +197,11 @@ export class LinkMenuItem extends React.Component { this.props.destinationDoc.type === "import" ? "cloud-upload-alt" : this.props.destinationDoc.type === "docholder" ? "expand" : "question"; + const title = StrCast(this.props.destinationDoc.title).length > 18 ? + StrCast(this.props.destinationDoc.title).substr(0, 19) + "..." : this.props.destinationDoc.title; + + + console.log(StrCast(this.props.destinationDoc.title).length); return (
@@ -220,7 +225,8 @@ export class LinkMenuItem extends React.Component {

- {StrCast(this.props.destinationDoc.title)}

+ {title} +

{this.props.linkDoc.description !== "" ?

{StrCast(this.props.linkDoc.description)}

: null}
diff --git a/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx b/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx index acdc7c56b..f1602bfbc 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx +++ b/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx @@ -85,7 +85,7 @@ export class FormattedTextBoxComment { FormattedTextBoxComment.tooltip.appendChild(FormattedTextBoxComment.tooltipText); FormattedTextBoxComment.tooltip.className = "FormattedTextBox-tooltip"; FormattedTextBoxComment.tooltip.style.pointerEvents = "all"; - FormattedTextBoxComment.tooltip.style.maxWidth = "190px"; + FormattedTextBoxComment.tooltip.style.maxWidth = "200px"; FormattedTextBoxComment.tooltip.style.maxHeight = "235px"; FormattedTextBoxComment.tooltip.style.width = "100%"; FormattedTextBoxComment.tooltip.style.height = "100%"; @@ -257,11 +257,14 @@ export class FormattedTextBoxComment { if (target?.author) { FormattedTextBoxComment.showCommentbox("", view, nbef); + const title = StrCast(target.title).length > 16 ? + StrCast(target.title).substr(0, 16) + "..." : target.title; + const docPreview =
- {target.title} + {title} {FormattedTextBoxComment.linkDoc.description !== "" ?

{StrCast(FormattedTextBoxComment.linkDoc.description)}

: null}
@@ -300,8 +303,8 @@ export class FormattedTextBoxComment { ContainingCollectionDoc={undefined} ContainingCollectionView={undefined} renderDepth={0} - PanelWidth={() => 170} //Math.min(350, NumCast(target._width, 350))} - PanelHeight={() => 170} //Math.min(250, NumCast(target._height, 250))} + PanelWidth={() => 175} //Math.min(350, NumCast(target._width, 350))} + PanelHeight={() => 175} //Math.min(250, NumCast(target._height, 250))} focus={emptyFunction} whenActiveChanged={returnFalse} bringToFront={returnFalse} -- cgit v1.2.3-70-g09d2 From b9ba531c64fe7926a6794ab57e4989e1ea6c6992 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Fri, 10 Jul 2020 11:23:44 -0400 Subject: fixes for x/y panning on drag --- .../collectionFreeForm/CollectionFreeFormView.tsx | 66 ++++++---------------- 1 file changed, 16 insertions(+), 50 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index f2a39b240..3fdf6683e 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -84,6 +84,8 @@ export class CollectionFreeFormView extends CollectionSubView = new Map(); @@ -579,7 +581,7 @@ export class CollectionFreeFormView extends CollectionSubView { - this._lastClientY = undefined; + this._lastClientY = this._lastClientX = undefined; if (InteractionUtils.IsType(e, InteractionUtils.TOUCHTYPE)) return; document.removeEventListener("pointermove", this.onPointerMove); @@ -1172,76 +1174,40 @@ export class CollectionFreeFormView extends CollectionSubView - _lastClientY: number | undefined = 0; @action handleDragging = (e: CustomEvent, de: DragEvent) => { if ((e as any).handlePan) return; (e as any).handlePan = true; - const top = this.panX(); - const left = this.panY(); this._lastClientY = e.detail.clientY; - - console.log("draggg"); - - const size = this.getTransform().transformDirection(this.props.PanelWidth(), this.props.PanelHeight()); - const scale = this.getLocalTransform().inverse().Scale; + this._lastClientX = e.detail.clientX; if (this._marqueeRef?.current) { - - console.log("hellp"); - const dragX = e.detail.clientX; const dragY = e.detail.clientY; const bounds = this._marqueeRef.current?.getBoundingClientRect(); - if (dragX - bounds.left < 25) { - console.log("PAN left "); - - if (this.canPanX) { - this.Document._panX = left - 5; - setTimeout(action(() => { - this.canPanX = true; - this.panX(); - }), 250); - this.canPanX = false; - } - } else if (bounds.right - dragX < 25) { - console.log("PAN right "); - - if (this.canPanX) { - this.Document._panX = left + 5; - setTimeout(action(() => { - this.panX(); - this.canPanX = true; - }), 250); - this.canPanX = false; - } - - } - - if (dragY - bounds.top < 25) { - console.log("PAN top "); - this.continueYPan(-2); - } else if (bounds.bottom - dragY < 25) { - console.log("PAN bottom "); - this.continueYPan(2); - } + let deltaX = dragX - bounds.left < 25 ? -2 : bounds.right - dragX < 25 ? 2 : 0; + let deltaY = dragY - bounds.top < 25 ? -2 : bounds.bottom - dragY < 25 ? 2 : 0; + (deltaX !== 0 || deltaY !== 0) && this.continuePan(deltaX, deltaY); } e.stopPropagation(); } - continueYPan = (delta: number) => { + continuePan = (deltaX: number, deltaY: number) => { setTimeout(() => { const dragY = this._lastClientY; - if (dragY !== undefined && this._marqueeRef.current) { + const dragX = this._lastClientX; + if (dragY !== undefined && dragX !== undefined && this._marqueeRef.current) { const bounds = this._marqueeRef.current.getBoundingClientRect()!; - this.Document._panY = NumCast(this.Document._panY) + delta; - (dragY - bounds.top < 25 || bounds.bottom - dragY < 25) && this.continueYPan(delta); - } else this._lastClientY !== undefined && this.continueYPan(delta); + this.Document._panY = NumCast(this.Document._panY) + deltaY; + this.Document._panX = NumCast(this.Document._panX) + deltaX; + if (dragY - bounds.top < 25 || bounds.bottom - dragY < 25 || dragX - bounds.left < 25 || bounds.right - dragX < 25) { + this.continuePan(deltaX, deltaY); + } + } else this._lastClientY !== undefined && this._lastClientX !== undefined && this.continuePan(deltaX, deltaY); }, 50); } - promoteCollection = undoBatch(action(() => { const childDocs = this.childDocs.slice(); childDocs.forEach(doc => { -- cgit v1.2.3-70-g09d2 From d064024d9ab2cd8e836df5ba75e064d77617445b Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Fri, 10 Jul 2020 11:25:08 -0400 Subject: from last --- .../views/collections/collectionFreeForm/CollectionFreeFormView.tsx | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 3fdf6683e..2191021d2 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1194,7 +1194,7 @@ export class CollectionFreeFormView extends CollectionSubView { - setTimeout(() => { + setTimeout(action(() => { const dragY = this._lastClientY; const dragX = this._lastClientX; if (dragY !== undefined && dragX !== undefined && this._marqueeRef.current) { @@ -1205,7 +1205,7 @@ export class CollectionFreeFormView extends CollectionSubView { -- cgit v1.2.3-70-g09d2 From 20ab61d762e4c92e9ace6eb9b577667a9a8dc1e3 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Fri, 10 Jul 2020 12:05:53 -0500 Subject: fixed tooltip error, label styling --- src/client/views/linking/LinkMenuItem.scss | 3 +++ src/client/views/linking/LinkMenuItem.tsx | 19 +++++++++++++------ src/client/views/nodes/DocumentLinksButton.tsx | 2 +- .../views/nodes/formattedText/FormattedTextBox.tsx | 10 ++++++---- .../nodes/formattedText/FormattedTextBoxComment.tsx | 6 +++--- 5 files changed, 26 insertions(+), 14 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss index f759aef5e..3ecb306f9 100644 --- a/src/client/views/linking/LinkMenuItem.scss +++ b/src/client/views/linking/LinkMenuItem.scss @@ -77,6 +77,9 @@ color: rgb(95, 97, 102); font-size: 10px; margin-left: 20px; + max-width: 125px; + height: auto; + white-space: break-spaces; } p { diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index f1a744ff2..f7d189b20 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -15,7 +15,8 @@ import { setupMoveUpEvents, emptyFunction } from '../../../Utils'; import { DocumentView } from '../nodes/DocumentView'; import { DocumentLinksButton } from '../nodes/DocumentLinksButton'; import { LinkDocPreview } from '../nodes/LinkDocPreview'; -import Tooltip from '@material-ui/core/Tooltip'; +import { Tooltip } from '@material-ui/core'; +import { RichTextField } from '../../../fields/RichTextField'; library.add(faEye, faEdit, faTimes, faArrowRight, faChevronDown, faChevronUp, faPencilAlt, faEyeSlash); @@ -203,6 +204,12 @@ export class LinkMenuItem extends React.Component { console.log(StrCast(this.props.destinationDoc.title).length); + // ... + // from anika to bob: here's where the text that is specifically linked would show up (linkDoc.storedText) + // ... + const source = this.props.sourceDoc.type === "rtf" ? this.props.linkDoc.storedText ? + "stored text would show up here" : undefined : undefined; + return (
@@ -218,8 +225,8 @@ export class LinkMenuItem extends React.Component { onPointerDown={this.onLinkButtonDown}>
- {this.props.linkDoc.linkedText ?

- Source: {StrCast(this.props.linkDoc.linkedText)}

: null} + {source ?

+ Source: {source}

: null}
@@ -236,16 +243,16 @@ export class LinkMenuItem extends React.Component {
: <>} -
+
-
+
-
+
{/*
diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index f61ae2dd0..22431117e 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -150,7 +150,7 @@ export class DocumentLinksButton extends React.Component + const linkButton =
{ const key = entry[0]; const value = entry[1]; @@ -186,11 +184,15 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp DocServer.GetRefField(id).then(linkDoc => { this.dataDoc[key] = doc || Docs.Create.FreeformDocument([], { title: value, _width: 500, _height: 500 }, value); DocUtils.Publish(this.dataDoc[key] as Doc, value, this.props.addDocument, this.props.removeDocument); - if (linkDoc) { (linkDoc as Doc).anchor2 = this.dataDoc[key] as Doc; } - else DocUtils.MakeLink({ doc: this.rootDoc }, { doc: this.dataDoc[key] as Doc }, "portal link", "link to named target", id); + if (linkDoc) { + (linkDoc as Doc).anchor2 = this.dataDoc[key] as Doc; + } else { + DocUtils.MakeLink({ doc: this.rootDoc }, { doc: this.dataDoc[key] as Doc }, "portal link", "link to named target", id); + } }); }); }); + this.linkOnDeselect.clear(); } diff --git a/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx b/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx index f1602bfbc..fa2548cb5 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx +++ b/src/client/views/nodes/formattedText/FormattedTextBoxComment.tsx @@ -21,7 +21,7 @@ import { action } from "mobx"; import { LinkManager } from "../../../util/LinkManager"; import { LinkDocPreview } from "../LinkDocPreview"; import { DocumentLinksButton } from "../DocumentLinksButton"; -import Tooltip from "@material-ui/core/Tooltip"; +import { Tooltip } from "@material-ui/core"; export let formattedTextBoxCommentPlugin = new Plugin({ view(editorView) { return new FormattedTextBoxComment(editorView); } @@ -271,14 +271,14 @@ export class FormattedTextBoxComment {
-
this._deleteRef = r}>
-
this._followRef = r}> -- cgit v1.2.3-70-g09d2 From 5a70fb56062d6a5ed45cf3cf4453089bc83f3c6b Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Fri, 10 Jul 2020 18:11:09 -0500 Subject: added showing individual links with one bug --- .../collectionFreeForm/CollectionFreeFormLinkView.tsx | 4 ++-- src/client/views/linking/LinkMenuItem.tsx | 13 ++++++++++--- src/client/views/nodes/DocumentLinksButton.tsx | 8 +++++++- src/client/views/nodes/DocumentView.tsx | 18 ++++++++++++++---- 4 files changed, 33 insertions(+), 10 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx index a24693c30..ae79c27e0 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormLinkView.tsx @@ -110,10 +110,10 @@ export class CollectionFreeFormLinkView extends React.Component - {text !== "-ungrouped-" ? text : ""} + {text} diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index f7d189b20..8fc1ea12f 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -177,11 +177,16 @@ export class LinkMenuItem extends React.Component { DocumentLinksButton.EditLink = undefined; } + @action + showLink = () => { + this.props.linkDoc.hidden = !this.props.linkDoc.hidden; + } + render() { const keys = LinkManager.Instance.getMetadataKeysInGroup(this.props.groupType);//groupMetadataKeys.get(this.props.groupType); const canExpand = keys ? keys.length > 0 : false; - const eyeIcon = this.props.linkDoc.shown ? "eye-slash" : "eye"; + const eyeIcon = this.props.linkDoc.hidden ? "eye-slash" : "eye"; const destinationIcon = this.props.destinationDoc.type === "image" ? "image" : this.props.destinationDoc.type === "comparison" ? "columns" : @@ -208,7 +213,9 @@ export class LinkMenuItem extends React.Component { // from anika to bob: here's where the text that is specifically linked would show up (linkDoc.storedText) // ... const source = this.props.sourceDoc.type === "rtf" ? this.props.linkDoc.storedText ? - "stored text would show up here" : undefined : undefined; + StrCast(this.props.linkDoc.storedText).length > 17 ? + StrCast(this.props.linkDoc.storedText).substr(0, 18) + : this.props.linkDoc.storedText : undefined : undefined; return (
@@ -243,7 +250,7 @@ export class LinkMenuItem extends React.Component {
: <>} -
+
diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 22431117e..f07a2ea5a 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -95,6 +95,9 @@ export class DocumentLinksButton extends React.Component { LinkCreatedBox.popupX = e.screenX; LinkCreatedBox.popupY = e.screenY - 133; @@ -123,6 +126,9 @@ export class DocumentLinksButton extends React.Component { LinkCreatedBox.popupX = e.screenX; LinkCreatedBox.popupY = e.screenY - 133; @@ -173,7 +179,7 @@ export class DocumentLinksButton extends React.Component : (null)}
; - return (!links.length || links[0].hidden) && !this.props.AlwaysOn ? (null) : + return (!links.length) && !this.props.AlwaysOn ? (null) : {linkButton} ; diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 97e3bc01c..310260832 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -201,6 +201,8 @@ export class DocumentView extends DocComponent(Docu this._mainCont.current && (this.multiTouchDisposer = InteractionUtils.MakeMultiTouchTarget(this._mainCont.current, this.onTouchStart.bind(this))); // this._mainCont.current && (this.holdDisposer = InteractionUtils.MakeHoldTouchTarget(this._mainCont.current, this.handle1PointerHoldStart.bind(this))); + //this.layoutDoc.showAllLinks = true; + if (!this.props.dontRegisterView) { DocumentManager.Instance.DocumentViews.push(this); } @@ -646,6 +648,8 @@ export class DocumentView extends DocComponent(Docu const linkDoc = DocUtils.MakeLink({ doc: de.complete.annoDragData.annotationDocument }, { doc: this.props.Document }, "link"); LinkManager.currentLink = linkDoc; + linkDoc ? linkDoc.hidden = true : null; + linkDoc ? linkDoc.linkDisplay = true : null; runInAction(() => { LinkCreatedBox.popupX = de.x; @@ -668,6 +672,8 @@ export class DocumentView extends DocComponent(Docu const linkDoc = DocUtils.MakeLink({ doc: de.complete.linkDragData.linkSourceDocument }, { doc: this.props.Document }, `link`); LinkManager.currentLink = linkDoc; + linkDoc ? linkDoc.hidden = true : null; + linkDoc ? linkDoc.linkDisplay = true : null; de.complete.linkDragData.linkSourceDocument !== this.props.Document && (de.complete.linkDragData.linkDocument = linkDoc); // TODODO this is where in text links get passed @@ -783,9 +789,12 @@ export class DocumentView extends DocComponent(Docu const optionItems: ContextMenuProps[] = options && "subitems" in options ? options.subitems : []; const templateDoc = Cast(this.props.Document[StrCast(this.props.Document.layoutKey)], Doc, null); templateDoc && optionItems.push({ description: "Open Template ", event: () => this.props.addDocTab(templateDoc, "onRight"), icon: "eye" }); - optionItems.push({ description: "Toggle Show Each Link Dot", event: () => this.layoutDoc.showLinks = !this.layoutDoc.showLinks, icon: "eye" }); + optionItems.push({ + description: "Toggle Show Each Link Dot", event: () => { this.layoutDoc.showAllLinks = !this.layoutDoc.showAllLinks; }, icon: "eye" + }); !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "compass" }); + const existingOnClick = cm.findByDescription("OnClick..."); const onClicks: ContextMenuProps[] = existingOnClick && "subitems" in existingOnClick ? existingOnClick.subitems : []; onClicks.push({ description: "Enter Portal", event: this.makeIntoPortal, icon: "window-restore" }); @@ -1084,7 +1093,7 @@ export class DocumentView extends DocComponent(Docu select={this.select} onClick={this.onClickHandler} layoutKey={this.finalLayoutKey} /> - {this.layoutDoc.showLinks ? this.anchors : (null)} + {this.layoutDoc.showAllLinks ? this.allAnchors : null} {this.props.forcedBackgroundColor?.(this.Document) === "transparent" || this.props.dontRegisterView ? (null) : }
); @@ -1107,7 +1116,8 @@ export class DocumentView extends DocComponent(Docu hideLinkAnchor = (doc: Doc | Doc[]) => (doc instanceof Doc ? [doc] : doc).reduce((flg: boolean, doc) => flg && (doc.hidden = true), true) anchorPanelWidth = () => this.props.PanelWidth() || 1; anchorPanelHeight = () => this.props.PanelHeight() || 1; - @computed get anchors() { + + @computed get allAnchors() { TraceMobx(); return (this.props.treeViewDoc && this.props.LayoutTemplateString) || // render nothing for: tree view anchor dots this.layoutDoc.presBox || // presentationbox nodes @@ -1133,7 +1143,7 @@ export class DocumentView extends DocComponent(Docu if (this.props.treeViewDoc && !this.props.LayoutTemplateString) { // this happens when the document is a tree view label (but not an anchor dot) return
{StrCast(this.props.Document.title)} - {this.anchors} + {this.allAnchors}
; } -- cgit v1.2.3-70-g09d2 From ddad39f43f4b7398bb47f5513ec0d753d0288eca Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Fri, 10 Jul 2020 23:21:32 -0500 Subject: menu ui change --- src/client/views/linking/LinkMenuItem.scss | 2 +- src/client/views/linking/LinkMenuItem.tsx | 4 ++- src/client/views/nodes/DocumentLinksButton.scss | 2 +- src/client/views/nodes/DocumentLinksButton.tsx | 39 ++++++++++++---------- src/client/views/nodes/DocumentView.tsx | 35 +++++++++++-------- src/client/views/nodes/LinkDescriptionPopup.scss | 8 +++++ .../formattedText/FormattedTextBoxComment.scss | 2 +- 7 files changed, 57 insertions(+), 35 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/linking/LinkMenuItem.scss b/src/client/views/linking/LinkMenuItem.scss index 3ecb306f9..f70f5a23e 100644 --- a/src/client/views/linking/LinkMenuItem.scss +++ b/src/client/views/linking/LinkMenuItem.scss @@ -162,7 +162,7 @@ &:hover { background: $main-accent; - cursor: grab; + cursor: pointer; } } } \ No newline at end of file diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index 8fc1ea12f..9aa142728 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -217,6 +217,8 @@ export class LinkMenuItem extends React.Component { StrCast(this.props.linkDoc.storedText).substr(0, 18) : this.props.linkDoc.storedText : undefined : undefined; + const showTitle = this.props.linkDoc.hidden ? "Show link" : "Hide link"; + return (
@@ -249,7 +251,7 @@ export class LinkMenuItem extends React.Component { {canExpand ?
this.toggleShowMore(e)}>
: <>} - +
diff --git a/src/client/views/nodes/DocumentLinksButton.scss b/src/client/views/nodes/DocumentLinksButton.scss index b58603978..580e86442 100644 --- a/src/client/views/nodes/DocumentLinksButton.scss +++ b/src/client/views/nodes/DocumentLinksButton.scss @@ -23,7 +23,7 @@ &:hover { background: deepskyblue; transform: scale(1.05); - cursor: grab; + cursor: pointer; } } .documentLinksButton { diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index f07a2ea5a..03a96ea4a 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -99,15 +99,18 @@ export class DocumentLinksButton extends React.Component { - LinkCreatedBox.popupX = e.screenX; - LinkCreatedBox.popupY = e.screenY - 133; - LinkCreatedBox.linkCreated = true; + if (linkDoc) { + LinkCreatedBox.popupX = e.screenX; + LinkCreatedBox.popupY = e.screenY - 133; + LinkCreatedBox.linkCreated = true; - LinkDescriptionPopup.popupX = e.screenX; - LinkDescriptionPopup.popupY = e.screenY - 100; - LinkDescriptionPopup.descriptionPopup = true; + LinkDescriptionPopup.popupX = e.screenX; + LinkDescriptionPopup.popupY = e.screenY - 100; + LinkDescriptionPopup.descriptionPopup = true; + + setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + } - setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); }); } } @@ -130,17 +133,19 @@ export class DocumentLinksButton extends React.Component { - LinkCreatedBox.popupX = e.screenX; - LinkCreatedBox.popupY = e.screenY - 133; - LinkCreatedBox.linkCreated = true; - - if (LinkDescriptionPopup.showDescriptions === "ON" || !LinkDescriptionPopup.showDescriptions) { - LinkDescriptionPopup.popupX = e.screenX; - LinkDescriptionPopup.popupY = e.screenY - 100; - LinkDescriptionPopup.descriptionPopup = true; - } + if (linkDoc) { + LinkCreatedBox.popupX = e.screenX; + LinkCreatedBox.popupY = e.screenY - 133; + LinkCreatedBox.linkCreated = true; - setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + if (LinkDescriptionPopup.showDescriptions === "ON" || !LinkDescriptionPopup.showDescriptions) { + LinkDescriptionPopup.popupX = e.screenX; + LinkDescriptionPopup.popupY = e.screenY - 100; + LinkDescriptionPopup.descriptionPopup = true; + } + + setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + } }); } } diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 310260832..d0305c36c 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -652,15 +652,17 @@ export class DocumentView extends DocComponent(Docu linkDoc ? linkDoc.linkDisplay = true : null; runInAction(() => { - LinkCreatedBox.popupX = de.x; - LinkCreatedBox.popupY = de.y - 33; - LinkCreatedBox.linkCreated = true; + if (linkDoc) { + LinkCreatedBox.popupX = de.x; + LinkCreatedBox.popupY = de.y - 33; + LinkCreatedBox.linkCreated = true; - LinkDescriptionPopup.popupX = de.x; - LinkDescriptionPopup.popupY = de.y; - LinkDescriptionPopup.descriptionPopup = true; + LinkDescriptionPopup.popupX = de.x; + LinkDescriptionPopup.popupY = de.y; + LinkDescriptionPopup.descriptionPopup = true; - setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + } }); } if (de.complete.linkDragData) { @@ -678,15 +680,19 @@ export class DocumentView extends DocComponent(Docu de.complete.linkDragData.linkSourceDocument !== this.props.Document && (de.complete.linkDragData.linkDocument = linkDoc); // TODODO this is where in text links get passed runInAction(() => { - LinkCreatedBox.popupX = de.x; - LinkCreatedBox.popupY = de.y - 33; - LinkCreatedBox.linkCreated = true; - LinkDescriptionPopup.popupX = de.x; - LinkDescriptionPopup.popupY = de.y; - LinkDescriptionPopup.descriptionPopup = true; + if (linkDoc) { + LinkCreatedBox.popupX = de.x; + LinkCreatedBox.popupY = de.y - 33; + LinkCreatedBox.linkCreated = true; + + LinkDescriptionPopup.popupX = de.x; + LinkDescriptionPopup.popupY = de.y; + LinkDescriptionPopup.descriptionPopup = true; + + setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + } - setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); }); } @@ -1094,6 +1100,7 @@ export class DocumentView extends DocComponent(Docu onClick={this.onClickHandler} layoutKey={this.finalLayoutKey} /> {this.layoutDoc.showAllLinks ? this.allAnchors : null} + {/* {this.allAnchors} */} {this.props.forcedBackgroundColor?.(this.Document) === "transparent" || this.props.dontRegisterView ? (null) : }
); diff --git a/src/client/views/nodes/LinkDescriptionPopup.scss b/src/client/views/nodes/LinkDescriptionPopup.scss index 54002fd1b..d92823ccc 100644 --- a/src/client/views/nodes/LinkDescriptionPopup.scss +++ b/src/client/views/nodes/LinkDescriptionPopup.scss @@ -48,6 +48,10 @@ position: relative; margin-right: 4px; justify-content: center; + + &:hover{ + cursor: pointer; + } } .linkDescriptionPopup-btn-add { @@ -62,6 +66,10 @@ text-align: center; position: relative; justify-content: center; + + &:hover{ + cursor: pointer; + } } } diff --git a/src/client/views/nodes/formattedText/FormattedTextBoxComment.scss b/src/client/views/nodes/formattedText/FormattedTextBoxComment.scss index 83f99122a..6a403cb17 100644 --- a/src/client/views/nodes/formattedText/FormattedTextBoxComment.scss +++ b/src/client/views/nodes/formattedText/FormattedTextBoxComment.scss @@ -55,7 +55,7 @@ &:hover { background-color: rgb(77, 77, 77); - cursor: grab; + cursor: pointer; } } } -- cgit v1.2.3-70-g09d2 From 5154faab98dda93eb815551d8f35ce569012dcd4 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sat, 11 Jul 2020 10:20:20 -0400 Subject: fixed showing of inidvidual link trails. --- src/client/views/nodes/DocumentView.tsx | 10 +++------- 1 file changed, 3 insertions(+), 7 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index d0305c36c..a97df3368 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -201,8 +201,6 @@ export class DocumentView extends DocComponent(Docu this._mainCont.current && (this.multiTouchDisposer = InteractionUtils.MakeMultiTouchTarget(this._mainCont.current, this.onTouchStart.bind(this))); // this._mainCont.current && (this.holdDisposer = InteractionUtils.MakeHoldTouchTarget(this._mainCont.current, this.handle1PointerHoldStart.bind(this))); - //this.layoutDoc.showAllLinks = true; - if (!this.props.dontRegisterView) { DocumentManager.Instance.DocumentViews.push(this); } @@ -795,9 +793,6 @@ export class DocumentView extends DocComponent(Docu const optionItems: ContextMenuProps[] = options && "subitems" in options ? options.subitems : []; const templateDoc = Cast(this.props.Document[StrCast(this.props.Document.layoutKey)], Doc, null); templateDoc && optionItems.push({ description: "Open Template ", event: () => this.props.addDocTab(templateDoc, "onRight"), icon: "eye" }); - optionItems.push({ - description: "Toggle Show Each Link Dot", event: () => { this.layoutDoc.showAllLinks = !this.layoutDoc.showAllLinks; }, icon: "eye" - }); !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "compass" }); @@ -1099,7 +1094,7 @@ export class DocumentView extends DocComponent(Docu select={this.select} onClick={this.onClickHandler} layoutKey={this.finalLayoutKey} /> - {this.layoutDoc.showAllLinks ? this.allAnchors : null} + {this.layoutDoc.hideAllLinks ? (null) : this.allAnchors} {/* {this.allAnchors} */} {this.props.forcedBackgroundColor?.(this.Document) === "transparent" || this.props.dontRegisterView ? (null) : }
@@ -1126,6 +1121,7 @@ export class DocumentView extends DocComponent(Docu @computed get allAnchors() { TraceMobx(); + if (this.props.LayoutTemplateString?.includes("LinkAnchorBox")) return null; return (this.props.treeViewDoc && this.props.LayoutTemplateString) || // render nothing for: tree view anchor dots this.layoutDoc.presBox || // presentationbox nodes this.props.dontRegisterView ? (null) : // view that are not registered @@ -1147,7 +1143,7 @@ export class DocumentView extends DocComponent(Docu } @computed get innards() { TraceMobx(); - if (this.props.treeViewDoc && !this.props.LayoutTemplateString) { // this happens when the document is a tree view label (but not an anchor dot) + if (this.props.treeViewDoc && !this.props.LayoutTemplateString?.includes("LinkAnchorBox")) { // this happens when the document is a tree view label (but not an anchor dot) return
{StrCast(this.props.Document.title)} {this.allAnchors} -- cgit v1.2.3-70-g09d2 From 98c53819d8dfb56ea5fcb1f2b1bd13f87551d71d Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sat, 11 Jul 2020 10:47:49 -0400 Subject: fixed some warnings with richTextMenu --- .../views/nodes/formattedText/RichTextMenu.tsx | 30 +++++++++++----------- 1 file changed, 15 insertions(+), 15 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx index f10c425d4..1a8a4ceb7 100644 --- a/src/client/views/nodes/formattedText/RichTextMenu.tsx +++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx @@ -358,11 +358,11 @@ export default class RichTextMenu extends AntimodeMenu { const items = options.map(({ title, label, hidden, style }) => { if (hidden) { return label === activeOption ? - : + : ; } return label === activeOption ? - : + : ; }); @@ -385,11 +385,11 @@ export default class RichTextMenu extends AntimodeMenu { const items = options.map(({ title, label, hidden, style }) => { if (hidden) { return label === activeOption ? - : + : ; } return label === activeOption ? - : + : ; }); @@ -882,22 +882,22 @@ export default class RichTextMenu extends AntimodeMenu { render() { TraceMobx(); - const row1 =
{[ + const row1 =
{[ !this.collapsed ? this.getDragger() : (null), - !this.Pinned ? (null) : <> {[ + !this.Pinned ? (null) :
{[ this.createButton("bold", "Bold", this.boldActive, toggleMark(schema.marks.strong)), this.createButton("italic", "Italic", this.italicsActive, toggleMark(schema.marks.em)), this.createButton("underline", "Underline", this.underlineActive, toggleMark(schema.marks.underline)), this.createButton("strikethrough", "Strikethrough", this.strikethroughActive, toggleMark(schema.marks.strikethrough)), this.createButton("superscript", "Superscript", this.superscriptActive, toggleMark(schema.marks.superscript)), this.createButton("subscript", "Subscript", this.subscriptActive, toggleMark(schema.marks.subscript)), -
- ]}, +
+ ]}
, this.createColorButton(), this.createHighlighterButton(), this.createLinkButton(), this.createBrushButton(), -
, +
, this.createButton("align-left", "Align Left", this.activeAlignment === "left", this.alignLeft), this.createButton("align-center", "Align Center", this.activeAlignment === "center", this.alignCenter), this.createButton("align-right", "Align Right", this.activeAlignment === "right", this.alignRight), @@ -907,20 +907,20 @@ export default class RichTextMenu extends AntimodeMenu { this.createButton("hand-point-right", "Indent", undefined, this.indentParagraph), ]}
; - const row2 =
+ const row2 =
{this.collapsed ? this.getDragger() : (null)} -
-
, +
+
, {[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size"), this.createMarksDropdown(this.activeFontFamily, this.fontFamilyOptions, "font family"), -
, +
, this.createNodesDropdown(this.activeListType, this.listTypeOptions, "nodes"), this.createButton("sort-amount-down", "Summarize", undefined, this.insertSummarizer), this.createButton("quote-left", "Blockquote", undefined, this.insertBlockquote), this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule), -
,]} +
,]}
-
+
{/*
+ return <> +

-

; - return fillButton; +

+ ; } @computed get fillPicker() { - const fillPicker =
+ return
{this._palette.map(color => { return
; - return fillPicker; } @computed get lineButton() { - const lineButton = <> -

-

; - return lineButton; + return <> + +
+
+ ; } @computed get linePicker() { - const linePicker =
+ return
{this._palette.map(color => { return
; - return linePicker; } @computed get widthInput() { const widthInput = <> this.onChange(e.target.value, "width")} - autoFocus>
@@ -672,8 +494,8 @@ export default class FormatShapePane extends AntimodeMenu { this.onChange(e.target.value, "sizeHeight")} - autoFocus> + onChange={e => this._currSizeHeight = e.target.value} + autoFocus /> -

+
-

+
+

+ -

- ; - return positionHorizontalInput; + ; } @computed get positionVerticalInput() { - const positionVerticalInput = - <> + this.onChange(e.target.value, "positionVertical")} + onChange={e => this._currPositionVertical = e.target.value} autoFocus> - -

- ; - return positionVerticalInput; - } - - //change inputs - @action - onChange = (val: string, property: string): void => { - if (!Number.isNaN(Number(val)) && Number(val) !== null && val !== " ") { - - switch (property) { - case "width": - this._currWidth = val; - if (val !== "") { - this.editProperties(this._currWidth, "width"); - } - break; - case "sizeHeight": - this._currSizeHeight = val; - if (val !== "") { - this.editProperties(this._currSizeHeight, "heightSize"); - } - break; - case "sizeWidth": - this._currSizeWidth = val; - if (val !== "") { - - this.editProperties(this._currSizeWidth, "widthSize"); - } - break; - case "rotation": - - this._currRotation = val; - if (val !== "") { - - this.rotate(Number(val)); - } - break; - case "positionHorizontal": - this._currPositionHorizontal = val; if (val !== "") { - - this.editProperties(this._currPositionHorizontal, "horizontal"); - } - - break; - case "positionVertical": - this._currPositionVertical = val; - if (val !== "") { - - this.editProperties(this._currPositionVertical, "vertical"); - } - - break; - default: - break; - } - } - } - - - @computed get widthPicker() { - var widthPicker = ; - if (this._widthBtn) { - widthPicker =
- {widthPicker} - {this._width.map(wid => { - return ; - })} -
; - } - return widthPicker; +

+ + ; } - - render() { const buttons = [ diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index e4f3248d0..0866db2be 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -25,19 +25,19 @@ library.add(faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSup export default class InkOptionsMenu extends AntimodeMenu { static Instance: InkOptionsMenu; - private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF", "none"]; + private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF", ""]; private _width = ["1", "5", "10", "100"]; // private _buttons = ["circle", "triangle", "rectangle", "arrow", "line"]; // private _icons = ["O", "∆", "ロ", "➜", "-"]; // private _buttons = ["circle", "triangle", "rectangle", "line", "noRec", "",]; // private _icons = ["O", "∆", "ロ", "⎯⎯⎯", "✖︎", " "]; //arrowStart and arrowEnd must match and defs must exist in Inking Stroke - // private _arrowStart = ["arrowHead", "arrowHead", "dot", "dot", "none"]; + // private _arrowStart = ["arrowStart", "arrowStart", "dot", "dot", "none"]; // private _arrowEnd = ["none", "arrowEnd", "none", "dot", "none"]; // private _arrowIcons = ["→", "↔︎", "•", "••", " "]; private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; - private _head = ["none", "none", "arrowHead", "none", "none", "arrowHead", "none", "none", "none"]; - private _end = ["none", "arrowEnd", "arrowEnd", "none", "arrowEnd", "arrowEnd", "none", "none", "none"]; + private _head = ["", "", "arrow", "", "", "arrow", "", "", ""]; + private _end = ["", "arrow", "arrow", "", "arrow", "arrow", "", "", ""]; private _shape = ["", "", "", "", "", "", "rectangle", "circle", "triangle"]; @observable _shapesNum = this._shape.length; @@ -122,12 +122,6 @@ export default class InkOptionsMenu extends AntimodeMenu { case "bezier": // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; break; - case "arrowStart": - doc.arrowStart = String(value); - break; - case "arrowEnd": - doc.arrowEnd = String(value); - break; case "dash": doc.dash = Number(value); default: @@ -165,13 +159,12 @@ export default class InkOptionsMenu extends AntimodeMenu { SetActiveArrowEnd(this._end[i]); SetActiveBezierApprox("300"); - // this.editProperties(this._head[i], "arrowStart"), this.editProperties(this._end[i], "arrowEnd"); GestureOverlay.Instance.InkShape = this._shape[i]; } else { this._selected = this._shapesNum; Doc.SetSelectedTool(InkTool.None); - SetActiveArrowStart("none"); - SetActiveArrowEnd("none"); + SetActiveArrowStart(""); + SetActiveArrowEnd(""); GestureOverlay.Instance.InkShape = ""; SetActiveBezierApprox("0"); @@ -189,13 +182,12 @@ export default class InkOptionsMenu extends AntimodeMenu { SetActiveArrowEnd(this._end[i]); SetActiveBezierApprox("300"); - // this.editProperties(this._head[i], "arrowStart"), this.editProperties(this._end[i], "arrowEnd"); GestureOverlay.Instance.InkShape = this._shape[i]; } else { this._selected = this._shapesNum; Doc.SetSelectedTool(InkTool.None); - SetActiveArrowStart("none"); - SetActiveArrowEnd("none"); + SetActiveArrowStart(""); + SetActiveArrowEnd(""); GestureOverlay.Instance.InkShape = ""; SetActiveBezierApprox("0"); diff --git a/src/client/views/nodes/ColorBox.tsx b/src/client/views/nodes/ColorBox.tsx index 137b387c0..31c5a8b13 100644 --- a/src/client/views/nodes/ColorBox.tsx +++ b/src/client/views/nodes/ColorBox.tsx @@ -14,7 +14,6 @@ import { ViewBoxBaseComponent } from "../DocComponent"; import { ActiveInkPen, ActiveInkWidth, ActiveInkBezierApprox, SetActiveInkColor, SetActiveInkWidth, SetActiveBezierApprox } from "../InkingStroke"; import "./ColorBox.scss"; import { FieldView, FieldViewProps } from './FieldView'; -import { FormattedTextBox } from "./formattedText/FormattedTextBox"; type ColorDocument = makeInterface<[typeof documentSchema]>; const ColorDocument = makeInterface(documentSchema); -- cgit v1.2.3-70-g09d2 From cef8f8d5fb9f5b9dc1f56768c4fa5ec406fbc6ba Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sat, 11 Jul 2020 20:02:55 -0400 Subject: fixed layout of inkOptionsMenu --- src/client/views/collections/collectionFreeForm/FormatShapePane.scss | 2 +- src/client/views/collections/collectionFreeForm/FormatShapePane.tsx | 4 ++-- 2 files changed, 3 insertions(+), 3 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss index 80a74fe4c..7720140b9 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss @@ -1,6 +1,6 @@ .antimodeMenu-button { width: 200px; - position: absolute; + position: relative; text-align: left; .color-previewI { diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 3a1c8b18d..095473330 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -136,7 +136,7 @@ export default class FormatShapePane extends AntimodeMenu { } @computed get close() { - return ; } @@ -320,7 +320,7 @@ export default class FormatShapePane extends AntimodeMenu { colorButton(value: string, setter: () => {}) { return <> - -- cgit v1.2.3-70-g09d2 From 49b6ab8536f570ef244199ac39194d3b176c9e77 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sat, 11 Jul 2020 20:47:55 -0400 Subject: added open formatting pane to inkOptions. switched to radio buttons for some options. changed names of stroke parameters to start with 'stroke" --- src/client/views/InkingStroke.tsx | 4 ++-- .../collectionFreeForm/FormatShapePane.tsx | 25 +++++++++++----------- .../collectionFreeForm/InkOptionsMenu.tsx | 17 +++++++++++---- src/client/views/nodes/ColorBox.tsx | 11 ++++++++-- 4 files changed, 37 insertions(+), 20 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index 46f714875..d7f956e4f 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -63,8 +63,8 @@ export class InkingStroke extends ViewBoxBaseComponent 5 ? strokeColor : "transparent", strokeWidth, (strokeWidth + 15), StrCast(this.layoutDoc.strokeBezier), StrCast(this.layoutDoc.fillColor, "transparent"), diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 095473330..77d1b646d 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -43,10 +43,10 @@ export default class FormatShapePane extends AntimodeMenu { @computed get _noFill() { return this.inks?.reduce((p, i) => p && !i.rootDoc.fillColor ? true : false, true) || false; } @computed get _solidFill() { return this.inks?.reduce((p, i) => p && i.rootDoc.fillColor ? true : false, true) || false; } @computed get _noLine() { return this.inks?.reduce((p, i) => p && !i.rootDoc.color ? true : false, true) || false; } - @computed get _solidLine() { return this.inks?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.dash || i.rootDoc.dash === "0") ? true : false, true) || false; } - @computed get _arrowStart() { return this.getField("arrowStart") || ""; } - @computed get _arrowEnd() { return this.getField("arrowEnd") || ""; } - @computed get _dashLine() { return !this._noLine && this.getField("dash") || ""; } + @computed get _solidLine() { return this.inks?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.strokeDash || i.rootDoc.strokeDash === "0") ? true : false, true) || false; } + @computed get _arrowStart() { return this.getField("strokeArrowStart") || ""; } + @computed get _arrowEnd() { return this.getField("strokeArrowEnd") || ""; } + @computed get _dashLine() { return !this._noLine && this.getField("strokeDash") || ""; } @computed get _currSizeHeight() { return this.getField("_height"); } @computed get _currSizeWidth() { return this.getField("_width"); } @computed get _currRotation() { return this.getField("rotation"); } @@ -59,13 +59,13 @@ export default class FormatShapePane extends AntimodeMenu { set _solidFill(value) { this._noFill = !value; } set _currFill(value) { value && (this._lastFill = value); this.inks?.forEach(i => i.rootDoc.fillColor = value ? value : undefined); } set _currColor(value) { value && (this._lastLine = value); this.inks?.forEach(i => i.rootDoc.color = value ? value : undefined); } - set _arrowStart(value) { this.inks?.forEach(i => i.rootDoc.arrowStart = value); } - set _arrowEnd(value) { this.inks?.forEach(i => i.rootDoc.arrowEnd = value); } + set _arrowStart(value) { this.inks?.forEach(i => i.rootDoc.strokeArrowStart = value); } + set _arrowEnd(value) { this.inks?.forEach(i => i.rootDoc.strokeArrowEnd = value); } set _noLine(value) { this._currColor = value ? "" : this._lastLine; } set _solidLine(value) { this._dashLine = ""; this._noLine = !value; } set _dashLine(value) { value && (this._lastDash = value) && (this._noLine = false); - this.inks?.forEach(i => i.rootDoc.dash = value ? this._lastDash : undefined); + this.inks?.forEach(i => i.rootDoc.strokeDash = value ? this._lastDash : undefined); } set _currXpos(value) { this.inks?.forEach(i => i.rootDoc.x = Number(value)); } set _currYpos(value) { this.inks?.forEach(i => i.rootDoc.y = Number(value)); } @@ -192,10 +192,10 @@ export default class FormatShapePane extends AntimodeMenu { @computed get subMenu() { const fillCheck =
- this._noFill = true)} /> + this._noFill = true)} /> No Fill
- this._solidFill = true)} /> + this._solidFill = true)} /> Solid Fill

@@ -214,13 +214,13 @@ export default class FormatShapePane extends AntimodeMenu { ; const lineCheck =
- this._noLine = true)} /> + this._noLine = true)} /> No Line
- this._solidLine = true)} /> + this._solidLine = true)} /> Solid Line
- this._dashLine = "2")} /> + this._dashLine = "2")} /> Dash Line

@@ -230,6 +230,7 @@ export default class FormatShapePane extends AntimodeMenu {
{(this._solidLine || this._dashLine) ? "Width" : ""} {(this._solidLine || this._dashLine) ? this.widthInput : ""} + {(this._solidLine || this._dashLine) ? this._currStrokeWidth = e.target.value} /> : (null)}

{(this._solidLine || this._dashLine) ? arrows : ""} diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index ddba8a66d..7f0bb5364 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -18,6 +18,7 @@ import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; import { faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSubscript, faSuperscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faSleigh, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve, } from "@fortawesome/free-solid-svg-icons"; import { Cast, StrCast, BoolCast } from "../../../../fields/Types"; +import FormatShapePane from "./FormatShapePane"; library.add(faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSuperscript, faSubscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve); @@ -40,7 +41,7 @@ export default class InkOptionsMenu extends AntimodeMenu { private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; private _head = ["", "", "arrow", "", "", "arrow", "", "", ""]; private _end = ["", "arrow", "arrow", "", "arrow", "arrow", "", "", ""]; - private _shape = ["", "", "", "", "", "", "rectangle", "circle", "triangle"]; + private _shape = ["line", "line", "line", "", "", "", "rectangle", "circle", "triangle"]; @observable _shapesNum = this._shape.length; @observable _selected = this._shapesNum; @@ -127,7 +128,7 @@ export default class InkOptionsMenu extends AntimodeMenu { // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; break; case "dash": - doc.dash = Number(value); + doc.strokeDash = Number(value); default: break; } @@ -144,7 +145,7 @@ export default class InkOptionsMenu extends AntimodeMenu { @action changeDash = (e: React.PointerEvent): void => { SetActiveDash(ActiveDash() === "0" ? "2" : "0"); - this.editProperties(ActiveDash(), "dash"); + this.editProperties(ActiveDash(), "strokeDash"); } @computed get drawButtons() { @@ -296,6 +297,14 @@ export default class InkOptionsMenu extends AntimodeMenu { } return colorPicker; } + @computed get formatPane() { + return ; + } @computed get fillPicker() { var fillPicker = - ]; // return this.getElement(buttons); diff --git a/src/client/views/nodes/ColorBox.tsx b/src/client/views/nodes/ColorBox.tsx index c35c52644..57028b0ca 100644 --- a/src/client/views/nodes/ColorBox.tsx +++ b/src/client/views/nodes/ColorBox.tsx @@ -14,6 +14,7 @@ import { ViewBoxBaseComponent } from "../DocComponent"; import { ActiveInkPen, ActiveInkWidth, ActiveInkBezierApprox, SetActiveInkColor, SetActiveInkWidth, SetActiveBezierApprox } from "../InkingStroke"; import "./ColorBox.scss"; import { FieldView, FieldViewProps } from './FieldView'; +import { DocumentType } from "../../documents/DocumentTypes"; type ColorDocument = makeInterface<[typeof documentSchema]>; const ColorDocument = makeInterface(documentSchema); @@ -62,9 +63,15 @@ export class ColorBox extends ViewBoxBaseComponent
{ActiveInkWidth() ?? 2}
- ) => SetActiveInkWidth(e.target.value)} /> + ) => { + SetActiveInkWidth(e.target.value); + SelectionManager.SelectedDocuments().filter(i => StrCast(i.rootDoc.type) === DocumentType.INK).map(i => i.rootDoc.strokeWidth = Number(e.target.value)); + }} />
{ActiveInkBezierApprox() ?? 2}
- ) => SetActiveBezierApprox(e.target.value)} /> + ) => { + SetActiveBezierApprox(e.target.value); + SelectionManager.SelectedDocuments().filter(i => StrCast(i.rootDoc.type) === DocumentType.INK).map(i => i.rootDoc.strokeBezier = e.target.value); + }} />

-- cgit v1.2.3-70-g09d2 From add9dfeec764b5a60a57344c79fd23a91c031a2d Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sun, 12 Jul 2020 10:31:06 -0400 Subject: final cleanup of names and structure of FormatShapePane --- src/client/views/InkingStroke.tsx | 2 +- .../collectionFreeForm/FormatShapePane.scss | 5 + .../collectionFreeForm/FormatShapePane.tsx | 404 +++++++++------------ .../collectionFreeForm/InkOptionsMenu.tsx | 9 +- 4 files changed, 182 insertions(+), 238 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/InkingStroke.tsx b/src/client/views/InkingStroke.tsx index d7f956e4f..abc698e62 100644 --- a/src/client/views/InkingStroke.tsx +++ b/src/client/views/InkingStroke.tsx @@ -63,7 +63,7 @@ export class InkingStroke extends ViewBoxBaseComponent 5 ? strokeColor : "transparent", strokeWidth, (strokeWidth + 15), diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss index 7720140b9..88876471c 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.scss +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.scss @@ -22,6 +22,11 @@ padding: 0; } +.formatShapePane-inputBtn { + width: inherit; + position: absolute; +} + .sketch-picker { background: #323232; diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 77d1b646d..56ba9e96a 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -1,18 +1,16 @@ import React = require("react"); -import AntimodeMenu from "../../AntimodeMenu"; +import { IconProp } from '@fortawesome/fontawesome-svg-core'; +import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; +import { action, computed, observable } from "mobx"; import { observer } from "mobx-react"; -import { observable, action, computed } from "mobx"; -import "./FormatShapePane.scss"; -import { Scripting } from "../../../util/Scripting"; -import { InkField } from "../../../../fields/InkField"; -import { Doc, Opt, Field } from "../../../../fields/Doc"; -import { SelectionManager } from "../../../util/SelectionManager"; -import { DocumentView } from "../../../views/nodes/DocumentView"; +import { Doc, Field, Opt } from "../../../../fields/Doc"; import { Document } from "../../../../fields/documentSchemas"; +import { InkField } from "../../../../fields/InkField"; +import { BoolCast, Cast, NumCast } from "../../../../fields/Types"; import { DocumentType } from "../../../documents/DocumentTypes"; -import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { IconProp } from '@fortawesome/fontawesome-svg-core'; -import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; +import { SelectionManager } from "../../../util/SelectionManager"; +import AntimodeMenu from "../../AntimodeMenu"; +import "./FormatShapePane.scss"; @observer export default class FormatShapePane extends AntimodeMenu { @@ -23,63 +21,62 @@ export default class FormatShapePane extends AntimodeMenu { private _lastDash = "2"; private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF"]; private _mode = ["fill-drip", "ruler-combined"]; - private _subMenu = ["fill", "line", "size", "position"]; @observable private _subOpen = [false, false, false, false]; - @observable private _currMode: string = "fill-drip"; + @observable private _currMode = "fill-drip"; @observable private _lock = false; @observable private _fillBtn = false; @observable private _lineBtn = false; getField(key: string) { - return this.inks?.reduce((p, i) => + return this.selectedInk?.reduce((p, i) => (p === undefined || (p && p === i.rootDoc[key])) && i.rootDoc[key] !== "0" ? Field.toString(i.rootDoc[key] as Field) : "", undefined as Opt) } - @computed get inks() { + @computed get selectedInk() { const inks = SelectionManager.SelectedDocuments().filter(i => Document(i.rootDoc).type === DocumentType.INK); return inks.length ? inks : undefined; } - @computed get _noFill() { return this.inks?.reduce((p, i) => p && !i.rootDoc.fillColor ? true : false, true) || false; } - @computed get _solidFill() { return this.inks?.reduce((p, i) => p && i.rootDoc.fillColor ? true : false, true) || false; } - @computed get _noLine() { return this.inks?.reduce((p, i) => p && !i.rootDoc.color ? true : false, true) || false; } - @computed get _solidLine() { return this.inks?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.strokeDash || i.rootDoc.strokeDash === "0") ? true : false, true) || false; } - @computed get _arrowStart() { return this.getField("strokeArrowStart") || ""; } - @computed get _arrowEnd() { return this.getField("strokeArrowEnd") || ""; } - @computed get _dashLine() { return !this._noLine && this.getField("strokeDash") || ""; } - @computed get _currSizeHeight() { return this.getField("_height"); } - @computed get _currSizeWidth() { return this.getField("_width"); } - @computed get _currRotation() { return this.getField("rotation"); } - @computed get _currXpos() { return this.getField("x"); } - @computed get _currYpos() { return this.getField("y"); } - @computed get _currStrokeWidth() { return this.getField("strokeWidth"); } - @computed get _currFill() { const cfill = this.getField("fillColor") || ""; cfill && (this._lastFill = cfill); return cfill; } - @computed get _currColor() { const ccol = this.getField("color") || ""; ccol && (this._lastLine = ccol); return ccol; } - set _noFill(value) { this._currFill = value ? "" : this._lastFill; } - set _solidFill(value) { this._noFill = !value; } - set _currFill(value) { value && (this._lastFill = value); this.inks?.forEach(i => i.rootDoc.fillColor = value ? value : undefined); } - set _currColor(value) { value && (this._lastLine = value); this.inks?.forEach(i => i.rootDoc.color = value ? value : undefined); } - set _arrowStart(value) { this.inks?.forEach(i => i.rootDoc.strokeArrowStart = value); } - set _arrowEnd(value) { this.inks?.forEach(i => i.rootDoc.strokeArrowEnd = value); } - set _noLine(value) { this._currColor = value ? "" : this._lastLine; } - set _solidLine(value) { this._dashLine = ""; this._noLine = !value; } - set _dashLine(value) { - value && (this._lastDash = value) && (this._noLine = false); - this.inks?.forEach(i => i.rootDoc.strokeDash = value ? this._lastDash : undefined); + @computed get unFilled() { return this.selectedInk?.reduce((p, i) => p && !i.rootDoc.fillColor ? true : false, true) || false; } + @computed get unStrokd() { return this.selectedInk?.reduce((p, i) => p && !i.rootDoc.color ? true : false, true) || false; } + @computed get solidFil() { return this.selectedInk?.reduce((p, i) => p && i.rootDoc.fillColor ? true : false, true) || false; } + @computed get solidStk() { return this.selectedInk?.reduce((p, i) => p && i.rootDoc.color && (!i.rootDoc.strokeDash || i.rootDoc.strokeDash === "0") ? true : false, true) || false; } + @computed get dashdStk() { return !this.unStrokd && this.getField("strokeDash") || ""; } + @computed get colorFil() { const ccol = this.getField("fillColor") || ""; ccol && (this._lastFill = ccol); return ccol; } + @computed get colorStk() { const ccol = this.getField("color") || ""; ccol && (this._lastLine = ccol); return ccol; } + @computed get widthStk() { return this.getField("strokeWidth") || "1"; } + @computed get markHead() { return this.getField("strokeStartMarker") || ""; } + @computed get markTail() { return this.getField("strokeEndMarker") || ""; } + @computed get shapeHgt() { return this.getField("_height"); } + @computed get shapeWid() { return this.getField("_width"); } + @computed get shapeXps() { return this.getField("x"); } + @computed get shapeYps() { return this.getField("y"); } + @computed get shapeRot() { return this.getField("rotation"); } + set unFilled(value) { this.colorFil = value ? "" : this._lastFill; } + set solidFil(value) { this.unFilled = !value; } + set colorFil(value) { value && (this._lastFill = value); this.selectedInk?.forEach(i => i.rootDoc.fillColor = value ? value : undefined); } + set colorStk(value) { value && (this._lastLine = value); this.selectedInk?.forEach(i => i.rootDoc.color = value ? value : undefined); } + set markHead(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeStartMarker = value); } + set markTail(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeEndMarker = value); } + set unStrokd(value) { this.colorStk = value ? "" : this._lastLine; } + set solidStk(value) { this.dashdStk = ""; this.unStrokd = !value; } + set dashdStk(value) { + value && (this._lastDash = value) && (this.unStrokd = false); + this.selectedInk?.forEach(i => i.rootDoc.strokeDash = value ? this._lastDash : undefined); } - set _currXpos(value) { this.inks?.forEach(i => i.rootDoc.x = Number(value)); } - set _currYpos(value) { this.inks?.forEach(i => i.rootDoc.y = Number(value)); } - set _currRotation(value) { this.inks?.forEach(i => i.rootDoc.rotation = Number(value)); } - set _currStrokeWidth(value) { this.inks?.forEach(i => i.rootDoc.strokeWidth = Number(value)); } - set _currSizeWidth(value) { - this.inks?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + set shapeXps(value) { this.selectedInk?.forEach(i => i.rootDoc.x = Number(value)); } + set shapeYps(value) { this.selectedInk?.forEach(i => i.rootDoc.y = Number(value)); } + set shapeRot(value) { this.selectedInk?.forEach(i => i.rootDoc.rotation = Number(value)); } + set widthStk(value) { this.selectedInk?.forEach(i => i.rootDoc.strokeWidth = Number(value)); } + set shapeWid(value) { + this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { const oldWidth = NumCast(i.rootDoc._width); i.rootDoc._width = Number(value); this._lock && (i.rootDoc._height = (i.rootDoc._width * NumCast(i.rootDoc._height)) / oldWidth); }); } - set _currSizeHeight(value) { - this.inks?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + set shapeHgt(value) { + this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { const oldHeight = NumCast(i.rootDoc._height); i.rootDoc._height = Number(value); this._lock && (i.rootDoc._width = (i.rootDoc._height * NumCast(i.rootDoc._width)) / oldHeight); @@ -90,72 +87,41 @@ export default class FormatShapePane extends AntimodeMenu { super(props); FormatShapePane.Instance = this; this._canFade = false; - this.Pinned = BoolCast(Doc.UserDoc()["formatShapePane-pinned"]); + this.Pinned = BoolCast(Doc.UserDoc()["menuFormatShape-pinned"]); } @action closePane = () => { - this.jumpTo(-300, -300); + this.fadeOut(false); this.Pinned = false; } @action upDownButtons = (dirs: string, field: string) => { switch (field) { - case "horizontal": this.inks?.forEach(i => i.rootDoc.x = NumCast(i.rootDoc.x) + (dirs === "up" ? 10 : -10)); break; - case "vertical": this.inks?.forEach(i => i.rootDoc.y = NumCast(i.rootDoc.y) + (dirs === "up" ? 10 : -10)); break; - case "rotation": this.rotate((dirs === "up" ? .1 : -.1)); break; - case "width": this.inks?.forEach(i => i.rootDoc.strokeWidth = NumCast(i.rootDoc.strokeWidth) + (dirs === "up" ? .1 : -.1)); break; - case "sizeWidth": - this.inks?.forEach(i => { - const doc = i.rootDoc; - if (doc._width && doc._height) { - const oldWidth = NumCast(doc._width); - const oldHeight = NumCast(doc._height); - doc._width = NumCast(doc._width) + (dirs === "up" ? 10 : - 10); - if (this._lock) { - doc._height = (NumCast(doc._width) * oldHeight) / oldWidth; - } - } - }); + case "rot": this.rotate((dirs === "up" ? .1 : -.1)); break; + case "Xps": this.selectedInk?.forEach(i => i.rootDoc.x = NumCast(i.rootDoc.x) + (dirs === "up" ? 10 : -10)); break; + case "Yps": this.selectedInk?.forEach(i => i.rootDoc.y = NumCast(i.rootDoc.y) + (dirs === "up" ? 10 : -10)); break; + case "stk": this.selectedInk?.forEach(i => i.rootDoc.strokeWidth = NumCast(i.rootDoc.strokeWidth) + (dirs === "up" ? .1 : -.1)); break; + case "wid": this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + const oldWidth = NumCast(i.rootDoc._width); + i.rootDoc._width = oldWidth + (dirs === "up" ? 10 : - 10); + this._lock && (i.rootDoc._height = (i.rootDoc._width / oldWidth * NumCast(i.rootDoc._height))); + }); break; - case "sizeHeight": - this.inks?.forEach(i => { - const doc = i.rootDoc; - if (doc._width && doc._height) { - const oldWidth = NumCast(doc._width); - const oldHeight = NumCast(doc._height); - doc._height = NumCast(doc._height) + (dirs === "up" ? 10 : - 10); - if (this._lock) { - doc._width = (NumCast(doc._height) * oldWidth) / oldHeight; - } - } - }); + case "hgt": this.selectedInk?.filter(i => i.rootDoc._width && i.rootDoc._height).forEach(i => { + const oldHeight = NumCast(i.rootDoc._height); + i.rootDoc._height = oldHeight + (dirs === "up" ? 10 : - 10); + this._lock && (i.rootDoc._width = (i.rootDoc._height / oldHeight * NumCast(i.rootDoc._width))); + }); break; } } - @computed get close() { - return ; - } - - //select either coor&fill or size&position - @computed get modes() { - return
- {this._mode.map(mode => - )} -
; - } - @action rotate = (degrees: number) => { - SelectionManager.SelectedDocuments().forEach(action((element: DocumentView) => { - const doc = Document(element.rootDoc); + this.selectedInk?.forEach(action(inkView => { + const doc = Document(inkView.rootDoc); if (doc.type === DocumentType.INK && doc.x && doc.y && doc._width && doc._height && doc.data) { const angle = Number(degrees) - Number(doc.rotation); doc.rotation = Number(degrees); @@ -183,117 +149,13 @@ export default class FormatShapePane extends AntimodeMenu { const top2 = Math.min(...ys2); const right2 = Math.max(...xs2); const bottom2 = Math.max(...ys2); - doc._height = (bottom2 - top2) * element.props.ScreenToLocalTransform().Scale; - doc._width = (right2 - left2) * element.props.ScreenToLocalTransform().Scale; + doc._height = (bottom2 - top2) * inkView.props.ScreenToLocalTransform().Scale; + doc._width = (right2 - left2) * inkView.props.ScreenToLocalTransform().Scale; } } })); } - @computed get subMenu() { - const fillCheck =
- this._noFill = true)} /> - No Fill -
- this._solidFill = true)} /> - Solid Fill -
-
- {this._solidFill ? "Color" : ""} - {this._solidFill ? this.fillButton : ""} - {this._fillBtn && this._solidFill ? this.fillPicker : ""} -
; - - const arrows = <> - this._arrowStart = this._arrowStart ? "" : "arrow")} /> - Arrow Head -
- this._arrowEnd = this._arrowEnd ? "" : "arrow")} /> - Arrow End -
- ; - - const lineCheck =
- this._noLine = true)} /> - No Line -
- this._solidLine = true)} /> - Solid Line -
- this._dashLine = "2")} /> - Dash Line -
-
- {(this._solidLine || this._dashLine) ? "Color" : ""} - {(this._solidLine || this._dashLine) ? this.lineButton : ""} - {this._lineBtn && (this._solidLine || this._dashLine) ? this.linePicker : ""} -
- {(this._solidLine || this._dashLine) ? "Width" : ""} - {(this._solidLine || this._dashLine) ? this.widthInput : ""} - {(this._solidLine || this._dashLine) ? this._currStrokeWidth = e.target.value} /> : (null)} -
-
- {(this._solidLine || this._dashLine) ? arrows : ""} -
; - - const sizeCheck =
- Height {this.sizeHeightInput} -
-
- - Width {this.sizeWidthInput} -
-
- - this._lock = !this._lock)} /> - Lock Ratio -
-
- - Rotation {this.rotationInput} -
-
-
; - - const positionCheck =
- Horizontal {this.positionHorizontalInput} -
-
- - Vertical {this.positionVerticalInput} -
-
-
; - - return
- {this._subMenu.map((subMenu, i) => { - if (subMenu === "fill" || subMenu === "line") { - return
- - {this._currMode === "fill-drip" && subMenu === "fill" && this._subOpen[0] ? fillCheck : ""} - {this._currMode === "fill-drip" && subMenu === "line" && this._subOpen[1] ? lineCheck : ""} -
; - } - else if (subMenu === "size" || subMenu === "position") { - return
- - {this._currMode === "ruler-combined" && subMenu === "size" && this._subOpen[2] ? sizeCheck : ""} - {this._currMode === "ruler-combined" && subMenu === "position" && this._subOpen[3] ? positionCheck : ""} -
; - } - })} -
; - } colorPicker(setter: (color: string) => {}) { return
@@ -325,37 +187,119 @@ export default class FormatShapePane extends AntimodeMenu {
-

-

+

; } - @computed get fillButton() { return this.colorButton(this._currFill, () => this._fillBtn = !this._fillBtn); } - @computed get lineButton() { return this.colorButton(this._currColor, () => this._lineBtn = !this._lineBtn); } + @computed get fillButton() { return this.colorButton(this.colorFil, () => this._fillBtn = !this._fillBtn); } + @computed get lineButton() { return this.colorButton(this.colorStk, () => this._lineBtn = !this._lineBtn); } - @computed get fillPicker() { return this.colorPicker((color: string) => this._currFill = color); } - @computed get linePicker() { return this.colorPicker((color: string) => this._currColor = color); } + @computed get fillPicker() { return this.colorPicker((color: string) => this.colorFil = color); } + @computed get linePicker() { return this.colorPicker((color: string) => this.colorStk = color); } - @computed get widthInput() { return this.inputBox("width", this._currStrokeWidth, (val: string) => this._currStrokeWidth = val); } - @computed get sizeHeightInput() { return this.inputBox("height", this._currSizeHeight, (val: string) => this._currSizeHeight = val); } - @computed get sizeWidthInput() { return this.inputBox("height", this._currSizeWidth, (val: string) => this._currSizeWidth = val); } - @computed get rotationInput() { return this.inputBox("rotation", this._currRotation, (val: string) => this._currRotation = val); } - @computed get positionHorizontalInput() { return this.inputBox("horizontal", this._currXpos, (val: string) => this._currXpos = val); } - @computed get positionVerticalInput() { return this.inputBox("vertical", this._currYpos, (val: string) => this._currYpos = val); } + @computed get stkInput() { return this.inputBox("stk", this.widthStk, (val: string) => this.widthStk = val); } + @computed get hgtInput() { return this.inputBox("hgt", this.shapeHgt, (val: string) => this.shapeHgt = val); } + @computed get widInput() { return this.inputBox("wid", this.shapeWid, (val: string) => this.shapeWid = val); } + @computed get rotInput() { return this.inputBox("rot", this.shapeRot, (val: string) => this.shapeRot = val); } + @computed get XpsInput() { return this.inputBox("Xps", this.shapeXps, (val: string) => this.shapeXps = val); } + @computed get YpsInput() { return this.inputBox("Yps", this.shapeYps, (val: string) => this.shapeYps = val); } - render() { - return this.getElementVert([this.close, this.modes, this.subMenu]); + @computed get propertyGroupItems() { + const fillCheck =
+ this.unFilled = true)} /> + No Fill +
+ this.solidFil = true)} /> + Solid Fill +

+ {this.solidFil ? "Color" : ""} + {this.solidFil ? this.fillButton : ""} + {this._fillBtn && this.solidFil ? this.fillPicker : ""} +
; + + const markers = <> + this.markHead = this.markHead ? "" : "arrow")} /> + Arrow Head +
+ this.markTail = this.markTail ? "" : "arrow")} /> + Arrow End +
+ ; + + const lineCheck =
+ this.unStrokd = true)} /> + No Line +
+ this.solidStk = true)} /> + Solid Line +
+ this.dashdStk = "2")} /> + Dash Line +
+
+ {(this.solidStk || this.dashdStk) ? "Color" : ""} + {(this.solidStk || this.dashdStk) ? this.lineButton : ""} + {(this.solidStk || this.dashdStk) && this._lineBtn ? this.linePicker : ""} +
+ {(this.solidStk || this.dashdStk) ? "Width" : ""} + {(this.solidStk || this.dashdStk) ? this.stkInput : ""} + {(this.solidStk || this.dashdStk) ? this.widthStk = e.target.value} /> : (null)} +

+ {(this.solidStk || this.dashdStk) ? markers : ""} +
; + + const sizeCheck =
+ Height {this.hgtInput} +

+ Width {this.widInput} +

+ this._lock = !this._lock)} /> + Lock Ratio +

+ Rotation {this.rotInput} +

+
; + + const positionCheck =
+ Horizontal {this.XpsInput} +

+ Vertical {this.YpsInput} +

+
; + + const subMenus = this._currMode === "fill-drip" ? [`fill`, `line`] : [`size`, `position`]; + const menuItems = this._currMode === "fill-drip" ? [fillCheck, lineCheck] : [sizeCheck, positionCheck]; + const indexOffset = this._currMode === "fill-drip" ? 0 : 2; + return
+ {subMenus.map((subMenu, i) => +
+ + {menuItems[i]} +
)} +
; + } + + @computed get closeBtn() { + return ; + } + + @computed get propertyGroupBtn() { + return
+ {this._mode.map(mode => + )} +
; } -} -Scripting.addGlobal(function activatePen2(penBtn: any) { - if (penBtn) { - //no longer changes to inkmode - // Doc.SetSelectedTool(InkTool.Pen); - FormatShapePane.Instance.jumpTo(300, 300); - FormatShapePane.Instance.Pinned = true; - } else { - // Doc.SetSelectedTool(InkTool.None); - FormatShapePane.Instance.Pinned = false; - FormatShapePane.Instance.fadeOut(true); + + render() { + return this.getElementVert([this.closeBtn, this.propertyGroupBtn, this.propertyGroupItems]); } -}); \ No newline at end of file +} \ No newline at end of file diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index 7f0bb5364..15707ad9e 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -62,13 +62,13 @@ export default class InkOptionsMenu extends AntimodeMenu { super(props); InkOptionsMenu.Instance = this; this._canFade = false; // don't let the inking menu fade away - this.Pinned = BoolCast(Doc.UserDoc()["inkOptionsMenu-pinned"]); + this.Pinned = BoolCast(Doc.UserDoc()["menuInkOptions-pinned"]); } @action toggleMenuPin = (e: React.MouseEvent) => { - Doc.UserDoc()["inkOptionsMenu-pinned"] = this.Pinned = !this.Pinned; + Doc.UserDoc()["menuInkOptions-pinned"] = this.Pinned = !this.Pinned; if (!this.Pinned) { // this.fadeOut(true); } @@ -426,15 +426,10 @@ export default class InkOptionsMenu extends AntimodeMenu { } Scripting.addGlobal(function activatePen(penBtn: any) { if (penBtn) { - //no longer changes to inkmode - // Doc.SetSelectedTool(InkTool.Pen); InkOptionsMenu.Instance.jumpTo(300, 300); InkOptionsMenu.Instance.Pinned = true; - } else { - // Doc.SetSelectedTool(InkTool.None); InkOptionsMenu.Instance.Pinned = false; InkOptionsMenu.Instance.fadeOut(true); - } }); -- cgit v1.2.3-70-g09d2 From c77f890a3ddd817738564a84046e65f0916d8a46 Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Sun, 12 Jul 2020 12:02:19 -0500 Subject: more tooltips --- src/client/views/DocumentButtonBar.tsx | 87 +++++++++++----------- src/client/views/DocumentDecorations.tsx | 41 +++++----- .../views/collections/CollectionLinearView.tsx | 23 +++--- src/client/views/nodes/DocumentLinksButton.tsx | 4 +- 4 files changed, 85 insertions(+), 70 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx index 1667b2f65..072648ef0 100644 --- a/src/client/views/DocumentButtonBar.tsx +++ b/src/client/views/DocumentButtonBar.tsx @@ -23,6 +23,7 @@ import { TemplateMenu } from "./TemplateMenu"; import { Template, Templates } from "./Templates"; import React = require("react"); import { DocumentLinksButton } from './nodes/DocumentLinksButton'; +import { Tooltip } from '@material-ui/core'; const higflyout = require("@hig/flyout"); export const { anchorPoints } = higflyout; export const Flyout = higflyout.default; @@ -118,18 +119,18 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV const targetDoc = this.view0?.props.Document; const published = targetDoc && Doc.GetProto(targetDoc)[GoogleRef] !== undefined; const animation = this.isAnimatingPulse ? "shadow-pulse 1s linear infinite" : "none"; - return !targetDoc ? (null) :
{ - await GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken(); - !published && runInAction(() => this.isAnimatingPulse = true); - DocumentButtonBar.hasPushedHack = false; - targetDoc[Pushes] = NumCast(targetDoc[Pushes]) + 1; - }}> - -
; + return !targetDoc ? (null) : +
{ + await GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken(); + !published && runInAction(() => this.isAnimatingPulse = true); + DocumentButtonBar.hasPushedHack = false; + targetDoc[Pushes] = NumCast(targetDoc[Pushes]) + 1; + }}> + +
; } @computed @@ -137,7 +138,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV const targetDoc = this.view0?.props.Document; const dataDoc = targetDoc && Doc.GetProto(targetDoc); const animation = this.isAnimatingFetch ? "spin 0.5s linear infinite" : "none"; - return !targetDoc || !dataDoc || !dataDoc[GoogleRef] ? (null) :
{ switch (this.openHover) { default: @@ -146,6 +147,7 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV case UtilityButtonState.OpenExternally: return "Open in new Browser Tab"; } })()} + >
{ if (e.altKey) { @@ -176,43 +178,43 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV dataDoc.unchanged && runInAction(() => this.isAnimatingFetch = true); } }}> - { - switch (this.openHover) { - default: - case UtilityButtonState.Default: return dataDoc.unchanged === false ? (this.pullIcon as any) : fetch; - case UtilityButtonState.OpenRight: return "arrow-alt-circle-right"; - case UtilityButtonState.OpenExternally: return "share"; - } - })()} - /> -
; + { + switch (this.openHover) { + default: + case UtilityButtonState.Default: return dataDoc.unchanged === false ? (this.pullIcon as any) : fetch; + case UtilityButtonState.OpenRight: return "arrow-alt-circle-right"; + case UtilityButtonState.OpenExternally: return "share"; + } + })()} + /> +
; } @computed get pinButton() { const targetDoc = this.view0?.props.Document; const isPinned = targetDoc && Doc.isDocPinned(targetDoc); - return !targetDoc ? (null) :
DockedFrameRenderer.PinDoc(targetDoc, isPinned)}> - -
; + return !targetDoc ? (null) : +
DockedFrameRenderer.PinDoc(targetDoc, isPinned)}> + +
; } @computed get metadataButton() { const view0 = this.view0; - return !view0 ? (null) :
+ return !view0 ? (null) :
this.props.views().filter(dv => dv).map(dv => dv!.props.Document)} suggestWithFunction /> /* tfs: @bcz This might need to be the data document? */}>
e.stopPropagation()} > {}
-
; +
; } @computed @@ -253,14 +255,15 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV Array.from(Object.values(Templates.TemplateList)).map(template => templates.set(template, views.reduce((checked, doc) => checked || doc?.props.Document["_show" + template.Name] ? true : false, false as boolean))); return !view0 ? (null) : -
- this._aliasDown = true)} onClose={action(() => this._aliasDown = false)} - content={!this._aliasDown ? (null) : v).map(v => v as DocumentView)} templates={templates} />}> -
- {} -
-
-
; + +
+ this._aliasDown = true)} onClose={action(() => this._aliasDown = false)} + content={!this._aliasDown ? (null) : v).map(v => v as DocumentView)} templates={templates} />}> +
+ {} +
+
+
; } render() { diff --git a/src/client/views/DocumentDecorations.tsx b/src/client/views/DocumentDecorations.tsx index 0bf4814e7..d7324e1a6 100644 --- a/src/client/views/DocumentDecorations.tsx +++ b/src/client/views/DocumentDecorations.tsx @@ -25,6 +25,7 @@ import { HtmlField } from '../../fields/HtmlField'; import { InkData, InkField, InkTool } from "../../fields/InkField"; import { update } from 'serializr'; import { Transform } from "../util/Transform"; +import { Tooltip } from '@material-ui/core'; library.add(faCaretUp); library.add(faObjectGroup); @@ -546,13 +547,15 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> } const minimal = bounds.r - bounds.x < 100 ? true : false; const maximizeIcon = minimal ? ( -
- -
) : ( -
- {/* Currently, this is set to be enabled if there is no ink selected. It might be interesting to think about minimizing ink if it's useful? -syip2*/} - -
); + +
+ +
) : ( + +
+ {/* Currently, this is set to be enabled if there is no ink selected. It might be interesting to think about minimizing ink if it's useful? -syip2*/} + +
); const titleArea = this._edtingTitle ? <> @@ -572,9 +575,9 @@ export class DocumentDecorations extends React.Component<{}, { value: string }>
} : <> - {minimal ? (null) :
+ {minimal ? (null) :
-
} +
}
{`${this.selectionTitle}`}
@@ -611,12 +614,13 @@ export class DocumentDecorations extends React.Component<{}, { value: string }> {maximizeIcon} {titleArea} {SelectionManager.SelectedDocuments().length !== 1 || seldoc.Document.type === DocumentType.INK ? (null) : -
- {"_"} -
} -
+ +
+ {"_"} +
} +
{SelectionManager.SelectedDocuments().length === 1 ? DocumentDecorations.DocumentIcon(StrCast(seldoc.props.Document.layout, "...")) : "..."} -
+
e.preventDefault()}>
{seldoc.props.renderDepth <= 1 || !seldoc.props.ContainingCollectionView ? (null) : -
e.preventDefault()}> - -
} + +
e.preventDefault()}> + +
}
e.preventDefault()}>
diff --git a/src/client/views/collections/CollectionLinearView.tsx b/src/client/views/collections/CollectionLinearView.tsx index 2dd48aa27..4c68cc949 100644 --- a/src/client/views/collections/CollectionLinearView.tsx +++ b/src/client/views/collections/CollectionLinearView.tsx @@ -111,17 +111,22 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) { const flexDir: any = StrCast(this.Document.flexDirection); const backgroundColor = StrCast(this.props.Document.backgroundColor, "black"); const color = StrCast(this.props.Document.color, "white"); + + const menuOpener = ; + return
- + + {menuOpener} + this.props.Document.linearViewIsExpanded = this.addMenuToggle.current!.checked)} /> diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 03a96ea4a..1c15b31de 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -64,6 +64,8 @@ export class DocumentLinksButton extends React.Component Doc.BrushDoc(this.props.View.Document)); DocumentLinksButton.StartLink = this.props.View; } else if (!!!this.props.InMenu) { + console.log("editing"); + this.props.View ? console.log("view") : null; DocumentLinksButton.EditLink = this.props.View; DocumentLinksButton.EditLinkLoc = [e.clientX + 10, e.clientY]; } @@ -159,7 +161,7 @@ export class DocumentLinksButton extends React.Component
Date: Sun, 12 Jul 2020 13:05:42 -0400 Subject: fixed stroke alignment with docked menus. fixed initializing InkingStrokes --- src/client/documents/Documents.ts | 14 ++--- src/client/views/GestureOverlay.tsx | 103 +++++++++++------------------------- src/client/views/MainView.tsx | 8 +-- src/fields/documentSchemas.ts | 3 ++ 4 files changed, 40 insertions(+), 88 deletions(-) (limited to 'src/client/views') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 26abd4c3c..72b716492 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -671,12 +671,12 @@ export namespace Docs { I.type = DocumentType.INK; I.layout = InkingStroke.LayoutString("data"); I.color = color; + I.fillColor = fillColor; I.strokeWidth = Number(strokeWidth); I.strokeBezier = strokeBezier; - I.fillColor = fillColor; - I.arrowStart = arrowStart; - I.arrowEnd = arrowEnd; - I.dash = dash; + I.strokeStartMarker = arrowStart; + I.strokeEndMarker = arrowEnd; + I.strokeDash = dash; I.tool = tool; I.title = "ink"; I.x = options.x; @@ -688,12 +688,6 @@ export namespace Docs { I.rotation = 0; I.data = new InkField(points); return I; - // return I; - // const doc = InstanceFromProto(Prototypes.get(DocumentType.INK), new InkField(points), options); - // doc.color = color; - // doc.strokeWidth = strokeWidth; - // doc.tool = tool; - // return doc; } export function PdfDocument(url: string, options: DocumentOptions = {}) { diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index fc8530811..768057c22 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -7,9 +7,8 @@ import { Cast, FieldValue, NumCast } from "../../fields/Types"; import MobileInkOverlay from "../../mobile/MobileInkOverlay"; import { GestureUtils } from "../../pen-gestures/GestureUtils"; import { MobileInkOverlayContent } from "../../server/Message"; -import { emptyFunction, emptyPath, returnEmptyString, returnFalse, returnOne, returnTrue, returnZero, returnEmptyFilter } from "../../Utils"; +import { emptyFunction, emptyPath, returnEmptyString, returnFalse, returnOne, returnTrue, returnZero, returnEmptyFilter, setupMoveUpEvents } from "../../Utils"; import { CognitiveServices } from "../cognitive_services/CognitiveServices"; -import { DocServer } from "../DocServer"; import { DocUtils } from "../documents/Documents"; import { CurrentUserUtils } from "../util/CurrentUserUtils"; import { InteractionUtils } from "../util/InteractionUtils"; @@ -23,7 +22,6 @@ import { RadialMenu } from "./nodes/RadialMenu"; import HorizontalPalette from "./Palette"; import { Touchable } from "./Touchable"; import TouchScrollableMenu, { TouchScrollableMenuItem } from "./TouchScrollableMenu"; -import HeightLabel from "./collections/collectionMulticolumn/MultirowHeightLabel"; import InkOptionsMenu from "./collections/collectionFreeForm/InkOptionsMenu"; @observer @@ -56,6 +54,7 @@ export default class GestureOverlay extends Touchable { @observable private showMobileInkOverlay: boolean = false; + private _overlayRef = React.createRef(); private _d1: Doc | undefined; private _inkToTextDoc: Doc | undefined; private _thumbDoc: Doc | undefined; @@ -498,39 +497,26 @@ export default class GestureOverlay extends Touchable { onPointerDown = (e: React.PointerEvent) => { if (InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (Doc.GetSelectedTool() === InkTool.Highlighter || Doc.GetSelectedTool() === InkTool.Pen)) { this._points.push({ X: e.clientX, Y: e.clientY }); - e.stopPropagation(); - e.preventDefault(); - - document.removeEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - document.addEventListener("pointermove", this.onPointerMove); - document.addEventListener("pointerup", this.onPointerUp); + setupMoveUpEvents(this, e, this.onPointerMove, this.onPointerUp, emptyFunction); } } @action onPointerMove = (e: PointerEvent) => { - if (InteractionUtils.IsType(e, InteractionUtils.PENTYPE) || (Doc.GetSelectedTool() === InkTool.Highlighter || Doc.GetSelectedTool() === InkTool.Pen)) { - this._points.push({ X: e.clientX, Y: e.clientY }); - e.stopPropagation(); - e.preventDefault(); - - - if (this._points.length > 1) { - const B = this.svgBounds; - const initialPoint = this._points[0.]; - const xInGlass = initialPoint.X > (this._thumbX ?? Number.MAX_SAFE_INTEGER) && initialPoint.X < (this._thumbX ?? Number.MAX_SAFE_INTEGER) + this.height; - const yInGlass = initialPoint.Y > (this._thumbY ?? Number.MAX_SAFE_INTEGER) - this.height && initialPoint.Y < (this._thumbY ?? Number.MAX_SAFE_INTEGER); - if (this.Tool !== ToolglassTools.None && xInGlass && yInGlass) { - switch (this.Tool) { - case ToolglassTools.RadialMenu: - document.removeEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - //this.handle1PointerHoldStart(e); - } + this._points.push({ X: e.clientX, Y: e.clientY }); + + if (this._points.length > 1) { + const B = this.svgBounds; + const initialPoint = this._points[0.]; + const xInGlass = initialPoint.X > (this._thumbX ?? Number.MAX_SAFE_INTEGER) && initialPoint.X < (this._thumbX ?? Number.MAX_SAFE_INTEGER) + this.height; + const yInGlass = initialPoint.Y > (this._thumbY ?? Number.MAX_SAFE_INTEGER) - this.height && initialPoint.Y < (this._thumbY ?? Number.MAX_SAFE_INTEGER); + if (this.Tool !== ToolglassTools.None && xInGlass && yInGlass) { + switch (this.Tool) { + case ToolglassTools.RadialMenu: return true; } } } + return false; } handleLineGesture = (): boolean => { @@ -589,8 +575,6 @@ export default class GestureOverlay extends Touchable { if (this.Tool !== ToolglassTools.None && xInGlass && yInGlass) { switch (this.Tool) { case ToolglassTools.InkToText: - document.removeEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); this._strokes.push(new Array(...this._points)); this._points = []; CognitiveServices.Inking.Appliers.InterpretStrokes(this._strokes).then((results) => { @@ -635,50 +619,27 @@ export default class GestureOverlay extends Touchable { let actionPerformed = false; if (result && result.Score > 0.7) { switch (result.Name) { - case GestureUtils.Gestures.Box: - this.dispatchGesture(GestureUtils.Gestures.Box); - actionPerformed = true; - break; - case GestureUtils.Gestures.StartBracket: - this.dispatchGesture(GestureUtils.Gestures.StartBracket); - actionPerformed = true; - break; - case GestureUtils.Gestures.EndBracket: - this.dispatchGesture("endbracket"); - actionPerformed = true; - break; - case GestureUtils.Gestures.Line: - actionPerformed = this.handleLineGesture(); - break; - case GestureUtils.Gestures.Triangle: - this.makePolygon("triangle", true); - break; - case GestureUtils.Gestures.Circle: - this.makePolygon("circle", true); - break; - case GestureUtils.Gestures.Rectangle: - this.makePolygon("rectangle", true); - break; - case GestureUtils.Gestures.Scribble: - console.log("scribble"); - break; - } - if (actionPerformed) { - this._points = []; + case GestureUtils.Gestures.Box: actionPerformed = this.dispatchGesture(GestureUtils.Gestures.Box); break; + case GestureUtils.Gestures.StartBracket: actionPerformed = this.dispatchGesture(GestureUtils.Gestures.StartBracket); break; + case GestureUtils.Gestures.EndBracket: actionPerformed = this.dispatchGesture("endbracket"); break; + case GestureUtils.Gestures.Line: actionPerformed = this.handleLineGesture(); break; + case GestureUtils.Gestures.Triangle: actionPerformed = this.makePolygon("triangle", true); break; + case GestureUtils.Gestures.Circle: actionPerformed = this.makePolygon("circle", true); break; + case GestureUtils.Gestures.Rectangle: actionPerformed = this.makePolygon("rectangle", true); break; + case GestureUtils.Gestures.Scribble: console.log("scribble"); break; } } // if no gesture (or if the gesture was unsuccessful), "dry" the stroke into an ink document if (!actionPerformed) { this.dispatchGesture(GestureUtils.Gestures.Stroke); - this._points = []; } + this._points = []; } } else { this._points = []; } //get out of ink mode after each stroke= - console.log("now"); if (InkOptionsMenu.Instance._double === "") { Doc.SetSelectedTool(InkTool.None); InkOptionsMenu.Instance._selected = InkOptionsMenu.Instance._shapesNum; @@ -687,9 +648,6 @@ export default class GestureOverlay extends Touchable { SetActiveArrowEnd("none"); GestureOverlay.Instance.SavedArrowEnd = ActiveArrowEnd(); } - document.removeEventListener("pointermove", this.onPointerMove); - document.removeEventListener("pointerup", this.onPointerUp); - } makePolygon = (shape: string, gesture: boolean) => { @@ -700,7 +658,7 @@ export default class GestureOverlay extends Touchable { var bottom = Math.max(...ys); var top = Math.min(...ys); if (shape === "noRec") { - return; + return false; } if (!gesture) { //if shape options is activated in inkOptionMenu @@ -781,11 +739,12 @@ export default class GestureOverlay extends Touchable { this._points.push({ X: x2, Y: y2 }); // this._points.push({ X: x1, Y: y1 - 1 }); } + return true; } dispatchGesture = (gesture: "box" | "line" | "startbracket" | "endbracket" | "stroke" | "scribble" | "text", stroke?: InkData, data?: any) => { const target = document.elementFromPoint((stroke ?? this._points)[0].X, (stroke ?? this._points)[0].Y); - target?.dispatchEvent( + return target?.dispatchEvent( new CustomEvent("dashOnGesture", { bubbles: true, @@ -797,7 +756,7 @@ export default class GestureOverlay extends Touchable { } } ) - ); + ) || false; } getBounds = (stroke: InkData) => { @@ -816,10 +775,11 @@ export default class GestureOverlay extends Touchable { @computed get elements() { const width = Number(ActiveInkWidth()); + const rect = this._overlayRef.current?.getBoundingClientRect(); const B = this.svgBounds; B.left = B.left - width / 2; B.right = B.right + width / 2; - B.top = B.top - width / 2; + B.top = B.top - width / 2 - (rect?.y || 0); B.bottom = B.bottom + width / 2; B.width += width; B.height += width; @@ -836,7 +796,7 @@ export default class GestureOverlay extends Touchable { }), this._points.length <= 1 ? (null) : - {InteractionUtils.CreatePolyline(this._points, B.left, B.top, ActiveInkColor(), width, width, ActiveInkBezierApprox(), ActiveFillColor(), ActiveArrowStart(), ActiveArrowEnd(), ActiveDash(), 1, 1, this.InkShape, "none", false, false)} + {InteractionUtils.CreatePolyline(this._points.map(p => ({ X: p.X, Y: p.Y - (rect?.y || 0) })), B.left, B.top, ActiveInkColor(), width, width, ActiveInkBezierApprox(), ActiveFillColor(), ActiveArrowStart(), ActiveArrowEnd(), ActiveDash(), 1, 1, this.InkShape, "none", false, false)} ] ]; } @@ -885,8 +845,7 @@ export default class GestureOverlay extends Touchable { render() { return ( - -
{this.showMobileInkOverlay ? : <>} {this.elements} diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index ab23a6ee9..b9ee58d5d 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -610,13 +610,9 @@ export class MainView extends React.Component { - - + + - - - - {this.mainContent} diff --git a/src/fields/documentSchemas.ts b/src/fields/documentSchemas.ts index 97f62c9d4..c1659d4d5 100644 --- a/src/fields/documentSchemas.ts +++ b/src/fields/documentSchemas.ts @@ -73,6 +73,9 @@ export const documentSchema = createSchema({ opacity: "number", // opacity of document strokeWidth: "number", strokeBezier: "number", + strokeStartMarker: "string", + strokeEndMarker: "string", + strokeDash: "string", textTransform: "string", treeViewOpen: "boolean", // flag denoting whether the documents sub-tree (contents) is visible or hidden treeViewExpandedView: "string", // name of field whose contents are being displayed as the document's subtree -- cgit v1.2.3-70-g09d2 From f159aa5378b433111d15d08ffe37d1e342958466 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sun, 12 Jul 2020 13:42:03 -0400 Subject: fixed display of linkMenu --- src/client/views/GestureOverlay.scss | 2 +- src/client/views/GestureOverlay.tsx | 2 +- src/client/views/MainView.tsx | 10 +++++----- src/client/views/linking/LinkMenu.scss | 2 +- src/client/views/linking/LinkMenu.tsx | 18 ++++++++++-------- src/client/views/nodes/DocumentLinksButton.tsx | 4 ++-- 6 files changed, 20 insertions(+), 18 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/GestureOverlay.scss b/src/client/views/GestureOverlay.scss index f61f4a05e..c9d78890e 100644 --- a/src/client/views/GestureOverlay.scss +++ b/src/client/views/GestureOverlay.scss @@ -1,7 +1,7 @@ .gestureOverlay-cont { width: 100vw; height: 100vh; - position: fixed; + position: relative; top: 0; left: 0; touch-action: none; diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index 768057c22..a48b7b673 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -845,7 +845,7 @@ export default class GestureOverlay extends Touchable { render() { return ( -
{this.showMobileInkOverlay ? : <>} {this.elements} diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index b9ee58d5d..92f1dfec0 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -612,16 +612,16 @@ export class MainView extends React.Component { - - {this.mainContent} - - - {LinkDescriptionPopup.descriptionPopup ? : null} {DocumentLinksButton.EditLink ? : (null)} {LinkDocPreview.LinkInfo ? : (null)} + + {this.mainContent} + + + diff --git a/src/client/views/linking/LinkMenu.scss b/src/client/views/linking/LinkMenu.scss index 1fa185150..3fb0ff517 100644 --- a/src/client/views/linking/LinkMenu.scss +++ b/src/client/views/linking/LinkMenu.scss @@ -3,7 +3,7 @@ .linkMenu { width: auto; height: auto; - + position: absolute; .linkMenu-list { diff --git a/src/client/views/linking/LinkMenu.tsx b/src/client/views/linking/LinkMenu.tsx index 234cd5e07..2d151e9bc 100644 --- a/src/client/views/linking/LinkMenu.tsx +++ b/src/client/views/linking/LinkMenu.tsx @@ -44,8 +44,8 @@ export class LinkMenu extends React.Component { LinkDocPreview.LinkInfo = undefined; - if (this._linkMenuRef && !!!this._linkMenuRef.current?.contains(e.target as any)) { - if (this._editorRef && !!!this._editorRef.current?.contains(e.target as any)) { + if (this._linkMenuRef && !this._linkMenuRef.current?.contains(e.target as any)) { + if (this._editorRef && !this._editorRef.current?.contains(e.target as any)) { console.log("outside click"); DocumentLinksButton.EditLink = undefined; } @@ -90,14 +90,16 @@ export class LinkMenu extends React.Component { const sourceDoc = this.props.docView.props.Document; const groups: Map = LinkManager.Instance.getRelatedGroupedLinks(sourceDoc); return
- {!this._editingLink ?
- {this.renderAllGroups(groups)} -
:
+ {!this._editingLink ?
+ {this.renderAllGroups(groups)} +
:
this._editingLink = undefined)} /> -
+
}
; diff --git a/src/client/views/nodes/DocumentLinksButton.tsx b/src/client/views/nodes/DocumentLinksButton.tsx index 1c15b31de..e6e4aa6c2 100644 --- a/src/client/views/nodes/DocumentLinksButton.tsx +++ b/src/client/views/nodes/DocumentLinksButton.tsx @@ -63,7 +63,7 @@ export class DocumentLinksButton extends React.Component Doc.BrushDoc(this.props.View.Document)); DocumentLinksButton.StartLink = this.props.View; - } else if (!!!this.props.InMenu) { + } else if (!this.props.InMenu) { console.log("editing"); this.props.View ? console.log("view") : null; DocumentLinksButton.EditLink = this.props.View; @@ -77,7 +77,7 @@ export class DocumentLinksButton extends React.Component Doc.BrushDoc(this.props.View.Document)); - } else if (!!!this.props.InMenu) { + } else if (!this.props.InMenu) { DocumentLinksButton.EditLink = this.props.View; DocumentLinksButton.EditLinkLoc = [e.clientX + 10, e.clientY]; } -- cgit v1.2.3-70-g09d2 From 9caf9edad5b6e739ca2b2a3bb045fadba0bed592 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sun, 12 Jul 2020 13:51:51 -0400 Subject: fixed positioning of linkMenu --- src/client/views/linking/LinkMenu.scss | 2 ++ 1 file changed, 2 insertions(+) (limited to 'src/client/views') diff --git a/src/client/views/linking/LinkMenu.scss b/src/client/views/linking/LinkMenu.scss index 3fb0ff517..b0edd238e 100644 --- a/src/client/views/linking/LinkMenu.scss +++ b/src/client/views/linking/LinkMenu.scss @@ -4,6 +4,8 @@ width: auto; height: auto; position: absolute; + top : 0; + left: 0; .linkMenu-list { -- cgit v1.2.3-70-g09d2 From 245fc10362e162492050328215dc0f38c0137eb6 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sun, 12 Jul 2020 14:22:03 -0400 Subject: fixed cheat sheet --- src/client/views/nodes/DocumentView.tsx | 2 +- src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts | 3 ++- 2 files changed, 3 insertions(+), 2 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index a97df3368..0a32b415f 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -849,7 +849,7 @@ export class DocumentView extends DocComponent(Docu const help = cm.findByDescription("Help..."); const helpItems: ContextMenuProps[] = help && "subitems" in help ? help.subitems : []; - helpItems.push({ description: "Text Shortcuts Ctrl+/", event: () => this.props.addDocTab(Docs.Create.PdfDocument("http://localhost:1050/assets/cheat-sheet.pdf", { _width: 300, _height: 300 }), "onRight"), icon: "keyboard" }); + helpItems.push({ description: "Text Shortcuts Ctrl+/", event: () => this.props.addDocTab(Docs.Create.PdfDocument(Utils.prepend("/assets/cheat-sheet.pdf"), { _width: 300, _height: 300 }), "onRight"), icon: "keyboard" }); helpItems.push({ description: "Show Fields ", event: () => this.props.addDocTab(Docs.Create.KVPDocument(this.props.Document, { _width: 300, _height: 300 }), "onRight"), icon: "layer-group" }); cm.addItem({ description: "Help...", subitems: helpItems, icon: "question" }); diff --git a/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts b/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts index 3f73ec436..172cde3e0 100644 --- a/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts +++ b/src/client/views/nodes/formattedText/ProsemirrorExampleTransfer.ts @@ -11,6 +11,7 @@ import { Doc, DataSym } from "../../../../fields/Doc"; import { FormattedTextBox } from "./FormattedTextBox"; import { Id } from "../../../../fields/FieldSymbols"; import { Docs } from "../../../documents/Documents"; +import { Utils } from "../../../../Utils"; const mac = typeof navigator !== "undefined" ? /Mac/.test(navigator.platform) : false; @@ -102,7 +103,7 @@ export default function buildKeymap>(schema: S, props: any //Command to create a new Tab with a PDF of all the command shortcuts bind("Mod-/", (state: EditorState, dispatch: (tx: Transaction) => void) => { - const newDoc = Docs.Create.PdfDocument("http://localhost:1050/assets/cheat-sheet.pdf", { _width: 300, _height: 300 }); + const newDoc = Docs.Create.PdfDocument(Utils.prepend("/assets/cheat-sheet.pdf"), { _width: 300, _height: 300 }); props.addDocTab(newDoc, "onRight"); }); -- cgit v1.2.3-70-g09d2 From 9f1ad8a6e9c1a2071b20907af1b2c8d5adc1a65c Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sun, 12 Jul 2020 14:53:51 -0400 Subject: changed enter link lable to accept Enter. cleaned up some link code. --- src/client/views/linking/LinkMenuItem.tsx | 38 ++++++++------- .../views/nodes/ContentFittingDocumentView.tsx | 2 - src/client/views/nodes/DocumentView.tsx | 56 +++++++--------------- src/client/views/nodes/LinkDescriptionPopup.tsx | 14 ++---- 4 files changed, 40 insertions(+), 70 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/linking/LinkMenuItem.tsx b/src/client/views/linking/LinkMenuItem.tsx index 9aa142728..b451f0168 100644 --- a/src/client/views/linking/LinkMenuItem.tsx +++ b/src/client/views/linking/LinkMenuItem.tsx @@ -17,6 +17,7 @@ import { DocumentLinksButton } from '../nodes/DocumentLinksButton'; import { LinkDocPreview } from '../nodes/LinkDocPreview'; import { Tooltip } from '@material-ui/core'; import { RichTextField } from '../../../fields/RichTextField'; +import { DocumentType } from '../../documents/DocumentTypes'; library.add(faEye, faEdit, faTimes, faArrowRight, faChevronDown, faChevronUp, faPencilAlt, faEyeSlash); @@ -188,31 +189,32 @@ export class LinkMenuItem extends React.Component { const eyeIcon = this.props.linkDoc.hidden ? "eye-slash" : "eye"; - const destinationIcon = this.props.destinationDoc.type === "image" ? "image" : - this.props.destinationDoc.type === "comparison" ? "columns" : - this.props.destinationDoc.type === "rtf" ? "font" : - this.props.destinationDoc.type === "collection" ? "folder" : - this.props.destinationDoc.type === "web" ? "globe-asia" : - this.props.destinationDoc.type === "screenshot" ? "photo-video" : - this.props.destinationDoc.type === "webcam" ? "video" : - this.props.destinationDoc.type === "audio" ? "microphone" : - this.props.destinationDoc.type === "button" ? "bolt" : - this.props.destinationDoc.type === "presentation" ? "tv" : - this.props.destinationDoc.type === "query" ? "search" : - this.props.destinationDoc.type === "script" ? "terminal" : - this.props.destinationDoc.type === "import" ? "cloud-upload-alt" : - this.props.destinationDoc.type === "docholder" ? "expand" : "question"; + let destinationIcon: string = "";; + switch (this.props.destinationDoc.type) { + case DocumentType.IMG: destinationIcon = "image"; break; + case DocumentType.COMPARISON: destinationIcon = "columns"; break; + case DocumentType.RTF: destinationIcon = "font"; break; + case DocumentType.COL: destinationIcon = "folder"; break; + case DocumentType.WEB: destinationIcon = "globe-asia"; break; + case DocumentType.SCREENSHOT: destinationIcon = "photo-video"; break; + case DocumentType.WEBCAM: destinationIcon = "video"; break; + case DocumentType.AUDIO: destinationIcon = "microphone"; break; + case DocumentType.BUTTON: destinationIcon = "bolt"; break; + case DocumentType.PRES: destinationIcon = "tv"; break; + case DocumentType.QUERY: destinationIcon = "search"; break; + case DocumentType.SCRIPTING: destinationIcon = "terminal"; break; + case DocumentType.IMPORT: destinationIcon = "cloud-upload-alt"; break; + case DocumentType.DOCHOLDER: destinationIcon = "expand"; break; + default: "question"; + } const title = StrCast(this.props.destinationDoc.title).length > 18 ? StrCast(this.props.destinationDoc.title).substr(0, 19) + "..." : this.props.destinationDoc.title; - - console.log(StrCast(this.props.destinationDoc.title).length); - // ... // from anika to bob: here's where the text that is specifically linked would show up (linkDoc.storedText) // ... - const source = this.props.sourceDoc.type === "rtf" ? this.props.linkDoc.storedText ? + const source = this.props.sourceDoc.type === DocumentType.RTF ? this.props.linkDoc.storedText ? StrCast(this.props.linkDoc.storedText).length > 17 ? StrCast(this.props.linkDoc.storedText).substr(0, 18) : this.props.linkDoc.storedText : undefined : undefined; diff --git a/src/client/views/nodes/ContentFittingDocumentView.tsx b/src/client/views/nodes/ContentFittingDocumentView.tsx index be72bf60c..6081def5d 100644 --- a/src/client/views/nodes/ContentFittingDocumentView.tsx +++ b/src/client/views/nodes/ContentFittingDocumentView.tsx @@ -2,7 +2,6 @@ import React = require("react"); import { computed } from "mobx"; import { observer } from "mobx-react"; import { Transform } from "nodemailer/lib/xoauth2"; -//import "react-table/react-table.css"; import { Doc, HeightSym, Opt, WidthSym } from "../../../fields/Doc"; import { ScriptField } from "../../../fields/ScriptField"; import { Cast, NumCast, StrCast } from "../../../fields/Types"; @@ -10,7 +9,6 @@ import { TraceMobx } from "../../../fields/util"; import { emptyFunction } from "../../../Utils"; import { dropActionType } from "../../util/DragManager"; import { CollectionView } from "../collections/CollectionView"; - import { DocumentView, DocumentViewProps } from "../nodes/DocumentView"; import "./ContentFittingDocumentView.scss"; diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 0a32b415f..2e492a865 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -639,59 +639,37 @@ export class DocumentView extends DocComponent(Docu alert("linking to document tabs not yet supported. Drop link on document content."); return; } + const makeLink = action((linkDoc: Doc) => { + LinkManager.currentLink = linkDoc; + linkDoc.hidden = true; + linkDoc.linkDisplay = true; + + LinkCreatedBox.popupX = de.x; + LinkCreatedBox.popupY = de.y - 33; + LinkCreatedBox.linkCreated = true; + + LinkDescriptionPopup.popupX = de.x; + LinkDescriptionPopup.popupY = de.y; + LinkDescriptionPopup.descriptionPopup = true; + + setTimeout(action(() => LinkCreatedBox.linkCreated = false), 2500); + }); if (de.complete.annoDragData) { /// this whole section for handling PDF annotations looks weird. Need to rethink this to make it cleaner e.stopPropagation(); de.complete.annoDragData.linkedToDoc = true; const linkDoc = DocUtils.MakeLink({ doc: de.complete.annoDragData.annotationDocument }, { doc: this.props.Document }, "link"); - LinkManager.currentLink = linkDoc; - linkDoc ? linkDoc.hidden = true : null; - linkDoc ? linkDoc.linkDisplay = true : null; - - runInAction(() => { - if (linkDoc) { - LinkCreatedBox.popupX = de.x; - LinkCreatedBox.popupY = de.y - 33; - LinkCreatedBox.linkCreated = true; - - LinkDescriptionPopup.popupX = de.x; - LinkDescriptionPopup.popupY = de.y; - LinkDescriptionPopup.descriptionPopup = true; - - setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); - } - }); + linkDoc && makeLink(linkDoc); } if (de.complete.linkDragData) { e.stopPropagation(); - // const docs = await SearchUtil.Search(`data_l:"${destDoc[Id]}"`, true); - // const views = docs.map(d => DocumentManager.Instance.getDocumentView(d)).filter(d => d).map(d => d as DocumentView); - if (de.complete.linkDragData.linkSourceDocument !== this.props.Document) { const linkDoc = DocUtils.MakeLink({ doc: de.complete.linkDragData.linkSourceDocument }, { doc: this.props.Document }, `link`); - LinkManager.currentLink = linkDoc; - linkDoc ? linkDoc.hidden = true : null; - linkDoc ? linkDoc.linkDisplay = true : null; - de.complete.linkDragData.linkSourceDocument !== this.props.Document && (de.complete.linkDragData.linkDocument = linkDoc); // TODODO this is where in text links get passed - runInAction(() => { - - if (linkDoc) { - LinkCreatedBox.popupX = de.x; - LinkCreatedBox.popupY = de.y - 33; - LinkCreatedBox.linkCreated = true; - - LinkDescriptionPopup.popupX = de.x; - LinkDescriptionPopup.popupY = de.y; - LinkDescriptionPopup.descriptionPopup = true; - - setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); - } - - }); + linkDoc && makeLink(linkDoc); } } diff --git a/src/client/views/nodes/LinkDescriptionPopup.tsx b/src/client/views/nodes/LinkDescriptionPopup.tsx index 3bb52d9fb..06e8d30d1 100644 --- a/src/client/views/nodes/LinkDescriptionPopup.tsx +++ b/src/client/views/nodes/LinkDescriptionPopup.tsx @@ -19,15 +19,7 @@ export class LinkDescriptionPopup extends React.Component<{}> { @action descriptionChanged = (e: React.ChangeEvent) => { - this.description = e.currentTarget.value; - } - - @action - setDescription = () => { - if (LinkManager.currentLink) { - LinkManager.currentLink.description = this.description; - } - LinkDescriptionPopup.descriptionPopup = false; + LinkManager.currentLink && (LinkManager.currentLink.description = e.currentTarget.value); } @action @@ -58,7 +50,7 @@ export class LinkDescriptionPopup extends React.Component<{}> { left: LinkDescriptionPopup.popupX ? LinkDescriptionPopup.popupX : 700, top: LinkDescriptionPopup.popupY ? LinkDescriptionPopup.popupY : 350, }}> - e.key === "Enter" && this.onDismiss()} placeholder={"(optional) enter link label..."} onChange={(e) => this.descriptionChanged(e)}> @@ -66,7 +58,7 @@ export class LinkDescriptionPopup extends React.Component<{}> {
Dismiss
Add
+ onPointerDown={this.onDismiss}> Add
; } -- cgit v1.2.3-70-g09d2 From c4ec1a6a5baff6574fe8236ad52386b7ea11057f Mon Sep 17 00:00:00 2001 From: anika-ahluwalia Date: Sun, 12 Jul 2020 16:19:50 -0500 Subject: norm's changes --- deploy/assets/endLink.png | Bin 0 -> 10322 bytes deploy/assets/link.png | Bin 0 -> 8790 bytes deploy/assets/startLink.png | Bin 0 -> 10538 bytes src/client/views/DocumentButtonBar.tsx | 5 +- src/client/views/MainView.tsx | 4 +- .../views/collections/CollectionLinearView.tsx | 2 +- src/client/views/nodes/DocumentLinksButton.scss | 19 ++- src/client/views/nodes/DocumentLinksButton.tsx | 129 +++++++++++++-------- 8 files changed, 101 insertions(+), 58 deletions(-) create mode 100644 deploy/assets/endLink.png create mode 100644 deploy/assets/link.png create mode 100644 deploy/assets/startLink.png (limited to 'src/client/views') diff --git a/deploy/assets/endLink.png b/deploy/assets/endLink.png new file mode 100644 index 000000000..abadc9550 Binary files /dev/null and b/deploy/assets/endLink.png differ diff --git a/deploy/assets/link.png b/deploy/assets/link.png new file mode 100644 index 000000000..2dbcd61ce Binary files /dev/null and b/deploy/assets/link.png differ diff --git a/deploy/assets/startLink.png b/deploy/assets/startLink.png new file mode 100644 index 000000000..8f3825682 Binary files /dev/null and b/deploy/assets/startLink.png differ diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx index 072648ef0..a3d24b3b6 100644 --- a/src/client/views/DocumentButtonBar.tsx +++ b/src/client/views/DocumentButtonBar.tsx @@ -274,7 +274,10 @@ export class DocumentButtonBar extends React.Component<{ views: () => (DocumentV const considerPush = isText && this.considerGoogleDocsPush; return
- + +
+
+
{this.templateButton} diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index 92f1dfec0..2ed528836 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -6,7 +6,7 @@ import { faCommentAlt, faCompressArrowsAlt, faCut, faEllipsisV, faEraser, faExclamation, faFileAlt, faFileAudio, faFilePdf, faFilm, faFilter, faFont, faGlobeAsia, faHighlighter, faLongArrowAltRight, faMicrophone, faMousePointer, faMusic, faObjectGroup, faPause, faPen, faPenNib, faPhone, faPlay, faPortrait, faRedoAlt, faStamp, faStickyNote, faTimesCircle, faThumbtack, faTree, faTv, faUndoAlt, faVideo, faAsterisk, faBrain, faImage, faPaintBrush, faTimes, faEye, faArrowsAlt, faQuoteLeft, faSortAmountDown, faAlignLeft, faAlignCenter, faAlignRight, - faHeading, faRulerCombined, faFillDrip + faHeading, faRulerCombined, faFillDrip, faUnlink } from '@fortawesome/free-solid-svg-icons'; import { ANTIMODEMENU_HEIGHT } from './globalCssVariables.scss'; import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; @@ -147,7 +147,7 @@ export class MainView extends React.Component { faCommentAlt, faCompressArrowsAlt, faCut, faEllipsisV, faEraser, faExclamation, faFileAlt, faFileAudio, faFilePdf, faFilm, faFilter, faFont, faGlobeAsia, faHighlighter, faLongArrowAltRight, faMicrophone, faMousePointer, faMusic, faObjectGroup, faPause, faPen, faPenNib, faPhone, faPlay, faPortrait, faRedoAlt, faStamp, faStickyNote, faTrashAlt, faAngleRight, faBell, faThumbtack, faTree, faTv, faUndoAlt, faVideo, faAsterisk, faBrain, faImage, faPaintBrush, faTimes, faEye, faArrowsAlt, faQuoteLeft, faSortAmountDown, faAlignLeft, faAlignCenter, faAlignRight, - faHeading, faRulerCombined, faFillDrip); + faHeading, faRulerCombined, faFillDrip, faUnlink); this.initEventListeners(); this.initAuthenticationRouters(); } diff --git a/src/client/views/collections/CollectionLinearView.tsx b/src/client/views/collections/CollectionLinearView.tsx index 4c68cc949..dd4df20c9 100644 --- a/src/client/views/collections/CollectionLinearView.tsx +++ b/src/client/views/collections/CollectionLinearView.tsx @@ -186,7 +186,7 @@ export class CollectionLinearView extends CollectionSubView(LinearDocument) { Exit + >Clear {/* { @@ -32,27 +33,30 @@ export class DocumentLinksButton extends React.Component { - if (this._linkButton.current !== null) { - const linkDrag = UndoManager.StartBatch("Drag Link"); - this.props.View && DragManager.StartLinkDrag(this._linkButton.current, this.props.View.props.Document, e.pageX, e.pageY, { - dragComplete: dropEv => { - const linkDoc = dropEv.linkDragData?.linkDocument as Doc; // equivalent to !dropEve.aborted since linkDocument is only assigned on a completed drop - if (this.props.View && linkDoc) { - !linkDoc.linkRelationship && (Doc.GetProto(linkDoc).linkRelationship = "hyperlink"); - - // we want to allow specific views to handle the link creation in their own way (e.g., rich text makes text hyperlinks) - // the dragged view can regiser a linkDropCallback to be notified that the link was made and to update their data structures - // however, the dropped document isn't so accessible. What we do is set the newly created link document on the documentView - // The documentView passes a function prop returning this link doc to its descendants who can react to changes to it. - dropEv.linkDragData?.linkDropCallback?.(dropEv.linkDragData); - runInAction(() => this.props.View._link = linkDoc); - setTimeout(action(() => this.props.View._link = undefined), 0); - } - linkDrag?.end(); - }, - hideSource: false - }); - return true; + if (this.props.InMenu && this.props.StartLink) { + if (this._linkButton.current !== null) { + const linkDrag = UndoManager.StartBatch("Drag Link"); + this.props.View && DragManager.StartLinkDrag(this._linkButton.current, this.props.View.props.Document, e.pageX, e.pageY, { + dragComplete: dropEv => { + const linkDoc = dropEv.linkDragData?.linkDocument as Doc; // equivalent to !dropEve.aborted since linkDocument is only assigned on a completed drop + if (this.props.View && linkDoc) { + !linkDoc.linkRelationship && (Doc.GetProto(linkDoc).linkRelationship = "hyperlink"); + + // we want to allow specific views to handle the link creation in their own way (e.g., rich text makes text hyperlinks) + // the dragged view can regiser a linkDropCallback to be notified that the link was made and to update their data structures + // however, the dropped document isn't so accessible. What we do is set the newly created link document on the documentView + // The documentView passes a function prop returning this link doc to its descendants who can react to changes to it. + dropEv.linkDragData?.linkDropCallback?.(dropEv.linkDragData); + runInAction(() => this.props.View._link = linkDoc); + setTimeout(action(() => this.props.View._link = undefined), 0); + } + linkDrag?.end(); + }, + hideSource: false + }); + return true; + } + return false; } return false; } @@ -60,7 +64,7 @@ export class DocumentLinksButton extends React.Component { setupMoveUpEvents(this, e, this.onLinkButtonMoved, emptyFunction, action((e, doubleTap) => { - if (doubleTap && this.props.InMenu) { + if (doubleTap && this.props.InMenu && this.props.StartLink) { //action(() => Doc.BrushDoc(this.props.View.Document)); DocumentLinksButton.StartLink = this.props.View; } else if (!this.props.InMenu) { @@ -74,7 +78,7 @@ export class DocumentLinksButton extends React.Component { - if (this.props.InMenu) { + if (this.props.InMenu && this.props.StartLink) { DocumentLinksButton.StartLink = this.props.View; //action(() => Doc.BrushDoc(this.props.View.Document)); } else if (!this.props.InMenu) { @@ -86,7 +90,7 @@ export class DocumentLinksButton extends React.Component { setupMoveUpEvents(this, e, returnFalse, emptyFunction, action((e, doubleTap) => { - if (doubleTap) { + if (doubleTap && this.props.InMenu && !!!this.props.StartLink) { if (DocumentLinksButton.StartLink === this.props.View) { DocumentLinksButton.StartLink = undefined; // action((e: React.PointerEvent) => { @@ -128,27 +132,29 @@ export class DocumentLinksButton extends React.Component { - if (linkDoc) { - LinkCreatedBox.popupX = e.screenX; - LinkCreatedBox.popupY = e.screenY - 133; - LinkCreatedBox.linkCreated = true; - - if (LinkDescriptionPopup.showDescriptions === "ON" || !LinkDescriptionPopup.showDescriptions) { - LinkDescriptionPopup.popupX = e.screenX; - LinkDescriptionPopup.popupY = e.screenY - 100; - LinkDescriptionPopup.descriptionPopup = true; - } + if (this.props.InMenu && !!!this.props.StartLink) { + if (DocumentLinksButton.StartLink && DocumentLinksButton.StartLink !== this.props.View) { + const linkDoc = DocUtils.MakeLink({ doc: DocumentLinksButton.StartLink.props.Document }, { doc: this.props.View.props.Document }, "long drag"); + LinkManager.currentLink = linkDoc; + linkDoc ? linkDoc.hidden = true : null; + linkDoc ? linkDoc.linkDisplay = true : null; + + runInAction(() => { + if (linkDoc) { + LinkCreatedBox.popupX = e.screenX; + LinkCreatedBox.popupY = e.screenY - 133; + LinkCreatedBox.linkCreated = true; + + if (LinkDescriptionPopup.showDescriptions === "ON" || !LinkDescriptionPopup.showDescriptions) { + LinkDescriptionPopup.popupX = e.screenX; + LinkDescriptionPopup.popupY = e.screenY - 100; + LinkDescriptionPopup.descriptionPopup = true; + } - setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); - } - }); + setTimeout(action(() => { LinkCreatedBox.linkCreated = false; }), 2500); + } + }); + } } } } @@ -161,11 +167,29 @@ export class DocumentLinksButton extends React.Component; + + const endLink = ; + + const link = ; const linkButton =
- {links.length && !!!this.props.InMenu ? links.length : } + {/* {this.props.InMenu ? this.props.StartLink ? : + : links.length} */} + + {/* {this.props.InMenu ? this.props.StartLink ? : + link : links.length} */} + + {this.props.InMenu ? this.props.StartLink ? startLink : + endLink : links.length}
- {DocumentLinksButton.StartLink && DocumentLinksButton.StartLink !== this.props.View ?
this.finishLinkClick(e)} /> : (null)} - {DocumentLinksButton.StartLink === this.props.View ?
: (null)}
; return (!links.length) && !this.props.AlwaysOn ? (null) : -- cgit v1.2.3-70-g09d2 From 0b0183de3a13649819983203e2aba1dc6b84fdb1 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Sun, 12 Jul 2020 23:34:34 -0400 Subject: fixed updating RichTextMenu with proper values for fontFamily, size, bullet, and alignment --- src/client/documents/Documents.ts | 2 +- src/client/util/CurrentUserUtils.ts | 15 +-- src/client/util/DragManager.ts | 2 +- src/client/views/animationtimeline/Timeline.tsx | 4 +- .../collectionFreeForm/CollectionFreeFormView.tsx | 2 +- .../collections/collectionFreeForm/MarqueeView.tsx | 2 +- src/client/views/nodes/DocumentView.tsx | 2 +- src/client/views/nodes/LabelBox.tsx | 2 +- src/client/views/nodes/SliderBox.tsx | 2 +- .../views/nodes/formattedText/FormattedTextBox.tsx | 7 +- .../views/nodes/formattedText/RichTextMenu.tsx | 111 ++++++++++++--------- .../views/nodes/formattedText/RichTextRules.ts | 2 +- src/fields/documentSchemas.ts | 2 +- 13 files changed, 88 insertions(+), 67 deletions(-) (limited to 'src/client/views') diff --git a/src/client/documents/Documents.ts b/src/client/documents/Documents.ts index 72b716492..a415e17c8 100644 --- a/src/client/documents/Documents.ts +++ b/src/client/documents/Documents.ts @@ -123,7 +123,7 @@ export interface DocumentOptions { isBackground?: boolean; isLinkButton?: boolean; _columnWidth?: number; - _fontSize?: number; + _fontSize?: string; _fontFamily?: string; curPage?: number; currentTimecode?: number; // the current timecode of a time-based document (e.g., current time of a video) value is in seconds diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index ce910c062..39781a5ce 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -211,7 +211,7 @@ export class CurrentUserUtils { details.text = new RichTextField(JSON.stringify(detailedTemplate), buxtonFieldKeys.join(" ")); const shared = { _chromeStatus: "disabled", _autoHeight: true, _xMargin: 0 }; - const detailViewOpts = { title: "detailView", _width: 300, _fontFamily: "Arial", _fontSize: 12 }; + const detailViewOpts = { title: "detailView", _width: 300, _fontFamily: "Arial", _fontSize: "12pt" }; const descriptionWrapperOpts = { title: "descriptions", _height: 300, _columnWidth: -1, treeViewHideTitle: true, _pivotField: "title" }; const descriptionWrapper = MasonryDocument([details, short, long], { ...shared, ...descriptionWrapperOpts }); @@ -525,13 +525,13 @@ export class CurrentUserUtils { // Sets up the title of the button static mobileButtonText = (opts: DocumentOptions, buttonTitle: string) => Docs.Create.TextDocument(buttonTitle, { ...opts, - dropAction: undefined, title: buttonTitle, _fontSize: 37, _xMargin: 0, _yMargin: 0, ignoreClick: true, _chromeStatus: "disabled", backgroundColor: "rgba(0,0,0,0)" + dropAction: undefined, title: buttonTitle, _fontSize: "37pt", _xMargin: 0, _yMargin: 0, ignoreClick: true, _chromeStatus: "disabled", backgroundColor: "rgba(0,0,0,0)" }) as any as Doc // Sets up the description of the button static mobileButtonInfo = (opts: DocumentOptions, buttonInfo: string) => Docs.Create.TextDocument(buttonInfo, { ...opts, - dropAction: undefined, title: "info", _fontSize: 25, _xMargin: 0, _yMargin: 0, ignoreClick: true, _chromeStatus: "disabled", backgroundColor: "rgba(0,0,0,0)", _dimMagnitude: 2, + dropAction: undefined, title: "info", _fontSize: "25pt", _xMargin: 0, _yMargin: 0, ignoreClick: true, _chromeStatus: "disabled", backgroundColor: "rgba(0,0,0,0)", _dimMagnitude: 2, }) as any as Doc @@ -598,7 +598,7 @@ export class CurrentUserUtils { _width: 500, lockedPosition: true, _chromeStatus: "disabled", title: "tools stack", forceActive: true })) as any as Doc; doc["tabs-button-tools"] = new PrefetchProxy(Docs.Create.ButtonDocument({ - _width: 35, _height: 25, title: "Tools", _fontSize: 10, + _width: 35, _height: 25, title: "Tools", _fontSize: "10pt", letterSpacing: "0px", textTransform: "unset", borderRounding: "5px 5px 0px 0px", boxShadow: "3px 3px 0px rgb(34, 34, 34)", sourcePanel: toolsStack, onDragStart: ScriptField.MakeFunction('getAlias(this.dragFactory, true)'), @@ -663,7 +663,7 @@ export class CurrentUserUtils { lockedPosition: true, boxShadow: "0 0", dontRegisterChildViews: true, targetDropAction: "same" })) as any as Doc; doc["tabs-button-library"] = new PrefetchProxy(Docs.Create.ButtonDocument({ - _width: 50, _height: 25, title: "Library", _fontSize: 10, targetDropAction: "same", + _width: 50, _height: 25, title: "Library", _fontSize: "10pt", targetDropAction: "same", letterSpacing: "0px", textTransform: "unset", borderRounding: "5px 5px 0px 0px", boxShadow: "3px 3px 0px rgb(34, 34, 34)", sourcePanel: libraryStack, onDragStart: ScriptField.MakeFunction('getAlias(this.dragFactory, true)'), @@ -681,7 +681,7 @@ export class CurrentUserUtils { static setupSearchBtnPanel(doc: Doc, sidebarContainer: Doc) { if (doc["tabs-button-search"] === undefined) { doc["tabs-button-search"] = new PrefetchProxy(Docs.Create.ButtonDocument({ - _width: 50, _height: 25, title: "Search", _fontSize: 10, + _width: 50, _height: 25, title: "Search", _fontSize: "10pt", letterSpacing: "0px", textTransform: "unset", borderRounding: "5px 5px 0px 0px", boxShadow: "3px 3px 0px rgb(34, 34, 34)", sourcePanel: new PrefetchProxy(Docs.Create.QueryDocument({ title: "search stack", })) as any as Doc, searchFileTypes: new List([DocumentType.RTF, DocumentType.IMG, DocumentType.PDF, DocumentType.VID, DocumentType.WEB, DocumentType.SCRIPTING]), @@ -824,7 +824,8 @@ export class CurrentUserUtils { doc.activeArrowStart = StrCast(doc.activeArrowStart, ""); doc.activeArrowEnd = StrCast(doc.activeArrowEnd, ""); doc.activeDash = StrCast(doc.activeDash, "0"); - doc.fontSize = NumCast(doc.fontSize, 12); + doc.fontSize = StrCast(doc.fontSize, "12pt"); + doc.fontFamily = StrCast(doc.fontFamily, "Arial"); doc["constants-snapThreshold"] = NumCast(doc["constants-snapThreshold"], 10); // doc["constants-dragThreshold"] = NumCast(doc["constants-dragThreshold"], 4); // Utils.DRAG_THRESHOLD = NumCast(doc["constants-dragThreshold"]); diff --git a/src/client/util/DragManager.ts b/src/client/util/DragManager.ts index 64c3d8458..5f34509a1 100644 --- a/src/client/util/DragManager.ts +++ b/src/client/util/DragManager.ts @@ -323,7 +323,7 @@ export namespace DragManager { dragLabel = document.createElement("div"); dragLabel.className = "dragManager-dragLabel"; dragLabel.style.zIndex = "100001"; - dragLabel.style.fontSize = "10"; + dragLabel.style.fontSize = "10pt"; dragLabel.style.position = "absolute"; // dragLabel.innerText = "press 'a' to embed on drop"; // bcz: need to move this to a status bar dragDiv.appendChild(dragLabel); diff --git a/src/client/views/animationtimeline/Timeline.tsx b/src/client/views/animationtimeline/Timeline.tsx index f54bd3aff..eac30ca75 100644 --- a/src/client/views/animationtimeline/Timeline.tsx +++ b/src/client/views/animationtimeline/Timeline.tsx @@ -385,10 +385,10 @@ export class Timeline extends React.Component { const ttime = `Total: ${this.toReadTime(this._time)}`; return (
-
+
{ctime}
-
+
{ttime}
diff --git a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx index 2191021d2..ef6ea8f99 100644 --- a/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx +++ b/src/client/views/collections/collectionFreeForm/CollectionFreeFormView.tsx @@ -1034,7 +1034,7 @@ export class CollectionFreeFormView extends CollectionSubView val === undefined) ? undefined : { ele:
diff --git a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx index b47236bea..2db665337 100644 --- a/src/client/views/collections/collectionFreeForm/MarqueeView.tsx +++ b/src/client/views/collections/collectionFreeForm/MarqueeView.tsx @@ -129,7 +129,7 @@ export class MarqueeView extends React.Component(Docu background: finalColor, opacity: finalOpacity, fontFamily: StrCast(this.Document._fontFamily, "inherit"), - fontSize: Cast(this.Document._fontSize, "number", null) + fontSize: Cast(this.Document._fontSize, "string", null) }}> {this.onClickHandler && this.props.ContainingCollectionView?.props.Document._viewType === CollectionViewType.Time ? <> {this.innards} diff --git a/src/client/views/nodes/LabelBox.tsx b/src/client/views/nodes/LabelBox.tsx index 360ead18e..836ef4149 100644 --- a/src/client/views/nodes/LabelBox.tsx +++ b/src/client/views/nodes/LabelBox.tsx @@ -67,7 +67,7 @@ export class LabelBox extends ViewBoxBaseComponent
this._editorView && RichTextMenu.Instance.updateFromDash(this._editorView, undefined, this.props), 0); - } else if (FormattedTextBoxComment.textBox === this) { + setTimeout(() => this._editorView && RichTextMenu.Instance.updateFromDash(this._editorView, undefined, this.props), this.props.isSelected() ? 10 : 0); // need to make sure that we update a text box that is selected after updating the one that was deselected + if (!this.props.isSelected() && FormattedTextBoxComment.textBox === this) { setTimeout(() => FormattedTextBoxComment.Hide(), 0); } const selPad = this.props.isSelected() ? -10 : 0; @@ -1376,7 +1375,7 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp opacity: this.props.hideOnLeave ? (this._entered ? 1 : 0.1) : 1, color: this.props.color ? this.props.color : StrCast(this.layoutDoc[this.props.fieldKey + "-color"], this.props.hideOnLeave ? "white" : "inherit"), pointerEvents: interactive ? undefined : "none", - fontSize: Cast(this.layoutDoc._fontSize, "number", null), + fontSize: Cast(this.layoutDoc._fontSize, "string", null), fontFamily: StrCast(this.layoutDoc._fontFamily, "inherit"), transition: "opacity 1s" }} diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx index 1a8a4ceb7..a70f879ff 100644 --- a/src/client/views/nodes/formattedText/RichTextMenu.tsx +++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx @@ -11,7 +11,7 @@ import { EditorState, NodeSelection, TextSelection } from "prosemirror-state"; import { EditorView } from "prosemirror-view"; import { Doc } from "../../../../fields/Doc"; import { DarkPastelSchemaPalette, PastelSchemaPalette } from '../../../../fields/SchemaHeaderField'; -import { Cast, StrCast, BoolCast } from "../../../../fields/Types"; +import { Cast, StrCast, BoolCast, NumCast } from "../../../../fields/Types"; import { unimplementedFunction, Utils } from "../../../../Utils"; import { DocServer } from "../../../DocServer"; import { LinkManager } from "../../../util/LinkManager"; @@ -112,6 +112,7 @@ export default class RichTextMenu extends AntimodeMenu { { node: schema.nodes.ordered_list.create({ mapStyle: "bullet" }), title: "Set list type", label: ":", command: this.changeListType }, { node: schema.nodes.ordered_list.create({ mapStyle: "decimal" }), title: "Set list type", label: "1.1", command: this.changeListType }, { node: schema.nodes.ordered_list.create({ mapStyle: "multi" }), title: "Set list type", label: "A.1", command: this.changeListType }, + { node: schema.nodes.ordered_list.create({ mapStyle: "" }), title: "Set list type", label: "", command: this.changeListType }, //{ node: undefined, title: "Set list type", label: "Remove", command: this.changeListType }, ]; @@ -217,7 +218,7 @@ export default class RichTextMenu extends AntimodeMenu { // finds font sizes and families in selection getActiveAlignment() { - if (this.view) { + if (this.view && this.TextView.props.isSelected()) { const path = (this.view.state.selection.$from as any).path; for (let i = path.length - 3; i < path.length && i >= 0; i -= 3) { if (path[i]?.type === this.view.state.schema.nodes.paragraph) { @@ -230,15 +231,18 @@ export default class RichTextMenu extends AntimodeMenu { // finds font sizes and families in selection getActiveListStyle() { - if (this.view) { + if (this.view && this.TextView.props.isSelected()) { const path = (this.view.state.selection.$from as any).path; for (let i = 0; i < path.length; i += 3) { if (path[i].type === this.view.state.schema.nodes.ordered_list) { return path[i].attrs.mapStyle; } } + if (this.view.state.selection.$from.nodeAfter?.type === this.view.state.schema.nodes.ordered_list) { + return this.view.state.selection.$from.nodeAfter?.attrs.mapStyle; + } } - return "decimal"; + return ""; } // finds font sizes and families in selection @@ -247,16 +251,21 @@ export default class RichTextMenu extends AntimodeMenu { const activeFamilies: string[] = []; const activeSizes: string[] = []; - const state = this.view.state; - const pos = this.view.state.selection.$from; - const ref_node = this.reference_node(pos); - if (ref_node && ref_node !== this.view.state.doc && ref_node.isText) { - ref_node.marks.forEach(m => { - m.type === state.schema.marks.pFontFamily && activeFamilies.push(m.attrs.family); - m.type === state.schema.marks.pFontSize && activeSizes.push(String(m.attrs.fontSize) + "pt"); - }); + if (this.TextView.props.isSelected()) { + const state = this.view.state; + const pos = this.view.state.selection.$from; + const ref_node = this.reference_node(pos); + if (ref_node && ref_node !== this.view.state.doc && ref_node.isText) { + ref_node.marks.forEach(m => { + m.type === state.schema.marks.pFontFamily && activeFamilies.push(m.attrs.family); + m.type === state.schema.marks.pFontSize && activeSizes.push(String(m.attrs.fontSize) + "pt"); + }); + } + !activeFamilies.length && (activeFamilies.push(StrCast(this.TextView.layoutDoc._fontFamily, StrCast(Doc.UserDoc().fontFamily)))); + !activeSizes.length && (activeSizes.push(StrCast(this.TextView.layoutDoc._fontSize, StrCast(Doc.UserDoc().fontSize)))); } - + !activeFamilies.length && (activeFamilies.push(StrCast(Doc.UserDoc().fontFamily))); + !activeSizes.length && (activeSizes.push(StrCast(Doc.UserDoc().fontSize))); return { activeFamilies, activeSizes }; } @@ -269,14 +278,14 @@ export default class RichTextMenu extends AntimodeMenu { //finds all active marks on selection in given group getActiveMarksOnSelection() { - if (!this.view) return; + let activeMarks: MarkType[] = []; + if (!this.view || !this.TextView.props.isSelected()) return activeMarks; const markGroup = [schema.marks.strong, schema.marks.em, schema.marks.underline, schema.marks.strikethrough, schema.marks.superscript, schema.marks.subscript]; if (this.view.state.storedMarks) return this.view.state.storedMarks.map(mark => mark.type); //current selection const { empty, ranges, $to } = this.view.state.selection as TextSelection; const state = this.view.state; - let activeMarks: MarkType[] = []; if (!empty) { activeMarks = markGroup.filter(mark => { const has = false; @@ -357,13 +366,9 @@ export default class RichTextMenu extends AntimodeMenu { createMarksDropdown(activeOption: string, options: { mark: Mark | null, title: string, label: string, command: (mark: Mark, view: EditorView) => void, hidden?: boolean, style?: {} }[], key: string): JSX.Element { const items = options.map(({ title, label, hidden, style }) => { if (hidden) { - return label === activeOption ? - : - ; + return ; } - return label === activeOption ? - : - ; + return ; }); const self = this; @@ -372,37 +377,42 @@ export default class RichTextMenu extends AntimodeMenu { e.preventDefault(); self.TextView.endUndoTypingBatch(); options.forEach(({ label, mark, command }) => { - if (e.target.value === label) { - UndoManager.RunInBatch(() => self.view && mark && command(mark, self.view), "text mark dropdown"); + if (e.target.value === label && mark) { + if (!self.TextView.props.isSelected()) { + switch (mark.type) { + case schema.marks.pFontFamily: Doc.UserDoc().fontFamily = mark.attrs.family; break; + case schema.marks.pFontSize: Doc.UserDoc().fontSize = mark.attrs.fontSize.toString() + "pt"; break; + } + } + else UndoManager.RunInBatch(() => self.view && mark && command(mark, self.view), "text mark dropdown"); } }); } - return ; + return ; } - createNodesDropdown(activeMap: string, options: { node: NodeType | any | null, title: string, label: string, command: (node: NodeType | any) => void, hidden?: boolean, style?: {} }[], key: string): JSX.Element { - const activeOption = activeMap === "bullet" ? ":" : activeMap === "decimal" ? "1.1" : "A.1"; + createNodesDropdown(activeMap: string, options: { node: NodeType | any | null, title: string, label: string, command: (node: NodeType | any) => void, hidden?: boolean, style?: {} }[], key: string, setter: (val: string) => {}): JSX.Element { + const activeOption = activeMap === "bullet" ? ":" : activeMap === "decimal" ? "1.1" : activeMap === "multi" ? "A.1" : ""; const items = options.map(({ title, label, hidden, style }) => { if (hidden) { - return label === activeOption ? - : - ; + return ; } - return label === activeOption ? - : - ; + return ; }); const self = this; function onChange(val: string) { self.TextView.endUndoTypingBatch(); options.forEach(({ label, node, command }) => { - if (val === label) { - UndoManager.RunInBatch(() => self.view && node && command(node), "nodes dropdown"); + if (val === label && node) { + if (self.TextView.props.isSelected()) { + UndoManager.RunInBatch(() => self.view && node && command(node), "nodes dropdown"); + setter(val); + } } }); } - return ; + return ; } changeFontSize = (mark: Mark, view: EditorView) => { @@ -416,10 +426,21 @@ export default class RichTextMenu extends AntimodeMenu { // TODO: remove doesn't work //remove all node type and apply the passed-in one to the selected text changeListType = (nodeType: Node | undefined) => { - if (!this.view) return; + if (!this.view || (nodeType as any)?.attrs.mapStyle === "") return; + + const nextIsOL = this.view.state.selection.$from.nodeAfter?.type === schema.nodes.ordered_list; + let inList: any = undefined; + let fromList = -1; + let path: any = Array.from((this.view.state.selection.$from as any).path); + for (let i = 0; i < path.length; i++) { + if (path[i]?.type === schema.nodes.ordered_list) { + inList = path[i]; + fromList = path[i - 1]; + } + } const marks = this.view.state.storedMarks || (this.view.state.selection.$to.parentOffset && this.view.state.selection.$from.marks()); - if (!wrapInList(schema.nodes.ordered_list)(this.view.state, (tx2: any) => { + if (inList || !wrapInList(schema.nodes.ordered_list)(this.view.state, (tx2: any) => { const tx3 = updateBullets(tx2, schema, nodeType && (nodeType as any).attrs.mapStyle, this.view!.state.selection.from - 1, this.view!.state.selection.to + 1); marks && tx3.ensureMarks([...marks]); marks && tx3.setStoredMarks([...marks]); @@ -427,12 +448,12 @@ export default class RichTextMenu extends AntimodeMenu { this.view!.dispatch(tx2); })) { const tx2 = this.view.state.tr; - if (nodeType && this.view.state.selection.$from.nodeAfter?.type === schema.nodes.ordered_list) { - const tx3 = updateBullets(tx2, schema, nodeType && (nodeType as any).attrs.mapStyle, this.view.state.selection.from, this.view.state.selection.to); + if (nodeType && (inList || nextIsOL)) { + const tx3 = updateBullets(tx2, schema, nodeType && (nodeType as any).attrs.mapStyle, inList ? fromList : this.view.state.selection.from, + inList ? fromList + inList.nodeSize : this.view.state.selection.to); marks && tx3.ensureMarks([...marks]); marks && tx3.setStoredMarks([...marks]); - - this.view.dispatch(tx3.setSelection(new NodeSelection(tx3.doc.resolve(this.view.state.selection.$from.pos)))); + this.view.dispatch(tx3); } } } @@ -448,13 +469,13 @@ export default class RichTextMenu extends AntimodeMenu { return true; } alignCenter = (state: EditorState, dispatch: any) => { - return this.alignParagraphs(state, "center", dispatch); + return this.TextView.props.isSelected() && this.alignParagraphs(state, "center", dispatch); } alignLeft = (state: EditorState, dispatch: any) => { - return this.alignParagraphs(state, "left", dispatch); + return this.TextView.props.isSelected() && this.alignParagraphs(state, "left", dispatch); } alignRight = (state: EditorState, dispatch: any) => { - return this.alignParagraphs(state, "right", dispatch); + return this.TextView.props.isSelected() && this.alignParagraphs(state, "right", dispatch); } alignParagraphs(state: EditorState, align: "left" | "right" | "center", dispatch: any) { @@ -914,7 +935,7 @@ export default class RichTextMenu extends AntimodeMenu { {[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size"), this.createMarksDropdown(this.activeFontFamily, this.fontFamilyOptions, "font family"),
, - this.createNodesDropdown(this.activeListType, this.listTypeOptions, "nodes"), + this.createNodesDropdown(this.activeListType, this.listTypeOptions, "nodes", action((val: string) => this.activeListType = val)), this.createButton("sort-amount-down", "Summarize", undefined, this.insertSummarizer), this.createButton("quote-left", "Blockquote", undefined, this.insertBlockquote), this.createButton("minus", "Horizontal Rule", undefined, this.insertHorizontalRule), diff --git a/src/client/views/nodes/formattedText/RichTextRules.ts b/src/client/views/nodes/formattedText/RichTextRules.ts index ca30dde9d..ef0fead4a 100644 --- a/src/client/views/nodes/formattedText/RichTextRules.ts +++ b/src/client/views/nodes/formattedText/RichTextRules.ts @@ -90,7 +90,7 @@ export class RichTextRules { textDoc.inlineTextCount = numInlines + 1; const inlineFieldKey = "inline" + numInlines; // which field on the text document this annotation will write to const inlineLayoutKey = "layout_" + inlineFieldKey; // the field holding the layout string that will render the inline annotation - const textDocInline = Docs.Create.TextDocument("", { layoutKey: inlineLayoutKey, _width: 75, _height: 35, annotationOn: textDoc, _autoHeight: true, _fontSize: 9, title: "inline comment" }); + const textDocInline = Docs.Create.TextDocument("", { layoutKey: inlineLayoutKey, _width: 75, _height: 35, annotationOn: textDoc, _autoHeight: true, _fontSize: "9pt", title: "inline comment" }); textDocInline.title = inlineFieldKey; // give the annotation its own title textDocInline.customTitle = true; // And make sure that it's 'custom' so that editing text doesn't change the title of the containing doc textDocInline.isTemplateForField = inlineFieldKey; // this is needed in case the containing text doc is converted to a template at some point diff --git a/src/fields/documentSchemas.ts b/src/fields/documentSchemas.ts index c1659d4d5..61a37ef8a 100644 --- a/src/fields/documentSchemas.ts +++ b/src/fields/documentSchemas.ts @@ -55,7 +55,7 @@ export const documentSchema = createSchema({ _columnsHideIfEmpty: "boolean", // whether empty stacking view column headings should be hidden _columnHeaders: listSpec(SchemaHeaderField), // header descriptions for stacking/masonry _schemaHeaders: listSpec(SchemaHeaderField), // header descriptions for schema views - _fontSize: "number", + _fontSize: "string", _fontFamily: "string", _sidebarWidthPercent: "string", // percent of text window width taken up by sidebar -- cgit v1.2.3-70-g09d2 From 0ec2faed931c2cbfe5f5de1ceb7486a1916e2559 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Mon, 13 Jul 2020 14:03:17 -0400 Subject: fixed fontfamil/size updating in menu bar (again). --- src/client/views/nodes/formattedText/RichTextMenu.tsx | 18 +++++++++--------- 1 file changed, 9 insertions(+), 9 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/nodes/formattedText/RichTextMenu.tsx b/src/client/views/nodes/formattedText/RichTextMenu.tsx index a70f879ff..8da1f99b5 100644 --- a/src/client/views/nodes/formattedText/RichTextMenu.tsx +++ b/src/client/views/nodes/formattedText/RichTextMenu.tsx @@ -363,7 +363,7 @@ export default class RichTextMenu extends AntimodeMenu { ); } - createMarksDropdown(activeOption: string, options: { mark: Mark | null, title: string, label: string, command: (mark: Mark, view: EditorView) => void, hidden?: boolean, style?: {} }[], key: string): JSX.Element { + createMarksDropdown(activeOption: string, options: { mark: Mark | null, title: string, label: string, command: (mark: Mark, view: EditorView) => void, hidden?: boolean, style?: {} }[], key: string, setter: (val: string) => {}): JSX.Element { const items = options.map(({ title, label, hidden, style }) => { if (hidden) { return ; @@ -380,24 +380,24 @@ export default class RichTextMenu extends AntimodeMenu { if (e.target.value === label && mark) { if (!self.TextView.props.isSelected()) { switch (mark.type) { - case schema.marks.pFontFamily: Doc.UserDoc().fontFamily = mark.attrs.family; break; - case schema.marks.pFontSize: Doc.UserDoc().fontSize = mark.attrs.fontSize.toString() + "pt"; break; + case schema.marks.pFontFamily: setter(Doc.UserDoc().fontFamily = mark.attrs.family); break; + case schema.marks.pFontSize: setter(Doc.UserDoc().fontSize = mark.attrs.fontSize.toString() + "pt"); break; } } else UndoManager.RunInBatch(() => self.view && mark && command(mark, self.view), "text mark dropdown"); } }); } - return ; + return ; } createNodesDropdown(activeMap: string, options: { node: NodeType | any | null, title: string, label: string, command: (node: NodeType | any) => void, hidden?: boolean, style?: {} }[], key: string, setter: (val: string) => {}): JSX.Element { const activeOption = activeMap === "bullet" ? ":" : activeMap === "decimal" ? "1.1" : activeMap === "multi" ? "A.1" : ""; const items = options.map(({ title, label, hidden, style }) => { if (hidden) { - return ; + return ; } - return ; + return ; }); const self = this; @@ -412,7 +412,7 @@ export default class RichTextMenu extends AntimodeMenu { } }); } - return ; + return ; } changeFontSize = (mark: Mark, view: EditorView) => { @@ -932,8 +932,8 @@ export default class RichTextMenu extends AntimodeMenu { {this.collapsed ? this.getDragger() : (null)}
, - {[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size"), - this.createMarksDropdown(this.activeFontFamily, this.fontFamilyOptions, "font family"), + {[this.createMarksDropdown(this.activeFontSize, this.fontSizeOptions, "font size", action((val: string) => this.activeFontSize = val)), + this.createMarksDropdown(this.activeFontFamily, this.fontFamilyOptions, "font family", action((val: string) => this.activeFontFamily = val)),
, this.createNodesDropdown(this.activeListType, this.listTypeOptions, "nodes", action((val: string) => this.activeListType = val)), this.createButton("sort-amount-down", "Summarize", undefined, this.insertSummarizer), -- cgit v1.2.3-70-g09d2 From 0e2a5196b47c05eab74d0aae06c2db4a9528f0fb Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Mon, 13 Jul 2020 20:44:03 -0400 Subject: switched context menus to be less hierarchical. --- src/client/util/CurrentUserUtils.ts | 2 - src/client/util/SettingsManager.scss | 2 +- src/client/util/SettingsManager.tsx | 14 ++++++- src/client/views/ContextMenuItem.tsx | 6 +++ .../views/collections/CollectionCarousel3DView.tsx | 13 +----- .../views/collections/CollectionCarouselView.tsx | 14 +------ .../views/collections/CollectionTreeView.tsx | 2 +- src/client/views/collections/CollectionView.tsx | 6 +-- .../collectionFreeForm/FormatShapePane.tsx | 26 ++++++------ .../collectionGrid/CollectionGridView.tsx | 5 +-- src/client/views/nodes/DocumentView.tsx | 38 ++++++++--------- src/client/views/nodes/ImageBox.tsx | 48 +++++++++++----------- src/client/views/nodes/LabelBox.tsx | 2 +- .../views/nodes/formattedText/FormattedTextBox.tsx | 48 +++++++++++----------- 14 files changed, 111 insertions(+), 115 deletions(-) (limited to 'src/client/views') diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 39781a5ce..048ab9edc 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -423,8 +423,6 @@ export class CurrentUserUtils { // { title: "use drag", icon: "mouse-pointer", click: 'deactivateInk();this.activeInkPen = this;', ischecked: `sameDocs(this.activeInkPen, this)`, backgroundColor: "white", activeInkPen: doc }, { title: "Drag a document previewer", label: "Prev", icon: "expand", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory,true)', dragFactory: doc.emptyDocHolder as Doc }, { title: "Toggle a Calculator REPL", label: "repl", icon: "calculator", click: 'addOverlayWindow("ScriptingRepl", { x: 300, y: 100, width: 200, height: 200, title: "Scripting REPL" })' }, - { title: "Connect a Google Account", label: "Google Account", icon: "external-link-alt", click: 'GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken(true)' }, - { title: "Connect a Hypothesis Account", label: "Hypothesis Account", icon: "heading", click: 'HypothesisAuthenticationManager.Instance.fetchOrGenerateAccessToken(true)' }, ]; } diff --git a/src/client/util/SettingsManager.scss b/src/client/util/SettingsManager.scss index 13c65042c..6d394a38d 100644 --- a/src/client/util/SettingsManager.scss +++ b/src/client/util/SettingsManager.scss @@ -56,7 +56,7 @@ .settings-type { display: flex; flex-direction: column; - flex-basis: 30%; + flex-basis: 45%; } diff --git a/src/client/util/SettingsManager.tsx b/src/client/util/SettingsManager.tsx index 9888cce48..f7ca3942b 100644 --- a/src/client/util/SettingsManager.tsx +++ b/src/client/util/SettingsManager.tsx @@ -11,6 +11,8 @@ import { Networking } from "../Network"; import { CurrentUserUtils } from "./CurrentUserUtils"; import { Utils } from "../../Utils"; import { Doc } from "../../fields/Doc"; +import HypothesisAuthenticationManager from "../apis/HypothesisAuthenticationManager"; +import GoogleAuthenticationManager from "../apis/GoogleAuthenticationManager"; library.add(fa.faWindowClose); @@ -83,6 +85,14 @@ export default class SettingsManager extends React.Component<{}> { noviceToggle = (event: any) => { Doc.UserDoc().noviceMode = !Doc.UserDoc().noviceMode; } + @action + googleAuthorize = (event: any) => { + GoogleAuthenticationManager.Instance.fetchOrGenerateAccessToken(true) + } + @action + hypothesisAuthorize = (event: any) => { + HypothesisAuthenticationManager.Instance.fetchAccessToken(true) + } private get settingsInterface() { return ( @@ -96,7 +106,9 @@ export default class SettingsManager extends React.Component<{}> {
- + + + diff --git a/src/client/views/ContextMenuItem.tsx b/src/client/views/ContextMenuItem.tsx index 99840047f..68ebd8e14 100644 --- a/src/client/views/ContextMenuItem.tsx +++ b/src/client/views/ContextMenuItem.tsx @@ -19,6 +19,7 @@ export interface OriginalMenuProps { export interface SubmenuProps { description: string; subitems: ContextMenuProps[]; + noexpand?: boolean; icon: IconProp; //maybe should be optional (icon?) closeMenu?: () => void; } @@ -96,6 +97,11 @@ export class ContextMenuItem extends React.Component {this._items.map(prop => )}
; + if (!("noexpand" in this.props)) { + return <> + {this._items.map(prop => )} + ; + } return (
diff --git a/src/client/views/collections/CollectionCarousel3DView.tsx b/src/client/views/collections/CollectionCarousel3DView.tsx index 1344b70f4..8f1cd5311 100644 --- a/src/client/views/collections/CollectionCarousel3DView.tsx +++ b/src/client/views/collections/CollectionCarousel3DView.tsx @@ -108,17 +108,6 @@ export class CollectionCarousel3DView extends CollectionSubView(Carousel3DDocume }, 1500); } - onContextMenu = (e: React.MouseEvent): void => { - // need to test if propagation has stopped because GoldenLayout forces a parallel react hierarchy to be created for its top-level layout - if (!e.isPropagationStopped()) { - ContextMenu.Instance.addItem({ - description: "Make Hero Image", event: () => { - const index = NumCast(this.layoutDoc._itemIndex); - (this.dataDoc || Doc.GetProto(this.props.Document)).hero = ObjectField.MakeCopy(this.childLayoutPairs[index].layout.data as ObjectField); - }, icon: "plus" - }); - } - } _downX = 0; _downY = 0; onPointerDown = (e: React.PointerEvent) => { @@ -184,7 +173,7 @@ export class CollectionCarousel3DView extends CollectionSubView(Carousel3DDocume const index = NumCast(this.layoutDoc._itemIndex); const translateX = (1 - index) / this.childLayoutPairs.length * 100; - return
+ return
{this.content}
diff --git a/src/client/views/collections/CollectionCarouselView.tsx b/src/client/views/collections/CollectionCarouselView.tsx index bd0e4fc9a..b3fecfb91 100644 --- a/src/client/views/collections/CollectionCarouselView.tsx +++ b/src/client/views/collections/CollectionCarouselView.tsx @@ -83,18 +83,6 @@ export class CollectionCarouselView extends CollectionSubView(CarouselDocument) ; } - - onContextMenu = (e: React.MouseEvent): void => { - // need to test if propagation has stopped because GoldenLayout forces a parallel react hierarchy to be created for its top-level layout - if (!e.isPropagationStopped()) { - ContextMenu.Instance?.addItem({ - description: "Make Hero Image", event: () => { - const index = NumCast(this.layoutDoc._itemIndex); - (this.dataDoc || Doc.GetProto(this.props.Document)).hero = ObjectField.MakeCopy(this.childLayoutPairs[index].layout.data as ObjectField); - }, icon: "plus" - }); - } - } _downX = 0; _downY = 0; onPointerDown = (e: React.PointerEvent) => { @@ -119,7 +107,7 @@ export class CollectionCarouselView extends CollectionSubView(CarouselDocument) } render() { - return
+ return
{this.content} {this.props.Document._chromeStatus !== "replaced" ? this.buttons : (null)}
; diff --git a/src/client/views/collections/CollectionTreeView.tsx b/src/client/views/collections/CollectionTreeView.tsx index 26c41f524..dbd39d8df 100644 --- a/src/client/views/collections/CollectionTreeView.tsx +++ b/src/client/views/collections/CollectionTreeView.tsx @@ -780,7 +780,7 @@ export class CollectionTreeView extends CollectionSubView UndoManager.RunInBatch(() => DocUtils.makeCustomViewClicked(this.doc, undefined, "onCheckedClick"), "edit onCheckedClick"), icon: "edit" }); - !existingOnClick && ContextMenu.Instance.addItem({ description: "OnClick...", subitems: onClicks, icon: "hand-point-right" }); + !existingOnClick && ContextMenu.Instance.addItem({ description: "OnClick...", noexpand: true, subitems: onClicks, icon: "hand-point-right" }); } outerXf = () => Utils.GetScreenTransform(this._mainEle!); onTreeDrop = (e: React.DragEvent) => this.onExternalDrop(e, {}); diff --git a/src/client/views/collections/CollectionView.tsx b/src/client/views/collections/CollectionView.tsx index df21d6a28..cbd1ac9af 100644 --- a/src/client/views/collections/CollectionView.tsx +++ b/src/client/views/collections/CollectionView.tsx @@ -272,7 +272,7 @@ export class CollectionView extends Touchable this._isLightboxOpen = true), icon: "eye" }); - !existingVm && ContextMenu.Instance.addItem({ description: category, subitems: subItems, icon: "eye" }); + !existingVm && ContextMenu.Instance.addItem({ description: category, noexpand: true, subitems: subItems, icon: "eye" }); } onContextMenu = (e: React.MouseEvent): void => { @@ -294,7 +294,7 @@ export class CollectionView extends Touchable this.props.addDocTab(this.props.Document.childClickedOpenTemplateView as Doc, "onRight"), icon: "project-diagram" }); } - layoutItems.push({ description: `${this.props.Document.isInPlaceContainer ? "Unset" : "Set"} inPlace Container`, event: () => this.props.Document.isInPlaceContainer = !this.props.Document.isInPlaceContainer, icon: "project-diagram" }); + !Doc.UserDoc().noviceMode && layoutItems.push({ description: `${this.props.Document.isInPlaceContainer ? "Unset" : "Set"} inPlace Container`, event: () => this.props.Document.isInPlaceContainer = !this.props.Document.isInPlaceContainer, icon: "project-diagram" }); !existing && cm.addItem({ description: "Options...", subitems: layoutItems, icon: "hand-point-right" }); @@ -314,7 +314,7 @@ export class CollectionView extends Touchable this.props.Document[StrCast(childClick.targetScriptKey)] = ObjectField.MakeCopy(ScriptCast(childClick.data)), })); - !existingOnClick && cm.addItem({ description: "OnClick...", subitems: onClicks, icon: "hand-point-right" }); + !existingOnClick && cm.addItem({ description: "OnClick...", noexpand: true, subitems: onClicks, icon: "hand-point-right" }); if (!Doc.UserDoc().noviceMode) { const more = cm.findByDescription("More..."); diff --git a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx index 56ba9e96a..9d9ce7f36 100644 --- a/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx +++ b/src/client/views/collections/collectionFreeForm/FormatShapePane.tsx @@ -11,6 +11,7 @@ import { DocumentType } from "../../../documents/DocumentTypes"; import { SelectionManager } from "../../../util/SelectionManager"; import AntimodeMenu from "../../AntimodeMenu"; import "./FormatShapePane.scss"; +import { undoBatch } from "../../../util/UndoManager"; @observer export default class FormatShapePane extends AntimodeMenu { @@ -118,6 +119,7 @@ export default class FormatShapePane extends AntimodeMenu { } } + @undoBatch @action rotate = (degrees: number) => { this.selectedInk?.forEach(action(inkView => { @@ -160,7 +162,7 @@ export default class FormatShapePane extends AntimodeMenu { colorPicker(setter: (color: string) => {}) { return
{this._palette.map(color => - )}
; @@ -171,11 +173,11 @@ export default class FormatShapePane extends AntimodeMenu { type="text" value={value} onChange={e => setter(e.target.value)} autoFocus /> -
- ; @@ -183,7 +185,7 @@ export default class FormatShapePane extends AntimodeMenu { colorButton(value: string, setter: () => {}) { return <> - @@ -206,10 +208,10 @@ export default class FormatShapePane extends AntimodeMenu { @computed get propertyGroupItems() { const fillCheck =
- this.unFilled = true)} /> + this.unFilled = true))} /> No Fill
- this.solidFil = true)} /> + this.solidFil = true))} /> Solid Fill

{this.solidFil ? "Color" : ""} @@ -218,22 +220,22 @@ export default class FormatShapePane extends AntimodeMenu {
; const markers = <> - this.markHead = this.markHead ? "" : "arrow")} /> + this.markHead = this.markHead ? "" : "arrow"))} /> Arrow Head
- this.markTail = this.markTail ? "" : "arrow")} /> + this.markTail = this.markTail ? "" : "arrow"))} /> Arrow End
; const lineCheck =
- this.unStrokd = true)} /> + this.unStrokd = true))} /> No Line
- this.solidStk = true)} /> + this.solidStk = true))} /> Solid Line
- this.dashdStk = "2")} /> + this.dashdStk = "2"))} /> Dash Line

@@ -253,7 +255,7 @@ export default class FormatShapePane extends AntimodeMenu {

Width {this.widInput}

- this._lock = !this._lock)} /> + this._lock = !this._lock))} /> Lock Ratio

Rotation {this.rotInput} diff --git a/src/client/views/collections/collectionGrid/CollectionGridView.tsx b/src/client/views/collections/collectionGrid/CollectionGridView.tsx index 2015ca930..188b88c41 100644 --- a/src/client/views/collections/collectionGrid/CollectionGridView.tsx +++ b/src/client/views/collections/collectionGrid/CollectionGridView.tsx @@ -1,7 +1,7 @@ import { action, computed, Lambda, observable, reaction } from 'mobx'; import { observer } from 'mobx-react'; import * as React from "react"; -import { Doc, Opt } from '../../../../fields/Doc'; +import { Doc, Opt, WidthSym } from '../../../../fields/Doc'; import { documentSchema } from '../../../../fields/documentSchemas'; import { Id } from '../../../../fields/FieldSymbols'; import { makeInterface } from '../../../../fields/Schema'; @@ -248,8 +248,7 @@ export class CollectionGridView extends CollectionSubView(GridSchema) { */ onContextMenu = () => { const displayOptionsMenu: ContextMenuProps[] = []; - displayOptionsMenu.push({ description: "Contents", event: () => this.props.Document.display = "contents", icon: "copy" }); - displayOptionsMenu.push({ description: "Undefined", event: () => this.props.Document.display = undefined, icon: "exclamation" }); + displayOptionsMenu.push({ description: "Toggle Content Display Style", event: () => this.props.Document.display = this.props.Document.display ? undefined : "contents", icon: "copy" }); ContextMenu.Instance.addItem({ description: "Display", subitems: displayOptionsMenu, icon: "tv" }); } diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index 6ef976ceb..a586e81d8 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -770,6 +770,7 @@ export class DocumentView extends DocComponent(Docu const options = cm.findByDescription("Options..."); const optionItems: ContextMenuProps[] = options && "subitems" in options ? options.subitems : []; const templateDoc = Cast(this.props.Document[StrCast(this.props.Document.layoutKey)], Doc, null); + optionItems.push({ description: this.Document.lockedPosition ? "Unlock Position" : "Lock Position", event: this.toggleLockPosition, icon: BoolCast(this.Document.lockedPosition) ? "unlock" : "lock" }); templateDoc && optionItems.push({ description: "Open Template ", event: () => this.props.addDocTab(templateDoc, "onRight"), icon: "eye" }); !options && cm.addItem({ description: "Options...", subitems: optionItems, icon: "compass" }); @@ -783,14 +784,14 @@ export class DocumentView extends DocComponent(Docu onClicks.push({ description: this.Document.isLinkButton ? "Remove Follow Behavior" : "Follow Link on Right", event: this.toggleFollowOnRight, icon: "concierge-bell" }); onClicks.push({ description: this.Document.isLinkButton || this.onClickHandler ? "Remove Click Behavior" : "Follow Link", event: this.toggleLinkButtonBehavior, icon: "concierge-bell" }); onClicks.push({ description: "Edit onClick Script", event: () => UndoManager.RunInBatch(() => DocUtils.makeCustomViewClicked(this.props.Document, undefined, "onClick"), "edit onClick"), icon: "edit" }); - !existingOnClick && cm.addItem({ description: "OnClick...", subitems: onClicks, icon: "hand-point-right" }); + !existingOnClick && cm.addItem({ description: "OnClick...", noexpand: true, subitems: onClicks, icon: "hand-point-right" }); const funcs: ContextMenuProps[] = []; if (this.layoutDoc.onDragStart) { funcs.push({ description: "Drag an Alias", icon: "edit", event: () => this.Document.dragFactory && (this.layoutDoc.onDragStart = ScriptField.MakeFunction('getAlias(this.dragFactory)')) }); funcs.push({ description: "Drag a Copy", icon: "edit", event: () => this.Document.dragFactory && (this.layoutDoc.onDragStart = ScriptField.MakeFunction('getCopy(this.dragFactory, true)')) }); funcs.push({ description: "Drag Document", icon: "edit", event: () => this.layoutDoc.onDragStart = undefined }); - cm.addItem({ description: "OnDrag...", subitems: funcs, icon: "asterisk" }); + cm.addItem({ description: "OnDrag...", noexpand: true, subitems: funcs, icon: "asterisk" }); } const more = cm.findByDescription("More..."); @@ -817,29 +818,28 @@ export class DocumentView extends DocComponent(Docu // a.download = `DocExport-${this.props.Document[Id]}.zip`; // a.click(); }); + moreItems.push({ description: "Copy ID", event: () => Utils.CopyText(Utils.prepend("/doc/" + this.props.Document[Id])), icon: "fingerprint" }); } - moreItems.push({ description: this.Document.lockedPosition ? "Unlock Position" : "Lock Position", event: this.toggleLockPosition, icon: BoolCast(this.Document.lockedPosition) ? "unlock" : "lock" }); - moreItems.push({ description: "Copy ID", event: () => Utils.CopyText(Utils.prepend("/doc/" + this.props.Document[Id])), icon: "fingerprint" }); moreItems.push({ description: "Delete", event: this.deleteClicked, icon: "trash" }); moreItems.push({ description: "Share", event: () => SharingManager.Instance.open(this), icon: "external-link-alt" }); !more && cm.addItem({ description: "More...", subitems: moreItems, icon: "hand-point-right" }); cm.moveAfter(cm.findByDescription("More...")!, cm.findByDescription("OnClick...")!); - const help = cm.findByDescription("Help..."); - const helpItems: ContextMenuProps[] = help && "subitems" in help ? help.subitems : []; - helpItems.push({ description: "Text Shortcuts Ctrl+/", event: () => this.props.addDocTab(Docs.Create.PdfDocument(Utils.prepend("/assets/cheat-sheet.pdf"), { _width: 300, _height: 300 }), "onRight"), icon: "keyboard" }); - helpItems.push({ description: "Show Fields ", event: () => this.props.addDocTab(Docs.Create.KVPDocument(this.props.Document, { _width: 300, _height: 300 }), "onRight"), icon: "layer-group" }); - cm.addItem({ description: "Help...", subitems: helpItems, icon: "question" }); - - const existingAcls = cm.findByDescription("Privacy..."); - const aclItems: ContextMenuProps[] = existingAcls && "subitems" in existingAcls ? existingAcls.subitems : []; - aclItems.push({ description: "Make Add Only", event: () => this.setAcl("addOnly"), icon: "concierge-bell" }); - aclItems.push({ description: "Make Read Only", event: () => this.setAcl("readOnly"), icon: "concierge-bell" }); - aclItems.push({ description: "Make Private", event: () => this.setAcl("ownerOnly"), icon: "concierge-bell" }); - aclItems.push({ description: "Make Editable", event: () => this.setAcl("write"), icon: "concierge-bell" }); - aclItems.push({ description: "Test Private", event: () => this.testAcl("ownerOnly"), icon: "concierge-bell" }); - aclItems.push({ description: "Test Readonly", event: () => this.testAcl("readOnly"), icon: "concierge-bell" }); - !existingAcls && cm.addItem({ description: "Privacy...", subitems: aclItems, icon: "question" }); + // const help = cm.findByDescription("Help..."); + // const helpItems: ContextMenuProps[] = help && "subitems" in help ? help.subitems : []; + // helpItems.push({ description: "Text Shortcuts Ctrl+/", event: () => this.props.addDocTab(Docs.Create.PdfDocument(Utils.prepend("/assets/cheat-sheet.pdf"), { _width: 300, _height: 300 }), "onRight"), icon: "keyboard" }); + // helpItems.push({ description: "Show Fields ", event: () => this.props.addDocTab(Docs.Create.KVPDocument(this.props.Document, { _width: 300, _height: 300 }), "onRight"), icon: "layer-group" }); + // cm.addItem({ description: "Help...", subitems: helpItems, icon: "question" }); + + // const existingAcls = cm.findByDescription("Privacy..."); + // const aclItems: ContextMenuProps[] = existingAcls && "subitems" in existingAcls ? existingAcls.subitems : []; + // aclItems.push({ description: "Make Add Only", event: () => this.setAcl("addOnly"), icon: "concierge-bell" }); + // aclItems.push({ description: "Make Read Only", event: () => this.setAcl("readOnly"), icon: "concierge-bell" }); + // aclItems.push({ description: "Make Private", event: () => this.setAcl("ownerOnly"), icon: "concierge-bell" }); + // aclItems.push({ description: "Make Editable", event: () => this.setAcl("write"), icon: "concierge-bell" }); + // aclItems.push({ description: "Test Private", event: () => this.testAcl("ownerOnly"), icon: "concierge-bell" }); + // aclItems.push({ description: "Test Readonly", event: () => this.testAcl("readOnly"), icon: "concierge-bell" }); + // !existingAcls && cm.addItem({ description: "Privacy...", subitems: aclItems, icon: "question" }); // const recommender_subitems: ContextMenuProps[] = []; diff --git a/src/client/views/nodes/ImageBox.tsx b/src/client/views/nodes/ImageBox.tsx index d16aa528c..4eba21eab 100644 --- a/src/client/views/nodes/ImageBox.tsx +++ b/src/client/views/nodes/ImageBox.tsx @@ -157,29 +157,31 @@ export class ImageBox extends ViewBoxAnnotatableComponent GooglePhotos.Transactions.UploadImages([this.props.Document]), icon: "caret-square-right" }); - funcs.push({ description: "Copy path", event: () => Utils.CopyText(field.url.href), icon: "expand-arrows-alt" }); - // funcs.push({ - // description: "Reset Native Dimensions", event: action(async () => { - // const curNW = NumCast(this.dataDoc[this.fieldKey + "-nativeWidth"]); - // const curNH = NumCast(this.dataDoc[this.fieldKey + "-nativeHeight"]); - // if (this.props.PanelWidth() / this.props.PanelHeight() > curNW / curNH) { - // this.dataDoc[this.fieldKey + "-nativeWidth"] = this.props.PanelHeight() * curNW / curNH; - // this.dataDoc[this.fieldKey + "-nativeHeight"] = this.props.PanelHeight(); - // } else { - // this.dataDoc[this.fieldKey + "-nativeWidth"] = this.props.PanelWidth(); - // this.dataDoc[this.fieldKey + "-nativeHeight"] = this.props.PanelWidth() * curNH / curNW; - // } - // }), icon: "expand-arrows-alt" - // }); - - const existingAnalyze = ContextMenu.Instance?.findByDescription("Analyzers..."); - const modes: ContextMenuProps[] = existingAnalyze && "subitems" in existingAnalyze ? existingAnalyze.subitems : []; - modes.push({ description: "Generate Tags", event: this.generateMetadata, icon: "tag" }); - modes.push({ description: "Find Faces", event: this.extractFaces, icon: "camera" }); - //modes.push({ description: "Recommend", event: this.extractText, icon: "brain" }); - !existingAnalyze && ContextMenu.Instance?.addItem({ description: "Analyzers...", subitems: modes, icon: "hand-point-right" }); + funcs.push({ description: "Rotate Clockwise 90", event: this.rotate, icon: "expand-arrows-alt" }); + if (!Doc.UserDoc().noviceMode) { + funcs.push({ description: "Export to Google Photos", event: () => GooglePhotos.Transactions.UploadImages([this.props.Document]), icon: "caret-square-right" }); + funcs.push({ description: "Copy path", event: () => Utils.CopyText(field.url.href), icon: "expand-arrows-alt" }); + // funcs.push({ + // description: "Reset Native Dimensions", event: action(async () => { + // const curNW = NumCast(this.dataDoc[this.fieldKey + "-nativeWidth"]); + // const curNH = NumCast(this.dataDoc[this.fieldKey + "-nativeHeight"]); + // if (this.props.PanelWidth() / this.props.PanelHeight() > curNW / curNH) { + // this.dataDoc[this.fieldKey + "-nativeWidth"] = this.props.PanelHeight() * curNW / curNH; + // this.dataDoc[this.fieldKey + "-nativeHeight"] = this.props.PanelHeight(); + // } else { + // this.dataDoc[this.fieldKey + "-nativeWidth"] = this.props.PanelWidth(); + // this.dataDoc[this.fieldKey + "-nativeHeight"] = this.props.PanelWidth() * curNH / curNW; + // } + // }), icon: "expand-arrows-alt" + // }); + + const existingAnalyze = ContextMenu.Instance?.findByDescription("Analyzers..."); + const modes: ContextMenuProps[] = existingAnalyze && "subitems" in existingAnalyze ? existingAnalyze.subitems : []; + modes.push({ description: "Generate Tags", event: this.generateMetadata, icon: "tag" }); + modes.push({ description: "Find Faces", event: this.extractFaces, icon: "camera" }); + //modes.push({ description: "Recommend", event: this.extractText, icon: "brain" }); + !existingAnalyze && ContextMenu.Instance?.addItem({ description: "Analyzers...", subitems: modes, icon: "hand-point-right" }); + } ContextMenu.Instance?.addItem({ description: "Options...", subitems: funcs, icon: "asterisk" }); } diff --git a/src/client/views/nodes/LabelBox.tsx b/src/client/views/nodes/LabelBox.tsx index 836ef4149..0dfbdc5cf 100644 --- a/src/client/views/nodes/LabelBox.tsx +++ b/src/client/views/nodes/LabelBox.tsx @@ -41,7 +41,7 @@ export class LabelBox extends ViewBoxBaseComponent DocUtils.makeCustomViewClicked(this.rootDoc, Docs.Create.FreeformDocument, "freeform"), icon: "eye" }); - appearanceItems.push({ description: "Change Perspective...", subitems: changeItems, icon: "external-link-alt" }); + appearanceItems.push({ description: "Change Perspective...", noexpand: true, subitems: changeItems, icon: "external-link-alt" }); const uicontrols: ContextMenuProps[] = []; uicontrols.push({ description: "Toggle Sidebar", event: () => this.layoutDoc._showSidebar = !this.layoutDoc._showSidebar, icon: "expand-arrows-alt" }); uicontrols.push({ description: "Toggle Dictation Icon", event: () => this.layoutDoc._showAudio = !this.layoutDoc._showAudio, icon: "expand-arrows-alt" }); @@ -489,10 +489,29 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp proto instanceof Doc && (proto.BROADCAST_MESSAGE = Cast(this.rootDoc[this.fieldKey], RichTextField)?.Text)), icon: "expand-arrows-alt" }); - appearanceItems.push({ description: "UI Controls...", subitems: uicontrols, icon: "asterisk" }); + appearanceItems.push({ description: "UI Controls...", noexpand: true, subitems: uicontrols, icon: "asterisk" }); this.rootDoc.isTemplateDoc && appearanceItems.push({ description: "Make Default Layout", event: async () => Doc.UserDoc().defaultTextLayout = new PrefetchProxy(this.rootDoc), icon: "eye" }); Doc.UserDoc().defaultTextLayout && appearanceItems.push({ description: "Reset default note style", event: () => Doc.UserDoc().defaultTextLayout = undefined, icon: "eye" }); - appearanceItems.push({ + + !appearance && ContextMenu.Instance.addItem({ description: "Appearance...", subitems: appearanceItems, icon: "eye" }); + + const funcs: ContextMenuProps[] = []; + + const highlighting: ContextMenuProps[] = []; + ["My Text", "Text from Others", "Todo Items", "Important Items", "Ignore Items", "Disagree Items", "By Recent Minute", "By Recent Hour"].forEach(option => + highlighting.push({ + description: (FormattedTextBox._highlights.indexOf(option) === -1 ? "Highlight " : "Unhighlight ") + option, event: () => { + e.stopPropagation(); + if (FormattedTextBox._highlights.indexOf(option) === -1) { + FormattedTextBox._highlights.push(option); + } else { + FormattedTextBox._highlights.splice(FormattedTextBox._highlights.indexOf(option), 1); + } + this.updateHighlights(); + }, icon: "expand-arrows-alt" + })); + funcs.push({ description: "highlighting...", noexpand: true, subitems: highlighting, icon: "hand-point-right" }); + funcs.push({ description: "Convert to be a template style", event: () => { if (!this.layoutDoc.isTemplateDoc) { const title = StrCast(this.rootDoc.title); @@ -517,29 +536,10 @@ export class FormattedTextBox extends ViewBoxAnnotatableComponent<(FieldViewProp Doc.AddDocToList(Cast(Doc.UserDoc()["template-notes"], Doc, null), "data", this.rootDoc); }, icon: "eye" }); - !appearance && ContextMenu.Instance.addItem({ description: "Appearance...", subitems: appearanceItems, icon: "eye" }); + funcs.push({ description: `${this.Document._autoHeight ? "Variable Height" : "Auto Height"}`, event: () => this.layoutDoc._autoHeight = !this.layoutDoc._autoHeight, icon: "plus" }); - const funcs: ContextMenuProps[] = []; - - //funcs.push({ description: `${this.Document._autoHeight ? "Variable Height" : "Auto Height"}`, event: () => this.layoutDoc._autoHeight = !this.layoutDoc._autoHeight, icon: "plus" }); - funcs.push({ description: (!this.layoutDoc._nativeWidth || !this.layoutDoc._nativeHeight ? "Freeze" : "Unfreeze") + " Aspect", event: this.toggleNativeDimensions, icon: "snowflake" }); funcs.push({ description: "Toggle Single Line", event: () => this.layoutDoc._singleLine = !this.layoutDoc._singleLine, icon: "expand-arrows-alt" }); - - const highlighting: ContextMenuProps[] = []; - ["My Text", "Text from Others", "Todo Items", "Important Items", "Ignore Items", "Disagree Items", "By Recent Minute", "By Recent Hour"].forEach(option => - highlighting.push({ - description: (FormattedTextBox._highlights.indexOf(option) === -1 ? "Highlight " : "Unhighlight ") + option, event: () => { - e.stopPropagation(); - if (FormattedTextBox._highlights.indexOf(option) === -1) { - FormattedTextBox._highlights.push(option); - } else { - FormattedTextBox._highlights.splice(FormattedTextBox._highlights.indexOf(option), 1); - } - this.updateHighlights(); - }, icon: "expand-arrows-alt" - })); - funcs.push({ description: "highlighting...", subitems: highlighting, icon: "hand-point-right" }); - + funcs.push({ description: (!this.layoutDoc._nativeWidth || !this.layoutDoc._nativeHeight ? "Freeze" : "Unfreeze") + " Aspect", event: this.toggleNativeDimensions, icon: "snowflake" }); ContextMenu.Instance.addItem({ description: "Options...", subitems: funcs, icon: "asterisk" }); this._downX = this._downY = Number.NaN; } -- cgit v1.2.3-70-g09d2 From af0741acc8e4aad40c5db206ccfd97cffecefbd4 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Mon, 13 Jul 2020 21:26:03 -0400 Subject: simplified tools panel (remove buxton, import folder). changed spacing of fonticon labels. --- src/client/util/CurrentUserUtils.ts | 14 +++++++------- src/client/views/nodes/FontIconBox.scss | 1 + src/client/views/nodes/FontIconBox.tsx | 2 +- src/server/websocket.ts | 2 +- 4 files changed, 10 insertions(+), 9 deletions(-) (limited to 'src/client/views') diff --git a/src/client/util/CurrentUserUtils.ts b/src/client/util/CurrentUserUtils.ts index 048ab9edc..7a06e1bc1 100644 --- a/src/client/util/CurrentUserUtils.ts +++ b/src/client/util/CurrentUserUtils.ts @@ -402,20 +402,20 @@ export class CurrentUserUtils { this.setupActiveMobileMenu(doc); } return [ - { title: "Drag a comparison box", label: "Comp", icon: "columns", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyComparison as Doc }, { title: "Drag a collection", label: "Col", icon: "folder", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyCollection as Doc }, { title: "Drag a web page", label: "Web", icon: "globe-asia", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyWebpage as Doc }, - { title: "Drag a cat image", label: "Img", icon: "cat", ignoreClick: true, drag: 'Docs.Create.ImageDocument("https://upload.wikimedia.org/wikipedia/commons/thumb/3/3a/Cat03.jpg/1200px-Cat03.jpg", { _width: 250, _nativeWidth:250, title: "an image of a cat" })' }, - { title: "Drag a screenshot", label: "Grab", icon: "photo-video", ignoreClick: true, drag: 'Docs.Create.ScreenshotDocument("", { _width: 400, _height: 200, title: "screen snapshot" })' }, - { title: "Drag a webcam", label: "Cam", icon: "video", ignoreClick: true, drag: 'Docs.Create.WebCamDocument("", { _width: 400, _height: 400, title: "a test cam" })' }, + { title: "Drag a cat image", label: "Image", icon: "cat", ignoreClick: true, drag: 'Docs.Create.ImageDocument("https://upload.wikimedia.org/wikipedia/commons/thumb/3/3a/Cat03.jpg/1200px-Cat03.jpg", { _width: 250, _nativeWidth:250, title: "an image of a cat" })' }, + { title: "Drag a comparison box", label: "Comp", icon: "columns", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyComparison as Doc }, + { title: "Drag a screengrabber", label: "Grab", icon: "photo-video", ignoreClick: true, drag: 'Docs.Create.ScreenshotDocument("", { _width: 400, _height: 200, title: "screen snapshot" })' }, + // { title: "Drag a webcam", label: "Cam", icon: "video", ignoreClick: true, drag: 'Docs.Create.WebCamDocument("", { _width: 400, _height: 400, title: "a test cam" })' }, { title: "Drag a audio recorder", label: "Audio", icon: "microphone", ignoreClick: true, drag: `Docs.Create.AudioDocument("${nullAudio}", { _width: 200, title: "ready to record audio" })` }, - { title: "Drag a clickable button", label: "Btn", icon: "bolt", ignoreClick: true, drag: 'Docs.Create.ButtonDocument({ _width: 150, _height: 50, _xPadding:10, _yPadding: 10, title: "Button" })' }, + { title: "Drag a button", label: "Button", icon: "bolt", ignoreClick: true, drag: 'Docs.Create.ButtonDocument({ _width: 150, _height: 50, _xPadding:10, _yPadding: 10, title: "Button" })' }, { title: "Drag a presentation view", label: "Prezi", icon: "tv", click: 'openOnRight(Doc.UserDoc().activePresentation = getCopy(this.dragFactory, true))', drag: `Doc.UserDoc().activePresentation = getCopy(this.dragFactory,true)`, dragFactory: doc.emptyPresentation as Doc }, { title: "Drag a search box", label: "Query", icon: "search", ignoreClick: true, drag: 'Docs.Create.QueryDocument({ _width: 200, title: "an image of a cat" })' }, { title: "Drag a scripting box", label: "Script", icon: "terminal", click: 'openOnRight(getCopy(this.dragFactory, true))', drag: 'getCopy(this.dragFactory, true)', dragFactory: doc.emptyScript as Doc }, - { title: "Drag an import folder", label: "Load", icon: "cloud-upload-alt", ignoreClick: true, drag: 'Docs.Create.DirectoryImportDocument({ title: "Directory Import", _width: 400, _height: 400 })' }, + // { title: "Drag an import folder", label: "Load", icon: "cloud-upload-alt", ignoreClick: true, drag: 'Docs.Create.DirectoryImportDocument({ title: "Directory Import", _width: 400, _height: 400 })' }, { title: "Drag a mobile view", label: "Phone", icon: "mobile", click: 'openOnRight(Doc.UserDoc().activeMobileMenu)', drag: 'this.dragFactory', dragFactory: doc.activeMobileMenu as Doc }, - { title: "Drag an instance of the device collection", label: "Buxton", icon: "globe-asia", ignoreClick: true, drag: 'Docs.Create.Buxton()' }, + // { title: "Drag an instance of the device collection", label: "Buxton", icon: "globe-asia", ignoreClick: true, drag: 'Docs.Create.Buxton()' }, // { title: "use pen", icon: "pen-nib", click: 'activatePen(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this)', backgroundColor: "blue", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, // { title: "use highlighter", icon: "highlighter", click: 'activateBrush(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this,20,this.backgroundColor)', backgroundColor: "yellow", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, // { title: "use stamp", icon: "stamp", click: 'activateStamp(this.activeInkPen = sameDocs(this.activeInkPen, this) ? undefined : this)', backgroundColor: "orange", ischecked: `sameDocs(this.activeInkPen, this)`, activeInkPen: doc }, diff --git a/src/client/views/nodes/FontIconBox.scss b/src/client/views/nodes/FontIconBox.scss index 68b00a5be..fe0f067ad 100644 --- a/src/client/views/nodes/FontIconBox.scss +++ b/src/client/views/nodes/FontIconBox.scss @@ -18,6 +18,7 @@ text-align: center; font-size: 8px; margin-top:4px; + letter-spacing: normal; } svg { diff --git a/src/client/views/nodes/FontIconBox.tsx b/src/client/views/nodes/FontIconBox.tsx index 5e8dd2497..86e9a4527 100644 --- a/src/client/views/nodes/FontIconBox.tsx +++ b/src/client/views/nodes/FontIconBox.tsx @@ -67,7 +67,7 @@ export class FontIconBox extends DocComponent( boxShadow: this.layoutDoc.ischecked ? `4px 4px 12px black` : undefined }}> - {!this.rootDoc.label ? (null) :
{StrCast(this.rootDoc.label).substring(0, 5)}
} + {!this.rootDoc.label ? (null) :
{StrCast(this.rootDoc.label).substring(0, 6)}
} ; } } \ No newline at end of file diff --git a/src/server/websocket.ts b/src/server/websocket.ts index edb0d6279..f63a35e43 100644 --- a/src/server/websocket.ts +++ b/src/server/websocket.ts @@ -181,7 +181,7 @@ export namespace WebSocket { function barReceived(socket: SocketIO.Socket, userEmail: string) { clients[userEmail] = new Client(userEmail.toString()); const currentdate = new Date(); - const datetime = "Last Sync: " + currentdate.getDate() + "/" + const datetime = currentdate.getDate() + "/" + (currentdate.getMonth() + 1) + "/" + currentdate.getFullYear() + " @ " + currentdate.getHours() + ":" -- cgit v1.2.3-70-g09d2 From c8acb1b215769a1071f0083fea6a2621b2926fde Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Mon, 13 Jul 2020 22:45:52 -0400 Subject: added show fields for non=novice users context menu item. --- src/client/views/nodes/DocumentView.tsx | 10 +++++----- 1 file changed, 5 insertions(+), 5 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/nodes/DocumentView.tsx b/src/client/views/nodes/DocumentView.tsx index a586e81d8..11be4c2e7 100644 --- a/src/client/views/nodes/DocumentView.tsx +++ b/src/client/views/nodes/DocumentView.tsx @@ -825,11 +825,11 @@ export class DocumentView extends DocComponent(Docu !more && cm.addItem({ description: "More...", subitems: moreItems, icon: "hand-point-right" }); cm.moveAfter(cm.findByDescription("More...")!, cm.findByDescription("OnClick...")!); - // const help = cm.findByDescription("Help..."); - // const helpItems: ContextMenuProps[] = help && "subitems" in help ? help.subitems : []; - // helpItems.push({ description: "Text Shortcuts Ctrl+/", event: () => this.props.addDocTab(Docs.Create.PdfDocument(Utils.prepend("/assets/cheat-sheet.pdf"), { _width: 300, _height: 300 }), "onRight"), icon: "keyboard" }); - // helpItems.push({ description: "Show Fields ", event: () => this.props.addDocTab(Docs.Create.KVPDocument(this.props.Document, { _width: 300, _height: 300 }), "onRight"), icon: "layer-group" }); - // cm.addItem({ description: "Help...", subitems: helpItems, icon: "question" }); + const help = cm.findByDescription("Help..."); + const helpItems: ContextMenuProps[] = help && "subitems" in help ? help.subitems : []; + //!Doc.UserDoc().novice && helpItems.push({ description: "Text Shortcuts Ctrl+/", event: () => this.props.addDocTab(Docs.Create.PdfDocument(Utils.prepend("/assets/cheat-sheet.pdf"), { _width: 300, _height: 300 }), "onRight"), icon: "keyboard" }); + !Doc.UserDoc().novice && helpItems.push({ description: "Show Fields ", event: () => this.props.addDocTab(Docs.Create.KVPDocument(this.props.Document, { _width: 300, _height: 300 }), "onRight"), icon: "layer-group" }); + cm.addItem({ description: "Help...", noexpand: true, subitems: helpItems, icon: "question" }); // const existingAcls = cm.findByDescription("Privacy..."); // const aclItems: ContextMenuProps[] = existingAcls && "subitems" in existingAcls ? existingAcls.subitems : []; -- cgit v1.2.3-70-g09d2 From 05339b56927df92701f51342c0740d63875332bb Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 14 Jul 2020 01:52:46 -0400 Subject: added image load idle view --- package-lock.json | 5 +++++ package.json | 1 + src/client/views/DocumentButtonBar.tsx | 1 - src/client/views/OverlayView.tsx | 4 +++- src/client/views/collections/CollectionSubView.tsx | 21 +++++++++++++++++---- 5 files changed, 26 insertions(+), 6 deletions(-) (limited to 'src/client/views') diff --git a/package-lock.json b/package-lock.json index ad181758c..1b39905cf 100644 --- a/package-lock.json +++ b/package-lock.json @@ -14256,6 +14256,11 @@ "resolved": "https://registry.npmjs.org/react-lifecycles-compat/-/react-lifecycles-compat-3.0.4.tgz", "integrity": "sha512-fBASbA6LnOU9dOU2eW7aQ8xmYBSXUIWr+UmF9b1efZBazGNO+rcXT/icdKnYm2pTwcRylVUYwW7H1PHfLekVzA==" }, + "react-loading": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/react-loading/-/react-loading-2.0.3.tgz", + "integrity": "sha512-Vdqy79zq+bpeWJqC+xjltUjuGApyoItPgL0vgVfcJHhqwU7bAMKzysfGW/ADu6i0z0JiOCRJjo+IkFNkRNbA3A==" + }, "react-measure": { "version": "2.3.0", "resolved": "https://registry.npmjs.org/react-measure/-/react-measure-2.3.0.tgz", diff --git a/package.json b/package.json index 6fabab6a7..cb083020f 100644 --- a/package.json +++ b/package.json @@ -221,6 +221,7 @@ "react-grid-layout": "^0.18.3", "react-image-lightbox-with-rotate": "^5.1.1", "react-jsx-parser": "^1.25.1", + "react-loading": "^2.0.3", "react-measure": "^2.2.4", "react-resizable": "^1.10.1", "react-select": "^3.1.0", diff --git a/src/client/views/DocumentButtonBar.tsx b/src/client/views/DocumentButtonBar.tsx index a3d24b3b6..c188618f4 100644 --- a/src/client/views/DocumentButtonBar.tsx +++ b/src/client/views/DocumentButtonBar.tsx @@ -11,7 +11,6 @@ import GoogleAuthenticationManager from '../apis/GoogleAuthenticationManager'; import { Pulls, Pushes } from '../apis/google_docs/GoogleApiClientUtils'; import { Docs, DocUtils } from '../documents/Documents'; import { DragManager } from '../util/DragManager'; -import { UndoManager } from "../util/UndoManager"; import { CollectionDockingView, DockedFrameRenderer } from './collections/CollectionDockingView'; import { ParentDocSelector } from './collections/ParentDocumentSelector'; import './collections/ParentDocumentSelector.scss'; diff --git a/src/client/views/OverlayView.tsx b/src/client/views/OverlayView.tsx index 37d8dd23b..5c3a8185c 100644 --- a/src/client/views/OverlayView.tsx +++ b/src/client/views/OverlayView.tsx @@ -124,7 +124,9 @@ export class OverlayView extends React.Component { ele =
{ele}
; this._elements.push(ele); return remove; diff --git a/src/client/views/collections/CollectionSubView.tsx b/src/client/views/collections/CollectionSubView.tsx index ce6872695..3794088d4 100644 --- a/src/client/views/collections/CollectionSubView.tsx +++ b/src/client/views/collections/CollectionSubView.tsx @@ -1,4 +1,4 @@ -import { action, computed, IReactionDisposer, reaction } from "mobx"; +import { action, computed, IReactionDisposer, reaction, observable, runInAction } from "mobx"; import { basename } from 'path'; import CursorField from "../../../fields/CursorField"; import { Doc, Opt, Field } from "../../../fields/Doc"; @@ -19,6 +19,7 @@ import { DocComponent } from "../DocComponent"; import { FieldViewProps } from "../nodes/FieldView"; import React = require("react"); import * as rp from 'request-promise'; +import ReactLoading from 'react-loading'; export interface CollectionViewProps extends FieldViewProps { addDocument: (document: Doc | Doc[]) => boolean; @@ -377,13 +378,20 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: }); } } + this.slowLoadDocuments(files, options, generatedDocuments, text, completed, e.clientX, e.clientY); + batch.end(); + } + slowLoadDocuments = async (files: File[], options: DocumentOptions, generatedDocuments: Doc[], text: string, completed: (() => void) | undefined, clientX: number, clientY: number) => { + runInAction(() => CollectionSubViewLoader.Waiting = "block"); + const disposer = OverlayView.Instance.addElement( + , { x: clientX - 125, y: clientY - 125 }); generatedDocuments.push(...await DocUtils.uploadFilesToDocs(files, options)); if (generatedDocuments.length) { const set = generatedDocuments.length > 1 && generatedDocuments.map(d => DocUtils.iconify(d)); if (set) { - this.addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!)!); + UndoManager.RunInBatch(() => this.addDocument(DocUtils.pileup(generatedDocuments, options.x!, options.y!)!), "drop"); } else { - generatedDocuments.forEach(this.addDocument); + UndoManager.RunInBatch(() => generatedDocuments.forEach(this.addDocument), "drop"); } completed?.(); } else { @@ -391,13 +399,17 @@ export function CollectionSubView(schemaCtor: (doc: Doc) => T, moreProps?: this.addDocument(Docs.Create.TextDocument(text, { ...options, _width: 400, _height: 315 })); } } - batch.end(); + disposer(); } } return CollectionSubView; } +export class CollectionSubViewLoader { + @observable public static Waiting = "none"; +} + import { DragManager, dropActionType } from "../../util/DragManager"; import { Docs, DocumentOptions, DocUtils } from "../../documents/Documents"; import { CurrentUserUtils } from "../../util/CurrentUserUtils"; @@ -405,4 +417,5 @@ import { DocumentType } from "../../documents/DocumentTypes"; import { FormattedTextBox, GoogleRef } from "../nodes/formattedText/FormattedTextBox"; import { CollectionView } from "./CollectionView"; import { SelectionManager } from "../../util/SelectionManager"; +import { OverlayView } from "../OverlayView"; -- cgit v1.2.3-70-g09d2 From fcc7d375deb197854367ec40691fe0e72fba74f5 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 14 Jul 2020 02:13:06 -0400 Subject: fixed cursor for doc decoration title drag --- src/client/views/DocumentDecorations.tsx | 5 +---- 1 file changed, 1 insertion(+), 4 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/DocumentDecorations.tsx b/src/client/views/DocumentDecorations.tsx index d7324e1a6..444d2fe50 100644 --- a/src/client/views/DocumentDecorations.tsx +++ b/src/client/views/DocumentDecorations.tsx @@ -17,14 +17,11 @@ import { DocumentButtonBar } from './DocumentButtonBar'; import './DocumentDecorations.scss'; import { DocumentView } from "./nodes/DocumentView"; import React = require("react"); -import { Id, Copy, Update } from '../../fields/FieldSymbols'; import e = require('express'); import { CollectionDockingView } from './collections/CollectionDockingView'; import { SnappingManager } from '../util/SnappingManager'; import { HtmlField } from '../../fields/HtmlField'; import { InkData, InkField, InkTool } from "../../fields/InkField"; -import { update } from 'serializr'; -import { Transform } from "../util/Transform"; import { Tooltip } from '@material-ui/core'; library.add(faCaretUp); @@ -579,7 +576,7 @@ export class DocumentDecorations extends React.Component<{}, { value: string }>
}
- {`${this.selectionTitle}`} + {`${this.selectionTitle}`}
; -- cgit v1.2.3-70-g09d2 From 07d71ea914c5bae3136b6c911c38b3373afcd5a7 Mon Sep 17 00:00:00 2001 From: Bob Zeleznik Date: Tue, 14 Jul 2020 19:32:56 -0400 Subject: cleaned up InkOptionsMenu --- src/client/views/GestureOverlay.tsx | 5 +- src/client/views/MainView.tsx | 7 +- .../collectionFreeForm/InkOptionsMenu.tsx | 381 ++++----------------- 3 files changed, 77 insertions(+), 316 deletions(-) (limited to 'src/client/views') diff --git a/src/client/views/GestureOverlay.tsx b/src/client/views/GestureOverlay.tsx index a48b7b673..2f34cbc05 100644 --- a/src/client/views/GestureOverlay.tsx +++ b/src/client/views/GestureOverlay.tsx @@ -608,8 +608,7 @@ export default class GestureOverlay extends Touchable { this.makePolygon(this.InkShape, false); this.dispatchGesture(GestureUtils.Gestures.Stroke); this._points = []; - if (InkOptionsMenu.Instance._double === "") { - + if (!InkOptionsMenu.Instance._keepMode) { this.InkShape = ""; } } @@ -640,7 +639,7 @@ export default class GestureOverlay extends Touchable { this._points = []; } //get out of ink mode after each stroke= - if (InkOptionsMenu.Instance._double === "") { + if (!InkOptionsMenu.Instance._keepMode) { Doc.SetSelectedTool(InkTool.None); InkOptionsMenu.Instance._selected = InkOptionsMenu.Instance._shapesNum; SetActiveArrowStart("none"); diff --git a/src/client/views/MainView.tsx b/src/client/views/MainView.tsx index 2ed528836..41efe246c 100644 --- a/src/client/views/MainView.tsx +++ b/src/client/views/MainView.tsx @@ -1,4 +1,5 @@ import { library } from '@fortawesome/fontawesome-svg-core'; + import { faTasks, faEdit, faTrashAlt, faPalette, faAngleRight, faBell, faTrash, faCamera, faExpand, faCaretDown, faCaretLeft, faCaretRight, faCaretSquareDown, faCaretSquareRight, faArrowsAltH, faPlus, faMinus, faTerminal, faToggleOn, faFile as fileSolid, faExternalLinkAlt, faLocationArrow, faSearch, faFileDownload, faStop, faCalculator, faWindowMaximize, faAddressCard, @@ -6,7 +7,8 @@ import { faCommentAlt, faCompressArrowsAlt, faCut, faEllipsisV, faEraser, faExclamation, faFileAlt, faFileAudio, faFilePdf, faFilm, faFilter, faFont, faGlobeAsia, faHighlighter, faLongArrowAltRight, faMicrophone, faMousePointer, faMusic, faObjectGroup, faPause, faPen, faPenNib, faPhone, faPlay, faPortrait, faRedoAlt, faStamp, faStickyNote, faTimesCircle, faThumbtack, faTree, faTv, faUndoAlt, faVideo, faAsterisk, faBrain, faImage, faPaintBrush, faTimes, faEye, faArrowsAlt, faQuoteLeft, faSortAmountDown, faAlignLeft, faAlignCenter, faAlignRight, - faHeading, faRulerCombined, faFillDrip, faUnlink + faHeading, faRulerCombined, faFillDrip, faLink, faUnlink, faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSuperscript, faSubscript, faIndent, faEyeDropper, + faPaintRoller, faBars, faBrush, faShapes, faEllipsisH } from '@fortawesome/free-solid-svg-icons'; import { ANTIMODEMENU_HEIGHT } from './globalCssVariables.scss'; import { FontAwesomeIcon } from '@fortawesome/react-fontawesome'; @@ -147,7 +149,8 @@ export class MainView extends React.Component { faCommentAlt, faCompressArrowsAlt, faCut, faEllipsisV, faEraser, faExclamation, faFileAlt, faFileAudio, faFilePdf, faFilm, faFilter, faFont, faGlobeAsia, faHighlighter, faLongArrowAltRight, faMicrophone, faMousePointer, faMusic, faObjectGroup, faPause, faPen, faPenNib, faPhone, faPlay, faPortrait, faRedoAlt, faStamp, faStickyNote, faTrashAlt, faAngleRight, faBell, faThumbtack, faTree, faTv, faUndoAlt, faVideo, faAsterisk, faBrain, faImage, faPaintBrush, faTimes, faEye, faArrowsAlt, faQuoteLeft, faSortAmountDown, faAlignLeft, faAlignCenter, faAlignRight, - faHeading, faRulerCombined, faFillDrip, faUnlink); + faHeading, faRulerCombined, faFillDrip, faLink, faUnlink, faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSuperscript, faSubscript, faIndent, faEyeDropper, + faPaintRoller, faBars, faBrush, faShapes, faEllipsisH); this.initEventListeners(); this.initAuthenticationRouters(); } diff --git a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx index 15707ad9e..23e1c194a 100644 --- a/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx +++ b/src/client/views/collections/collectionFreeForm/InkOptionsMenu.tsx @@ -3,7 +3,7 @@ import AntimodeMenu from "../../AntimodeMenu"; import { observer } from "mobx-react"; import { observable, action, computed } from "mobx"; import "./InkOptionsMenu.scss"; -import { ActiveInkColor, ActiveInkBezierApprox, ActiveFillColor, ActiveArrowStart, ActiveArrowEnd, SetActiveInkWidth, SetActiveInkColor, SetActiveBezierApprox, SetActiveFillColor, SetActiveArrowStart, SetActiveArrowEnd, ActiveDash, SetActiveDash } from "../../InkingStroke"; +import { ActiveInkColor, ActiveFillColor, SetActiveInkWidth, SetActiveInkColor, SetActiveBezierApprox, SetActiveFillColor, SetActiveArrowStart, SetActiveArrowEnd, ActiveDash, SetActiveDash } from "../../InkingStroke"; import { Scripting } from "../../../util/Scripting"; import { InkTool } from "../../../../fields/InkField"; import { ColorState } from "react-color"; @@ -14,30 +14,16 @@ import { SelectionManager } from "../../../util/SelectionManager"; import { DocumentView } from "../../../views/nodes/DocumentView"; import { Document } from "../../../../fields/documentSchemas"; import { DocumentType } from "../../../documents/DocumentTypes"; -import { FontAwesomeIcon } from "@fortawesome/react-fontawesome"; -import { IconProp, library } from '@fortawesome/fontawesome-svg-core'; -import { faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSubscript, faSuperscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faSleigh, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve, } from "@fortawesome/free-solid-svg-icons"; -import { Cast, StrCast, BoolCast } from "../../../../fields/Types"; +import { FontAwesomeIcon, FontAwesomeIconProps } from "@fortawesome/react-fontawesome"; +import { BoolCast } from "../../../../fields/Types"; import FormatShapePane from "./FormatShapePane"; -library.add(faBold, faItalic, faChevronLeft, faUnderline, faStrikethrough, faSuperscript, faSubscript, faIndent, faEyeDropper, faCaretDown, faPalette, faArrowsAlt, faHighlighter, faLink, faPaintRoller, faBars, faFillDrip, faBrush, faPenNib, faShapes, faArrowLeft, faEllipsisH, faBezierCurve); - - - @observer export default class InkOptionsMenu extends AntimodeMenu { static Instance: InkOptionsMenu; private _palette = ["#D0021B", "#F5A623", "#F8E71C", "#8B572A", "#7ED321", "#417505", "#9013FE", "#4A90E2", "#50E3C2", "#B8E986", "#000000", "#4A4A4A", "#9B9B9B", "#FFFFFF", ""]; private _width = ["1", "5", "10", "100"]; - // private _buttons = ["circle", "triangle", "rectangle", "arrow", "line"]; - // private _icons = ["O", "∆", "ロ", "➜", "-"]; - // private _buttons = ["circle", "triangle", "rectangle", "line", "noRec", "",]; - // private _icons = ["O", "∆", "ロ", "⎯⎯⎯", "✖︎", " "]; - //arrowStart and arrowEnd must match and defs must exist in Inking Stroke - // private _arrowStart = ["arrowStart", "arrowStart", "dot", "dot", "none"]; - // private _arrowEnd = ["none", "arrowEnd", "none", "dot", "none"]; - // private _arrowIcons = ["→", "↔︎", "•", "••", " "]; private _draw = ["⎯", "→", "↔︎", "∿", "↝", "↭", "ロ", "O", "∆"]; private _head = ["", "", "arrow", "", "", "arrow", "", "", ""]; private _end = ["", "arrow", "arrow", "", "arrow", "arrow", "", "", ""]; @@ -46,56 +32,25 @@ export default class InkOptionsMenu extends AntimodeMenu { @observable _shapesNum = this._shape.length; @observable _selected = this._shapesNum; - @observable private collapsed: boolean = false; - @observable _double = ""; + @observable _collapsed = false; + @observable _keepMode = false; @observable _colorBtn = false; @observable _widthBtn = false; @observable _fillBtn = false; - // @observable _arrowBtn = false; - // @observable _dashBtn = false; - // @observable _shapeBtn = false; - - constructor(props: Readonly<{}>) { super(props); InkOptionsMenu.Instance = this; this._canFade = false; // don't let the inking menu fade away this.Pinned = BoolCast(Doc.UserDoc()["menuInkOptions-pinned"]); - } @action toggleMenuPin = (e: React.MouseEvent) => { Doc.UserDoc()["menuInkOptions-pinned"] = this.Pinned = !this.Pinned; - if (!this.Pinned) { - // this.fadeOut(true); - } - } - - @action - protected toggleCollapse = (e: React.MouseEvent) => { - this.collapsed = !this.collapsed; - setTimeout(() => { - const x = Math.min(this._left, window.innerWidth - InkOptionsMenu.Instance.width); - InkOptionsMenu.Instance.jumpTo(x, this._top, true); - }, 0); - } - - - - - getColors = () => { - return this._palette; } - // @action - // changeArrow = (arrowStart: string, arrowEnd: string) => { - // SetActiveArrowStart(arrowStart); - // SetActiveArrowEnd(arrowEnd); - // } - @action changeColor = (color: string, type: string) => { const col: ColorState = { @@ -115,313 +70,117 @@ export default class InkOptionsMenu extends AntimodeMenu { const doc = Document(element.rootDoc); if (doc.type === DocumentType.INK) { switch (field) { - case "width": - doc.strokeWidth = Number(value); - break; - case "color": - doc.color = String(value); - break; - case "fill": - doc.fillColor = String(value); - break; - case "bezier": - // doc.strokeBezier === 300 ? doc.strokeBezier = 0 : doc.strokeBezier = 300; - break; - case "dash": - doc.strokeDash = Number(value); - default: - break; + case "width": doc.strokeWidth = Number(value); break; + case "color": doc.color = String(value); break; + case "fill": doc.fillColor = String(value); break; + case "dash": doc.strokeDash = value; } } })); } - - @action - changeBezier = (e: React.PointerEvent): void => { - SetActiveBezierApprox(!ActiveInkBezierApprox() ? "300" : ""); - this.editProperties(0, "bezier"); - } - @action - changeDash = (e: React.PointerEvent): void => { - SetActiveDash(ActiveDash() === "0" ? "2" : "0"); - this.editProperties(ActiveDash(), "strokeDash"); - } - @computed get drawButtons() { - const drawButtons =
- {this._draw.map((icon, i) => { - return ; - })}
; - return drawButtons; + )} +
; } - // @computed get arrowPicker() { - // var currIcon; - // for (var i = 0; i < this._arrowStart.length; i++) { - // if (this._arrowStart[i] === ActiveArrowStart() && this._arrowEnd[i] === ActiveArrowEnd()) { - // currIcon = this._arrowIcons[i]; - // if (this._arrowIcons[i] === " ") { - // currIcon = "➤"; - // } - // } - // } - // var arrowPicker = ; - // if (this._arrowBtn) { - // arrowPicker =
- // {arrowPicker} - // {this._arrowStart.map((arrowStart, i) => { - // return ; - // })} - //
; - // } - // return arrowPicker; - // } + toggleButton = (key: string, value: boolean, setter: () => {}, icon: FontAwesomeIconProps["icon"], ele: JSX.Element | null) => { + return ; + } @computed get widthPicker() { - var widthPicker = ; - if (this._widthBtn) { - widthPicker =
+ var widthPicker = this.toggleButton("stroke width", this._widthBtn, () => this._widthBtn = !this._widthBtn, "bars", null); + return !this._widthBtn ? widthPicker : +
{widthPicker} - {this._width.map(wid => { - return ; - })} + )}
; - } - return widthPicker; } - - @computed get colorPicker() { - var colorPicker = ; - if (this._colorBtn) { - colorPicker =
+ var colorPicker = this.toggleButton("stroke color", this._colorBtn, () => this._colorBtn = !this._colorBtn, "pen-nib", +
); + return !this._colorBtn ? colorPicker : +
{colorPicker} - {this._palette.map(color => { - return ; - })} +
+ )}
; - } - return colorPicker; - } - @computed get formatPane() { - return ; } - @computed get fillPicker() { - var fillPicker = ; - if (this._fillBtn) { - fillPicker =
+ var fillPicker = this.toggleButton("shape fill color", this._fillBtn, () => this._fillBtn = !this._fillBtn, "fill-drip", +
); + return !this._fillBtn ? fillPicker : +
{fillPicker} - {this._palette.map(color => { - return ; - })} + )}
; - } - return fillPicker; } - // @computed get shapePicker() { - // var currIcon; - // if (GestureOverlay.Instance.InkShape === "") { - // currIcon = ; - // } else { - // for (var i = 0; i < this._icons.length; i++) { - // if (GestureOverlay.Instance.InkShape === this._buttons[i]) { - // currIcon = this._icons[i]; - // } - // } - // } - // var shapePicker = ; - // if (this._shapeBtn) { - // shapePicker =
- // {shapePicker} - // {this._buttons.map((btn, i) => { - // var ttl = btn; - // if (btn === "") { - // ttl = "no shape"; - // } - // if (btn === "noRec") { - // ttl = "disable shape recognition"; - // } - // return ; - // })} - //
; - // } - // return shapePicker; - // } - - @computed get bezierButton() { - return ; - } - - @computed get dashButton() { - return ; } render() { - const buttons = [ - // , - // this.shapePicker, - // this.bezierButton, + return this.getElement([ this.widthPicker, this.colorPicker, this.fillPicker, this.drawButtons, this.formatPane, - // this.arrowPicker, - // this.dashButton, - - ]; - - // return this.getElement(buttons); - return this.getElement(buttons); + ]); } } Scripting.addGlobal(function activatePen(penBtn: any) { -- cgit v1.2.3-70-g09d2